From 45e227c1a4aae511b9c176c2f44e76649db2ac06 Mon Sep 17 00:00:00 2001 From: Vaibhav Agarwal Date: Wed, 31 Oct 2018 18:21:32 +0530 Subject: [PATCH] Made File Compatible to be Opened in Visual Studio Later 2015 or later 1. Added SLN (Auto Generated by VS 2015 if you install / reinstall Nuget Packages 2. New Files Added as a result of Nuget Package Install 3. Explicit mention of connection string in DbContent constructor 4. Changed ConnectionString in Web.Config with new LocalDb Db present in Visual 2015 or later --- Areas/HelpPage/ApiDescriptionExtensions.cs | 39 + Areas/HelpPage/App_Start/HelpPageConfig.cs | 51 + Areas/HelpPage/Controllers/HelpController.cs | 44 + Areas/HelpPage/HelpPage.css | 89 + Areas/HelpPage/HelpPageAreaRegistration.cs | 26 + .../HelpPageConfigurationExtensions.cs | 247 + Areas/HelpPage/Models/HelpPageApiModel.cs | 43 + .../HelpPageSampleGenerator.cs | 372 + .../SampleGeneration/HelpPageSampleKey.cs | 178 + .../HelpPage/SampleGeneration/ImageSample.cs | 41 + .../SampleGeneration/InvalidSample.cs | 37 + .../SampleGeneration/ObjectGenerator.cs | 456 + .../SampleGeneration/SampleDirection.cs | 11 + Areas/HelpPage/SampleGeneration/TextSample.cs | 37 + Areas/HelpPage/Views/Help/Api.cshtml | 25 + .../Help/DisplayTemplates/ApiGroup.cshtml | 30 + .../DisplayTemplates/HelpPageApiModel.cshtml | 43 + .../Help/DisplayTemplates/ImageSample.cshtml | 4 + .../DisplayTemplates/InvalidSample.cshtml | 13 + .../Help/DisplayTemplates/Parameters.cshtml | 42 + .../Help/DisplayTemplates/Samples.cshtml | 30 + .../Help/DisplayTemplates/TextSample.cshtml | 6 + Areas/HelpPage/Views/Help/Index.cshtml | 40 + Areas/HelpPage/Views/Shared/_Layout.cshtml | 12 + Areas/HelpPage/Views/Web.config | 62 + Areas/HelpPage/Views/_ViewStart.cshtml | 4 + Areas/HelpPage/XmlDocumentationProvider.cs | 112 + .../images/ui-bg_flat_0_aaaaaa_40x100.png | Bin 0 -> 180 bytes .../images/ui-bg_flat_75_ffffff_40x100.png | Bin 0 -> 178 bytes .../images/ui-bg_glass_55_fbf9ee_1x400.png | Bin 0 -> 120 bytes .../images/ui-bg_glass_65_ffffff_1x400.png | Bin 0 -> 105 bytes .../images/ui-bg_glass_75_dadada_1x400.png | Bin 0 -> 111 bytes .../images/ui-bg_glass_75_e6e6e6_1x400.png | Bin 0 -> 110 bytes .../images/ui-bg_glass_95_fef1ec_1x400.png | Bin 0 -> 119 bytes .../ui-bg_highlight-soft_75_cccccc_1x100.png | Bin 0 -> 101 bytes .../base/images/ui-icons_222222_256x240.png | Bin 0 -> 4369 bytes .../base/images/ui-icons_2e83ff_256x240.png | Bin 0 -> 4369 bytes .../base/images/ui-icons_454545_256x240.png | Bin 0 -> 4369 bytes .../base/images/ui-icons_888888_256x240.png | Bin 0 -> 4369 bytes .../base/images/ui-icons_cd0a0a_256x240.png | Bin 0 -> 4369 bytes Content/themes/base/jquery-ui.css | 464 + Content/themes/base/jquery.ui.accordion.css | 19 + Content/themes/base/jquery.ui.all.css | 11 + .../themes/base/jquery.ui.autocomplete.css | 53 + Content/themes/base/jquery.ui.base.css | 21 + Content/themes/base/jquery.ui.button.css | 38 + Content/themes/base/jquery.ui.core.css | 38 + Content/themes/base/jquery.ui.datepicker.css | 66 + Content/themes/base/jquery.ui.dialog.css | 21 + Content/themes/base/jquery.ui.progressbar.css | 11 + Content/themes/base/jquery.ui.resizable.css | 20 + Content/themes/base/jquery.ui.selectable.css | 10 + Content/themes/base/jquery.ui.slider.css | 24 + Content/themes/base/jquery.ui.tabs.css | 18 + Content/themes/base/jquery.ui.theme.css | 247 + .../images/ui-bg_flat_0_aaaaaa_40x100.png | Bin 0 -> 180 bytes .../images/ui-bg_flat_75_ffffff_40x100.png | Bin 0 -> 178 bytes .../images/ui-bg_glass_55_fbf9ee_1x400.png | Bin 0 -> 120 bytes .../images/ui-bg_glass_65_ffffff_1x400.png | Bin 0 -> 105 bytes .../images/ui-bg_glass_75_dadada_1x400.png | Bin 0 -> 111 bytes .../images/ui-bg_glass_75_e6e6e6_1x400.png | Bin 0 -> 110 bytes .../images/ui-bg_glass_95_fef1ec_1x400.png | Bin 0 -> 119 bytes .../ui-bg_highlight-soft_75_cccccc_1x100.png | Bin 0 -> 101 bytes .../images/ui-icons_222222_256x240.png | Bin 0 -> 4369 bytes .../images/ui-icons_2e83ff_256x240.png | Bin 0 -> 4369 bytes .../images/ui-icons_454545_256x240.png | Bin 0 -> 4369 bytes .../images/ui-icons_888888_256x240.png | Bin 0 -> 4369 bytes .../images/ui-icons_cd0a0a_256x240.png | Bin 0 -> 4369 bytes .../themes/base/minified/jquery-ui.min.css | 5 + .../base/minified/jquery.ui.accordion.min.css | 5 + .../minified/jquery.ui.autocomplete.min.css | 5 + .../base/minified/jquery.ui.button.min.css | 5 + .../base/minified/jquery.ui.core.min.css | 5 + .../minified/jquery.ui.datepicker.min.css | 5 + .../base/minified/jquery.ui.dialog.min.css | 5 + .../minified/jquery.ui.progressbar.min.css | 5 + .../base/minified/jquery.ui.resizable.min.css | 5 + .../minified/jquery.ui.selectable.min.css | 5 + .../base/minified/jquery.ui.slider.min.css | 5 + .../base/minified/jquery.ui.tabs.min.css | 5 + .../base/minified/jquery.ui.theme.min.css | 5 + DAL/DataContext.cs | 8 + JSGridWebAPISample.csproj | 229 +- JSGridWebAPISample.sln | 22 + Scripts/_references.js | Bin 82 -> 86 bytes Scripts/jquery-1.8.2.js | 14 - Scripts/jquery-1.8.2.min.js | 17 - Scripts/jquery-ui-1.8.24.js | 11377 ++++++++++++++++ Scripts/jquery-ui-1.8.24.min.js | 5 + Scripts/jquery.unobtrusive-ajax.js | 163 + Scripts/jquery.unobtrusive-ajax.min.js | 5 + Scripts/jquery.validate-vsdoc.js | 1291 ++ Scripts/jquery.validate.js | 1248 ++ Scripts/jquery.validate.min.js | 4 + Scripts/jquery.validate.unobtrusive.js | 367 + Scripts/jquery.validate.unobtrusive.min.js | 5 + Scripts/knockout-2.2.0.debug.js | 3577 +++++ Scripts/knockout-2.2.0.js | 85 + Scripts/modernizr-2.6.2.js | 1393 ++ Web.config | 34 +- 100 files changed, 22964 insertions(+), 100 deletions(-) create mode 100644 Areas/HelpPage/ApiDescriptionExtensions.cs create mode 100644 Areas/HelpPage/App_Start/HelpPageConfig.cs create mode 100644 Areas/HelpPage/Controllers/HelpController.cs create mode 100644 Areas/HelpPage/HelpPage.css create mode 100644 Areas/HelpPage/HelpPageAreaRegistration.cs create mode 100644 Areas/HelpPage/HelpPageConfigurationExtensions.cs create mode 100644 Areas/HelpPage/Models/HelpPageApiModel.cs create mode 100644 Areas/HelpPage/SampleGeneration/HelpPageSampleGenerator.cs create mode 100644 Areas/HelpPage/SampleGeneration/HelpPageSampleKey.cs create mode 100644 Areas/HelpPage/SampleGeneration/ImageSample.cs create mode 100644 Areas/HelpPage/SampleGeneration/InvalidSample.cs create mode 100644 Areas/HelpPage/SampleGeneration/ObjectGenerator.cs create mode 100644 Areas/HelpPage/SampleGeneration/SampleDirection.cs create mode 100644 Areas/HelpPage/SampleGeneration/TextSample.cs create mode 100644 Areas/HelpPage/Views/Help/Api.cshtml create mode 100644 Areas/HelpPage/Views/Help/DisplayTemplates/ApiGroup.cshtml create mode 100644 Areas/HelpPage/Views/Help/DisplayTemplates/HelpPageApiModel.cshtml create mode 100644 Areas/HelpPage/Views/Help/DisplayTemplates/ImageSample.cshtml create mode 100644 Areas/HelpPage/Views/Help/DisplayTemplates/InvalidSample.cshtml create mode 100644 Areas/HelpPage/Views/Help/DisplayTemplates/Parameters.cshtml create mode 100644 Areas/HelpPage/Views/Help/DisplayTemplates/Samples.cshtml create mode 100644 Areas/HelpPage/Views/Help/DisplayTemplates/TextSample.cshtml create mode 100644 Areas/HelpPage/Views/Help/Index.cshtml create mode 100644 Areas/HelpPage/Views/Shared/_Layout.cshtml create mode 100644 Areas/HelpPage/Views/Web.config create mode 100644 Areas/HelpPage/Views/_ViewStart.cshtml create mode 100644 Areas/HelpPage/XmlDocumentationProvider.cs create mode 100644 Content/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png create mode 100644 Content/themes/base/images/ui-bg_flat_75_ffffff_40x100.png create mode 100644 Content/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png create mode 100644 Content/themes/base/images/ui-bg_glass_65_ffffff_1x400.png create mode 100644 Content/themes/base/images/ui-bg_glass_75_dadada_1x400.png create mode 100644 Content/themes/base/images/ui-bg_glass_75_e6e6e6_1x400.png create mode 100644 Content/themes/base/images/ui-bg_glass_95_fef1ec_1x400.png create mode 100644 Content/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png create mode 100644 Content/themes/base/images/ui-icons_222222_256x240.png create mode 100644 Content/themes/base/images/ui-icons_2e83ff_256x240.png create mode 100644 Content/themes/base/images/ui-icons_454545_256x240.png create mode 100644 Content/themes/base/images/ui-icons_888888_256x240.png create mode 100644 Content/themes/base/images/ui-icons_cd0a0a_256x240.png create mode 100644 Content/themes/base/jquery-ui.css create mode 100644 Content/themes/base/jquery.ui.accordion.css create mode 100644 Content/themes/base/jquery.ui.all.css create mode 100644 Content/themes/base/jquery.ui.autocomplete.css create mode 100644 Content/themes/base/jquery.ui.base.css create mode 100644 Content/themes/base/jquery.ui.button.css create mode 100644 Content/themes/base/jquery.ui.core.css create mode 100644 Content/themes/base/jquery.ui.datepicker.css create mode 100644 Content/themes/base/jquery.ui.dialog.css create mode 100644 Content/themes/base/jquery.ui.progressbar.css create mode 100644 Content/themes/base/jquery.ui.resizable.css create mode 100644 Content/themes/base/jquery.ui.selectable.css create mode 100644 Content/themes/base/jquery.ui.slider.css create mode 100644 Content/themes/base/jquery.ui.tabs.css create mode 100644 Content/themes/base/jquery.ui.theme.css create mode 100644 Content/themes/base/minified/images/ui-bg_flat_0_aaaaaa_40x100.png create mode 100644 Content/themes/base/minified/images/ui-bg_flat_75_ffffff_40x100.png create mode 100644 Content/themes/base/minified/images/ui-bg_glass_55_fbf9ee_1x400.png create mode 100644 Content/themes/base/minified/images/ui-bg_glass_65_ffffff_1x400.png create mode 100644 Content/themes/base/minified/images/ui-bg_glass_75_dadada_1x400.png create mode 100644 Content/themes/base/minified/images/ui-bg_glass_75_e6e6e6_1x400.png create mode 100644 Content/themes/base/minified/images/ui-bg_glass_95_fef1ec_1x400.png create mode 100644 Content/themes/base/minified/images/ui-bg_highlight-soft_75_cccccc_1x100.png create mode 100644 Content/themes/base/minified/images/ui-icons_222222_256x240.png create mode 100644 Content/themes/base/minified/images/ui-icons_2e83ff_256x240.png create mode 100644 Content/themes/base/minified/images/ui-icons_454545_256x240.png create mode 100644 Content/themes/base/minified/images/ui-icons_888888_256x240.png create mode 100644 Content/themes/base/minified/images/ui-icons_cd0a0a_256x240.png create mode 100644 Content/themes/base/minified/jquery-ui.min.css create mode 100644 Content/themes/base/minified/jquery.ui.accordion.min.css create mode 100644 Content/themes/base/minified/jquery.ui.autocomplete.min.css create mode 100644 Content/themes/base/minified/jquery.ui.button.min.css create mode 100644 Content/themes/base/minified/jquery.ui.core.min.css create mode 100644 Content/themes/base/minified/jquery.ui.datepicker.min.css create mode 100644 Content/themes/base/minified/jquery.ui.dialog.min.css create mode 100644 Content/themes/base/minified/jquery.ui.progressbar.min.css create mode 100644 Content/themes/base/minified/jquery.ui.resizable.min.css create mode 100644 Content/themes/base/minified/jquery.ui.selectable.min.css create mode 100644 Content/themes/base/minified/jquery.ui.slider.min.css create mode 100644 Content/themes/base/minified/jquery.ui.tabs.min.css create mode 100644 Content/themes/base/minified/jquery.ui.theme.min.css create mode 100644 JSGridWebAPISample.sln create mode 100644 Scripts/jquery-ui-1.8.24.js create mode 100644 Scripts/jquery-ui-1.8.24.min.js create mode 100644 Scripts/jquery.unobtrusive-ajax.js create mode 100644 Scripts/jquery.unobtrusive-ajax.min.js create mode 100644 Scripts/jquery.validate-vsdoc.js create mode 100644 Scripts/jquery.validate.js create mode 100644 Scripts/jquery.validate.min.js create mode 100644 Scripts/jquery.validate.unobtrusive.js create mode 100644 Scripts/jquery.validate.unobtrusive.min.js create mode 100644 Scripts/knockout-2.2.0.debug.js create mode 100644 Scripts/knockout-2.2.0.js create mode 100644 Scripts/modernizr-2.6.2.js diff --git a/Areas/HelpPage/ApiDescriptionExtensions.cs b/Areas/HelpPage/ApiDescriptionExtensions.cs new file mode 100644 index 0000000..dce5f9a --- /dev/null +++ b/Areas/HelpPage/ApiDescriptionExtensions.cs @@ -0,0 +1,39 @@ +using System; +using System.Text; +using System.Web; +using System.Web.Http.Description; + +namespace JSGridWebAPISample.Areas.HelpPage +{ + public static class ApiDescriptionExtensions + { + /// + /// Generates an URI-friendly ID for the . E.g. "Get-Values-id_name" instead of "GetValues/{id}?name={name}" + /// + /// The . + /// The ID as a string. + public static string GetFriendlyId(this ApiDescription description) + { + string path = description.RelativePath; + string[] urlParts = path.Split('?'); + string localPath = urlParts[0]; + string queryKeyString = null; + if (urlParts.Length > 1) + { + string query = urlParts[1]; + string[] queryKeys = HttpUtility.ParseQueryString(query).AllKeys; + queryKeyString = String.Join("_", queryKeys); + } + + StringBuilder friendlyPath = new StringBuilder(); + friendlyPath.AppendFormat("{0}-{1}", + description.HttpMethod.Method, + localPath.Replace("/", "-").Replace("{", String.Empty).Replace("}", String.Empty)); + if (queryKeyString != null) + { + friendlyPath.AppendFormat("_{0}", queryKeyString); + } + return friendlyPath.ToString(); + } + } +} \ No newline at end of file diff --git a/Areas/HelpPage/App_Start/HelpPageConfig.cs b/Areas/HelpPage/App_Start/HelpPageConfig.cs new file mode 100644 index 0000000..28ad672 --- /dev/null +++ b/Areas/HelpPage/App_Start/HelpPageConfig.cs @@ -0,0 +1,51 @@ +using System; +using System.Collections.Generic; +using System.Net.Http.Headers; +using System.Web; +using System.Web.Http; + +namespace JSGridWebAPISample.Areas.HelpPage +{ + /// + /// Use this class to customize the Help Page. + /// For example you can set a custom to supply the documentation + /// or you can provide the samples for the requests/responses. + /// + public static class HelpPageConfig + { + public static void Register(HttpConfiguration config) + { + //// Uncomment the following to use the documentation from XML documentation file. + //config.SetDocumentationProvider(new XmlDocumentationProvider(HttpContext.Current.Server.MapPath("~/App_Data/XmlDocument.xml"))); + + //// Uncomment the following to use "sample string" as the sample for all actions that have string as the body parameter or return type. + //// Also, the string arrays will be used for IEnumerable. The sample objects will be serialized into different media type + //// formats by the available formatters. + //config.SetSampleObjects(new Dictionary + //{ + // {typeof(string), "sample string"}, + // {typeof(IEnumerable), new string[]{"sample 1", "sample 2"}} + //}); + + //// Uncomment the following to use "[0]=foo&[1]=bar" directly as the sample for all actions that support form URL encoded format + //// and have IEnumerable as the body parameter or return type. + //config.SetSampleForType("[0]=foo&[1]=bar", new MediaTypeHeaderValue("application/x-www-form-urlencoded"), typeof(IEnumerable)); + + //// Uncomment the following to use "1234" directly as the request sample for media type "text/plain" on the controller named "Values" + //// and action named "Put". + //config.SetSampleRequest("1234", new MediaTypeHeaderValue("text/plain"), "Values", "Put"); + + //// Uncomment the following to use the image on "../images/aspNetHome.png" directly as the response sample for media type "image/png" + //// on the controller named "Values" and action named "Get" with parameter "id". + //config.SetSampleResponse(new ImageSample("../images/aspNetHome.png"), new MediaTypeHeaderValue("image/png"), "Values", "Get", "id"); + + //// Uncomment the following to correct the sample request when the action expects an HttpRequestMessage with ObjectContent. + //// The sample will be generated as if the controller named "Values" and action named "Get" were having string as the body parameter. + //config.SetActualRequestType(typeof(string), "Values", "Get"); + + //// Uncomment the following to correct the sample response when the action returns an HttpResponseMessage with ObjectContent. + //// The sample will be generated as if the controller named "Values" and action named "Post" were returning a string. + //config.SetActualResponseType(typeof(string), "Values", "Post"); + } + } +} \ No newline at end of file diff --git a/Areas/HelpPage/Controllers/HelpController.cs b/Areas/HelpPage/Controllers/HelpController.cs new file mode 100644 index 0000000..23d47de --- /dev/null +++ b/Areas/HelpPage/Controllers/HelpController.cs @@ -0,0 +1,44 @@ +using System; +using System.Web.Http; +using System.Web.Mvc; +using JSGridWebAPISample.Areas.HelpPage.Models; + +namespace JSGridWebAPISample.Areas.HelpPage.Controllers +{ + /// + /// The controller that will handle requests for the help page. + /// + public class HelpController : Controller + { + public HelpController() + : this(GlobalConfiguration.Configuration) + { + } + + public HelpController(HttpConfiguration config) + { + Configuration = config; + } + + public HttpConfiguration Configuration { get; private set; } + + public ActionResult Index() + { + return View(Configuration.Services.GetApiExplorer().ApiDescriptions); + } + + public ActionResult Api(string apiId) + { + if (!String.IsNullOrEmpty(apiId)) + { + HelpPageApiModel apiModel = Configuration.GetHelpPageApiModel(apiId); + if (apiModel != null) + { + return View(apiModel); + } + } + + return View("Error"); + } + } +} \ No newline at end of file diff --git a/Areas/HelpPage/HelpPage.css b/Areas/HelpPage/HelpPage.css new file mode 100644 index 0000000..ee461e0 --- /dev/null +++ b/Areas/HelpPage/HelpPage.css @@ -0,0 +1,89 @@ +pre.wrapped { + white-space: -moz-pre-wrap; + white-space: -pre-wrap; + white-space: -o-pre-wrap; + white-space: pre-wrap; +} + +.warning-message-container { + margin-top: 20px; + padding: 0 10px; + color: #525252; + background: #EFDCA9; + border: 1px solid #CCCCCC; +} + +.help-page-table { + width: 100%; + border-collapse: collapse; + text-align: left; + margin: 0px 0px 20px 0px; + border-top: 2px solid #D4D4D4; +} + +.help-page-table th { + text-align: left; + font-weight: bold; + border-bottom: 2px solid #D4D4D4; + padding: 8px 6px 8px 6px; +} + +.help-page-table td { + border-bottom: 2px solid #D4D4D4; + padding: 15px 8px 15px 8px; + vertical-align: top; +} + +.help-page-table pre, .help-page-table p { + margin: 0px; + padding: 0px; + font-family: inherit; + font-size: 100%; +} + +.help-page-table tbody tr:hover td { + background-color: #F3F3F3; +} + +a:hover { + background-color: transparent; +} + +.sample-header { + border: 2px solid #D4D4D4; + background: #76B8DB; + color: #FFFFFF; + padding: 8px 15px; + border-bottom: none; + display: inline-block; + margin: 10px 0px 0px 0px; +} + +.sample-content { + display: block; + border-width: 0; + padding: 15px 20px; + background: #FFFFFF; + border: 2px solid #D4D4D4; + margin: 0px 0px 10px 0px; +} + +.api-name { + width: 40%; +} + +.api-documentation { + width: 60%; +} + +.parameter-name { + width: 20%; +} + +.parameter-documentation { + width: 50%; +} + +.parameter-source { + width: 30%; +} diff --git a/Areas/HelpPage/HelpPageAreaRegistration.cs b/Areas/HelpPage/HelpPageAreaRegistration.cs new file mode 100644 index 0000000..73b3dc5 --- /dev/null +++ b/Areas/HelpPage/HelpPageAreaRegistration.cs @@ -0,0 +1,26 @@ +using System.Web.Http; +using System.Web.Mvc; + +namespace JSGridWebAPISample.Areas.HelpPage +{ + public class HelpPageAreaRegistration : AreaRegistration + { + public override string AreaName + { + get + { + return "HelpPage"; + } + } + + public override void RegisterArea(AreaRegistrationContext context) + { + context.MapRoute( + "HelpPage_Default", + "Help/{action}/{apiId}", + new { controller = "Help", action = "Index", apiId = UrlParameter.Optional }); + + HelpPageConfig.Register(GlobalConfiguration.Configuration); + } + } +} \ No newline at end of file diff --git a/Areas/HelpPage/HelpPageConfigurationExtensions.cs b/Areas/HelpPage/HelpPageConfigurationExtensions.cs new file mode 100644 index 0000000..7bbf42b --- /dev/null +++ b/Areas/HelpPage/HelpPageConfigurationExtensions.cs @@ -0,0 +1,247 @@ +using System; +using System.Collections.Generic; +using System.Collections.ObjectModel; +using System.Diagnostics.CodeAnalysis; +using System.Globalization; +using System.Linq; +using System.Net.Http.Headers; +using System.Web.Http; +using System.Web.Http.Description; +using JSGridWebAPISample.Areas.HelpPage.Models; + +namespace JSGridWebAPISample.Areas.HelpPage +{ + public static class HelpPageConfigurationExtensions + { + private const string ApiModelPrefix = "MS_HelpPageApiModel_"; + + /// + /// Sets the documentation provider for help page. + /// + /// The . + /// The documentation provider. + public static void SetDocumentationProvider(this HttpConfiguration config, IDocumentationProvider documentationProvider) + { + config.Services.Replace(typeof(IDocumentationProvider), documentationProvider); + } + + /// + /// Sets the objects that will be used by the formatters to produce sample requests/responses. + /// + /// The . + /// The sample objects. + public static void SetSampleObjects(this HttpConfiguration config, IDictionary sampleObjects) + { + config.GetHelpPageSampleGenerator().SampleObjects = sampleObjects; + } + + /// + /// Sets the sample request directly for the specified media type and action. + /// + /// The . + /// The sample request. + /// The media type. + /// Name of the controller. + /// Name of the action. + public static void SetSampleRequest(this HttpConfiguration config, object sample, MediaTypeHeaderValue mediaType, string controllerName, string actionName) + { + config.GetHelpPageSampleGenerator().ActionSamples.Add(new HelpPageSampleKey(mediaType, SampleDirection.Request, controllerName, actionName, new[] { "*" }), sample); + } + + /// + /// Sets the sample request directly for the specified media type and action with parameters. + /// + /// The . + /// The sample request. + /// The media type. + /// Name of the controller. + /// Name of the action. + /// The parameter names. + public static void SetSampleRequest(this HttpConfiguration config, object sample, MediaTypeHeaderValue mediaType, string controllerName, string actionName, params string[] parameterNames) + { + config.GetHelpPageSampleGenerator().ActionSamples.Add(new HelpPageSampleKey(mediaType, SampleDirection.Request, controllerName, actionName, parameterNames), sample); + } + + /// + /// Sets the sample request directly for the specified media type of the action. + /// + /// The . + /// The sample response. + /// The media type. + /// Name of the controller. + /// Name of the action. + public static void SetSampleResponse(this HttpConfiguration config, object sample, MediaTypeHeaderValue mediaType, string controllerName, string actionName) + { + config.GetHelpPageSampleGenerator().ActionSamples.Add(new HelpPageSampleKey(mediaType, SampleDirection.Response, controllerName, actionName, new[] { "*" }), sample); + } + + /// + /// Sets the sample response directly for the specified media type of the action with specific parameters. + /// + /// The . + /// The sample response. + /// The media type. + /// Name of the controller. + /// Name of the action. + /// The parameter names. + public static void SetSampleResponse(this HttpConfiguration config, object sample, MediaTypeHeaderValue mediaType, string controllerName, string actionName, params string[] parameterNames) + { + config.GetHelpPageSampleGenerator().ActionSamples.Add(new HelpPageSampleKey(mediaType, SampleDirection.Response, controllerName, actionName, parameterNames), sample); + } + + /// + /// Sets the sample directly for all actions with the specified type and media type. + /// + /// The . + /// The sample. + /// The media type. + /// The parameter type or return type of an action. + public static void SetSampleForType(this HttpConfiguration config, object sample, MediaTypeHeaderValue mediaType, Type type) + { + config.GetHelpPageSampleGenerator().ActionSamples.Add(new HelpPageSampleKey(mediaType, type), sample); + } + + /// + /// Specifies the actual type of passed to the in an action. + /// The help page will use this information to produce more accurate request samples. + /// + /// The . + /// The type. + /// Name of the controller. + /// Name of the action. + public static void SetActualRequestType(this HttpConfiguration config, Type type, string controllerName, string actionName) + { + config.GetHelpPageSampleGenerator().ActualHttpMessageTypes.Add(new HelpPageSampleKey(SampleDirection.Request, controllerName, actionName, new[] { "*" }), type); + } + + /// + /// Specifies the actual type of passed to the in an action. + /// The help page will use this information to produce more accurate request samples. + /// + /// The . + /// The type. + /// Name of the controller. + /// Name of the action. + /// The parameter names. + public static void SetActualRequestType(this HttpConfiguration config, Type type, string controllerName, string actionName, params string[] parameterNames) + { + config.GetHelpPageSampleGenerator().ActualHttpMessageTypes.Add(new HelpPageSampleKey(SampleDirection.Request, controllerName, actionName, parameterNames), type); + } + + /// + /// Specifies the actual type of returned as part of the in an action. + /// The help page will use this information to produce more accurate response samples. + /// + /// The . + /// The type. + /// Name of the controller. + /// Name of the action. + public static void SetActualResponseType(this HttpConfiguration config, Type type, string controllerName, string actionName) + { + config.GetHelpPageSampleGenerator().ActualHttpMessageTypes.Add(new HelpPageSampleKey(SampleDirection.Response, controllerName, actionName, new[] { "*" }), type); + } + + /// + /// Specifies the actual type of returned as part of the in an action. + /// The help page will use this information to produce more accurate response samples. + /// + /// The . + /// The type. + /// Name of the controller. + /// Name of the action. + /// The parameter names. + public static void SetActualResponseType(this HttpConfiguration config, Type type, string controllerName, string actionName, params string[] parameterNames) + { + config.GetHelpPageSampleGenerator().ActualHttpMessageTypes.Add(new HelpPageSampleKey(SampleDirection.Response, controllerName, actionName, parameterNames), type); + } + + /// + /// Gets the help page sample generator. + /// + /// The . + /// The help page sample generator. + public static HelpPageSampleGenerator GetHelpPageSampleGenerator(this HttpConfiguration config) + { + return (HelpPageSampleGenerator)config.Properties.GetOrAdd( + typeof(HelpPageSampleGenerator), + k => new HelpPageSampleGenerator()); + } + + /// + /// Sets the help page sample generator. + /// + /// The . + /// The help page sample generator. + public static void SetHelpPageSampleGenerator(this HttpConfiguration config, HelpPageSampleGenerator sampleGenerator) + { + config.Properties.AddOrUpdate( + typeof(HelpPageSampleGenerator), + k => sampleGenerator, + (k, o) => sampleGenerator); + } + + /// + /// Gets the model that represents an API displayed on the help page. The model is initialized on the first call and cached for subsequent calls. + /// + /// The . + /// The ID. + /// + /// An + /// + public static HelpPageApiModel GetHelpPageApiModel(this HttpConfiguration config, string apiDescriptionId) + { + object model; + string modelId = ApiModelPrefix + apiDescriptionId; + if (!config.Properties.TryGetValue(modelId, out model)) + { + Collection apiDescriptions = config.Services.GetApiExplorer().ApiDescriptions; + ApiDescription apiDescription = apiDescriptions.FirstOrDefault(api => String.Equals(api.GetFriendlyId(), apiDescriptionId, StringComparison.OrdinalIgnoreCase)); + if (apiDescription != null) + { + HelpPageSampleGenerator sampleGenerator = config.GetHelpPageSampleGenerator(); + model = GenerateApiModel(apiDescription, sampleGenerator); + config.Properties.TryAdd(modelId, model); + } + } + + return (HelpPageApiModel)model; + } + + [SuppressMessage("Microsoft.Design", "CA1031:DoNotCatchGeneralExceptionTypes", Justification = "The exception is recorded as ErrorMessages.")] + private static HelpPageApiModel GenerateApiModel(ApiDescription apiDescription, HelpPageSampleGenerator sampleGenerator) + { + HelpPageApiModel apiModel = new HelpPageApiModel(); + apiModel.ApiDescription = apiDescription; + + try + { + foreach (var item in sampleGenerator.GetSampleRequests(apiDescription)) + { + apiModel.SampleRequests.Add(item.Key, item.Value); + LogInvalidSampleAsError(apiModel, item.Value); + } + + foreach (var item in sampleGenerator.GetSampleResponses(apiDescription)) + { + apiModel.SampleResponses.Add(item.Key, item.Value); + LogInvalidSampleAsError(apiModel, item.Value); + } + } + catch (Exception e) + { + apiModel.ErrorMessages.Add(String.Format(CultureInfo.CurrentCulture, "An exception has occurred while generating the sample. Exception Message: {0}", e.Message)); + } + + return apiModel; + } + + private static void LogInvalidSampleAsError(HelpPageApiModel apiModel, object sample) + { + InvalidSample invalidSample = sample as InvalidSample; + if (invalidSample != null) + { + apiModel.ErrorMessages.Add(invalidSample.ErrorMessage); + } + } + } +} diff --git a/Areas/HelpPage/Models/HelpPageApiModel.cs b/Areas/HelpPage/Models/HelpPageApiModel.cs new file mode 100644 index 0000000..84d1bc0 --- /dev/null +++ b/Areas/HelpPage/Models/HelpPageApiModel.cs @@ -0,0 +1,43 @@ +using System.Collections.Generic; +using System.Collections.ObjectModel; +using System.Net.Http.Headers; +using System.Web.Http.Description; + +namespace JSGridWebAPISample.Areas.HelpPage.Models +{ + /// + /// The model that represents an API displayed on the help page. + /// + public class HelpPageApiModel + { + /// + /// Initializes a new instance of the class. + /// + public HelpPageApiModel() + { + SampleRequests = new Dictionary(); + SampleResponses = new Dictionary(); + ErrorMessages = new Collection(); + } + + /// + /// Gets or sets the that describes the API. + /// + public ApiDescription ApiDescription { get; set; } + + /// + /// Gets the sample requests associated with the API. + /// + public IDictionary SampleRequests { get; private set; } + + /// + /// Gets the sample responses associated with the API. + /// + public IDictionary SampleResponses { get; private set; } + + /// + /// Gets the error messages associated with this model. + /// + public Collection ErrorMessages { get; private set; } + } +} \ No newline at end of file diff --git a/Areas/HelpPage/SampleGeneration/HelpPageSampleGenerator.cs b/Areas/HelpPage/SampleGeneration/HelpPageSampleGenerator.cs new file mode 100644 index 0000000..c765361 --- /dev/null +++ b/Areas/HelpPage/SampleGeneration/HelpPageSampleGenerator.cs @@ -0,0 +1,372 @@ +using System; +using System.Collections.Generic; +using System.Collections.ObjectModel; +using System.ComponentModel; +using System.Diagnostics.CodeAnalysis; +using System.Globalization; +using System.IO; +using System.Linq; +using System.Net.Http; +using System.Net.Http.Formatting; +using System.Net.Http.Headers; +using System.Web.Http.Description; +using System.Xml.Linq; +using Newtonsoft.Json; + +namespace JSGridWebAPISample.Areas.HelpPage +{ + /// + /// This class will generate the samples for the help page. + /// + public class HelpPageSampleGenerator + { + /// + /// Initializes a new instance of the class. + /// + public HelpPageSampleGenerator() + { + ActualHttpMessageTypes = new Dictionary(); + ActionSamples = new Dictionary(); + SampleObjects = new Dictionary(); + } + + /// + /// Gets CLR types that are used as the content of or . + /// + public IDictionary ActualHttpMessageTypes { get; internal set; } + + /// + /// Gets the objects that are used directly as samples for certain actions. + /// + public IDictionary ActionSamples { get; internal set; } + + /// + /// Gets the objects that are serialized as samples by the supported formatters. + /// + public IDictionary SampleObjects { get; internal set; } + + /// + /// Gets the request body samples for a given . + /// + /// The . + /// The samples keyed by media type. + public IDictionary GetSampleRequests(ApiDescription api) + { + return GetSample(api, SampleDirection.Request); + } + + /// + /// Gets the response body samples for a given . + /// + /// The . + /// The samples keyed by media type. + public IDictionary GetSampleResponses(ApiDescription api) + { + return GetSample(api, SampleDirection.Response); + } + + /// + /// Gets the request or response body samples. + /// + /// The . + /// The value indicating whether the sample is for a request or for a response. + /// The samples keyed by media type. + public virtual IDictionary GetSample(ApiDescription api, SampleDirection sampleDirection) + { + if (api == null) + { + throw new ArgumentNullException("api"); + } + string controllerName = api.ActionDescriptor.ControllerDescriptor.ControllerName; + string actionName = api.ActionDescriptor.ActionName; + IEnumerable parameterNames = api.ParameterDescriptions.Select(p => p.Name); + Collection formatters; + Type type = ResolveType(api, controllerName, actionName, parameterNames, sampleDirection, out formatters); + var samples = new Dictionary(); + + // Use the samples provided directly for actions + var actionSamples = GetAllActionSamples(controllerName, actionName, parameterNames, sampleDirection); + foreach (var actionSample in actionSamples) + { + samples.Add(actionSample.Key.MediaType, WrapSampleIfString(actionSample.Value)); + } + + // Do the sample generation based on formatters only if an action doesn't return an HttpResponseMessage. + // Here we cannot rely on formatters because we don't know what's in the HttpResponseMessage, it might not even use formatters. + if (type != null && !typeof(HttpResponseMessage).IsAssignableFrom(type)) + { + object sampleObject = GetSampleObject(type); + foreach (var formatter in formatters) + { + foreach (MediaTypeHeaderValue mediaType in formatter.SupportedMediaTypes) + { + if (!samples.ContainsKey(mediaType)) + { + object sample = GetActionSample(controllerName, actionName, parameterNames, type, formatter, mediaType, sampleDirection); + + // If no sample found, try generate sample using formatter and sample object + if (sample == null && sampleObject != null) + { + sample = WriteSampleObjectUsingFormatter(formatter, sampleObject, type, mediaType); + } + + samples.Add(mediaType, WrapSampleIfString(sample)); + } + } + } + } + + return samples; + } + + /// + /// Search for samples that are provided directly through . + /// + /// Name of the controller. + /// Name of the action. + /// The parameter names. + /// The CLR type. + /// The formatter. + /// The media type. + /// The value indicating whether the sample is for a request or for a response. + /// The sample that matches the parameters. + public virtual object GetActionSample(string controllerName, string actionName, IEnumerable parameterNames, Type type, MediaTypeFormatter formatter, MediaTypeHeaderValue mediaType, SampleDirection sampleDirection) + { + object sample; + + // First, try get sample provided for a specific mediaType, controllerName, actionName and parameterNames. + // If not found, try get the sample provided for a specific mediaType, controllerName and actionName regardless of the parameterNames + // If still not found, try get the sample provided for a specific type and mediaType + if (ActionSamples.TryGetValue(new HelpPageSampleKey(mediaType, sampleDirection, controllerName, actionName, parameterNames), out sample) || + ActionSamples.TryGetValue(new HelpPageSampleKey(mediaType, sampleDirection, controllerName, actionName, new[] { "*" }), out sample) || + ActionSamples.TryGetValue(new HelpPageSampleKey(mediaType, type), out sample)) + { + return sample; + } + + return null; + } + + /// + /// Gets the sample object that will be serialized by the formatters. + /// First, it will look at the . If no sample object is found, it will try to create one using . + /// + /// The type. + /// The sample object. + public virtual object GetSampleObject(Type type) + { + object sampleObject; + + if (!SampleObjects.TryGetValue(type, out sampleObject)) + { + // Try create a default sample object + ObjectGenerator objectGenerator = new ObjectGenerator(); + sampleObject = objectGenerator.GenerateObject(type); + } + + return sampleObject; + } + + /// + /// Resolves the type of the action parameter or return value when or is used. + /// + /// The . + /// Name of the controller. + /// Name of the action. + /// The parameter names. + /// The value indicating whether the sample is for a request or a response. + /// The formatters. + [SuppressMessage("Microsoft.Design", "CA1021:AvoidOutParameters", Justification = "This is only used in advanced scenarios.")] + public virtual Type ResolveType(ApiDescription api, string controllerName, string actionName, IEnumerable parameterNames, SampleDirection sampleDirection, out Collection formatters) + { + if (!Enum.IsDefined(typeof(SampleDirection), sampleDirection)) + { + throw new InvalidEnumArgumentException("sampleDirection", (int)sampleDirection, typeof(SampleDirection)); + } + if (api == null) + { + throw new ArgumentNullException("api"); + } + Type type; + if (ActualHttpMessageTypes.TryGetValue(new HelpPageSampleKey(sampleDirection, controllerName, actionName, parameterNames), out type) || + ActualHttpMessageTypes.TryGetValue(new HelpPageSampleKey(sampleDirection, controllerName, actionName, new[] { "*" }), out type)) + { + // Re-compute the supported formatters based on type + Collection newFormatters = new Collection(); + foreach (var formatter in api.ActionDescriptor.Configuration.Formatters) + { + if (IsFormatSupported(sampleDirection, formatter, type)) + { + newFormatters.Add(formatter); + } + } + formatters = newFormatters; + } + else + { + switch (sampleDirection) + { + case SampleDirection.Request: + ApiParameterDescription requestBodyParameter = api.ParameterDescriptions.FirstOrDefault(p => p.Source == ApiParameterSource.FromBody); + type = requestBodyParameter == null ? null : requestBodyParameter.ParameterDescriptor.ParameterType; + formatters = api.SupportedRequestBodyFormatters; + break; + case SampleDirection.Response: + default: + type = api.ActionDescriptor.ReturnType; + formatters = api.SupportedResponseFormatters; + break; + } + } + + return type; + } + + /// + /// Writes the sample object using formatter. + /// + /// The formatter. + /// The value. + /// The type. + /// Type of the media. + /// + [SuppressMessage("Microsoft.Design", "CA1031:DoNotCatchGeneralExceptionTypes", Justification = "The exception is recorded as InvalidSample.")] + public virtual object WriteSampleObjectUsingFormatter(MediaTypeFormatter formatter, object value, Type type, MediaTypeHeaderValue mediaType) + { + if (formatter == null) + { + throw new ArgumentNullException("formatter"); + } + if (mediaType == null) + { + throw new ArgumentNullException("mediaType"); + } + + object sample = String.Empty; + MemoryStream ms = null; + HttpContent content = null; + try + { + if (formatter.CanWriteType(type)) + { + ms = new MemoryStream(); + content = new ObjectContent(type, value, formatter, mediaType); + formatter.WriteToStreamAsync(type, value, ms, content, null).Wait(); + ms.Position = 0; + StreamReader reader = new StreamReader(ms); + string serializedSampleString = reader.ReadToEnd(); + if (mediaType.MediaType.ToUpperInvariant().Contains("XML")) + { + serializedSampleString = TryFormatXml(serializedSampleString); + } + else if (mediaType.MediaType.ToUpperInvariant().Contains("JSON")) + { + serializedSampleString = TryFormatJson(serializedSampleString); + } + + sample = new TextSample(serializedSampleString); + } + else + { + sample = new InvalidSample(String.Format( + CultureInfo.CurrentCulture, + "Failed to generate the sample for media type '{0}'. Cannot use formatter '{1}' to write type '{2}'.", + mediaType, + formatter.GetType().Name, + type.Name)); + } + } + catch (Exception e) + { + sample = new InvalidSample(String.Format( + CultureInfo.CurrentCulture, + "An exception has occurred while using the formatter '{0}' to generate sample for media type '{1}'. Exception message: {2}", + formatter.GetType().Name, + mediaType.MediaType, + e.Message)); + } + finally + { + if (ms != null) + { + ms.Dispose(); + } + if (content != null) + { + content.Dispose(); + } + } + + return sample; + } + + [SuppressMessage("Microsoft.Design", "CA1031:DoNotCatchGeneralExceptionTypes", Justification = "Handling the failure by returning the original string.")] + private static string TryFormatJson(string str) + { + try + { + object parsedJson = JsonConvert.DeserializeObject(str); + return JsonConvert.SerializeObject(parsedJson, Formatting.Indented); + } + catch + { + // can't parse JSON, return the original string + return str; + } + } + + [SuppressMessage("Microsoft.Design", "CA1031:DoNotCatchGeneralExceptionTypes", Justification = "Handling the failure by returning the original string.")] + private static string TryFormatXml(string str) + { + try + { + XDocument xml = XDocument.Parse(str); + return xml.ToString(); + } + catch + { + // can't parse XML, return the original string + return str; + } + } + + private static bool IsFormatSupported(SampleDirection sampleDirection, MediaTypeFormatter formatter, Type type) + { + switch (sampleDirection) + { + case SampleDirection.Request: + return formatter.CanReadType(type); + case SampleDirection.Response: + return formatter.CanWriteType(type); + } + return false; + } + + private IEnumerable> GetAllActionSamples(string controllerName, string actionName, IEnumerable parameterNames, SampleDirection sampleDirection) + { + HashSet parameterNamesSet = new HashSet(parameterNames, StringComparer.OrdinalIgnoreCase); + foreach (var sample in ActionSamples) + { + HelpPageSampleKey sampleKey = sample.Key; + if (String.Equals(controllerName, sampleKey.ControllerName, StringComparison.OrdinalIgnoreCase) && + String.Equals(actionName, sampleKey.ActionName, StringComparison.OrdinalIgnoreCase) && + (sampleKey.ParameterNames.SetEquals(new[] { "*" }) || parameterNamesSet.SetEquals(sampleKey.ParameterNames)) && + sampleDirection == sampleKey.SampleDirection) + { + yield return sample; + } + } + } + + private static object WrapSampleIfString(object sample) + { + string stringSample = sample as string; + if (stringSample != null) + { + return new TextSample(stringSample); + } + + return sample; + } + } +} \ No newline at end of file diff --git a/Areas/HelpPage/SampleGeneration/HelpPageSampleKey.cs b/Areas/HelpPage/SampleGeneration/HelpPageSampleKey.cs new file mode 100644 index 0000000..ee1c59f --- /dev/null +++ b/Areas/HelpPage/SampleGeneration/HelpPageSampleKey.cs @@ -0,0 +1,178 @@ +using System; +using System.Collections.Generic; +using System.ComponentModel; +using System.Net.Http.Headers; + +namespace JSGridWebAPISample.Areas.HelpPage +{ + /// + /// This is used to identify the place where the sample should be applied. + /// + public class HelpPageSampleKey + { + /// + /// Creates a new based on media type and CLR type. + /// + /// The media type. + /// The CLR type. + public HelpPageSampleKey(MediaTypeHeaderValue mediaType, Type type) + { + if (mediaType == null) + { + throw new ArgumentNullException("mediaType"); + } + if (type == null) + { + throw new ArgumentNullException("type"); + } + ControllerName = String.Empty; + ActionName = String.Empty; + ParameterNames = new HashSet(StringComparer.OrdinalIgnoreCase); + ParameterType = type; + MediaType = mediaType; + } + + /// + /// Creates a new based on , controller name, action name and parameter names. + /// + /// The . + /// Name of the controller. + /// Name of the action. + /// The parameter names. + public HelpPageSampleKey(SampleDirection sampleDirection, string controllerName, string actionName, IEnumerable parameterNames) + { + if (!Enum.IsDefined(typeof(SampleDirection), sampleDirection)) + { + throw new InvalidEnumArgumentException("sampleDirection", (int)sampleDirection, typeof(SampleDirection)); + } + if (controllerName == null) + { + throw new ArgumentNullException("controllerName"); + } + if (actionName == null) + { + throw new ArgumentNullException("actionName"); + } + if (parameterNames == null) + { + throw new ArgumentNullException("parameterNames"); + } + ControllerName = controllerName; + ActionName = actionName; + ParameterNames = new HashSet(parameterNames, StringComparer.OrdinalIgnoreCase); + SampleDirection = sampleDirection; + } + + /// + /// Creates a new based on media type, , controller name, action name and parameter names. + /// + /// The media type. + /// The . + /// Name of the controller. + /// Name of the action. + /// The parameter names. + public HelpPageSampleKey(MediaTypeHeaderValue mediaType, SampleDirection sampleDirection, string controllerName, string actionName, IEnumerable parameterNames) + { + if (mediaType == null) + { + throw new ArgumentNullException("mediaType"); + } + if (!Enum.IsDefined(typeof(SampleDirection), sampleDirection)) + { + throw new InvalidEnumArgumentException("sampleDirection", (int)sampleDirection, typeof(SampleDirection)); + } + if (controllerName == null) + { + throw new ArgumentNullException("controllerName"); + } + if (actionName == null) + { + throw new ArgumentNullException("actionName"); + } + if (parameterNames == null) + { + throw new ArgumentNullException("parameterNames"); + } + ControllerName = controllerName; + ActionName = actionName; + MediaType = mediaType; + ParameterNames = new HashSet(parameterNames, StringComparer.OrdinalIgnoreCase); + SampleDirection = sampleDirection; + } + + /// + /// Gets the name of the controller. + /// + /// + /// The name of the controller. + /// + public string ControllerName { get; private set; } + + /// + /// Gets the name of the action. + /// + /// + /// The name of the action. + /// + public string ActionName { get; private set; } + + /// + /// Gets the media type. + /// + /// + /// The media type. + /// + public MediaTypeHeaderValue MediaType { get; private set; } + + /// + /// Gets the parameter names. + /// + public HashSet ParameterNames { get; private set; } + + public Type ParameterType { get; private set; } + + /// + /// Gets the . + /// + public SampleDirection? SampleDirection { get; private set; } + + public override bool Equals(object obj) + { + HelpPageSampleKey otherKey = obj as HelpPageSampleKey; + if (otherKey == null) + { + return false; + } + + return String.Equals(ControllerName, otherKey.ControllerName, StringComparison.OrdinalIgnoreCase) && + String.Equals(ActionName, otherKey.ActionName, StringComparison.OrdinalIgnoreCase) && + (MediaType == otherKey.MediaType || (MediaType != null && MediaType.Equals(otherKey.MediaType))) && + ParameterType == otherKey.ParameterType && + SampleDirection == otherKey.SampleDirection && + ParameterNames.SetEquals(otherKey.ParameterNames); + } + + public override int GetHashCode() + { + int hashCode = ControllerName.ToUpperInvariant().GetHashCode() ^ ActionName.ToUpperInvariant().GetHashCode(); + if (MediaType != null) + { + hashCode ^= MediaType.GetHashCode(); + } + if (SampleDirection != null) + { + hashCode ^= SampleDirection.GetHashCode(); + } + if (ParameterType != null) + { + hashCode ^= ParameterType.GetHashCode(); + } + foreach (string parameterName in ParameterNames) + { + hashCode ^= parameterName.ToUpperInvariant().GetHashCode(); + } + + return hashCode; + } + } +} diff --git a/Areas/HelpPage/SampleGeneration/ImageSample.cs b/Areas/HelpPage/SampleGeneration/ImageSample.cs new file mode 100644 index 0000000..e67caee --- /dev/null +++ b/Areas/HelpPage/SampleGeneration/ImageSample.cs @@ -0,0 +1,41 @@ +using System; + +namespace JSGridWebAPISample.Areas.HelpPage +{ + /// + /// This represents an image sample on the help page. There's a display template named ImageSample associated with this class. + /// + public class ImageSample + { + /// + /// Initializes a new instance of the class. + /// + /// The URL of an image. + public ImageSample(string src) + { + if (src == null) + { + throw new ArgumentNullException("src"); + } + Src = src; + } + + public string Src { get; private set; } + + public override bool Equals(object obj) + { + ImageSample other = obj as ImageSample; + return other != null && Src == other.Src; + } + + public override int GetHashCode() + { + return Src.GetHashCode(); + } + + public override string ToString() + { + return Src; + } + } +} \ No newline at end of file diff --git a/Areas/HelpPage/SampleGeneration/InvalidSample.cs b/Areas/HelpPage/SampleGeneration/InvalidSample.cs new file mode 100644 index 0000000..c331445 --- /dev/null +++ b/Areas/HelpPage/SampleGeneration/InvalidSample.cs @@ -0,0 +1,37 @@ +using System; + +namespace JSGridWebAPISample.Areas.HelpPage +{ + /// + /// This represents an invalid sample on the help page. There's a display template named InvalidSample associated with this class. + /// + public class InvalidSample + { + public InvalidSample(string errorMessage) + { + if (errorMessage == null) + { + throw new ArgumentNullException("errorMessage"); + } + ErrorMessage = errorMessage; + } + + public string ErrorMessage { get; private set; } + + public override bool Equals(object obj) + { + InvalidSample other = obj as InvalidSample; + return other != null && ErrorMessage == other.ErrorMessage; + } + + public override int GetHashCode() + { + return ErrorMessage.GetHashCode(); + } + + public override string ToString() + { + return ErrorMessage; + } + } +} \ No newline at end of file diff --git a/Areas/HelpPage/SampleGeneration/ObjectGenerator.cs b/Areas/HelpPage/SampleGeneration/ObjectGenerator.cs new file mode 100644 index 0000000..f176358 --- /dev/null +++ b/Areas/HelpPage/SampleGeneration/ObjectGenerator.cs @@ -0,0 +1,456 @@ +using System; +using System.Collections; +using System.Collections.Generic; +using System.Diagnostics.CodeAnalysis; +using System.Globalization; +using System.Linq; +using System.Reflection; + +namespace JSGridWebAPISample.Areas.HelpPage +{ + /// + /// This class will create an object of a given type and populate it with sample data. + /// + public class ObjectGenerator + { + private const int DefaultCollectionSize = 3; + private readonly SimpleTypeObjectGenerator SimpleObjectGenerator = new SimpleTypeObjectGenerator(); + + /// + /// Generates an object for a given type. The type needs to be public, have a public default constructor and settable public properties/fields. Currently it supports the following types: + /// Simple types: , , , , , etc. + /// Complex types: POCO types. + /// Nullables: . + /// Arrays: arrays of simple types or complex types. + /// Key value pairs: + /// Tuples: , , etc + /// Dictionaries: or anything deriving from . + /// Collections: , , , , , or anything deriving from or . + /// Queryables: , . + /// + /// The type. + /// An object of the given type. + public object GenerateObject(Type type) + { + return GenerateObject(type, new Dictionary()); + } + + [SuppressMessage("Microsoft.Design", "CA1031:DoNotCatchGeneralExceptionTypes", Justification = "Here we just want to return null if anything goes wrong.")] + private object GenerateObject(Type type, Dictionary createdObjectReferences) + { + try + { + if (SimpleTypeObjectGenerator.CanGenerateObject(type)) + { + return SimpleObjectGenerator.GenerateObject(type); + } + + if (type.IsArray) + { + return GenerateArray(type, DefaultCollectionSize, createdObjectReferences); + } + + if (type.IsGenericType) + { + return GenerateGenericType(type, DefaultCollectionSize, createdObjectReferences); + } + + if (type == typeof(IDictionary)) + { + return GenerateDictionary(typeof(Hashtable), DefaultCollectionSize, createdObjectReferences); + } + + if (typeof(IDictionary).IsAssignableFrom(type)) + { + return GenerateDictionary(type, DefaultCollectionSize, createdObjectReferences); + } + + if (type == typeof(IList) || + type == typeof(IEnumerable) || + type == typeof(ICollection)) + { + return GenerateCollection(typeof(ArrayList), DefaultCollectionSize, createdObjectReferences); + } + + if (typeof(IList).IsAssignableFrom(type)) + { + return GenerateCollection(type, DefaultCollectionSize, createdObjectReferences); + } + + if (type == typeof(IQueryable)) + { + return GenerateQueryable(type, DefaultCollectionSize, createdObjectReferences); + } + + if (type.IsEnum) + { + return GenerateEnum(type); + } + + if (type.IsPublic || type.IsNestedPublic) + { + return GenerateComplexObject(type, createdObjectReferences); + } + } + catch + { + // Returns null if anything fails + return null; + } + + return null; + } + + private static object GenerateGenericType(Type type, int collectionSize, Dictionary createdObjectReferences) + { + Type genericTypeDefinition = type.GetGenericTypeDefinition(); + if (genericTypeDefinition == typeof(Nullable<>)) + { + return GenerateNullable(type, createdObjectReferences); + } + + if (genericTypeDefinition == typeof(KeyValuePair<,>)) + { + return GenerateKeyValuePair(type, createdObjectReferences); + } + + if (IsTuple(genericTypeDefinition)) + { + return GenerateTuple(type, createdObjectReferences); + } + + Type[] genericArguments = type.GetGenericArguments(); + if (genericArguments.Length == 1) + { + if (genericTypeDefinition == typeof(IList<>) || + genericTypeDefinition == typeof(IEnumerable<>) || + genericTypeDefinition == typeof(ICollection<>)) + { + Type collectionType = typeof(List<>).MakeGenericType(genericArguments); + return GenerateCollection(collectionType, collectionSize, createdObjectReferences); + } + + if (genericTypeDefinition == typeof(IQueryable<>)) + { + return GenerateQueryable(type, collectionSize, createdObjectReferences); + } + + Type closedCollectionType = typeof(ICollection<>).MakeGenericType(genericArguments[0]); + if (closedCollectionType.IsAssignableFrom(type)) + { + return GenerateCollection(type, collectionSize, createdObjectReferences); + } + } + + if (genericArguments.Length == 2) + { + if (genericTypeDefinition == typeof(IDictionary<,>)) + { + Type dictionaryType = typeof(Dictionary<,>).MakeGenericType(genericArguments); + return GenerateDictionary(dictionaryType, collectionSize, createdObjectReferences); + } + + Type closedDictionaryType = typeof(IDictionary<,>).MakeGenericType(genericArguments[0], genericArguments[1]); + if (closedDictionaryType.IsAssignableFrom(type)) + { + return GenerateDictionary(type, collectionSize, createdObjectReferences); + } + } + + if (type.IsPublic || type.IsNestedPublic) + { + return GenerateComplexObject(type, createdObjectReferences); + } + + return null; + } + + private static object GenerateTuple(Type type, Dictionary createdObjectReferences) + { + Type[] genericArgs = type.GetGenericArguments(); + object[] parameterValues = new object[genericArgs.Length]; + bool failedToCreateTuple = true; + ObjectGenerator objectGenerator = new ObjectGenerator(); + for (int i = 0; i < genericArgs.Length; i++) + { + parameterValues[i] = objectGenerator.GenerateObject(genericArgs[i], createdObjectReferences); + failedToCreateTuple &= parameterValues[i] == null; + } + if (failedToCreateTuple) + { + return null; + } + object result = Activator.CreateInstance(type, parameterValues); + return result; + } + + private static bool IsTuple(Type genericTypeDefinition) + { + return genericTypeDefinition == typeof(Tuple<>) || + genericTypeDefinition == typeof(Tuple<,>) || + genericTypeDefinition == typeof(Tuple<,,>) || + genericTypeDefinition == typeof(Tuple<,,,>) || + genericTypeDefinition == typeof(Tuple<,,,,>) || + genericTypeDefinition == typeof(Tuple<,,,,,>) || + genericTypeDefinition == typeof(Tuple<,,,,,,>) || + genericTypeDefinition == typeof(Tuple<,,,,,,,>); + } + + private static object GenerateKeyValuePair(Type keyValuePairType, Dictionary createdObjectReferences) + { + Type[] genericArgs = keyValuePairType.GetGenericArguments(); + Type typeK = genericArgs[0]; + Type typeV = genericArgs[1]; + ObjectGenerator objectGenerator = new ObjectGenerator(); + object keyObject = objectGenerator.GenerateObject(typeK, createdObjectReferences); + object valueObject = objectGenerator.GenerateObject(typeV, createdObjectReferences); + if (keyObject == null && valueObject == null) + { + // Failed to create key and values + return null; + } + object result = Activator.CreateInstance(keyValuePairType, keyObject, valueObject); + return result; + } + + private static object GenerateArray(Type arrayType, int size, Dictionary createdObjectReferences) + { + Type type = arrayType.GetElementType(); + Array result = Array.CreateInstance(type, size); + bool areAllElementsNull = true; + ObjectGenerator objectGenerator = new ObjectGenerator(); + for (int i = 0; i < size; i++) + { + object element = objectGenerator.GenerateObject(type, createdObjectReferences); + result.SetValue(element, i); + areAllElementsNull &= element == null; + } + + if (areAllElementsNull) + { + return null; + } + + return result; + } + + private static object GenerateDictionary(Type dictionaryType, int size, Dictionary createdObjectReferences) + { + Type typeK = typeof(object); + Type typeV = typeof(object); + if (dictionaryType.IsGenericType) + { + Type[] genericArgs = dictionaryType.GetGenericArguments(); + typeK = genericArgs[0]; + typeV = genericArgs[1]; + } + + object result = Activator.CreateInstance(dictionaryType); + MethodInfo addMethod = dictionaryType.GetMethod("Add") ?? dictionaryType.GetMethod("TryAdd"); + MethodInfo containsMethod = dictionaryType.GetMethod("Contains") ?? dictionaryType.GetMethod("ContainsKey"); + ObjectGenerator objectGenerator = new ObjectGenerator(); + for (int i = 0; i < size; i++) + { + object newKey = objectGenerator.GenerateObject(typeK, createdObjectReferences); + if (newKey == null) + { + // Cannot generate a valid key + return null; + } + + bool containsKey = (bool)containsMethod.Invoke(result, new object[] { newKey }); + if (!containsKey) + { + object newValue = objectGenerator.GenerateObject(typeV, createdObjectReferences); + addMethod.Invoke(result, new object[] { newKey, newValue }); + } + } + + return result; + } + + private static object GenerateEnum(Type enumType) + { + Array possibleValues = Enum.GetValues(enumType); + if (possibleValues.Length > 0) + { + return possibleValues.GetValue(0); + } + return null; + } + + private static object GenerateQueryable(Type queryableType, int size, Dictionary createdObjectReferences) + { + bool isGeneric = queryableType.IsGenericType; + object list; + if (isGeneric) + { + Type listType = typeof(List<>).MakeGenericType(queryableType.GetGenericArguments()); + list = GenerateCollection(listType, size, createdObjectReferences); + } + else + { + list = GenerateArray(typeof(object[]), size, createdObjectReferences); + } + if (list == null) + { + return null; + } + if (isGeneric) + { + Type argumentType = typeof(IEnumerable<>).MakeGenericType(queryableType.GetGenericArguments()); + MethodInfo asQueryableMethod = typeof(Queryable).GetMethod("AsQueryable", new[] { argumentType }); + return asQueryableMethod.Invoke(null, new[] { list }); + } + + return Queryable.AsQueryable((IEnumerable)list); + } + + private static object GenerateCollection(Type collectionType, int size, Dictionary createdObjectReferences) + { + Type type = collectionType.IsGenericType ? + collectionType.GetGenericArguments()[0] : + typeof(object); + object result = Activator.CreateInstance(collectionType); + MethodInfo addMethod = collectionType.GetMethod("Add"); + bool areAllElementsNull = true; + ObjectGenerator objectGenerator = new ObjectGenerator(); + for (int i = 0; i < size; i++) + { + object element = objectGenerator.GenerateObject(type, createdObjectReferences); + addMethod.Invoke(result, new object[] { element }); + areAllElementsNull &= element == null; + } + + if (areAllElementsNull) + { + return null; + } + + return result; + } + + private static object GenerateNullable(Type nullableType, Dictionary createdObjectReferences) + { + Type type = nullableType.GetGenericArguments()[0]; + ObjectGenerator objectGenerator = new ObjectGenerator(); + return objectGenerator.GenerateObject(type, createdObjectReferences); + } + + private static object GenerateComplexObject(Type type, Dictionary createdObjectReferences) + { + object result = null; + + if (createdObjectReferences.TryGetValue(type, out result)) + { + // The object has been created already, just return it. This will handle the circular reference case. + return result; + } + + if (type.IsValueType) + { + result = Activator.CreateInstance(type); + } + else + { + ConstructorInfo defaultCtor = type.GetConstructor(Type.EmptyTypes); + if (defaultCtor == null) + { + // Cannot instantiate the type because it doesn't have a default constructor + return null; + } + + result = defaultCtor.Invoke(new object[0]); + } + createdObjectReferences.Add(type, result); + SetPublicProperties(type, result, createdObjectReferences); + SetPublicFields(type, result, createdObjectReferences); + return result; + } + + private static void SetPublicProperties(Type type, object obj, Dictionary createdObjectReferences) + { + PropertyInfo[] properties = type.GetProperties(BindingFlags.Public | BindingFlags.Instance); + ObjectGenerator objectGenerator = new ObjectGenerator(); + foreach (PropertyInfo property in properties) + { + if (property.CanWrite) + { + object propertyValue = objectGenerator.GenerateObject(property.PropertyType, createdObjectReferences); + property.SetValue(obj, propertyValue, null); + } + } + } + + private static void SetPublicFields(Type type, object obj, Dictionary createdObjectReferences) + { + FieldInfo[] fields = type.GetFields(BindingFlags.Public | BindingFlags.Instance); + ObjectGenerator objectGenerator = new ObjectGenerator(); + foreach (FieldInfo field in fields) + { + object fieldValue = objectGenerator.GenerateObject(field.FieldType, createdObjectReferences); + field.SetValue(obj, fieldValue); + } + } + + private class SimpleTypeObjectGenerator + { + private long _index = 0; + private static readonly Dictionary> DefaultGenerators = InitializeGenerators(); + + [SuppressMessage("Microsoft.Maintainability", "CA1502:AvoidExcessiveComplexity", Justification = "These are simple type factories and cannot be split up.")] + private static Dictionary> InitializeGenerators() + { + return new Dictionary> + { + { typeof(Boolean), index => true }, + { typeof(Byte), index => (Byte)64 }, + { typeof(Char), index => (Char)65 }, + { typeof(DateTime), index => DateTime.Now }, + { typeof(DateTimeOffset), index => new DateTimeOffset(DateTime.Now) }, + { typeof(DBNull), index => DBNull.Value }, + { typeof(Decimal), index => (Decimal)index }, + { typeof(Double), index => (Double)(index + 0.1) }, + { typeof(Guid), index => Guid.NewGuid() }, + { typeof(Int16), index => (Int16)(index % Int16.MaxValue) }, + { typeof(Int32), index => (Int32)(index % Int32.MaxValue) }, + { typeof(Int64), index => (Int64)index }, + { typeof(Object), index => new object() }, + { typeof(SByte), index => (SByte)64 }, + { typeof(Single), index => (Single)(index + 0.1) }, + { + typeof(String), index => + { + return String.Format(CultureInfo.CurrentCulture, "sample string {0}", index); + } + }, + { + typeof(TimeSpan), index => + { + return TimeSpan.FromTicks(1234567); + } + }, + { typeof(UInt16), index => (UInt16)(index % UInt16.MaxValue) }, + { typeof(UInt32), index => (UInt32)(index % UInt32.MaxValue) }, + { typeof(UInt64), index => (UInt64)index }, + { + typeof(Uri), index => + { + return new Uri(String.Format(CultureInfo.CurrentCulture, "http://webapihelppage{0}.com", index)); + } + }, + }; + } + + public static bool CanGenerateObject(Type type) + { + return DefaultGenerators.ContainsKey(type); + } + + public object GenerateObject(Type type) + { + return DefaultGenerators[type](++_index); + } + } + } +} \ No newline at end of file diff --git a/Areas/HelpPage/SampleGeneration/SampleDirection.cs b/Areas/HelpPage/SampleGeneration/SampleDirection.cs new file mode 100644 index 0000000..63edeab --- /dev/null +++ b/Areas/HelpPage/SampleGeneration/SampleDirection.cs @@ -0,0 +1,11 @@ +namespace JSGridWebAPISample.Areas.HelpPage +{ + /// + /// Indicates whether the sample is used for request or response + /// + public enum SampleDirection + { + Request = 0, + Response + } +} \ No newline at end of file diff --git a/Areas/HelpPage/SampleGeneration/TextSample.cs b/Areas/HelpPage/SampleGeneration/TextSample.cs new file mode 100644 index 0000000..dabac60 --- /dev/null +++ b/Areas/HelpPage/SampleGeneration/TextSample.cs @@ -0,0 +1,37 @@ +using System; + +namespace JSGridWebAPISample.Areas.HelpPage +{ + /// + /// This represents a preformatted text sample on the help page. There's a display template named TextSample associated with this class. + /// + public class TextSample + { + public TextSample(string text) + { + if (text == null) + { + throw new ArgumentNullException("text"); + } + Text = text; + } + + public string Text { get; private set; } + + public override bool Equals(object obj) + { + TextSample other = obj as TextSample; + return other != null && Text == other.Text; + } + + public override int GetHashCode() + { + return Text.GetHashCode(); + } + + public override string ToString() + { + return Text; + } + } +} \ No newline at end of file diff --git a/Areas/HelpPage/Views/Help/Api.cshtml b/Areas/HelpPage/Views/Help/Api.cshtml new file mode 100644 index 0000000..7486629 --- /dev/null +++ b/Areas/HelpPage/Views/Help/Api.cshtml @@ -0,0 +1,25 @@ +@using System.Web.Http +@using JSGridWebAPISample.Areas.HelpPage.Models +@model HelpPageApiModel + +@{ + var description = Model.ApiDescription; + ViewBag.Title = description.HttpMethod.Method + " " + description.RelativePath; +} + +
+
+
+

+ @Html.ActionLink("Help Page Home", "Index") +

+
+
+
+ @Html.DisplayFor(m => Model) +
+
+ +@section Scripts { + +} \ No newline at end of file diff --git a/Areas/HelpPage/Views/Help/DisplayTemplates/ApiGroup.cshtml b/Areas/HelpPage/Views/Help/DisplayTemplates/ApiGroup.cshtml new file mode 100644 index 0000000..6685e4e --- /dev/null +++ b/Areas/HelpPage/Views/Help/DisplayTemplates/ApiGroup.cshtml @@ -0,0 +1,30 @@ +@using System.Web.Http +@using System.Web.Http.Description +@using JSGridWebAPISample.Areas.HelpPage +@using JSGridWebAPISample.Areas.HelpPage.Models +@model IGrouping + +

@Model.Key

+ + + + + + @foreach (var api in Model) + { + + + + + } + +
APIDescription
@api.HttpMethod.Method @api.RelativePath + @if (api.Documentation != null) + { +

@api.Documentation

+ } + else + { +

No documentation available.

+ } +
\ No newline at end of file diff --git a/Areas/HelpPage/Views/Help/DisplayTemplates/HelpPageApiModel.cshtml b/Areas/HelpPage/Views/Help/DisplayTemplates/HelpPageApiModel.cshtml new file mode 100644 index 0000000..2964a3b --- /dev/null +++ b/Areas/HelpPage/Views/Help/DisplayTemplates/HelpPageApiModel.cshtml @@ -0,0 +1,43 @@ +@using System.Web.Http +@using JSGridWebAPISample.Areas.HelpPage.Models +@model HelpPageApiModel + +@{ + var description = Model.ApiDescription; + bool hasParameters = description.ParameterDescriptions.Count > 0; + bool hasRequestSamples = Model.SampleRequests.Count > 0; + bool hasResponseSamples = Model.SampleResponses.Count > 0; +} +

@description.HttpMethod.Method @description.RelativePath

+
+ @if (description.Documentation != null) + { +

@description.Documentation

+ } + else + { +

No documentation available.

+ } + + @if (hasParameters || hasRequestSamples) + { +

Request Information

+ if (hasParameters) + { +

Parameters

+ @Html.DisplayFor(apiModel => apiModel.ApiDescription.ParameterDescriptions, "Parameters") + } + if (hasRequestSamples) + { +

Request body formats

+ @Html.DisplayFor(apiModel => apiModel.SampleRequests, "Samples") + } + } + + @if (hasResponseSamples) + { +

Response Information

+

Response body formats

+ @Html.DisplayFor(apiModel => apiModel.SampleResponses, "Samples") + } +
\ No newline at end of file diff --git a/Areas/HelpPage/Views/Help/DisplayTemplates/ImageSample.cshtml b/Areas/HelpPage/Views/Help/DisplayTemplates/ImageSample.cshtml new file mode 100644 index 0000000..f0ff0f1 --- /dev/null +++ b/Areas/HelpPage/Views/Help/DisplayTemplates/ImageSample.cshtml @@ -0,0 +1,4 @@ +@using JSGridWebAPISample.Areas.HelpPage +@model ImageSample + + \ No newline at end of file diff --git a/Areas/HelpPage/Views/Help/DisplayTemplates/InvalidSample.cshtml b/Areas/HelpPage/Views/Help/DisplayTemplates/InvalidSample.cshtml new file mode 100644 index 0000000..03471f0 --- /dev/null +++ b/Areas/HelpPage/Views/Help/DisplayTemplates/InvalidSample.cshtml @@ -0,0 +1,13 @@ +@using JSGridWebAPISample.Areas.HelpPage +@model InvalidSample + +@if (HttpContext.Current.IsDebuggingEnabled) +{ +
+

@Model.ErrorMessage

+
+} +else +{ +

Sample not available.

+} \ No newline at end of file diff --git a/Areas/HelpPage/Views/Help/DisplayTemplates/Parameters.cshtml b/Areas/HelpPage/Views/Help/DisplayTemplates/Parameters.cshtml new file mode 100644 index 0000000..6023df6 --- /dev/null +++ b/Areas/HelpPage/Views/Help/DisplayTemplates/Parameters.cshtml @@ -0,0 +1,42 @@ +@using System.Collections.ObjectModel +@using System.Web.Http.Description +@using System.Threading +@model Collection + + + + + + + @foreach (ApiParameterDescription parameter in Model) + { + string parameterDocumentation = parameter.Documentation != null ? + parameter.Documentation : + "No documentation available."; + + // Don't show CancellationToken because it's a special parameter + if (!typeof(CancellationToken).IsAssignableFrom(parameter.ParameterDescriptor.ParameterType)) + { + + + + + + } + } + +
NameDescriptionAdditional information
@parameter.Name
@parameterDocumentation
 + @switch (parameter.Source) + { + case ApiParameterSource.FromBody: +

Define this parameter in the request body.

+ break; + case ApiParameterSource.FromUri: +

Define this parameter in the request URI.

+ break; + case ApiParameterSource.Unknown: + default: +

None.

+ break; + } +
\ No newline at end of file diff --git a/Areas/HelpPage/Views/Help/DisplayTemplates/Samples.cshtml b/Areas/HelpPage/Views/Help/DisplayTemplates/Samples.cshtml new file mode 100644 index 0000000..c19596f --- /dev/null +++ b/Areas/HelpPage/Views/Help/DisplayTemplates/Samples.cshtml @@ -0,0 +1,30 @@ +@using System.Net.Http.Headers +@model Dictionary + +@{ + // Group the samples into a single tab if they are the same. + Dictionary samples = Model.GroupBy(pair => pair.Value).ToDictionary( + pair => String.Join(", ", pair.Select(m => m.Key.ToString()).ToArray()), + pair => pair.Key); + var mediaTypes = samples.Keys; +} +
+ @foreach (var mediaType in mediaTypes) + { +

@mediaType

+
+ Sample: + @{ + var sample = samples[mediaType]; + if (sample == null) + { +

Sample not available.

+ } + else + { + @Html.DisplayFor(s => sample); + } + } +
+ } +
\ No newline at end of file diff --git a/Areas/HelpPage/Views/Help/DisplayTemplates/TextSample.cshtml b/Areas/HelpPage/Views/Help/DisplayTemplates/TextSample.cshtml new file mode 100644 index 0000000..74c53b7 --- /dev/null +++ b/Areas/HelpPage/Views/Help/DisplayTemplates/TextSample.cshtml @@ -0,0 +1,6 @@ +@using JSGridWebAPISample.Areas.HelpPage +@model TextSample + +
+@Model.Text
+
\ No newline at end of file diff --git a/Areas/HelpPage/Views/Help/Index.cshtml b/Areas/HelpPage/Views/Help/Index.cshtml new file mode 100644 index 0000000..22d7a34 --- /dev/null +++ b/Areas/HelpPage/Views/Help/Index.cshtml @@ -0,0 +1,40 @@ +@using System.Web.Http +@using System.Web.Http.Description +@using System.Collections.ObjectModel +@using JSGridWebAPISample.Areas.HelpPage.Models +@model Collection + +@{ + ViewBag.Title = "ASP.NET Web API Help Page"; + + // Group APIs by controller + ILookup apiGroups = Model.ToLookup(api => api.ActionDescriptor.ControllerDescriptor.ControllerName); +} + +
+
+
+

@ViewBag.Title

+
+
+
+
+
+
+

Introduction

+

+ Provide a general description of your APIs here. +

+
+
+
+ @foreach (var group in apiGroups) + { + @Html.DisplayFor(m => group, "ApiGroup") + } +
+
+ +@section Scripts { + +} \ No newline at end of file diff --git a/Areas/HelpPage/Views/Shared/_Layout.cshtml b/Areas/HelpPage/Views/Shared/_Layout.cshtml new file mode 100644 index 0000000..bc2e96f --- /dev/null +++ b/Areas/HelpPage/Views/Shared/_Layout.cshtml @@ -0,0 +1,12 @@ + + + + + + @ViewBag.Title + @RenderSection("scripts", required: false) + + + @RenderBody() + + \ No newline at end of file diff --git a/Areas/HelpPage/Views/Web.config b/Areas/HelpPage/Views/Web.config new file mode 100644 index 0000000..4794f5c --- /dev/null +++ b/Areas/HelpPage/Views/Web.config @@ -0,0 +1,62 @@ + + + + + +
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/Areas/HelpPage/Views/_ViewStart.cshtml b/Areas/HelpPage/Views/_ViewStart.cshtml new file mode 100644 index 0000000..a925950 --- /dev/null +++ b/Areas/HelpPage/Views/_ViewStart.cshtml @@ -0,0 +1,4 @@ +@{ + // Change the Layout path below to blend the look and feel of the help page with your existing web pages. + Layout = "~/Areas/HelpPage/Views/Shared/_Layout.cshtml"; +} \ No newline at end of file diff --git a/Areas/HelpPage/XmlDocumentationProvider.cs b/Areas/HelpPage/XmlDocumentationProvider.cs new file mode 100644 index 0000000..6d84d3e --- /dev/null +++ b/Areas/HelpPage/XmlDocumentationProvider.cs @@ -0,0 +1,112 @@ +using System; +using System.Globalization; +using System.Linq; +using System.Reflection; +using System.Web.Http.Controllers; +using System.Web.Http.Description; +using System.Xml.XPath; + +namespace JSGridWebAPISample.Areas.HelpPage +{ + /// + /// A custom that reads the API documentation from an XML documentation file. + /// + public class XmlDocumentationProvider : IDocumentationProvider + { + private XPathNavigator _documentNavigator; + private const string MethodExpression = "/doc/members/member[@name='M:{0}']"; + private const string ParameterExpression = "param[@name='{0}']"; + + /// + /// Initializes a new instance of the class. + /// + /// The physical path to XML document. + public XmlDocumentationProvider(string documentPath) + { + if (documentPath == null) + { + throw new ArgumentNullException("documentPath"); + } + XPathDocument xpath = new XPathDocument(documentPath); + _documentNavigator = xpath.CreateNavigator(); + } + + public virtual string GetDocumentation(HttpActionDescriptor actionDescriptor) + { + XPathNavigator methodNode = GetMethodNode(actionDescriptor); + if (methodNode != null) + { + XPathNavigator summaryNode = methodNode.SelectSingleNode("summary"); + if (summaryNode != null) + { + return summaryNode.Value.Trim(); + } + } + + return null; + } + + public virtual string GetDocumentation(HttpParameterDescriptor parameterDescriptor) + { + ReflectedHttpParameterDescriptor reflectedParameterDescriptor = parameterDescriptor as ReflectedHttpParameterDescriptor; + if (reflectedParameterDescriptor != null) + { + XPathNavigator methodNode = GetMethodNode(reflectedParameterDescriptor.ActionDescriptor); + if (methodNode != null) + { + string parameterName = reflectedParameterDescriptor.ParameterInfo.Name; + XPathNavigator parameterNode = methodNode.SelectSingleNode(String.Format(CultureInfo.InvariantCulture, ParameterExpression, parameterName)); + if (parameterNode != null) + { + return parameterNode.Value.Trim(); + } + } + } + + return null; + } + + private XPathNavigator GetMethodNode(HttpActionDescriptor actionDescriptor) + { + ReflectedHttpActionDescriptor reflectedActionDescriptor = actionDescriptor as ReflectedHttpActionDescriptor; + if (reflectedActionDescriptor != null) + { + string selectExpression = String.Format(CultureInfo.InvariantCulture, MethodExpression, GetMemberName(reflectedActionDescriptor.MethodInfo)); + return _documentNavigator.SelectSingleNode(selectExpression); + } + + return null; + } + + private static string GetMemberName(MethodInfo method) + { + string name = String.Format(CultureInfo.InvariantCulture, "{0}.{1}", method.DeclaringType.FullName, method.Name); + ParameterInfo[] parameters = method.GetParameters(); + if (parameters.Length != 0) + { + string[] parameterTypeNames = parameters.Select(param => GetTypeName(param.ParameterType)).ToArray(); + name += String.Format(CultureInfo.InvariantCulture, "({0})", String.Join(",", parameterTypeNames)); + } + + return name; + } + + private static string GetTypeName(Type type) + { + if (type.IsGenericType) + { + // Format the generic type name to something like: Generic{System.Int32,System.String} + Type genericType = type.GetGenericTypeDefinition(); + Type[] genericArguments = type.GetGenericArguments(); + string typeName = genericType.FullName; + + // Trim the generic parameter counts from the name + typeName = typeName.Substring(0, typeName.IndexOf('`')); + string[] argumentTypeNames = genericArguments.Select(t => GetTypeName(t)).ToArray(); + return String.Format(CultureInfo.InvariantCulture, "{0}{{{1}}}", typeName, String.Join(",", argumentTypeNames)); + } + + return type.FullName; + } + } +} diff --git a/Content/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png b/Content/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png new file mode 100644 index 0000000000000000000000000000000000000000..5b5dab2ab7b1c50dea9cfe73dc5a269a92d2d4b4 GIT binary patch literal 180 zcmeAS@N?(olHy`uVBq!ia0vp^8bF-F!3HG1q!d*FscKIb$B>N1x91EQ4=4yQ7#`R^ z$vje}bP0l+XkK DSH>_4 literal 0 HcmV?d00001 diff --git a/Content/themes/base/images/ui-bg_flat_75_ffffff_40x100.png b/Content/themes/base/images/ui-bg_flat_75_ffffff_40x100.png new file mode 100644 index 0000000000000000000000000000000000000000..ac8b229af950c29356abf64a6c4aa894575445f0 GIT binary patch literal 178 zcmeAS@N?(olHy`uVBq!ia0vp^8bF-F!3HG1q!d*FsY*{5$B>N1x91EQ4=4yQYz+E8 zPo9&<{J;c_6SHRil>2s{Zw^OT)6@jj2u|u!(plXsM>LJD`vD!n;OXk;vd$@?2>^GI BH@yG= literal 0 HcmV?d00001 diff --git a/Content/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png b/Content/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png new file mode 100644 index 0000000000000000000000000000000000000000..ad3d6346e00f246102f72f2e026ed0491988b394 GIT binary patch literal 120 zcmeAS@N?(olHy`uVBq!ia0vp^j6gJjgAK^akKnour0hLi978O6-<~(*I$*%ybaDOn z{W;e!B}_MSUQoPXhYd^Y6RUoS1yepnPx`2Kz)7OXQG!!=-jY=F+d2OOy?#DnJ32>z UEim$g7SJdLPgg&ebxsLQ09~*s;{X5v literal 0 HcmV?d00001 diff --git a/Content/themes/base/images/ui-bg_glass_65_ffffff_1x400.png b/Content/themes/base/images/ui-bg_glass_65_ffffff_1x400.png new file mode 100644 index 0000000000000000000000000000000000000000..42ccba269b6e91bef12ad0fa18be651b5ef0ee68 GIT binary patch literal 105 zcmeAS@N?(olHy`uVBq!ia0vp^j6gJjgAK^akKnouqzpV=978O6-=0?FV^9z|eBtf= z|7WztIJ;WT>{+tN>ySr~=F{k$>;_x^_y?afmf9pRKH0)6?eSP?3s5hEr>mdKI;Vst E0O;M1& literal 0 HcmV?d00001 diff --git a/Content/themes/base/images/ui-bg_glass_75_dadada_1x400.png b/Content/themes/base/images/ui-bg_glass_75_dadada_1x400.png new file mode 100644 index 0000000000000000000000000000000000000000..5a46b47cb16631068aee9e0bd61269fc4e95e5cd GIT binary patch literal 111 zcmeAS@N?(olHy`uVBq!ia0vp^j6gJjgAK^akKnouq|7{B978O6lPf+wIa#m9#>Unb zm^4K~wN3Zq+uP{vDV26o)#~38k_!`W=^oo1w6ixmPC4R1b Tyd6G3lNdZ*{an^LB{Ts5`idse literal 0 HcmV?d00001 diff --git a/Content/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/Content/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png new file mode 100644 index 0000000000000000000000000000000000000000..7c9fa6c6edcfcdd3e5b77e6f547b719e6fc66e30 GIT binary patch literal 101 zcmeAS@N?(olHy`uVBq!ia0vp^j6j^i!3HGVb)pi0l#Zv1V~E7mI3`<(O3xvulR&VAkQJHZBho(m=l0{{SA7UpJl008iB z3Rqvn`1P1SiomLXkg776;)RSXXXV1Iqu_@e2%8dEPZ*NvG6-d*$oWlBXKKg zV({l@ll0gM+F;pm#SBg*2mQ!Rn_HBhT&5w_d`jyG6+_vuxMHXoKj|Yh2EGJ-B`N+E z$pmy>sA-*C0S`BfHv`&Y>Z626r?uZY8?`zzbXj7u1}` z;TS<~e1eY(jD4j)wElgyeR*V7`qdhf3S5Vcdq_R*a&F^r|9|M*i>!yeL)xMH?-6M_ zJjl&7(M|RQJ2z;fI7;E!$?Pfq$usWpjLxzlazT~K6v`ft@@P32;&o$5@b}Yj#d~r) z9^2%vhdyIgOXOGiCNOR_sjx3j8*01pUqQBn7r}I@E53HUy&DusRETO9wG~Rdfx=Ta zwD>0smtXx6l#X>f`lTc3c!pmLbwTP$Zfe7s__87<&i+s33P`Udim99RAA$T_Y7T3^ z>vV9wL8Sc0x! z_eRl4cEFZ`EXPfL3omdIIY|MS@P4-79I_Af%(!ONP=msk&*mFs^(0gOj->4HEJ}Ca zL(HZSEXEQH#fbJDfQ^RQnvtlx$kD>NeLhPB+yUp!E5O$&?fP1}JdI;l4(=H(hEfAQ zNRU;>uU@{f`2)^*UI^NA8VHraDlXrE*?OWOs z7D#P(ftiy|@ab?=t923@#mR}=S6GNj1 z?mTR4hby}vE*2>Wg7-X!KAz3vwvJ)qVMtB~**$wrQ^&0>;8UR6E7imZV-)iH?Tt~> zX-EGVhMYWVxX}dU)MQaN+jv0*8;3JBy*az#1aW|^_4%i?mlU$yRTy>-wCJJVC==P> zEx=B7cZ&E7jJ@{Z{CG+0A-lAG;ovs3FALs8|JLq?o#M-to~~wx^JI)GhP%l=X?-mS zEbfx}Nj)D74<>(1{)gt2^%v7UAlLYp6gO$gsv=`$#2)3F9ed8@mcK6i!h@mGQqU}e zyItCAfl~4IqG~(AU2lV?`)nu#S5+1BrCJv>QmoI?LyuLj8e^o>li?U6OMey{r_T(* zY8RG<@x>cK$(nNMlhy)E`{;|c6$@%L*hZEYs{mUmt$8-u8m?YV3{83m{YAwB%6Y{L z6k9V^jd0tnd%q4+xwp&Yfr#>WqoooH9K5xYM|V_s8{16~N?TcuYd@6+y1_aS;c{q^(Kyv6DZcFd zd@RkCqyC{5yX5E=oHd-`WBQ0I>9_&^<}<7793`JA=$mRuSrr}iQyzxG9T)%=Xp2g4 zkFI*p1^XIjQQE0yQNGyZNn{h@1;N1>r@)!(21u5LGg2Ob1==Thh`ZXost~Y05y+XE zrc7k%zx|Fxe^LX9HhqjcV~P|W`3AXYj%WAaFNz@uZ-xRmf!NHrNh4zKSO1WrwFL6P zXM}G=*p9v_k=mUmpg-$Y6I7Mt4@y2D+ys?c;_C@aVePnKabqAS%y%AoFzKI#JaeQxo%Il=}>GqqqxhG8cPyu>P?R=}Ol7vhvDcW{Z8i0Zn zzm^YCS5qT4m#*SycTaxzIpnMMHwFrEO>lJzqr0i6lGn6M7x;$7B7Iy)6renY$OiZc zMEFF-;Ff)@RWrYEodz{P?avD?^RtUsN$GEP>xrgxlbtd22`L1q+Vm;zyBzLIj#2fp zQZS2sUF)*%MR5S(jid&TIT<2`Js!yUdi}%lzzxkuKjf|bHvGZz#1l5%O0plla6C28K&%)=R}0F6xRI>HvM|=4x#=-to|lSN^N9P6&xIP z2dq0{CX-Xc&YJNeXXD#dn;c9feR-*P_CfUEp8(wN{z!yEZrI*MPs**fh@b|xe*S&i zHc8i5C2XFuJ)xhg7K~%2H`zsX?JhZT+>};UB5HaE$E92V@>aXAPbP zjHGY7LH_&c+;-7yblDf5tKrky!+N>Vx>?)QZi1hm1Aea(92RyRiFczw&w7)GT*KddVhT(T~0Egdo9qyLRosyG6?!=QbqPzk^x9!b!;O zjEYZ(YM2+oYg-TrJTt9??(26|bMF?&#cgl&%SzC;-tOToW%SoAmvaoExO%bz%?xjk zc(|{^J<~z4;>Loltn&Q#cD-zLlA0oFa(P1*5{sdl$v0#75<`$?CT{uv?urEF5%l#% z1*lLBO|PYH2z}OUCDP!56T6(s<{oG|TOAmiP3Z95>EKzFu=~wRiHd}%-yn`p^?J6( zih27|xpMpU0(-^Ma=J7`xm^&DhSqXkjnQt=LQjM?m_ss!!0cIcfgCXk7TijCGz5At zUKx0OZ(Pc2owm3zR5RS0N)Y#iMfl$WQCVB&sa%OY<#3FtYF&H{`S5{&n#aQKe2Se9 zB?KD>qbcT%&$2w0lfgg>hoa-{bj}D!0GrB0(o9%dP6Pxsw8y%(rU7O|*#fSHYBm2h zyytq$C(2?`j}W=ORiP$Y;41*}G=Y$(2OhqHVfd_b2NmhSboLunMtOr5!~U=jF_g7g zx!U^R$M++HtM%nJWA0HW6A->{j|_B;D@i9waP$)>{6HyW zi?%Q-uGS3xs5_COdmgZjld7Pfo4dBxil@eQDw4^F*Vcb}d)bfW?|OD#N(nd^;T^jB zZea;L9}obXL9cH4o}9qQv(@ovFw_meU5D94g#m>tZ>F(pY-+sVc~p1lWWYncfsZBD zlLUulh#8ZKbJZaXx~7T%9*9kCI?ptUWNtB6zk6wB?Esa@U>adq3-GJsAap@@buxd8 zEh*0kH65g*0pwfcCE82`98Gls@jB5(U`@lWMLxq4sPDlmq!Rv*Vp(zSX$437XGBPqZRXNva3-1V4LK`FF19js@6mZK*48gf-Z-ZNB zLM=}?fKd18YCyN<3I%#wqeFjR9^PLn0C|nbyn1-&Ph!re@O0EEp`97_ouN^T>luaA zQbRd68s2B-M1Q}bL`59M`{jC(<_`P4m+_LOgr`2Gt(Rm4y+wDaGcvik0$;t-0c3C{ zKhx0TB~7CpakFn?r9>!&+;ccIO!hd{$-sX1k+O&#=VmV@?^gOz?c=kZ*8x}L)H)dP zYzhfqNU`(IVUtd)A!)GN@5UL@&OX&+@1C?lb`+!>)>=w1JnE$X>Lw#Yjk7&t)#5>X#Cjs|&jQ!X46aWn?QOjkKm*1G ztbhAifM)AKF=tIbp&vSIPqX&9FQ`BEN|??$UXR)85VQkj*P`!)ht-9)fQ|t&EI}c) zY_Dp0Km2C(q8potDF7er6kZ;VOs*dAVznYFU=Tj)$Gq2%pheYQJdTMt)xV?d0aA0f zf!9BB;E?X!!FWTWHx>8q_1{a`32+aVn2QqF4@>>wO;ea#m&96EhNkjIR(#vwq%yr` zfH0w))fHpM%M^W;nW$_)tb@EVVvhrYi*g_wUlF^|U`HFf<~&JOeBOMX&56=R~^VwL+|j!Ca?>Tx==&$#g^C#2+mS?tyG29g?7BC;5|* zhNhNJ?*-LgdlM)3Jx?L+w7;FK4mFXC;;XzQ429NM`AD>QNUJVX`T3s9}m~hbK7csE0P(!l|C~FWjU=g#?C}12ipKQAA~kz3%msO zg2N0*dRqd|SG=WcPVM-2UAcd>w1y8d%zsl=9Z^nq83TK_9xPH=!{}}AuqY7aaFPnP l;BjQ_^4`vQQuBMqxOYB4T*@HG=I>V@U~v|0R%wcf{y%IJ0Z9M= literal 0 HcmV?d00001 diff --git a/Content/themes/base/images/ui-icons_2e83ff_256x240.png b/Content/themes/base/images/ui-icons_2e83ff_256x240.png new file mode 100644 index 0000000000000000000000000000000000000000..45e8928e5284adacea3f9ec07b9b50667d2ac65f GIT binary patch literal 4369 zcmd^?`8O2)_s3^phOrG}UnfiUEn8(9QW1?MNkxXVDEpFin2{xWrLx5kBC;k~GmFhwsn)TR1w<4t)tA3_robX4CdCOHJC|7j+vW z%J-EMX&`87enIluaSc0_SnYUx$GzUc?vrNXt&I`o?~7C3RJ>C-Ajq!3AfU8Dx90^_ zp3}MKjJzYC+`T(&egFXQ#9Ek{*oVAaa!zrZtmlRFnwQPRJXH<%pkK2*eP`pT=lwD7 zifq+4BY_rUTa+U|2#&?i7>PVvD?7R4ZfOLPT{e9G~G!Ls3s8JtQE`jMM9wl2V9&Q+K2DHW0M+uQmEr%nYJ^7cK?uIpU-)=wn71ZZ-=@ar0;3^AY z5+TI{2b(e%t{2PZ^HKF*vu@+Xr&BAc@2BC4 z_vCgww#i=)ea5Vo$glEEVBBg_VPBj!)OO>)f@}#dg6ULOeC>LBHz<;*5Y;YfE0lNx zg{N+4@lO~ozxpF69qV@VOGnc248Iuag4C1T)P^(hWkpP!{h!JekX}m^Q#b2B4f1oT zIjsGz)4}-$rQ*-tSuc%qG>%<4xM#E& zN)7lRK~^2VdiloY4>;#}A!yHOAXEmEi^+eA#05pawGXs>!z)gSoDuI#>bRCq-qjJe zZ)r=A`*EMX6+)~er1kdv1L^)0-PsAEM7JF$O6G8>496$24lkOSR^RTfUuIz%iSfn5b-t!##cs7sQI);gdAvqmn_v|%I9k;fCPl0Z)R1+hNQONJN zH%3jT9sOq*a`LF*MiY=zlSSQZ;{_FL9M07A=In+O!~wR}=bzGEQpk2!Vc0p)qKAH? zOk{(%06W#)DdICQ_S%Q@<0Y+!?9%#$gWJ%)EO->^YZP{<`oB4~9xh zL9-0*c4@B#O2ylYs_g`Ky$zb~v!M`NRaMNFYF*Gsu|7)=JyyMHjFC=HhGUE@{aI|B zJ~ITXU052%7jFb5Ys#fhS_?4kqc7H0EU49B8(Chg0&JzU=Gka#xOz1)H0d4m7ZnRA z=M^tdY|U6T!fmte{W?_r8H~qdq|q{5AMU_2It1I4143n~xL?4&K#BOB48l9_Rdm!(c^C?JU;tF0 zEh@o1y6Qa_>}#AwX{VY+`C^kNkxhgb1P5cB0%xupAXyg9NO=SnXrJUE?rQg{Lcsn+ zAZKctGLfbK_B#^&Nev|0^fB&?DN=ak8|0!np524LD25=s84BP8Vl(3=jflNp{X>e@ z637Ri5xx;&JNl+XYImA|{;XR~P*svYDEWYJ6I5!6uO~2twFC1ZQevB7#3z~(apxn& z^J@>Mc`>PJair{yT`iuan-V+i%|Ho-pA<1?V-k^R2Q<5;Co%XxmL` z018t4T0TTwO^w)Gx{9OSJ^9_|kgwX`7%0Rw!PO~@?xvnfUehvN;2Rc;^l>3kfbtk3 z8{j7p;S&{uTlTe9&HTc38q@%_KQFk<&n{vmrN7y&Cz{etcE->rq!6HL)2F!aa=0%! zM%Bwo!7TQ5t;@a_#Q}sjk{UebWQZ8{cp&HN^$*JfH#8spkhk{R@CVBiPuP@yEhu{} zsQfuhTqV%rioATpEphMfhyRYbVfVW`YwLFXUWm-===J(byMf!5;W^CV1g~2194Xx) zFK|z{pm%n-)-DRe{Qhk(d!QaoI*y%Wn6h7<6A{i*Sob&B^y|Spg!&J$`kN>zwUJ3x zaB$ciu*0FJKg}T ztgnh)ASF8njz5>h6?f#{c=*Yr4W_34$GmVIo8OLWjcZK4a0`+Yv-!*}9 zBwKm;DAsA(nDI-`iH@;`=gP+m{lgFLHK3m$W@?)&dGhDA_Z2xOzI0$p(ZJtH$vCxE zj>+kYNBJzs-TlSx!tSH}%I9fQv)mc!C7X0bKlZv4f&}C3+O-4k7AmVO|KYZ9ydP%(N1^uisV8y;~p`x4qFXD?!_OyN9=w(Od6W; zGrT?G;l2v@Ob5k^8w<9w%Jbjb^|H}PYKo}I~bobd!XrTbzp2Zp~H8lgJ)I3?l&(bDiWf8gE&6b z>)9GB=Iu-6%I((+>=jGP>CzD8c0oWITFZGgM!Q7|JrUYq4#^Y(vuDu-a>OWDa4Y4} z5a_*lW#IL_aVf8L+Ty}c&2VojLEIA-;eQK6Wo?xAuK>i;1VWx3c=!s2;j_*iRHOsb*>6-CgcYP+Ho=L@XLd*j~2ln-;WHg)|cCixksH$K={5rGSD@yB%LI|(NCc8 z1Er8H+QO)~S~K{g?nH|2dB8SKs)BxQ?%G}}o*LV!NG2m*TmR|pWj~g`>)ClJCE#F$ zcj)fBg(dKOKmc$Cy}IRlasngIR>z~kP&WW~9cC951{AKmnZ~ZMsqup6QQf7J0T1;C zK9*Qd5*(HxW=tl|RfjO>nkoW#AU3t>JkuzWxy4-l?xmTv15_r1X@p@dz^{&j&;{Mq z$^0$0q&y?kbdZh)kZ+NfXfqLTG}Q^j>qHlUH4VEK`3y^-z6Y<6O88Hf4v^;}!{t-a zDWg;znYu%6zA1~A5~w?fxO~i8-Ib(^02{c4pXjhDI^2 zXB1LP4dvWuc%PXQ{r!d#6>${rm+M8EJM8yf#!H$Kp8AxwUXm5`7Tu-J$mHeCG>vw|&Ay415}_1w&*9K8+2d3v1N+@a$|820o4u60Tj@u&kI!~q2V9X; z>tMvQDI|O$#m+m2O**ZHq`_{#8)ry6`&5s~2k{O4Du16Fn0P;&_(0!e5%Bel){nU0 zJX~<8U6hoI%yx}qGY_1Tq7YKDJ)ETOCs&W)TiCrK*1%DE*vXdD-7hwE*LUgjeHRM` z&@pkhTi>m#Kc+QIK+2Ybn9-sFVKNHyIgfob4H_77yYh))Rq$7Pw|+aD6&yZ|ki9 z8Zb6s{oBt1G+PgfIcxd}{m@~1nzhe;LH)5;!gS8@ddyabpdBc?7JVl?tS+<#bPSMT z2@0uYdsWN(;Ww)n-PlA-0r+62@bYkEa`k{0s})fJgYZ#5=DmIdEvok7aZJRi{w-|} zkea&6X}ZA3b7&vbDb7)v8CuI(+zzSf3z&P2eOrPNP?D~ zf zn0@)0h;~5F&BG5vOFU!=woW&ZSl~nrs{?1w>nWfW_dnpTd z4qvLDYJ*ft>Sp%M(^_xCZpNBnc66JX}A|ZL9IENM`U>`ph7d<+RQiI}@E8Y)70s zMC*_&))}GlmR}@{v9*nm)29-=rn`Q$rc^4G)GVQHlTr6BpGxtHuU(8AF7Ffh54?5w zj+EYT9>x)PWL-iQ@RNmT?R+|c@=FOmj)5Za6_ z@DkVy4l^L>Z3#SI@s_eVwd3D)<^Ivq8a~J{|4mhOL^<7M4D8){ut;GIqqn`oqCk|x pNh;Wa$C0(mdpqYz&F>xK-uVD=DT5%Jzh8ZT#aXmjr70%*{{S|9XD$E$ literal 0 HcmV?d00001 diff --git a/Content/themes/base/images/ui-icons_454545_256x240.png b/Content/themes/base/images/ui-icons_454545_256x240.png new file mode 100644 index 0000000000000000000000000000000000000000..7ec70d11bfb2f77374dfd00ef61ba0c3647b5a0c GIT binary patch literal 4369 zcmd^?`8yPD_s3^phOrG}UnfiUEn8(9QW1?MNkxXVDEpFin2{xWrLx5kBC;k~GmI3`<(O3xvulR&VAkQJHZBho(m=l0{{SA7UpJl008iB z3RqC-Ajq!3AfU8Dx90^_p3}MK zjJzYC+`T(&egFXQ#9Ek{*oVAaa!zrZtmlRFnwQPRJXH<%pkK2*eP`pT=lwD7ifq+4 zBY_rUTa+U|2#&?i7>PVvD?7R4ZfOLPT{e9G~G!Ls3s8JtQE`jMM9wl2V9&Q+K2DHW0M+uQmEr%nYJ^7cK?uIpU-)=wn71ZZ-=@ar0;3^AY5+TI{ z2b(e%t{2PZ^HKF*vu@+Xr&BAc@2BC4_vCgw zw#i=)ea5Vo$glEEVBBg_VPBj!)OO>)f@}#dg6ULOeC>LBHz<;*5Y;YfE0lNxg{N+4 z@lO~ozxpF69qV@VOGnc248Iuag4C1T)P^(hWkpP!{h!JekX}m^Q#b2B0{OYr9M*o< z>EL{WQt@Z+Ea-hxX0}nTSZxnpi^#Kn8Ox8FgIS|hc}KJQ4tm*HO16ui{(O9}1YN)G zjiQt6fGq`Cj+^`zUf?8hk^(T{{cOQGWFP98am}is28A!5%{R#ENv8fCN!j69lMEK(2z?|BY=Je$XD9mB-Kkem*(d-j^9j$2#6r$Dz?s)-TCDCGCs8>6Pv zj{Y+YIeFA@qY22V$)awy@q!9A4rgk5b9TcC;s9Ig^G|6nDP+5=Fzg&?(L=vcCbGd> zfSu~@6!94td+o#d@sid!EIX$rx7*cawe6`dScJ z+$HssdOjE)O#Ybs56vm-FQ$7yuJJD^Zqk%hMaIgAJ<2yb_MFQte_i;62ScT$pjifY zyR_E=rQ+>H)pmlr-Udzg*-!|ssw(D7wJvC+Sf8bb9;;q8#z?0p!!bsd{wy|5pBaMH zE-Ve>i#LLjHRaMLtp%9&(HCng7Sw96jVv!#0k%?F^K7&=T)mnYn)D9(i;4x5^NJTJ zwq~pv;kH@#ejTd*48~(J(r6j34|m`h9fEDj0im)~+%I5XphWymhT;_Zty|Q&zjPg# z-ufAHZ1M*Gccw?Kf|8Pnhtb0`!{N`Bqsa37J+>wC$!e00k+2 zEgzz;rbcWoUB%Jvp8W1}$XD%e3>4y;;OZ1ccT-O#uW6Ys@C}Pa`nZrNKzR(24e%3) z@QI4SE&E!lW`5y14QhbepBG%_XBV-O(%5tj)@9#|;sC-MNev!zGDHk}JdpGC`iJF#8=8-P$Xoku_=Dw%Cv3{U7L>gfRQ?<$ zt`cZ*MP5GQmbmx#!++P@u>0MewRO9GFGS{b^m_fJ-N0?j@EqoFf>$khj+E|@7r3We z&^tR^YZrxKe*d22agXqCO0l44&kqCv{u)T|(lv`~PK@DvE{QI_T zlCH5z*gR!>LO)k67{^R+vWx24U2^2ODXpwT;6y+6+$5m)_*w4WY&#do9dCeE)>p+Y zkdhq($DhmMiaYXey!_kiL26uz($aJ!QT{B^Wu}U$^9e#5)=c+XF9@Ill?ZmMlNgHi zz*9!vDc&uxOo;ZVxb`Q!Sk0*gnfxWzmbZh4(=%CD%qP?0=);n$&zaW_$UKV98axdc zN#AyZ{P)wj?V{P}vM)YY!>6@}^>U+iv$`9>nMTCPjN>z%yF&3yf%>+T@0vh4lC8Xa z6zeo?%=o3}M8{aebLHcO{^1Ar8qiM=Gquf?Jo)q5`-+?sUpg?QXyEUpWSm+n$K-Uy zqkIwHLquru~o(OF)hhz$Y*|X>ZIbswnxRvr~2=rdO zGVuD|xRlpAZE<0!X1F(%Anpl^@V^D3vbM}qxe|NI;TTiZy7(IM;R69RkA>a&6gwYE z2sREzQ_LHmWqB+ogMk(fMaSFeoDq-!HkFB_nXt5+2ncFuk9BQL1I&oB1zZi)YW{6_ z&-Ip1l*OVRA##1ILQS;5R{-K^0wGTiJbVSi@LA^$D$;@J>^G{6@&+%4{b3(sC~LEH ziTv(0b#zxt?YJ0r_~pUZM~mQ(??(n#>&tD%+@nq=Abj5*8R!~Ul1`G~=qFJ4fl|m8 zZDCYgtr`4LcOpgiJYX9qRY5;DcWti~PmS$VB$E-Zt^f4)vLDOe_3XTq5^ylWJ9PKm z!V-8sAOJXnUfuFNIf0R9tK-pNs2hO04zr620}5B(Ok>yB)Of-3sP59qfQNbmA4{w! z2@cB;GbR(~szVrbO%(w=5S!X`o@o@x++wbN_tMPT0Vc)*I;Fgsbf^*g02Di?H zTApwKq3+YwfNsqd3iP%{hyK1iyuVZc@*0tO_3+N0#GFsz>8MjeJ2UJ%L!%hiGYYAt zhH`E+ywA*u{(eJ=ia3h*%k?779rk-K<0VZAPkl;TFUbmei|$fqWO8!_zIvqt$ly$V zrlH46nnpX~X5Yk0iBJl;=WuA4>~X4-f&K0yWf42h&0b30t@NYX$7egQ1Fp!abui-D z6cWCWV&|R1CY@G8(qOmWjWeX3eX7UggZPGimA}soOuQdXe4uZ#2>5zN>qlI09xk}l zE=tNpX1m6*nFr2EQ3xs79!^sCldDJYE$m(qYv3q7>}1R7?iZW7>$~*%zKaC|=$N?M zE$>#+%T&MZC`dW1wUl6Z)JgxkeN920S>e@EK`q~>k| zuYcsgA>F%!@rFciD(>Iwzn8KT;2tb77bUPCmioh+rZBfIiM6f_P34cQ__o1GWqQp3 zVL~~pE5?qODf%iiQQ3f42YF@09tQ*$4v_EKUx;t1KCPCBtgqg@+Tn; zO)a0uky_%jm+WjNB?=~VyH>V#L!*=l*@OSMSVyt_UEH&NA=?V2stHPyKkVN!&jg<#cjros){#ji)dK%)We0 zL_478=HZ8-@xnwsKrWs8)x`MB;(Y`Cmu2c-&SH(vN-F(*e`l?c%+l$|y_AJJhcDGn zwLvN+bu;_sX|1AiePhx@u&%P$hf*xE+O=~D?_(_KGWQ!158YL-y9$*6mmPo;Rp*Dl5lm-mVM2i`h-M@nxv z590_tvMwPD_{l=b$iOm|+|S{D9&P%zeT$GgX6Akl-tfUF>tL@Ld!B&{pN39tH>3V> zqksMAYul+jb7UiouWVGPNsxX7Ueba+9|~dz?d*QM$ng0DZfO0`7fAy?2yMm|cnRzU zhZ&IcwgjH9cuU!w+VStYa{p*)4IgBf|E8)sqMYtB2KH_}SfsFq(c9i(Q6S3UBo%DI k*Kv;w;*%(i9W@fAqs5i2wiq literal 0 HcmV?d00001 diff --git a/Content/themes/base/images/ui-icons_888888_256x240.png b/Content/themes/base/images/ui-icons_888888_256x240.png new file mode 100644 index 0000000000000000000000000000000000000000..5ba708c39172a69e069136bd1309c4322c61f571 GIT binary patch literal 4369 zcmd^?`8yPD_s3^phOrG}UnfiUEn8(9QW1?MNkxXVDEpFin2{xWrLx5kBC;k~GmI3`<(O3xvulR&VAkQJHZBho(m=l0{{SA7UpJl008iB z3RqU$@Wfh}nb?QCTyjovo2=)B^qQB=#XMCF_n=?1Jbh>5sptJM?}}{I zHzR=-V_TFXKM0P+&lrh3TPr)c<8EmLl3g~EY}W@od*0X6Ljv>L(67bjz58EDypsu&ddu2a@@x)`5aA^S^DxkW8rs_vKtu8N8(o0 z#Nf}*Ch4&iw866BiW!_r4*HRsHn%80xlBW<`IOcXDu%LQam7$Ge$q#1415XvN>cnS zk_qU%P}4fO0v>J{Zw9o*)JF-CPA!KcpFR1Pn(l@*bKh=1_!ZRWb?FoG5a22cVG<$5 z0|%Qj7p@n}=Hrkk`BkD99I57h7_+lQ-AZ-?fETz5E~q(= z!!d%~_yivn82d_pX#M+Y`|`-F^s6-{6}S!?_mFzr<=n>M{{PUq7g-N`hqOcY-y_m= zc#xZEqMPgqc5cu{ag@Tdli5@JlV{xH8J%TA}P<$=Qej`5Hq>_Gzk+NDFM{b*SA6Yydp9VOs1VgIYAcj@1BIt< zXz@=NF2DLCC>`r|^h-z5@eIEh>Vnjh+|-6M@nuC!oc*856_8#_6jL|rKLYu=)Ew4+ z*XiJVgHrKl?=0wjQ)aeNu2^jkUW>@Hei_S;nuA%RRe49V`VM;8SxUBxpZPe>l9ZA{YS(NU; zhnP(vSd1kYiV^KQ02>XpH6u}Xk)wrk`+SxNxC73cSAefm+V!<`c^b#A9NaTn45bEq zkRYp$U%h-|^9P*syb!eKG!QC-$;IS9MdE^@-`WRSzTp+8M9zqJCUsoPC-3Tr+qbkO z$o;ra-wGjC64H8m{(*FVitg+LQKH+96D4!FREFb|Scex)lw()`rHV$WMdUJNe3E}`->+?@(FDYcZt1#>wXwgHzQ6{p% zTY#PF?iBGE7<=u*`SFt0Lw0HX!oh85UlzQH{;k~&JH?kPJzdQX=gAmX40n@#()wBu zSllJ`lX^ZF9!&n2{1443>o2BzK(6sGDQ?n~RYk_ih&{?TJNBH*Eq`73g$F~WrJz{` zce}LL0;S^ZMb&nKyWR#(_t{VguBs~LOSLX&q*$M&haRh5HO5G%C&MvDmi{a@PM;Zq z)h;XzD;Cshu#GG)RsptBTJvnQHC(-#7@G7B`iqJMl=F%g zD7I#-8sWBC_kJC!{tU)rGSX-nt`B$M86ARc$^oIWRNOCMU!X+%PKM$X`mI~kxxaKB znBMvsb8nZ)0}JBmidn3FUeG@ZcdpwZy_4oi*b{&c?T^HaVC|`tnlo?1SjRKLNPk{gDWT+_1fio|Ic{5kU=X{rvm3 zZIZ6BO4vMQdqO`~Ef~j4Z?cQ(+Ff$wxGAlyMBqd}_S__(_xM@v-fTM;$Q^HhR@PU= zE|8KP1IM4s;)*-+Z@m25>p^N(PgHJsq+a!8`ezsTQ3Np0+k4Mtdkgu z^}tg`-YMQKuuO>dsJQkgyjabt1)2OM)|R(}hto4zSIj5V;^@PYtIwI&4#+%;&Kf)o z7)jrDgZ%f?x$UCa=&~<9SHq{ZhxKx!b+ft~!I?(H$&BMOox4KuOo95gl<%5AIg+is zd=%?6ZOr(k=S0U?!*k{1h5q3O_ZrYo5Hq#Sl|1?L+WU%}6JI(orD)*qq-300E63z? z#iM){^ff?RwehBsE3Uh)}m z74!C`a^?2x1@?-i<#cI?a=RcP4Xx$88l&B!g`Nm)Fo$Fcf!VX@0y$z7EVz~OXbALP zyfX0m-nf+4I&E=bsAjk~l_2g3i}1e%qO!KkQ@Ij*%HbGO)w=i^^5FvkHIIee`4l@J zN(eR%MpMiipJjP0Cxd|&4n@b?>6{Ue05+A0q?xd^oCpYNXpePmO#{q`vISfX)oT82 zc+d5gPn5-?9wBmlt3pk*z*hj`X#ycn4?KJY!|++>4l2@t>FhVEjPeFAhW%k5Vkm2~ zbcy`#HFb1XOYOKAcKGGN*GG%skMBnYSL@4d#@wS$CLny@9vSEwSCUSW;OHk%_<>T$ z7HwfvT&)@WQFkIm_dH-5Csjc|H+OBX6;F-rR3wuTudV;|_Oc(#-}UUgloD_-!aH>L z-NF)hJ|F-%gI?Y8Jvo7qXRG7UV5l2_yAHF93IhsP-b`cH*wlEz^Qi99$$*D?10PGQ zCkYPA5Hltd=c+>(bWIfjJP@1Obe?Gx$=qVDe)rPM+5sw)!8F3K7T{OMLFj_+>SX>F zTT-48YC1?q1IV|?OSG8?IGXAN;&q~nz?z0#i+qM9P~U@BNG1FyO9#kvk>T>G=#)_^ zj!fMlH{X;+ONmr!LsJx(j*b2&WMpJ+s&cN;7Tyu8gf>RT2kOR+DBzZr7=m-v-UheM zgj$|(0HN;F)qrlz6$FyVsy6e02`M!$<1L&Bz z+b!=_(#ur8?I=h&thJP2c+^S%)lEi*8fSaPs>Or&i1kF^p9QX&8C;)E+S__7fCh{W zSpW930L|8eV$Pa=LO*oao@VWHUr>MSl`x%iydJaFA!rB6u0`Jo5337p0UZNmSb{=o z*%W(>6W|^!F&8DUAC~&Vo2D?gE{V0S3{B;atoXLUNo9J? z0AWHot1HHimnr%xGf~-qSOO6>z*MtHe(EIN3<7@k-U&gFD+Xq}Ua*o~(!1kApC zO+-7O=jP#uq4B~*JwPs<`_;tw%;J3m{g-9xU(RBU&q^x&eSc@Ik<8NR$i0+>JBKgT zPqjfRC3Q3V=4q|BVK-yVuyUMByvXqR1a4^k&=*MqJ_v2b7I+El z1&0}s^tJ?^uXsz@oZ9j4x^n+$X$>D_nE$4#I-;EJG6wc;Jy@i$hSA&JVNoE;;UpDo l!Q;r<<-MKrq~`aIaqoP9xRgPV&EKy+z~U_0tkM({{ePlYU?u&Z`mr_kcwz5Nh&g=McJ3E!;CE1E0ryV5Ro;>nvty8 zA{omJnn+{p4952Let*87zvA;auXFF~{<`_uPA4&sV%P>LMpp1PTBEIL*yWZ2%{t3Pe;FXZ3XmxI8(D_g57_$Zil~sY6d4T}-hu9_Wqp4C0AMO{-e2$W~1A}=8 z?24)=?B)4HUDo_oXckN%okP)HFJjaB4*3_SNpKaf;yPT}KqfS{2x7`d{0xbPErH%h zh`mQJ03DaATP9aP!}a4$fY#``NI~M6&RljED)8z}hhWxrNbxIBlTxG^j z!X>$3AQQ&I%_5mRECOjaGwR-GHmde})^)t-3_~aFM1G_L#mpCNdcLqr(RKjv3R}(z zG2^yBftMYh;H3a#-slaj|5$BX9+{PTv&NtR*P-L?l21FGTG`$H9~##p%VE!uR>=NG zc&auxVl!1_lP%uX71AJvlz(wLYl?63oLd~dqjZRrU#UEWw8J6Yn-7L~T$$tjeAQiW z9$XG5Hu>rxFBnzgd6ho#^gE5pY>U$dTCRN85Y1tQQ0=Pn{?7OJ10x9Xk!>P2f(f^f zILd}5--N;Po4*25F|J3ywIv+R@rfcYNj}R-sXrH2TFAiK{jFGG(ru1p=w$wR;IXQwAX*S~oiEK{g;kZPW;YE|!QY|g^2`dMS{&1Fr zkf?!sj~m)xO3v`hh4KQRJ&&Q!=X1HNq8T_Sg2P^B&rZX{VQUNc9O(K+B_Z4hiTH7M zW7K5Y!Ec5xD~B9zFlKUWG_Rd)xTK7U#hRGhp51T++e6oS{gT^?3s~>V4?6{zchhc_ z3UBb_W2U+~guMsG-g=@#aWPSFypk)5jIUTxFiM zycGZzbxQuCTnvH*kv=E=LsRnltLbhgm$=ttS1IzU0)1t~4(XE>bHVwJpAPKOqoI-# zrdc{yo0R7Qx%~ZQl{UPa?gmxo#ZWM|vNHNxl@8NLksfn5Ek>C${w=x~pekl%gfwaLwWspL{af)?f zTOBmhTyU&3;}QeF&VLwhJ>Dezu>~P zc+$aFxKDWKj-CmD(v`}uH|ts*SefX@lyrc<%~WE6tHU#dv;y+LlA@cTgl8J!u@@u6 z@@fvJdC)1TvBa$QT@ck`rUxF**7w4Yh0!vZUsGu%Lm(cl(l#QPpmoOH3JC>FMe07G zq0kl#K+GLndyoOx8{t9g8JiLs#`pH8JWqR_ZM%J!Yr>cp>95<^#=FWQfzPm%q;5B+ z0>}ul8+l+gRaHV$$tsq5|MU;?AJ~m-XNxjW3U6JH2k`tOXAqi)yGI@^uA&dQ% zZCJIe7{qK>+p_F)Sqy-GC!x-5MgogsP6lwiUH`N^a7*LKPdO{!4L^_^;goe*e}3s( z0i~~@V#)#L*W~2F?}&N*IQ)0a4Z1$uTU)p7^Mq&IM6K6d*$vpX2+L*+$9vY0=7?$b zxdD4R`8~74HMWsx#*goNSp#(_;z`UT-GuGxoUl-){JNk1rf)aSKE!W`#m`t#v6V!u zgn>fufpkVprL(KqSkhl*Z+yRQosF)bEiV<#K8hOr>yQ1@7Xg>g3EjKwLB7)(9$3%X z$G30OD&Z2Nh{;v5!}oF4fUu0TM%&2F-6aS1+fqu3cn;K4k4-#kkB|BO?bZtcTygp+ zB|R0)0x`)UVEm;Fwx~Vt*6ZV3k5Xcj6_=(X2y*8M&NGz^?Jr>Jutu8idcHpesED^^ znM9MV2AcX%oppm45TS9yYBtteX?1liAe($}l8Mrk|YY*cFUp@Yl5_|Ih%+ z5^dz*^BpQ&l8;Le-Z+E?J1_|}dtK>`0HCSg@u z*e9pUpX4zkcJ~*%3c8N=D_*8f&2puu6>riMeA#MG3E+*kYt|0Dnl;U^u0x`IJLnY* zjELAyFaL6=ihd=uwgnc)F;a_ZKEBsA_UuVc$NS1$GwozcE)2-hGS_c!*V9@%u`#?lhbMR;p$MXpbUS7*AsAt5?3(xQtcatZ zK;B-KhX__vb(?F4Q0GloBJ>|QvdJoM?lDbgsR3iM@a;Z3?cA&4wtslYkr80ETZHkc z9*>q7Q7<0~XHK7PK#yo@cBi@smopq(-%`e-KH4Qx-~rbHu}dW58QqJ{;3Inef@=x4 zI)BgQYXff|j7xg1Qx_M8s)u`0@M0d&aKAfD6qe?B3THxh84PWrQX5xII()>h>b|f$ zpKR+*4#vbnsS3H{v&>IrrO}Xrp{O`p?Q{I%z{XPHRAc7mQ~rVVZ80t_sel;~R{!fE znoWNU9=P1`jx=A?#Ye1fm8**6`|yK3jKQSofyZy4XkM$FK?NExjqO&YVea7N(7$X$ zbR{k3PT@a2CJt_@Dead-55GO?f3gVr{BdM(wXV#1%q{YCJlyB~k-m;m1@SZyhI$5p z9ViBGQ5QzVRGUDbbtaN^E&{f(lI64ub2s){aFm!11riDV*6MFh58H{nU5}0{$^Hi; zJVW(-UYp)>>|Lx|%+y^DwKhz`tPS-85#6Rh0)ckL)U$^na{7 z@VVG(5^ui@Hf1odF537(mlR>ZBhjf%rT+ zPUdZ~CgvIZM_wUkJAw%w}x9jc8!TL)0!EfOi*AMUgP00QdmWDhdxHH4HGc<~J zIVYb|Vj$~E#d*)1>gzKQFOMaAy}BVVo}IK&7ZMB zx!9l*+ek@g>FsKVCTu!A+bt50<5zR%LvhtB47 zphLoLmz-;H4@2#)g8=!k#zLI#UMqFnH)&}~tj#&gW_Q99mQw+L7dU5Tu)W%;@9Qi9 z>QGi--TSZnR2z4)8B5wJy^vu$s+IRc0ll#|LNt!?I`me%fGty24eDN4Xl+O{(+NPj z1ygVh>zf*$Pk&fEX-3AP^1w$s1y_e7lBxzgSu6?iXt=l939t1dNMV&Hw?hI}<+!vx zKuXRw@aAWBEW)iT2xma>qG11B|GnfLf43m`S%SD z3d3^-2o=m;T`_XFO4d`JiOd4T*vl!w_t?SMNPGOr712xew$!m3PP4`3g2iVGiU!9* z&w=GY2O}!evGB%RQa5rA7s5%`YA&A$+(`a%B< z)4%^Wyf-xKA)KjJ=y>(k$Cki3nVk)wxAEYIGA3p>sG^i;f$cIw3$H&^I7dNHU=sw$d)j7 zh|(sSuhT>1EWU{wVQLz{XV1iYPIvxnNv=>Vu3kdkB_SVNJ(KJiSF;#9T-Gc6A9!kU z?a4i1-1H;R$hx=;;1@G7Jsm?|a=U>2b+qZz`aN9sgsIyFSp6r%%!9oq%tbmjY#K7P z-Gux{jUMaKw>DF`W{3tTZ|SIDqX6v)w4@1rITXmow6pv9GTr+NsJ`V>Zv++iD5MFK z@5#Rx6sk|u-Qs__;w5Q)X2-Ad+QXxzHC&)U-n+`G@G_e77|5&TV3EucN^AXqK{AmK pCn+FvZU>f5ukGw-)qi%3dglGbB=rNWkH7i=^YbXv3KMkH{{f&jC-?vW literal 0 HcmV?d00001 diff --git a/Content/themes/base/jquery-ui.css b/Content/themes/base/jquery-ui.css new file mode 100644 index 0000000..3f58908 --- /dev/null +++ b/Content/themes/base/jquery-ui.css @@ -0,0 +1,464 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.progressbar.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.slider.css, jquery.ui.tabs.css, jquery.ui.theme.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:before, .ui-helper-clearfix:after { content: ""; display: table; } +.ui-helper-clearfix:after { clear: both; } +.ui-helper-clearfix { zoom: 1; } +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } + +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.24 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} + +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ + +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +} +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } + +.ui-progressbar { height:2em; text-align: left; overflow: hidden; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;} +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } + +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; } +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } +.ui-widget-content a { color: #222222/*{fcContent}*/; } +.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } +.ui-widget-header a { color: #222222/*{fcHeader}*/; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -khtml-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -khtml-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } +.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -khtml-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; } \ No newline at end of file diff --git a/Content/themes/base/jquery.ui.accordion.css b/Content/themes/base/jquery.ui.accordion.css new file mode 100644 index 0000000..a3ae969 --- /dev/null +++ b/Content/themes/base/jquery.ui.accordion.css @@ -0,0 +1,19 @@ +/*! + * jQuery UI Accordion 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } diff --git a/Content/themes/base/jquery.ui.all.css b/Content/themes/base/jquery.ui.all.css new file mode 100644 index 0000000..dd03bd7 --- /dev/null +++ b/Content/themes/base/jquery.ui.all.css @@ -0,0 +1,11 @@ +/*! + * jQuery UI CSS Framework 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming + */ +@import "jquery.ui.base.css"; +@import "jquery.ui.theme.css"; diff --git a/Content/themes/base/jquery.ui.autocomplete.css b/Content/themes/base/jquery.ui.autocomplete.css new file mode 100644 index 0000000..397ff64 --- /dev/null +++ b/Content/themes/base/jquery.ui.autocomplete.css @@ -0,0 +1,53 @@ +/*! + * jQuery UI Autocomplete 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.24 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} diff --git a/Content/themes/base/jquery.ui.base.css b/Content/themes/base/jquery.ui.base.css new file mode 100644 index 0000000..5d71682 --- /dev/null +++ b/Content/themes/base/jquery.ui.base.css @@ -0,0 +1,21 @@ +/*! + * jQuery UI CSS Framework 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming + */ +@import url("jquery.ui.core.css"); + +@import url("jquery.ui.accordion.css"); +@import url("jquery.ui.autocomplete.css"); +@import url("jquery.ui.button.css"); +@import url("jquery.ui.datepicker.css"); +@import url("jquery.ui.dialog.css"); +@import url("jquery.ui.progressbar.css"); +@import url("jquery.ui.resizable.css"); +@import url("jquery.ui.selectable.css"); +@import url("jquery.ui.slider.css"); +@import url("jquery.ui.tabs.css"); diff --git a/Content/themes/base/jquery.ui.button.css b/Content/themes/base/jquery.ui.button.css new file mode 100644 index 0000000..dd24f87 --- /dev/null +++ b/Content/themes/base/jquery.ui.button.css @@ -0,0 +1,38 @@ +/*! + * jQuery UI Button 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ diff --git a/Content/themes/base/jquery.ui.core.css b/Content/themes/base/jquery.ui.core.css new file mode 100644 index 0000000..03867e8 --- /dev/null +++ b/Content/themes/base/jquery.ui.core.css @@ -0,0 +1,38 @@ +/*! + * jQuery UI CSS Framework 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:before, .ui-helper-clearfix:after { content: ""; display: table; } +.ui-helper-clearfix:after { clear: both; } +.ui-helper-clearfix { zoom: 1; } +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } diff --git a/Content/themes/base/jquery.ui.datepicker.css b/Content/themes/base/jquery.ui.datepicker.css new file mode 100644 index 0000000..8e6223e --- /dev/null +++ b/Content/themes/base/jquery.ui.datepicker.css @@ -0,0 +1,66 @@ +/*! + * jQuery UI Datepicker 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +} \ No newline at end of file diff --git a/Content/themes/base/jquery.ui.dialog.css b/Content/themes/base/jquery.ui.dialog.css new file mode 100644 index 0000000..5460faf --- /dev/null +++ b/Content/themes/base/jquery.ui.dialog.css @@ -0,0 +1,21 @@ +/*! + * jQuery UI Dialog 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } diff --git a/Content/themes/base/jquery.ui.progressbar.css b/Content/themes/base/jquery.ui.progressbar.css new file mode 100644 index 0000000..3bc324d --- /dev/null +++ b/Content/themes/base/jquery.ui.progressbar.css @@ -0,0 +1,11 @@ +/*! + * jQuery UI Progressbar 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; overflow: hidden; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file diff --git a/Content/themes/base/jquery.ui.resizable.css b/Content/themes/base/jquery.ui.resizable.css new file mode 100644 index 0000000..4797f34 --- /dev/null +++ b/Content/themes/base/jquery.ui.resizable.css @@ -0,0 +1,20 @@ +/*! + * jQuery UI Resizable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;} \ No newline at end of file diff --git a/Content/themes/base/jquery.ui.selectable.css b/Content/themes/base/jquery.ui.selectable.css new file mode 100644 index 0000000..c9fb691 --- /dev/null +++ b/Content/themes/base/jquery.ui.selectable.css @@ -0,0 +1,10 @@ +/*! + * jQuery UI Selectable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } diff --git a/Content/themes/base/jquery.ui.slider.css b/Content/themes/base/jquery.ui.slider.css new file mode 100644 index 0000000..b35d87f --- /dev/null +++ b/Content/themes/base/jquery.ui.slider.css @@ -0,0 +1,24 @@ +/*! + * jQuery UI Slider 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; } \ No newline at end of file diff --git a/Content/themes/base/jquery.ui.tabs.css b/Content/themes/base/jquery.ui.tabs.css new file mode 100644 index 0000000..0405782 --- /dev/null +++ b/Content/themes/base/jquery.ui.tabs.css @@ -0,0 +1,18 @@ +/*! + * jQuery UI Tabs 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } diff --git a/Content/themes/base/jquery.ui.theme.css b/Content/themes/base/jquery.ui.theme.css new file mode 100644 index 0000000..6af77c1 --- /dev/null +++ b/Content/themes/base/jquery.ui.theme.css @@ -0,0 +1,247 @@ +/*! + * jQuery UI CSS Framework 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/ + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } +.ui-widget-content a { color: #222222/*{fcContent}*/; } +.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } +.ui-widget-header a { color: #222222/*{fcHeader}*/; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -khtml-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -khtml-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } +.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -khtml-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; } \ No newline at end of file diff --git a/Content/themes/base/minified/images/ui-bg_flat_0_aaaaaa_40x100.png b/Content/themes/base/minified/images/ui-bg_flat_0_aaaaaa_40x100.png new file mode 100644 index 0000000000000000000000000000000000000000..5b5dab2ab7b1c50dea9cfe73dc5a269a92d2d4b4 GIT binary patch literal 180 zcmeAS@N?(olHy`uVBq!ia0vp^8bF-F!3HG1q!d*FscKIb$B>N1x91EQ4=4yQ7#`R^ z$vje}bP0l+XkK DSH>_4 literal 0 HcmV?d00001 diff --git a/Content/themes/base/minified/images/ui-bg_flat_75_ffffff_40x100.png b/Content/themes/base/minified/images/ui-bg_flat_75_ffffff_40x100.png new file mode 100644 index 0000000000000000000000000000000000000000..ac8b229af950c29356abf64a6c4aa894575445f0 GIT binary patch literal 178 zcmeAS@N?(olHy`uVBq!ia0vp^8bF-F!3HG1q!d*FsY*{5$B>N1x91EQ4=4yQYz+E8 zPo9&<{J;c_6SHRil>2s{Zw^OT)6@jj2u|u!(plXsM>LJD`vD!n;OXk;vd$@?2>^GI BH@yG= literal 0 HcmV?d00001 diff --git a/Content/themes/base/minified/images/ui-bg_glass_55_fbf9ee_1x400.png b/Content/themes/base/minified/images/ui-bg_glass_55_fbf9ee_1x400.png new file mode 100644 index 0000000000000000000000000000000000000000..ad3d6346e00f246102f72f2e026ed0491988b394 GIT binary patch literal 120 zcmeAS@N?(olHy`uVBq!ia0vp^j6gJjgAK^akKnour0hLi978O6-<~(*I$*%ybaDOn z{W;e!B}_MSUQoPXhYd^Y6RUoS1yepnPx`2Kz)7OXQG!!=-jY=F+d2OOy?#DnJ32>z UEim$g7SJdLPgg&ebxsLQ09~*s;{X5v literal 0 HcmV?d00001 diff --git a/Content/themes/base/minified/images/ui-bg_glass_65_ffffff_1x400.png b/Content/themes/base/minified/images/ui-bg_glass_65_ffffff_1x400.png new file mode 100644 index 0000000000000000000000000000000000000000..42ccba269b6e91bef12ad0fa18be651b5ef0ee68 GIT binary patch literal 105 zcmeAS@N?(olHy`uVBq!ia0vp^j6gJjgAK^akKnouqzpV=978O6-=0?FV^9z|eBtf= z|7WztIJ;WT>{+tN>ySr~=F{k$>;_x^_y?afmf9pRKH0)6?eSP?3s5hEr>mdKI;Vst E0O;M1& literal 0 HcmV?d00001 diff --git a/Content/themes/base/minified/images/ui-bg_glass_75_dadada_1x400.png b/Content/themes/base/minified/images/ui-bg_glass_75_dadada_1x400.png new file mode 100644 index 0000000000000000000000000000000000000000..5a46b47cb16631068aee9e0bd61269fc4e95e5cd GIT binary patch literal 111 zcmeAS@N?(olHy`uVBq!ia0vp^j6gJjgAK^akKnouq|7{B978O6lPf+wIa#m9#>Unb zm^4K~wN3Zq+uP{vDV26o)#~38k_!`W=^oo1w6ixmPC4R1b Tyd6G3lNdZ*{an^LB{Ts5`idse literal 0 HcmV?d00001 diff --git a/Content/themes/base/minified/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/Content/themes/base/minified/images/ui-bg_highlight-soft_75_cccccc_1x100.png new file mode 100644 index 0000000000000000000000000000000000000000..7c9fa6c6edcfcdd3e5b77e6f547b719e6fc66e30 GIT binary patch literal 101 zcmeAS@N?(olHy`uVBq!ia0vp^j6j^i!3HGVb)pi0l#Zv1V~E7mI3`<(O3xvulR&VAkQJHZBho(m=l0{{SA7UpJl008iB z3Rqvn`1P1SiomLXkg776;)RSXXXV1Iqu_@e2%8dEPZ*NvG6-d*$oWlBXKKg zV({l@ll0gM+F;pm#SBg*2mQ!Rn_HBhT&5w_d`jyG6+_vuxMHXoKj|Yh2EGJ-B`N+E z$pmy>sA-*C0S`BfHv`&Y>Z626r?uZY8?`zzbXj7u1}` z;TS<~e1eY(jD4j)wElgyeR*V7`qdhf3S5Vcdq_R*a&F^r|9|M*i>!yeL)xMH?-6M_ zJjl&7(M|RQJ2z;fI7;E!$?Pfq$usWpjLxzlazT~K6v`ft@@P32;&o$5@b}Yj#d~r) z9^2%vhdyIgOXOGiCNOR_sjx3j8*01pUqQBn7r}I@E53HUy&DusRETO9wG~Rdfx=Ta zwD>0smtXx6l#X>f`lTc3c!pmLbwTP$Zfe7s__87<&i+s33P`Udim99RAA$T_Y7T3^ z>vV9wL8Sc0x! z_eRl4cEFZ`EXPfL3omdIIY|MS@P4-79I_Af%(!ONP=msk&*mFs^(0gOj->4HEJ}Ca zL(HZSEXEQH#fbJDfQ^RQnvtlx$kD>NeLhPB+yUp!E5O$&?fP1}JdI;l4(=H(hEfAQ zNRU;>uU@{f`2)^*UI^NA8VHraDlXrE*?OWOs z7D#P(ftiy|@ab?=t923@#mR}=S6GNj1 z?mTR4hby}vE*2>Wg7-X!KAz3vwvJ)qVMtB~**$wrQ^&0>;8UR6E7imZV-)iH?Tt~> zX-EGVhMYWVxX}dU)MQaN+jv0*8;3JBy*az#1aW|^_4%i?mlU$yRTy>-wCJJVC==P> zEx=B7cZ&E7jJ@{Z{CG+0A-lAG;ovs3FALs8|JLq?o#M-to~~wx^JI)GhP%l=X?-mS zEbfx}Nj)D74<>(1{)gt2^%v7UAlLYp6gO$gsv=`$#2)3F9ed8@mcK6i!h@mGQqU}e zyItCAfl~4IqG~(AU2lV?`)nu#S5+1BrCJv>QmoI?LyuLj8e^o>li?U6OMey{r_T(* zY8RG<@x>cK$(nNMlhy)E`{;|c6$@%L*hZEYs{mUmt$8-u8m?YV3{83m{YAwB%6Y{L z6k9V^jd0tnd%q4+xwp&Yfr#>WqoooH9K5xYM|V_s8{16~N?TcuYd@6+y1_aS;c{q^(Kyv6DZcFd zd@RkCqyC{5yX5E=oHd-`WBQ0I>9_&^<}<7793`JA=$mRuSrr}iQyzxG9T)%=Xp2g4 zkFI*p1^XIjQQE0yQNGyZNn{h@1;N1>r@)!(21u5LGg2Ob1==Thh`ZXost~Y05y+XE zrc7k%zx|Fxe^LX9HhqjcV~P|W`3AXYj%WAaFNz@uZ-xRmf!NHrNh4zKSO1WrwFL6P zXM}G=*p9v_k=mUmpg-$Y6I7Mt4@y2D+ys?c;_C@aVePnKabqAS%y%AoFzKI#JaeQxo%Il=}>GqqqxhG8cPyu>P?R=}Ol7vhvDcW{Z8i0Zn zzm^YCS5qT4m#*SycTaxzIpnMMHwFrEO>lJzqr0i6lGn6M7x;$7B7Iy)6renY$OiZc zMEFF-;Ff)@RWrYEodz{P?avD?^RtUsN$GEP>xrgxlbtd22`L1q+Vm;zyBzLIj#2fp zQZS2sUF)*%MR5S(jid&TIT<2`Js!yUdi}%lzzxkuKjf|bHvGZz#1l5%O0plla6C28K&%)=R}0F6xRI>HvM|=4x#=-to|lSN^N9P6&xIP z2dq0{CX-Xc&YJNeXXD#dn;c9feR-*P_CfUEp8(wN{z!yEZrI*MPs**fh@b|xe*S&i zHc8i5C2XFuJ)xhg7K~%2H`zsX?JhZT+>};UB5HaE$E92V@>aXAPbP zjHGY7LH_&c+;-7yblDf5tKrky!+N>Vx>?)QZi1hm1Aea(92RyRiFczw&w7)GT*KddVhT(T~0Egdo9qyLRosyG6?!=QbqPzk^x9!b!;O zjEYZ(YM2+oYg-TrJTt9??(26|bMF?&#cgl&%SzC;-tOToW%SoAmvaoExO%bz%?xjk zc(|{^J<~z4;>Loltn&Q#cD-zLlA0oFa(P1*5{sdl$v0#75<`$?CT{uv?urEF5%l#% z1*lLBO|PYH2z}OUCDP!56T6(s<{oG|TOAmiP3Z95>EKzFu=~wRiHd}%-yn`p^?J6( zih27|xpMpU0(-^Ma=J7`xm^&DhSqXkjnQt=LQjM?m_ss!!0cIcfgCXk7TijCGz5At zUKx0OZ(Pc2owm3zR5RS0N)Y#iMfl$WQCVB&sa%OY<#3FtYF&H{`S5{&n#aQKe2Se9 zB?KD>qbcT%&$2w0lfgg>hoa-{bj}D!0GrB0(o9%dP6Pxsw8y%(rU7O|*#fSHYBm2h zyytq$C(2?`j}W=ORiP$Y;41*}G=Y$(2OhqHVfd_b2NmhSboLunMtOr5!~U=jF_g7g zx!U^R$M++HtM%nJWA0HW6A->{j|_B;D@i9waP$)>{6HyW zi?%Q-uGS3xs5_COdmgZjld7Pfo4dBxil@eQDw4^F*Vcb}d)bfW?|OD#N(nd^;T^jB zZea;L9}obXL9cH4o}9qQv(@ovFw_meU5D94g#m>tZ>F(pY-+sVc~p1lWWYncfsZBD zlLUulh#8ZKbJZaXx~7T%9*9kCI?ptUWNtB6zk6wB?Esa@U>adq3-GJsAap@@buxd8 zEh*0kH65g*0pwfcCE82`98Gls@jB5(U`@lWMLxq4sPDlmq!Rv*Vp(zSX$437XGBPqZRXNva3-1V4LK`FF19js@6mZK*48gf-Z-ZNB zLM=}?fKd18YCyN<3I%#wqeFjR9^PLn0C|nbyn1-&Ph!re@O0EEp`97_ouN^T>luaA zQbRd68s2B-M1Q}bL`59M`{jC(<_`P4m+_LOgr`2Gt(Rm4y+wDaGcvik0$;t-0c3C{ zKhx0TB~7CpakFn?r9>!&+;ccIO!hd{$-sX1k+O&#=VmV@?^gOz?c=kZ*8x}L)H)dP zYzhfqNU`(IVUtd)A!)GN@5UL@&OX&+@1C?lb`+!>)>=w1JnE$X>Lw#Yjk7&t)#5>X#Cjs|&jQ!X46aWn?QOjkKm*1G ztbhAifM)AKF=tIbp&vSIPqX&9FQ`BEN|??$UXR)85VQkj*P`!)ht-9)fQ|t&EI}c) zY_Dp0Km2C(q8potDF7er6kZ;VOs*dAVznYFU=Tj)$Gq2%pheYQJdTMt)xV?d0aA0f zf!9BB;E?X!!FWTWHx>8q_1{a`32+aVn2QqF4@>>wO;ea#m&96EhNkjIR(#vwq%yr` zfH0w))fHpM%M^W;nW$_)tb@EVVvhrYi*g_wUlF^|U`HFf<~&JOeBOMX&56=R~^VwL+|j!Ca?>Tx==&$#g^C#2+mS?tyG29g?7BC;5|* zhNhNJ?*-LgdlM)3Jx?L+w7;FK4mFXC;;XzQ429NM`AD>QNUJVX`T3s9}m~hbK7csE0P(!l|C~FWjU=g#?C}12ipKQAA~kz3%msO zg2N0*dRqd|SG=WcPVM-2UAcd>w1y8d%zsl=9Z^nq83TK_9xPH=!{}}AuqY7aaFPnP l;BjQ_^4`vQQuBMqxOYB4T*@HG=I>V@U~v|0R%wcf{y%IJ0Z9M= literal 0 HcmV?d00001 diff --git a/Content/themes/base/minified/images/ui-icons_2e83ff_256x240.png b/Content/themes/base/minified/images/ui-icons_2e83ff_256x240.png new file mode 100644 index 0000000000000000000000000000000000000000..45e8928e5284adacea3f9ec07b9b50667d2ac65f GIT binary patch literal 4369 zcmd^?`8O2)_s3^phOrG}UnfiUEn8(9QW1?MNkxXVDEpFin2{xWrLx5kBC;k~GmFhwsn)TR1w<4t)tA3_robX4CdCOHJC|7j+vW z%J-EMX&`87enIluaSc0_SnYUx$GzUc?vrNXt&I`o?~7C3RJ>C-Ajq!3AfU8Dx90^_ zp3}MKjJzYC+`T(&egFXQ#9Ek{*oVAaa!zrZtmlRFnwQPRJXH<%pkK2*eP`pT=lwD7 zifq+4BY_rUTa+U|2#&?i7>PVvD?7R4ZfOLPT{e9G~G!Ls3s8JtQE`jMM9wl2V9&Q+K2DHW0M+uQmEr%nYJ^7cK?uIpU-)=wn71ZZ-=@ar0;3^AY z5+TI{2b(e%t{2PZ^HKF*vu@+Xr&BAc@2BC4 z_vCgww#i=)ea5Vo$glEEVBBg_VPBj!)OO>)f@}#dg6ULOeC>LBHz<;*5Y;YfE0lNx zg{N+4@lO~ozxpF69qV@VOGnc248Iuag4C1T)P^(hWkpP!{h!JekX}m^Q#b2B4f1oT zIjsGz)4}-$rQ*-tSuc%qG>%<4xM#E& zN)7lRK~^2VdiloY4>;#}A!yHOAXEmEi^+eA#05pawGXs>!z)gSoDuI#>bRCq-qjJe zZ)r=A`*EMX6+)~er1kdv1L^)0-PsAEM7JF$O6G8>496$24lkOSR^RTfUuIz%iSfn5b-t!##cs7sQI);gdAvqmn_v|%I9k;fCPl0Z)R1+hNQONJN zH%3jT9sOq*a`LF*MiY=zlSSQZ;{_FL9M07A=In+O!~wR}=bzGEQpk2!Vc0p)qKAH? zOk{(%06W#)DdICQ_S%Q@<0Y+!?9%#$gWJ%)EO->^YZP{<`oB4~9xh zL9-0*c4@B#O2ylYs_g`Ky$zb~v!M`NRaMNFYF*Gsu|7)=JyyMHjFC=HhGUE@{aI|B zJ~ITXU052%7jFb5Ys#fhS_?4kqc7H0EU49B8(Chg0&JzU=Gka#xOz1)H0d4m7ZnRA z=M^tdY|U6T!fmte{W?_r8H~qdq|q{5AMU_2It1I4143n~xL?4&K#BOB48l9_Rdm!(c^C?JU;tF0 zEh@o1y6Qa_>}#AwX{VY+`C^kNkxhgb1P5cB0%xupAXyg9NO=SnXrJUE?rQg{Lcsn+ zAZKctGLfbK_B#^&Nev|0^fB&?DN=ak8|0!np524LD25=s84BP8Vl(3=jflNp{X>e@ z637Ri5xx;&JNl+XYImA|{;XR~P*svYDEWYJ6I5!6uO~2twFC1ZQevB7#3z~(apxn& z^J@>Mc`>PJair{yT`iuan-V+i%|Ho-pA<1?V-k^R2Q<5;Co%XxmL` z018t4T0TTwO^w)Gx{9OSJ^9_|kgwX`7%0Rw!PO~@?xvnfUehvN;2Rc;^l>3kfbtk3 z8{j7p;S&{uTlTe9&HTc38q@%_KQFk<&n{vmrN7y&Cz{etcE->rq!6HL)2F!aa=0%! zM%Bwo!7TQ5t;@a_#Q}sjk{UebWQZ8{cp&HN^$*JfH#8spkhk{R@CVBiPuP@yEhu{} zsQfuhTqV%rioATpEphMfhyRYbVfVW`YwLFXUWm-===J(byMf!5;W^CV1g~2194Xx) zFK|z{pm%n-)-DRe{Qhk(d!QaoI*y%Wn6h7<6A{i*Sob&B^y|Spg!&J$`kN>zwUJ3x zaB$ciu*0FJKg}T ztgnh)ASF8njz5>h6?f#{c=*Yr4W_34$GmVIo8OLWjcZK4a0`+Yv-!*}9 zBwKm;DAsA(nDI-`iH@;`=gP+m{lgFLHK3m$W@?)&dGhDA_Z2xOzI0$p(ZJtH$vCxE zj>+kYNBJzs-TlSx!tSH}%I9fQv)mc!C7X0bKlZv4f&}C3+O-4k7AmVO|KYZ9ydP%(N1^uisV8y;~p`x4qFXD?!_OyN9=w(Od6W; zGrT?G;l2v@Ob5k^8w<9w%Jbjb^|H}PYKo}I~bobd!XrTbzp2Zp~H8lgJ)I3?l&(bDiWf8gE&6b z>)9GB=Iu-6%I((+>=jGP>CzD8c0oWITFZGgM!Q7|JrUYq4#^Y(vuDu-a>OWDa4Y4} z5a_*lW#IL_aVf8L+Ty}c&2VojLEIA-;eQK6Wo?xAuK>i;1VWx3c=!s2;j_*iRHOsb*>6-CgcYP+Ho=L@XLd*j~2ln-;WHg)|cCixksH$K={5rGSD@yB%LI|(NCc8 z1Er8H+QO)~S~K{g?nH|2dB8SKs)BxQ?%G}}o*LV!NG2m*TmR|pWj~g`>)ClJCE#F$ zcj)fBg(dKOKmc$Cy}IRlasngIR>z~kP&WW~9cC951{AKmnZ~ZMsqup6QQf7J0T1;C zK9*Qd5*(HxW=tl|RfjO>nkoW#AU3t>JkuzWxy4-l?xmTv15_r1X@p@dz^{&j&;{Mq z$^0$0q&y?kbdZh)kZ+NfXfqLTG}Q^j>qHlUH4VEK`3y^-z6Y<6O88Hf4v^;}!{t-a zDWg;znYu%6zA1~A5~w?fxO~i8-Ib(^02{c4pXjhDI^2 zXB1LP4dvWuc%PXQ{r!d#6>${rm+M8EJM8yf#!H$Kp8AxwUXm5`7Tu-J$mHeCG>vw|&Ay415}_1w&*9K8+2d3v1N+@a$|820o4u60Tj@u&kI!~q2V9X; z>tMvQDI|O$#m+m2O**ZHq`_{#8)ry6`&5s~2k{O4Du16Fn0P;&_(0!e5%Bel){nU0 zJX~<8U6hoI%yx}qGY_1Tq7YKDJ)ETOCs&W)TiCrK*1%DE*vXdD-7hwE*LUgjeHRM` z&@pkhTi>m#Kc+QIK+2Ybn9-sFVKNHyIgfob4H_77yYh))Rq$7Pw|+aD6&yZ|ki9 z8Zb6s{oBt1G+PgfIcxd}{m@~1nzhe;LH)5;!gS8@ddyabpdBc?7JVl?tS+<#bPSMT z2@0uYdsWN(;Ww)n-PlA-0r+62@bYkEa`k{0s})fJgYZ#5=DmIdEvok7aZJRi{w-|} zkea&6X}ZA3b7&vbDb7)v8CuI(+zzSf3z&P2eOrPNP?D~ zf zn0@)0h;~5F&BG5vOFU!=woW&ZSl~nrs{?1w>nWfW_dnpTd z4qvLDYJ*ft>Sp%M(^_xCZpNBnc66JX}A|ZL9IENM`U>`ph7d<+RQiI}@E8Y)70s zMC*_&))}GlmR}@{v9*nm)29-=rn`Q$rc^4G)GVQHlTr6BpGxtHuU(8AF7Ffh54?5w zj+EYT9>x)PWL-iQ@RNmT?R+|c@=FOmj)5Za6_ z@DkVy4l^L>Z3#SI@s_eVwd3D)<^Ivq8a~J{|4mhOL^<7M4D8){ut;GIqqn`oqCk|x pNh;Wa$C0(mdpqYz&F>xK-uVD=DT5%Jzh8ZT#aXmjr70%*{{S|9XD$E$ literal 0 HcmV?d00001 diff --git a/Content/themes/base/minified/images/ui-icons_454545_256x240.png b/Content/themes/base/minified/images/ui-icons_454545_256x240.png new file mode 100644 index 0000000000000000000000000000000000000000..7ec70d11bfb2f77374dfd00ef61ba0c3647b5a0c GIT binary patch literal 4369 zcmd^?`8yPD_s3^phOrG}UnfiUEn8(9QW1?MNkxXVDEpFin2{xWrLx5kBC;k~GmI3`<(O3xvulR&VAkQJHZBho(m=l0{{SA7UpJl008iB z3RqC-Ajq!3AfU8Dx90^_p3}MK zjJzYC+`T(&egFXQ#9Ek{*oVAaa!zrZtmlRFnwQPRJXH<%pkK2*eP`pT=lwD7ifq+4 zBY_rUTa+U|2#&?i7>PVvD?7R4ZfOLPT{e9G~G!Ls3s8JtQE`jMM9wl2V9&Q+K2DHW0M+uQmEr%nYJ^7cK?uIpU-)=wn71ZZ-=@ar0;3^AY5+TI{ z2b(e%t{2PZ^HKF*vu@+Xr&BAc@2BC4_vCgw zw#i=)ea5Vo$glEEVBBg_VPBj!)OO>)f@}#dg6ULOeC>LBHz<;*5Y;YfE0lNxg{N+4 z@lO~ozxpF69qV@VOGnc248Iuag4C1T)P^(hWkpP!{h!JekX}m^Q#b2B0{OYr9M*o< z>EL{WQt@Z+Ea-hxX0}nTSZxnpi^#Kn8Ox8FgIS|hc}KJQ4tm*HO16ui{(O9}1YN)G zjiQt6fGq`Cj+^`zUf?8hk^(T{{cOQGWFP98am}is28A!5%{R#ENv8fCN!j69lMEK(2z?|BY=Je$XD9mB-Kkem*(d-j^9j$2#6r$Dz?s)-TCDCGCs8>6Pv zj{Y+YIeFA@qY22V$)awy@q!9A4rgk5b9TcC;s9Ig^G|6nDP+5=Fzg&?(L=vcCbGd> zfSu~@6!94td+o#d@sid!EIX$rx7*cawe6`dScJ z+$HssdOjE)O#Ybs56vm-FQ$7yuJJD^Zqk%hMaIgAJ<2yb_MFQte_i;62ScT$pjifY zyR_E=rQ+>H)pmlr-Udzg*-!|ssw(D7wJvC+Sf8bb9;;q8#z?0p!!bsd{wy|5pBaMH zE-Ve>i#LLjHRaMLtp%9&(HCng7Sw96jVv!#0k%?F^K7&=T)mnYn)D9(i;4x5^NJTJ zwq~pv;kH@#ejTd*48~(J(r6j34|m`h9fEDj0im)~+%I5XphWymhT;_Zty|Q&zjPg# z-ufAHZ1M*Gccw?Kf|8Pnhtb0`!{N`Bqsa37J+>wC$!e00k+2 zEgzz;rbcWoUB%Jvp8W1}$XD%e3>4y;;OZ1ccT-O#uW6Ys@C}Pa`nZrNKzR(24e%3) z@QI4SE&E!lW`5y14QhbepBG%_XBV-O(%5tj)@9#|;sC-MNev!zGDHk}JdpGC`iJF#8=8-P$Xoku_=Dw%Cv3{U7L>gfRQ?<$ zt`cZ*MP5GQmbmx#!++P@u>0MewRO9GFGS{b^m_fJ-N0?j@EqoFf>$khj+E|@7r3We z&^tR^YZrxKe*d22agXqCO0l44&kqCv{u)T|(lv`~PK@DvE{QI_T zlCH5z*gR!>LO)k67{^R+vWx24U2^2ODXpwT;6y+6+$5m)_*w4WY&#do9dCeE)>p+Y zkdhq($DhmMiaYXey!_kiL26uz($aJ!QT{B^Wu}U$^9e#5)=c+XF9@Ill?ZmMlNgHi zz*9!vDc&uxOo;ZVxb`Q!Sk0*gnfxWzmbZh4(=%CD%qP?0=);n$&zaW_$UKV98axdc zN#AyZ{P)wj?V{P}vM)YY!>6@}^>U+iv$`9>nMTCPjN>z%yF&3yf%>+T@0vh4lC8Xa z6zeo?%=o3}M8{aebLHcO{^1Ar8qiM=Gquf?Jo)q5`-+?sUpg?QXyEUpWSm+n$K-Uy zqkIwHLquru~o(OF)hhz$Y*|X>ZIbswnxRvr~2=rdO zGVuD|xRlpAZE<0!X1F(%Anpl^@V^D3vbM}qxe|NI;TTiZy7(IM;R69RkA>a&6gwYE z2sREzQ_LHmWqB+ogMk(fMaSFeoDq-!HkFB_nXt5+2ncFuk9BQL1I&oB1zZi)YW{6_ z&-Ip1l*OVRA##1ILQS;5R{-K^0wGTiJbVSi@LA^$D$;@J>^G{6@&+%4{b3(sC~LEH ziTv(0b#zxt?YJ0r_~pUZM~mQ(??(n#>&tD%+@nq=Abj5*8R!~Ul1`G~=qFJ4fl|m8 zZDCYgtr`4LcOpgiJYX9qRY5;DcWti~PmS$VB$E-Zt^f4)vLDOe_3XTq5^ylWJ9PKm z!V-8sAOJXnUfuFNIf0R9tK-pNs2hO04zr620}5B(Ok>yB)Of-3sP59qfQNbmA4{w! z2@cB;GbR(~szVrbO%(w=5S!X`o@o@x++wbN_tMPT0Vc)*I;Fgsbf^*g02Di?H zTApwKq3+YwfNsqd3iP%{hyK1iyuVZc@*0tO_3+N0#GFsz>8MjeJ2UJ%L!%hiGYYAt zhH`E+ywA*u{(eJ=ia3h*%k?779rk-K<0VZAPkl;TFUbmei|$fqWO8!_zIvqt$ly$V zrlH46nnpX~X5Yk0iBJl;=WuA4>~X4-f&K0yWf42h&0b30t@NYX$7egQ1Fp!abui-D z6cWCWV&|R1CY@G8(qOmWjWeX3eX7UggZPGimA}soOuQdXe4uZ#2>5zN>qlI09xk}l zE=tNpX1m6*nFr2EQ3xs79!^sCldDJYE$m(qYv3q7>}1R7?iZW7>$~*%zKaC|=$N?M zE$>#+%T&MZC`dW1wUl6Z)JgxkeN920S>e@EK`q~>k| zuYcsgA>F%!@rFciD(>Iwzn8KT;2tb77bUPCmioh+rZBfIiM6f_P34cQ__o1GWqQp3 zVL~~pE5?qODf%iiQQ3f42YF@09tQ*$4v_EKUx;t1KCPCBtgqg@+Tn; zO)a0uky_%jm+WjNB?=~VyH>V#L!*=l*@OSMSVyt_UEH&NA=?V2stHPyKkVN!&jg<#cjros){#ji)dK%)We0 zL_478=HZ8-@xnwsKrWs8)x`MB;(Y`Cmu2c-&SH(vN-F(*e`l?c%+l$|y_AJJhcDGn zwLvN+bu;_sX|1AiePhx@u&%P$hf*xE+O=~D?_(_KGWQ!158YL-y9$*6mmPo;Rp*Dl5lm-mVM2i`h-M@nxv z590_tvMwPD_{l=b$iOm|+|S{D9&P%zeT$GgX6Akl-tfUF>tL@Ld!B&{pN39tH>3V> zqksMAYul+jb7UiouWVGPNsxX7Ueba+9|~dz?d*QM$ng0DZfO0`7fAy?2yMm|cnRzU zhZ&IcwgjH9cuU!w+VStYa{p*)4IgBf|E8)sqMYtB2KH_}SfsFq(c9i(Q6S3UBo%DI k*Kv;w;*%(i9W@fAqs5i2wiq literal 0 HcmV?d00001 diff --git a/Content/themes/base/minified/images/ui-icons_888888_256x240.png b/Content/themes/base/minified/images/ui-icons_888888_256x240.png new file mode 100644 index 0000000000000000000000000000000000000000..5ba708c39172a69e069136bd1309c4322c61f571 GIT binary patch literal 4369 zcmd^?`8yPD_s3^phOrG}UnfiUEn8(9QW1?MNkxXVDEpFin2{xWrLx5kBC;k~GmI3`<(O3xvulR&VAkQJHZBho(m=l0{{SA7UpJl008iB z3RqU$@Wfh}nb?QCTyjovo2=)B^qQB=#XMCF_n=?1Jbh>5sptJM?}}{I zHzR=-V_TFXKM0P+&lrh3TPr)c<8EmLl3g~EY}W@od*0X6Ljv>L(67bjz58EDypsu&ddu2a@@x)`5aA^S^DxkW8rs_vKtu8N8(o0 z#Nf}*Ch4&iw866BiW!_r4*HRsHn%80xlBW<`IOcXDu%LQam7$Ge$q#1415XvN>cnS zk_qU%P}4fO0v>J{Zw9o*)JF-CPA!KcpFR1Pn(l@*bKh=1_!ZRWb?FoG5a22cVG<$5 z0|%Qj7p@n}=Hrkk`BkD99I57h7_+lQ-AZ-?fETz5E~q(= z!!d%~_yivn82d_pX#M+Y`|`-F^s6-{6}S!?_mFzr<=n>M{{PUq7g-N`hqOcY-y_m= zc#xZEqMPgqc5cu{ag@Tdli5@JlV{xH8J%TA}P<$=Qej`5Hq>_Gzk+NDFM{b*SA6Yydp9VOs1VgIYAcj@1BIt< zXz@=NF2DLCC>`r|^h-z5@eIEh>Vnjh+|-6M@nuC!oc*856_8#_6jL|rKLYu=)Ew4+ z*XiJVgHrKl?=0wjQ)aeNu2^jkUW>@Hei_S;nuA%RRe49V`VM;8SxUBxpZPe>l9ZA{YS(NU; zhnP(vSd1kYiV^KQ02>XpH6u}Xk)wrk`+SxNxC73cSAefm+V!<`c^b#A9NaTn45bEq zkRYp$U%h-|^9P*syb!eKG!QC-$;IS9MdE^@-`WRSzTp+8M9zqJCUsoPC-3Tr+qbkO z$o;ra-wGjC64H8m{(*FVitg+LQKH+96D4!FREFb|Scex)lw()`rHV$WMdUJNe3E}`->+?@(FDYcZt1#>wXwgHzQ6{p% zTY#PF?iBGE7<=u*`SFt0Lw0HX!oh85UlzQH{;k~&JH?kPJzdQX=gAmX40n@#()wBu zSllJ`lX^ZF9!&n2{1443>o2BzK(6sGDQ?n~RYk_ih&{?TJNBH*Eq`73g$F~WrJz{` zce}LL0;S^ZMb&nKyWR#(_t{VguBs~LOSLX&q*$M&haRh5HO5G%C&MvDmi{a@PM;Zq z)h;XzD;Cshu#GG)RsptBTJvnQHC(-#7@G7B`iqJMl=F%g zD7I#-8sWBC_kJC!{tU)rGSX-nt`B$M86ARc$^oIWRNOCMU!X+%PKM$X`mI~kxxaKB znBMvsb8nZ)0}JBmidn3FUeG@ZcdpwZy_4oi*b{&c?T^HaVC|`tnlo?1SjRKLNPk{gDWT+_1fio|Ic{5kU=X{rvm3 zZIZ6BO4vMQdqO`~Ef~j4Z?cQ(+Ff$wxGAlyMBqd}_S__(_xM@v-fTM;$Q^HhR@PU= zE|8KP1IM4s;)*-+Z@m25>p^N(PgHJsq+a!8`ezsTQ3Np0+k4Mtdkgu z^}tg`-YMQKuuO>dsJQkgyjabt1)2OM)|R(}hto4zSIj5V;^@PYtIwI&4#+%;&Kf)o z7)jrDgZ%f?x$UCa=&~<9SHq{ZhxKx!b+ft~!I?(H$&BMOox4KuOo95gl<%5AIg+is zd=%?6ZOr(k=S0U?!*k{1h5q3O_ZrYo5Hq#Sl|1?L+WU%}6JI(orD)*qq-300E63z? z#iM){^ff?RwehBsE3Uh)}m z74!C`a^?2x1@?-i<#cI?a=RcP4Xx$88l&B!g`Nm)Fo$Fcf!VX@0y$z7EVz~OXbALP zyfX0m-nf+4I&E=bsAjk~l_2g3i}1e%qO!KkQ@Ij*%HbGO)w=i^^5FvkHIIee`4l@J zN(eR%MpMiipJjP0Cxd|&4n@b?>6{Ue05+A0q?xd^oCpYNXpePmO#{q`vISfX)oT82 zc+d5gPn5-?9wBmlt3pk*z*hj`X#ycn4?KJY!|++>4l2@t>FhVEjPeFAhW%k5Vkm2~ zbcy`#HFb1XOYOKAcKGGN*GG%skMBnYSL@4d#@wS$CLny@9vSEwSCUSW;OHk%_<>T$ z7HwfvT&)@WQFkIm_dH-5Csjc|H+OBX6;F-rR3wuTudV;|_Oc(#-}UUgloD_-!aH>L z-NF)hJ|F-%gI?Y8Jvo7qXRG7UV5l2_yAHF93IhsP-b`cH*wlEz^Qi99$$*D?10PGQ zCkYPA5Hltd=c+>(bWIfjJP@1Obe?Gx$=qVDe)rPM+5sw)!8F3K7T{OMLFj_+>SX>F zTT-48YC1?q1IV|?OSG8?IGXAN;&q~nz?z0#i+qM9P~U@BNG1FyO9#kvk>T>G=#)_^ zj!fMlH{X;+ONmr!LsJx(j*b2&WMpJ+s&cN;7Tyu8gf>RT2kOR+DBzZr7=m-v-UheM zgj$|(0HN;F)qrlz6$FyVsy6e02`M!$<1L&Bz z+b!=_(#ur8?I=h&thJP2c+^S%)lEi*8fSaPs>Or&i1kF^p9QX&8C;)E+S__7fCh{W zSpW930L|8eV$Pa=LO*oao@VWHUr>MSl`x%iydJaFA!rB6u0`Jo5337p0UZNmSb{=o z*%W(>6W|^!F&8DUAC~&Vo2D?gE{V0S3{B;atoXLUNo9J? z0AWHot1HHimnr%xGf~-qSOO6>z*MtHe(EIN3<7@k-U&gFD+Xq}Ua*o~(!1kApC zO+-7O=jP#uq4B~*JwPs<`_;tw%;J3m{g-9xU(RBU&q^x&eSc@Ik<8NR$i0+>JBKgT zPqjfRC3Q3V=4q|BVK-yVuyUMByvXqR1a4^k&=*MqJ_v2b7I+El z1&0}s^tJ?^uXsz@oZ9j4x^n+$X$>D_nE$4#I-;EJG6wc;Jy@i$hSA&JVNoE;;UpDo l!Q;r<<-MKrq~`aIaqoP9xRgPV&EKy+z~U_0tkM({{ePlYU?u&Z`mr_kcwz5Nh&g=McJ3E!;CE1E0ryV5Ro;>nvty8 zA{omJnn+{p4952Let*87zvA;auXFF~{<`_uPA4&sV%P>LMpp1PTBEIL*yWZ2%{t3Pe;FXZ3XmxI8(D_g57_$Zil~sY6d4T}-hu9_Wqp4C0AMO{-e2$W~1A}=8 z?24)=?B)4HUDo_oXckN%okP)HFJjaB4*3_SNpKaf;yPT}KqfS{2x7`d{0xbPErH%h zh`mQJ03DaATP9aP!}a4$fY#``NI~M6&RljED)8z}hhWxrNbxIBlTxG^j z!X>$3AQQ&I%_5mRECOjaGwR-GHmde})^)t-3_~aFM1G_L#mpCNdcLqr(RKjv3R}(z zG2^yBftMYh;H3a#-slaj|5$BX9+{PTv&NtR*P-L?l21FGTG`$H9~##p%VE!uR>=NG zc&auxVl!1_lP%uX71AJvlz(wLYl?63oLd~dqjZRrU#UEWw8J6Yn-7L~T$$tjeAQiW z9$XG5Hu>rxFBnzgd6ho#^gE5pY>U$dTCRN85Y1tQQ0=Pn{?7OJ10x9Xk!>P2f(f^f zILd}5--N;Po4*25F|J3ywIv+R@rfcYNj}R-sXrH2TFAiK{jFGG(ru1p=w$wR;IXQwAX*S~oiEK{g;kZPW;YE|!QY|g^2`dMS{&1Fr zkf?!sj~m)xO3v`hh4KQRJ&&Q!=X1HNq8T_Sg2P^B&rZX{VQUNc9O(K+B_Z4hiTH7M zW7K5Y!Ec5xD~B9zFlKUWG_Rd)xTK7U#hRGhp51T++e6oS{gT^?3s~>V4?6{zchhc_ z3UBb_W2U+~guMsG-g=@#aWPSFypk)5jIUTxFiM zycGZzbxQuCTnvH*kv=E=LsRnltLbhgm$=ttS1IzU0)1t~4(XE>bHVwJpAPKOqoI-# zrdc{yo0R7Qx%~ZQl{UPa?gmxo#ZWM|vNHNxl@8NLksfn5Ek>C${w=x~pekl%gfwaLwWspL{af)?f zTOBmhTyU&3;}QeF&VLwhJ>Dezu>~P zc+$aFxKDWKj-CmD(v`}uH|ts*SefX@lyrc<%~WE6tHU#dv;y+LlA@cTgl8J!u@@u6 z@@fvJdC)1TvBa$QT@ck`rUxF**7w4Yh0!vZUsGu%Lm(cl(l#QPpmoOH3JC>FMe07G zq0kl#K+GLndyoOx8{t9g8JiLs#`pH8JWqR_ZM%J!Yr>cp>95<^#=FWQfzPm%q;5B+ z0>}ul8+l+gRaHV$$tsq5|MU;?AJ~m-XNxjW3U6JH2k`tOXAqi)yGI@^uA&dQ% zZCJIe7{qK>+p_F)Sqy-GC!x-5MgogsP6lwiUH`N^a7*LKPdO{!4L^_^;goe*e}3s( z0i~~@V#)#L*W~2F?}&N*IQ)0a4Z1$uTU)p7^Mq&IM6K6d*$vpX2+L*+$9vY0=7?$b zxdD4R`8~74HMWsx#*goNSp#(_;z`UT-GuGxoUl-){JNk1rf)aSKE!W`#m`t#v6V!u zgn>fufpkVprL(KqSkhl*Z+yRQosF)bEiV<#K8hOr>yQ1@7Xg>g3EjKwLB7)(9$3%X z$G30OD&Z2Nh{;v5!}oF4fUu0TM%&2F-6aS1+fqu3cn;K4k4-#kkB|BO?bZtcTygp+ zB|R0)0x`)UVEm;Fwx~Vt*6ZV3k5Xcj6_=(X2y*8M&NGz^?Jr>Jutu8idcHpesED^^ znM9MV2AcX%oppm45TS9yYBtteX?1liAe($}l8Mrk|YY*cFUp@Yl5_|Ih%+ z5^dz*^BpQ&l8;Le-Z+E?J1_|}dtK>`0HCSg@u z*e9pUpX4zkcJ~*%3c8N=D_*8f&2puu6>riMeA#MG3E+*kYt|0Dnl;U^u0x`IJLnY* zjELAyFaL6=ihd=uwgnc)F;a_ZKEBsA_UuVc$NS1$GwozcE)2-hGS_c!*V9@%u`#?lhbMR;p$MXpbUS7*AsAt5?3(xQtcatZ zK;B-KhX__vb(?F4Q0GloBJ>|QvdJoM?lDbgsR3iM@a;Z3?cA&4wtslYkr80ETZHkc z9*>q7Q7<0~XHK7PK#yo@cBi@smopq(-%`e-KH4Qx-~rbHu}dW58QqJ{;3Inef@=x4 zI)BgQYXff|j7xg1Qx_M8s)u`0@M0d&aKAfD6qe?B3THxh84PWrQX5xII()>h>b|f$ zpKR+*4#vbnsS3H{v&>IrrO}Xrp{O`p?Q{I%z{XPHRAc7mQ~rVVZ80t_sel;~R{!fE znoWNU9=P1`jx=A?#Ye1fm8**6`|yK3jKQSofyZy4XkM$FK?NExjqO&YVea7N(7$X$ zbR{k3PT@a2CJt_@Dead-55GO?f3gVr{BdM(wXV#1%q{YCJlyB~k-m;m1@SZyhI$5p z9ViBGQ5QzVRGUDbbtaN^E&{f(lI64ub2s){aFm!11riDV*6MFh58H{nU5}0{$^Hi; zJVW(-UYp)>>|Lx|%+y^DwKhz`tPS-85#6Rh0)ckL)U$^na{7 z@VVG(5^ui@Hf1odF537(mlR>ZBhjf%rT+ zPUdZ~CgvIZM_wUkJAw%w}x9jc8!TL)0!EfOi*AMUgP00QdmWDhdxHH4HGc<~J zIVYb|Vj$~E#d*)1>gzKQFOMaAy}BVVo}IK&7ZMB zx!9l*+ek@g>FsKVCTu!A+bt50<5zR%LvhtB47 zphLoLmz-;H4@2#)g8=!k#zLI#UMqFnH)&}~tj#&gW_Q99mQw+L7dU5Tu)W%;@9Qi9 z>QGi--TSZnR2z4)8B5wJy^vu$s+IRc0ll#|LNt!?I`me%fGty24eDN4Xl+O{(+NPj z1ygVh>zf*$Pk&fEX-3AP^1w$s1y_e7lBxzgSu6?iXt=l939t1dNMV&Hw?hI}<+!vx zKuXRw@aAWBEW)iT2xma>qG11B|GnfLf43m`S%SD z3d3^-2o=m;T`_XFO4d`JiOd4T*vl!w_t?SMNPGOr712xew$!m3PP4`3g2iVGiU!9* z&w=GY2O}!evGB%RQa5rA7s5%`YA&A$+(`a%B< z)4%^Wyf-xKA)KjJ=y>(k$Cki3nVk)wxAEYIGA3p>sG^i;f$cIw3$H&^I7dNHU=sw$d)j7 zh|(sSuhT>1EWU{wVQLz{XV1iYPIvxnNv=>Vu3kdkB_SVNJ(KJiSF;#9T-Gc6A9!kU z?a4i1-1H;R$hx=;;1@G7Jsm?|a=U>2b+qZz`aN9sgsIyFSp6r%%!9oq%tbmjY#K7P z-Gux{jUMaKw>DF`W{3tTZ|SIDqX6v)w4@1rITXmow6pv9GTr+NsJ`V>Zv++iD5MFK z@5#Rx6sk|u-Qs__;w5Q)X2-Ad+QXxzHC&)U-n+`G@G_e77|5&TV3EucN^AXqK{AmK pCn+FvZU>f5ukGw-)qi%3dglGbB=rNWkH7i=^YbXv3KMkH{{f&jC-?vW literal 0 HcmV?d00001 diff --git a/Content/themes/base/minified/jquery-ui.min.css b/Content/themes/base/minified/jquery-ui.min.css new file mode 100644 index 0000000..802bc28 --- /dev/null +++ b/Content/themes/base/minified/jquery-ui.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.progressbar.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.slider.css, jquery.ui.tabs.css, jquery.ui.theme.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-helper-hidden{display:none}.ui-helper-hidden-accessible{position:absolute!important;clip:rect(1px);clip:rect(1px,1px,1px,1px)}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none}.ui-helper-clearfix:before,.ui-helper-clearfix:after{content:"";display:table}.ui-helper-clearfix:after{clear:both}.ui-helper-clearfix{zoom:1}.ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0)}.ui-state-disabled{cursor:default!important}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat}.ui-widget-overlay{position:absolute;top:0;left:0;width:100%;height:100%}.ui-accordion{width:100%}.ui-accordion .ui-accordion-header{cursor:pointer;position:relative;margin-top:1px;zoom:1}.ui-accordion .ui-accordion-li-fix{display:inline}.ui-accordion .ui-accordion-header-active{border-bottom:0!important}.ui-accordion .ui-accordion-header a{display:block;font-size:1em;padding:.5em .5em .5em .7em}.ui-accordion-icons .ui-accordion-header a{padding-left:2.2em}.ui-accordion .ui-accordion-header .ui-icon{position:absolute;left:.5em;top:50%;margin-top:-8px}.ui-accordion .ui-accordion-content{padding:1em 2.2em;border-top:0;margin-top:-2px;position:relative;top:1px;margin-bottom:2px;overflow:auto;display:none;zoom:1}.ui-accordion .ui-accordion-content-active{display:block}.ui-autocomplete{position:absolute;cursor:default}* html .ui-autocomplete{width:1px}.ui-menu{list-style:none;padding:2px;margin:0;display:block;float:left}.ui-menu .ui-menu{margin-top:-3px}.ui-menu .ui-menu-item{margin:0;padding:0;zoom:1;float:left;clear:left;width:100%}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:.2em .4em;line-height:1.5;zoom:1}.ui-menu .ui-menu-item a.ui-state-hover,.ui-menu .ui-menu-item a.ui-state-active{font-weight:normal;margin:-1px}.ui-button{display:inline-block;position:relative;padding:0;margin-right:.1em;text-decoration:none!important;cursor:pointer;text-align:center;zoom:1;overflow:visible}.ui-button-icon-only{width:2.2em}button.ui-button-icon-only{width:2.4em}.ui-button-icons-only{width:3.4em}button.ui-button-icons-only{width:3.7em}.ui-button .ui-button-text{display:block;line-height:1.4}.ui-button-text-only .ui-button-text{padding:.4em 1em}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em}input.ui-button{padding:.4em 1em}.ui-button-icon-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon,.ui-button-icons-only .ui-icon{position:absolute;top:50%;margin-top:-8px}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px}.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary,.ui-button-icons-only .ui-button-icon-primary{left:.5em}.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-buttonset{margin-right:7px}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em}button.ui-button::-moz-focus-inner{border:0;padding:0}.ui-datepicker{width:17em;padding:.2em .2em 0;display:none}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0}.ui-datepicker .ui-datepicker-prev,.ui-datepicker .ui-datepicker-next{position:absolute;top:2px;width:1.8em;height:1.8em}.ui-datepicker .ui-datepicker-prev-hover,.ui-datepicker .ui-datepicker-next-hover{top:1px}.ui-datepicker .ui-datepicker-prev{left:2px}.ui-datepicker .ui-datepicker-next{right:2px}.ui-datepicker .ui-datepicker-prev-hover{left:1px}.ui-datepicker .ui-datepicker-next-hover{right:1px}.ui-datepicker .ui-datepicker-prev span,.ui-datepicker .ui-datepicker-next span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0}.ui-datepicker select.ui-datepicker-month-year{width:100%}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:bold;border:0}.ui-datepicker td{border:0;padding:1px}.ui-datepicker td span,.ui-datepicker td a{display:block;padding:.2em;text-align:right;text-decoration:none}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em .6em;width:auto;overflow:visible}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left}.ui-datepicker.ui-datepicker-multi{width:auto}.ui-datepicker-multi .ui-datepicker-group{float:left}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left}.ui-datepicker-row-break{clear:both;width:100%;font-size:0em}.ui-datepicker-rtl{direction:rtl}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current{float:right}.ui-datepicker-rtl .ui-datepicker-group{float:right}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-cover{position:absolute;z-index:-1;filter:mask();top:-4px;left:-4px;width:200px;height:200px}.ui-dialog{position:absolute;padding:.2em;width:300px;overflow:hidden}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative}.ui-dialog .ui-dialog-title{float:left;margin:.1em 16px .1em 0}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:19px;margin:-10px 0 0 0;padding:1px;height:18px}.ui-dialog .ui-dialog-titlebar-close span{display:block;margin:1px}.ui-dialog .ui-dialog-titlebar-close:hover,.ui-dialog .ui-dialog-titlebar-close:focus{padding:0}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:none;overflow:auto;zoom:1}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0 0;background-image:none;margin:.5em 0 0 0;padding:.3em 1em .5em .4em}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer}.ui-dialog .ui-resizable-se{width:14px;height:14px;right:3px;bottom:3px}.ui-draggable .ui-dialog-titlebar{cursor:move}.ui-progressbar{height:2em;text-align:left;overflow:hidden}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%}.ui-resizable{position:relative}.ui-resizable-handle{position:absolute;font-size:0.1px;display:block}.ui-resizable-disabled .ui-resizable-handle,.ui-resizable-autohide .ui-resizable-handle{display:none}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px}.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted black}.ui-slider{position:relative;text-align:left}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0}.ui-slider-horizontal{height:.8em}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em}.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.ui-slider-horizontal .ui-slider-range-min{left:0}.ui-slider-horizontal .ui-slider-range-max{right:0}.ui-slider-vertical{width:.8em;height:100px}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em}.ui-slider-vertical .ui-slider-range{left:0;width:100%}.ui-slider-vertical .ui-slider-range-min{bottom:0}.ui-slider-vertical .ui-slider-range-max{top:0}.ui-tabs{position:relative;padding:.2em;zoom:1}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:1px;margin:0 .2em 1px 0;border-bottom:0!important;padding:0;white-space:nowrap}.ui-tabs .ui-tabs-nav li a{float:left;padding:.5em 1em;text-decoration:none}.ui-tabs .ui-tabs-nav li.ui-tabs-selected{margin-bottom:0;padding-bottom:1px}.ui-tabs .ui-tabs-nav li.ui-tabs-selected a,.ui-tabs .ui-tabs-nav li.ui-state-disabled a,.ui-tabs .ui-tabs-nav li.ui-state-processing a{cursor:text}.ui-tabs .ui-tabs-nav li a,.ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a{cursor:pointer}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:none}.ui-tabs .ui-tabs-hide{display:none!important}.ui-widget{font-family:Verdana,Arial,sans-serif;font-size:1.1em}.ui-widget .ui-widget{font-size:1em}.ui-widget input,.ui-widget select,.ui-widget textarea,.ui-widget button{font-family:Verdana,Arial,sans-serif;font-size:1em}.ui-widget-content{border:1px solid #aaa;background:#fff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;color:#222}.ui-widget-content a{color:#222}.ui-widget-header{border:1px solid #aaa;background:#ccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;color:#222;font-weight:bold}.ui-widget-header a{color:#222}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:1px solid #d3d3d3;background:#e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#555}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#555;text-decoration:none}.ui-state-hover,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-hover,.ui-state-focus,.ui-widget-content .ui-state-focus,.ui-widget-header .ui-state-focus{border:1px solid #999;background:#dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-hover a,.ui-state-hover a:hover{color:#212121;text-decoration:none}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{border:1px solid #aaa;background:#fff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none}.ui-widget:active{outline:none}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a}.ui-state-error a,.ui-widget-content .ui-state-error a,.ui-widget-header .ui-state-error a{color:#cd0a0a}.ui-state-error-text,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error-text{color:#cd0a0a}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:bold}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:normal}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none}.ui-icon{width:16px;height:16px;background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-content .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-header .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-state-default .ui-icon{background-image:url(images/ui-icons_888888_256x240.png)}.ui-state-hover .ui-icon,.ui-state-focus .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-active .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_2e83ff_256x240.png)}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_cd0a0a_256x240.png)}.ui-icon-carat-1-n{background-position:0 0}.ui-icon-carat-1-ne{background-position:-16px 0}.ui-icon-carat-1-e{background-position:-32px 0}.ui-icon-carat-1-se{background-position:-48px 0}.ui-icon-carat-1-s{background-position:-64px 0}.ui-icon-carat-1-sw{background-position:-80px 0}.ui-icon-carat-1-w{background-position:-96px 0}.ui-icon-carat-1-nw{background-position:-112px 0}.ui-icon-carat-2-n-s{background-position:-128px 0}.ui-icon-carat-2-e-w{background-position:-144px 0}.ui-icon-triangle-1-n{background-position:0 -16px}.ui-icon-triangle-1-ne{background-position:-16px -16px}.ui-icon-triangle-1-e{background-position:-32px -16px}.ui-icon-triangle-1-se{background-position:-48px -16px}.ui-icon-triangle-1-s{background-position:-64px -16px}.ui-icon-triangle-1-sw{background-position:-80px -16px}.ui-icon-triangle-1-w{background-position:-96px -16px}.ui-icon-triangle-1-nw{background-position:-112px -16px}.ui-icon-triangle-2-n-s{background-position:-128px -16px}.ui-icon-triangle-2-e-w{background-position:-144px -16px}.ui-icon-arrow-1-n{background-position:0 -32px}.ui-icon-arrow-1-ne{background-position:-16px -32px}.ui-icon-arrow-1-e{background-position:-32px -32px}.ui-icon-arrow-1-se{background-position:-48px -32px}.ui-icon-arrow-1-s{background-position:-64px -32px}.ui-icon-arrow-1-sw{background-position:-80px -32px}.ui-icon-arrow-1-w{background-position:-96px -32px}.ui-icon-arrow-1-nw{background-position:-112px -32px}.ui-icon-arrow-2-n-s{background-position:-128px -32px}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px}.ui-icon-arrow-2-e-w{background-position:-160px -32px}.ui-icon-arrow-2-se-nw{background-position:-176px -32px}.ui-icon-arrowstop-1-n{background-position:-192px -32px}.ui-icon-arrowstop-1-e{background-position:-208px -32px}.ui-icon-arrowstop-1-s{background-position:-224px -32px}.ui-icon-arrowstop-1-w{background-position:-240px -32px}.ui-icon-arrowthick-1-n{background-position:0 -48px}.ui-icon-arrowthick-1-ne{background-position:-16px -48px}.ui-icon-arrowthick-1-e{background-position:-32px -48px}.ui-icon-arrowthick-1-se{background-position:-48px -48px}.ui-icon-arrowthick-1-s{background-position:-64px -48px}.ui-icon-arrowthick-1-sw{background-position:-80px -48px}.ui-icon-arrowthick-1-w{background-position:-96px -48px}.ui-icon-arrowthick-1-nw{background-position:-112px -48px}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px}.ui-icon-arrowreturn-1-w{background-position:-64px -64px}.ui-icon-arrowreturn-1-n{background-position:-80px -64px}.ui-icon-arrowreturn-1-e{background-position:-96px -64px}.ui-icon-arrowreturn-1-s{background-position:-112px -64px}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px}.ui-icon-arrow-4{background-position:0 -80px}.ui-icon-arrow-4-diag{background-position:-16px -80px}.ui-icon-extlink{background-position:-32px -80px}.ui-icon-newwin{background-position:-48px -80px}.ui-icon-refresh{background-position:-64px -80px}.ui-icon-shuffle{background-position:-80px -80px}.ui-icon-transfer-e-w{background-position:-96px -80px}.ui-icon-transferthick-e-w{background-position:-112px -80px}.ui-icon-folder-collapsed{background-position:0 -96px}.ui-icon-folder-open{background-position:-16px -96px}.ui-icon-document{background-position:-32px -96px}.ui-icon-document-b{background-position:-48px -96px}.ui-icon-note{background-position:-64px -96px}.ui-icon-mail-closed{background-position:-80px -96px}.ui-icon-mail-open{background-position:-96px -96px}.ui-icon-suitcase{background-position:-112px -96px}.ui-icon-comment{background-position:-128px -96px}.ui-icon-person{background-position:-144px -96px}.ui-icon-print{background-position:-160px -96px}.ui-icon-trash{background-position:-176px -96px}.ui-icon-locked{background-position:-192px -96px}.ui-icon-unlocked{background-position:-208px -96px}.ui-icon-bookmark{background-position:-224px -96px}.ui-icon-tag{background-position:-240px -96px}.ui-icon-home{background-position:0 -112px}.ui-icon-flag{background-position:-16px -112px}.ui-icon-calendar{background-position:-32px -112px}.ui-icon-cart{background-position:-48px -112px}.ui-icon-pencil{background-position:-64px -112px}.ui-icon-clock{background-position:-80px -112px}.ui-icon-disk{background-position:-96px -112px}.ui-icon-calculator{background-position:-112px -112px}.ui-icon-zoomin{background-position:-128px -112px}.ui-icon-zoomout{background-position:-144px -112px}.ui-icon-search{background-position:-160px -112px}.ui-icon-wrench{background-position:-176px -112px}.ui-icon-gear{background-position:-192px -112px}.ui-icon-heart{background-position:-208px -112px}.ui-icon-star{background-position:-224px -112px}.ui-icon-link{background-position:-240px -112px}.ui-icon-cancel{background-position:0 -128px}.ui-icon-plus{background-position:-16px -128px}.ui-icon-plusthick{background-position:-32px -128px}.ui-icon-minus{background-position:-48px -128px}.ui-icon-minusthick{background-position:-64px -128px}.ui-icon-close{background-position:-80px -128px}.ui-icon-closethick{background-position:-96px -128px}.ui-icon-key{background-position:-112px -128px}.ui-icon-lightbulb{background-position:-128px -128px}.ui-icon-scissors{background-position:-144px -128px}.ui-icon-clipboard{background-position:-160px -128px}.ui-icon-copy{background-position:-176px -128px}.ui-icon-contact{background-position:-192px -128px}.ui-icon-image{background-position:-208px -128px}.ui-icon-video{background-position:-224px -128px}.ui-icon-script{background-position:-240px -128px}.ui-icon-alert{background-position:0 -144px}.ui-icon-info{background-position:-16px -144px}.ui-icon-notice{background-position:-32px -144px}.ui-icon-help{background-position:-48px -144px}.ui-icon-check{background-position:-64px -144px}.ui-icon-bullet{background-position:-80px -144px}.ui-icon-radio-off{background-position:-96px -144px}.ui-icon-radio-on{background-position:-112px -144px}.ui-icon-pin-w{background-position:-128px -144px}.ui-icon-pin-s{background-position:-144px -144px}.ui-icon-play{background-position:0 -160px}.ui-icon-pause{background-position:-16px -160px}.ui-icon-seek-next{background-position:-32px -160px}.ui-icon-seek-prev{background-position:-48px -160px}.ui-icon-seek-end{background-position:-64px -160px}.ui-icon-seek-start{background-position:-80px -160px}.ui-icon-seek-first{background-position:-80px -160px}.ui-icon-stop{background-position:-96px -160px}.ui-icon-eject{background-position:-112px -160px}.ui-icon-volume-off{background-position:-128px -160px}.ui-icon-volume-on{background-position:-144px -160px}.ui-icon-power{background-position:0 -176px}.ui-icon-signal-diag{background-position:-16px -176px}.ui-icon-signal{background-position:-32px -176px}.ui-icon-battery-0{background-position:-48px -176px}.ui-icon-battery-1{background-position:-64px -176px}.ui-icon-battery-2{background-position:-80px -176px}.ui-icon-battery-3{background-position:-96px -176px}.ui-icon-circle-plus{background-position:0 -192px}.ui-icon-circle-minus{background-position:-16px -192px}.ui-icon-circle-close{background-position:-32px -192px}.ui-icon-circle-triangle-e{background-position:-48px -192px}.ui-icon-circle-triangle-s{background-position:-64px -192px}.ui-icon-circle-triangle-w{background-position:-80px -192px}.ui-icon-circle-triangle-n{background-position:-96px -192px}.ui-icon-circle-arrow-e{background-position:-112px -192px}.ui-icon-circle-arrow-s{background-position:-128px -192px}.ui-icon-circle-arrow-w{background-position:-144px -192px}.ui-icon-circle-arrow-n{background-position:-160px -192px}.ui-icon-circle-zoomin{background-position:-176px -192px}.ui-icon-circle-zoomout{background-position:-192px -192px}.ui-icon-circle-check{background-position:-208px -192px}.ui-icon-circlesmall-plus{background-position:0 -208px}.ui-icon-circlesmall-minus{background-position:-16px -208px}.ui-icon-circlesmall-close{background-position:-32px -208px}.ui-icon-squaresmall-plus{background-position:-48px -208px}.ui-icon-squaresmall-minus{background-position:-64px -208px}.ui-icon-squaresmall-close{background-position:-80px -208px}.ui-icon-grip-dotted-vertical{background-position:0 -224px}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px}.ui-icon-grip-solid-vertical{background-position:-32px -224px}.ui-icon-grip-solid-horizontal{background-position:-48px -224px}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px}.ui-icon-grip-diagonal-se{background-position:-80px -224px}.ui-corner-all,.ui-corner-top,.ui-corner-left,.ui-corner-tl{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;-khtml-border-top-left-radius:4px;border-top-left-radius:4px}.ui-corner-all,.ui-corner-top,.ui-corner-right,.ui-corner-tr{-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;-khtml-border-top-right-radius:4px;border-top-right-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-left,.ui-corner-bl{-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;-khtml-border-bottom-left-radius:4px;border-bottom-left-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-right,.ui-corner-br{-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;-khtml-border-bottom-right-radius:4px;border-bottom-right-radius:4px}.ui-widget-overlay{background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30)}.ui-widget-shadow{margin:-8px 0 0 -8px;padding:8px;background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30);-moz-border-radius:8px;-khtml-border-radius:8px;-webkit-border-radius:8px;border-radius:8px} \ No newline at end of file diff --git a/Content/themes/base/minified/jquery.ui.accordion.min.css b/Content/themes/base/minified/jquery.ui.accordion.min.css new file mode 100644 index 0000000..161832d --- /dev/null +++ b/Content/themes/base/minified/jquery.ui.accordion.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.accordion.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-accordion{width:100%}.ui-accordion .ui-accordion-header{cursor:pointer;position:relative;margin-top:1px;zoom:1}.ui-accordion .ui-accordion-li-fix{display:inline}.ui-accordion .ui-accordion-header-active{border-bottom:0!important}.ui-accordion .ui-accordion-header a{display:block;font-size:1em;padding:.5em .5em .5em .7em}.ui-accordion-icons .ui-accordion-header a{padding-left:2.2em}.ui-accordion .ui-accordion-header .ui-icon{position:absolute;left:.5em;top:50%;margin-top:-8px}.ui-accordion .ui-accordion-content{padding:1em 2.2em;border-top:0;margin-top:-2px;position:relative;top:1px;margin-bottom:2px;overflow:auto;display:none;zoom:1}.ui-accordion .ui-accordion-content-active{display:block} \ No newline at end of file diff --git a/Content/themes/base/minified/jquery.ui.autocomplete.min.css b/Content/themes/base/minified/jquery.ui.autocomplete.min.css new file mode 100644 index 0000000..bed892a --- /dev/null +++ b/Content/themes/base/minified/jquery.ui.autocomplete.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.autocomplete.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-autocomplete{position:absolute;cursor:default}* html .ui-autocomplete{width:1px}.ui-menu{list-style:none;padding:2px;margin:0;display:block;float:left}.ui-menu .ui-menu{margin-top:-3px}.ui-menu .ui-menu-item{margin:0;padding:0;zoom:1;float:left;clear:left;width:100%}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:.2em .4em;line-height:1.5;zoom:1}.ui-menu .ui-menu-item a.ui-state-hover,.ui-menu .ui-menu-item a.ui-state-active{font-weight:normal;margin:-1px} \ No newline at end of file diff --git a/Content/themes/base/minified/jquery.ui.button.min.css b/Content/themes/base/minified/jquery.ui.button.min.css new file mode 100644 index 0000000..4c1303c --- /dev/null +++ b/Content/themes/base/minified/jquery.ui.button.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.button.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-button{display:inline-block;position:relative;padding:0;margin-right:.1em;text-decoration:none!important;cursor:pointer;text-align:center;zoom:1;overflow:visible}.ui-button-icon-only{width:2.2em}button.ui-button-icon-only{width:2.4em}.ui-button-icons-only{width:3.4em}button.ui-button-icons-only{width:3.7em}.ui-button .ui-button-text{display:block;line-height:1.4}.ui-button-text-only .ui-button-text{padding:.4em 1em}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em}input.ui-button{padding:.4em 1em}.ui-button-icon-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon,.ui-button-icons-only .ui-icon{position:absolute;top:50%;margin-top:-8px}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px}.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary,.ui-button-icons-only .ui-button-icon-primary{left:.5em}.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-buttonset{margin-right:7px}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em}button.ui-button::-moz-focus-inner{border:0;padding:0} \ No newline at end of file diff --git a/Content/themes/base/minified/jquery.ui.core.min.css b/Content/themes/base/minified/jquery.ui.core.min.css new file mode 100644 index 0000000..53983ce --- /dev/null +++ b/Content/themes/base/minified/jquery.ui.core.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-helper-hidden{display:none}.ui-helper-hidden-accessible{position:absolute!important;clip:rect(1px);clip:rect(1px,1px,1px,1px)}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none}.ui-helper-clearfix:before,.ui-helper-clearfix:after{content:"";display:table}.ui-helper-clearfix:after{clear:both}.ui-helper-clearfix{zoom:1}.ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0)}.ui-state-disabled{cursor:default!important}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat}.ui-widget-overlay{position:absolute;top:0;left:0;width:100%;height:100%} \ No newline at end of file diff --git a/Content/themes/base/minified/jquery.ui.datepicker.min.css b/Content/themes/base/minified/jquery.ui.datepicker.min.css new file mode 100644 index 0000000..ae5aae5 --- /dev/null +++ b/Content/themes/base/minified/jquery.ui.datepicker.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.datepicker.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-datepicker{width:17em;padding:.2em .2em 0;display:none}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0}.ui-datepicker .ui-datepicker-prev,.ui-datepicker .ui-datepicker-next{position:absolute;top:2px;width:1.8em;height:1.8em}.ui-datepicker .ui-datepicker-prev-hover,.ui-datepicker .ui-datepicker-next-hover{top:1px}.ui-datepicker .ui-datepicker-prev{left:2px}.ui-datepicker .ui-datepicker-next{right:2px}.ui-datepicker .ui-datepicker-prev-hover{left:1px}.ui-datepicker .ui-datepicker-next-hover{right:1px}.ui-datepicker .ui-datepicker-prev span,.ui-datepicker .ui-datepicker-next span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0}.ui-datepicker select.ui-datepicker-month-year{width:100%}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:bold;border:0}.ui-datepicker td{border:0;padding:1px}.ui-datepicker td span,.ui-datepicker td a{display:block;padding:.2em;text-align:right;text-decoration:none}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em .6em;width:auto;overflow:visible}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left}.ui-datepicker.ui-datepicker-multi{width:auto}.ui-datepicker-multi .ui-datepicker-group{float:left}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left}.ui-datepicker-row-break{clear:both;width:100%;font-size:0em}.ui-datepicker-rtl{direction:rtl}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current{float:right}.ui-datepicker-rtl .ui-datepicker-group{float:right}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-cover{position:absolute;z-index:-1;filter:mask();top:-4px;left:-4px;width:200px;height:200px} \ No newline at end of file diff --git a/Content/themes/base/minified/jquery.ui.dialog.min.css b/Content/themes/base/minified/jquery.ui.dialog.min.css new file mode 100644 index 0000000..3157754 --- /dev/null +++ b/Content/themes/base/minified/jquery.ui.dialog.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.dialog.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-dialog{position:absolute;padding:.2em;width:300px;overflow:hidden}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative}.ui-dialog .ui-dialog-title{float:left;margin:.1em 16px .1em 0}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:19px;margin:-10px 0 0 0;padding:1px;height:18px}.ui-dialog .ui-dialog-titlebar-close span{display:block;margin:1px}.ui-dialog .ui-dialog-titlebar-close:hover,.ui-dialog .ui-dialog-titlebar-close:focus{padding:0}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:none;overflow:auto;zoom:1}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0 0;background-image:none;margin:.5em 0 0 0;padding:.3em 1em .5em .4em}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer}.ui-dialog .ui-resizable-se{width:14px;height:14px;right:3px;bottom:3px}.ui-draggable .ui-dialog-titlebar{cursor:move} \ No newline at end of file diff --git a/Content/themes/base/minified/jquery.ui.progressbar.min.css b/Content/themes/base/minified/jquery.ui.progressbar.min.css new file mode 100644 index 0000000..1b34ceb --- /dev/null +++ b/Content/themes/base/minified/jquery.ui.progressbar.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.progressbar.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-progressbar{height:2em;text-align:left;overflow:hidden}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%} \ No newline at end of file diff --git a/Content/themes/base/minified/jquery.ui.resizable.min.css b/Content/themes/base/minified/jquery.ui.resizable.min.css new file mode 100644 index 0000000..0e781c3 --- /dev/null +++ b/Content/themes/base/minified/jquery.ui.resizable.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.resizable.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-resizable{position:relative}.ui-resizable-handle{position:absolute;font-size:0.1px;display:block}.ui-resizable-disabled .ui-resizable-handle,.ui-resizable-autohide .ui-resizable-handle{display:none}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px} \ No newline at end of file diff --git a/Content/themes/base/minified/jquery.ui.selectable.min.css b/Content/themes/base/minified/jquery.ui.selectable.min.css new file mode 100644 index 0000000..62934b5 --- /dev/null +++ b/Content/themes/base/minified/jquery.ui.selectable.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.selectable.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted black} \ No newline at end of file diff --git a/Content/themes/base/minified/jquery.ui.slider.min.css b/Content/themes/base/minified/jquery.ui.slider.min.css new file mode 100644 index 0000000..aad334f --- /dev/null +++ b/Content/themes/base/minified/jquery.ui.slider.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.slider.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-slider{position:relative;text-align:left}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0}.ui-slider-horizontal{height:.8em}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em}.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.ui-slider-horizontal .ui-slider-range-min{left:0}.ui-slider-horizontal .ui-slider-range-max{right:0}.ui-slider-vertical{width:.8em;height:100px}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em}.ui-slider-vertical .ui-slider-range{left:0;width:100%}.ui-slider-vertical .ui-slider-range-min{bottom:0}.ui-slider-vertical .ui-slider-range-max{top:0} \ No newline at end of file diff --git a/Content/themes/base/minified/jquery.ui.tabs.min.css b/Content/themes/base/minified/jquery.ui.tabs.min.css new file mode 100644 index 0000000..e8a7af5 --- /dev/null +++ b/Content/themes/base/minified/jquery.ui.tabs.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.tabs.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-tabs{position:relative;padding:.2em;zoom:1}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:1px;margin:0 .2em 1px 0;border-bottom:0!important;padding:0;white-space:nowrap}.ui-tabs .ui-tabs-nav li a{float:left;padding:.5em 1em;text-decoration:none}.ui-tabs .ui-tabs-nav li.ui-tabs-selected{margin-bottom:0;padding-bottom:1px}.ui-tabs .ui-tabs-nav li.ui-tabs-selected a,.ui-tabs .ui-tabs-nav li.ui-state-disabled a,.ui-tabs .ui-tabs-nav li.ui-state-processing a{cursor:text}.ui-tabs .ui-tabs-nav li a,.ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a{cursor:pointer}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:none}.ui-tabs .ui-tabs-hide{display:none!important} \ No newline at end of file diff --git a/Content/themes/base/minified/jquery.ui.theme.min.css b/Content/themes/base/minified/jquery.ui.theme.min.css new file mode 100644 index 0000000..1437a1e --- /dev/null +++ b/Content/themes/base/minified/jquery.ui.theme.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.theme.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-widget{font-family:Verdana,Arial,sans-serif;font-size:1.1em}.ui-widget .ui-widget{font-size:1em}.ui-widget input,.ui-widget select,.ui-widget textarea,.ui-widget button{font-family:Verdana,Arial,sans-serif;font-size:1em}.ui-widget-content{border:1px solid #aaa;background:#fff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;color:#222}.ui-widget-content a{color:#222}.ui-widget-header{border:1px solid #aaa;background:#ccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;color:#222;font-weight:bold}.ui-widget-header a{color:#222}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:1px solid #d3d3d3;background:#e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#555}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#555;text-decoration:none}.ui-state-hover,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-hover,.ui-state-focus,.ui-widget-content .ui-state-focus,.ui-widget-header .ui-state-focus{border:1px solid #999;background:#dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-hover a,.ui-state-hover a:hover{color:#212121;text-decoration:none}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{border:1px solid #aaa;background:#fff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none}.ui-widget:active{outline:none}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a}.ui-state-error a,.ui-widget-content .ui-state-error a,.ui-widget-header .ui-state-error a{color:#cd0a0a}.ui-state-error-text,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error-text{color:#cd0a0a}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:bold}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:normal}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none}.ui-icon{width:16px;height:16px;background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-content .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-header .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-state-default .ui-icon{background-image:url(images/ui-icons_888888_256x240.png)}.ui-state-hover .ui-icon,.ui-state-focus .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-active .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_2e83ff_256x240.png)}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_cd0a0a_256x240.png)}.ui-icon-carat-1-n{background-position:0 0}.ui-icon-carat-1-ne{background-position:-16px 0}.ui-icon-carat-1-e{background-position:-32px 0}.ui-icon-carat-1-se{background-position:-48px 0}.ui-icon-carat-1-s{background-position:-64px 0}.ui-icon-carat-1-sw{background-position:-80px 0}.ui-icon-carat-1-w{background-position:-96px 0}.ui-icon-carat-1-nw{background-position:-112px 0}.ui-icon-carat-2-n-s{background-position:-128px 0}.ui-icon-carat-2-e-w{background-position:-144px 0}.ui-icon-triangle-1-n{background-position:0 -16px}.ui-icon-triangle-1-ne{background-position:-16px -16px}.ui-icon-triangle-1-e{background-position:-32px -16px}.ui-icon-triangle-1-se{background-position:-48px -16px}.ui-icon-triangle-1-s{background-position:-64px -16px}.ui-icon-triangle-1-sw{background-position:-80px -16px}.ui-icon-triangle-1-w{background-position:-96px -16px}.ui-icon-triangle-1-nw{background-position:-112px -16px}.ui-icon-triangle-2-n-s{background-position:-128px -16px}.ui-icon-triangle-2-e-w{background-position:-144px -16px}.ui-icon-arrow-1-n{background-position:0 -32px}.ui-icon-arrow-1-ne{background-position:-16px -32px}.ui-icon-arrow-1-e{background-position:-32px -32px}.ui-icon-arrow-1-se{background-position:-48px -32px}.ui-icon-arrow-1-s{background-position:-64px -32px}.ui-icon-arrow-1-sw{background-position:-80px -32px}.ui-icon-arrow-1-w{background-position:-96px -32px}.ui-icon-arrow-1-nw{background-position:-112px -32px}.ui-icon-arrow-2-n-s{background-position:-128px -32px}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px}.ui-icon-arrow-2-e-w{background-position:-160px -32px}.ui-icon-arrow-2-se-nw{background-position:-176px -32px}.ui-icon-arrowstop-1-n{background-position:-192px -32px}.ui-icon-arrowstop-1-e{background-position:-208px -32px}.ui-icon-arrowstop-1-s{background-position:-224px -32px}.ui-icon-arrowstop-1-w{background-position:-240px -32px}.ui-icon-arrowthick-1-n{background-position:0 -48px}.ui-icon-arrowthick-1-ne{background-position:-16px -48px}.ui-icon-arrowthick-1-e{background-position:-32px -48px}.ui-icon-arrowthick-1-se{background-position:-48px -48px}.ui-icon-arrowthick-1-s{background-position:-64px -48px}.ui-icon-arrowthick-1-sw{background-position:-80px -48px}.ui-icon-arrowthick-1-w{background-position:-96px -48px}.ui-icon-arrowthick-1-nw{background-position:-112px -48px}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px}.ui-icon-arrowreturn-1-w{background-position:-64px -64px}.ui-icon-arrowreturn-1-n{background-position:-80px -64px}.ui-icon-arrowreturn-1-e{background-position:-96px -64px}.ui-icon-arrowreturn-1-s{background-position:-112px -64px}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px}.ui-icon-arrow-4{background-position:0 -80px}.ui-icon-arrow-4-diag{background-position:-16px -80px}.ui-icon-extlink{background-position:-32px -80px}.ui-icon-newwin{background-position:-48px -80px}.ui-icon-refresh{background-position:-64px -80px}.ui-icon-shuffle{background-position:-80px -80px}.ui-icon-transfer-e-w{background-position:-96px -80px}.ui-icon-transferthick-e-w{background-position:-112px -80px}.ui-icon-folder-collapsed{background-position:0 -96px}.ui-icon-folder-open{background-position:-16px -96px}.ui-icon-document{background-position:-32px -96px}.ui-icon-document-b{background-position:-48px -96px}.ui-icon-note{background-position:-64px -96px}.ui-icon-mail-closed{background-position:-80px -96px}.ui-icon-mail-open{background-position:-96px -96px}.ui-icon-suitcase{background-position:-112px -96px}.ui-icon-comment{background-position:-128px -96px}.ui-icon-person{background-position:-144px -96px}.ui-icon-print{background-position:-160px -96px}.ui-icon-trash{background-position:-176px -96px}.ui-icon-locked{background-position:-192px -96px}.ui-icon-unlocked{background-position:-208px -96px}.ui-icon-bookmark{background-position:-224px -96px}.ui-icon-tag{background-position:-240px -96px}.ui-icon-home{background-position:0 -112px}.ui-icon-flag{background-position:-16px -112px}.ui-icon-calendar{background-position:-32px -112px}.ui-icon-cart{background-position:-48px -112px}.ui-icon-pencil{background-position:-64px -112px}.ui-icon-clock{background-position:-80px -112px}.ui-icon-disk{background-position:-96px -112px}.ui-icon-calculator{background-position:-112px -112px}.ui-icon-zoomin{background-position:-128px -112px}.ui-icon-zoomout{background-position:-144px -112px}.ui-icon-search{background-position:-160px -112px}.ui-icon-wrench{background-position:-176px -112px}.ui-icon-gear{background-position:-192px -112px}.ui-icon-heart{background-position:-208px -112px}.ui-icon-star{background-position:-224px -112px}.ui-icon-link{background-position:-240px -112px}.ui-icon-cancel{background-position:0 -128px}.ui-icon-plus{background-position:-16px -128px}.ui-icon-plusthick{background-position:-32px -128px}.ui-icon-minus{background-position:-48px -128px}.ui-icon-minusthick{background-position:-64px -128px}.ui-icon-close{background-position:-80px -128px}.ui-icon-closethick{background-position:-96px -128px}.ui-icon-key{background-position:-112px -128px}.ui-icon-lightbulb{background-position:-128px -128px}.ui-icon-scissors{background-position:-144px -128px}.ui-icon-clipboard{background-position:-160px -128px}.ui-icon-copy{background-position:-176px -128px}.ui-icon-contact{background-position:-192px -128px}.ui-icon-image{background-position:-208px -128px}.ui-icon-video{background-position:-224px -128px}.ui-icon-script{background-position:-240px -128px}.ui-icon-alert{background-position:0 -144px}.ui-icon-info{background-position:-16px -144px}.ui-icon-notice{background-position:-32px -144px}.ui-icon-help{background-position:-48px -144px}.ui-icon-check{background-position:-64px -144px}.ui-icon-bullet{background-position:-80px -144px}.ui-icon-radio-off{background-position:-96px -144px}.ui-icon-radio-on{background-position:-112px -144px}.ui-icon-pin-w{background-position:-128px -144px}.ui-icon-pin-s{background-position:-144px -144px}.ui-icon-play{background-position:0 -160px}.ui-icon-pause{background-position:-16px -160px}.ui-icon-seek-next{background-position:-32px -160px}.ui-icon-seek-prev{background-position:-48px -160px}.ui-icon-seek-end{background-position:-64px -160px}.ui-icon-seek-start{background-position:-80px -160px}.ui-icon-seek-first{background-position:-80px -160px}.ui-icon-stop{background-position:-96px -160px}.ui-icon-eject{background-position:-112px -160px}.ui-icon-volume-off{background-position:-128px -160px}.ui-icon-volume-on{background-position:-144px -160px}.ui-icon-power{background-position:0 -176px}.ui-icon-signal-diag{background-position:-16px -176px}.ui-icon-signal{background-position:-32px -176px}.ui-icon-battery-0{background-position:-48px -176px}.ui-icon-battery-1{background-position:-64px -176px}.ui-icon-battery-2{background-position:-80px -176px}.ui-icon-battery-3{background-position:-96px -176px}.ui-icon-circle-plus{background-position:0 -192px}.ui-icon-circle-minus{background-position:-16px -192px}.ui-icon-circle-close{background-position:-32px -192px}.ui-icon-circle-triangle-e{background-position:-48px -192px}.ui-icon-circle-triangle-s{background-position:-64px -192px}.ui-icon-circle-triangle-w{background-position:-80px -192px}.ui-icon-circle-triangle-n{background-position:-96px -192px}.ui-icon-circle-arrow-e{background-position:-112px -192px}.ui-icon-circle-arrow-s{background-position:-128px -192px}.ui-icon-circle-arrow-w{background-position:-144px -192px}.ui-icon-circle-arrow-n{background-position:-160px -192px}.ui-icon-circle-zoomin{background-position:-176px -192px}.ui-icon-circle-zoomout{background-position:-192px -192px}.ui-icon-circle-check{background-position:-208px -192px}.ui-icon-circlesmall-plus{background-position:0 -208px}.ui-icon-circlesmall-minus{background-position:-16px -208px}.ui-icon-circlesmall-close{background-position:-32px -208px}.ui-icon-squaresmall-plus{background-position:-48px -208px}.ui-icon-squaresmall-minus{background-position:-64px -208px}.ui-icon-squaresmall-close{background-position:-80px -208px}.ui-icon-grip-dotted-vertical{background-position:0 -224px}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px}.ui-icon-grip-solid-vertical{background-position:-32px -224px}.ui-icon-grip-solid-horizontal{background-position:-48px -224px}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px}.ui-icon-grip-diagonal-se{background-position:-80px -224px}.ui-corner-all,.ui-corner-top,.ui-corner-left,.ui-corner-tl{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;-khtml-border-top-left-radius:4px;border-top-left-radius:4px}.ui-corner-all,.ui-corner-top,.ui-corner-right,.ui-corner-tr{-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;-khtml-border-top-right-radius:4px;border-top-right-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-left,.ui-corner-bl{-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;-khtml-border-bottom-left-radius:4px;border-bottom-left-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-right,.ui-corner-br{-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;-khtml-border-bottom-right-radius:4px;border-bottom-right-radius:4px}.ui-widget-overlay{background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30)}.ui-widget-shadow{margin:-8px 0 0 -8px;padding:8px;background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30);-moz-border-radius:8px;-khtml-border-radius:8px;-webkit-border-radius:8px;border-radius:8px} \ No newline at end of file diff --git a/DAL/DataContext.cs b/DAL/DataContext.cs index bea83c5..0bc8f1b 100644 --- a/DAL/DataContext.cs +++ b/DAL/DataContext.cs @@ -10,6 +10,14 @@ namespace JSGridWebAPISample.DAL { public class DataContext: DbContext { + /// + /// It is always recommended to EXPLICITLY define the name of connectionstring as not defining connectionstring gives issues in VS 2015 and above + /// + public DataContext() : base("name=DefaultConnection") + { + + } + public DbSet Client { get; set; } protected override void OnModelCreating(DbModelBuilder modelBuilder) { diff --git a/JSGridWebAPISample.csproj b/JSGridWebAPISample.csproj index 8e21958..d08e8c3 100644 --- a/JSGridWebAPISample.csproj +++ b/JSGridWebAPISample.csproj @@ -20,6 +20,7 @@ + true @@ -39,109 +40,116 @@ 4 + + packages\WebGrease.1.3.0\lib\Antlr3.Runtime.dll + True + - False - ..\packages\EntityFramework.6.1.3\lib\net45\EntityFramework.dll + packages\EntityFramework.6.1.3\lib\net45\EntityFramework.dll + True - - ..\packages\EntityFramework.6.1.3\lib\net45\EntityFramework.SqlServer.dll + + packages\EntityFramework.6.1.3\lib\net45\EntityFramework.SqlServer.dll + True - - - - - - - - - - - - - - + + packages\Microsoft.Data.Edm.5.2.0\lib\net40\Microsoft.Data.Edm.dll + True + + + packages\Microsoft.Data.OData.5.2.0\lib\net40\Microsoft.Data.OData.dll + True + + packages\Microsoft.Web.Infrastructure.1.0.0.0\lib\net40\Microsoft.Web.Infrastructure.dll True - ..\packages\Microsoft.Web.Infrastructure.1.0.0.0\lib\net40\Microsoft.Web.Infrastructure.dll + packages\Microsoft.AspNet.Mvc.FixedDisplayModes.1.0.0\lib\net40\Microsoft.Web.Mvc.FixedDisplayModes.dll True - ..\packages\Microsoft.AspNet.Mvc.FixedDisplayModes.1.0.0\lib\net40\Microsoft.Web.Mvc.FixedDisplayModes.dll - - ..\packages\Newtonsoft.Json.4.5.11\lib\net40\Newtonsoft.Json.dll - - + + packages\Newtonsoft.Json.4.5.11\lib\net40\Newtonsoft.Json.dll + True + + + - ..\packages\Microsoft.AspNet.WebApi.Client.4.0.30506.0\lib\net40\System.Net.Http.Formatting.dll + packages\Microsoft.AspNet.WebApi.Client.4.0.30506.0\lib\net40\System.Net.Http.Formatting.dll + True - + + packages\System.Spatial.5.2.0\lib\net40\System.Spatial.dll + True + + + + + + packages\Microsoft.AspNet.WebPages.2.0.30506.0\lib\net40\System.Web.Helpers.dll True - ..\packages\Microsoft.AspNet.WebPages.2.0.30506.0\lib\net40\System.Web.Helpers.dll - ..\packages\Microsoft.AspNet.WebApi.Core.4.0.30506.0\lib\net40\System.Web.Http.dll - - - ..\packages\Microsoft.AspNet.WebApi.WebHost.4.0.30506.0\lib\net40\System.Web.Http.WebHost.dll - - + packages\Microsoft.AspNet.WebApi.Core.4.0.30506.0\lib\net40\System.Web.Http.dll True - ..\packages\Microsoft.AspNet.Mvc.4.0.30506.0\lib\net40\System.Web.Mvc.dll - - ..\packages\Microsoft.AspNet.Web.Optimization.1.0.0\lib\net40\System.Web.Optimization.dll - - - ..\packages\Microsoft.AspNet.Providers.Core.1.2\lib\net40\System.Web.Providers.dll - - + + packages\Microsoft.AspNet.WebApi.OData.4.0.30506\lib\net40\System.Web.Http.OData.dll True - ..\packages\Microsoft.AspNet.Razor.2.0.30506.0\lib\net40\System.Web.Razor.dll - + + packages\Microsoft.AspNet.WebApi.Tracing.4.0.30506\lib\net40\System.Web.Http.Tracing.dll True - ..\packages\Microsoft.AspNet.WebPages.2.0.30506.0\lib\net40\System.Web.WebPages.dll - + + packages\Microsoft.AspNet.WebApi.WebHost.4.0.30506.0\lib\net40\System.Web.Http.WebHost.dll True - ..\packages\Microsoft.AspNet.WebPages.2.0.30506.0\lib\net40\System.Web.WebPages.Deployment.dll - + + packages\Microsoft.AspNet.Mvc.4.0.30506.0\lib\net40\System.Web.Mvc.dll True - ..\packages\Microsoft.AspNet.WebPages.2.0.30506.0\lib\net40\System.Web.WebPages.Razor.dll - + + packages\Microsoft.AspNet.Web.Optimization.1.0.0\lib\net40\System.Web.Optimization.dll True - ..\packages\Microsoft.AspNet.WebApi.Tracing.4.0.30506\lib\net40\System.Web.Http.Tracing.dll - + + packages\Microsoft.AspNet.Providers.Core.1.2\lib\net40\System.Web.Providers.dll True - ..\packages\Microsoft.AspNet.WebApi.OData.4.0.30506\lib\net40\System.Web.Http.OData.dll - + + packages\Microsoft.AspNet.Razor.2.0.30506.0\lib\net40\System.Web.Razor.dll True - ..\packages\Microsoft.Data.Edm.5.2.0\lib\net40\Microsoft.Data.Edm.dll - + + packages\Microsoft.AspNet.WebPages.2.0.30506.0\lib\net40\System.Web.WebPages.dll True - ..\packages\Microsoft.Data.OData.5.2.0\lib\net40\Microsoft.Data.OData.dll - + + packages\Microsoft.AspNet.WebPages.2.0.30506.0\lib\net40\System.Web.WebPages.Deployment.dll True - ..\packages\System.Spatial.5.2.0\lib\net40\System.Spatial.dll - + + packages\Microsoft.AspNet.WebPages.2.0.30506.0\lib\net40\System.Web.WebPages.Razor.dll True - ..\packages\WebGrease.1.3.0\lib\WebGrease.dll - + + + + + + + + + + + + packages\WebGrease.1.3.0\lib\WebGrease.dll True - ..\packages\WebGrease.1.3.0\lib\Antlr3.Runtime.dll @@ -149,6 +157,20 @@ + + + + + + + + + + + + + + @@ -162,10 +184,90 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + Web.config @@ -184,9 +286,6 @@ - - - 10.0 $(MSBuildExtensionsPath32)\Microsoft\VisualStudio\v$(VisualStudioVersion) diff --git a/JSGridWebAPISample.sln b/JSGridWebAPISample.sln new file mode 100644 index 0000000..0052882 --- /dev/null +++ b/JSGridWebAPISample.sln @@ -0,0 +1,22 @@ + +Microsoft Visual Studio Solution File, Format Version 12.00 +# Visual Studio 14 +VisualStudioVersion = 14.0.25420.1 +MinimumVisualStudioVersion = 10.0.40219.1 +Project("{FAE04EC0-301F-11D3-BF4B-00C04F79EFBC}") = "JSGridWebAPISample", "JSGridWebAPISample.csproj", "{560BE71C-3CB2-46D4-B9A2-2B5AE7865118}" +EndProject +Global + GlobalSection(SolutionConfigurationPlatforms) = preSolution + Debug|Any CPU = Debug|Any CPU + Release|Any CPU = Release|Any CPU + EndGlobalSection + GlobalSection(ProjectConfigurationPlatforms) = postSolution + {560BE71C-3CB2-46D4-B9A2-2B5AE7865118}.Debug|Any CPU.ActiveCfg = Debug|Any CPU + {560BE71C-3CB2-46D4-B9A2-2B5AE7865118}.Debug|Any CPU.Build.0 = Debug|Any CPU + {560BE71C-3CB2-46D4-B9A2-2B5AE7865118}.Release|Any CPU.ActiveCfg = Release|Any CPU + {560BE71C-3CB2-46D4-B9A2-2B5AE7865118}.Release|Any CPU.Build.0 = Release|Any CPU + EndGlobalSection + GlobalSection(SolutionProperties) = preSolution + HideSolutionNode = FALSE + EndGlobalSection +EndGlobal diff --git a/Scripts/_references.js b/Scripts/_references.js index 2b10807133bb3a3f252ba5a40f8d18f03eccb413..c36bb73856745dfef5a5e1e7349f7a9e2194dde1 100644 GIT binary patch delta 9 QcmWFvn-Ijp%fQ6|01MLrrT_o{ delta 4 LcmWFwnh*p41H=J~ diff --git a/Scripts/jquery-1.8.2.js b/Scripts/jquery-1.8.2.js index 32c9010..12c7797 100644 --- a/Scripts/jquery-1.8.2.js +++ b/Scripts/jquery-1.8.2.js @@ -1,17 +1,3 @@ -/* NUGET: BEGIN LICENSE TEXT - * - * Microsoft grants you the right to use these script files for the sole - * purpose of either: (i) interacting through your browser with the Microsoft - * website or online service, subject to the applicable licensing or use - * terms; or (ii) using the files as included with a Microsoft product subject - * to that product's license terms. Microsoft reserves all other rights to the - * files not expressly granted by Microsoft, whether by implication, estoppel - * or otherwise. Insofar as a script file is dual licensed under GPL, - * Microsoft neither took the code under GPL nor distributes it thereunder but - * under the terms set out in this paragraph. All notices and licenses - * below are for informational purposes only. - * - * NUGET: END LICENSE TEXT */ /*! * jQuery JavaScript Library v1.8.2 * http://jquery.com/ diff --git a/Scripts/jquery-1.8.2.min.js b/Scripts/jquery-1.8.2.min.js index a41a9d4..bc3fbc8 100644 --- a/Scripts/jquery-1.8.2.min.js +++ b/Scripts/jquery-1.8.2.min.js @@ -1,19 +1,2 @@ -/* NUGET: BEGIN LICENSE TEXT - * - * Microsoft grants you the right to use these script files for the sole - * purpose of either: (i) interacting through your browser with the Microsoft - * website or online service, subject to the applicable licensing or use - * terms; or (ii) using the files as included with a Microsoft product subject - * to that product's license terms. Microsoft reserves all other rights to the - * files not expressly granted by Microsoft, whether by implication, estoppel - * or otherwise. Insofar as a script file is dual licensed under GPL, - * Microsoft neither took the code under GPL nor distributes it thereunder but - * under the terms set out in this paragraph. All notices and licenses - * below are for informational purposes only. - * - * JQUERY CORE 1.8.2; Copyright 2012 jQuery Foundation and other contributors; http://jquery.org/license - * Includes Sizzle CSS Selector Engine; Copyright 2012 jQuery Foundation and other contributors; http://opensource.org/licenses/MIT - * - * NUGET: END LICENSE TEXT */ /*! jQuery v1.8.2 jquery.com | jquery.org/license */ (function(a,b){function G(a){var b=F[a]={};return p.each(a.split(s),function(a,c){b[c]=!0}),b}function J(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(I,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:+d+""===d?+d:H.test(d)?p.parseJSON(d):d}catch(f){}p.data(a,c,d)}else d=b}return d}function K(a){var b;for(b in a){if(b==="data"&&p.isEmptyObject(a[b]))continue;if(b!=="toJSON")return!1}return!0}function ba(){return!1}function bb(){return!0}function bh(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function bi(a,b){do a=a[b];while(a&&a.nodeType!==1);return a}function bj(a,b,c){b=b||0;if(p.isFunction(b))return p.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return p.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=p.grep(a,function(a){return a.nodeType===1});if(be.test(b))return p.filter(b,d,!c);b=p.filter(b,d)}return p.grep(a,function(a,d){return p.inArray(a,b)>=0===c})}function bk(a){var b=bl.split("|"),c=a.createDocumentFragment();if(c.createElement)while(b.length)c.createElement(b.pop());return c}function bC(a,b){return a.getElementsByTagName(b)[0]||a.appendChild(a.ownerDocument.createElement(b))}function bD(a,b){if(b.nodeType!==1||!p.hasData(a))return;var c,d,e,f=p._data(a),g=p._data(b,f),h=f.events;if(h){delete g.handle,g.events={};for(c in h)for(d=0,e=h[c].length;d").appendTo(e.body),c=b.css("display");b.remove();if(c==="none"||c===""){bI=e.body.appendChild(bI||p.extend(e.createElement("iframe"),{frameBorder:0,width:0,height:0}));if(!bJ||!bI.createElement)bJ=(bI.contentWindow||bI.contentDocument).document,bJ.write(""),bJ.close();b=bJ.body.appendChild(bJ.createElement(a)),c=bH(b,"display"),e.body.removeChild(bI)}return bS[a]=c,c}function ci(a,b,c,d){var e;if(p.isArray(b))p.each(b,function(b,e){c||ce.test(a)?d(a,e):ci(a+"["+(typeof e=="object"?b:"")+"]",e,c,d)});else if(!c&&p.type(b)==="object")for(e in b)ci(a+"["+e+"]",b[e],c,d);else d(a,b)}function cz(a){return function(b,c){typeof b!="string"&&(c=b,b="*");var d,e,f,g=b.toLowerCase().split(s),h=0,i=g.length;if(p.isFunction(c))for(;h)[^>]*$|#([\w\-]*)$)/,v=/^<(\w+)\s*\/?>(?:<\/\1>|)$/,w=/^[\],:{}\s]*$/,x=/(?:^|:|,)(?:\s*\[)+/g,y=/\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g,z=/"[^"\\\r\n]*"|true|false|null|-?(?:\d\d*\.|)\d+(?:[eE][\-+]?\d+|)/g,A=/^-ms-/,B=/-([\da-z])/gi,C=function(a,b){return(b+"").toUpperCase()},D=function(){e.addEventListener?(e.removeEventListener("DOMContentLoaded",D,!1),p.ready()):e.readyState==="complete"&&(e.detachEvent("onreadystatechange",D),p.ready())},E={};p.fn=p.prototype={constructor:p,init:function(a,c,d){var f,g,h,i;if(!a)return this;if(a.nodeType)return this.context=this[0]=a,this.length=1,this;if(typeof a=="string"){a.charAt(0)==="<"&&a.charAt(a.length-1)===">"&&a.length>=3?f=[null,a,null]:f=u.exec(a);if(f&&(f[1]||!c)){if(f[1])return c=c instanceof p?c[0]:c,i=c&&c.nodeType?c.ownerDocument||c:e,a=p.parseHTML(f[1],i,!0),v.test(f[1])&&p.isPlainObject(c)&&this.attr.call(a,c,!0),p.merge(this,a);g=e.getElementById(f[2]);if(g&&g.parentNode){if(g.id!==f[2])return d.find(a);this.length=1,this[0]=g}return this.context=e,this.selector=a,this}return!c||c.jquery?(c||d).find(a):this.constructor(c).find(a)}return p.isFunction(a)?d.ready(a):(a.selector!==b&&(this.selector=a.selector,this.context=a.context),p.makeArray(a,this))},selector:"",jquery:"1.8.2",length:0,size:function(){return this.length},toArray:function(){return k.call(this)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=p.merge(this.constructor(),a);return d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")"),d},each:function(a,b){return p.each(this,a,b)},ready:function(a){return p.ready.promise().done(a),this},eq:function(a){return a=+a,a===-1?this.slice(a):this.slice(a,a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(k.apply(this,arguments),"slice",k.call(arguments).join(","))},map:function(a){return this.pushStack(p.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:j,sort:[].sort,splice:[].splice},p.fn.init.prototype=p.fn,p.extend=p.fn.extend=function(){var a,c,d,e,f,g,h=arguments[0]||{},i=1,j=arguments.length,k=!1;typeof h=="boolean"&&(k=h,h=arguments[1]||{},i=2),typeof h!="object"&&!p.isFunction(h)&&(h={}),j===i&&(h=this,--i);for(;i0)return;d.resolveWith(e,[p]),p.fn.trigger&&p(e).trigger("ready").off("ready")},isFunction:function(a){return p.type(a)==="function"},isArray:Array.isArray||function(a){return p.type(a)==="array"},isWindow:function(a){return a!=null&&a==a.window},isNumeric:function(a){return!isNaN(parseFloat(a))&&isFinite(a)},type:function(a){return a==null?String(a):E[m.call(a)]||"object"},isPlainObject:function(a){if(!a||p.type(a)!=="object"||a.nodeType||p.isWindow(a))return!1;try{if(a.constructor&&!n.call(a,"constructor")&&!n.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||n.call(a,d)},isEmptyObject:function(a){var b;for(b in a)return!1;return!0},error:function(a){throw new Error(a)},parseHTML:function(a,b,c){var d;return!a||typeof a!="string"?null:(typeof b=="boolean"&&(c=b,b=0),b=b||e,(d=v.exec(a))?[b.createElement(d[1])]:(d=p.buildFragment([a],b,c?null:[]),p.merge([],(d.cacheable?p.clone(d.fragment):d.fragment).childNodes)))},parseJSON:function(b){if(!b||typeof b!="string")return null;b=p.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(w.test(b.replace(y,"@").replace(z,"]").replace(x,"")))return(new Function("return "+b))();p.error("Invalid JSON: "+b)},parseXML:function(c){var d,e;if(!c||typeof c!="string")return null;try{a.DOMParser?(e=new DOMParser,d=e.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(f){d=b}return(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&p.error("Invalid XML: "+c),d},noop:function(){},globalEval:function(b){b&&r.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(A,"ms-").replace(B,C)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toLowerCase()===b.toLowerCase()},each:function(a,c,d){var e,f=0,g=a.length,h=g===b||p.isFunction(a);if(d){if(h){for(e in a)if(c.apply(a[e],d)===!1)break}else for(;f0&&a[0]&&a[i-1]||i===0||p.isArray(a));if(j)for(;h-1)i.splice(c,1),e&&(c<=g&&g--,c<=h&&h--)}),this},has:function(a){return p.inArray(a,i)>-1},empty:function(){return i=[],this},disable:function(){return i=j=c=b,this},disabled:function(){return!i},lock:function(){return j=b,c||l.disable(),this},locked:function(){return!j},fireWith:function(a,b){return b=b||[],b=[a,b.slice?b.slice():b],i&&(!d||j)&&(e?j.push(b):k(b)),this},fire:function(){return l.fireWith(this,arguments),this},fired:function(){return!!d}};return l},p.extend({Deferred:function(a){var b=[["resolve","done",p.Callbacks("once memory"),"resolved"],["reject","fail",p.Callbacks("once memory"),"rejected"],["notify","progress",p.Callbacks("memory")]],c="pending",d={state:function(){return c},always:function(){return e.done(arguments).fail(arguments),this},then:function(){var a=arguments;return p.Deferred(function(c){p.each(b,function(b,d){var f=d[0],g=a[b];e[d[1]](p.isFunction(g)?function(){var a=g.apply(this,arguments);a&&p.isFunction(a.promise)?a.promise().done(c.resolve).fail(c.reject).progress(c.notify):c[f+"With"](this===e?c:this,[a])}:c[f])}),a=null}).promise()},promise:function(a){return a!=null?p.extend(a,d):d}},e={};return d.pipe=d.then,p.each(b,function(a,f){var g=f[2],h=f[3];d[f[1]]=g.add,h&&g.add(function(){c=h},b[a^1][2].disable,b[2][2].lock),e[f[0]]=g.fire,e[f[0]+"With"]=g.fireWith}),d.promise(e),a&&a.call(e,e),e},when:function(a){var b=0,c=k.call(arguments),d=c.length,e=d!==1||a&&p.isFunction(a.promise)?d:0,f=e===1?a:p.Deferred(),g=function(a,b,c){return function(d){b[a]=this,c[a]=arguments.length>1?k.call(arguments):d,c===h?f.notifyWith(b,c):--e||f.resolveWith(b,c)}},h,i,j;if(d>1){h=new Array(d),i=new Array(d),j=new Array(d);for(;b
a",c=n.getElementsByTagName("*"),d=n.getElementsByTagName("a")[0],d.style.cssText="top:1px;float:left;opacity:.5";if(!c||!c.length)return{};f=e.createElement("select"),g=f.appendChild(e.createElement("option")),h=n.getElementsByTagName("input")[0],b={leadingWhitespace:n.firstChild.nodeType===3,tbody:!n.getElementsByTagName("tbody").length,htmlSerialize:!!n.getElementsByTagName("link").length,style:/top/.test(d.getAttribute("style")),hrefNormalized:d.getAttribute("href")==="/a",opacity:/^0.5/.test(d.style.opacity),cssFloat:!!d.style.cssFloat,checkOn:h.value==="on",optSelected:g.selected,getSetAttribute:n.className!=="t",enctype:!!e.createElement("form").enctype,html5Clone:e.createElement("nav").cloneNode(!0).outerHTML!=="<:nav>",boxModel:e.compatMode==="CSS1Compat",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0,boxSizingReliable:!0,pixelPosition:!1},h.checked=!0,b.noCloneChecked=h.cloneNode(!0).checked,f.disabled=!0,b.optDisabled=!g.disabled;try{delete n.test}catch(o){b.deleteExpando=!1}!n.addEventListener&&n.attachEvent&&n.fireEvent&&(n.attachEvent("onclick",m=function(){b.noCloneEvent=!1}),n.cloneNode(!0).fireEvent("onclick"),n.detachEvent("onclick",m)),h=e.createElement("input"),h.value="t",h.setAttribute("type","radio"),b.radioValue=h.value==="t",h.setAttribute("checked","checked"),h.setAttribute("name","t"),n.appendChild(h),i=e.createDocumentFragment(),i.appendChild(n.lastChild),b.checkClone=i.cloneNode(!0).cloneNode(!0).lastChild.checked,b.appendChecked=h.checked,i.removeChild(h),i.appendChild(n);if(n.attachEvent)for(k in{submit:!0,change:!0,focusin:!0})j="on"+k,l=j in n,l||(n.setAttribute(j,"return;"),l=typeof n[j]=="function"),b[k+"Bubbles"]=l;return p(function(){var c,d,f,g,h="padding:0;margin:0;border:0;display:block;overflow:hidden;",i=e.getElementsByTagName("body")[0];if(!i)return;c=e.createElement("div"),c.style.cssText="visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px",i.insertBefore(c,i.firstChild),d=e.createElement("div"),c.appendChild(d),d.innerHTML="
t
",f=d.getElementsByTagName("td"),f[0].style.cssText="padding:0;margin:0;border:0;display:none",l=f[0].offsetHeight===0,f[0].style.display="",f[1].style.display="none",b.reliableHiddenOffsets=l&&f[0].offsetHeight===0,d.innerHTML="",d.style.cssText="box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;",b.boxSizing=d.offsetWidth===4,b.doesNotIncludeMarginInBodyOffset=i.offsetTop!==1,a.getComputedStyle&&(b.pixelPosition=(a.getComputedStyle(d,null)||{}).top!=="1%",b.boxSizingReliable=(a.getComputedStyle(d,null)||{width:"4px"}).width==="4px",g=e.createElement("div"),g.style.cssText=d.style.cssText=h,g.style.marginRight=g.style.width="0",d.style.width="1px",d.appendChild(g),b.reliableMarginRight=!parseFloat((a.getComputedStyle(g,null)||{}).marginRight)),typeof d.style.zoom!="undefined"&&(d.innerHTML="",d.style.cssText=h+"width:1px;padding:1px;display:inline;zoom:1",b.inlineBlockNeedsLayout=d.offsetWidth===3,d.style.display="block",d.style.overflow="visible",d.innerHTML="
",d.firstChild.style.width="5px",b.shrinkWrapBlocks=d.offsetWidth!==3,c.style.zoom=1),i.removeChild(c),c=d=f=g=null}),i.removeChild(n),c=d=f=g=h=i=n=null,b}();var H=/(?:\{[\s\S]*\}|\[[\s\S]*\])$/,I=/([A-Z])/g;p.extend({cache:{},deletedIds:[],uuid:0,expando:"jQuery"+(p.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){return a=a.nodeType?p.cache[a[p.expando]]:a[p.expando],!!a&&!K(a)},data:function(a,c,d,e){if(!p.acceptData(a))return;var f,g,h=p.expando,i=typeof c=="string",j=a.nodeType,k=j?p.cache:a,l=j?a[h]:a[h]&&h;if((!l||!k[l]||!e&&!k[l].data)&&i&&d===b)return;l||(j?a[h]=l=p.deletedIds.pop()||p.guid++:l=h),k[l]||(k[l]={},j||(k[l].toJSON=p.noop));if(typeof c=="object"||typeof c=="function")e?k[l]=p.extend(k[l],c):k[l].data=p.extend(k[l].data,c);return f=k[l],e||(f.data||(f.data={}),f=f.data),d!==b&&(f[p.camelCase(c)]=d),i?(g=f[c],g==null&&(g=f[p.camelCase(c)])):g=f,g},removeData:function(a,b,c){if(!p.acceptData(a))return;var d,e,f,g=a.nodeType,h=g?p.cache:a,i=g?a[p.expando]:p.expando;if(!h[i])return;if(b){d=c?h[i]:h[i].data;if(d){p.isArray(b)||(b in d?b=[b]:(b=p.camelCase(b),b in d?b=[b]:b=b.split(" ")));for(e=0,f=b.length;e1,null,!1))},removeData:function(a){return this.each(function(){p.removeData(this,a)})}}),p.extend({queue:function(a,b,c){var d;if(a)return b=(b||"fx")+"queue",d=p._data(a,b),c&&(!d||p.isArray(c)?d=p._data(a,b,p.makeArray(c)):d.push(c)),d||[]},dequeue:function(a,b){b=b||"fx";var c=p.queue(a,b),d=c.length,e=c.shift(),f=p._queueHooks(a,b),g=function(){p.dequeue(a,b)};e==="inprogress"&&(e=c.shift(),d--),e&&(b==="fx"&&c.unshift("inprogress"),delete f.stop,e.call(a,g,f)),!d&&f&&f.empty.fire()},_queueHooks:function(a,b){var c=b+"queueHooks";return p._data(a,c)||p._data(a,c,{empty:p.Callbacks("once memory").add(function(){p.removeData(a,b+"queue",!0),p.removeData(a,c,!0)})})}}),p.fn.extend({queue:function(a,c){var d=2;return typeof a!="string"&&(c=a,a="fx",d--),arguments.length1)},removeAttr:function(a){return this.each(function(){p.removeAttr(this,a)})},prop:function(a,b){return p.access(this,p.prop,a,b,arguments.length>1)},removeProp:function(a){return a=p.propFix[a]||a,this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,f,g,h;if(p.isFunction(a))return this.each(function(b){p(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(s);for(c=0,d=this.length;c=0)d=d.replace(" "+c[f]+" "," ");e.className=a?p.trim(d):""}}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";return p.isFunction(a)?this.each(function(c){p(this).toggleClass(a.call(this,c,this.className,b),b)}):this.each(function(){if(c==="string"){var e,f=0,g=p(this),h=b,i=a.split(s);while(e=i[f++])h=d?h:!g.hasClass(e),g[h?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&p._data(this,"__className__",this.className),this.className=this.className||a===!1?"":p._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ",c=0,d=this.length;for(;c=0)return!0;return!1},val:function(a){var c,d,e,f=this[0];if(!arguments.length){if(f)return c=p.valHooks[f.type]||p.valHooks[f.nodeName.toLowerCase()],c&&"get"in c&&(d=c.get(f,"value"))!==b?d:(d=f.value,typeof d=="string"?d.replace(P,""):d==null?"":d);return}return e=p.isFunction(a),this.each(function(d){var f,g=p(this);if(this.nodeType!==1)return;e?f=a.call(this,d,g.val()):f=a,f==null?f="":typeof f=="number"?f+="":p.isArray(f)&&(f=p.map(f,function(a){return a==null?"":a+""})),c=p.valHooks[this.type]||p.valHooks[this.nodeName.toLowerCase()];if(!c||!("set"in c)||c.set(this,f,"value")===b)this.value=f})}}),p.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c,d,e,f=a.selectedIndex,g=[],h=a.options,i=a.type==="select-one";if(f<0)return null;c=i?f:0,d=i?f+1:h.length;for(;c=0}),c.length||(a.selectedIndex=-1),c}}},attrFn:{},attr:function(a,c,d,e){var f,g,h,i=a.nodeType;if(!a||i===3||i===8||i===2)return;if(e&&p.isFunction(p.fn[c]))return p(a)[c](d);if(typeof a.getAttribute=="undefined")return p.prop(a,c,d);h=i!==1||!p.isXMLDoc(a),h&&(c=c.toLowerCase(),g=p.attrHooks[c]||(T.test(c)?M:L));if(d!==b){if(d===null){p.removeAttr(a,c);return}return g&&"set"in g&&h&&(f=g.set(a,d,c))!==b?f:(a.setAttribute(c,d+""),d)}return g&&"get"in g&&h&&(f=g.get(a,c))!==null?f:(f=a.getAttribute(c),f===null?b:f)},removeAttr:function(a,b){var c,d,e,f,g=0;if(b&&a.nodeType===1){d=b.split(s);for(;g=0}})});var V=/^(?:textarea|input|select)$/i,W=/^([^\.]*|)(?:\.(.+)|)$/,X=/(?:^|\s)hover(\.\S+|)\b/,Y=/^key/,Z=/^(?:mouse|contextmenu)|click/,$=/^(?:focusinfocus|focusoutblur)$/,_=function(a){return p.event.special.hover?a:a.replace(X,"mouseenter$1 mouseleave$1")};p.event={add:function(a,c,d,e,f){var g,h,i,j,k,l,m,n,o,q,r;if(a.nodeType===3||a.nodeType===8||!c||!d||!(g=p._data(a)))return;d.handler&&(o=d,d=o.handler,f=o.selector),d.guid||(d.guid=p.guid++),i=g.events,i||(g.events=i={}),h=g.handle,h||(g.handle=h=function(a){return typeof p!="undefined"&&(!a||p.event.triggered!==a.type)?p.event.dispatch.apply(h.elem,arguments):b},h.elem=a),c=p.trim(_(c)).split(" ");for(j=0;j=0&&(s=s.slice(0,-1),i=!0),s.indexOf(".")>=0&&(t=s.split("."),s=t.shift(),t.sort());if((!f||p.event.customEvent[s])&&!p.event.global[s])return;c=typeof c=="object"?c[p.expando]?c:new p.Event(s,c):new p.Event(s),c.type=s,c.isTrigger=!0,c.exclusive=i,c.namespace=t.join("."),c.namespace_re=c.namespace?new RegExp("(^|\\.)"+t.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,m=s.indexOf(":")<0?"on"+s:"";if(!f){h=p.cache;for(j in h)h[j].events&&h[j].events[s]&&p.event.trigger(c,d,h[j].handle.elem,!0);return}c.result=b,c.target||(c.target=f),d=d!=null?p.makeArray(d):[],d.unshift(c),n=p.event.special[s]||{};if(n.trigger&&n.trigger.apply(f,d)===!1)return;q=[[f,n.bindType||s]];if(!g&&!n.noBubble&&!p.isWindow(f)){r=n.delegateType||s,k=$.test(r+s)?f:f.parentNode;for(l=f;k;k=k.parentNode)q.push([k,r]),l=k;l===(f.ownerDocument||e)&&q.push([l.defaultView||l.parentWindow||a,r])}for(j=0;j=0:p.find(m,this,null,[f]).length),h[m]&&j.push(l);j.length&&u.push({elem:f,matches:j})}o.length>q&&u.push({elem:this,matches:o.slice(q)});for(d=0;d0?this.on(b,null,a,c):this.trigger(b)},Y.test(b)&&(p.event.fixHooks[b]=p.event.keyHooks),Z.test(b)&&(p.event.fixHooks[b]=p.event.mouseHooks)}),function(a,b){function bc(a,b,c,d){c=c||[],b=b||r;var e,f,i,j,k=b.nodeType;if(!a||typeof a!="string")return c;if(k!==1&&k!==9)return[];i=g(b);if(!i&&!d)if(e=P.exec(a))if(j=e[1]){if(k===9){f=b.getElementById(j);if(!f||!f.parentNode)return c;if(f.id===j)return c.push(f),c}else if(b.ownerDocument&&(f=b.ownerDocument.getElementById(j))&&h(b,f)&&f.id===j)return c.push(f),c}else{if(e[2])return w.apply(c,x.call(b.getElementsByTagName(a),0)),c;if((j=e[3])&&_&&b.getElementsByClassName)return w.apply(c,x.call(b.getElementsByClassName(j),0)),c}return bp(a.replace(L,"$1"),b,c,d,i)}function bd(a){return function(b){var c=b.nodeName.toLowerCase();return c==="input"&&b.type===a}}function be(a){return function(b){var c=b.nodeName.toLowerCase();return(c==="input"||c==="button")&&b.type===a}}function bf(a){return z(function(b){return b=+b,z(function(c,d){var e,f=a([],c.length,b),g=f.length;while(g--)c[e=f[g]]&&(c[e]=!(d[e]=c[e]))})})}function bg(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}function bh(a,b){var c,d,f,g,h,i,j,k=C[o][a];if(k)return b?0:k.slice(0);h=a,i=[],j=e.preFilter;while(h){if(!c||(d=M.exec(h)))d&&(h=h.slice(d[0].length)),i.push(f=[]);c=!1;if(d=N.exec(h))f.push(c=new q(d.shift())),h=h.slice(c.length),c.type=d[0].replace(L," ");for(g in e.filter)(d=W[g].exec(h))&&(!j[g]||(d=j[g](d,r,!0)))&&(f.push(c=new q(d.shift())),h=h.slice(c.length),c.type=g,c.matches=d);if(!c)break}return b?h.length:h?bc.error(a):C(a,i).slice(0)}function bi(a,b,d){var e=b.dir,f=d&&b.dir==="parentNode",g=u++;return b.first?function(b,c,d){while(b=b[e])if(f||b.nodeType===1)return a(b,c,d)}:function(b,d,h){if(!h){var i,j=t+" "+g+" ",k=j+c;while(b=b[e])if(f||b.nodeType===1){if((i=b[o])===k)return b.sizset;if(typeof i=="string"&&i.indexOf(j)===0){if(b.sizset)return b}else{b[o]=k;if(a(b,d,h))return b.sizset=!0,b;b.sizset=!1}}}else while(b=b[e])if(f||b.nodeType===1)if(a(b,d,h))return b}}function bj(a){return a.length>1?function(b,c,d){var e=a.length;while(e--)if(!a[e](b,c,d))return!1;return!0}:a[0]}function bk(a,b,c,d,e){var f,g=[],h=0,i=a.length,j=b!=null;for(;h-1},h,!0),m=[function(a,c,d){return!g&&(d||c!==l)||((b=c).nodeType?j(a,c,d):k(a,c,d))}];for(;i1&&bj(m),i>1&&a.slice(0,i-1).join("").replace(L,"$1"),c,i0,f=a.length>0,g=function(h,i,j,k,m){var n,o,p,q=[],s=0,u="0",x=h&&[],y=m!=null,z=l,A=h||f&&e.find.TAG("*",m&&i.parentNode||i),B=t+=z==null?1:Math.E;y&&(l=i!==r&&i,c=g.el);for(;(n=A[u])!=null;u++){if(f&&n){for(o=0;p=a[o];o++)if(p(n,i,j)){k.push(n);break}y&&(t=B,c=++g.el)}d&&((n=!p&&n)&&s--,h&&x.push(n))}s+=u;if(d&&u!==s){for(o=0;p=b[o];o++)p(x,q,i,j);if(h){if(s>0)while(u--)!x[u]&&!q[u]&&(q[u]=v.call(k));q=bk(q)}w.apply(k,q),y&&!h&&q.length>0&&s+b.length>1&&bc.uniqueSort(k)}return y&&(t=B,l=z),x};return g.el=0,d?z(g):g}function bo(a,b,c,d){var e=0,f=b.length;for(;e2&&(j=h[0]).type==="ID"&&b.nodeType===9&&!f&&e.relative[h[1].type]){b=e.find.ID(j.matches[0].replace(V,""),b,f)[0];if(!b)return c;a=a.slice(h.shift().length)}for(g=W.POS.test(a)?-1:h.length-1;g>=0;g--){j=h[g];if(e.relative[k=j.type])break;if(l=e.find[k])if(d=l(j.matches[0].replace(V,""),R.test(h[0].type)&&b.parentNode||b,f)){h.splice(g,1),a=d.length&&h.join("");if(!a)return w.apply(c,x.call(d,0)),c;break}}}return i(a,m)(d,b,f,c,R.test(a)),c}function bq(){}var c,d,e,f,g,h,i,j,k,l,m=!0,n="undefined",o=("sizcache"+Math.random()).replace(".",""),q=String,r=a.document,s=r.documentElement,t=0,u=0,v=[].pop,w=[].push,x=[].slice,y=[].indexOf||function(a){var b=0,c=this.length;for(;be.cacheLength&&delete a[b.shift()],a[c]=d},a)},B=A(),C=A(),D=A(),E="[\\x20\\t\\r\\n\\f]",F="(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+",G=F.replace("w","w#"),H="([*^$|!~]?=)",I="\\["+E+"*("+F+")"+E+"*(?:"+H+E+"*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|("+G+")|)|)"+E+"*\\]",J=":("+F+")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|([^()[\\]]*|(?:(?:"+I+")|[^:]|\\\\.)*|.*))\\)|)",K=":(even|odd|eq|gt|lt|nth|first|last)(?:\\("+E+"*((?:-\\d)?\\d*)"+E+"*\\)|)(?=[^-]|$)",L=new RegExp("^"+E+"+|((?:^|[^\\\\])(?:\\\\.)*)"+E+"+$","g"),M=new RegExp("^"+E+"*,"+E+"*"),N=new RegExp("^"+E+"*([\\x20\\t\\r\\n\\f>+~])"+E+"*"),O=new RegExp(J),P=/^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/,Q=/^:not/,R=/[\x20\t\r\n\f]*[+~]/,S=/:not\($/,T=/h\d/i,U=/input|select|textarea|button/i,V=/\\(?!\\)/g,W={ID:new RegExp("^#("+F+")"),CLASS:new RegExp("^\\.("+F+")"),NAME:new RegExp("^\\[name=['\"]?("+F+")['\"]?\\]"),TAG:new RegExp("^("+F.replace("w","w*")+")"),ATTR:new RegExp("^"+I),PSEUDO:new RegExp("^"+J),POS:new RegExp(K,"i"),CHILD:new RegExp("^:(only|nth|first|last)-child(?:\\("+E+"*(even|odd|(([+-]|)(\\d*)n|)"+E+"*(?:([+-]|)"+E+"*(\\d+)|))"+E+"*\\)|)","i"),needsContext:new RegExp("^"+E+"*[>+~]|"+K,"i")},X=function(a){var b=r.createElement("div");try{return a(b)}catch(c){return!1}finally{b=null}},Y=X(function(a){return a.appendChild(r.createComment("")),!a.getElementsByTagName("*").length}),Z=X(function(a){return a.innerHTML="",a.firstChild&&typeof a.firstChild.getAttribute!==n&&a.firstChild.getAttribute("href")==="#"}),$=X(function(a){a.innerHTML="";var b=typeof a.lastChild.getAttribute("multiple");return b!=="boolean"&&b!=="string"}),_=X(function(a){return a.innerHTML="",!a.getElementsByClassName||!a.getElementsByClassName("e").length?!1:(a.lastChild.className="e",a.getElementsByClassName("e").length===2)}),ba=X(function(a){a.id=o+0,a.innerHTML="
",s.insertBefore(a,s.firstChild);var b=r.getElementsByName&&r.getElementsByName(o).length===2+r.getElementsByName(o+0).length;return d=!r.getElementById(o),s.removeChild(a),b});try{x.call(s.childNodes,0)[0].nodeType}catch(bb){x=function(a){var b,c=[];for(;b=this[a];a++)c.push(b);return c}}bc.matches=function(a,b){return bc(a,null,null,b)},bc.matchesSelector=function(a,b){return bc(b,null,null,[a]).length>0},f=bc.getText=function(a){var b,c="",d=0,e=a.nodeType;if(e){if(e===1||e===9||e===11){if(typeof a.textContent=="string")return a.textContent;for(a=a.firstChild;a;a=a.nextSibling)c+=f(a)}else if(e===3||e===4)return a.nodeValue}else for(;b=a[d];d++)c+=f(b);return c},g=bc.isXML=function(a){var b=a&&(a.ownerDocument||a).documentElement;return b?b.nodeName!=="HTML":!1},h=bc.contains=s.contains?function(a,b){var c=a.nodeType===9?a.documentElement:a,d=b&&b.parentNode;return a===d||!!(d&&d.nodeType===1&&c.contains&&c.contains(d))}:s.compareDocumentPosition?function(a,b){return b&&!!(a.compareDocumentPosition(b)&16)}:function(a,b){while(b=b.parentNode)if(b===a)return!0;return!1},bc.attr=function(a,b){var c,d=g(a);return d||(b=b.toLowerCase()),(c=e.attrHandle[b])?c(a):d||$?a.getAttribute(b):(c=a.getAttributeNode(b),c?typeof a[b]=="boolean"?a[b]?b:null:c.specified?c.value:null:null)},e=bc.selectors={cacheLength:50,createPseudo:z,match:W,attrHandle:Z?{}:{href:function(a){return a.getAttribute("href",2)},type:function(a){return a.getAttribute("type")}},find:{ID:d?function(a,b,c){if(typeof b.getElementById!==n&&!c){var d=b.getElementById(a);return d&&d.parentNode?[d]:[]}}:function(a,c,d){if(typeof c.getElementById!==n&&!d){var e=c.getElementById(a);return e?e.id===a||typeof e.getAttributeNode!==n&&e.getAttributeNode("id").value===a?[e]:b:[]}},TAG:Y?function(a,b){if(typeof b.getElementsByTagName!==n)return b.getElementsByTagName(a)}:function(a,b){var c=b.getElementsByTagName(a);if(a==="*"){var d,e=[],f=0;for(;d=c[f];f++)d.nodeType===1&&e.push(d);return e}return c},NAME:ba&&function(a,b){if(typeof b.getElementsByName!==n)return b.getElementsByName(name)},CLASS:_&&function(a,b,c){if(typeof b.getElementsByClassName!==n&&!c)return b.getElementsByClassName(a)}},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(a){return a[1]=a[1].replace(V,""),a[3]=(a[4]||a[5]||"").replace(V,""),a[2]==="~="&&(a[3]=" "+a[3]+" "),a.slice(0,4)},CHILD:function(a){return a[1]=a[1].toLowerCase(),a[1]==="nth"?(a[2]||bc.error(a[0]),a[3]=+(a[3]?a[4]+(a[5]||1):2*(a[2]==="even"||a[2]==="odd")),a[4]=+(a[6]+a[7]||a[2]==="odd")):a[2]&&bc.error(a[0]),a},PSEUDO:function(a){var b,c;if(W.CHILD.test(a[0]))return null;if(a[3])a[2]=a[3];else if(b=a[4])O.test(b)&&(c=bh(b,!0))&&(c=b.indexOf(")",b.length-c)-b.length)&&(b=b.slice(0,c),a[0]=a[0].slice(0,c)),a[2]=b;return a.slice(0,3)}},filter:{ID:d?function(a){return a=a.replace(V,""),function(b){return b.getAttribute("id")===a}}:function(a){return a=a.replace(V,""),function(b){var c=typeof b.getAttributeNode!==n&&b.getAttributeNode("id");return c&&c.value===a}},TAG:function(a){return a==="*"?function(){return!0}:(a=a.replace(V,"").toLowerCase(),function(b){return b.nodeName&&b.nodeName.toLowerCase()===a})},CLASS:function(a){var b=B[o][a];return b||(b=B(a,new RegExp("(^|"+E+")"+a+"("+E+"|$)"))),function(a){return b.test(a.className||typeof a.getAttribute!==n&&a.getAttribute("class")||"")}},ATTR:function(a,b,c){return function(d,e){var f=bc.attr(d,a);return f==null?b==="!=":b?(f+="",b==="="?f===c:b==="!="?f!==c:b==="^="?c&&f.indexOf(c)===0:b==="*="?c&&f.indexOf(c)>-1:b==="$="?c&&f.substr(f.length-c.length)===c:b==="~="?(" "+f+" ").indexOf(c)>-1:b==="|="?f===c||f.substr(0,c.length+1)===c+"-":!1):!0}},CHILD:function(a,b,c,d){return a==="nth"?function(a){var b,e,f=a.parentNode;if(c===1&&d===0)return!0;if(f){e=0;for(b=f.firstChild;b;b=b.nextSibling)if(b.nodeType===1){e++;if(a===b)break}}return e-=d,e===c||e%c===0&&e/c>=0}:function(b){var c=b;switch(a){case"only":case"first":while(c=c.previousSibling)if(c.nodeType===1)return!1;if(a==="first")return!0;c=b;case"last":while(c=c.nextSibling)if(c.nodeType===1)return!1;return!0}}},PSEUDO:function(a,b){var c,d=e.pseudos[a]||e.setFilters[a.toLowerCase()]||bc.error("unsupported pseudo: "+a);return d[o]?d(b):d.length>1?(c=[a,a,"",b],e.setFilters.hasOwnProperty(a.toLowerCase())?z(function(a,c){var e,f=d(a,b),g=f.length;while(g--)e=y.call(a,f[g]),a[e]=!(c[e]=f[g])}):function(a){return d(a,0,c)}):d}},pseudos:{not:z(function(a){var b=[],c=[],d=i(a.replace(L,"$1"));return d[o]?z(function(a,b,c,e){var f,g=d(a,null,e,[]),h=a.length;while(h--)if(f=g[h])a[h]=!(b[h]=f)}):function(a,e,f){return b[0]=a,d(b,null,f,c),!c.pop()}}),has:z(function(a){return function(b){return bc(a,b).length>0}}),contains:z(function(a){return function(b){return(b.textContent||b.innerText||f(b)).indexOf(a)>-1}}),enabled:function(a){return a.disabled===!1},disabled:function(a){return a.disabled===!0},checked:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&!!a.checked||b==="option"&&!!a.selected},selected:function(a){return a.parentNode&&a.parentNode.selectedIndex,a.selected===!0},parent:function(a){return!e.pseudos.empty(a)},empty:function(a){var b;a=a.firstChild;while(a){if(a.nodeName>"@"||(b=a.nodeType)===3||b===4)return!1;a=a.nextSibling}return!0},header:function(a){return T.test(a.nodeName)},text:function(a){var b,c;return a.nodeName.toLowerCase()==="input"&&(b=a.type)==="text"&&((c=a.getAttribute("type"))==null||c.toLowerCase()===b)},radio:bd("radio"),checkbox:bd("checkbox"),file:bd("file"),password:bd("password"),image:bd("image"),submit:be("submit"),reset:be("reset"),button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&a.type==="button"||b==="button"},input:function(a){return U.test(a.nodeName)},focus:function(a){var b=a.ownerDocument;return a===b.activeElement&&(!b.hasFocus||b.hasFocus())&&(!!a.type||!!a.href)},active:function(a){return a===a.ownerDocument.activeElement},first:bf(function(a,b,c){return[0]}),last:bf(function(a,b,c){return[b-1]}),eq:bf(function(a,b,c){return[c<0?c+b:c]}),even:bf(function(a,b,c){for(var d=0;d=0;)a.push(d);return a}),gt:bf(function(a,b,c){for(var d=c<0?c+b:c;++d",a.querySelectorAll("[selected]").length||e.push("\\["+E+"*(?:checked|disabled|ismap|multiple|readonly|selected|value)"),a.querySelectorAll(":checked").length||e.push(":checked")}),X(function(a){a.innerHTML="

",a.querySelectorAll("[test^='']").length&&e.push("[*^$]="+E+"*(?:\"\"|'')"),a.innerHTML="",a.querySelectorAll(":enabled").length||e.push(":enabled",":disabled")}),e=new RegExp(e.join("|")),bp=function(a,d,f,g,h){if(!g&&!h&&(!e||!e.test(a))){var i,j,k=!0,l=o,m=d,n=d.nodeType===9&&a;if(d.nodeType===1&&d.nodeName.toLowerCase()!=="object"){i=bh(a),(k=d.getAttribute("id"))?l=k.replace(c,"\\$&"):d.setAttribute("id",l),l="[id='"+l+"'] ",j=i.length;while(j--)i[j]=l+i[j].join("");m=R.test(a)&&d.parentNode||d,n=i.join(",")}if(n)try{return w.apply(f,x.call(m.querySelectorAll(n),0)),f}catch(p){}finally{k||d.removeAttribute("id")}}return b(a,d,f,g,h)},h&&(X(function(b){a=h.call(b,"div");try{h.call(b,"[test!='']:sizzle"),f.push("!=",J)}catch(c){}}),f=new RegExp(f.join("|")),bc.matchesSelector=function(b,c){c=c.replace(d,"='$1']");if(!g(b)&&!f.test(c)&&(!e||!e.test(c)))try{var i=h.call(b,c);if(i||a||b.document&&b.document.nodeType!==11)return i}catch(j){}return bc(c,null,null,[b]).length>0})}(),e.pseudos.nth=e.pseudos.eq,e.filters=bq.prototype=e.pseudos,e.setFilters=new bq,bc.attr=p.attr,p.find=bc,p.expr=bc.selectors,p.expr[":"]=p.expr.pseudos,p.unique=bc.uniqueSort,p.text=bc.getText,p.isXMLDoc=bc.isXML,p.contains=bc.contains}(a);var bc=/Until$/,bd=/^(?:parents|prev(?:Until|All))/,be=/^.[^:#\[\.,]*$/,bf=p.expr.match.needsContext,bg={children:!0,contents:!0,next:!0,prev:!0};p.fn.extend({find:function(a){var b,c,d,e,f,g,h=this;if(typeof a!="string")return p(a).filter(function(){for(b=0,c=h.length;b0)for(e=d;e=0:p.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c,d=0,e=this.length,f=[],g=bf.test(a)||typeof a!="string"?p(a,b||this.context):0;for(;d-1:p.find.matchesSelector(c,a)){f.push(c);break}c=c.parentNode}}return f=f.length>1?p.unique(f):f,this.pushStack(f,"closest",a)},index:function(a){return a?typeof a=="string"?p.inArray(this[0],p(a)):p.inArray(a.jquery?a[0]:a,this):this[0]&&this[0].parentNode?this.prevAll().length:-1},add:function(a,b){var c=typeof a=="string"?p(a,b):p.makeArray(a&&a.nodeType?[a]:a),d=p.merge(this.get(),c);return this.pushStack(bh(c[0])||bh(d[0])?d:p.unique(d))},addBack:function(a){return this.add(a==null?this.prevObject:this.prevObject.filter(a))}}),p.fn.andSelf=p.fn.addBack,p.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return p.dir(a,"parentNode")},parentsUntil:function(a,b,c){return p.dir(a,"parentNode",c)},next:function(a){return bi(a,"nextSibling")},prev:function(a){return bi(a,"previousSibling")},nextAll:function(a){return p.dir(a,"nextSibling")},prevAll:function(a){return p.dir(a,"previousSibling")},nextUntil:function(a,b,c){return p.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return p.dir(a,"previousSibling",c)},siblings:function(a){return p.sibling((a.parentNode||{}).firstChild,a)},children:function(a){return p.sibling(a.firstChild)},contents:function(a){return p.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:p.merge([],a.childNodes)}},function(a,b){p.fn[a]=function(c,d){var e=p.map(this,b,c);return bc.test(a)||(d=c),d&&typeof d=="string"&&(e=p.filter(d,e)),e=this.length>1&&!bg[a]?p.unique(e):e,this.length>1&&bd.test(a)&&(e=e.reverse()),this.pushStack(e,a,k.call(arguments).join(","))}}),p.extend({filter:function(a,b,c){return c&&(a=":not("+a+")"),b.length===1?p.find.matchesSelector(b[0],a)?[b[0]]:[]:p.find.matches(a,b)},dir:function(a,c,d){var e=[],f=a[c];while(f&&f.nodeType!==9&&(d===b||f.nodeType!==1||!p(f).is(d)))f.nodeType===1&&e.push(f),f=f[c];return e},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var bl="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",bm=/ jQuery\d+="(?:null|\d+)"/g,bn=/^\s+/,bo=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,bp=/<([\w:]+)/,bq=/]","i"),bv=/^(?:checkbox|radio)$/,bw=/checked\s*(?:[^=]|=\s*.checked.)/i,bx=/\/(java|ecma)script/i,by=/^\s*\s*$/g,bz={option:[1,""],legend:[1,"
","
"],thead:[1,"","
"],tr:[2,"","
"],td:[3,"","
"],col:[2,"","
"],area:[1,"",""],_default:[0,"",""]},bA=bk(e),bB=bA.appendChild(e.createElement("div"));bz.optgroup=bz.option,bz.tbody=bz.tfoot=bz.colgroup=bz.caption=bz.thead,bz.th=bz.td,p.support.htmlSerialize||(bz._default=[1,"X
","
"]),p.fn.extend({text:function(a){return p.access(this,function(a){return a===b?p.text(this):this.empty().append((this[0]&&this[0].ownerDocument||e).createTextNode(a))},null,a,arguments.length)},wrapAll:function(a){if(p.isFunction(a))return this.each(function(b){p(this).wrapAll(a.call(this,b))});if(this[0]){var b=p(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){return p.isFunction(a)?this.each(function(b){p(this).wrapInner(a.call(this,b))}):this.each(function(){var b=p(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=p.isFunction(a);return this.each(function(c){p(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){p.nodeName(this,"body")||p(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){(this.nodeType===1||this.nodeType===11)&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){(this.nodeType===1||this.nodeType===11)&&this.insertBefore(a,this.firstChild)})},before:function(){if(!bh(this[0]))return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=p.clean(arguments);return this.pushStack(p.merge(a,this),"before",this.selector)}},after:function(){if(!bh(this[0]))return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=p.clean(arguments);return this.pushStack(p.merge(this,a),"after",this.selector)}},remove:function(a,b){var c,d=0;for(;(c=this[d])!=null;d++)if(!a||p.filter(a,[c]).length)!b&&c.nodeType===1&&(p.cleanData(c.getElementsByTagName("*")),p.cleanData([c])),c.parentNode&&c.parentNode.removeChild(c);return this},empty:function(){var a,b=0;for(;(a=this[b])!=null;b++){a.nodeType===1&&p.cleanData(a.getElementsByTagName("*"));while(a.firstChild)a.removeChild(a.firstChild)}return this},clone:function(a,b){return a=a==null?!1:a,b=b==null?a:b,this.map(function(){return p.clone(this,a,b)})},html:function(a){return p.access(this,function(a){var c=this[0]||{},d=0,e=this.length;if(a===b)return c.nodeType===1?c.innerHTML.replace(bm,""):b;if(typeof a=="string"&&!bs.test(a)&&(p.support.htmlSerialize||!bu.test(a))&&(p.support.leadingWhitespace||!bn.test(a))&&!bz[(bp.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(bo,"<$1>");try{for(;d1&&typeof j=="string"&&bw.test(j))return this.each(function(){p(this).domManip(a,c,d)});if(p.isFunction(j))return this.each(function(e){var f=p(this);a[0]=j.call(this,e,c?f.html():b),f.domManip(a,c,d)});if(this[0]){e=p.buildFragment(a,this,k),g=e.fragment,f=g.firstChild,g.childNodes.length===1&&(g=f);if(f){c=c&&p.nodeName(f,"tr");for(h=e.cacheable||l-1;i0?this.clone(!0):this).get(),p(g[e])[b](d),f=f.concat(d);return this.pushStack(f,a,g.selector)}}),p.extend({clone:function(a,b,c){var d,e,f,g;p.support.html5Clone||p.isXMLDoc(a)||!bu.test("<"+a.nodeName+">")?g=a.cloneNode(!0):(bB.innerHTML=a.outerHTML,bB.removeChild(g=bB.firstChild));if((!p.support.noCloneEvent||!p.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!p.isXMLDoc(a)){bE(a,g),d=bF(a),e=bF(g);for(f=0;d[f];++f)e[f]&&bE(d[f],e[f])}if(b){bD(a,g);if(c){d=bF(a),e=bF(g);for(f=0;d[f];++f)bD(d[f],e[f])}}return d=e=null,g},clean:function(a,b,c,d){var f,g,h,i,j,k,l,m,n,o,q,r,s=b===e&&bA,t=[];if(!b||typeof b.createDocumentFragment=="undefined")b=e;for(f=0;(h=a[f])!=null;f++){typeof h=="number"&&(h+="");if(!h)continue;if(typeof h=="string")if(!br.test(h))h=b.createTextNode(h);else{s=s||bk(b),l=b.createElement("div"),s.appendChild(l),h=h.replace(bo,"<$1>"),i=(bp.exec(h)||["",""])[1].toLowerCase(),j=bz[i]||bz._default,k=j[0],l.innerHTML=j[1]+h+j[2];while(k--)l=l.lastChild;if(!p.support.tbody){m=bq.test(h),n=i==="table"&&!m?l.firstChild&&l.firstChild.childNodes:j[1]===""&&!m?l.childNodes:[];for(g=n.length-1;g>=0;--g)p.nodeName(n[g],"tbody")&&!n[g].childNodes.length&&n[g].parentNode.removeChild(n[g])}!p.support.leadingWhitespace&&bn.test(h)&&l.insertBefore(b.createTextNode(bn.exec(h)[0]),l.firstChild),h=l.childNodes,l.parentNode.removeChild(l)}h.nodeType?t.push(h):p.merge(t,h)}l&&(h=l=s=null);if(!p.support.appendChecked)for(f=0;(h=t[f])!=null;f++)p.nodeName(h,"input")?bG(h):typeof h.getElementsByTagName!="undefined"&&p.grep(h.getElementsByTagName("input"),bG);if(c){q=function(a){if(!a.type||bx.test(a.type))return d?d.push(a.parentNode?a.parentNode.removeChild(a):a):c.appendChild(a)};for(f=0;(h=t[f])!=null;f++)if(!p.nodeName(h,"script")||!q(h))c.appendChild(h),typeof h.getElementsByTagName!="undefined"&&(r=p.grep(p.merge([],h.getElementsByTagName("script")),q),t.splice.apply(t,[f+1,0].concat(r)),f+=r.length)}return t},cleanData:function(a,b){var c,d,e,f,g=0,h=p.expando,i=p.cache,j=p.support.deleteExpando,k=p.event.special;for(;(e=a[g])!=null;g++)if(b||p.acceptData(e)){d=e[h],c=d&&i[d];if(c){if(c.events)for(f in c.events)k[f]?p.event.remove(e,f):p.removeEvent(e,f,c.handle);i[d]&&(delete i[d],j?delete e[h]:e.removeAttribute?e.removeAttribute(h):e[h]=null,p.deletedIds.push(d))}}}}),function(){var a,b;p.uaMatch=function(a){a=a.toLowerCase();var b=/(chrome)[ \/]([\w.]+)/.exec(a)||/(webkit)[ \/]([\w.]+)/.exec(a)||/(opera)(?:.*version|)[ \/]([\w.]+)/.exec(a)||/(msie) ([\w.]+)/.exec(a)||a.indexOf("compatible")<0&&/(mozilla)(?:.*? rv:([\w.]+)|)/.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},a=p.uaMatch(g.userAgent),b={},a.browser&&(b[a.browser]=!0,b.version=a.version),b.chrome?b.webkit=!0:b.webkit&&(b.safari=!0),p.browser=b,p.sub=function(){function a(b,c){return new a.fn.init(b,c)}p.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function c(c,d){return d&&d instanceof p&&!(d instanceof a)&&(d=a(d)),p.fn.init.call(this,c,d,b)},a.fn.init.prototype=a.fn;var b=a(e);return a}}();var bH,bI,bJ,bK=/alpha\([^)]*\)/i,bL=/opacity=([^)]*)/,bM=/^(top|right|bottom|left)$/,bN=/^(none|table(?!-c[ea]).+)/,bO=/^margin/,bP=new RegExp("^("+q+")(.*)$","i"),bQ=new RegExp("^("+q+")(?!px)[a-z%]+$","i"),bR=new RegExp("^([-+])=("+q+")","i"),bS={},bT={position:"absolute",visibility:"hidden",display:"block"},bU={letterSpacing:0,fontWeight:400},bV=["Top","Right","Bottom","Left"],bW=["Webkit","O","Moz","ms"],bX=p.fn.toggle;p.fn.extend({css:function(a,c){return p.access(this,function(a,c,d){return d!==b?p.style(a,c,d):p.css(a,c)},a,c,arguments.length>1)},show:function(){return b$(this,!0)},hide:function(){return b$(this)},toggle:function(a,b){var c=typeof a=="boolean";return p.isFunction(a)&&p.isFunction(b)?bX.apply(this,arguments):this.each(function(){(c?a:bZ(this))?p(this).show():p(this).hide()})}}),p.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bH(a,"opacity");return c===""?"1":c}}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":p.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!a||a.nodeType===3||a.nodeType===8||!a.style)return;var f,g,h,i=p.camelCase(c),j=a.style;c=p.cssProps[i]||(p.cssProps[i]=bY(j,i)),h=p.cssHooks[c]||p.cssHooks[i];if(d===b)return h&&"get"in h&&(f=h.get(a,!1,e))!==b?f:j[c];g=typeof d,g==="string"&&(f=bR.exec(d))&&(d=(f[1]+1)*f[2]+parseFloat(p.css(a,c)),g="number");if(d==null||g==="number"&&isNaN(d))return;g==="number"&&!p.cssNumber[i]&&(d+="px");if(!h||!("set"in h)||(d=h.set(a,d,e))!==b)try{j[c]=d}catch(k){}},css:function(a,c,d,e){var f,g,h,i=p.camelCase(c);return c=p.cssProps[i]||(p.cssProps[i]=bY(a.style,i)),h=p.cssHooks[c]||p.cssHooks[i],h&&"get"in h&&(f=h.get(a,!0,e)),f===b&&(f=bH(a,c)),f==="normal"&&c in bU&&(f=bU[c]),d||e!==b?(g=parseFloat(f),d||p.isNumeric(g)?g||0:f):f},swap:function(a,b,c){var d,e,f={};for(e in b)f[e]=a.style[e],a.style[e]=b[e];d=c.call(a);for(e in b)a.style[e]=f[e];return d}}),a.getComputedStyle?bH=function(b,c){var d,e,f,g,h=a.getComputedStyle(b,null),i=b.style;return h&&(d=h[c],d===""&&!p.contains(b.ownerDocument,b)&&(d=p.style(b,c)),bQ.test(d)&&bO.test(c)&&(e=i.width,f=i.minWidth,g=i.maxWidth,i.minWidth=i.maxWidth=i.width=d,d=h.width,i.width=e,i.minWidth=f,i.maxWidth=g)),d}:e.documentElement.currentStyle&&(bH=function(a,b){var c,d,e=a.currentStyle&&a.currentStyle[b],f=a.style;return e==null&&f&&f[b]&&(e=f[b]),bQ.test(e)&&!bM.test(b)&&(c=f.left,d=a.runtimeStyle&&a.runtimeStyle.left,d&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":e,e=f.pixelLeft+"px",f.left=c,d&&(a.runtimeStyle.left=d)),e===""?"auto":e}),p.each(["height","width"],function(a,b){p.cssHooks[b]={get:function(a,c,d){if(c)return a.offsetWidth===0&&bN.test(bH(a,"display"))?p.swap(a,bT,function(){return cb(a,b,d)}):cb(a,b,d)},set:function(a,c,d){return b_(a,c,d?ca(a,b,d,p.support.boxSizing&&p.css(a,"boxSizing")==="border-box"):0)}}}),p.support.opacity||(p.cssHooks.opacity={get:function(a,b){return bL.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?.01*parseFloat(RegExp.$1)+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=p.isNumeric(b)?"alpha(opacity="+b*100+")":"",f=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&p.trim(f.replace(bK,""))===""&&c.removeAttribute){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bK.test(f)?f.replace(bK,e):f+" "+e}}),p(function(){p.support.reliableMarginRight||(p.cssHooks.marginRight={get:function(a,b){return p.swap(a,{display:"inline-block"},function(){if(b)return bH(a,"marginRight")})}}),!p.support.pixelPosition&&p.fn.position&&p.each(["top","left"],function(a,b){p.cssHooks[b]={get:function(a,c){if(c){var d=bH(a,b);return bQ.test(d)?p(a).position()[b]+"px":d}}}})}),p.expr&&p.expr.filters&&(p.expr.filters.hidden=function(a){return a.offsetWidth===0&&a.offsetHeight===0||!p.support.reliableHiddenOffsets&&(a.style&&a.style.display||bH(a,"display"))==="none"},p.expr.filters.visible=function(a){return!p.expr.filters.hidden(a)}),p.each({margin:"",padding:"",border:"Width"},function(a,b){p.cssHooks[a+b]={expand:function(c){var d,e=typeof c=="string"?c.split(" "):[c],f={};for(d=0;d<4;d++)f[a+bV[d]+b]=e[d]||e[d-2]||e[0];return f}},bO.test(a)||(p.cssHooks[a+b].set=b_)});var cd=/%20/g,ce=/\[\]$/,cf=/\r?\n/g,cg=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,ch=/^(?:select|textarea)/i;p.fn.extend({serialize:function(){return p.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?p.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||ch.test(this.nodeName)||cg.test(this.type))}).map(function(a,b){var c=p(this).val();return c==null?null:p.isArray(c)?p.map(c,function(a,c){return{name:b.name,value:a.replace(cf,"\r\n")}}):{name:b.name,value:c.replace(cf,"\r\n")}}).get()}}),p.param=function(a,c){var d,e=[],f=function(a,b){b=p.isFunction(b)?b():b==null?"":b,e[e.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=p.ajaxSettings&&p.ajaxSettings.traditional);if(p.isArray(a)||a.jquery&&!p.isPlainObject(a))p.each(a,function(){f(this.name,this.value)});else for(d in a)ci(d,a[d],c,f);return e.join("&").replace(cd,"+")};var cj,ck,cl=/#.*$/,cm=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,cn=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,co=/^(?:GET|HEAD)$/,cp=/^\/\//,cq=/\?/,cr=/)<[^<]*)*<\/script>/gi,cs=/([?&])_=[^&]*/,ct=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/,cu=p.fn.load,cv={},cw={},cx=["*/"]+["*"];try{ck=f.href}catch(cy){ck=e.createElement("a"),ck.href="",ck=ck.href}cj=ct.exec(ck.toLowerCase())||[],p.fn.load=function(a,c,d){if(typeof a!="string"&&cu)return cu.apply(this,arguments);if(!this.length)return this;var e,f,g,h=this,i=a.indexOf(" ");return i>=0&&(e=a.slice(i,a.length),a=a.slice(0,i)),p.isFunction(c)?(d=c,c=b):c&&typeof c=="object"&&(f="POST"),p.ajax({url:a,type:f,dataType:"html",data:c,complete:function(a,b){d&&h.each(d,g||[a.responseText,b,a])}}).done(function(a){g=arguments,h.html(e?p("
").append(a.replace(cr,"")).find(e):a)}),this},p.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){p.fn[b]=function(a){return this.on(b,a)}}),p.each(["get","post"],function(a,c){p[c]=function(a,d,e,f){return p.isFunction(d)&&(f=f||e,e=d,d=b),p.ajax({type:c,url:a,data:d,success:e,dataType:f})}}),p.extend({getScript:function(a,c){return p.get(a,b,c,"script")},getJSON:function(a,b,c){return p.get(a,b,c,"json")},ajaxSetup:function(a,b){return b?cB(a,p.ajaxSettings):(b=a,a=p.ajaxSettings),cB(a,b),a},ajaxSettings:{url:ck,isLocal:cn.test(cj[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded; charset=UTF-8",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":cx},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":p.parseJSON,"text xml":p.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:cz(cv),ajaxTransport:cz(cw),ajax:function(a,c){function y(a,c,f,i){var k,s,t,u,w,y=c;if(v===2)return;v=2,h&&clearTimeout(h),g=b,e=i||"",x.readyState=a>0?4:0,f&&(u=cC(l,x,f));if(a>=200&&a<300||a===304)l.ifModified&&(w=x.getResponseHeader("Last-Modified"),w&&(p.lastModified[d]=w),w=x.getResponseHeader("Etag"),w&&(p.etag[d]=w)),a===304?(y="notmodified",k=!0):(k=cD(l,u),y=k.state,s=k.data,t=k.error,k=!t);else{t=y;if(!y||a)y="error",a<0&&(a=0)}x.status=a,x.statusText=(c||y)+"",k?o.resolveWith(m,[s,y,x]):o.rejectWith(m,[x,y,t]),x.statusCode(r),r=b,j&&n.trigger("ajax"+(k?"Success":"Error"),[x,l,k?s:t]),q.fireWith(m,[x,y]),j&&(n.trigger("ajaxComplete",[x,l]),--p.active||p.event.trigger("ajaxStop"))}typeof a=="object"&&(c=a,a=b),c=c||{};var d,e,f,g,h,i,j,k,l=p.ajaxSetup({},c),m=l.context||l,n=m!==l&&(m.nodeType||m instanceof p)?p(m):p.event,o=p.Deferred(),q=p.Callbacks("once memory"),r=l.statusCode||{},t={},u={},v=0,w="canceled",x={readyState:0,setRequestHeader:function(a,b){if(!v){var c=a.toLowerCase();a=u[c]=u[c]||a,t[a]=b}return this},getAllResponseHeaders:function(){return v===2?e:null},getResponseHeader:function(a){var c;if(v===2){if(!f){f={};while(c=cm.exec(e))f[c[1].toLowerCase()]=c[2]}c=f[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){return v||(l.mimeType=a),this},abort:function(a){return a=a||w,g&&g.abort(a),y(0,a),this}};o.promise(x),x.success=x.done,x.error=x.fail,x.complete=q.add,x.statusCode=function(a){if(a){var b;if(v<2)for(b in a)r[b]=[r[b],a[b]];else b=a[x.status],x.always(b)}return this},l.url=((a||l.url)+"").replace(cl,"").replace(cp,cj[1]+"//"),l.dataTypes=p.trim(l.dataType||"*").toLowerCase().split(s),l.crossDomain==null&&(i=ct.exec(l.url.toLowerCase())||!1,l.crossDomain=i&&i.join(":")+(i[3]?"":i[1]==="http:"?80:443)!==cj.join(":")+(cj[3]?"":cj[1]==="http:"?80:443)),l.data&&l.processData&&typeof l.data!="string"&&(l.data=p.param(l.data,l.traditional)),cA(cv,l,c,x);if(v===2)return x;j=l.global,l.type=l.type.toUpperCase(),l.hasContent=!co.test(l.type),j&&p.active++===0&&p.event.trigger("ajaxStart");if(!l.hasContent){l.data&&(l.url+=(cq.test(l.url)?"&":"?")+l.data,delete l.data),d=l.url;if(l.cache===!1){var z=p.now(),A=l.url.replace(cs,"$1_="+z);l.url=A+(A===l.url?(cq.test(l.url)?"&":"?")+"_="+z:"")}}(l.data&&l.hasContent&&l.contentType!==!1||c.contentType)&&x.setRequestHeader("Content-Type",l.contentType),l.ifModified&&(d=d||l.url,p.lastModified[d]&&x.setRequestHeader("If-Modified-Since",p.lastModified[d]),p.etag[d]&&x.setRequestHeader("If-None-Match",p.etag[d])),x.setRequestHeader("Accept",l.dataTypes[0]&&l.accepts[l.dataTypes[0]]?l.accepts[l.dataTypes[0]]+(l.dataTypes[0]!=="*"?", "+cx+"; q=0.01":""):l.accepts["*"]);for(k in l.headers)x.setRequestHeader(k,l.headers[k]);if(!l.beforeSend||l.beforeSend.call(m,x,l)!==!1&&v!==2){w="abort";for(k in{success:1,error:1,complete:1})x[k](l[k]);g=cA(cw,l,c,x);if(!g)y(-1,"No Transport");else{x.readyState=1,j&&n.trigger("ajaxSend",[x,l]),l.async&&l.timeout>0&&(h=setTimeout(function(){x.abort("timeout")},l.timeout));try{v=1,g.send(t,y)}catch(B){if(v<2)y(-1,B);else throw B}}return x}return x.abort()},active:0,lastModified:{},etag:{}});var cE=[],cF=/\?/,cG=/(=)\?(?=&|$)|\?\?/,cH=p.now();p.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var a=cE.pop()||p.expando+"_"+cH++;return this[a]=!0,a}}),p.ajaxPrefilter("json jsonp",function(c,d,e){var f,g,h,i=c.data,j=c.url,k=c.jsonp!==!1,l=k&&cG.test(j),m=k&&!l&&typeof i=="string"&&!(c.contentType||"").indexOf("application/x-www-form-urlencoded")&&cG.test(i);if(c.dataTypes[0]==="jsonp"||l||m)return f=c.jsonpCallback=p.isFunction(c.jsonpCallback)?c.jsonpCallback():c.jsonpCallback,g=a[f],l?c.url=j.replace(cG,"$1"+f):m?c.data=i.replace(cG,"$1"+f):k&&(c.url+=(cF.test(j)?"&":"?")+c.jsonp+"="+f),c.converters["script json"]=function(){return h||p.error(f+" was not called"),h[0]},c.dataTypes[0]="json",a[f]=function(){h=arguments},e.always(function(){a[f]=g,c[f]&&(c.jsonpCallback=d.jsonpCallback,cE.push(f)),h&&p.isFunction(g)&&g(h[0]),h=g=b}),"script"}),p.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){return p.globalEval(a),a}}}),p.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),p.ajaxTransport("script",function(a){if(a.crossDomain){var c,d=e.head||e.getElementsByTagName("head")[0]||e.documentElement;return{send:function(f,g){c=e.createElement("script"),c.async="async",a.scriptCharset&&(c.charset=a.scriptCharset),c.src=a.url,c.onload=c.onreadystatechange=function(a,e){if(e||!c.readyState||/loaded|complete/.test(c.readyState))c.onload=c.onreadystatechange=null,d&&c.parentNode&&d.removeChild(c),c=b,e||g(200,"success")},d.insertBefore(c,d.firstChild)},abort:function(){c&&c.onload(0,1)}}}});var cI,cJ=a.ActiveXObject?function(){for(var a in cI)cI[a](0,1)}:!1,cK=0;p.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&cL()||cM()}:cL,function(a){p.extend(p.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(p.ajaxSettings.xhr()),p.support.ajax&&p.ajaxTransport(function(c){if(!c.crossDomain||p.support.cors){var d;return{send:function(e,f){var g,h,i=c.xhr();c.username?i.open(c.type,c.url,c.async,c.username,c.password):i.open(c.type,c.url,c.async);if(c.xhrFields)for(h in c.xhrFields)i[h]=c.xhrFields[h];c.mimeType&&i.overrideMimeType&&i.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(h in e)i.setRequestHeader(h,e[h])}catch(j){}i.send(c.hasContent&&c.data||null),d=function(a,e){var h,j,k,l,m;try{if(d&&(e||i.readyState===4)){d=b,g&&(i.onreadystatechange=p.noop,cJ&&delete cI[g]);if(e)i.readyState!==4&&i.abort();else{h=i.status,k=i.getAllResponseHeaders(),l={},m=i.responseXML,m&&m.documentElement&&(l.xml=m);try{l.text=i.responseText}catch(a){}try{j=i.statusText}catch(n){j=""}!h&&c.isLocal&&!c.crossDomain?h=l.text?200:404:h===1223&&(h=204)}}}catch(o){e||f(-1,o)}l&&f(h,j,l,k)},c.async?i.readyState===4?setTimeout(d,0):(g=++cK,cJ&&(cI||(cI={},p(a).unload(cJ)),cI[g]=d),i.onreadystatechange=d):d()},abort:function(){d&&d(0,1)}}}});var cN,cO,cP=/^(?:toggle|show|hide)$/,cQ=new RegExp("^(?:([-+])=|)("+q+")([a-z%]*)$","i"),cR=/queueHooks$/,cS=[cY],cT={"*":[function(a,b){var c,d,e=this.createTween(a,b),f=cQ.exec(b),g=e.cur(),h=+g||0,i=1,j=20;if(f){c=+f[2],d=f[3]||(p.cssNumber[a]?"":"px");if(d!=="px"&&h){h=p.css(e.elem,a,!0)||c||1;do i=i||".5",h=h/i,p.style(e.elem,a,h+d);while(i!==(i=e.cur()/g)&&i!==1&&--j)}e.unit=d,e.start=h,e.end=f[1]?h+(f[1]+1)*c:c}return e}]};p.Animation=p.extend(cW,{tweener:function(a,b){p.isFunction(a)?(b=a,a=["*"]):a=a.split(" ");var c,d=0,e=a.length;for(;d-1,j={},k={},l,m;i?(k=e.position(),l=k.top,m=k.left):(l=parseFloat(g)||0,m=parseFloat(h)||0),p.isFunction(b)&&(b=b.call(a,c,f)),b.top!=null&&(j.top=b.top-f.top+l),b.left!=null&&(j.left=b.left-f.left+m),"using"in b?b.using.call(a,j):e.css(j)}},p.fn.extend({position:function(){if(!this[0])return;var a=this[0],b=this.offsetParent(),c=this.offset(),d=c_.test(b[0].nodeName)?{top:0,left:0}:b.offset();return c.top-=parseFloat(p.css(a,"marginTop"))||0,c.left-=parseFloat(p.css(a,"marginLeft"))||0,d.top+=parseFloat(p.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(p.css(b[0],"borderLeftWidth"))||0,{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||e.body;while(a&&!c_.test(a.nodeName)&&p.css(a,"position")==="static")a=a.offsetParent;return a||e.body})}}),p.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(a,c){var d=/Y/.test(c);p.fn[a]=function(e){return p.access(this,function(a,e,f){var g=da(a);if(f===b)return g?c in g?g[c]:g.document.documentElement[e]:a[e];g?g.scrollTo(d?p(g).scrollLeft():f,d?f:p(g).scrollTop()):a[e]=f},a,e,arguments.length,null)}}),p.each({Height:"height",Width:"width"},function(a,c){p.each({padding:"inner"+a,content:c,"":"outer"+a},function(d,e){p.fn[e]=function(e,f){var g=arguments.length&&(d||typeof e!="boolean"),h=d||(e===!0||f===!0?"margin":"border");return p.access(this,function(c,d,e){var f;return p.isWindow(c)?c.document.documentElement["client"+a]:c.nodeType===9?(f=c.documentElement,Math.max(c.body["scroll"+a],f["scroll"+a],c.body["offset"+a],f["offset"+a],f["client"+a])):e===b?p.css(c,d,e,h):p.style(c,d,e,h)},c,g?e:b,g,null)}})}),a.jQuery=a.$=p,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return p})})(window); \ No newline at end of file diff --git a/Scripts/jquery-ui-1.8.24.js b/Scripts/jquery-ui-1.8.24.js new file mode 100644 index 0000000..5e0f7ff --- /dev/null +++ b/Scripts/jquery-ui-1.8.24.js @@ -0,0 +1,11377 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.effects.core.js, jquery.effects.blind.js, jquery.effects.bounce.js, jquery.effects.clip.js, jquery.effects.drop.js, jquery.effects.explode.js, jquery.effects.fade.js, jquery.effects.fold.js, jquery.effects.highlight.js, jquery.effects.pulsate.js, jquery.effects.scale.js, jquery.effects.shake.js, jquery.effects.slide.js, jquery.effects.transfer.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.position.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.tabs.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ + +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.24", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + //
+ value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +// support: jQuery <1.8 +if ( !$( "" ).outerWidth( 1 ).jquery ) { + $.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; + }); +} + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: $.expr.createPseudo ? + $.expr.createPseudo(function( dataName ) { + return function( elem ) { + return !!$.data( elem, dataName ); + }; + }) : + // support: jQuery <1.8 + function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + // access offsetHeight before setting the style to prevent a layout bug + // in IE 9 which causes the elemnt to continue to take up space even + // after it is removed from the DOM (#8026) + div.offsetHeight; + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + +// jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css +if ( !$.curCSS ) { + $.curCSS = $.css; +} + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); + +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); + +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + if ( this._mouseMoveDelegate ) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + } + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + if ( o.iframeFix ) { + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('
') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + } + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + this.helper.addClass("ui-draggable-dragging"); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is no longer in the DOM don't bother to continue (see #8269) + var element = this.element[0], elementInDom = false; + while ( element && (element = element.parentNode) ) { + if (element == document ) { + elementInDom = true; + } + } + if ( !elementInDom && this.options.helper === "original" ) + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + //Remove frame helpers + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var c = $(o.containment); + var ce = c[0]; if(!ce) return; + var co = c.offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + var containment; + if(this.containment) { + if (this.relative_container){ + var co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.24" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.24" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = this._drop.call(this, event) || dropped; + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + // find droppable parents with same scope + var scope = this.options.scope; + var parent = this.element.parents(':data(droppable)').filter(function () { + return $.data(this, 'droppable').options.scope === scope; + }); + + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + } +}; + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('
').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('
'); + + // Apply zIndex to all handles - see #7960 + axis.css({ zIndex: o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + if (o.disabled) return; + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (o.disabled) return; + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; + if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; + if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; + if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); + else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('
'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.24" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.addClass("ui-selectee"); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("
"); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey && !event.ctrlKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if ((event.metaKey || event.ctrlKey) && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.24" +}); + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + //We're ready to go + this.ready = true + + }, + + destroy: function() { + $.Widget.prototype.destroy.call( this ); + this.element + .removeClass("ui-sortable ui-sortable-disabled"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData(this.widgetName + "-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + var that = this; + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, that.widgetName + '-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + // Only put the placeholder inside the current Container, skip all + // items form other containers. This works because when moving + // an item from one container to another the + // currentContainer is switched before the placeholder is moved. + // + // Without this moving items in "sub-sortables" can cause the placeholder to jitter + // beetween the outer and inner container. + if (item.instance !== this.currentContainer) continue; + + if (itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.containers[innermostIndex].floating ? this.items[j].item.offset().left : this.items[j].item.offset().top; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + this.direction = (cur - base > 0) ? 'down' : 'up'; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + + // Check if the items Container has Changed and trigger appropriate + // events. + if (this !== this.currentContainer) { + if(!noPropagation) { + delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + } + } + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.24" +}); + +})(jQuery); + +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + // jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css + color = ($.curCSS || $.css)(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.queue(function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('class') || ""; + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('class', className); + + that.animate(styleDifference(originalStyle, newStyle), { + queue: false, + duration: duration, + easing: easing, + complete: function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + $.dequeue( this ); + } + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.24", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('
') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }), + active = document.activeElement; + + // support: Firefox + // Firefox incorrectly exposes anonymous content + // https://bugzilla.mozilla.org/show_bug.cgi?id=561664 + try { + active.id; + } catch( e ) { + active = document.body; + } + + element.wrap( wrapper ); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + var parent, + active = document.activeElement; + + if (element.parent().is('.ui-effects-wrapper')) { + parent = element.parent().replaceWith(element); + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + return parent; + } + + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + var unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +// based on easing equations from Robert Penner (http://www.robertpenner.com/easing) + +var baseEasings = {}; + +$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) { + baseEasings[ name ] = function( p ) { + return Math.pow( p, i + 2 ); + }; +}); + +$.extend( baseEasings, { + Sine: function ( p ) { + return 1 - Math.cos( p * Math.PI / 2 ); + }, + Circ: function ( p ) { + return 1 - Math.sqrt( 1 - p * p ); + }, + Elastic: function( p ) { + return p === 0 || p === 1 ? p : + -Math.pow( 2, 8 * (p - 1) ) * Math.sin( ( (p - 1) * 80 - 7.5 ) * Math.PI / 15 ); + }, + Back: function( p ) { + return p * p * ( 3 * p - 2 ); + }, + Bounce: function ( p ) { + var pow2, + bounce = 4; + + while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {} + return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 ); + } +}); + +$.each( baseEasings, function( name, easeIn ) { + $.easing[ "easeIn" + name ] = easeIn; + $.easing[ "easeOut" + name ] = function( p ) { + return 1 - easeIn( 1 - p ); + }; + $.easing[ "easeInOut" + name ] = function( p ) { + return p < .5 ? + easeIn( p * 2 ) / 2 : + easeIn( p * -2 + 2 ) / -2 + 1; + }; +}); + +})(jQuery); + +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight(true) / 3 : el.outerWidth(true) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight( true ) / 2 : el.outerWidth( true ) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i
') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'), + times = ((o.options.times || 5) * 2) - 1, + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; + var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + var child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight( true ) : el.outerWidth( true )); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('
') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // find elements to show and hide + var active = this.active, + toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + // switch classes + active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + // Work around for rendering bug in IE (#5421) + if ( this.toHide.length ) { + this.toHide.parent()[0].className = this.toHide.parent()[0].className; + } + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.24", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( s.parent().width() + - parseFloat( s.css( "paddingLeft" ) ) + - parseFloat( s.css( "paddingRight" ) ) + - ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 ) + - ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); + +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + + pending: 0, + + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + this.isMultiLine = this.element.is( "textarea" ); + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + self._keyEvent( "next", event ); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.menu = $( "
    " ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + self.beforeunloadHandler = function() { + self.element.removeAttr( "autocomplete" ); + }; + $( window ).bind( "beforeunload", self.beforeunloadHandler ); + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $( window ).unbind( "beforeunload", this.beforeunloadHandler ); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( self.xhr ) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data, status ) { + response( data ); + }, + error: function() { + response( [] ); + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this._response() ); + }, + + _response: function() { + var that = this, + index = ++requestIndex; + + return function( content ) { + if ( index === requestIndex ) { + that.__response( content ); + } + + that.pending--; + if ( !that.pending ) { + that.element.removeClass( "ui-autocomplete-loading" ); + } + }; + }, + + __response: function( content ) { + if ( !this.options.disabled && content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next( new $.Event("mouseover") ); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + // Firefox wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping (#7513) + ul.width( "" ).outerWidth() + 1, + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "
  • " ) + .data( "item.autocomplete", item ) + .append( $( "    " ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + }, + _keyEvent: function( keyEvent, event ) { + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + this._move( keyEvent, event ); + + // prevents moving cursor to beginning/end of the text field in some browsers + event.preventDefault(); + } + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.scrollTop(), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.scrollTop( scroll + offset); + } else if (offset >= elementHeight) { + this.element.scrollTop( scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); + +(function( $, undefined ) { + +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = !!this.element.propAttr( "disabled" ); + } else { + this.element.propAttr( "disabled", this.options.disabled ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "click.button", function( event ) { + if ( options.disabled ) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + }); + + this.element + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + self.buttonElement.addClass( focusClass ); + }) + .bind( "blur.button", function() { + self.buttonElement.removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + if ( clickDragged ) { + return; + } + self.refresh(); + }); + // if mouse moves between mousedown and mouseup (drag) set clickDragged flag + // prevents issue where button state changes but checkbox/radio checked state + // does not in Firefox (see ticket #6970) + this.buttonElement + .bind( "mousedown.button", function( event ) { + if ( options.disabled ) { + return; + } + clickDragged = false; + startXPos = event.pageX; + startYPos = event.pageY; + }) + .bind( "mouseup.button", function( event ) { + if ( options.disabled ) { + return; + } + if ( startXPos !== event.pageX || startYPos !== event.pageY ) { + clickDragged = true; + } + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", "true" ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + this._resetButton(); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else if ( this.element.is(":radio") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + var ancestor = this.element.parents().filter(":last"), + labelSelector = "label[for='" + this.element.attr("id") + "']"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.propAttr( "disabled", true ); + } else { + this.element.propAttr( "disabled", false ); + } + return; + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "", this.element[0].ownerDocument ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; + + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + } + + if ( icons.primary ) { + buttonElement.prepend( "" ); + } + + if ( icons.secondary ) { + buttonElement.append( "" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + var rtl = this.element.css( "direction" ) === "rtl"; + + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( rtl ? "ui-corner-right" : "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( rtl ? "ui-corner-left" : "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); + +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.24" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); +var instActive; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false, // True to size the input for the date format, false to leave as is + disabled: false // The initial disabled state + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = bindHover($('
    ')); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + bindHover($('
    ')))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('' + appendText + ''); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) { + $.datepicker._hideDatepicker(); + $.datepicker._showDatepicker(input[0]); + } else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $(''); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (err) { + $.datepicker.log(err); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false + return; + } + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + this._attachHandlers(inst); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()); + var viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop()); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + this._datepickerShowing = false; + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); + + if ( ( ( $target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) ) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Attach the onxxx handlers. These are declared statically so + * they work with static code transformers like Caja. + */ + _attachHandlers: function(inst) { + var stepMonths = this._get(inst, 'stepMonths'); + var id = '#' + inst.id.replace( /\\\\/g, "\\" ); + inst.dpDiv.find('[data-handler]').map(function () { + var handler = { + prev: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, -stepMonths, 'M'); + }, + next: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, +stepMonths, 'M'); + }, + hide: function () { + window['DP_jQuery_' + dpuuid].datepicker._hideDatepicker(); + }, + today: function () { + window['DP_jQuery_' + dpuuid].datepicker._gotoToday(id); + }, + selectDay: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectDay(id, +this.getAttribute('data-month'), +this.getAttribute('data-year'), this); + return false; + }, + selectMonth: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'M'); + return false; + }, + selectYear: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'Y'); + return false; + } + }; + $(this).bind(this.getAttribute('data-event'), handler[this.getAttribute('data-handler')]); + }); + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '
    ' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
    ' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '
    '; + } + calender += '
    ' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '
    ' + + ''; + var thead = (showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = (!showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '
    ' + this._get(inst, 'weekHeader') + '
    ' + + this._get(inst, 'calculateWeek')(printDate) + '' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
    ' + (isMultiMonth ? '' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
    ' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
    '; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ''; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ''; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '
    '; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.24"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); + +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('
    ')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('
    ')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('
    ') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "
    " ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in button ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.24", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('
    ').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); + +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + if ( $.isFunction( options ) ) { + return this.each(function( i ) { + $( this ).offset( options.call( this, i, $( this ).offset() ) ); + }); + } + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css +if ( !$.curCSS ) { + $.curCSS = $.css; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); + +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "
    " ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.24" +}); + +})( jQuery ); + +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "
    " ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.24" +}); + +}(jQuery)); + +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "
    ", + remove: null, + select: null, + show: null, + spinner: "Loading…", + tabTemplate: "
  • #{label}
    • " + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on
  • + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.24" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); diff --git a/Scripts/jquery-ui-1.8.24.min.js b/Scripts/jquery-ui-1.8.24.min.js new file mode 100644 index 0000000..9278857 --- /dev/null +++ b/Scripts/jquery-ui-1.8.24.min.js @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.24 - 2012-09-28 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.effects.core.js, jquery.effects.blind.js, jquery.effects.bounce.js, jquery.effects.clip.js, jquery.effects.drop.js, jquery.effects.explode.js, jquery.effects.fade.js, jquery.effects.fold.js, jquery.effects.highlight.js, jquery.effects.pulsate.js, jquery.effects.scale.js, jquery.effects.shake.js, jquery.effects.slide.js, jquery.effects.transfer.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.position.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.tabs.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +(function(a,b){function c(b,c){var e=b.nodeName.toLowerCase();if("area"===e){var f=b.parentNode,g=f.name,h;return!b.href||!g||f.nodeName.toLowerCase()!=="map"?!1:(h=a("img[usemap=#"+g+"]")[0],!!h&&d(h))}return(/input|select|textarea|button|object/.test(e)?!b.disabled:"a"==e?b.href||c:c)&&d(b)}function d(b){return!a(b).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.ui=a.ui||{};if(a.ui.version)return;a.extend(a.ui,{version:"1.8.24",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}}),a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(b,c){return typeof b=="number"?this.each(function(){var d=this;setTimeout(function(){a(d).focus(),c&&c.call(d)},b)}):this._focus.apply(this,arguments)},scrollParent:function(){var b;return a.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?b=this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.curCSS(this,"position",1))&&/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0):b=this.parents().filter(function(){return/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0),/fixed/.test(this.css("position"))||!b.length?a(document):b},zIndex:function(c){if(c!==b)return this.css("zIndex",c);if(this.length){var d=a(this[0]),e,f;while(d.length&&d[0]!==document){e=d.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){f=parseInt(d.css("zIndex"),10);if(!isNaN(f)&&f!==0)return f}d=d.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}}),a("").outerWidth(1).jquery||a.each(["Width","Height"],function(c,d){function h(b,c,d,f){return a.each(e,function(){c-=parseFloat(a.curCSS(b,"padding"+this,!0))||0,d&&(c-=parseFloat(a.curCSS(b,"border"+this+"Width",!0))||0),f&&(c-=parseFloat(a.curCSS(b,"margin"+this,!0))||0)}),c}var e=d==="Width"?["Left","Right"]:["Top","Bottom"],f=d.toLowerCase(),g={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};a.fn["inner"+d]=function(c){return c===b?g["inner"+d].call(this):this.each(function(){a(this).css(f,h(this,c)+"px")})},a.fn["outer"+d]=function(b,c){return typeof b!="number"?g["outer"+d].call(this,b):this.each(function(){a(this).css(f,h(this,b,!0,c)+"px")})}}),a.extend(a.expr[":"],{data:a.expr.createPseudo?a.expr.createPseudo(function(b){return function(c){return!!a.data(c,b)}}):function(b,c,d){return!!a.data(b,d[3])},focusable:function(b){return c(b,!isNaN(a.attr(b,"tabindex")))},tabbable:function(b){var d=a.attr(b,"tabindex"),e=isNaN(d);return(e||d>=0)&&c(b,!e)}}),a(function(){var b=document.body,c=b.appendChild(c=document.createElement("div"));c.offsetHeight,a.extend(c.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0}),a.support.minHeight=c.offsetHeight===100,a.support.selectstart="onselectstart"in c,b.removeChild(c).style.display="none"}),a.curCSS||(a.curCSS=a.css),a.extend(a.ui,{plugin:{add:function(b,c,d){var e=a.ui[b].prototype;for(var f in d)e.plugins[f]=e.plugins[f]||[],e.plugins[f].push([c,d[f]])},call:function(a,b,c){var d=a.plugins[b];if(!d||!a.element[0].parentNode)return;for(var e=0;e0?!0:(b[d]=1,e=b[d]>0,b[d]=0,e)},isOverAxis:function(a,b,c){return a>b&&a=9||!!b.button?this._mouseStarted?(this._mouseDrag(b),b.preventDefault()):(this._mouseDistanceMet(b)&&this._mouseDelayMet(b)&&(this._mouseStarted=this._mouseStart(this._mouseDownEvent,b)!==!1,this._mouseStarted?this._mouseDrag(b):this._mouseUp(b)),!this._mouseStarted):this._mouseUp(b)},_mouseUp:function(b){return a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,b.target==this._mouseDownEvent.target&&a.data(b.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(b)),!1},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(a){return this.mouseDelayMet},_mouseStart:function(a){},_mouseDrag:function(a){},_mouseStop:function(a){},_mouseCapture:function(a){return!0}})}(jQuery),function(a,b){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1},_create:function(){this.options.helper=="original"&&!/^(?:r|a|f)/.test(this.element.css("position"))&&(this.element[0].style.position="relative"),this.options.addClasses&&this.element.addClass("ui-draggable"),this.options.disabled&&this.element.addClass("ui-draggable-disabled"),this._mouseInit()},destroy:function(){if(!this.element.data("draggable"))return;return this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"),this._mouseDestroy(),this},_mouseCapture:function(b){var c=this.options;return this.helper||c.disabled||a(b.target).is(".ui-resizable-handle")?!1:(this.handle=this._getHandle(b),this.handle?(c.iframeFix&&a(c.iframeFix===!0?"iframe":c.iframeFix).each(function(){a('
    ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1e3}).css(a(this).offset()).appendTo("body")}),!0):!1)},_mouseStart:function(b){var c=this.options;return this.helper=this._createHelper(b),this.helper.addClass("ui-draggable-dragging"),this._cacheHelperProportions(),a.ui.ddmanager&&(a.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(),this.offset=this.positionAbs=this.element.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this.position=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt),c.containment&&this._setContainment(),this._trigger("start",b)===!1?(this._clear(),!1):(this._cacheHelperProportions(),a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this._mouseDrag(b,!0),a.ui.ddmanager&&a.ui.ddmanager.dragStart(this,b),!0)},_mouseDrag:function(b,c){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute");if(!c){var d=this._uiHash();if(this._trigger("drag",b,d)===!1)return this._mouseUp({}),!1;this.position=d.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";return a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),!1},_mouseStop:function(b){var c=!1;a.ui.ddmanager&&!this.options.dropBehaviour&&(c=a.ui.ddmanager.drop(this,b)),this.dropped&&(c=this.dropped,this.dropped=!1);var d=this.element[0],e=!1;while(d&&(d=d.parentNode))d==document&&(e=!0);if(!e&&this.options.helper==="original")return!1;if(this.options.revert=="invalid"&&!c||this.options.revert=="valid"&&c||this.options.revert===!0||a.isFunction(this.options.revert)&&this.options.revert.call(this.element,c)){var f=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){f._trigger("stop",b)!==!1&&f._clear()})}else this._trigger("stop",b)!==!1&&this._clear();return!1},_mouseUp:function(b){return a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)}),a.ui.ddmanager&&a.ui.ddmanager.dragStop(this,b),a.ui.mouse.prototype._mouseUp.call(this,b)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?!0:!1;return a(this.options.handle,this.element).find("*").andSelf().each(function(){this==b.target&&(c=!0)}),c},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b])):c.helper=="clone"?this.element.clone().removeAttr("id"):this.element;return d.parents("body").length||d.appendTo(c.appendTo=="parent"?this.element[0].parentNode:c.appendTo),d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&&d.css("position","absolute"),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[b.containment=="document"?0:a(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,b.containment=="document"?0:a(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,(b.containment=="document"?0:a(window).scrollLeft())+a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(b.containment=="document"?0:a(window).scrollTop())+(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)&&b.containment.constructor!=Array){var c=a(b.containment),d=c[0];if(!d)return;var e=c.offset(),f=a(d).css("overflow")!="hidden";this.containment=[(parseInt(a(d).css("borderLeftWidth"),10)||0)+(parseInt(a(d).css("paddingLeft"),10)||0),(parseInt(a(d).css("borderTopWidth"),10)||0)+(parseInt(a(d).css("paddingTop"),10)||0),(f?Math.max(d.scrollWidth,d.offsetWidth):d.offsetWidth)-(parseInt(a(d).css("borderLeftWidth"),10)||0)-(parseInt(a(d).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(f?Math.max(d.scrollHeight,d.offsetHeight):d.offsetHeight)-(parseInt(a(d).css("borderTopWidth"),10)||0)-(parseInt(a(d).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relative_container=c}else b.containment.constructor==Array&&(this.containment=b.containment)},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName),f=b.pageX,g=b.pageY;if(this.originalPosition){var h;if(this.containment){if(this.relative_container){var i=this.relative_container.offset();h=[this.containment[0]+i.left,this.containment[1]+i.top,this.containment[2]+i.left,this.containment[3]+i.top]}else h=this.containment;b.pageX-this.offset.click.lefth[2]&&(f=h[2]+this.offset.click.left),b.pageY-this.offset.click.top>h[3]&&(g=h[3]+this.offset.click.top)}if(c.grid){var j=c.grid[1]?this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1]:this.originalPageY;g=h?j-this.offset.click.toph[3]?j-this.offset.click.toph[2]?k-this.offset.click.left=0;k--){var l=d.snapElements[k].left,m=l+d.snapElements[k].width,n=d.snapElements[k].top,o=n+d.snapElements[k].height;if(!(l-f=k&&g<=l||h>=k&&h<=l||gl)&&(e>=i&&e<=j||f>=i&&f<=j||ej);default:return!1}},a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(b,c){var d=a.ui.ddmanager.droppables[b.options.scope]||[],e=c?c.type:null,f=(b.currentItem||b.element).find(":data(droppable)").andSelf();g:for(var h=0;h').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("resizable",this.element.data("resizable")),this.elementIsWrapper=!0,this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")}),this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0}),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css({margin:this.originalElement.css("margin")}),this._proportionallyResize()),this.handles=c.handles||(a(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se");if(this.handles.constructor==String){this.handles=="all"&&(this.handles="n,e,s,w,se,sw,ne,nw");var d=this.handles.split(",");this.handles={};for(var e=0;e');h.css({zIndex:c.zIndex}),"se"==f&&h.addClass("ui-icon ui-icon-gripsmall-diagonal-se"),this.handles[f]=".ui-resizable-"+f,this.element.append(h)}}this._renderAxis=function(b){b=b||this.element;for(var c in this.handles){this.handles[c].constructor==String&&(this.handles[c]=a(this.handles[c],this.element).show());if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var d=a(this.handles[c],this.element),e=0;e=/sw|ne|nw|se|n|s/.test(c)?d.outerHeight():d.outerWidth();var f=["padding",/ne|nw|n/.test(c)?"Top":/se|sw|s/.test(c)?"Bottom":/^e$/.test(c)?"Right":"Left"].join("");b.css(f,e),this._proportionallyResize()}if(!a(this.handles[c]).length)continue}},this._renderAxis(this.element),this._handles=a(".ui-resizable-handle",this.element).disableSelection(),this._handles.mouseover(function(){if(!b.resizing){if(this.className)var a=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=a&&a[1]?a[1]:"se"}}),c.autoHide&&(this._handles.hide(),a(this.element).addClass("ui-resizable-autohide").hover(function(){if(c.disabled)return;a(this).removeClass("ui-resizable-autohide"),b._handles.show()},function(){if(c.disabled)return;b.resizing||(a(this).addClass("ui-resizable-autohide"),b._handles.hide())})),this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(b){a(b).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var c=this.element;c.after(this.originalElement.css({position:c.css("position"),width:c.outerWidth(),height:c.outerHeight(),top:c.css("top"),left:c.css("left")})).remove()}return this.originalElement.css("resize",this.originalResizeStyle),b(this.originalElement),this},_mouseCapture:function(b){var c=!1;for(var d in this.handles)a(this.handles[d])[0]==b.target&&(c=!0);return!this.options.disabled&&c},_mouseStart:function(b){var d=this.options,e=this.element.position(),f=this.element;this.resizing=!0,this.documentScroll={top:a(document).scrollTop(),left:a(document).scrollLeft()},(f.is(".ui-draggable")||/absolute/.test(f.css("position")))&&f.css({position:"absolute",top:e.top,left:e.left}),this._renderProxy();var g=c(this.helper.css("left")),h=c(this.helper.css("top"));d.containment&&(g+=a(d.containment).scrollLeft()||0,h+=a(d.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:g,top:h},this.size=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalSize=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalPosition={left:g,top:h},this.sizeDiff={width:f.outerWidth()-f.width(),height:f.outerHeight()-f.height()},this.originalMousePosition={left:b.pageX,top:b.pageY},this.aspectRatio=typeof d.aspectRatio=="number"?d.aspectRatio:this.originalSize.width/this.originalSize.height||1;var i=a(".ui-resizable-"+this.axis).css("cursor");return a("body").css("cursor",i=="auto"?this.axis+"-resize":i),f.addClass("ui-resizable-resizing"),this._propagate("start",b),!0},_mouseDrag:function(b){var c=this.helper,d=this.options,e={},f=this,g=this.originalMousePosition,h=this.axis,i=b.pageX-g.left||0,j=b.pageY-g.top||0,k=this._change[h];if(!k)return!1;var l=k.apply(this,[b,i,j]),m=a.browser.msie&&a.browser.version<7,n=this.sizeDiff;this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)l=this._updateRatio(l,b);return l=this._respectSize(l,b),this._propagate("resize",b),c.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"}),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),this._updateCache(l),this._trigger("resize",b,this.ui()),!1},_mouseStop:function(b){this.resizing=!1;var c=this.options,d=this;if(this._helper){var e=this._proportionallyResizeElements,f=e.length&&/textarea/i.test(e[0].nodeName),g=f&&a.ui.hasScroll(e[0],"left")?0:d.sizeDiff.height,h=f?0:d.sizeDiff.width,i={width:d.helper.width()-h,height:d.helper.height()-g},j=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,k=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;c.animate||this.element.css(a.extend(i,{top:k,left:j})),d.helper.height(d.size.height),d.helper.width(d.size.width),this._helper&&!c.animate&&this._proportionallyResize()}return a("body").css("cursor","auto"),this.element.removeClass("ui-resizable-resizing"),this._propagate("stop",b),this._helper&&this.helper.remove(),!1},_updateVirtualBoundaries:function(a){var b=this.options,c,e,f,g,h;h={minWidth:d(b.minWidth)?b.minWidth:0,maxWidth:d(b.maxWidth)?b.maxWidth:Infinity,minHeight:d(b.minHeight)?b.minHeight:0,maxHeight:d(b.maxHeight)?b.maxHeight:Infinity};if(this._aspectRatio||a)c=h.minHeight*this.aspectRatio,f=h.minWidth/this.aspectRatio,e=h.maxHeight*this.aspectRatio,g=h.maxWidth/this.aspectRatio,c>h.minWidth&&(h.minWidth=c),f>h.minHeight&&(h.minHeight=f),ea.width,k=d(a.height)&&e.minHeight&&e.minHeight>a.height;j&&(a.width=e.minWidth),k&&(a.height=e.minHeight),h&&(a.width=e.maxWidth),i&&(a.height=e.maxHeight);var l=this.originalPosition.left+this.originalSize.width,m=this.position.top+this.size.height,n=/sw|nw|w/.test(g),o=/nw|ne|n/.test(g);j&&n&&(a.left=l-e.minWidth),h&&n&&(a.left=l-e.maxWidth),k&&o&&(a.top=m-e.minHeight),i&&o&&(a.top=m-e.maxHeight);var p=!a.width&&!a.height;return p&&!a.left&&a.top?a.top=null:p&&!a.top&&a.left&&(a.left=null),a},_proportionallyResize:function(){var b=this.options;if(!this._proportionallyResizeElements.length)return;var c=this.helper||this.element;for(var d=0;d');var d=a.browser.msie&&a.browser.version<7,e=d?1:0,f=d?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+f,height:this.element.outerHeight()+f,position:"absolute",left:this.elementOffset.left-e+"px",top:this.elementOffset.top-e+"px",zIndex:++c.zIndex}),this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(a,b,c){return{width:this.originalSize.width+b}},w:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{left:f.left+b,width:e.width-b}},n:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{top:f.top+c,height:e.height-c}},s:function(a,b,c){return{height:this.originalSize.height+c}},se:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},sw:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,c,d]))},ne:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},nw:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,c,d]))}},_propagate:function(b,c){a.ui.plugin.call(this,b,[c,this.ui()]),b!="resize"&&this._trigger(b,c,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),a.extend(a.ui.resizable,{version:"1.8.24"}),a.ui.plugin.add("resizable","alsoResize",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=function(b){a(b).each(function(){var b=a(this);b.data("resizable-alsoresize",{width:parseInt(b.width(),10),height:parseInt(b.height(),10),left:parseInt(b.css("left"),10),top:parseInt(b.css("top"),10)})})};typeof e.alsoResize=="object"&&!e.alsoResize.parentNode?e.alsoResize.length?(e.alsoResize=e.alsoResize[0],f(e.alsoResize)):a.each(e.alsoResize,function(a){f(a)}):f(e.alsoResize)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.originalSize,g=d.originalPosition,h={height:d.size.height-f.height||0,width:d.size.width-f.width||0,top:d.position.top-g.top||0,left:d.position.left-g.left||0},i=function(b,d){a(b).each(function(){var b=a(this),e=a(this).data("resizable-alsoresize"),f={},g=d&&d.length?d:b.parents(c.originalElement[0]).length?["width","height"]:["width","height","top","left"];a.each(g,function(a,b){var c=(e[b]||0)+(h[b]||0);c&&c>=0&&(f[b]=c||null)}),b.css(f)})};typeof e.alsoResize=="object"&&!e.alsoResize.nodeType?a.each(e.alsoResize,function(a,b){i(a,b)}):i(e.alsoResize)},stop:function(b,c){a(this).removeData("resizable-alsoresize")}}),a.ui.plugin.add("resizable","animate",{stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d._proportionallyResizeElements,g=f.length&&/textarea/i.test(f[0].nodeName),h=g&&a.ui.hasScroll(f[0],"left")?0:d.sizeDiff.height,i=g?0:d.sizeDiff.width,j={width:d.size.width-i,height:d.size.height-h},k=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,l=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;d.element.animate(a.extend(j,l&&k?{top:l,left:k}:{}),{duration:e.animateDuration,easing:e.animateEasing,step:function(){var c={width:parseInt(d.element.css("width"),10),height:parseInt(d.element.css("height"),10),top:parseInt(d.element.css("top"),10),left:parseInt(d.element.css("left"),10)};f&&f.length&&a(f[0]).css({width:c.width,height:c.height}),d._updateCache(c),d._propagate("resize",b)}})}}),a.ui.plugin.add("resizable","containment",{start:function(b,d){var e=a(this).data("resizable"),f=e.options,g=e.element,h=f.containment,i=h instanceof a?h.get(0):/parent/.test(h)?g.parent().get(0):h;if(!i)return;e.containerElement=a(i);if(/document/.test(h)||h==document)e.containerOffset={left:0,top:0},e.containerPosition={left:0,top:0},e.parentData={element:a(document),left:0,top:0,width:a(document).width(),height:a(document).height()||document.body.parentNode.scrollHeight};else{var j=a(i),k=[];a(["Top","Right","Left","Bottom"]).each(function(a,b){k[a]=c(j.css("padding"+b))}),e.containerOffset=j.offset(),e.containerPosition=j.position(),e.containerSize={height:j.innerHeight()-k[3],width:j.innerWidth()-k[1]};var l=e.containerOffset,m=e.containerSize.height,n=e.containerSize.width,o=a.ui.hasScroll(i,"left")?i.scrollWidth:n,p=a.ui.hasScroll(i)?i.scrollHeight:m;e.parentData={element:i,left:l.left,top:l.top,width:o,height:p}}},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.containerSize,g=d.containerOffset,h=d.size,i=d.position,j=d._aspectRatio||b.shiftKey,k={top:0,left:0},l=d.containerElement;l[0]!=document&&/static/.test(l.css("position"))&&(k=g),i.left<(d._helper?g.left:0)&&(d.size.width=d.size.width+(d._helper?d.position.left-g.left:d.position.left-k.left),j&&(d.size.height=d.size.width/d.aspectRatio),d.position.left=e.helper?g.left:0),i.top<(d._helper?g.top:0)&&(d.size.height=d.size.height+(d._helper?d.position.top-g.top:d.position.top),j&&(d.size.width=d.size.height*d.aspectRatio),d.position.top=d._helper?g.top:0),d.offset.left=d.parentData.left+d.position.left,d.offset.top=d.parentData.top+d.position.top;var m=Math.abs((d._helper?d.offset.left-k.left:d.offset.left-k.left)+d.sizeDiff.width),n=Math.abs((d._helper?d.offset.top-k.top:d.offset.top-g.top)+d.sizeDiff.height),o=d.containerElement.get(0)==d.element.parent().get(0),p=/relative|absolute/.test(d.containerElement.css("position"));o&&p&&(m-=d.parentData.left),m+d.size.width>=d.parentData.width&&(d.size.width=d.parentData.width-m,j&&(d.size.height=d.size.width/d.aspectRatio)),n+d.size.height>=d.parentData.height&&(d.size.height=d.parentData.height-n,j&&(d.size.width=d.size.height*d.aspectRatio))},stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.position,g=d.containerOffset,h=d.containerPosition,i=d.containerElement,j=a(d.helper),k=j.offset(),l=j.outerWidth()-d.sizeDiff.width,m=j.outerHeight()-d.sizeDiff.height;d._helper&&!e.animate&&/relative/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m}),d._helper&&!e.animate&&/static/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m})}}),a.ui.plugin.add("resizable","ghost",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size;d.ghost=d.originalElement.clone(),d.ghost.css({opacity:.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof e.ghost=="string"?e.ghost:""),d.ghost.appendTo(d.helper)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.ghost.css({position:"relative",height:d.size.height,width:d.size.width})},stop:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.helper&&d.helper.get(0).removeChild(d.ghost.get(0))}}),a.ui.plugin.add("resizable","grid",{resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size,g=d.originalSize,h=d.originalPosition,i=d.axis,j=e._aspectRatio||b.shiftKey;e.grid=typeof e.grid=="number"?[e.grid,e.grid]:e.grid;var k=Math.round((f.width-g.width)/(e.grid[0]||1))*(e.grid[0]||1),l=Math.round((f.height-g.height)/(e.grid[1]||1))*(e.grid[1]||1);/^(se|s|e)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l):/^(ne)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l):/^(sw)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.left=h.left-k):(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l,d.position.left=h.left-k)}});var c=function(a){return parseInt(a,10)||0},d=function(a){return!isNaN(parseInt(a,10))}}(jQuery),function(a,b){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch"},_create:function(){var b=this;this.element.addClass("ui-selectable"),this.dragged=!1;var c;this.refresh=function(){c=a(b.options.filter,b.element[0]),c.addClass("ui-selectee"),c.each(function(){var b=a(this),c=b.offset();a.data(this,"selectable-item",{element:this,$element:b,left:c.left,top:c.top,right:c.left+b.outerWidth(),bottom:c.top+b.outerHeight(),startselected:!1,selected:b.hasClass("ui-selected"),selecting:b.hasClass("ui-selecting"),unselecting:b.hasClass("ui-unselecting")})})},this.refresh(),this.selectees=c.addClass("ui-selectee"),this._mouseInit(),this.helper=a("
    ")},destroy:function(){return this.selectees.removeClass("ui-selectee").removeData("selectable-item"),this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable"),this._mouseDestroy(),this},_mouseStart:function(b){var c=this;this.opos=[b.pageX,b.pageY];if(this.options.disabled)return;var d=this.options;this.selectees=a(d.filter,this.element[0]),this._trigger("start",b),a(d.appendTo).append(this.helper),this.helper.css({left:b.clientX,top:b.clientY,width:0,height:0}),d.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var d=a.data(this,"selectable-item");d.startselected=!0,!b.metaKey&&!b.ctrlKey&&(d.$element.removeClass("ui-selected"),d.selected=!1,d.$element.addClass("ui-unselecting"),d.unselecting=!0,c._trigger("unselecting",b,{unselecting:d.element}))}),a(b.target).parents().andSelf().each(function(){var d=a.data(this,"selectable-item");if(d){var e=!b.metaKey&&!b.ctrlKey||!d.$element.hasClass("ui-selected");return d.$element.removeClass(e?"ui-unselecting":"ui-selected").addClass(e?"ui-selecting":"ui-unselecting"),d.unselecting=!e,d.selecting=e,d.selected=e,e?c._trigger("selecting",b,{selecting:d.element}):c._trigger("unselecting",b,{unselecting:d.element}),!1}})},_mouseDrag:function(b){var c=this;this.dragged=!0;if(this.options.disabled)return;var d=this.options,e=this.opos[0],f=this.opos[1],g=b.pageX,h=b.pageY;if(e>g){var i=g;g=e,e=i}if(f>h){var i=h;h=f,f=i}return this.helper.css({left:e,top:f,width:g-e,height:h-f}),this.selectees.each(function(){var i=a.data(this,"selectable-item");if(!i||i.element==c.element[0])return;var j=!1;d.tolerance=="touch"?j=!(i.left>g||i.righth||i.bottome&&i.rightf&&i.bottom *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3},_create:function(){var a=this.options;this.containerCache={},this.element.addClass("ui-sortable"),this.refresh(),this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):!1,this.offset=this.element.offset(),this._mouseInit(),this.ready=!0},destroy:function(){a.Widget.prototype.destroy.call(this),this.element.removeClass("ui-sortable ui-sortable-disabled"),this._mouseDestroy();for(var b=this.items.length-1;b>=0;b--)this.items[b].item.removeData(this.widgetName+"-item");return this},_setOption:function(b,c){b==="disabled"?(this.options[b]=c,this.widget()[c?"addClass":"removeClass"]("ui-sortable-disabled")):a.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(b,c){var d=this;if(this.reverting)return!1;if(this.options.disabled||this.options.type=="static")return!1;this._refreshItems(b);var e=null,f=this,g=a(b.target).parents().each(function(){if(a.data(this,d.widgetName+"-item")==f)return e=a(this),!1});a.data(b.target,d.widgetName+"-item")==f&&(e=a(b.target));if(!e)return!1;if(this.options.handle&&!c){var h=!1;a(this.options.handle,e).find("*").andSelf().each(function(){this==b.target&&(h=!0)});if(!h)return!1}return this.currentItem=e,this._removeCurrentsFromItems(),!0},_mouseStart:function(b,c,d){var e=this.options,f=this;this.currentContainer=this,this.refreshPositions(),this.helper=this._createHelper(b),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),this.originalPosition=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!=this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),e.containment&&this._setContainment(),e.cursor&&(a("body").css("cursor")&&(this._storedCursor=a("body").css("cursor")),a("body").css("cursor",e.cursor)),e.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",e.opacity)),e.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",e.zIndex)),this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",b,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions();if(!d)for(var g=this.containers.length-1;g>=0;g--)this.containers[g]._trigger("activate",b,f._uiHash(this));return a.ui.ddmanager&&(a.ui.ddmanager.current=this),a.ui.ddmanager&&!e.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this.dragging=!0,this.helper.addClass("ui-sortable-helper"),this._mouseDrag(b),!0},_mouseDrag:function(b){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs);if(this.options.scroll){var c=this.options,d=!1;this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-b.pageY=0;e--){var f=this.items[e],g=f.item[0],h=this._intersectsWithPointer(f);if(!h)continue;if(f.instance!==this.currentContainer)continue;if(g!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=g&&!a.ui.contains(this.placeholder[0],g)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],g):!0)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(f))this._rearrange(b,f);else break;this._trigger("change",b,this._uiHash());break}}return this._contactContainers(b),a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),this._trigger("sort",b,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(b,c){if(!b)return;a.ui.ddmanager&&!this.options.dropBehaviour&&a.ui.ddmanager.drop(this,b);if(this.options.revert){var d=this,e=d.placeholder.offset();d.reverting=!0,a(this.helper).animate({left:e.left-this.offset.parent.left-d.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-d.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){d._clear(b)})}else this._clear(b,c);return!1},cancel:function(){var b=this;if(this.dragging){this._mouseUp({target:null}),this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("deactivate",null,b._uiHash(this)),this.containers[c].containerCache.over&&(this.containers[c]._trigger("out",null,b._uiHash(this)),this.containers[c].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),a.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?a(this.domPosition.prev).after(this.currentItem):a(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},a(c).each(function(){var c=(a(b.item||this).attr(b.attribute||"id")||"").match(b.expression||/(.+)[-=_](.+)/);c&&d.push((b.key||c[1]+"[]")+"="+(b.key&&b.expression?c[1]:c[2]))}),!d.length&&b.key&&d.push(b.key+"="),d.join("&")},toArray:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},c.each(function(){d.push(a(b.item||this).attr(b.attribute||"id")||"")}),d},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,d=this.positionAbs.top,e=d+this.helperProportions.height,f=a.left,g=f+a.width,h=a.top,i=h+a.height,j=this.offset.click.top,k=this.offset.click.left,l=d+j>h&&d+jf&&b+ka[this.floating?"width":"height"]?l:f0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){return this._refreshItems(a),this.refreshPositions(),this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(b){var c=this,d=[],e=[],f=this._connectWith();if(f&&b)for(var g=f.length-1;g>=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&e.push([a.isFunction(j.options.items)?j.options.items.call(j.element):a(j.options.items,j.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),j])}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var g=e.length-1;g>=0;g--)e[g][0].each(function(){d.push(this)});return a(d)},_removeCurrentsFromItems:function(){var a=this.currentItem.find(":data("+this.widgetName+"-item)");for(var b=0;b=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&(e.push([a.isFunction(j.options.items)?j.options.items.call(j.element[0],b,{item:this.currentItem}):a(j.options.items,j.element),j]),this.containers.push(j))}}for(var g=e.length-1;g>=0;g--){var k=e[g][1],l=e[g][0];for(var i=0,m=l.length;i=0;c--){var d=this.items[c];if(d.instance!=this.currentContainer&&this.currentContainer&&d.item[0]!=this.currentItem[0])continue;var e=this.options.toleranceElement?a(this.options.toleranceElement,d.item):d.item;b||(d.width=e.outerWidth(),d.height=e.outerHeight());var f=e.offset();d.left=f.left,d.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(var c=this.containers.length-1;c>=0;c--){var f=this.containers[c].element.offset();this.containers[c].containerCache.left=f.left,this.containers[c].containerCache.top=f.top,this.containers[c].containerCache.width=this.containers[c].element.outerWidth(),this.containers[c].containerCache.height=this.containers[c].element.outerHeight()}return this},_createPlaceholder:function(b){var c=b||this,d=c.options;if(!d.placeholder||d.placeholder.constructor==String){var e=d.placeholder;d.placeholder={element:function(){var b=a(document.createElement(c.currentItem[0].nodeName)).addClass(e||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];return e||(b.style.visibility="hidden"),b},update:function(a,b){if(e&&!d.forcePlaceholderSize)return;b.height()||b.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10)),b.width()||b.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")||0,10))}}}c.placeholder=a(d.placeholder.element.call(c.element,c.currentItem)),c.currentItem.after(c.placeholder),d.placeholder.update(c,c.placeholder)},_contactContainers:function(b){var c=null,d=null;for(var e=this.containers.length-1;e>=0;e--){if(a.ui.contains(this.currentItem[0],this.containers[e].element[0]))continue;if(this._intersectsWith(this.containers[e].containerCache)){if(c&&a.ui.contains(this.containers[e].element[0],c.element[0]))continue;c=this.containers[e],d=e}else this.containers[e].containerCache.over&&(this.containers[e]._trigger("out",b,this._uiHash(this)),this.containers[e].containerCache.over=0)}if(!c)return;if(this.containers.length===1)this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1;else if(this.currentContainer!=this.containers[d]){var f=1e4,g=null,h=this.positionAbs[this.containers[d].floating?"left":"top"];for(var i=this.items.length-1;i>=0;i--){if(!a.ui.contains(this.containers[d].element[0],this.items[i].item[0]))continue;var j=this.containers[d].floating?this.items[i].item.offset().left:this.items[i].item.offset().top;Math.abs(j-h)0?"down":"up")}if(!g&&!this.options.dropOnEmpty)return;this.currentContainer=this.containers[d],g?this._rearrange(b,g,null,!0):this._rearrange(b,null,this.containers[d].element,!0),this._trigger("change",b,this._uiHash()),this.containers[d]._trigger("change",b,this._uiHash(this)),this.options.placeholder.update(this.currentContainer,this.placeholder),this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1}},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b,this.currentItem])):c.helper=="clone"?this.currentItem.clone():this.currentItem;return d.parents("body").length||a(c.appendTo!="parent"?c.appendTo:this.currentItem[0].parentNode)[0].appendChild(d[0]),d[0]==this.currentItem[0]&&(this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}),(d[0].style.width==""||c.forceHelperSize)&&d.width(this.currentItem.width()),(d[0].style.height==""||c.forceHelperSize)&&d.height(this.currentItem.height()),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)){var c=a(b.containment)[0],d=a(b.containment).offset(),e=a(c).css("overflow")!="hidden";this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(e?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(e?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName);this.cssPosition=="relative"&&(this.scrollParent[0]==document||this.scrollParent[0]==this.offsetParent[0])&&(this.offset.relative=this._getRelativeOffset());var f=b.pageX,g=b.pageY;if(this.originalPosition){this.containment&&(b.pageX-this.offset.click.leftthis.containment[2]&&(f=this.containment[2]+this.offset.click.left),b.pageY-this.offset.click.top>this.containment[3]&&(g=this.containment[3]+this.offset.click.top));if(c.grid){var h=this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1];g=this.containment?h-this.offset.click.topthis.containment[3]?h-this.offset.click.topthis.containment[2]?i-this.offset.click.left=0;f--)c||d.push(function(a){return function(b){a._trigger("deactivate",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over&&(d.push(function(a){return function(b){a._trigger("out",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over=0);this._storedCursor&&a("body").css("cursor",this._storedCursor),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex),this.dragging=!1;if(this.cancelHelperRemoval){if(!c){this._trigger("beforeStop",b,this._uiHash());for(var f=0;f").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),e=document.activeElement;try{e.id}catch(f){e=document.body}return b.wrap(d),(b[0]===e||a.contains(b[0],e))&&a(e).focus(),d=b.parent(),b.css("position")=="static"?(d.css({position:"relative"}),b.css({position:"relative"})):(a.extend(c,{position:b.css("position"),zIndex:b.css("z-index")}),a.each(["top","left","bottom","right"],function(a,d){c[d]=b.css(d),isNaN(parseInt(c[d],10))&&(c[d]="auto")}),b.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),d.css(c).show()},removeWrapper:function(b){var c,d=document.activeElement;return b.parent().is(".ui-effects-wrapper")?(c=b.parent().replaceWith(b),(b[0]===d||a.contains(b[0],d))&&a(d).focus(),c):b},setTransition:function(b,c,d,e){return e=e||{},a.each(c,function(a,c){var f=b.cssUnit(c);f[0]>0&&(e[c]=f[0]*d+f[1])}),e}}),a.fn.extend({effect:function(b,c,d,e){var f=k.apply(this,arguments),g={options:f[1],duration:f[2],callback:f[3]},h=g.options.mode,i=a.effects[b];return a.fx.off||!i?h?this[h](g.duration,g.callback):this.each(function(){g.callback&&g.callback.call(this)}):i.call(this,g)},_show:a.fn.show,show:function(a){if(l(a))return this._show.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="show",this.effect.apply(this,b)},_hide:a.fn.hide,hide:function(a){if(l(a))return this._hide.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="hide",this.effect.apply(this,b)},__toggle:a.fn.toggle,toggle:function(b){if(l(b)||typeof b=="boolean"||a.isFunction(b))return this.__toggle.apply(this,arguments);var c=k.apply(this,arguments);return c[1].mode="toggle",this.effect.apply(this,c)},cssUnit:function(b){var c=this.css(b),d=[];return a.each(["em","px","%","pt"],function(a,b){c.indexOf(b)>0&&(d=[parseFloat(c),b])}),d}});var m={};a.each(["Quad","Cubic","Quart","Quint","Expo"],function(a,b){m[b]=function(b){return Math.pow(b,a+2)}}),a.extend(m,{Sine:function(a){return 1-Math.cos(a*Math.PI/2)},Circ:function(a){return 1-Math.sqrt(1-a*a)},Elastic:function(a){return a===0||a===1?a:-Math.pow(2,8*(a-1))*Math.sin(((a-1)*80-7.5)*Math.PI/15)},Back:function(a){return a*a*(3*a-2)},Bounce:function(a){var b,c=4;while(a<((b=Math.pow(2,--c))-1)/11);return 1/Math.pow(4,3-c)-7.5625*Math.pow((b*3-2)/22-a,2)}}),a.each(m,function(b,c){a.easing["easeIn"+b]=c,a.easing["easeOut"+b]=function(a){return 1-c(1-a)},a.easing["easeInOut"+b]=function(a){return a<.5?c(a*2)/2:c(a*-2+2)/-2+1}})}(jQuery),function(a,b){a.effects.blind=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.direction||"vertical";a.effects.save(c,d),c.show();var g=a.effects.createWrapper(c).css({overflow:"hidden"}),h=f=="vertical"?"height":"width",i=f=="vertical"?g.height():g.width();e=="show"&&g.css(h,0);var j={};j[h]=e=="show"?i:0,g.animate(j,b.duration,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}}(jQuery),function(a,b){a.effects.bounce=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"effect"),f=b.options.direction||"up",g=b.options.distance||20,h=b.options.times||5,i=b.duration||250;/show|hide/.test(e)&&d.push("opacity"),a.effects.save(c,d),c.show(),a.effects.createWrapper(c);var j=f=="up"||f=="down"?"top":"left",k=f=="up"||f=="left"?"pos":"neg",g=b.options.distance||(j=="top"?c.outerHeight(!0)/3:c.outerWidth(!0)/3);e=="show"&&c.css("opacity",0).css(j,k=="pos"?-g:g),e=="hide"&&(g=g/(h*2)),e!="hide"&&h--;if(e=="show"){var l={opacity:1};l[j]=(k=="pos"?"+=":"-=")+g,c.animate(l,i/2,b.options.easing),g=g/2,h--}for(var m=0;m").css({position:"absolute",visibility:"visible",left:-j*(g/d),top:-i*(h/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/d,height:h/c,left:f.left+j*(g/d)+(b.options.mode=="show"?(j-Math.floor(d/2))*(g/d):0),top:f.top+i*(h/c)+(b.options.mode=="show"?(i-Math.floor(c/2))*(h/c):0),opacity:b.options.mode=="show"?0:1}).animate({left:f.left+j*(g/d)+(b.options.mode=="show"?0:(j-Math.floor(d/2))*(g/d)),top:f.top+i*(h/c)+(b.options.mode=="show"?0:(i-Math.floor(c/2))*(h/c)),opacity:b.options.mode=="show"?1:0},b.duration||500);setTimeout(function(){b.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide(),b.callback&&b.callback.apply(e[0]),e.dequeue(),a("div.ui-effects-explode").remove()},b.duration||500)})}}(jQuery),function(a,b){a.effects.fade=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"hide");c.animate({opacity:d},{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.fold=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.size||15,g=!!b.options.horizFirst,h=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(c,d),c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"}),j=e=="show"!=g,k=j?["width","height"]:["height","width"],l=j?[i.width(),i.height()]:[i.height(),i.width()],m=/([0-9]+)%/.exec(f);m&&(f=parseInt(m[1],10)/100*l[e=="hide"?0:1]),e=="show"&&i.css(g?{height:0,width:f}:{height:f,width:0});var n={},p={};n[k[0]]=e=="show"?l[0]:f,p[k[1]]=e=="show"?l[1]:0,i.animate(n,h,b.options.easing).animate(p,h,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}}(jQuery),function(a,b){a.effects.highlight=function(b){return this.queue(function(){var c=a(this),d=["backgroundImage","backgroundColor","opacity"],e=a.effects.setMode(c,b.options.mode||"show"),f={backgroundColor:c.css("backgroundColor")};e=="hide"&&(f.opacity=0),a.effects.save(c,d),c.show().css({backgroundImage:"none",backgroundColor:b.options.color||"#ffff99"}).animate(f,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),e=="show"&&!a.support.opacity&&this.style.removeAttribute("filter"),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.pulsate=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"show"),e=(b.options.times||5)*2-1,f=b.duration?b.duration/2:a.fx.speeds._default/2,g=c.is(":visible"),h=0;g||(c.css("opacity",0).show(),h=1),(d=="hide"&&g||d=="show"&&!g)&&e--;for(var i=0;i').appendTo(document.body).addClass(b.options.className).css({top:g.top,left:g.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(f,b.duration,b.options.easing,function(){h.remove(),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}}(jQuery),function(a,b){a.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:!0,clearStyle:!1,collapsible:!1,event:"click",fillSpace:!1,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:!1,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var b=this,c=b.options;b.running=0,b.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"),b.headers=b.element.find(c.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-focus")}),b.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");if(c.navigation){var d=b.element.find("a").filter(c.navigationFilter).eq(0);if(d.length){var e=d.closest(".ui-accordion-header");e.length?b.active=e:b.active=d.closest(".ui-accordion-content").prev()}}b.active=b._findActive(b.active||c.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top"),b.active.next().addClass("ui-accordion-content-active"),b._createIcons(),b.resize(),b.element.attr("role","tablist"),b.headers.attr("role","tab").bind("keydown.accordion",function(a){return b._keydown(a)}).next().attr("role","tabpanel"),b.headers.not(b.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide(),b.active.length?b.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):b.headers.eq(0).attr("tabIndex",0),a.browser.safari||b.headers.find("a").attr("tabIndex",-1),c.event&&b.headers.bind(c.event.split(" ").join(".accordion ")+".accordion",function(a){b._clickHandler.call(b,a,this),a.preventDefault()})},_createIcons:function(){var b=this.options;b.icons&&(a("").addClass("ui-icon "+b.icons.header).prependTo(this.headers),this.active.children(".ui-icon").toggleClass(b.icons.header).toggleClass(b.icons.headerSelected),this.element.addClass("ui-accordion-icons"))},_destroyIcons:function(){this.headers.children(".ui-icon").remove(),this.element.removeClass("ui-accordion-icons")},destroy:function(){var b=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"),this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"),this.headers.find("a").removeAttr("tabIndex"),this._destroyIcons();var c=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");return(b.autoHeight||b.fillHeight)&&c.css("height",""),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b=="active"&&this.activate(c),b=="icons"&&(this._destroyIcons(),c&&this._createIcons()),b=="disabled"&&this.headers.add(this.headers.next())[c?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(b){if(this.options.disabled||b.altKey||b.ctrlKey)return;var c=a.ui.keyCode,d=this.headers.length,e=this.headers.index(b.target),f=!1;switch(b.keyCode){case c.RIGHT:case c.DOWN:f=this.headers[(e+1)%d];break;case c.LEFT:case c.UP:f=this.headers[(e-1+d)%d];break;case c.SPACE:case c.ENTER:this._clickHandler({target:b.target},b.target),b.preventDefault()}return f?(a(b.target).attr("tabIndex",-1),a(f).attr("tabIndex",0),f.focus(),!1):!0},resize:function(){var b=this.options,c;if(b.fillSpace){if(a.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}c=this.element.parent().height(),a.browser.msie&&this.element.parent().css("overflow",d),this.headers.each(function(){c-=a(this).outerHeight(!0)}),this.headers.next().each(function(){a(this).height(Math.max(0,c-a(this).innerHeight()+a(this).height()))}).css("overflow","auto")}else b.autoHeight&&(c=0,this.headers.next().each(function(){c=Math.max(c,a(this).height("").height())}).height(c));return this},activate:function(a){this.options.active=a;var b=this._findActive(a)[0];return this._clickHandler({target:b},b),this},_findActive:function(b){return b?typeof b=="number"?this.headers.filter(":eq("+b+")"):this.headers.not(this.headers.not(b)):b===!1?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(b,c){var d=this.options;if(d.disabled)return;if(!b.target){if(!d.collapsible)return;this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),this.active.next().addClass("ui-accordion-content-active");var e=this.active.next(),f={options:d,newHeader:a([]),oldHeader:d.active,newContent:a([]),oldContent:e},g=this.active=a([]);this._toggle(g,e,f);return}var h=a(b.currentTarget||c),i=h[0]===this.active[0];d.active=d.collapsible&&i?!1:this.headers.index(h);if(this.running||!d.collapsible&&i)return;var j=this.active,g=h.next(),e=this.active.next(),f={options:d,newHeader:i&&d.collapsible?a([]):h,oldHeader:this.active,newContent:i&&d.collapsible?a([]):g,oldContent:e},k=this.headers.index(this.active[0])>this.headers.index(h[0]);this.active=i?a([]):h,this._toggle(g,e,f,i,k),j.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),i||(h.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected),h.next().addClass("ui-accordion-content-active"));return},_toggle:function(b,c,d,e,f){var g=this,h=g.options;g.toShow=b,g.toHide=c,g.data=d;var i=function(){if(!g)return;return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data),g.running=c.size()===0?b.size():c.size();if(h.animated){var j={};h.collapsible&&e?j={toShow:a([]),toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace}:j={toShow:b,toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace},h.proxied||(h.proxied=h.animated),h.proxiedDuration||(h.proxiedDuration=h.duration),h.animated=a.isFunction(h.proxied)?h.proxied(j):h.proxied,h.duration=a.isFunction(h.proxiedDuration)?h.proxiedDuration(j):h.proxiedDuration;var k=a.ui.accordion.animations,l=h.duration,m=h.animated;m&&!k[m]&&!a.easing[m]&&(m="slide"),k[m]||(k[m]=function(a){this.slide(a,{easing:m,duration:l||700})}),k[m](j)}else h.collapsible&&e?b.toggle():(c.hide(),b.show()),i(!0);c.prev().attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).blur(),b.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(this.running)return;this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""}),this.toHide.removeClass("ui-accordion-content-active"),this.toHide.length&&(this.toHide.parent()[0].className=this.toHide.parent()[0].className),this._trigger("change",null,this.data)}}),a.extend(a.ui.accordion,{version:"1.8.24",animations:{slide:function(b,c){b=a.extend({easing:"swing",duration:300},b,c);if(!b.toHide.size()){b.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},b);return}if(!b.toShow.size()){b.toHide.animate({height:"hide",paddingTop:"hide",paddingBottom:"hide"},b);return}var d=b.toShow.css("overflow"),e=0,f={},g={},h=["height","paddingTop","paddingBottom"],i,j=b.toShow;i=j[0].style.width,j.width(j.parent().width()-parseFloat(j.css("paddingLeft"))-parseFloat(j.css("paddingRight"))-(parseFloat(j.css("borderLeftWidth"))||0)-(parseFloat(j.css("borderRightWidth"))||0)),a.each(h,function(c,d){g[d]="hide";var e=(""+a.css(b.toShow[0],d)).match(/^([\d+-.]+)(.*)$/);f[d]={value:e[1],unit:e[2]||"px"}}),b.toShow.css({height:0,overflow:"hidden"}).show(),b.toHide.filter(":hidden").each(b.complete).end().filter(":visible").animate(g,{step:function(a,c){c.prop=="height"&&(e=c.end-c.start===0?0:(c.now-c.start)/(c.end-c.start)),b.toShow[0].style[c.prop]=e*f[c.prop].value+f[c.prop].unit},duration:b.duration,easing:b.easing,complete:function(){b.autoHeight||b.toShow.css("height",""),b.toShow.css({width:i,overflow:d}),b.complete()}})},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1e3:200})}}})}(jQuery),function(a,b){var c=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var b=this,c=this.element[0].ownerDocument,d;this.isMultiLine=this.element.is("textarea"),this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(b.options.disabled||b.element.propAttr("readOnly"))return;d=!1;var e=a.ui.keyCode;switch(c.keyCode){case e.PAGE_UP:b._move("previousPage",c);break;case e.PAGE_DOWN:b._move("nextPage",c);break;case e.UP:b._keyEvent("previous",c);break;case e.DOWN:b._keyEvent("next",c);break;case e.ENTER:case e.NUMPAD_ENTER:b.menu.active&&(d=!0,c.preventDefault());case e.TAB:if(!b.menu.active)return;b.menu.select(c);break;case e.ESCAPE:b.element.val(b.term),b.close(c);break;default:clearTimeout(b.searching),b.searching=setTimeout(function(){b.term!=b.element.val()&&(b.selectedItem=null,b.search(null,c))},b.options.delay)}}).bind("keypress.autocomplete",function(a){d&&(d=!1,a.preventDefault())}).bind("focus.autocomplete",function(){if(b.options.disabled)return;b.selectedItem=null,b.previous=b.element.val()}).bind("blur.autocomplete",function(a){if(b.options.disabled)return;clearTimeout(b.searching),b.closing=setTimeout(function(){b.close(a),b._change(a)},150)}),this._initSource(),this.menu=a("
      ").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",c)[0]).mousedown(function(c){var d=b.menu.element[0];a(c.target).closest(".ui-menu-item").length||setTimeout(function(){a(document).one("mousedown",function(c){c.target!==b.element[0]&&c.target!==d&&!a.ui.contains(d,c.target)&&b.close()})},1),setTimeout(function(){clearTimeout(b.closing)},13)}).menu({focus:function(a,c){var d=c.item.data("item.autocomplete");!1!==b._trigger("focus",a,{item:d})&&/^key/.test(a.originalEvent.type)&&b.element.val(d.value)},selected:function(a,d){var e=d.item.data("item.autocomplete"),f=b.previous;b.element[0]!==c.activeElement&&(b.element.focus(),b.previous=f,setTimeout(function(){b.previous=f,b.selectedItem=e},1)),!1!==b._trigger("select",a,{item:e})&&b.element.val(e.value),b.term=b.element.val(),b.close(a),b.selectedItem=e},blur:function(a,c){b.menu.element.is(":visible")&&b.element.val()!==b.term&&b.element.val(b.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"),a.fn.bgiframe&&this.menu.element.bgiframe(),b.beforeunloadHandler=function(){b.element.removeAttr("autocomplete")},a(window).bind("beforeunload",b.beforeunloadHandler)},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"),this.menu.element.remove(),a(window).unbind("beforeunload",this.beforeunloadHandler),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b==="source"&&this._initSource(),b==="appendTo"&&this.menu.element.appendTo(a(c||"body",this.element[0].ownerDocument)[0]),b==="disabled"&&c&&this.xhr&&this.xhr.abort()},_initSource:function(){var b=this,c,d;a.isArray(this.options.source)?(c=this.options.source,this.source=function(b,d){d(a.ui.autocomplete.filter(c,b.term))}):typeof this.options.source=="string"?(d=this.options.source,this.source=function(c,e){b.xhr&&b.xhr.abort(),b.xhr=a.ajax({url:d,data:c,dataType:"json",success:function(a,b){e(a)},error:function(){e([])}})}):this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val(),this.term=this.element.val();if(a.length
      • ").data("item.autocomplete",c).append(a("").text(c.label)).appendTo(b)},_move:function(a,b){if(!this.menu.element.is(":visible")){this.search(null,b);return}if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term),this.menu.deactivate();return}this.menu[a](b)},widget:function(){return this.menu.element},_keyEvent:function(a,b){if(!this.isMultiLine||this.menu.element.is(":visible"))this._move(a,b),b.preventDefault()}}),a.extend(a.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(b,c){var d=new RegExp(a.ui.autocomplete.escapeRegex(c),"i");return a.grep(b,function(a){return d.test(a.label||a.value||a)})}})}(jQuery),function(a){a.widget("ui.menu",{_create:function(){var b=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(!a(c.target).closest(".ui-menu-item a").length)return;c.preventDefault(),b.select(c)}),this.refresh()},refresh:function(){var b=this,c=this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem");c.children("a").addClass("ui-corner-all").attr("tabindex",-1).mouseenter(function(c){b.activate(c,a(this).parent())}).mouseleave(function(){b.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var c=b.offset().top-this.element.offset().top,d=this.element.scrollTop(),e=this.element.height();c<0?this.element.scrollTop(d+c):c>=e&&this.element.scrollTop(d+c-e+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end(),this._trigger("focus",a,{item:b})},deactivate:function(){if(!this.active)return;this.active.children("a").removeClass("ui-state-hover").removeAttr("id"),this._trigger("blur"),this.active=null},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,c){if(!this.active){this.activate(c,this.element.children(b));return}var d=this.active[a+"All"](".ui-menu-item").eq(0);d.length?this.activate(c,d):this.activate(c,this.element.children(b))},nextPage:function(b){if(this.hasScroll()){if(!this.active||this.last()){this.activate(b,this.element.children(".ui-menu-item:first"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c-d+a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:last")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(b){if(this.hasScroll()){if(!this.active||this.first()){this.activate(b,this.element.children(".ui-menu-item:last"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c+d-a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:first")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()",this.element[0].ownerDocument).addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,e=d.primary&&d.secondary,f=[];d.primary||d.secondary?(this.options.text&&f.push("ui-button-text-icon"+(e?"s":d.primary?"-primary":"-secondary")),d.primary&&b.prepend(""),d.secondary&&b.append(""),this.options.text||(f.push(e?"ui-button-icons-only":"ui-button-icon-only"),this.hasTitle||b.attr("title",c))):f.push("ui-button-text-only"),b.addClass(f.join(" "))}}),a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c),a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var b=this.element.css("direction")==="rtl";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(b?"ui-corner-right":"ui-corner-left").end().filter(":last").addClass(b?"ui-corner-left":"ui-corner-right").end().end()},destroy:function(){this.element.removeClass("ui-buttonset"),this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"),a.Widget.prototype.destroy.call(this)}})}(jQuery),function($,undefined){function Datepicker(){this.debug=!1,this._curInst=null,this._keyEvent=!1,this._disabledInputs=[],this._datepickerShowing=!1,this._inDialog=!1,this._mainDivId="ui-datepicker-div",this._inlineClass="ui-datepicker-inline",this._appendClass="ui-datepicker-append",this._triggerClass="ui-datepicker-trigger",this._dialogClass="ui-datepicker-dialog",this._disableClass="ui-datepicker-disabled",this._unselectableClass="ui-datepicker-unselectable",this._currentClass="ui-datepicker-current-day",this._dayOverClass="ui-datepicker-days-cell-over",this.regional=[],this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:!1,showMonthAfterYear:!1,yearSuffix:""},this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:!1,hideIfNoPrevNext:!1,navigationAsDateFormat:!1,gotoCurrent:!1,changeMonth:!1,changeYear:!1,yearRange:"c-10:c+10",showOtherMonths:!1,selectOtherMonths:!1,showWeek:!1,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:!0,showButtonPanel:!1,autoSize:!1,disabled:!1},$.extend(this._defaults,this.regional[""]),this.dpDiv=bindHover($('
      '))}function bindHover(a){var b="button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";return a.bind("mouseout",function(a){var c=$(a.target).closest(b);if(!c.length)return;c.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(c){var d=$(c.target).closest(b);if($.datepicker._isDisabledDatepicker(instActive.inline?a.parent()[0]:instActive.input[0])||!d.length)return;d.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"),d.addClass("ui-state-hover"),d.hasClass("ui-datepicker-prev")&&d.addClass("ui-datepicker-prev-hover"),d.hasClass("ui-datepicker-next")&&d.addClass("ui-datepicker-next-hover")})}function extendRemove(a,b){$.extend(a,b);for(var c in b)if(b[c]==null||b[c]==undefined)a[c]=b[c];return a}function isArray(a){return a&&($.browser.safari&&typeof a=="object"&&a.length||a.constructor&&a.constructor.toString().match(/\Array\(\)/))}$.extend($.ui,{datepicker:{version:"1.8.24"}});var PROP_NAME="datepicker",dpuuid=(new Date).getTime(),instActive;$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){return extendRemove(this._defaults,a||{}),this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase(),inline=nodeName=="div"||nodeName=="span";target.id||(this.uuid+=1,target.id="dp"+this.uuid);var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{}),nodeName=="input"?this._connectDatepicker(target,inst):inline&&this._inlineDatepicker(target,inst)},_newInst:function(a,b){var c=a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1");return{id:c,input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:b?bindHover($('
      ')):this.dpDiv}},_connectDatepicker:function(a,b){var c=$(a);b.append=$([]),b.trigger=$([]);if(c.hasClass(this.markerClassName))return;this._attachments(c,b),c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),this._autoSize(b),$.data(a,PROP_NAME,b),b.settings.disabled&&this._disableDatepicker(a)},_attachments:function(a,b){var c=this._get(b,"appendText"),d=this._get(b,"isRTL");b.append&&b.append.remove(),c&&(b.append=$(''+c+""),a[d?"before":"after"](b.append)),a.unbind("focus",this._showDatepicker),b.trigger&&b.trigger.remove();var e=this._get(b,"showOn");(e=="focus"||e=="both")&&a.focus(this._showDatepicker);if(e=="button"||e=="both"){var f=this._get(b,"buttonText"),g=this._get(b,"buttonImage");b.trigger=$(this._get(b,"buttonImageOnly")?$("").addClass(this._triggerClass).attr({src:g,alt:f,title:f}):$('').addClass(this._triggerClass).html(g==""?f:$("").attr({src:g,alt:f,title:f}))),a[d?"before":"after"](b.trigger),b.trigger.click(function(){return $.datepicker._datepickerShowing&&$.datepicker._lastInput==a[0]?$.datepicker._hideDatepicker():$.datepicker._datepickerShowing&&$.datepicker._lastInput!=a[0]?($.datepicker._hideDatepicker(),$.datepicker._showDatepicker(a[0])):$.datepicker._showDatepicker(a[0]),!1})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var d=function(a){var b=0,c=0;for(var d=0;db&&(b=a[d].length,c=d);return c};b.setMonth(d(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort"))),b.setDate(d(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=$(a);if(c.hasClass(this.markerClassName))return;c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),$.data(a,PROP_NAME,b),this._setDate(b,this._getDefaultDate(b),!0),this._updateDatepicker(b),this._updateAlternate(b),b.settings.disabled&&this._disableDatepicker(a),b.dpDiv.css("display","block")},_dialogDatepicker:function(a,b,c,d,e){var f=this._dialogInst;if(!f){this.uuid+=1;var g="dp"+this.uuid;this._dialogInput=$(''),this._dialogInput.keydown(this._doKeyDown),$("body").append(this._dialogInput),f=this._dialogInst=this._newInst(this._dialogInput,!1),f.settings={},$.data(this._dialogInput[0],PROP_NAME,f)}extendRemove(f.settings,d||{}),b=b&&b.constructor==Date?this._formatDate(f,b):b,this._dialogInput.val(b),this._pos=e?e.length?e:[e.pageX,e.pageY]:null;if(!this._pos){var h=document.documentElement.clientWidth,i=document.documentElement.clientHeight,j=document.documentElement.scrollLeft||document.body.scrollLeft,k=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[h/2-100+j,i/2-150+k]}return this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px"),f.settings.onSelect=c,this._inDialog=!0,this.dpDiv.addClass(this._dialogClass),this._showDatepicker(this._dialogInput[0]),$.blockUI&&$.blockUI(this.dpDiv),$.data(this._dialogInput[0],PROP_NAME,f),this},_destroyDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();$.removeData(a,PROP_NAME),d=="input"?(c.append.remove(),c.trigger.remove(),b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)):(d=="div"||d=="span")&&b.removeClass(this.markerClassName).empty()},_enableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!1,c.trigger.filter("button").each(function(){this.disabled=!1}).end().filter("img").css({opacity:"1.0",cursor:""});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().removeClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b})},_disableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!0,c.trigger.filter("button").each(function(){this.disabled=!0}).end().filter("img").css({opacity:"0.5",cursor:"default"});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().addClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b}),this._disabledInputs[this._disabledInputs.length]=a},_isDisabledDatepicker:function(a){if(!a)return!1;for(var b=0;b-1}},_doKeyUp:function(a){var b=$.datepicker._getInst(a.target);if(b.input.val()!=b.lastVal)try{var c=$.datepicker.parseDate($.datepicker._get(b,"dateFormat"),b.input?b.input.val():null,$.datepicker._getFormatConfig(b));c&&($.datepicker._setDateFromField(b),$.datepicker._updateAlternate(b),$.datepicker._updateDatepicker(b))}catch(d){$.datepicker.log(d)}return!0},_showDatepicker:function(a){a=a.target||a,a.nodeName.toLowerCase()!="input"&&(a=$("input",a.parentNode)[0]);if($.datepicker._isDisabledDatepicker(a)||$.datepicker._lastInput==a)return;var b=$.datepicker._getInst(a);$.datepicker._curInst&&$.datepicker._curInst!=b&&($.datepicker._curInst.dpDiv.stop(!0,!0),b&&$.datepicker._datepickerShowing&&$.datepicker._hideDatepicker($.datepicker._curInst.input[0]));var c=$.datepicker._get(b,"beforeShow"),d=c?c.apply(a,[a,b]):{};if(d===!1)return;extendRemove(b.settings,d),b.lastVal=null,$.datepicker._lastInput=a,$.datepicker._setDateFromField(b),$.datepicker._inDialog&&(a.value=""),$.datepicker._pos||($.datepicker._pos=$.datepicker._findPos(a),$.datepicker._pos[1]+=a.offsetHeight);var e=!1;$(a).parents().each(function(){return e|=$(this).css("position")=="fixed",!e}),e&&$.browser.opera&&($.datepicker._pos[0]-=document.documentElement.scrollLeft,$.datepicker._pos[1]-=document.documentElement.scrollTop);var f={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null,b.dpDiv.empty(),b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"}),$.datepicker._updateDatepicker(b),f=$.datepicker._checkOffset(b,f,e),b.dpDiv.css({position:$.datepicker._inDialog&&$.blockUI?"static":e?"fixed":"absolute",display:"none",left:f.left+"px",top:f.top+"px"});if(!b.inline){var g=$.datepicker._get(b,"showAnim"),h=$.datepicker._get(b,"duration"),i=function(){var a=b.dpDiv.find("iframe.ui-datepicker-cover");if(!!a.length){var c=$.datepicker._getBorders(b.dpDiv);a.css({left:-c[0],top:-c[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex($(a).zIndex()+1),$.datepicker._datepickerShowing=!0,$.effects&&$.effects[g]?b.dpDiv.show(g,$.datepicker._get(b,"showOptions"),h,i):b.dpDiv[g||"show"](g?h:null,i),(!g||!h)&&i(),b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus(),$.datepicker._curInst=b}},_updateDatepicker:function(a){var b=this;b.maxRows=4;var c=$.datepicker._getBorders(a.dpDiv);instActive=a,a.dpDiv.empty().append(this._generateHTML(a)),this._attachHandlers(a);var d=a.dpDiv.find("iframe.ui-datepicker-cover");!d.length||d.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}),a.dpDiv.find("."+this._dayOverClass+" a").mouseover();var e=this._getNumberOfMonths(a),f=e[1],g=17;a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""),f>1&&a.dpDiv.addClass("ui-datepicker-multi-"+f).css("width",g*f+"em"),a.dpDiv[(e[0]!=1||e[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"),a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl"),a==$.datepicker._curInst&&$.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var h=a.yearshtml;setTimeout(function(){h===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml),h=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(a){return{thin:1,medium:2,thick:3}[a]||a};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var d=a.dpDiv.outerWidth(),e=a.dpDiv.outerHeight(),f=a.input?a.input.outerWidth():0,g=a.input?a.input.outerHeight():0,h=document.documentElement.clientWidth+(c?0:$(document).scrollLeft()),i=document.documentElement.clientHeight+(c?0:$(document).scrollTop());return b.left-=this._get(a,"isRTL")?d-f:0,b.left-=c&&b.left==a.input.offset().left?$(document).scrollLeft():0,b.top-=c&&b.top==a.input.offset().top+g?$(document).scrollTop():0,b.left-=Math.min(b.left,b.left+d>h&&h>d?Math.abs(b.left+d-h):0),b.top-=Math.min(b.top,b.top+e>i&&i>e?Math.abs(e+g):0),b},_findPos:function(a){var b=this._getInst(a),c=this._get(b,"isRTL");while(a&&(a.type=="hidden"||a.nodeType!=1||$.expr.filters.hidden(a)))a=a[c?"previousSibling":"nextSibling"];var d=$(a).offset();return[d.left,d.top]},_hideDatepicker:function(a){var b=this._curInst;if(!b||a&&b!=$.data(a,PROP_NAME))return;if(this._datepickerShowing){var c=this._get(b,"showAnim"),d=this._get(b,"duration"),e=function(){$.datepicker._tidyDialog(b)};$.effects&&$.effects[c]?b.dpDiv.hide(c,$.datepicker._get(b,"showOptions"),d,e):b.dpDiv[c=="slideDown"?"slideUp":c=="fadeIn"?"fadeOut":"hide"](c?d:null,e),c||e(),this._datepickerShowing=!1;var f=this._get(b,"onClose");f&&f.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]),this._lastInput=null,this._inDialog&&(this._dialogInput.css({position:"absolute",left:"0",top:"-100px"}),$.blockUI&&($.unblockUI(),$("body").append(this.dpDiv))),this._inDialog=!1}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(!$.datepicker._curInst)return;var b=$(a.target),c=$.datepicker._getInst(b[0]);(b[0].id!=$.datepicker._mainDivId&&b.parents("#"+$.datepicker._mainDivId).length==0&&!b.hasClass($.datepicker.markerClassName)&&!b.closest("."+$.datepicker._triggerClass).length&&$.datepicker._datepickerShowing&&(!$.datepicker._inDialog||!$.blockUI)||b.hasClass($.datepicker.markerClassName)&&$.datepicker._curInst!=c)&&$.datepicker._hideDatepicker()},_adjustDate:function(a,b,c){var d=$(a),e=this._getInst(d[0]);if(this._isDisabledDatepicker(d[0]))return;this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c),this._updateDatepicker(e)},_gotoToday:function(a){var b=$(a),c=this._getInst(b[0]);if(this._get(c,"gotoCurrent")&&c.currentDay)c.selectedDay=c.currentDay,c.drawMonth=c.selectedMonth=c.currentMonth,c.drawYear=c.selectedYear=c.currentYear;else{var d=new Date;c.selectedDay=d.getDate(),c.drawMonth=c.selectedMonth=d.getMonth(),c.drawYear=c.selectedYear=d.getFullYear()}this._notifyChange(c),this._adjustDate(b)},_selectMonthYear:function(a,b,c){var d=$(a),e=this._getInst(d[0]);e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10),this._notifyChange(e),this._adjustDate(d)},_selectDay:function(a,b,c,d){var e=$(a);if($(d).hasClass(this._unselectableClass)||this._isDisabledDatepicker(e[0]))return;var f=this._getInst(e[0]);f.selectedDay=f.currentDay=$("a",d).html(),f.selectedMonth=f.currentMonth=b,f.selectedYear=f.currentYear=c,this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))},_clearDate:function(a){var b=$(a),c=this._getInst(b[0]);this._selectDate(b,"")},_selectDate:function(a,b){var c=$(a),d=this._getInst(c[0]);b=b!=null?b:this._formatDate(d),d.input&&d.input.val(b),this._updateAlternate(d);var e=this._get(d,"onSelect");e?e.apply(d.input?d.input[0]:null,[b,d]):d.input&&d.input.trigger("change"),d.inline?this._updateDatepicker(d):(this._hideDatepicker(),this._lastInput=d.input[0],typeof d.input[0]!="object"&&d.input.focus(),this._lastInput=null)},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),d=this._getDate(a),e=this.formatDate(c,d,this._getFormatConfig(a));$(b).each(function(){$(this).val(e)})}},noWeekends:function(a){var b=a.getDay();return[b>0&&b<6,""]},iso8601Week:function(a){var b=new Date(a.getTime());b.setDate(b.getDate()+4-(b.getDay()||7));var c=b.getTime();return b.setMonth(0),b.setDate(1),Math.floor(Math.round((c-b)/864e5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var d=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;d=typeof d!="string"?d:(new Date).getFullYear()%100+parseInt(d,10);var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,g=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,h=(c?c.monthNames:null)||this._defaults.monthNames,i=-1,j=-1,k=-1,l=-1,m=!1,n=function(b){var c=s+1-1){j=1,k=l;do{var u=this._getDaysInMonth(i,j-1);if(k<=u)break;j++,k-=u}while(!0)}var t=this._daylightSavingAdjust(new Date(i,j-1,k));if(t.getFullYear()!=i||t.getMonth()+1!=j||t.getDate()!=k)throw"Invalid date";return t},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1e7,formatDate:function(a,b,c){if(!b)return"";var d=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,e=(c?c.dayNames:null)||this._defaults.dayNames,f=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,h=function(b){var c=m+112?a.getHours()+2:0),a):null},_setDate:function(a,b,c){var d=!b,e=a.selectedMonth,f=a.selectedYear,g=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=g.getDate(),a.drawMonth=a.selectedMonth=a.currentMonth=g.getMonth(),a.drawYear=a.selectedYear=a.currentYear=g.getFullYear(),(e!=a.selectedMonth||f!=a.selectedYear)&&!c&&this._notifyChange(a),this._adjustInstDate(a),a.input&&a.input.val(d?"":this._formatDate(a))},_getDate:function(a){var b=!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return b},_attachHandlers:function(a){var b=this._get(a,"stepMonths"),c="#"+a.id.replace(/\\\\/g,"\\");a.dpDiv.find("[data-handler]").map(function(){var a={prev:function(){window["DP_jQuery_"+dpuuid].datepicker._adjustDate(c,-b,"M")},next:function(){window["DP_jQuery_"+dpuuid].datepicker._adjustDate(c,+b,"M")},hide:function(){window["DP_jQuery_"+dpuuid].datepicker._hideDatepicker()},today:function(){window["DP_jQuery_"+dpuuid].datepicker._gotoToday(c)},selectDay:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectDay(c,+this.getAttribute("data-month"),+this.getAttribute("data-year"),this),!1},selectMonth:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectMonthYear(c,this,"M"),!1},selectYear:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectMonthYear(c,this,"Y"),!1}};$(this).bind(this.getAttribute("data-event"),a[this.getAttribute("data-handler")])})},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),d=this._get(a,"showButtonPanel"),e=this._get(a,"hideIfNoPrevNext"),f=this._get(a,"navigationAsDateFormat"),g=this._getNumberOfMonths(a),h=this._get(a,"showCurrentAtPos"),i=this._get(a,"stepMonths"),j=g[0]!=1||g[1]!=1,k=this._daylightSavingAdjust(a.currentDay?new Date(a.currentYear,a.currentMonth,a.currentDay):new Date(9999,9,9)),l=this._getMinMaxDate(a,"min"),m=this._getMinMaxDate(a,"max"),n=a.drawMonth-h,o=a.drawYear;n<0&&(n+=12,o--);if(m){var p=this._daylightSavingAdjust(new Date(m.getFullYear(),m.getMonth()-g[0]*g[1]+1,m.getDate()));p=l&&pp)n--,n<0&&(n=11,o--)}a.drawMonth=n,a.drawYear=o;var q=this._get(a,"prevText");q=f?this.formatDate(q,this._daylightSavingAdjust(new Date(o,n-i,1)),this._getFormatConfig(a)):q;var r=this._canAdjustMonth(a,-1,o,n)?''+q+"":e?"":''+q+"",s=this._get(a,"nextText");s=f?this.formatDate(s,this._daylightSavingAdjust(new Date(o,n+i,1)),this._getFormatConfig(a)):s;var t=this._canAdjustMonth(a,1,o,n)?''+s+"":e?"":''+s+"",u=this._get(a,"currentText"),v=this._get(a,"gotoCurrent")&&a.currentDay?k:b;u=f?this.formatDate(u,v,this._getFormatConfig(a)):u;var w=a.inline?"":'",x=d?'
      '+(c?w:"")+(this._isInRange(a,v)?'":"")+(c?"":w)+"
      ":"",y=parseInt(this._get(a,"firstDay"),10);y=isNaN(y)?0:y;var z=this._get(a,"showWeek"),A=this._get(a,"dayNames"),B=this._get(a,"dayNamesShort"),C=this._get(a,"dayNamesMin"),D=this._get(a,"monthNames"),E=this._get(a,"monthNamesShort"),F=this._get(a,"beforeShowDay"),G=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths"),I=this._get(a,"calculateWeek")||this.iso8601Week,J=this._getDefaultDate(a),K="";for(var L=0;L1)switch(N){case 0:Q+=" ui-datepicker-group-first",P=" ui-corner-"+(c?"right":"left");break;case g[1]-1:Q+=" ui-datepicker-group-last",P=" ui-corner-"+(c?"left":"right");break;default:Q+=" ui-datepicker-group-middle",P=""}Q+='">'}Q+='
      '+(/all|left/.test(P)&&L==0?c?t:r:"")+(/all|right/.test(P)&&L==0?c?r:t:"")+this._generateMonthYearHeader(a,n,o,l,m,L>0||N>0,D,E)+'
      '+"";var R=z?'":"";for(var S=0;S<7;S++){var T=(S+y)%7;R+="=5?' class="ui-datepicker-week-end"':"")+">"+''+C[T]+""}Q+=R+"";var U=this._getDaysInMonth(o,n);o==a.selectedYear&&n==a.selectedMonth&&(a.selectedDay=Math.min(a.selectedDay,U));var V=(this._getFirstDayOfMonth(o,n)-y+7)%7,W=Math.ceil((V+U)/7),X=j?this.maxRows>W?this.maxRows:W:W;this.maxRows=X;var Y=this._daylightSavingAdjust(new Date(o,n,1-V));for(var Z=0;Z";var _=z?'":"";for(var S=0;S<7;S++){var ba=F?F.apply(a.input?a.input[0]:null,[Y]):[!0,""],bb=Y.getMonth()!=n,bc=bb&&!H||!ba[0]||l&&Ym;_+='",Y.setDate(Y.getDate()+1),Y=this._daylightSavingAdjust(Y)}Q+=_+""}n++,n>11&&(n=0,o++),Q+="
      '+this._get(a,"weekHeader")+"
      '+this._get(a,"calculateWeek")(Y)+""+(bb&&!G?" ":bc?''+Y.getDate()+"":''+Y.getDate()+"")+"
      "+(j?""+(g[0]>0&&N==g[1]-1?'
      ':""):""),M+=Q}K+=M}return K+=x+($.browser.msie&&parseInt($.browser.version,10)<7&&!a.inline?'':""),a._keyEvent=!1,K},_generateMonthYearHeader:function(a,b,c,d,e,f,g,h){var i=this._get(a,"changeMonth"),j=this._get(a,"changeYear"),k=this._get(a,"showMonthAfterYear"),l='
      ',m="";if(f||!i)m+=''+g[b]+"";else{var n=d&&d.getFullYear()==c,o=e&&e.getFullYear()==c;m+='"}k||(l+=m+(f||!i||!j?" ":""));if(!a.yearshtml){a.yearshtml="";if(f||!j)l+=''+c+"";else{var q=this._get(a,"yearRange").split(":"),r=(new Date).getFullYear(),s=function(a){var b=a.match(/c[+-].*/)?c+parseInt(a.substring(1),10):a.match(/[+-].*/)?r+parseInt(a,10):parseInt(a,10);return isNaN(b)?r:b},t=s(q[0]),u=Math.max(t,s(q[1]||""));t=d?Math.max(t,d.getFullYear()):t,u=e?Math.min(u,e.getFullYear()):u,a.yearshtml+='",l+=a.yearshtml,a.yearshtml=null}}return l+=this._get(a,"yearSuffix"),k&&(l+=(f||!i||!j?" ":"")+m),l+="
      ",l},_adjustInstDate:function(a,b,c){var d=a.drawYear+(c=="Y"?b:0),e=a.drawMonth+(c=="M"?b:0),f=Math.min(a.selectedDay,this._getDaysInMonth(d,e))+(c=="D"?b:0),g=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(d,e,f)));a.selectedDay=g.getDate(),a.drawMonth=a.selectedMonth=g.getMonth(),a.drawYear=a.selectedYear=g.getFullYear(),(c=="M"||c=="Y")&&this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max"),e=c&&bd?d:e,e},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");b&&b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){var b=this._get(a,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,d){var e=this._getNumberOfMonths(a),f=this._daylightSavingAdjust(new Date(c,d+(b<0?b:e[0]*e[1]),1));return b<0&&f.setDate(this._getDaysInMonth(f.getFullYear(),f.getMonth())),this._isInRange(a,f)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!d||b.getTime()<=d.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");return b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10),{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,d){b||(a.currentDay=a.selectedDay,a.currentMonth=a.selectedMonth,a.currentYear=a.selectedYear);var e=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(d,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),e,this._getFormatConfig(a))}}),$.fn.datepicker=function(a){if(!this.length)return this;$.datepicker.initialized||($(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv),$.datepicker.initialized=!0);var b=Array.prototype.slice.call(arguments,1);return typeof a!="string"||a!="isDisabled"&&a!="getDate"&&a!="widget"?a=="option"&&arguments.length==2&&typeof arguments[1]=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b)):this.each(function(){typeof a=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this].concat(b)):$.datepicker._attachDatepicker(this,a)}):$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b))},$.datepicker=new Datepicker,$.datepicker.initialized=!1,$.datepicker.uuid=(new Date).getTime(),$.datepicker.version="1.8.24",window["DP_jQuery_"+dpuuid]=$}(jQuery),function(a,b){var c="ui-dialog ui-widget ui-widget-content ui-corner-all ",d={buttons:!0,height:!0,maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0,width:!0},e={maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0};a.widget("ui.dialog",{options:{autoOpen:!0,buttons:{},closeOnEscape:!0,closeText:"close",dialogClass:"",draggable:!0,hide:null,height:"auto",maxHeight:!1,maxWidth:!1,minHeight:150,minWidth:150,modal:!1,position:{my:"center",at:"center",collision:"fit",using:function(b){var c=a(this).css(b).offset().top;c<0&&a(this).css("top",b.top-c)}},resizable:!0,show:null,stack:!0,title:"",width:300,zIndex:1e3},_create:function(){this.originalTitle=this.element.attr("title"),typeof this.originalTitle!="string"&&(this.originalTitle=""),this.options.title=this.options.title||this.originalTitle;var b=this,d=b.options,e=d.title||" ",f=a.ui.dialog.getTitleId(b.element),g=(b.uiDialog=a("
      ")).appendTo(document.body).hide().addClass(c+d.dialogClass).css({zIndex:d.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(c){d.closeOnEscape&&!c.isDefaultPrevented()&&c.keyCode&&c.keyCode===a.ui.keyCode.ESCAPE&&(b.close(c),c.preventDefault())}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(a){b.moveToTop(!1,a)}),h=b.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g),i=(b.uiDialogTitlebar=a("
      ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),j=a('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){j.addClass("ui-state-hover")},function(){j.removeClass("ui-state-hover")}).focus(function(){j.addClass("ui-state-focus")}).blur(function(){j.removeClass("ui-state-focus")}).click(function(a){return b.close(a),!1}).appendTo(i),k=(b.uiDialogTitlebarCloseText=a("")).addClass("ui-icon ui-icon-closethick").text(d.closeText).appendTo(j),l=a("").addClass("ui-dialog-title").attr("id",f).html(e).prependTo(i);a.isFunction(d.beforeclose)&&!a.isFunction(d.beforeClose)&&(d.beforeClose=d.beforeclose),i.find("*").add(i).disableSelection(),d.draggable&&a.fn.draggable&&b._makeDraggable(),d.resizable&&a.fn.resizable&&b._makeResizable(),b._createButtons(d.buttons),b._isOpen=!1,a.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;return a.overlay&&a.overlay.destroy(),a.uiDialog.hide(),a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"),a.uiDialog.remove(),a.originalTitle&&a.element.attr("title",a.originalTitle),a},widget:function(){return this.uiDialog},close:function(b){var c=this,d,e;if(!1===c._trigger("beforeClose",b))return;return c.overlay&&c.overlay.destroy(),c.uiDialog.unbind("keypress.ui-dialog"),c._isOpen=!1,c.options.hide?c.uiDialog.hide(c.options.hide,function(){c._trigger("close",b)}):(c.uiDialog.hide(),c._trigger("close",b)),a.ui.dialog.overlay.resize(),c.options.modal&&(d=0,a(".ui-dialog").each(function(){this!==c.uiDialog[0]&&(e=a(this).css("z-index"),isNaN(e)||(d=Math.max(d,e)))}),a.ui.dialog.maxZ=d),c},isOpen:function(){return this._isOpen},moveToTop:function(b,c){var d=this,e=d.options,f;return e.modal&&!b||!e.stack&&!e.modal?d._trigger("focus",c):(e.zIndex>a.ui.dialog.maxZ&&(a.ui.dialog.maxZ=e.zIndex),d.overlay&&(a.ui.dialog.maxZ+=1,d.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)),f={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()},a.ui.dialog.maxZ+=1,d.uiDialog.css("z-index",a.ui.dialog.maxZ),d.element.attr(f),d._trigger("focus",c),d)},open:function(){if(this._isOpen)return;var b=this,c=b.options,d=b.uiDialog;return b.overlay=c.modal?new a.ui.dialog.overlay(b):null,b._size(),b._position(c.position),d.show(c.show),b.moveToTop(!0),c.modal&&d.bind("keydown.ui-dialog",function(b){if(b.keyCode!==a.ui.keyCode.TAB)return;var c=a(":tabbable",this),d=c.filter(":first"),e=c.filter(":last");if(b.target===e[0]&&!b.shiftKey)return d.focus(1),!1;if(b.target===d[0]&&b.shiftKey)return e.focus(1),!1}),a(b.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus(),b._isOpen=!0,b._trigger("open"),b},_createButtons:function(b){var c=this,d=!1,e=a("
      ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),f=a("
      ").addClass("ui-dialog-buttonset").appendTo(e);c.uiDialog.find(".ui-dialog-buttonpane").remove(),typeof b=="object"&&b!==null&&a.each(b,function(){return!(d=!0)}),d&&(a.each(b,function(b,d){d=a.isFunction(d)?{click:d,text:b}:d;var e=a('').click(function(){d.click.apply(c.element[0],arguments)}).appendTo(f);a.each(d,function(a,b){if(a==="click")return;a in e?e[a](b):e.attr(a,b)}),a.fn.button&&e.button()}),e.appendTo(c.uiDialog))},_makeDraggable:function(){function f(a){return{position:a.position,offset:a.offset}}var b=this,c=b.options,d=a(document),e;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(d,g){e=c.height==="auto"?"auto":a(this).height(),a(this).height(a(this).height()).addClass("ui-dialog-dragging"),b._trigger("dragStart",d,f(g))},drag:function(a,c){b._trigger("drag",a,f(c))},stop:function(g,h){c.position=[h.position.left-d.scrollLeft(),h.position.top-d.scrollTop()],a(this).removeClass("ui-dialog-dragging").height(e),b._trigger("dragStop",g,f(h)),a.ui.dialog.overlay.resize()}})},_makeResizable:function(c){function h(a){return{originalPosition:a.originalPosition,originalSize:a.originalSize,position:a.position,size:a.size}}c=c===b?this.options.resizable:c;var d=this,e=d.options,f=d.uiDialog.css("position"),g=typeof c=="string"?c:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:g,start:function(b,c){a(this).addClass("ui-dialog-resizing"),d._trigger("resizeStart",b,h(c))},resize:function(a,b){d._trigger("resize",a,h(b))},stop:function(b,c){a(this).removeClass("ui-dialog-resizing"),e.height=a(this).height(),e.width=a(this).width(),d._trigger("resizeStop",b,h(c)),a.ui.dialog.overlay.resize()}}).css("position",f).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(b){var c=[],d=[0,0],e;if(b){if(typeof b=="string"||typeof b=="object"&&"0"in b)c=b.split?b.split(" "):[b[0],b[1]],c.length===1&&(c[1]=c[0]),a.each(["left","top"],function(a,b){+c[a]===c[a]&&(d[a]=c[a],c[a]=b)}),b={my:c.join(" "),at:c.join(" "),offset:d.join(" ")};b=a.extend({},a.ui.dialog.prototype.options.position,b)}else b=a.ui.dialog.prototype.options.position;e=this.uiDialog.is(":visible"),e||this.uiDialog.show(),this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},b)),e||this.uiDialog.hide()},_setOptions:function(b){var c=this,f={},g=!1;a.each(b,function(a,b){c._setOption(a,b),a in d&&(g=!0),a in e&&(f[a]=b)}),g&&this._size(),this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",f)},_setOption:function(b,d){var e=this,f=e.uiDialog;switch(b){case"beforeclose":b="beforeClose";break;case"buttons":e._createButtons(d);break;case"closeText":e.uiDialogTitlebarCloseText.text(""+d);break;case"dialogClass":f.removeClass(e.options.dialogClass).addClass(c+d);break;case"disabled":d?f.addClass("ui-dialog-disabled"):f.removeClass("ui-dialog-disabled");break;case"draggable":var g=f.is(":data(draggable)");g&&!d&&f.draggable("destroy"),!g&&d&&e._makeDraggable();break;case"position":e._position(d);break;case"resizable":var h=f.is(":data(resizable)");h&&!d&&f.resizable("destroy"),h&&typeof d=="string"&&f.resizable("option","handles",d),!h&&d!==!1&&e._makeResizable(d);break;case"title":a(".ui-dialog-title",e.uiDialogTitlebar).html(""+(d||" "))}a.Widget.prototype._setOption.apply(e,arguments)},_size:function(){var b=this.options,c,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0}),b.minWidth>b.width&&(b.width=b.minWidth),c=this.uiDialog.css({height:"auto",width:b.width}).height(),d=Math.max(0,b.minHeight-c);if(b.height==="auto")if(a.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();var f=this.element.css("height","auto").height();e||this.uiDialog.hide(),this.element.height(Math.max(f,d))}else this.element.height(Math.max(b.height-c,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}}),a.extend(a.ui.dialog,{version:"1.8.24",uuid:0,maxZ:0,getTitleId:function(a){var b=a.attr("id");return b||(this.uuid+=1,b=this.uuid),"ui-dialog-title-"+b},overlay:function(b){this.$el=a.ui.dialog.overlay.create(b)}}),a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(b){this.instances.length===0&&(setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});return a.fn.bgiframe&&c.bgiframe(),this.instances.push(c),c},destroy:function(b){var c=a.inArray(b,this.instances);c!=-1&&this.oldInstances.push(this.instances.splice(c,1)[0]),this.instances.length===0&&a([document,window]).unbind(".dialog-overlay"),b.remove();var d=0;a.each(this.instances,function(){d=Math.max(d,this.css("z-index"))}),this.maxZ=d},height:function(){var b,c;return a.browser.msie&&a.browser.version<7?(b=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight),c=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight),b0?b.left-e:Math.max(b.left-c.collisionPosition.left,b.left)},top:function(b,c){var d=a(window),e=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop();b.top=e>0?b.top-e:Math.max(b.top-c.collisionPosition.top,b.top)}},flip:{left:function(b,c){if(c.at[0]===e)return;var d=a(window),f=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft(),g=c.my[0]==="left"?-c.elemWidth:c.my[0]==="right"?c.elemWidth:0,h=c.at[0]==="left"?c.targetWidth:-c.targetWidth,i=-2*c.offset[0];b.left+=c.collisionPosition.left<0?g+h+i:f>0?g+h+i:0},top:function(b,c){if(c.at[1]===e)return;var d=a(window),f=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop(),g=c.my[1]==="top"?-c.elemHeight:c.my[1]==="bottom"?c.elemHeight:0,h=c.at[1]==="top"?c.targetHeight:-c.targetHeight,i=-2*c.offset[1];b.top+=c.collisionPosition.top<0?g+h+i:f>0?g+h+i:0}}},a.offset.setOffset||(a.offset.setOffset=function(b,c){/static/.test(a.curCSS(b,"position"))&&(b.style.position="relative");var d=a(b),e=d.offset(),f=parseInt(a.curCSS(b,"top",!0),10)||0,g=parseInt(a.curCSS(b,"left",!0),10)||0,h={top:c.top-e.top+f,left:c.left-e.left+g};"using"in c?c.using.call(b,h):d.css(h)},a.fn.offset=function(b){var c=this[0];return!c||!c.ownerDocument?null:b?a.isFunction(b)?this.each(function(c){a(this).offset(b.call(this,c,a(this).offset()))}):this.each(function(){a.offset.setOffset(this,b)}):h.call(this)}),a.curCSS||(a.curCSS=a.css),function(){var b=document.getElementsByTagName("body")[0],c=document.createElement("div"),d,e,g,h,i;d=document.createElement(b?"div":"body"),g={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"},b&&a.extend(g,{position:"absolute",left:"-1000px",top:"-1000px"});for(var j in g)d.style[j]=g[j];d.appendChild(c),e=b||document.documentElement,e.insertBefore(d,e.firstChild),c.style.cssText="position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;",h=a(c).offset(function(a,b){return b}).offset(),d.innerHTML="",e.removeChild(d),i=h.top+h.left+(b?2e3:0),f.fractions=i>21&&i<22}()}(jQuery),function(a,b){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()}),this.valueDiv=a("
      ").appendTo(this.element),this.oldValue=this._value(),this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.valueDiv.remove(),a.Widget.prototype.destroy.apply(this,arguments)},value:function(a){return a===b?this._value():(this._setOption("value",a),this)},_setOption:function(b,c){b==="value"&&(this.options.value=c,this._refreshValue(),this._value()===this.options.max&&this._trigger("complete")),a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;return typeof a!="number"&&(a=0),Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var a=this.value(),b=this._percentage();this.oldValue!==a&&(this.oldValue=a,this._trigger("change")),this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(b.toFixed(0)+"%"),this.element.attr("aria-valuenow",a)}}),a.extend(a.ui.progressbar,{version:"1.8.24"})}(jQuery),function(a,b){var c=5;a.widget("ui.slider",a.ui.mouse,{widgetEventPrefix:"slide",options:{animate:!1,distance:0,max:100,min:0,orientation:"horizontal",range:!1,step:1,value:0,values:null},_create:function(){var b=this,d=this.options,e=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f="",g=d.values&&d.values.length||1,h=[];this._keySliding=!1,this._mouseSliding=!1,this._animateOff=!0,this._handleIndex=null,this._detectOrientation(),this._mouseInit(),this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget"+" ui-widget-content"+" ui-corner-all"+(d.disabled?" ui-slider-disabled ui-disabled":"")),this.range=a([]),d.range&&(d.range===!0&&(d.values||(d.values=[this._valueMin(),this._valueMin()]),d.values.length&&d.values.length!==2&&(d.values=[d.values[0],d.values[0]])),this.range=a("
      ").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(d.range==="min"||d.range==="max"?" ui-slider-range-"+d.range:"")));for(var i=e.length;ic&&(f=c,g=a(this),i=b)}),c.range===!0&&this.values(1)===c.min&&(i+=1,g=a(this.handles[i])),j=this._start(b,i),j===!1?!1:(this._mouseSliding=!0,h._handleIndex=i,g.addClass("ui-state-active").focus(),k=g.offset(),l=!a(b.target).parents().andSelf().is(".ui-slider-handle"),this._clickOffset=l?{left:0,top:0}:{left:b.pageX-k.left-g.width()/2,top:b.pageY-k.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)},this.handles.hasClass("ui-state-hover")||this._slide(b,i,e),this._animateOff=!0,!0))},_mouseStart:function(a){return!0},_mouseDrag:function(a){var b={x:a.pageX,y:a.pageY},c=this._normValueFromMouse(b);return this._slide(a,this._handleIndex,c),!1},_mouseStop:function(a){return this.handles.removeClass("ui-state-active"),this._mouseSliding=!1,this._stop(a,this._handleIndex),this._change(a,this._handleIndex),this._handleIndex=null,this._clickOffset=null,this._animateOff=!1,!1},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b,c,d,e,f;return this.orientation==="horizontal"?(b=this.elementSize.width,c=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)):(b=this.elementSize.height,c=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)),d=c/b,d>1&&(d=1),d<0&&(d=0),this.orientation==="vertical"&&(d=1-d),e=this._valueMax()-this._valueMin(),f=this._valueMin()+d*e,this._trimAlignValue(f)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};return this.options.values&&this.options.values.length&&(c.value=this.values(b),c.values=this.values()),this._trigger("start",a,c)},_slide:function(a,b,c){var d,e,f;this.options.values&&this.options.values.length?(d=this.values(b?0:1),this.options.values.length===2&&this.options.range===!0&&(b===0&&c>d||b===1&&c1){this.options.values[b]=this._trimAlignValue(c),this._refreshValue(),this._change(null,b);return}if(!arguments.length)return this._values();if(!a.isArray(arguments[0]))return this.options.values&&this.options.values.length?this._values(b):this.value();d=this.options.values,e=arguments[0];for(f=0;f=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b,d=a-c;return Math.abs(c)*2>=b&&(d+=c>0?b:-b),parseFloat(d.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var b=this.options.range,c=this.options,d=this,e=this._animateOff?!1:c.animate,f,g={},h,i,j,k;this.options.values&&this.options.values.length?this.handles.each(function(b,i){f=(d.values(b)-d._valueMin())/(d._valueMax()-d._valueMin())*100,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",a(this).stop(1,1)[e?"animate":"css"](g,c.animate),d.options.range===!0&&(d.orientation==="horizontal"?(b===0&&d.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({width:f-h+"%"},{queue:!1,duration:c.animate})):(b===0&&d.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({height:f-h+"%"},{queue:!1,duration:c.animate}))),h=f}):(i=this.value(),j=this._valueMin(),k=this._valueMax(),f=k!==j?(i-j)/(k-j)*100:0,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",this.handle.stop(1,1)[e?"animate":"css"](g,c.animate),b==="min"&&this.orientation==="horizontal"&&this.range.stop(1,1)[e?"animate":"css"]({width:f+"%"},c.animate),b==="max"&&this.orientation==="horizontal"&&this.range[e?"animate":"css"]({width:100-f+"%"},{queue:!1,duration:c.animate}),b==="min"&&this.orientation==="vertical"&&this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},c.animate),b==="max"&&this.orientation==="vertical"&&this.range[e?"animate":"css"]({height:100-f+"%"},{queue:!1,duration:c.animate}))}}),a.extend(a.ui.slider,{version:"1.8.24"})}(jQuery),function(a,b){function e(){return++c}function f(){return++d}var c=0,d=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:!1,cookie:null,collapsible:!1,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
      ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
    • #{label}
      • "},_create:function(){this._tabify(!0)},_setOption:function(a,b){if(a=="selected"){if(this.options.collapsible&&b==this.options.selected)return;this.select(b)}else this.options[a]=b,this._tabify()},_tabId:function(a){return a.title&&a.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+e()},_sanitizeSelector:function(a){return a.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+f());return a.cookie.apply(null,[b].concat(a.makeArray(arguments)))},_ui:function(a,b){return{tab:a,panel:b,index:this.anchors.index(a)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=a(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(c){function m(b,c){b.css("display",""),!a.support.opacity&&c.opacity&&b[0].style.removeAttribute("filter")}var d=this,e=this.options,f=/^#.+/;this.list=this.element.find("ol,ul").eq(0),this.lis=a(" > li:has(a[href])",this.list),this.anchors=this.lis.map(function(){return a("a",this)[0]}),this.panels=a([]),this.anchors.each(function(b,c){var g=a(c).attr("href"),h=g.split("#")[0],i;h&&(h===location.toString().split("#")[0]||(i=a("base")[0])&&h===i.href)&&(g=c.hash,c.href=g);if(f.test(g))d.panels=d.panels.add(d.element.find(d._sanitizeSelector(g)));else if(g&&g!=="#"){a.data(c,"href.tabs",g),a.data(c,"load.tabs",g.replace(/#.*$/,""));var j=d._tabId(c);c.href="#"+j;var k=d.element.find("#"+j);k.length||(k=a(e.panelTemplate).attr("id",j).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(d.panels[b-1]||d.list),k.data("destroy.tabs",!0)),d.panels=d.panels.add(k)}else e.disabled.push(b)}),c?(this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"),this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.lis.addClass("ui-state-default ui-corner-top"),this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom"),e.selected===b?(location.hash&&this.anchors.each(function(a,b){if(b.hash==location.hash)return e.selected=a,!1}),typeof e.selected!="number"&&e.cookie&&(e.selected=parseInt(d._cookie(),10)),typeof e.selected!="number"&&this.lis.filter(".ui-tabs-selected").length&&(e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))),e.selected=e.selected||(this.lis.length?0:-1)):e.selected===null&&(e.selected=-1),e.selected=e.selected>=0&&this.anchors[e.selected]||e.selected<0?e.selected:0,e.disabled=a.unique(e.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(a,b){return d.lis.index(a)}))).sort(),a.inArray(e.selected,e.disabled)!=-1&&e.disabled.splice(a.inArray(e.selected,e.disabled),1),this.panels.addClass("ui-tabs-hide"),this.lis.removeClass("ui-tabs-selected ui-state-active"),e.selected>=0&&this.anchors.length&&(d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash)).removeClass("ui-tabs-hide"),this.lis.eq(e.selected).addClass("ui-tabs-selected ui-state-active"),d.element.queue("tabs",function(){d._trigger("show",null,d._ui(d.anchors[e.selected],d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash))[0]))}),this.load(e.selected)),a(window).bind("unload",function(){d.lis.add(d.anchors).unbind(".tabs"),d.lis=d.anchors=d.panels=null})):e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")),this.element[e.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible"),e.cookie&&this._cookie(e.selected,e.cookie);for(var g=0,h;h=this.lis[g];g++)a(h)[a.inArray(g,e.disabled)!=-1&&!a(h).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");e.cache===!1&&this.anchors.removeData("cache.tabs"),this.lis.add(this.anchors).unbind(".tabs");if(e.event!=="mouseover"){var i=function(a,b){b.is(":not(.ui-state-disabled)")&&b.addClass("ui-state-"+a)},j=function(a,b){b.removeClass("ui-state-"+a)};this.lis.bind("mouseover.tabs",function(){i("hover",a(this))}),this.lis.bind("mouseout.tabs",function(){j("hover",a(this))}),this.anchors.bind("focus.tabs",function(){i("focus",a(this).closest("li"))}),this.anchors.bind("blur.tabs",function(){j("focus",a(this).closest("li"))})}var k,l;e.fx&&(a.isArray(e.fx)?(k=e.fx[0],l=e.fx[1]):k=l=e.fx);var n=l?function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.hide().removeClass("ui-tabs-hide").animate(l,l.duration||"normal",function(){m(c,l),d._trigger("show",null,d._ui(b,c[0]))})}:function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.removeClass("ui-tabs-hide"),d._trigger("show",null,d._ui(b,c[0]))},o=k?function(a,b){b.animate(k,k.duration||"normal",function(){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),m(b,k),d.element.dequeue("tabs")})}:function(a,b,c){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),d.element.dequeue("tabs")};this.anchors.bind(e.event+".tabs",function(){var b=this,c=a(b).closest("li"),f=d.panels.filter(":not(.ui-tabs-hide)"),g=d.element.find(d._sanitizeSelector(b.hash));if(c.hasClass("ui-tabs-selected")&&!e.collapsible||c.hasClass("ui-state-disabled")||c.hasClass("ui-state-processing")||d.panels.filter(":animated").length||d._trigger("select",null,d._ui(this,g[0]))===!1)return this.blur(),!1;e.selected=d.anchors.index(this),d.abort();if(e.collapsible){if(c.hasClass("ui-tabs-selected"))return e.selected=-1,e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){o(b,f)}).dequeue("tabs"),this.blur(),!1;if(!f.length)return e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this)),this.blur(),!1}e.cookie&&d._cookie(e.selected,e.cookie);if(g.length)f.length&&d.element.queue("tabs",function(){o(b,f)}),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this));else throw"jQuery UI Tabs: Mismatching fragment identifier.";a.browser.msie&&this.blur()}),this.anchors.bind("click.tabs",function(){return!1})},_getIndex:function(a){return typeof a=="string"&&(a=this.anchors.index(this.anchors.filter("[href$='"+a+"']"))),a},destroy:function(){var b=this.options;return this.abort(),this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs"),this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.anchors.each(function(){var b=a.data(this,"href.tabs");b&&(this.href=b);var c=a(this).unbind(".tabs");a.each(["href","load","cache"],function(a,b){c.removeData(b+".tabs")})}),this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}),b.cookie&&this._cookie(null,b.cookie),this},add:function(c,d,e){e===b&&(e=this.anchors.length);var f=this,g=this.options,h=a(g.tabTemplate.replace(/#\{href\}/g,c).replace(/#\{label\}/g,d)),i=c.indexOf("#")?this._tabId(a("a",h)[0]):c.replace("#","");h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",!0);var j=f.element.find("#"+i);return j.length||(j=a(g.panelTemplate).attr("id",i).data("destroy.tabs",!0)),j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide"),e>=this.lis.length?(h.appendTo(this.list),j.appendTo(this.list[0].parentNode)):(h.insertBefore(this.lis[e]),j.insertBefore(this.panels[e])),g.disabled=a.map(g.disabled,function(a,b){return a>=e?++a:a}),this._tabify(),this.anchors.length==1&&(g.selected=0,h.addClass("ui-tabs-selected ui-state-active"),j.removeClass("ui-tabs-hide"),this.element.queue("tabs",function(){f._trigger("show",null,f._ui(f.anchors[0],f.panels[0]))}),this.load(0)),this._trigger("add",null,this._ui(this.anchors[e],this.panels[e])),this},remove:function(b){b=this._getIndex(b);var c=this.options,d=this.lis.eq(b).remove(),e=this.panels.eq(b).remove();return d.hasClass("ui-tabs-selected")&&this.anchors.length>1&&this.select(b+(b+1=b?--a:a}),this._tabify(),this._trigger("remove",null,this._ui(d.find("a")[0],e[0])),this},enable:function(b){b=this._getIndex(b);var c=this.options;if(a.inArray(b,c.disabled)==-1)return;return this.lis.eq(b).removeClass("ui-state-disabled"),c.disabled=a.grep(c.disabled,function(a,c){return a!=b}),this._trigger("enable",null,this._ui(this.anchors[b],this.panels[b])),this},disable:function(a){a=this._getIndex(a);var b=this,c=this.options;return a!=c.selected&&(this.lis.eq(a).addClass("ui-state-disabled"),c.disabled.push(a),c.disabled.sort(),this._trigger("disable",null,this._ui(this.anchors[a],this.panels[a]))),this},select:function(a){a=this._getIndex(a);if(a==-1)if(this.options.collapsible&&this.options.selected!=-1)a=this.options.selected;else return this;return this.anchors.eq(a).trigger(this.options.event+".tabs"),this},load:function(b){b=this._getIndex(b);var c=this,d=this.options,e=this.anchors.eq(b)[0],f=a.data(e,"load.tabs");this.abort();if(!f||this.element.queue("tabs").length!==0&&a.data(e,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(b).addClass("ui-state-processing");if(d.spinner){var g=a("span",e);g.data("label.tabs",g.html()).html(d.spinner)}return this.xhr=a.ajax(a.extend({},d.ajaxOptions,{url:f,success:function(f,g){c.element.find(c._sanitizeSelector(e.hash)).html(f),c._cleanup(),d.cache&&a.data(e,"cache.tabs",!0),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.success(f,g)}catch(h){}},error:function(a,f,g){c._cleanup(),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.error(a,f,b,e)}catch(g){}}})),c.element.dequeue("tabs"),this},abort:function(){return this.element.queue([]),this.panels.stop(!1,!0),this.element.queue("tabs",this.element.queue("tabs").splice(-2,2)),this.xhr&&(this.xhr.abort(),delete this.xhr),this._cleanup(),this},url:function(a,b){return this.anchors.eq(a).removeData("cache.tabs").data("load.tabs",b),this},length:function(){return this.anchors.length}}),a.extend(a.ui.tabs,{version:"1.8.24"}),a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(a,b){var c=this,d=this.options,e=c._rotate||(c._rotate=function(b){clearTimeout(c.rotation),c.rotation=setTimeout(function(){var a=d.selected;c.select(++a").html(data).contents().each(function () { + update.insertBefore(this, top); + }); + break; + case "AFTER": + $("
      ").html(data).contents().each(function () { + update.appendChild(this); + }); + break; + default: + $(update).html(data); + break; + } + }); + } + + function asyncRequest(element, options) { + var confirm, loading, method, duration; + + confirm = element.getAttribute("data-ajax-confirm"); + if (confirm && !window.confirm(confirm)) { + return; + } + + loading = $(element.getAttribute("data-ajax-loading")); + duration = element.getAttribute("data-ajax-loading-duration") || 0; + + $.extend(options, { + type: element.getAttribute("data-ajax-method") || undefined, + url: element.getAttribute("data-ajax-url") || undefined, + beforeSend: function (xhr) { + var result; + asyncOnBeforeSend(xhr, method); + result = getFunction(element.getAttribute("data-ajax-begin"), ["xhr"]).apply(this, arguments); + if (result !== false) { + loading.show(duration); + } + return result; + }, + complete: function () { + loading.hide(duration); + getFunction(element.getAttribute("data-ajax-complete"), ["xhr", "status"]).apply(this, arguments); + }, + success: function (data, status, xhr) { + asyncOnSuccess(element, data, xhr.getResponseHeader("Content-Type") || "text/html"); + getFunction(element.getAttribute("data-ajax-success"), ["data", "status", "xhr"]).apply(this, arguments); + }, + error: getFunction(element.getAttribute("data-ajax-failure"), ["xhr", "status", "error"]) + }); + + options.data.push({ name: "X-Requested-With", value: "XMLHttpRequest" }); + + method = options.type.toUpperCase(); + if (!isMethodProxySafe(method)) { + options.type = "POST"; + options.data.push({ name: "X-HTTP-Method-Override", value: method }); + } + + $.ajax(options); + } + + function validate(form) { + var validationInfo = $(form).data(data_validation); + return !validationInfo || !validationInfo.validate || validationInfo.validate(); + } + + $(document).on("click", "a[data-ajax=true]", function (evt) { + evt.preventDefault(); + asyncRequest(this, { + url: this.href, + type: "GET", + data: [] + }); + }); + + $(document).on("click", "form[data-ajax=true] input[type=image]", function (evt) { + var name = evt.target.name, + $target = $(evt.target), + form = $target.parents("form")[0], + offset = $target.offset(); + + $(form).data(data_click, [ + { name: name + ".x", value: Math.round(evt.pageX - offset.left) }, + { name: name + ".y", value: Math.round(evt.pageY - offset.top) } + ]); + + setTimeout(function () { + $(form).removeData(data_click); + }, 0); + }); + + $(document).on("click", "form[data-ajax=true] :submit", function (evt) { + var name = evt.target.name, + form = $(evt.target).parents("form")[0]; + + $(form).data(data_click, name ? [{ name: name, value: evt.target.value }] : []); + + setTimeout(function () { + $(form).removeData(data_click); + }, 0); + }); + + $(document).on("submit", "form[data-ajax=true]", function (evt) { + var clickInfo = $(this).data(data_click) || []; + evt.preventDefault(); + if (!validate(this)) { + return; + } + asyncRequest(this, { + url: this.action, + type: this.method || "GET", + data: clickInfo.concat($(this).serializeArray()) + }); + }); +}(jQuery)); \ No newline at end of file diff --git a/Scripts/jquery.unobtrusive-ajax.min.js b/Scripts/jquery.unobtrusive-ajax.min.js new file mode 100644 index 0000000..33e6fb3 --- /dev/null +++ b/Scripts/jquery.unobtrusive-ajax.min.js @@ -0,0 +1,5 @@ +/* +** Unobtrusive Ajax support library for jQuery +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ +(function(a){var b="unobtrusiveAjaxClick",g="unobtrusiveValidation";function c(d,b){var a=window,c=(d||"").split(".");while(a&&c.length)a=a[c.shift()];if(typeof a==="function")return a;b.push(d);return Function.constructor.apply(null,b)}function d(a){return a==="GET"||a==="POST"}function f(b,a){!d(a)&&b.setRequestHeader("X-HTTP-Method-Override",a)}function h(c,b,e){var d;if(e.indexOf("application/x-javascript")!==-1)return;d=(c.getAttribute("data-ajax-mode")||"").toUpperCase();a(c.getAttribute("data-ajax-update")).each(function(f,c){var e;switch(d){case"BEFORE":e=c.firstChild;a("
      ").html(b).contents().each(function(){c.insertBefore(this,e)});break;case"AFTER":a("
      ").html(b).contents().each(function(){c.appendChild(this)});break;default:a(c).html(b)}})}function e(b,e){var j,k,g,i;j=b.getAttribute("data-ajax-confirm");if(j&&!window.confirm(j))return;k=a(b.getAttribute("data-ajax-loading"));i=b.getAttribute("data-ajax-loading-duration")||0;a.extend(e,{type:b.getAttribute("data-ajax-method")||undefined,url:b.getAttribute("data-ajax-url")||undefined,beforeSend:function(d){var a;f(d,g);a=c(b.getAttribute("data-ajax-begin"),["xhr"]).apply(this,arguments);a!==false&&k.show(i);return a},complete:function(){k.hide(i);c(b.getAttribute("data-ajax-complete"),["xhr","status"]).apply(this,arguments)},success:function(a,e,d){h(b,a,d.getResponseHeader("Content-Type")||"text/html");c(b.getAttribute("data-ajax-success"),["data","status","xhr"]).apply(this,arguments)},error:c(b.getAttribute("data-ajax-failure"),["xhr","status","error"])});e.data.push({name:"X-Requested-With",value:"XMLHttpRequest"});g=e.type.toUpperCase();if(!d(g)){e.type="POST";e.data.push({name:"X-HTTP-Method-Override",value:g})}a.ajax(e)}function i(c){var b=a(c).data(g);return!b||!b.validate||b.validate()}a(document).on("click","a[data-ajax=true]",function(a){a.preventDefault();e(this,{url:this.href,type:"GET",data:[]})});a(document).on("click","form[data-ajax=true] input[type=image]",function(c){var g=c.target.name,d=a(c.target),f=d.parents("form")[0],e=d.offset();a(f).data(b,[{name:g+".x",value:Math.round(c.pageX-e.left)},{name:g+".y",value:Math.round(c.pageY-e.top)}]);setTimeout(function(){a(f).removeData(b)},0)});a(document).on("click","form[data-ajax=true] :submit",function(c){var e=c.target.name,d=a(c.target).parents("form")[0];a(d).data(b,e?[{name:e,value:c.target.value}]:[]);setTimeout(function(){a(d).removeData(b)},0)});a(document).on("submit","form[data-ajax=true]",function(d){var c=a(this).data(b)||[];d.preventDefault();if(!i(this))return;e(this,{url:this.action,type:this.method||"GET",data:c.concat(a(this).serializeArray())})})})(jQuery); \ No newline at end of file diff --git a/Scripts/jquery.validate-vsdoc.js b/Scripts/jquery.validate-vsdoc.js new file mode 100644 index 0000000..cd62a6a --- /dev/null +++ b/Scripts/jquery.validate-vsdoc.js @@ -0,0 +1,1291 @@ +/* +* This file has been commented to support Visual Studio Intellisense. +* You should not use this file at runtime inside the browser--it is only +* intended to be used only for design-time IntelliSense. Please use the +* standard jQuery library for all production use. +* +* Comment version: 1.10.0 +*/ + +/* +* Note: While Microsoft is not the author of this file, Microsoft is +* offering you a license subject to the terms of the Microsoft Software +* License Terms for Microsoft ASP.NET Model View Controller 3. +* Microsoft reserves all other rights. The notices below are provided +* for informational purposes only and are not the license terms under +* which Microsoft distributed this file. +* +* jQuery validation plugin 1.10.0 +* +* http://bassistance.de/jquery-plugins/jquery-plugin-validation/ +* http://docs.jquery.com/Plugins/Validation +* +* Copyright (c) 2006 - 2011 Jörn Zaefferer +* +*/ + +(function($) { + +$.extend($.fn, { + // http://docs.jquery.com/Plugins/Validation/validate + validate: function( options ) { + /// + /// Validates the selected form. This method sets up event handlers for submit, focus, + /// keyup, blur and click to trigger validation of the entire form or individual + /// elements. Each one can be disabled, see the onxxx options (onsubmit, onfocusout, + /// onkeyup, onclick). focusInvalid focuses elements when submitting a invalid form. + /// + /// + /// A set of key/value pairs that configure the validate. All options are optional. + /// + + // if nothing is selected, return nothing; can't chain anyway + if (!this.length) { + options && options.debug && window.console && console.warn( "nothing selected, can't validate, returning nothing" ); + return; + } + + // check if a validator for this form was already created + var validator = $.data(this[0], 'validator'); + if ( validator ) { + return validator; + } + + validator = new $.validator( options, this[0] ); + $.data(this[0], 'validator', validator); + + if ( validator.settings.onsubmit ) { + + // allow suppresing validation by adding a cancel class to the submit button + this.find("input, button").filter(".cancel").click(function() { + validator.cancelSubmit = true; + }); + + // when a submitHandler is used, capture the submitting button + if (validator.settings.submitHandler) { + this.find("input, button").filter(":submit").click(function() { + validator.submitButton = this; + }); + } + + // validate the form on submit + this.submit( function( event ) { + if ( validator.settings.debug ) + // prevent form submit to be able to see console output + event.preventDefault(); + + function handle() { + if ( validator.settings.submitHandler ) { + if (validator.submitButton) { + // insert a hidden input as a replacement for the missing submit button + var hidden = $("").attr("name", validator.submitButton.name).val(validator.submitButton.value).appendTo(validator.currentForm); + } + validator.settings.submitHandler.call( validator, validator.currentForm ); + if (validator.submitButton) { + // and clean up afterwards; thanks to no-block-scope, hidden can be referenced + hidden.remove(); + } + return false; + } + return true; + } + + // prevent submit for invalid forms or custom submit handlers + if ( validator.cancelSubmit ) { + validator.cancelSubmit = false; + return handle(); + } + if ( validator.form() ) { + if ( validator.pendingRequest ) { + validator.formSubmitted = true; + return false; + } + return handle(); + } else { + validator.focusInvalid(); + return false; + } + }); + } + + return validator; + }, + // http://docs.jquery.com/Plugins/Validation/valid + valid: function() { + /// + /// Checks if the selected form is valid or if all selected elements are valid. + /// validate() needs to be called on the form before checking it using this method. + /// + /// + + if ( $(this[0]).is('form')) { + return this.validate().form(); + } else { + var valid = true; + var validator = $(this[0].form).validate(); + this.each(function() { + valid &= validator.element(this); + }); + return valid; + } + }, + // attributes: space seperated list of attributes to retrieve and remove + removeAttrs: function(attributes) { + /// + /// Remove the specified attributes from the first matched element and return them. + /// + /// + /// A space-seperated list of attribute names to remove. + /// + + var result = {}, + $element = this; + $.each(attributes.split(/\s/), function(index, value) { + result[value] = $element.attr(value); + $element.removeAttr(value); + }); + return result; + }, + // http://docs.jquery.com/Plugins/Validation/rules + rules: function(command, argument) { + /// + /// Return the validations rules for the first selected element. + /// + /// + /// Can be either "add" or "remove". + /// + /// + /// A list of rules to add or remove. + /// + + var element = this[0]; + + if (command) { + var settings = $.data(element.form, 'validator').settings; + var staticRules = settings.rules; + var existingRules = $.validator.staticRules(element); + switch(command) { + case "add": + $.extend(existingRules, $.validator.normalizeRule(argument)); + staticRules[element.name] = existingRules; + if (argument.messages) + settings.messages[element.name] = $.extend( settings.messages[element.name], argument.messages ); + break; + case "remove": + if (!argument) { + delete staticRules[element.name]; + return existingRules; + } + var filtered = {}; + $.each(argument.split(/\s/), function(index, method) { + filtered[method] = existingRules[method]; + delete existingRules[method]; + }); + return filtered; + } + } + + var data = $.validator.normalizeRules( + $.extend( + {}, + $.validator.metadataRules(element), + $.validator.classRules(element), + $.validator.attributeRules(element), + $.validator.staticRules(element) + ), element); + + // make sure required is at front + if (data.required) { + var param = data.required; + delete data.required; + data = $.extend({required: param}, data); + } + + return data; + } +}); + +// Custom selectors +$.extend($.expr[":"], { + // http://docs.jquery.com/Plugins/Validation/blank + blank: function(a) {return !$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/filled + filled: function(a) {return !!$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/unchecked + unchecked: function(a) {return !a.checked;} +}); + +// constructor for validator +$.validator = function( options, form ) { + this.settings = $.extend( true, {}, $.validator.defaults, options ); + this.currentForm = form; + this.init(); +}; + +$.validator.format = function(source, params) { + /// + /// Replaces {n} placeholders with arguments. + /// One or more arguments can be passed, in addition to the string template itself, to insert + /// into the string. + /// + /// + /// The string to format. + /// + /// + /// The first argument to insert, or an array of Strings to insert + /// + /// + + if ( arguments.length == 1 ) + return function() { + var args = $.makeArray(arguments); + args.unshift(source); + return $.validator.format.apply( this, args ); + }; + if ( arguments.length > 2 && params.constructor != Array ) { + params = $.makeArray(arguments).slice(1); + } + if ( params.constructor != Array ) { + params = [ params ]; + } + $.each(params, function(i, n) { + source = source.replace(new RegExp("\\{" + i + "\\}", "g"), n); + }); + return source; +}; + +$.extend($.validator, { + + defaults: { + messages: {}, + groups: {}, + rules: {}, + errorClass: "error", + validClass: "valid", + errorElement: "label", + focusInvalid: true, + errorContainer: $( [] ), + errorLabelContainer: $( [] ), + onsubmit: true, + ignore: [], + ignoreTitle: false, + onfocusin: function(element) { + this.lastActive = element; + + // hide error label and remove error class on focus if enabled + if ( this.settings.focusCleanup && !this.blockFocusCleanup ) { + this.settings.unhighlight && this.settings.unhighlight.call( this, element, this.settings.errorClass, this.settings.validClass ); + this.addWrapper(this.errorsFor(element)).hide(); + } + }, + onfocusout: function(element) { + if ( !this.checkable(element) && (element.name in this.submitted || !this.optional(element)) ) { + this.element(element); + } + }, + onkeyup: function(element) { + if ( element.name in this.submitted || element == this.lastElement ) { + this.element(element); + } + }, + onclick: function(element) { + // click on selects, radiobuttons and checkboxes + if ( element.name in this.submitted ) + this.element(element); + // or option elements, check parent select in that case + else if (element.parentNode.name in this.submitted) + this.element(element.parentNode); + }, + highlight: function( element, errorClass, validClass ) { + $(element).addClass(errorClass).removeClass(validClass); + }, + unhighlight: function( element, errorClass, validClass ) { + $(element).removeClass(errorClass).addClass(validClass); + } + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/setDefaults + setDefaults: function(settings) { + /// + /// Modify default settings for validation. + /// Accepts everything that Plugins/Validation/validate accepts. + /// + /// + /// Options to set as default. + /// + + $.extend( $.validator.defaults, settings ); + }, + + messages: { + required: "This field is required.", + remote: "Please fix this field.", + email: "Please enter a valid email address.", + url: "Please enter a valid URL.", + date: "Please enter a valid date.", + dateISO: "Please enter a valid date (ISO).", + number: "Please enter a valid number.", + digits: "Please enter only digits.", + creditcard: "Please enter a valid credit card number.", + equalTo: "Please enter the same value again.", + accept: "Please enter a value with a valid extension.", + maxlength: $.validator.format("Please enter no more than {0} characters."), + minlength: $.validator.format("Please enter at least {0} characters."), + rangelength: $.validator.format("Please enter a value between {0} and {1} characters long."), + range: $.validator.format("Please enter a value between {0} and {1}."), + max: $.validator.format("Please enter a value less than or equal to {0}."), + min: $.validator.format("Please enter a value greater than or equal to {0}.") + }, + + autoCreateRanges: false, + + prototype: { + + init: function() { + this.labelContainer = $(this.settings.errorLabelContainer); + this.errorContext = this.labelContainer.length && this.labelContainer || $(this.currentForm); + this.containers = $(this.settings.errorContainer).add( this.settings.errorLabelContainer ); + this.submitted = {}; + this.valueCache = {}; + this.pendingRequest = 0; + this.pending = {}; + this.invalid = {}; + this.reset(); + + var groups = (this.groups = {}); + $.each(this.settings.groups, function(key, value) { + $.each(value.split(/\s/), function(index, name) { + groups[name] = key; + }); + }); + var rules = this.settings.rules; + $.each(rules, function(key, value) { + rules[key] = $.validator.normalizeRule(value); + }); + + function delegate(event) { + var validator = $.data(this[0].form, "validator"), + eventType = "on" + event.type.replace(/^validate/, ""); + validator.settings[eventType] && validator.settings[eventType].call(validator, this[0] ); + } + $(this.currentForm) + .validateDelegate(":text, :password, :file, select, textarea", "focusin focusout keyup", delegate) + .validateDelegate(":radio, :checkbox, select, option", "click", delegate); + + if (this.settings.invalidHandler) + $(this.currentForm).bind("invalid-form.validate", this.settings.invalidHandler); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/form + form: function() { + /// + /// Validates the form, returns true if it is valid, false otherwise. + /// This behaves as a normal submit event, but returns the result. + /// + /// + + this.checkForm(); + $.extend(this.submitted, this.errorMap); + this.invalid = $.extend({}, this.errorMap); + if (!this.valid()) + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.showErrors(); + return this.valid(); + }, + + checkForm: function() { + this.prepareForm(); + for ( var i = 0, elements = (this.currentElements = this.elements()); elements[i]; i++ ) { + this.check( elements[i] ); + } + return this.valid(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/element + element: function( element ) { + /// + /// Validates a single element, returns true if it is valid, false otherwise. + /// This behaves as validation on blur or keyup, but returns the result. + /// + /// + /// An element to validate, must be inside the validated form. + /// + /// + + element = this.clean( element ); + this.lastElement = element; + this.prepareElement( element ); + this.currentElements = $(element); + var result = this.check( element ); + if ( result ) { + delete this.invalid[element.name]; + } else { + this.invalid[element.name] = true; + } + if ( !this.numberOfInvalids() ) { + // Hide error containers on last error + this.toHide = this.toHide.add( this.containers ); + } + this.showErrors(); + return result; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/showErrors + showErrors: function(errors) { + /// + /// Show the specified messages. + /// Keys have to refer to the names of elements, values are displayed for those elements, using the configured error placement. + /// + /// + /// One or more key/value pairs of input names and messages. + /// + + if(errors) { + // add items to error list and map + $.extend( this.errorMap, errors ); + this.errorList = []; + for ( var name in errors ) { + this.errorList.push({ + message: errors[name], + element: this.findByName(name)[0] + }); + } + // remove items from success list + this.successList = $.grep( this.successList, function(element) { + return !(element.name in errors); + }); + } + this.settings.showErrors + ? this.settings.showErrors.call( this, this.errorMap, this.errorList ) + : this.defaultShowErrors(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/resetForm + resetForm: function() { + /// + /// Resets the controlled form. + /// Resets input fields to their original value (requires form plugin), removes classes + /// indicating invalid elements and hides error messages. + /// + + if ( $.fn.resetForm ) + $( this.currentForm ).resetForm(); + this.submitted = {}; + this.prepareForm(); + this.hideErrors(); + this.elements().removeClass( this.settings.errorClass ); + }, + + numberOfInvalids: function() { + /// + /// Returns the number of invalid fields. + /// This depends on the internal validator state. It covers all fields only after + /// validating the complete form (on submit or via $("form").valid()). After validating + /// a single element, only that element is counted. Most useful in combination with the + /// invalidHandler-option. + /// + /// + + return this.objectLength(this.invalid); + }, + + objectLength: function( obj ) { + var count = 0; + for ( var i in obj ) + count++; + return count; + }, + + hideErrors: function() { + this.addWrapper( this.toHide ).hide(); + }, + + valid: function() { + return this.size() == 0; + }, + + size: function() { + return this.errorList.length; + }, + + focusInvalid: function() { + if( this.settings.focusInvalid ) { + try { + $(this.findLastActive() || this.errorList.length && this.errorList[0].element || []) + .filter(":visible") + .focus() + // manually trigger focusin event; without it, focusin handler isn't called, findLastActive won't have anything to find + .trigger("focusin"); + } catch(e) { + // ignore IE throwing errors when focusing hidden elements + } + } + }, + + findLastActive: function() { + var lastActive = this.lastActive; + return lastActive && $.grep(this.errorList, function(n) { + return n.element.name == lastActive.name; + }).length == 1 && lastActive; + }, + + elements: function() { + var validator = this, + rulesCache = {}; + + // select all valid inputs inside the form (no submit or reset buttons) + // workaround $Query([]).add until http://dev.jquery.com/ticket/2114 is solved + return $([]).add(this.currentForm.elements) + .filter(":input") + .not(":submit, :reset, :image, [disabled]") + .not( this.settings.ignore ) + .filter(function() { + !this.name && validator.settings.debug && window.console && console.error( "%o has no name assigned", this); + + // select only the first element for each name, and only those with rules specified + if ( this.name in rulesCache || !validator.objectLength($(this).rules()) ) + return false; + + rulesCache[this.name] = true; + return true; + }); + }, + + clean: function( selector ) { + return $( selector )[0]; + }, + + errors: function() { + return $( this.settings.errorElement + "." + this.settings.errorClass, this.errorContext ); + }, + + reset: function() { + this.successList = []; + this.errorList = []; + this.errorMap = {}; + this.toShow = $([]); + this.toHide = $([]); + this.currentElements = $([]); + }, + + prepareForm: function() { + this.reset(); + this.toHide = this.errors().add( this.containers ); + }, + + prepareElement: function( element ) { + this.reset(); + this.toHide = this.errorsFor(element); + }, + + check: function( element ) { + element = this.clean( element ); + + // if radio/checkbox, validate first element in group instead + if (this.checkable(element)) { + element = this.findByName(element.name).not(this.settings.ignore)[0]; + } + + var rules = $(element).rules(); + var dependencyMismatch = false; + for (var method in rules) { + var rule = { method: method, parameters: rules[method] }; + try { + var result = $.validator.methods[method].call( this, element.value.replace(/\r/g, ""), element, rule.parameters ); + + // if a method indicates that the field is optional and therefore valid, + // don't mark it as valid when there are no other rules + if ( result == "dependency-mismatch" ) { + dependencyMismatch = true; + continue; + } + dependencyMismatch = false; + + if ( result == "pending" ) { + this.toHide = this.toHide.not( this.errorsFor(element) ); + return; + } + + if( !result ) { + this.formatAndAdd( element, rule ); + return false; + } + } catch(e) { + this.settings.debug && window.console && console.log("exception occured when checking element " + element.id + + ", check the '" + rule.method + "' method", e); + throw e; + } + } + if (dependencyMismatch) + return; + if ( this.objectLength(rules) ) + this.successList.push(element); + return true; + }, + + // return the custom message for the given element and validation method + // specified in the element's "messages" metadata + customMetaMessage: function(element, method) { + if (!$.metadata) + return; + + var meta = this.settings.meta + ? $(element).metadata()[this.settings.meta] + : $(element).metadata(); + + return meta && meta.messages && meta.messages[method]; + }, + + // return the custom message for the given element name and validation method + customMessage: function( name, method ) { + var m = this.settings.messages[name]; + return m && (m.constructor == String + ? m + : m[method]); + }, + + // return the first defined argument, allowing empty strings + findDefined: function() { + for(var i = 0; i < arguments.length; i++) { + if (arguments[i] !== undefined) + return arguments[i]; + } + return undefined; + }, + + defaultMessage: function( element, method) { + return this.findDefined( + this.customMessage( element.name, method ), + this.customMetaMessage( element, method ), + // title is never undefined, so handle empty string as undefined + !this.settings.ignoreTitle && element.title || undefined, + $.validator.messages[method], + "Warning: No message defined for " + element.name + "" + ); + }, + + formatAndAdd: function( element, rule ) { + var message = this.defaultMessage( element, rule.method ), + theregex = /\$?\{(\d+)\}/g; + if ( typeof message == "function" ) { + message = message.call(this, rule.parameters, element); + } else if (theregex.test(message)) { + message = jQuery.format(message.replace(theregex, '{$1}'), rule.parameters); + } + this.errorList.push({ + message: message, + element: element + }); + + this.errorMap[element.name] = message; + this.submitted[element.name] = message; + }, + + addWrapper: function(toToggle) { + if ( this.settings.wrapper ) + toToggle = toToggle.add( toToggle.parent( this.settings.wrapper ) ); + return toToggle; + }, + + defaultShowErrors: function() { + for ( var i = 0; this.errorList[i]; i++ ) { + var error = this.errorList[i]; + this.settings.highlight && this.settings.highlight.call( this, error.element, this.settings.errorClass, this.settings.validClass ); + this.showLabel( error.element, error.message ); + } + if( this.errorList.length ) { + this.toShow = this.toShow.add( this.containers ); + } + if (this.settings.success) { + for ( var i = 0; this.successList[i]; i++ ) { + this.showLabel( this.successList[i] ); + } + } + if (this.settings.unhighlight) { + for ( var i = 0, elements = this.validElements(); elements[i]; i++ ) { + this.settings.unhighlight.call( this, elements[i], this.settings.errorClass, this.settings.validClass ); + } + } + this.toHide = this.toHide.not( this.toShow ); + this.hideErrors(); + this.addWrapper( this.toShow ).show(); + }, + + validElements: function() { + return this.currentElements.not(this.invalidElements()); + }, + + invalidElements: function() { + return $(this.errorList).map(function() { + return this.element; + }); + }, + + showLabel: function(element, message) { + var label = this.errorsFor( element ); + if ( label.length ) { + // refresh error/success class + label.removeClass().addClass( this.settings.errorClass ); + + // check if we have a generated label, replace the message then + label.attr("generated") && label.html(message); + } else { + // create label + label = $("<" + this.settings.errorElement + "/>") + .attr({"for": this.idOrName(element), generated: true}) + .addClass(this.settings.errorClass) + .html(message || ""); + if ( this.settings.wrapper ) { + // make sure the element is visible, even in IE + // actually showing the wrapped element is handled elsewhere + label = label.hide().show().wrap("<" + this.settings.wrapper + "/>").parent(); + } + if ( !this.labelContainer.append(label).length ) + this.settings.errorPlacement + ? this.settings.errorPlacement(label, $(element) ) + : label.insertAfter(element); + } + if ( !message && this.settings.success ) { + label.text(""); + typeof this.settings.success == "string" + ? label.addClass( this.settings.success ) + : this.settings.success( label ); + } + this.toShow = this.toShow.add(label); + }, + + errorsFor: function(element) { + var name = this.idOrName(element); + return this.errors().filter(function() { + return $(this).attr('for') == name; + }); + }, + + idOrName: function(element) { + return this.groups[element.name] || (this.checkable(element) ? element.name : element.id || element.name); + }, + + checkable: function( element ) { + return /radio|checkbox/i.test(element.type); + }, + + findByName: function( name ) { + // select by name and filter by form for performance over form.find("[name=...]") + var form = this.currentForm; + return $(document.getElementsByName(name)).map(function(index, element) { + return element.form == form && element.name == name && element || null; + }); + }, + + getLength: function(value, element) { + switch( element.nodeName.toLowerCase() ) { + case 'select': + return $("option:selected", element).length; + case 'input': + if( this.checkable( element) ) + return this.findByName(element.name).filter(':checked').length; + } + return value.length; + }, + + depend: function(param, element) { + return this.dependTypes[typeof param] + ? this.dependTypes[typeof param](param, element) + : true; + }, + + dependTypes: { + "boolean": function(param, element) { + return param; + }, + "string": function(param, element) { + return !!$(param, element.form).length; + }, + "function": function(param, element) { + return param(element); + } + }, + + optional: function(element) { + return !$.validator.methods.required.call(this, $.trim(element.value), element) && "dependency-mismatch"; + }, + + startRequest: function(element) { + if (!this.pending[element.name]) { + this.pendingRequest++; + this.pending[element.name] = true; + } + }, + + stopRequest: function(element, valid) { + this.pendingRequest--; + // sometimes synchronization fails, make sure pendingRequest is never < 0 + if (this.pendingRequest < 0) + this.pendingRequest = 0; + delete this.pending[element.name]; + if ( valid && this.pendingRequest == 0 && this.formSubmitted && this.form() ) { + $(this.currentForm).submit(); + this.formSubmitted = false; + } else if (!valid && this.pendingRequest == 0 && this.formSubmitted) { + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.formSubmitted = false; + } + }, + + previousValue: function(element) { + return $.data(element, "previousValue") || $.data(element, "previousValue", { + old: null, + valid: true, + message: this.defaultMessage( element, "remote" ) + }); + } + + }, + + classRuleSettings: { + required: {required: true}, + email: {email: true}, + url: {url: true}, + date: {date: true}, + dateISO: {dateISO: true}, + dateDE: {dateDE: true}, + number: {number: true}, + numberDE: {numberDE: true}, + digits: {digits: true}, + creditcard: {creditcard: true} + }, + + addClassRules: function(className, rules) { + /// + /// Add a compound class method - useful to refactor common combinations of rules into a single + /// class. + /// + /// + /// The name of the class rule to add + /// + /// + /// The compound rules + /// + + className.constructor == String ? + this.classRuleSettings[className] = rules : + $.extend(this.classRuleSettings, className); + }, + + classRules: function(element) { + var rules = {}; + var classes = $(element).attr('class'); + classes && $.each(classes.split(' '), function() { + if (this in $.validator.classRuleSettings) { + $.extend(rules, $.validator.classRuleSettings[this]); + } + }); + return rules; + }, + + attributeRules: function(element) { + var rules = {}; + var $element = $(element); + + for (var method in $.validator.methods) { + var value = $element.attr(method); + if (value) { + rules[method] = value; + } + } + + // maxlength may be returned as -1, 2147483647 (IE) and 524288 (safari) for text inputs + if (rules.maxlength && /-1|2147483647|524288/.test(rules.maxlength)) { + delete rules.maxlength; + } + + return rules; + }, + + metadataRules: function(element) { + if (!$.metadata) return {}; + + var meta = $.data(element.form, 'validator').settings.meta; + return meta ? + $(element).metadata()[meta] : + $(element).metadata(); + }, + + staticRules: function(element) { + var rules = {}; + var validator = $.data(element.form, 'validator'); + if (validator.settings.rules) { + rules = $.validator.normalizeRule(validator.settings.rules[element.name]) || {}; + } + return rules; + }, + + normalizeRules: function(rules, element) { + // handle dependency check + $.each(rules, function(prop, val) { + // ignore rule when param is explicitly false, eg. required:false + if (val === false) { + delete rules[prop]; + return; + } + if (val.param || val.depends) { + var keepRule = true; + switch (typeof val.depends) { + case "string": + keepRule = !!$(val.depends, element.form).length; + break; + case "function": + keepRule = val.depends.call(element, element); + break; + } + if (keepRule) { + rules[prop] = val.param !== undefined ? val.param : true; + } else { + delete rules[prop]; + } + } + }); + + // evaluate parameters + $.each(rules, function(rule, parameter) { + rules[rule] = $.isFunction(parameter) ? parameter(element) : parameter; + }); + + // clean number parameters + $.each(['minlength', 'maxlength', 'min', 'max'], function() { + if (rules[this]) { + rules[this] = Number(rules[this]); + } + }); + $.each(['rangelength', 'range'], function() { + if (rules[this]) { + rules[this] = [Number(rules[this][0]), Number(rules[this][1])]; + } + }); + + if ($.validator.autoCreateRanges) { + // auto-create ranges + if (rules.min && rules.max) { + rules.range = [rules.min, rules.max]; + delete rules.min; + delete rules.max; + } + if (rules.minlength && rules.maxlength) { + rules.rangelength = [rules.minlength, rules.maxlength]; + delete rules.minlength; + delete rules.maxlength; + } + } + + // To support custom messages in metadata ignore rule methods titled "messages" + if (rules.messages) { + delete rules.messages; + } + + return rules; + }, + + // Converts a simple string to a {string: true} rule, e.g., "required" to {required:true} + normalizeRule: function(data) { + if( typeof data == "string" ) { + var transformed = {}; + $.each(data.split(/\s/), function() { + transformed[this] = true; + }); + data = transformed; + } + return data; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/addMethod + addMethod: function(name, method, message) { + /// + /// Add a custom validation method. It must consist of a name (must be a legal javascript + /// identifier), a javascript based function and a default string message. + /// + /// + /// The name of the method, used to identify and referencing it, must be a valid javascript + /// identifier + /// + /// + /// The actual method implementation, returning true if an element is valid + /// + /// + /// (Optional) The default message to display for this method. Can be a function created by + /// jQuery.validator.format(value). When undefined, an already existing message is used + /// (handy for localization), otherwise the field-specific messages have to be defined. + /// + + $.validator.methods[name] = method; + $.validator.messages[name] = message != undefined ? message : $.validator.messages[name]; + if (method.length < 3) { + $.validator.addClassRules(name, $.validator.normalizeRule(name)); + } + }, + + methods: { + + // http://docs.jquery.com/Plugins/Validation/Methods/required + required: function(value, element, param) { + // check if dependency is met + if ( !this.depend(param, element) ) + return "dependency-mismatch"; + switch( element.nodeName.toLowerCase() ) { + case 'select': + // could be an array for select-multiple or a string, both are fine this way + var val = $(element).val(); + return val && val.length > 0; + case 'input': + if ( this.checkable(element) ) + return this.getLength(value, element) > 0; + default: + return $.trim(value).length > 0; + } + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/remote + remote: function(value, element, param) { + if ( this.optional(element) ) + return "dependency-mismatch"; + + var previous = this.previousValue(element); + if (!this.settings.messages[element.name] ) + this.settings.messages[element.name] = {}; + previous.originalMessage = this.settings.messages[element.name].remote; + this.settings.messages[element.name].remote = previous.message; + + param = typeof param == "string" && {url:param} || param; + + if ( this.pending[element.name] ) { + return "pending"; + } + if ( previous.old === value ) { + return previous.valid; + } + + previous.old = value; + var validator = this; + this.startRequest(element); + var data = {}; + data[element.name] = value; + $.ajax($.extend(true, { + url: param, + mode: "abort", + port: "validate" + element.name, + dataType: "json", + data: data, + success: function(response) { + validator.settings.messages[element.name].remote = previous.originalMessage; + var valid = response === true; + if ( valid ) { + var submitted = validator.formSubmitted; + validator.prepareElement(element); + validator.formSubmitted = submitted; + validator.successList.push(element); + validator.showErrors(); + } else { + var errors = {}; + var message = response || validator.defaultMessage(element, "remote"); + errors[element.name] = previous.message = $.isFunction(message) ? message(value) : message; + validator.showErrors(errors); + } + previous.valid = valid; + validator.stopRequest(element, valid); + } + }, param)); + return "pending"; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/minlength + minlength: function(value, element, param) { + return this.optional(element) || this.getLength($.trim(value), element) >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/maxlength + maxlength: function(value, element, param) { + return this.optional(element) || this.getLength($.trim(value), element) <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/rangelength + rangelength: function(value, element, param) { + var length = this.getLength($.trim(value), element); + return this.optional(element) || ( length >= param[0] && length <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/min + min: function( value, element, param ) { + return this.optional(element) || value >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/max + max: function( value, element, param ) { + return this.optional(element) || value <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/range + range: function( value, element, param ) { + return this.optional(element) || ( value >= param[0] && value <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/email + email: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/email_address_validation/ + return this.optional(element) || /^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/url + url: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/iri/ + return this.optional(element) || /^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/date + date: function(value, element) { + return this.optional(element) || !/Invalid|NaN/.test(new Date(value)); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/dateISO + dateISO: function(value, element) { + return this.optional(element) || /^\d{4}[\/-]\d{1,2}[\/-]\d{1,2}$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/number + number: function(value, element) { + return this.optional(element) || /^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d+)?$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/digits + digits: function(value, element) { + return this.optional(element) || /^\d+$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/creditcard + // based on http://en.wikipedia.org/wiki/Luhn + creditcard: function(value, element) { + if ( this.optional(element) ) + return "dependency-mismatch"; + // accept only digits and dashes + if (/[^0-9-]+/.test(value)) + return false; + var nCheck = 0, + nDigit = 0, + bEven = false; + + value = value.replace(/\D/g, ""); + + for (var n = value.length - 1; n >= 0; n--) { + var cDigit = value.charAt(n); + var nDigit = parseInt(cDigit, 10); + if (bEven) { + if ((nDigit *= 2) > 9) + nDigit -= 9; + } + nCheck += nDigit; + bEven = !bEven; + } + + return (nCheck % 10) == 0; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/accept + accept: function(value, element, param) { + param = typeof param == "string" ? param.replace(/,/g, '|') : "png|jpe?g|gif"; + return this.optional(element) || value.match(new RegExp(".(" + param + ")$", "i")); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/equalTo + equalTo: function(value, element, param) { + // bind to the blur event of the target in order to revalidate whenever the target field is updated + // TODO find a way to bind the event just once, avoiding the unbind-rebind overhead + var target = $(param).unbind(".validate-equalTo").bind("blur.validate-equalTo", function() { + $(element).valid(); + }); + return value == target.val(); + } + + } + +}); + +// deprecated, use $.validator.format instead +$.format = $.validator.format; + +})(jQuery); + +// ajax mode: abort +// usage: $.ajax({ mode: "abort"[, port: "uniqueport"]}); +// if mode:"abort" is used, the previous request on that port (port can be undefined) is aborted via XMLHttpRequest.abort() +;(function($) { + var pendingRequests = {}; + // Use a prefilter if available (1.5+) + if ( $.ajaxPrefilter ) { + $.ajaxPrefilter(function(settings, _, xhr) { + var port = settings.port; + if (settings.mode == "abort") { + if ( pendingRequests[port] ) { + pendingRequests[port].abort(); + } pendingRequests[port] = xhr; + } + }); + } else { + // Proxy ajax + var ajax = $.ajax; + $.ajax = function(settings) { + var mode = ( "mode" in settings ? settings : $.ajaxSettings ).mode, + port = ( "port" in settings ? settings : $.ajaxSettings ).port; + if (mode == "abort") { + if ( pendingRequests[port] ) { + pendingRequests[port].abort(); + } + + return (pendingRequests[port] = ajax.apply(this, arguments)); + } + return ajax.apply(this, arguments); + }; + } +})(jQuery); + +// provides cross-browser focusin and focusout events +// IE has native support, in other browsers, use event caputuring (neither bubbles) + +// provides delegate(type: String, delegate: Selector, handler: Callback) plugin for easier event delegation +// handler is only called when $(event.target).is(delegate), in the scope of the jquery-object for event.target +;(function($) { + // only implement if not provided by jQuery core (since 1.4) + // TODO verify if jQuery 1.4's implementation is compatible with older jQuery special-event APIs + if (!jQuery.event.special.focusin && !jQuery.event.special.focusout && document.addEventListener) { + $.each({ + focus: 'focusin', + blur: 'focusout' + }, function( original, fix ){ + $.event.special[fix] = { + setup:function() { + this.addEventListener( original, handler, true ); + }, + teardown:function() { + this.removeEventListener( original, handler, true ); + }, + handler: function(e) { + arguments[0] = $.event.fix(e); + arguments[0].type = fix; + return $.event.handle.apply(this, arguments); + } + }; + function handler(e) { + e = $.event.fix(e); + e.type = fix; + return $.event.handle.call(this, e); + } + }); + }; + $.extend($.fn, { + validateDelegate: function(delegate, type, handler) { + return this.bind(type, function(event) { + var target = $(event.target); + if (target.is(delegate)) { + return handler.apply(target, arguments); + } + }); + } + }); +})(jQuery); diff --git a/Scripts/jquery.validate.js b/Scripts/jquery.validate.js new file mode 100644 index 0000000..0dbb7e4 --- /dev/null +++ b/Scripts/jquery.validate.js @@ -0,0 +1,1248 @@ +/*! jQuery Validation Plugin - v1.10.0 - 9/7/2012 +* https://github.com/jzaefferer/jquery-validation +* Copyright (c) 2012 Jörn Zaefferer; Licensed MIT */ + +(function($) { + +$.extend($.fn, { + // http://docs.jquery.com/Plugins/Validation/validate + validate: function( options ) { + + // if nothing is selected, return nothing; can't chain anyway + if (!this.length) { + if (options && options.debug && window.console) { + console.warn( "nothing selected, can't validate, returning nothing" ); + } + return; + } + + // check if a validator for this form was already created + var validator = $.data(this[0], 'validator'); + if ( validator ) { + return validator; + } + + // Add novalidate tag if HTML5. + this.attr('novalidate', 'novalidate'); + + validator = new $.validator( options, this[0] ); + $.data(this[0], 'validator', validator); + + if ( validator.settings.onsubmit ) { + + this.validateDelegate( ":submit", "click", function(ev) { + if ( validator.settings.submitHandler ) { + validator.submitButton = ev.target; + } + // allow suppressing validation by adding a cancel class to the submit button + if ( $(ev.target).hasClass('cancel') ) { + validator.cancelSubmit = true; + } + }); + + // validate the form on submit + this.submit( function( event ) { + if ( validator.settings.debug ) { + // prevent form submit to be able to see console output + event.preventDefault(); + } + function handle() { + var hidden; + if ( validator.settings.submitHandler ) { + if (validator.submitButton) { + // insert a hidden input as a replacement for the missing submit button + hidden = $("").attr("name", validator.submitButton.name).val(validator.submitButton.value).appendTo(validator.currentForm); + } + validator.settings.submitHandler.call( validator, validator.currentForm, event ); + if (validator.submitButton) { + // and clean up afterwards; thanks to no-block-scope, hidden can be referenced + hidden.remove(); + } + return false; + } + return true; + } + + // prevent submit for invalid forms or custom submit handlers + if ( validator.cancelSubmit ) { + validator.cancelSubmit = false; + return handle(); + } + if ( validator.form() ) { + if ( validator.pendingRequest ) { + validator.formSubmitted = true; + return false; + } + return handle(); + } else { + validator.focusInvalid(); + return false; + } + }); + } + + return validator; + }, + // http://docs.jquery.com/Plugins/Validation/valid + valid: function() { + if ( $(this[0]).is('form')) { + return this.validate().form(); + } else { + var valid = true; + var validator = $(this[0].form).validate(); + this.each(function() { + valid &= validator.element(this); + }); + return valid; + } + }, + // attributes: space seperated list of attributes to retrieve and remove + removeAttrs: function(attributes) { + var result = {}, + $element = this; + $.each(attributes.split(/\s/), function(index, value) { + result[value] = $element.attr(value); + $element.removeAttr(value); + }); + return result; + }, + // http://docs.jquery.com/Plugins/Validation/rules + rules: function(command, argument) { + var element = this[0]; + + if (command) { + var settings = $.data(element.form, 'validator').settings; + var staticRules = settings.rules; + var existingRules = $.validator.staticRules(element); + switch(command) { + case "add": + $.extend(existingRules, $.validator.normalizeRule(argument)); + staticRules[element.name] = existingRules; + if (argument.messages) { + settings.messages[element.name] = $.extend( settings.messages[element.name], argument.messages ); + } + break; + case "remove": + if (!argument) { + delete staticRules[element.name]; + return existingRules; + } + var filtered = {}; + $.each(argument.split(/\s/), function(index, method) { + filtered[method] = existingRules[method]; + delete existingRules[method]; + }); + return filtered; + } + } + + var data = $.validator.normalizeRules( + $.extend( + {}, + $.validator.metadataRules(element), + $.validator.classRules(element), + $.validator.attributeRules(element), + $.validator.staticRules(element) + ), element); + + // make sure required is at front + if (data.required) { + var param = data.required; + delete data.required; + data = $.extend({required: param}, data); + } + + return data; + } +}); + +// Custom selectors +$.extend($.expr[":"], { + // http://docs.jquery.com/Plugins/Validation/blank + blank: function(a) {return !$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/filled + filled: function(a) {return !!$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/unchecked + unchecked: function(a) {return !a.checked;} +}); + +// constructor for validator +$.validator = function( options, form ) { + this.settings = $.extend( true, {}, $.validator.defaults, options ); + this.currentForm = form; + this.init(); +}; + +$.validator.format = function(source, params) { + if ( arguments.length === 1 ) { + return function() { + var args = $.makeArray(arguments); + args.unshift(source); + return $.validator.format.apply( this, args ); + }; + } + if ( arguments.length > 2 && params.constructor !== Array ) { + params = $.makeArray(arguments).slice(1); + } + if ( params.constructor !== Array ) { + params = [ params ]; + } + $.each(params, function(i, n) { + source = source.replace(new RegExp("\\{" + i + "\\}", "g"), n); + }); + return source; +}; + +$.extend($.validator, { + + defaults: { + messages: {}, + groups: {}, + rules: {}, + errorClass: "error", + validClass: "valid", + errorElement: "label", + focusInvalid: true, + errorContainer: $( [] ), + errorLabelContainer: $( [] ), + onsubmit: true, + ignore: ":hidden", + ignoreTitle: false, + onfocusin: function(element, event) { + this.lastActive = element; + + // hide error label and remove error class on focus if enabled + if ( this.settings.focusCleanup && !this.blockFocusCleanup ) { + if ( this.settings.unhighlight ) { + this.settings.unhighlight.call( this, element, this.settings.errorClass, this.settings.validClass ); + } + this.addWrapper(this.errorsFor(element)).hide(); + } + }, + onfocusout: function(element, event) { + if ( !this.checkable(element) && (element.name in this.submitted || !this.optional(element)) ) { + this.element(element); + } + }, + onkeyup: function(element, event) { + if ( event.which === 9 && this.elementValue(element) === '' ) { + return; + } else if ( element.name in this.submitted || element === this.lastActive ) { + this.element(element); + } + }, + onclick: function(element, event) { + // click on selects, radiobuttons and checkboxes + if ( element.name in this.submitted ) { + this.element(element); + } + // or option elements, check parent select in that case + else if (element.parentNode.name in this.submitted) { + this.element(element.parentNode); + } + }, + highlight: function(element, errorClass, validClass) { + if (element.type === 'radio') { + this.findByName(element.name).addClass(errorClass).removeClass(validClass); + } else { + $(element).addClass(errorClass).removeClass(validClass); + } + }, + unhighlight: function(element, errorClass, validClass) { + if (element.type === 'radio') { + this.findByName(element.name).removeClass(errorClass).addClass(validClass); + } else { + $(element).removeClass(errorClass).addClass(validClass); + } + } + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/setDefaults + setDefaults: function(settings) { + $.extend( $.validator.defaults, settings ); + }, + + messages: { + required: "This field is required.", + remote: "Please fix this field.", + email: "Please enter a valid email address.", + url: "Please enter a valid URL.", + date: "Please enter a valid date.", + dateISO: "Please enter a valid date (ISO).", + number: "Please enter a valid number.", + digits: "Please enter only digits.", + creditcard: "Please enter a valid credit card number.", + equalTo: "Please enter the same value again.", + maxlength: $.validator.format("Please enter no more than {0} characters."), + minlength: $.validator.format("Please enter at least {0} characters."), + rangelength: $.validator.format("Please enter a value between {0} and {1} characters long."), + range: $.validator.format("Please enter a value between {0} and {1}."), + max: $.validator.format("Please enter a value less than or equal to {0}."), + min: $.validator.format("Please enter a value greater than or equal to {0}.") + }, + + autoCreateRanges: false, + + prototype: { + + init: function() { + this.labelContainer = $(this.settings.errorLabelContainer); + this.errorContext = this.labelContainer.length && this.labelContainer || $(this.currentForm); + this.containers = $(this.settings.errorContainer).add( this.settings.errorLabelContainer ); + this.submitted = {}; + this.valueCache = {}; + this.pendingRequest = 0; + this.pending = {}; + this.invalid = {}; + this.reset(); + + var groups = (this.groups = {}); + $.each(this.settings.groups, function(key, value) { + $.each(value.split(/\s/), function(index, name) { + groups[name] = key; + }); + }); + var rules = this.settings.rules; + $.each(rules, function(key, value) { + rules[key] = $.validator.normalizeRule(value); + }); + + function delegate(event) { + var validator = $.data(this[0].form, "validator"), + eventType = "on" + event.type.replace(/^validate/, ""); + if (validator.settings[eventType]) { + validator.settings[eventType].call(validator, this[0], event); + } + } + $(this.currentForm) + .validateDelegate(":text, [type='password'], [type='file'], select, textarea, " + + "[type='number'], [type='search'] ,[type='tel'], [type='url'], " + + "[type='email'], [type='datetime'], [type='date'], [type='month'], " + + "[type='week'], [type='time'], [type='datetime-local'], " + + "[type='range'], [type='color'] ", + "focusin focusout keyup", delegate) + .validateDelegate("[type='radio'], [type='checkbox'], select, option", "click", delegate); + + if (this.settings.invalidHandler) { + $(this.currentForm).bind("invalid-form.validate", this.settings.invalidHandler); + } + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/form + form: function() { + this.checkForm(); + $.extend(this.submitted, this.errorMap); + this.invalid = $.extend({}, this.errorMap); + if (!this.valid()) { + $(this.currentForm).triggerHandler("invalid-form", [this]); + } + this.showErrors(); + return this.valid(); + }, + + checkForm: function() { + this.prepareForm(); + for ( var i = 0, elements = (this.currentElements = this.elements()); elements[i]; i++ ) { + this.check( elements[i] ); + } + return this.valid(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/element + element: function( element ) { + element = this.validationTargetFor( this.clean( element ) ); + this.lastElement = element; + this.prepareElement( element ); + this.currentElements = $(element); + var result = this.check( element ) !== false; + if (result) { + delete this.invalid[element.name]; + } else { + this.invalid[element.name] = true; + } + if ( !this.numberOfInvalids() ) { + // Hide error containers on last error + this.toHide = this.toHide.add( this.containers ); + } + this.showErrors(); + return result; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/showErrors + showErrors: function(errors) { + if(errors) { + // add items to error list and map + $.extend( this.errorMap, errors ); + this.errorList = []; + for ( var name in errors ) { + this.errorList.push({ + message: errors[name], + element: this.findByName(name)[0] + }); + } + // remove items from success list + this.successList = $.grep( this.successList, function(element) { + return !(element.name in errors); + }); + } + if (this.settings.showErrors) { + this.settings.showErrors.call( this, this.errorMap, this.errorList ); + } else { + this.defaultShowErrors(); + } + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/resetForm + resetForm: function() { + if ( $.fn.resetForm ) { + $( this.currentForm ).resetForm(); + } + this.submitted = {}; + this.lastElement = null; + this.prepareForm(); + this.hideErrors(); + this.elements().removeClass( this.settings.errorClass ).removeData( "previousValue" ); + }, + + numberOfInvalids: function() { + return this.objectLength(this.invalid); + }, + + objectLength: function( obj ) { + var count = 0; + for ( var i in obj ) { + count++; + } + return count; + }, + + hideErrors: function() { + this.addWrapper( this.toHide ).hide(); + }, + + valid: function() { + return this.size() === 0; + }, + + size: function() { + return this.errorList.length; + }, + + focusInvalid: function() { + if( this.settings.focusInvalid ) { + try { + $(this.findLastActive() || this.errorList.length && this.errorList[0].element || []) + .filter(":visible") + .focus() + // manually trigger focusin event; without it, focusin handler isn't called, findLastActive won't have anything to find + .trigger("focusin"); + } catch(e) { + // ignore IE throwing errors when focusing hidden elements + } + } + }, + + findLastActive: function() { + var lastActive = this.lastActive; + return lastActive && $.grep(this.errorList, function(n) { + return n.element.name === lastActive.name; + }).length === 1 && lastActive; + }, + + elements: function() { + var validator = this, + rulesCache = {}; + + // select all valid inputs inside the form (no submit or reset buttons) + return $(this.currentForm) + .find("input, select, textarea") + .not(":submit, :reset, :image, [disabled]") + .not( this.settings.ignore ) + .filter(function() { + if ( !this.name && validator.settings.debug && window.console ) { + console.error( "%o has no name assigned", this); + } + + // select only the first element for each name, and only those with rules specified + if ( this.name in rulesCache || !validator.objectLength($(this).rules()) ) { + return false; + } + + rulesCache[this.name] = true; + return true; + }); + }, + + clean: function( selector ) { + return $( selector )[0]; + }, + + errors: function() { + var errorClass = this.settings.errorClass.replace(' ', '.'); + return $( this.settings.errorElement + "." + errorClass, this.errorContext ); + }, + + reset: function() { + this.successList = []; + this.errorList = []; + this.errorMap = {}; + this.toShow = $([]); + this.toHide = $([]); + this.currentElements = $([]); + }, + + prepareForm: function() { + this.reset(); + this.toHide = this.errors().add( this.containers ); + }, + + prepareElement: function( element ) { + this.reset(); + this.toHide = this.errorsFor(element); + }, + + elementValue: function( element ) { + var type = $(element).attr('type'), + val = $(element).val(); + + if ( type === 'radio' || type === 'checkbox' ) { + return $('input[name="' + $(element).attr('name') + '"]:checked').val(); + } + + if ( typeof val === 'string' ) { + return val.replace(/\r/g, ""); + } + return val; + }, + + check: function( element ) { + element = this.validationTargetFor( this.clean( element ) ); + + var rules = $(element).rules(); + var dependencyMismatch = false; + var val = this.elementValue(element); + var result; + + for (var method in rules ) { + var rule = { method: method, parameters: rules[method] }; + try { + + result = $.validator.methods[method].call( this, val, element, rule.parameters ); + + // if a method indicates that the field is optional and therefore valid, + // don't mark it as valid when there are no other rules + if ( result === "dependency-mismatch" ) { + dependencyMismatch = true; + continue; + } + dependencyMismatch = false; + + if ( result === "pending" ) { + this.toHide = this.toHide.not( this.errorsFor(element) ); + return; + } + + if( !result ) { + this.formatAndAdd( element, rule ); + return false; + } + } catch(e) { + if ( this.settings.debug && window.console ) { + console.log("exception occured when checking element " + element.id + ", check the '" + rule.method + "' method", e); + } + throw e; + } + } + if (dependencyMismatch) { + return; + } + if ( this.objectLength(rules) ) { + this.successList.push(element); + } + return true; + }, + + // return the custom message for the given element and validation method + // specified in the element's "messages" metadata + customMetaMessage: function(element, method) { + if (!$.metadata) { + return; + } + var meta = this.settings.meta ? $(element).metadata()[this.settings.meta] : $(element).metadata(); + return meta && meta.messages && meta.messages[method]; + }, + + // return the custom message for the given element and validation method + // specified in the element's HTML5 data attribute + customDataMessage: function(element, method) { + return $(element).data('msg-' + method.toLowerCase()) || (element.attributes && $(element).attr('data-msg-' + method.toLowerCase())); + }, + + // return the custom message for the given element name and validation method + customMessage: function( name, method ) { + var m = this.settings.messages[name]; + return m && (m.constructor === String ? m : m[method]); + }, + + // return the first defined argument, allowing empty strings + findDefined: function() { + for(var i = 0; i < arguments.length; i++) { + if (arguments[i] !== undefined) { + return arguments[i]; + } + } + return undefined; + }, + + defaultMessage: function( element, method) { + return this.findDefined( + this.customMessage( element.name, method ), + this.customDataMessage( element, method ), + this.customMetaMessage( element, method ), + // title is never undefined, so handle empty string as undefined + !this.settings.ignoreTitle && element.title || undefined, + $.validator.messages[method], + "Warning: No message defined for " + element.name + "" + ); + }, + + formatAndAdd: function( element, rule ) { + var message = this.defaultMessage( element, rule.method ), + theregex = /\$?\{(\d+)\}/g; + if ( typeof message === "function" ) { + message = message.call(this, rule.parameters, element); + } else if (theregex.test(message)) { + message = $.validator.format(message.replace(theregex, '{$1}'), rule.parameters); + } + this.errorList.push({ + message: message, + element: element + }); + + this.errorMap[element.name] = message; + this.submitted[element.name] = message; + }, + + addWrapper: function(toToggle) { + if ( this.settings.wrapper ) { + toToggle = toToggle.add( toToggle.parent( this.settings.wrapper ) ); + } + return toToggle; + }, + + defaultShowErrors: function() { + var i, elements; + for ( i = 0; this.errorList[i]; i++ ) { + var error = this.errorList[i]; + if ( this.settings.highlight ) { + this.settings.highlight.call( this, error.element, this.settings.errorClass, this.settings.validClass ); + } + this.showLabel( error.element, error.message ); + } + if( this.errorList.length ) { + this.toShow = this.toShow.add( this.containers ); + } + if (this.settings.success) { + for ( i = 0; this.successList[i]; i++ ) { + this.showLabel( this.successList[i] ); + } + } + if (this.settings.unhighlight) { + for ( i = 0, elements = this.validElements(); elements[i]; i++ ) { + this.settings.unhighlight.call( this, elements[i], this.settings.errorClass, this.settings.validClass ); + } + } + this.toHide = this.toHide.not( this.toShow ); + this.hideErrors(); + this.addWrapper( this.toShow ).show(); + }, + + validElements: function() { + return this.currentElements.not(this.invalidElements()); + }, + + invalidElements: function() { + return $(this.errorList).map(function() { + return this.element; + }); + }, + + showLabel: function(element, message) { + var label = this.errorsFor( element ); + if ( label.length ) { + // refresh error/success class + label.removeClass( this.settings.validClass ).addClass( this.settings.errorClass ); + + // check if we have a generated label, replace the message then + if ( label.attr("generated") ) { + label.html(message); + } + } else { + // create label + label = $("<" + this.settings.errorElement + "/>") + .attr({"for": this.idOrName(element), generated: true}) + .addClass(this.settings.errorClass) + .html(message || ""); + if ( this.settings.wrapper ) { + // make sure the element is visible, even in IE + // actually showing the wrapped element is handled elsewhere + label = label.hide().show().wrap("<" + this.settings.wrapper + "/>").parent(); + } + if ( !this.labelContainer.append(label).length ) { + if ( this.settings.errorPlacement ) { + this.settings.errorPlacement(label, $(element) ); + } else { + label.insertAfter(element); + } + } + } + if ( !message && this.settings.success ) { + label.text(""); + if ( typeof this.settings.success === "string" ) { + label.addClass( this.settings.success ); + } else { + this.settings.success( label, element ); + } + } + this.toShow = this.toShow.add(label); + }, + + errorsFor: function(element) { + var name = this.idOrName(element); + return this.errors().filter(function() { + return $(this).attr('for') === name; + }); + }, + + idOrName: function(element) { + return this.groups[element.name] || (this.checkable(element) ? element.name : element.id || element.name); + }, + + validationTargetFor: function(element) { + // if radio/checkbox, validate first element in group instead + if (this.checkable(element)) { + element = this.findByName( element.name ).not(this.settings.ignore)[0]; + } + return element; + }, + + checkable: function( element ) { + return (/radio|checkbox/i).test(element.type); + }, + + findByName: function( name ) { + return $(this.currentForm).find('[name="' + name + '"]'); + }, + + getLength: function(value, element) { + switch( element.nodeName.toLowerCase() ) { + case 'select': + return $("option:selected", element).length; + case 'input': + if( this.checkable( element) ) { + return this.findByName(element.name).filter(':checked').length; + } + } + return value.length; + }, + + depend: function(param, element) { + return this.dependTypes[typeof param] ? this.dependTypes[typeof param](param, element) : true; + }, + + dependTypes: { + "boolean": function(param, element) { + return param; + }, + "string": function(param, element) { + return !!$(param, element.form).length; + }, + "function": function(param, element) { + return param(element); + } + }, + + optional: function(element) { + var val = this.elementValue(element); + return !$.validator.methods.required.call(this, val, element) && "dependency-mismatch"; + }, + + startRequest: function(element) { + if (!this.pending[element.name]) { + this.pendingRequest++; + this.pending[element.name] = true; + } + }, + + stopRequest: function(element, valid) { + this.pendingRequest--; + // sometimes synchronization fails, make sure pendingRequest is never < 0 + if (this.pendingRequest < 0) { + this.pendingRequest = 0; + } + delete this.pending[element.name]; + if ( valid && this.pendingRequest === 0 && this.formSubmitted && this.form() ) { + $(this.currentForm).submit(); + this.formSubmitted = false; + } else if (!valid && this.pendingRequest === 0 && this.formSubmitted) { + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.formSubmitted = false; + } + }, + + previousValue: function(element) { + return $.data(element, "previousValue") || $.data(element, "previousValue", { + old: null, + valid: true, + message: this.defaultMessage( element, "remote" ) + }); + } + + }, + + classRuleSettings: { + required: {required: true}, + email: {email: true}, + url: {url: true}, + date: {date: true}, + dateISO: {dateISO: true}, + number: {number: true}, + digits: {digits: true}, + creditcard: {creditcard: true} + }, + + addClassRules: function(className, rules) { + if ( className.constructor === String ) { + this.classRuleSettings[className] = rules; + } else { + $.extend(this.classRuleSettings, className); + } + }, + + classRules: function(element) { + var rules = {}; + var classes = $(element).attr('class'); + if ( classes ) { + $.each(classes.split(' '), function() { + if (this in $.validator.classRuleSettings) { + $.extend(rules, $.validator.classRuleSettings[this]); + } + }); + } + return rules; + }, + + attributeRules: function(element) { + var rules = {}; + var $element = $(element); + + for (var method in $.validator.methods) { + var value; + + // support for in both html5 and older browsers + if (method === 'required') { + value = $element.get(0).getAttribute(method); + // Some browsers return an empty string for the required attribute + // and non-HTML5 browsers might have required="" markup + if (value === "") { + value = true; + } + // force non-HTML5 browsers to return bool + value = !!value; + } else { + value = $element.attr(method); + } + + if (value) { + rules[method] = value; + } else if ($element[0].getAttribute("type") === method) { + rules[method] = true; + } + } + + // maxlength may be returned as -1, 2147483647 (IE) and 524288 (safari) for text inputs + if (rules.maxlength && /-1|2147483647|524288/.test(rules.maxlength)) { + delete rules.maxlength; + } + + return rules; + }, + + metadataRules: function(element) { + if (!$.metadata) { + return {}; + } + + var meta = $.data(element.form, 'validator').settings.meta; + return meta ? + $(element).metadata()[meta] : + $(element).metadata(); + }, + + staticRules: function(element) { + var rules = {}; + var validator = $.data(element.form, 'validator'); + if (validator.settings.rules) { + rules = $.validator.normalizeRule(validator.settings.rules[element.name]) || {}; + } + return rules; + }, + + normalizeRules: function(rules, element) { + // handle dependency check + $.each(rules, function(prop, val) { + // ignore rule when param is explicitly false, eg. required:false + if (val === false) { + delete rules[prop]; + return; + } + if (val.param || val.depends) { + var keepRule = true; + switch (typeof val.depends) { + case "string": + keepRule = !!$(val.depends, element.form).length; + break; + case "function": + keepRule = val.depends.call(element, element); + break; + } + if (keepRule) { + rules[prop] = val.param !== undefined ? val.param : true; + } else { + delete rules[prop]; + } + } + }); + + // evaluate parameters + $.each(rules, function(rule, parameter) { + rules[rule] = $.isFunction(parameter) ? parameter(element) : parameter; + }); + + // clean number parameters + $.each(['minlength', 'maxlength', 'min', 'max'], function() { + if (rules[this]) { + rules[this] = Number(rules[this]); + } + }); + $.each(['rangelength', 'range'], function() { + if (rules[this]) { + rules[this] = [Number(rules[this][0]), Number(rules[this][1])]; + } + }); + + if ($.validator.autoCreateRanges) { + // auto-create ranges + if (rules.min && rules.max) { + rules.range = [rules.min, rules.max]; + delete rules.min; + delete rules.max; + } + if (rules.minlength && rules.maxlength) { + rules.rangelength = [rules.minlength, rules.maxlength]; + delete rules.minlength; + delete rules.maxlength; + } + } + + // To support custom messages in metadata ignore rule methods titled "messages" + if (rules.messages) { + delete rules.messages; + } + + return rules; + }, + + // Converts a simple string to a {string: true} rule, e.g., "required" to {required:true} + normalizeRule: function(data) { + if( typeof data === "string" ) { + var transformed = {}; + $.each(data.split(/\s/), function() { + transformed[this] = true; + }); + data = transformed; + } + return data; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/addMethod + addMethod: function(name, method, message) { + $.validator.methods[name] = method; + $.validator.messages[name] = message !== undefined ? message : $.validator.messages[name]; + if (method.length < 3) { + $.validator.addClassRules(name, $.validator.normalizeRule(name)); + } + }, + + methods: { + + // http://docs.jquery.com/Plugins/Validation/Methods/required + required: function(value, element, param) { + // check if dependency is met + if ( !this.depend(param, element) ) { + return "dependency-mismatch"; + } + if ( element.nodeName.toLowerCase() === "select" ) { + // could be an array for select-multiple or a string, both are fine this way + var val = $(element).val(); + return val && val.length > 0; + } + if ( this.checkable(element) ) { + return this.getLength(value, element) > 0; + } + return $.trim(value).length > 0; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/remote + remote: function(value, element, param) { + if ( this.optional(element) ) { + return "dependency-mismatch"; + } + + var previous = this.previousValue(element); + if (!this.settings.messages[element.name] ) { + this.settings.messages[element.name] = {}; + } + previous.originalMessage = this.settings.messages[element.name].remote; + this.settings.messages[element.name].remote = previous.message; + + param = typeof param === "string" && {url:param} || param; + + if ( this.pending[element.name] ) { + return "pending"; + } + if ( previous.old === value ) { + return previous.valid; + } + + previous.old = value; + var validator = this; + this.startRequest(element); + var data = {}; + data[element.name] = value; + $.ajax($.extend(true, { + url: param, + mode: "abort", + port: "validate" + element.name, + dataType: "json", + data: data, + success: function(response) { + validator.settings.messages[element.name].remote = previous.originalMessage; + var valid = response === true || response === "true"; + if ( valid ) { + var submitted = validator.formSubmitted; + validator.prepareElement(element); + validator.formSubmitted = submitted; + validator.successList.push(element); + delete validator.invalid[element.name]; + validator.showErrors(); + } else { + var errors = {}; + var message = response || validator.defaultMessage( element, "remote" ); + errors[element.name] = previous.message = $.isFunction(message) ? message(value) : message; + validator.invalid[element.name] = true; + validator.showErrors(errors); + } + previous.valid = valid; + validator.stopRequest(element, valid); + } + }, param)); + return "pending"; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/minlength + minlength: function(value, element, param) { + var length = $.isArray( value ) ? value.length : this.getLength($.trim(value), element); + return this.optional(element) || length >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/maxlength + maxlength: function(value, element, param) { + var length = $.isArray( value ) ? value.length : this.getLength($.trim(value), element); + return this.optional(element) || length <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/rangelength + rangelength: function(value, element, param) { + var length = $.isArray( value ) ? value.length : this.getLength($.trim(value), element); + return this.optional(element) || ( length >= param[0] && length <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/min + min: function( value, element, param ) { + return this.optional(element) || value >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/max + max: function( value, element, param ) { + return this.optional(element) || value <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/range + range: function( value, element, param ) { + return this.optional(element) || ( value >= param[0] && value <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/email + email: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/email_address_validation/ + return this.optional(element) || /^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/url + url: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/iri/ + return this.optional(element) || /^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/date + date: function(value, element) { + return this.optional(element) || !/Invalid|NaN/.test(new Date(value)); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/dateISO + dateISO: function(value, element) { + return this.optional(element) || /^\d{4}[\/\-]\d{1,2}[\/\-]\d{1,2}$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/number + number: function(value, element) { + return this.optional(element) || /^-?(?:\d+|\d{1,3}(?:,\d{3})+)?(?:\.\d+)?$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/digits + digits: function(value, element) { + return this.optional(element) || /^\d+$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/creditcard + // based on http://en.wikipedia.org/wiki/Luhn + creditcard: function(value, element) { + if ( this.optional(element) ) { + return "dependency-mismatch"; + } + // accept only spaces, digits and dashes + if (/[^0-9 \-]+/.test(value)) { + return false; + } + var nCheck = 0, + nDigit = 0, + bEven = false; + + value = value.replace(/\D/g, ""); + + for (var n = value.length - 1; n >= 0; n--) { + var cDigit = value.charAt(n); + nDigit = parseInt(cDigit, 10); + if (bEven) { + if ((nDigit *= 2) > 9) { + nDigit -= 9; + } + } + nCheck += nDigit; + bEven = !bEven; + } + + return (nCheck % 10) === 0; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/equalTo + equalTo: function(value, element, param) { + // bind to the blur event of the target in order to revalidate whenever the target field is updated + // TODO find a way to bind the event just once, avoiding the unbind-rebind overhead + var target = $(param); + if (this.settings.onfocusout) { + target.unbind(".validate-equalTo").bind("blur.validate-equalTo", function() { + $(element).valid(); + }); + } + return value === target.val(); + } + + } + +}); + +// deprecated, use $.validator.format instead +$.format = $.validator.format; + +}(jQuery)); + +// ajax mode: abort +// usage: $.ajax({ mode: "abort"[, port: "uniqueport"]}); +// if mode:"abort" is used, the previous request on that port (port can be undefined) is aborted via XMLHttpRequest.abort() +(function($) { + var pendingRequests = {}; + // Use a prefilter if available (1.5+) + if ( $.ajaxPrefilter ) { + $.ajaxPrefilter(function(settings, _, xhr) { + var port = settings.port; + if (settings.mode === "abort") { + if ( pendingRequests[port] ) { + pendingRequests[port].abort(); + } + pendingRequests[port] = xhr; + } + }); + } else { + // Proxy ajax + var ajax = $.ajax; + $.ajax = function(settings) { + var mode = ( "mode" in settings ? settings : $.ajaxSettings ).mode, + port = ( "port" in settings ? settings : $.ajaxSettings ).port; + if (mode === "abort") { + if ( pendingRequests[port] ) { + pendingRequests[port].abort(); + } + return (pendingRequests[port] = ajax.apply(this, arguments)); + } + return ajax.apply(this, arguments); + }; + } +}(jQuery)); + +// provides cross-browser focusin and focusout events +// IE has native support, in other browsers, use event caputuring (neither bubbles) + +// provides delegate(type: String, delegate: Selector, handler: Callback) plugin for easier event delegation +// handler is only called when $(event.target).is(delegate), in the scope of the jquery-object for event.target +(function($) { + // only implement if not provided by jQuery core (since 1.4) + // TODO verify if jQuery 1.4's implementation is compatible with older jQuery special-event APIs + if (!jQuery.event.special.focusin && !jQuery.event.special.focusout && document.addEventListener) { + $.each({ + focus: 'focusin', + blur: 'focusout' + }, function( original, fix ){ + $.event.special[fix] = { + setup:function() { + this.addEventListener( original, handler, true ); + }, + teardown:function() { + this.removeEventListener( original, handler, true ); + }, + handler: function(e) { + var args = arguments; + args[0] = $.event.fix(e); + args[0].type = fix; + return $.event.handle.apply(this, args); + } + }; + function handler(e) { + e = $.event.fix(e); + e.type = fix; + return $.event.handle.call(this, e); + } + }); + } + $.extend($.fn, { + validateDelegate: function(delegate, type, handler) { + return this.bind(type, function(event) { + var target = $(event.target); + if (target.is(delegate)) { + return handler.apply(target, arguments); + } + }); + } + }); +}(jQuery)); diff --git a/Scripts/jquery.validate.min.js b/Scripts/jquery.validate.min.js new file mode 100644 index 0000000..23474bd --- /dev/null +++ b/Scripts/jquery.validate.min.js @@ -0,0 +1,4 @@ +/*! jQuery Validation Plugin - v1.10.0 - 9/7/2012 +* https://github.com/jzaefferer/jquery-validation +* Copyright (c) 2012 Jörn Zaefferer; Licensed MIT */ +(function(a){a.extend(a.fn,{validate:function(b){if(!this.length){b&&b.debug&&window.console&&console.warn("nothing selected, can't validate, returning nothing");return}var c=a.data(this[0],"validator");return c?c:(this.attr("novalidate","novalidate"),c=new a.validator(b,this[0]),a.data(this[0],"validator",c),c.settings.onsubmit&&(this.validateDelegate(":submit","click",function(b){c.settings.submitHandler&&(c.submitButton=b.target),a(b.target).hasClass("cancel")&&(c.cancelSubmit=!0)}),this.submit(function(b){function d(){var d;return c.settings.submitHandler?(c.submitButton&&(d=a("").attr("name",c.submitButton.name).val(c.submitButton.value).appendTo(c.currentForm)),c.settings.submitHandler.call(c,c.currentForm,b),c.submitButton&&d.remove(),!1):!0}return c.settings.debug&&b.preventDefault(),c.cancelSubmit?(c.cancelSubmit=!1,d()):c.form()?c.pendingRequest?(c.formSubmitted=!0,!1):d():(c.focusInvalid(),!1)})),c)},valid:function(){if(a(this[0]).is("form"))return this.validate().form();var b=!0,c=a(this[0].form).validate();return this.each(function(){b&=c.element(this)}),b},removeAttrs:function(b){var c={},d=this;return a.each(b.split(/\s/),function(a,b){c[b]=d.attr(b),d.removeAttr(b)}),c},rules:function(b,c){var d=this[0];if(b){var e=a.data(d.form,"validator").settings,f=e.rules,g=a.validator.staticRules(d);switch(b){case"add":a.extend(g,a.validator.normalizeRule(c)),f[d.name]=g,c.messages&&(e.messages[d.name]=a.extend(e.messages[d.name],c.messages));break;case"remove":if(!c)return delete f[d.name],g;var h={};return a.each(c.split(/\s/),function(a,b){h[b]=g[b],delete g[b]}),h}}var i=a.validator.normalizeRules(a.extend({},a.validator.metadataRules(d),a.validator.classRules(d),a.validator.attributeRules(d),a.validator.staticRules(d)),d);if(i.required){var j=i.required;delete i.required,i=a.extend({required:j},i)}return i}}),a.extend(a.expr[":"],{blank:function(b){return!a.trim(""+b.value)},filled:function(b){return!!a.trim(""+b.value)},unchecked:function(a){return!a.checked}}),a.validator=function(b,c){this.settings=a.extend(!0,{},a.validator.defaults,b),this.currentForm=c,this.init()},a.validator.format=function(b,c){return arguments.length===1?function(){var c=a.makeArray(arguments);return c.unshift(b),a.validator.format.apply(this,c)}:(arguments.length>2&&c.constructor!==Array&&(c=a.makeArray(arguments).slice(1)),c.constructor!==Array&&(c=[c]),a.each(c,function(a,c){b=b.replace(new RegExp("\\{"+a+"\\}","g"),c)}),b)},a.extend(a.validator,{defaults:{messages:{},groups:{},rules:{},errorClass:"error",validClass:"valid",errorElement:"label",focusInvalid:!0,errorContainer:a([]),errorLabelContainer:a([]),onsubmit:!0,ignore:":hidden",ignoreTitle:!1,onfocusin:function(a,b){this.lastActive=a,this.settings.focusCleanup&&!this.blockFocusCleanup&&(this.settings.unhighlight&&this.settings.unhighlight.call(this,a,this.settings.errorClass,this.settings.validClass),this.addWrapper(this.errorsFor(a)).hide())},onfocusout:function(a,b){!this.checkable(a)&&(a.name in this.submitted||!this.optional(a))&&this.element(a)},onkeyup:function(a,b){if(b.which===9&&this.elementValue(a)==="")return;(a.name in this.submitted||a===this.lastActive)&&this.element(a)},onclick:function(a,b){a.name in this.submitted?this.element(a):a.parentNode.name in this.submitted&&this.element(a.parentNode)},highlight:function(b,c,d){b.type==="radio"?this.findByName(b.name).addClass(c).removeClass(d):a(b).addClass(c).removeClass(d)},unhighlight:function(b,c,d){b.type==="radio"?this.findByName(b.name).removeClass(c).addClass(d):a(b).removeClass(c).addClass(d)}},setDefaults:function(b){a.extend(a.validator.defaults,b)},messages:{required:"This field is required.",remote:"Please fix this field.",email:"Please enter a valid email address.",url:"Please enter a valid URL.",date:"Please enter a valid date.",dateISO:"Please enter a valid date (ISO).",number:"Please enter a valid number.",digits:"Please enter only digits.",creditcard:"Please enter a valid credit card number.",equalTo:"Please enter the same value again.",maxlength:a.validator.format("Please enter no more than {0} characters."),minlength:a.validator.format("Please enter at least {0} characters."),rangelength:a.validator.format("Please enter a value between {0} and {1} characters long."),range:a.validator.format("Please enter a value between {0} and {1}."),max:a.validator.format("Please enter a value less than or equal to {0}."),min:a.validator.format("Please enter a value greater than or equal to {0}.")},autoCreateRanges:!1,prototype:{init:function(){function d(b){var c=a.data(this[0].form,"validator"),d="on"+b.type.replace(/^validate/,"");c.settings[d]&&c.settings[d].call(c,this[0],b)}this.labelContainer=a(this.settings.errorLabelContainer),this.errorContext=this.labelContainer.length&&this.labelContainer||a(this.currentForm),this.containers=a(this.settings.errorContainer).add(this.settings.errorLabelContainer),this.submitted={},this.valueCache={},this.pendingRequest=0,this.pending={},this.invalid={},this.reset();var b=this.groups={};a.each(this.settings.groups,function(c,d){a.each(d.split(/\s/),function(a,d){b[d]=c})});var c=this.settings.rules;a.each(c,function(b,d){c[b]=a.validator.normalizeRule(d)}),a(this.currentForm).validateDelegate(":text, [type='password'], [type='file'], select, textarea, [type='number'], [type='search'] ,[type='tel'], [type='url'], [type='email'], [type='datetime'], [type='date'], [type='month'], [type='week'], [type='time'], [type='datetime-local'], [type='range'], [type='color'] ","focusin focusout keyup",d).validateDelegate("[type='radio'], [type='checkbox'], select, option","click",d),this.settings.invalidHandler&&a(this.currentForm).bind("invalid-form.validate",this.settings.invalidHandler)},form:function(){return this.checkForm(),a.extend(this.submitted,this.errorMap),this.invalid=a.extend({},this.errorMap),this.valid()||a(this.currentForm).triggerHandler("invalid-form",[this]),this.showErrors(),this.valid()},checkForm:function(){this.prepareForm();for(var a=0,b=this.currentElements=this.elements();b[a];a++)this.check(b[a]);return this.valid()},element:function(b){b=this.validationTargetFor(this.clean(b)),this.lastElement=b,this.prepareElement(b),this.currentElements=a(b);var c=this.check(b)!==!1;return c?delete this.invalid[b.name]:this.invalid[b.name]=!0,this.numberOfInvalids()||(this.toHide=this.toHide.add(this.containers)),this.showErrors(),c},showErrors:function(b){if(b){a.extend(this.errorMap,b),this.errorList=[];for(var c in b)this.errorList.push({message:b[c],element:this.findByName(c)[0]});this.successList=a.grep(this.successList,function(a){return!(a.name in b)})}this.settings.showErrors?this.settings.showErrors.call(this,this.errorMap,this.errorList):this.defaultShowErrors()},resetForm:function(){a.fn.resetForm&&a(this.currentForm).resetForm(),this.submitted={},this.lastElement=null,this.prepareForm(),this.hideErrors(),this.elements().removeClass(this.settings.errorClass).removeData("previousValue")},numberOfInvalids:function(){return this.objectLength(this.invalid)},objectLength:function(a){var b=0;for(var c in a)b++;return b},hideErrors:function(){this.addWrapper(this.toHide).hide()},valid:function(){return this.size()===0},size:function(){return this.errorList.length},focusInvalid:function(){if(this.settings.focusInvalid)try{a(this.findLastActive()||this.errorList.length&&this.errorList[0].element||[]).filter(":visible").focus().trigger("focusin")}catch(b){}},findLastActive:function(){var b=this.lastActive;return b&&a.grep(this.errorList,function(a){return a.element.name===b.name}).length===1&&b},elements:function(){var b=this,c={};return a(this.currentForm).find("input, select, textarea").not(":submit, :reset, :image, [disabled]").not(this.settings.ignore).filter(function(){return!this.name&&b.settings.debug&&window.console&&console.error("%o has no name assigned",this),this.name in c||!b.objectLength(a(this).rules())?!1:(c[this.name]=!0,!0)})},clean:function(b){return a(b)[0]},errors:function(){var b=this.settings.errorClass.replace(" ",".");return a(this.settings.errorElement+"."+b,this.errorContext)},reset:function(){this.successList=[],this.errorList=[],this.errorMap={},this.toShow=a([]),this.toHide=a([]),this.currentElements=a([])},prepareForm:function(){this.reset(),this.toHide=this.errors().add(this.containers)},prepareElement:function(a){this.reset(),this.toHide=this.errorsFor(a)},elementValue:function(b){var c=a(b).attr("type"),d=a(b).val();return c==="radio"||c==="checkbox"?a('input[name="'+a(b).attr("name")+'"]:checked').val():typeof d=="string"?d.replace(/\r/g,""):d},check:function(b){b=this.validationTargetFor(this.clean(b));var c=a(b).rules(),d=!1,e=this.elementValue(b),f;for(var g in c){var h={method:g,parameters:c[g]};try{f=a.validator.methods[g].call(this,e,b,h.parameters);if(f==="dependency-mismatch"){d=!0;continue}d=!1;if(f==="pending"){this.toHide=this.toHide.not(this.errorsFor(b));return}if(!f)return this.formatAndAdd(b,h),!1}catch(i){throw this.settings.debug&&window.console&&console.log("exception occured when checking element "+b.id+", check the '"+h.method+"' method",i),i}}if(d)return;return this.objectLength(c)&&this.successList.push(b),!0},customMetaMessage:function(b,c){if(!a.metadata)return;var d=this.settings.meta?a(b).metadata()[this.settings.meta]:a(b).metadata();return d&&d.messages&&d.messages[c]},customDataMessage:function(b,c){return a(b).data("msg-"+c.toLowerCase())||b.attributes&&a(b).attr("data-msg-"+c.toLowerCase())},customMessage:function(a,b){var c=this.settings.messages[a];return c&&(c.constructor===String?c:c[b])},findDefined:function(){for(var a=0;aWarning: No message defined for "+b.name+"")},formatAndAdd:function(b,c){var d=this.defaultMessage(b,c.method),e=/\$?\{(\d+)\}/g;typeof d=="function"?d=d.call(this,c.parameters,b):e.test(d)&&(d=a.validator.format(d.replace(e,"{$1}"),c.parameters)),this.errorList.push({message:d,element:b}),this.errorMap[b.name]=d,this.submitted[b.name]=d},addWrapper:function(a){return this.settings.wrapper&&(a=a.add(a.parent(this.settings.wrapper))),a},defaultShowErrors:function(){var a,b;for(a=0;this.errorList[a];a++){var c=this.errorList[a];this.settings.highlight&&this.settings.highlight.call(this,c.element,this.settings.errorClass,this.settings.validClass),this.showLabel(c.element,c.message)}this.errorList.length&&(this.toShow=this.toShow.add(this.containers));if(this.settings.success)for(a=0;this.successList[a];a++)this.showLabel(this.successList[a]);if(this.settings.unhighlight)for(a=0,b=this.validElements();b[a];a++)this.settings.unhighlight.call(this,b[a],this.settings.errorClass,this.settings.validClass);this.toHide=this.toHide.not(this.toShow),this.hideErrors(),this.addWrapper(this.toShow).show()},validElements:function(){return this.currentElements.not(this.invalidElements())},invalidElements:function(){return a(this.errorList).map(function(){return this.element})},showLabel:function(b,c){var d=this.errorsFor(b);d.length?(d.removeClass(this.settings.validClass).addClass(this.settings.errorClass),d.attr("generated")&&d.html(c)):(d=a("<"+this.settings.errorElement+"/>").attr({"for":this.idOrName(b),generated:!0}).addClass(this.settings.errorClass).html(c||""),this.settings.wrapper&&(d=d.hide().show().wrap("<"+this.settings.wrapper+"/>").parent()),this.labelContainer.append(d).length||(this.settings.errorPlacement?this.settings.errorPlacement(d,a(b)):d.insertAfter(b))),!c&&this.settings.success&&(d.text(""),typeof this.settings.success=="string"?d.addClass(this.settings.success):this.settings.success(d,b)),this.toShow=this.toShow.add(d)},errorsFor:function(b){var c=this.idOrName(b);return this.errors().filter(function(){return a(this).attr("for")===c})},idOrName:function(a){return this.groups[a.name]||(this.checkable(a)?a.name:a.id||a.name)},validationTargetFor:function(a){return this.checkable(a)&&(a=this.findByName(a.name).not(this.settings.ignore)[0]),a},checkable:function(a){return/radio|checkbox/i.test(a.type)},findByName:function(b){return a(this.currentForm).find('[name="'+b+'"]')},getLength:function(b,c){switch(c.nodeName.toLowerCase()){case"select":return a("option:selected",c).length;case"input":if(this.checkable(c))return this.findByName(c.name).filter(":checked").length}return b.length},depend:function(a,b){return this.dependTypes[typeof a]?this.dependTypes[typeof a](a,b):!0},dependTypes:{"boolean":function(a,b){return a},string:function(b,c){return!!a(b,c.form).length},"function":function(a,b){return a(b)}},optional:function(b){var c=this.elementValue(b);return!a.validator.methods.required.call(this,c,b)&&"dependency-mismatch"},startRequest:function(a){this.pending[a.name]||(this.pendingRequest++,this.pending[a.name]=!0)},stopRequest:function(b,c){this.pendingRequest--,this.pendingRequest<0&&(this.pendingRequest=0),delete this.pending[b.name],c&&this.pendingRequest===0&&this.formSubmitted&&this.form()?(a(this.currentForm).submit(),this.formSubmitted=!1):!c&&this.pendingRequest===0&&this.formSubmitted&&(a(this.currentForm).triggerHandler("invalid-form",[this]),this.formSubmitted=!1)},previousValue:function(b){return a.data(b,"previousValue")||a.data(b,"previousValue",{old:null,valid:!0,message:this.defaultMessage(b,"remote")})}},classRuleSettings:{required:{required:!0},email:{email:!0},url:{url:!0},date:{date:!0},dateISO:{dateISO:!0},number:{number:!0},digits:{digits:!0},creditcard:{creditcard:!0}},addClassRules:function(b,c){b.constructor===String?this.classRuleSettings[b]=c:a.extend(this.classRuleSettings,b)},classRules:function(b){var c={},d=a(b).attr("class");return d&&a.each(d.split(" "),function(){this in a.validator.classRuleSettings&&a.extend(c,a.validator.classRuleSettings[this])}),c},attributeRules:function(b){var c={},d=a(b);for(var e in a.validator.methods){var f;e==="required"?(f=d.get(0).getAttribute(e),f===""&&(f=!0),f=!!f):f=d.attr(e),f?c[e]=f:d[0].getAttribute("type")===e&&(c[e]=!0)}return c.maxlength&&/-1|2147483647|524288/.test(c.maxlength)&&delete c.maxlength,c},metadataRules:function(b){if(!a.metadata)return{};var c=a.data(b.form,"validator").settings.meta;return c?a(b).metadata()[c]:a(b).metadata()},staticRules:function(b){var c={},d=a.data(b.form,"validator");return d.settings.rules&&(c=a.validator.normalizeRule(d.settings.rules[b.name])||{}),c},normalizeRules:function(b,c){return a.each(b,function(d,e){if(e===!1){delete b[d];return}if(e.param||e.depends){var f=!0;switch(typeof e.depends){case"string":f=!!a(e.depends,c.form).length;break;case"function":f=e.depends.call(c,c)}f?b[d]=e.param!==undefined?e.param:!0:delete b[d]}}),a.each(b,function(d,e){b[d]=a.isFunction(e)?e(c):e}),a.each(["minlength","maxlength","min","max"],function(){b[this]&&(b[this]=Number(b[this]))}),a.each(["rangelength","range"],function(){b[this]&&(b[this]=[Number(b[this][0]),Number(b[this][1])])}),a.validator.autoCreateRanges&&(b.min&&b.max&&(b.range=[b.min,b.max],delete b.min,delete b.max),b.minlength&&b.maxlength&&(b.rangelength=[b.minlength,b.maxlength],delete b.minlength,delete b.maxlength)),b.messages&&delete b.messages,b},normalizeRule:function(b){if(typeof b=="string"){var c={};a.each(b.split(/\s/),function(){c[this]=!0}),b=c}return b},addMethod:function(b,c,d){a.validator.methods[b]=c,a.validator.messages[b]=d!==undefined?d:a.validator.messages[b],c.length<3&&a.validator.addClassRules(b,a.validator.normalizeRule(b))},methods:{required:function(b,c,d){if(!this.depend(d,c))return"dependency-mismatch";if(c.nodeName.toLowerCase()==="select"){var e=a(c).val();return e&&e.length>0}return this.checkable(c)?this.getLength(b,c)>0:a.trim(b).length>0},remote:function(b,c,d){if(this.optional(c))return"dependency-mismatch";var e=this.previousValue(c);this.settings.messages[c.name]||(this.settings.messages[c.name]={}),e.originalMessage=this.settings.messages[c.name].remote,this.settings.messages[c.name].remote=e.message,d=typeof d=="string"&&{url:d}||d;if(this.pending[c.name])return"pending";if(e.old===b)return e.valid;e.old=b;var f=this;this.startRequest(c);var g={};return g[c.name]=b,a.ajax(a.extend(!0,{url:d,mode:"abort",port:"validate"+c.name,dataType:"json",data:g,success:function(d){f.settings.messages[c.name].remote=e.originalMessage;var g=d===!0||d==="true";if(g){var h=f.formSubmitted;f.prepareElement(c),f.formSubmitted=h,f.successList.push(c),delete f.invalid[c.name],f.showErrors()}else{var i={},j=d||f.defaultMessage(c,"remote");i[c.name]=e.message=a.isFunction(j)?j(b):j,f.invalid[c.name]=!0,f.showErrors(i)}e.valid=g,f.stopRequest(c,g)}},d)),"pending"},minlength:function(b,c,d){var e=a.isArray(b)?b.length:this.getLength(a.trim(b),c);return this.optional(c)||e>=d},maxlength:function(b,c,d){var e=a.isArray(b)?b.length:this.getLength(a.trim(b),c);return this.optional(c)||e<=d},rangelength:function(b,c,d){var e=a.isArray(b)?b.length:this.getLength(a.trim(b),c);return this.optional(c)||e>=d[0]&&e<=d[1]},min:function(a,b,c){return this.optional(b)||a>=c},max:function(a,b,c){return this.optional(b)||a<=c},range:function(a,b,c){return this.optional(b)||a>=c[0]&&a<=c[1]},email:function(a,b){return this.optional(b)||/^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))$/i.test(a)},url:function(a,b){return this.optional(b)||/^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(a)},date:function(a,b){return this.optional(b)||!/Invalid|NaN/.test(new Date(a))},dateISO:function(a,b){return this.optional(b)||/^\d{4}[\/\-]\d{1,2}[\/\-]\d{1,2}$/.test(a)},number:function(a,b){return this.optional(b)||/^-?(?:\d+|\d{1,3}(?:,\d{3})+)?(?:\.\d+)?$/.test(a)},digits:function(a,b){return this.optional(b)||/^\d+$/.test(a)},creditcard:function(a,b){if(this.optional(b))return"dependency-mismatch";if(/[^0-9 \-]+/.test(a))return!1;var c=0,d=0,e=!1;a=a.replace(/\D/g,"");for(var f=a.length-1;f>=0;f--){var g=a.charAt(f);d=parseInt(g,10),e&&(d*=2)>9&&(d-=9),c+=d,e=!e}return c%10===0},equalTo:function(b,c,d){var e=a(d);return this.settings.onfocusout&&e.unbind(".validate-equalTo").bind("blur.validate-equalTo",function(){a(c).valid()}),b===e.val()}}}),a.format=a.validator.format})(jQuery),function(a){var b={};if(a.ajaxPrefilter)a.ajaxPrefilter(function(a,c,d){var e=a.port;a.mode==="abort"&&(b[e]&&b[e].abort(),b[e]=d)});else{var c=a.ajax;a.ajax=function(d){var e=("mode"in d?d:a.ajaxSettings).mode,f=("port"in d?d:a.ajaxSettings).port;return e==="abort"?(b[f]&&b[f].abort(),b[f]=c.apply(this,arguments)):c.apply(this,arguments)}}}(jQuery),function(a){!jQuery.event.special.focusin&&!jQuery.event.special.focusout&&document.addEventListener&&a.each({focus:"focusin",blur:"focusout"},function(b,c){function d(b){return b=a.event.fix(b),b.type=c,a.event.handle.call(this,b)}a.event.special[c]={setup:function(){this.addEventListener(b,d,!0)},teardown:function(){this.removeEventListener(b,d,!0)},handler:function(b){var d=arguments;return d[0]=a.event.fix(b),d[0].type=c,a.event.handle.apply(this,d)}}}),a.extend(a.fn,{validateDelegate:function(b,c,d){return this.bind(c,function(c){var e=a(c.target);if(e.is(b))return d.apply(e,arguments)})}})}(jQuery) \ No newline at end of file diff --git a/Scripts/jquery.validate.unobtrusive.js b/Scripts/jquery.validate.unobtrusive.js new file mode 100644 index 0000000..689657b --- /dev/null +++ b/Scripts/jquery.validate.unobtrusive.js @@ -0,0 +1,367 @@ +/*! +** Unobtrusive validation support library for jQuery and jQuery Validate +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ + +/*jslint white: true, browser: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: true, newcap: true, immed: true, strict: false */ +/*global document: false, jQuery: false */ + +(function ($) { + var $jQval = $.validator, + adapters, + data_validation = "unobtrusiveValidation"; + + function setValidationValues(options, ruleName, value) { + options.rules[ruleName] = value; + if (options.message) { + options.messages[ruleName] = options.message; + } + } + + function splitAndTrim(value) { + return value.replace(/^\s+|\s+$/g, "").split(/\s*,\s*/g); + } + + function escapeAttributeValue(value) { + // As mentioned on http://api.jquery.com/category/selectors/ + return value.replace(/([!"#$%&'()*+,./:;<=>?@\[\\\]^`{|}~])/g, "\\$1"); + } + + function getModelPrefix(fieldName) { + return fieldName.substr(0, fieldName.lastIndexOf(".") + 1); + } + + function appendModelPrefix(value, prefix) { + if (value.indexOf("*.") === 0) { + value = value.replace("*.", prefix); + } + return value; + } + + function onError(error, inputElement) { // 'this' is the form element + var container = $(this).find("[data-valmsg-for='" + escapeAttributeValue(inputElement[0].name) + "']"), + replaceAttrValue = container.attr("data-valmsg-replace"), + replace = replaceAttrValue ? $.parseJSON(replaceAttrValue) !== false : null; + + container.removeClass("field-validation-valid").addClass("field-validation-error"); + error.data("unobtrusiveContainer", container); + + if (replace) { + container.empty(); + error.removeClass("input-validation-error").appendTo(container); + } + else { + error.hide(); + } + } + + function onErrors(event, validator) { // 'this' is the form element + var container = $(this).find("[data-valmsg-summary=true]"), + list = container.find("ul"); + + if (list && list.length && validator.errorList.length) { + list.empty(); + container.addClass("validation-summary-errors").removeClass("validation-summary-valid"); + + $.each(validator.errorList, function () { + $("
    • ").html(this.message).appendTo(list); + }); + } + } + + function onSuccess(error) { // 'this' is the form element + var container = error.data("unobtrusiveContainer"), + replaceAttrValue = container.attr("data-valmsg-replace"), + replace = replaceAttrValue ? $.parseJSON(replaceAttrValue) : null; + + if (container) { + container.addClass("field-validation-valid").removeClass("field-validation-error"); + error.removeData("unobtrusiveContainer"); + + if (replace) { + container.empty(); + } + } + } + + function onReset(event) { // 'this' is the form element + var $form = $(this); + $form.data("validator").resetForm(); + $form.find(".validation-summary-errors") + .addClass("validation-summary-valid") + .removeClass("validation-summary-errors"); + $form.find(".field-validation-error") + .addClass("field-validation-valid") + .removeClass("field-validation-error") + .removeData("unobtrusiveContainer") + .find(">*") // If we were using valmsg-replace, get the underlying error + .removeData("unobtrusiveContainer"); + } + + function validationInfo(form) { + var $form = $(form), + result = $form.data(data_validation), + onResetProxy = $.proxy(onReset, form); + + if (!result) { + result = { + options: { // options structure passed to jQuery Validate's validate() method + errorClass: "input-validation-error", + errorElement: "span", + errorPlacement: $.proxy(onError, form), + invalidHandler: $.proxy(onErrors, form), + messages: {}, + rules: {}, + success: $.proxy(onSuccess, form) + }, + attachValidation: function () { + $form + .unbind("reset." + data_validation, onResetProxy) + .bind("reset." + data_validation, onResetProxy) + .validate(this.options); + }, + validate: function () { // a validation function that is called by unobtrusive Ajax + $form.validate(); + return $form.valid(); + } + }; + $form.data(data_validation, result); + } + + return result; + } + + $jQval.unobtrusive = { + adapters: [], + + parseElement: function (element, skipAttach) { + /// + /// Parses a single HTML element for unobtrusive validation attributes. + /// + /// The HTML element to be parsed. + /// [Optional] true to skip attaching the + /// validation to the form. If parsing just this single element, you should specify true. + /// If parsing several elements, you should specify false, and manually attach the validation + /// to the form when you are finished. The default is false. + var $element = $(element), + form = $element.parents("form")[0], + valInfo, rules, messages; + + if (!form) { // Cannot do client-side validation without a form + return; + } + + valInfo = validationInfo(form); + valInfo.options.rules[element.name] = rules = {}; + valInfo.options.messages[element.name] = messages = {}; + + $.each(this.adapters, function () { + var prefix = "data-val-" + this.name, + message = $element.attr(prefix), + paramValues = {}; + + if (message !== undefined) { // Compare against undefined, because an empty message is legal (and falsy) + prefix += "-"; + + $.each(this.params, function () { + paramValues[this] = $element.attr(prefix + this); + }); + + this.adapt({ + element: element, + form: form, + message: message, + params: paramValues, + rules: rules, + messages: messages + }); + } + }); + + $.extend(rules, { "__dummy__": true }); + + if (!skipAttach) { + valInfo.attachValidation(); + } + }, + + parse: function (selector) { + /// + /// Parses all the HTML elements in the specified selector. It looks for input elements decorated + /// with the [data-val=true] attribute value and enables validation according to the data-val-* + /// attribute values. + /// + /// Any valid jQuery selector. + var $forms = $(selector) + .parents("form") + .andSelf() + .add($(selector).find("form")) + .filter("form"); + + $(selector).find(":input[data-val=true]").each(function () { + $jQval.unobtrusive.parseElement(this, true); + }); + + $forms.each(function () { + var info = validationInfo(this); + if (info) { + info.attachValidation(); + } + }); + } + }; + + adapters = $jQval.unobtrusive.adapters; + + adapters.add = function (adapterName, params, fn) { + /// Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation. + /// The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name). + /// [Optional] An array of parameter names (strings) that will + /// be extracted from the data-val-nnnn-mmmm HTML attributes (where nnnn is the adapter name, and + /// mmmm is the parameter name). + /// The function to call, which adapts the values from the HTML + /// attributes into jQuery Validate rules and/or messages. + /// + if (!fn) { // Called with no params, just a function + fn = params; + params = []; + } + this.push({ name: adapterName, params: params, adapt: fn }); + return this; + }; + + adapters.addBool = function (adapterName, ruleName) { + /// Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation rule has no parameter values. + /// The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name). + /// [Optional] The name of the jQuery Validate rule. If not provided, the value + /// of adapterName will be used instead. + /// + return this.add(adapterName, function (options) { + setValidationValues(options, ruleName || adapterName, true); + }); + }; + + adapters.addMinMax = function (adapterName, minRuleName, maxRuleName, minMaxRuleName, minAttribute, maxAttribute) { + /// Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation has three potential rules (one for min-only, one for max-only, and + /// one for min-and-max). The HTML parameters are expected to be named -min and -max. + /// The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name). + /// The name of the jQuery Validate rule to be used when you only + /// have a minimum value. + /// The name of the jQuery Validate rule to be used when you only + /// have a maximum value. + /// The name of the jQuery Validate rule to be used when you + /// have both a minimum and maximum value. + /// [Optional] The name of the HTML attribute that + /// contains the minimum value. The default is "min". + /// [Optional] The name of the HTML attribute that + /// contains the maximum value. The default is "max". + /// + return this.add(adapterName, [minAttribute || "min", maxAttribute || "max"], function (options) { + var min = options.params.min, + max = options.params.max; + + if (min && max) { + setValidationValues(options, minMaxRuleName, [min, max]); + } + else if (min) { + setValidationValues(options, minRuleName, min); + } + else if (max) { + setValidationValues(options, maxRuleName, max); + } + }); + }; + + adapters.addSingleVal = function (adapterName, attribute, ruleName) { + /// Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation rule has a single value. + /// The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute(where nnnn is the adapter name). + /// [Optional] The name of the HTML attribute that contains the value. + /// The default is "val". + /// [Optional] The name of the jQuery Validate rule. If not provided, the value + /// of adapterName will be used instead. + /// + return this.add(adapterName, [attribute || "val"], function (options) { + setValidationValues(options, ruleName || adapterName, options.params[attribute]); + }); + }; + + $jQval.addMethod("__dummy__", function (value, element, params) { + return true; + }); + + $jQval.addMethod("regex", function (value, element, params) { + var match; + if (this.optional(element)) { + return true; + } + + match = new RegExp(params).exec(value); + return (match && (match.index === 0) && (match[0].length === value.length)); + }); + + $jQval.addMethod("nonalphamin", function (value, element, nonalphamin) { + var match; + if (nonalphamin) { + match = value.match(/\W/g); + match = match && match.length >= nonalphamin; + } + return match; + }); + + adapters.addSingleVal("accept", "exts").addSingleVal("regex", "pattern"); + adapters.addBool("creditcard").addBool("date").addBool("digits").addBool("email").addBool("number").addBool("url"); + adapters.addMinMax("length", "minlength", "maxlength", "rangelength").addMinMax("range", "min", "max", "range"); + adapters.add("equalto", ["other"], function (options) { + var prefix = getModelPrefix(options.element.name), + other = options.params.other, + fullOtherName = appendModelPrefix(other, prefix), + element = $(options.form).find(":input[name='" + escapeAttributeValue(fullOtherName) + "']")[0]; + + setValidationValues(options, "equalTo", element); + }); + adapters.add("required", function (options) { + // jQuery Validate equates "required" with "mandatory" for checkbox elements + if (options.element.tagName.toUpperCase() !== "INPUT" || options.element.type.toUpperCase() !== "CHECKBOX") { + setValidationValues(options, "required", true); + } + }); + adapters.add("remote", ["url", "type", "additionalfields"], function (options) { + var value = { + url: options.params.url, + type: options.params.type || "GET", + data: {} + }, + prefix = getModelPrefix(options.element.name); + + $.each(splitAndTrim(options.params.additionalfields || options.element.name), function (i, fieldName) { + var paramName = appendModelPrefix(fieldName, prefix); + value.data[paramName] = function () { + return $(options.form).find(":input[name='" + escapeAttributeValue(paramName) + "']").val(); + }; + }); + + setValidationValues(options, "remote", value); + }); + adapters.add("password", ["min", "nonalphamin", "regex"], function (options) { + if (options.params.min) { + setValidationValues(options, "minlength", options.params.min); + } + if (options.params.nonalphamin) { + setValidationValues(options, "nonalphamin", options.params.nonalphamin); + } + if (options.params.regex) { + setValidationValues(options, "regex", options.params.regex); + } + }); + + $(function () { + $jQval.unobtrusive.parse(document); + }); +} (jQuery)); \ No newline at end of file diff --git a/Scripts/jquery.validate.unobtrusive.min.js b/Scripts/jquery.validate.unobtrusive.min.js new file mode 100644 index 0000000..c458f74 --- /dev/null +++ b/Scripts/jquery.validate.unobtrusive.min.js @@ -0,0 +1,5 @@ +/* +** Unobtrusive validation support library for jQuery and jQuery Validate +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ +(function(a){var d=a.validator,b,e="unobtrusiveValidation";function c(a,b,c){a.rules[b]=c;if(a.message)a.messages[b]=a.message}function j(a){return a.replace(/^\s+|\s+$/g,"").split(/\s*,\s*/g)}function f(a){return a.replace(/([!"#$%&'()*+,./:;<=>?@\[\\\]^`{|}~])/g,"\\$1")}function h(a){return a.substr(0,a.lastIndexOf(".")+1)}function g(a,b){if(a.indexOf("*.")===0)a=a.replace("*.",b);return a}function m(c,e){var b=a(this).find("[data-valmsg-for='"+f(e[0].name)+"']"),d=b.attr("data-valmsg-replace"),g=d?a.parseJSON(d)!==false:null;b.removeClass("field-validation-valid").addClass("field-validation-error");c.data("unobtrusiveContainer",b);if(g){b.empty();c.removeClass("input-validation-error").appendTo(b)}else c.hide()}function l(e,d){var c=a(this).find("[data-valmsg-summary=true]"),b=c.find("ul");if(b&&b.length&&d.errorList.length){b.empty();c.addClass("validation-summary-errors").removeClass("validation-summary-valid");a.each(d.errorList,function(){a("
    • ").html(this.message).appendTo(b)})}}function k(d){var b=d.data("unobtrusiveContainer"),c=b.attr("data-valmsg-replace"),e=c?a.parseJSON(c):null;if(b){b.addClass("field-validation-valid").removeClass("field-validation-error");d.removeData("unobtrusiveContainer");e&&b.empty()}}function n(){var b=a(this);b.data("validator").resetForm();b.find(".validation-summary-errors").addClass("validation-summary-valid").removeClass("validation-summary-errors");b.find(".field-validation-error").addClass("field-validation-valid").removeClass("field-validation-error").removeData("unobtrusiveContainer").find(">*").removeData("unobtrusiveContainer")}function i(c){var b=a(c),d=b.data(e),f=a.proxy(n,c);if(!d){d={options:{errorClass:"input-validation-error",errorElement:"span",errorPlacement:a.proxy(m,c),invalidHandler:a.proxy(l,c),messages:{},rules:{},success:a.proxy(k,c)},attachValidation:function(){b.unbind("reset."+e,f).bind("reset."+e,f).validate(this.options)},validate:function(){b.validate();return b.valid()}};b.data(e,d)}return d}d.unobtrusive={adapters:[],parseElement:function(b,h){var d=a(b),f=d.parents("form")[0],c,e,g;if(!f)return;c=i(f);c.options.rules[b.name]=e={};c.options.messages[b.name]=g={};a.each(this.adapters,function(){var c="data-val-"+this.name,i=d.attr(c),h={};if(i!==undefined){c+="-";a.each(this.params,function(){h[this]=d.attr(c+this)});this.adapt({element:b,form:f,message:i,params:h,rules:e,messages:g})}});a.extend(e,{__dummy__:true});!h&&c.attachValidation()},parse:function(b){var c=a(b).parents("form").andSelf().add(a(b).find("form")).filter("form");a(b).find(":input[data-val=true]").each(function(){d.unobtrusive.parseElement(this,true)});c.each(function(){var a=i(this);a&&a.attachValidation()})}};b=d.unobtrusive.adapters;b.add=function(c,a,b){if(!b){b=a;a=[]}this.push({name:c,params:a,adapt:b});return this};b.addBool=function(a,b){return this.add(a,function(d){c(d,b||a,true)})};b.addMinMax=function(e,g,f,a,d,b){return this.add(e,[d||"min",b||"max"],function(b){var e=b.params.min,d=b.params.max;if(e&&d)c(b,a,[e,d]);else if(e)c(b,g,e);else d&&c(b,f,d)})};b.addSingleVal=function(a,b,d){return this.add(a,[b||"val"],function(e){c(e,d||a,e.params[b])})};d.addMethod("__dummy__",function(){return true});d.addMethod("regex",function(b,c,d){var a;if(this.optional(c))return true;a=(new RegExp(d)).exec(b);return a&&a.index===0&&a[0].length===b.length});d.addMethod("nonalphamin",function(c,d,b){var a;if(b){a=c.match(/\W/g);a=a&&a.length>=b}return a});b.addSingleVal("accept","exts").addSingleVal("regex","pattern");b.addBool("creditcard").addBool("date").addBool("digits").addBool("email").addBool("number").addBool("url");b.addMinMax("length","minlength","maxlength","rangelength").addMinMax("range","min","max","range");b.add("equalto",["other"],function(b){var i=h(b.element.name),j=b.params.other,d=g(j,i),e=a(b.form).find(":input[name='"+f(d)+"']")[0];c(b,"equalTo",e)});b.add("required",function(a){(a.element.tagName.toUpperCase()!=="INPUT"||a.element.type.toUpperCase()!=="CHECKBOX")&&c(a,"required",true)});b.add("remote",["url","type","additionalfields"],function(b){var d={url:b.params.url,type:b.params.type||"GET",data:{}},e=h(b.element.name);a.each(j(b.params.additionalfields||b.element.name),function(i,h){var c=g(h,e);d.data[c]=function(){return a(b.form).find(":input[name='"+f(c)+"']").val()}});c(b,"remote",d)});b.add("password",["min","nonalphamin","regex"],function(a){a.params.min&&c(a,"minlength",a.params.min);a.params.nonalphamin&&c(a,"nonalphamin",a.params.nonalphamin);a.params.regex&&c(a,"regex",a.params.regex)});a(function(){d.unobtrusive.parse(document)})})(jQuery); \ No newline at end of file diff --git a/Scripts/knockout-2.2.0.debug.js b/Scripts/knockout-2.2.0.debug.js new file mode 100644 index 0000000..61c2a0e --- /dev/null +++ b/Scripts/knockout-2.2.0.debug.js @@ -0,0 +1,3577 @@ +// Knockout JavaScript library v2.2.0 +// (c) Steven Sanderson - http://knockoutjs.com/ +// License: MIT (http://www.opensource.org/licenses/mit-license.php) + +(function(){ +var DEBUG=true; +(function(window,document,navigator,jQuery,undefined){ +!function(factory) { + // Support three module loading scenarios + if (typeof require === 'function' && typeof exports === 'object' && typeof module === 'object') { + // [1] CommonJS/Node.js + var target = module['exports'] || exports; // module.exports is for Node.js + factory(target); + } else if (typeof define === 'function' && define['amd']) { + // [2] AMD anonymous module + define(['exports'], factory); + } else { + // [3] No module loader (plain "); + }; + + if (jQueryTmplVersion > 0) { + jQuery['tmpl']['tag']['ko_code'] = { + open: "__.push($1 || '');" + }; + jQuery['tmpl']['tag']['ko_with'] = { + open: "with($1) {", + close: "} " + }; + } + }; + + ko.jqueryTmplTemplateEngine.prototype = new ko.templateEngine(); + + // Use this one by default *only if jquery.tmpl is referenced* + var jqueryTmplTemplateEngineInstance = new ko.jqueryTmplTemplateEngine(); + if (jqueryTmplTemplateEngineInstance.jQueryTmplVersion > 0) + ko.setTemplateEngine(jqueryTmplTemplateEngineInstance); + + ko.exportSymbol('jqueryTmplTemplateEngine', ko.jqueryTmplTemplateEngine); +})(); +}); +})(window,document,navigator,window["jQuery"]); +})(); diff --git a/Scripts/knockout-2.2.0.js b/Scripts/knockout-2.2.0.js new file mode 100644 index 0000000..11f8bd8 --- /dev/null +++ b/Scripts/knockout-2.2.0.js @@ -0,0 +1,85 @@ +// Knockout JavaScript library v2.2.0 +// (c) Steven Sanderson - http://knockoutjs.com/ +// License: MIT (http://www.opensource.org/licenses/mit-license.php) + +(function() {function i(v){throw v;}var l=!0,n=null,q=!1;function t(v){return function(){return v}};var w=window,x=document,fa=navigator,E=window.jQuery,H=void 0; +function K(v){function ga(a,d,c,e,f){var g=[],a=b.j(function(){var a=d(c,f)||[];0",g[0];);m=4b.a.i(d,a[c])&&d.push(a[c]);return d},V:function(a,b){for(var a=a||[],d=[],c=0,e=a.length;cm?a.setAttribute("selected",b):a.selected=b},D:function(a){return(a||"").replace(d,"")},Qb:function(a,d){for(var c=[],e=(a||"").split(d),f=0,g=e.length;fa.length?q:a.substring(0,b.length)===b},sb:function(a,b){if(b.compareDocumentPosition)return 16== +(b.compareDocumentPosition(a)&16);for(;a!=n;){if(a==b)return l;a=a.parentNode}return q},X:function(a){return b.a.sb(a,a.ownerDocument)},u:function(a){return a&&a.tagName&&a.tagName.toLowerCase()},n:function(b,d,c){var e=m&&k[d];if(!e&&"undefined"!=typeof E){if(a(b,d))var f=c,c=function(a,b){var d=this.checked;b&&(this.checked=b.mb!==l);f.call(this,a);this.checked=d};E(b).bind(d,c)}else!e&&"function"==typeof b.addEventListener?b.addEventListener(d,c,q):"undefined"!=typeof b.attachEvent?b.attachEvent("on"+ +d,function(a){c.call(b,a)}):i(Error("Browser doesn't support addEventListener or attachEvent"))},Aa:function(b,d){(!b||!b.nodeType)&&i(Error("element must be a DOM node when calling triggerEvent"));if("undefined"!=typeof E){var c=[];a(b,d)&&c.push({mb:b.checked});E(b).trigger(d,c)}else"function"==typeof x.createEvent?"function"==typeof b.dispatchEvent?(c=x.createEvent(e[d]||"HTMLEvents"),c.initEvent(d,l,l,w,0,0,0,0,0,q,q,q,q,0,b),b.dispatchEvent(c)):i(Error("The supplied element doesn't support dispatchEvent")): +"undefined"!=typeof b.fireEvent?(a(b,d)&&(b.checked=b.checked!==l),b.fireEvent("on"+d)):i(Error("Browser doesn't support triggering events"))},d:function(a){return b.$(a)?a():a},ta:function(a){return b.$(a)?a.t():a},da:function(a,d,c){if(d){var e=/[\w-]+/g,f=a.className.match(e)||[];b.a.o(d.match(e),function(a){var d=b.a.i(f,a);0<=d?c||f.splice(d,1):c&&f.push(a)});a.className=f.join(" ")}},bb:function(a,d){var c=b.a.d(d);if(c===n||c===H)c="";if(3===a.nodeType)a.data=c;else{var e=b.e.firstChild(a); +!e||3!=e.nodeType||b.e.nextSibling(e)?b.e.N(a,[x.createTextNode(c)]):e.data=c;b.a.vb(a)}},$a:function(a,b){a.name=b;if(7>=m)try{a.mergeAttributes(x.createElement(""),q)}catch(d){}},vb:function(a){9<=m&&(a=1==a.nodeType?a:a.parentNode,a.style&&(a.style.zoom=a.style.zoom))},tb:function(a){if(9<=m){var b=a.style.width;a.style.width=0;a.style.width=b}},Kb:function(a,d){for(var a=b.a.d(a),d=b.a.d(d),c=[],e=a;e<=d;e++)c.push(e);return c},L:function(a){for(var b=[],d=0,c=a.length;d< +c;d++)b.push(a[d]);return b},Ob:6===m,Pb:7===m,Z:m,Na:function(a,d){for(var c=b.a.L(a.getElementsByTagName("input")).concat(b.a.L(a.getElementsByTagName("textarea"))),e="string"==typeof d?function(a){return a.name===d}:function(a){return d.test(a.name)},f=[],g=c.length-1;0<=g;g--)e(c[g])&&f.push(c[g]);return f},Hb:function(a){return"string"==typeof a&&(a=b.a.D(a))?w.JSON&&w.JSON.parse?w.JSON.parse(a):(new Function("return "+a))():n},wa:function(a,d,c){("undefined"==typeof JSON||"undefined"==typeof JSON.stringify)&& +i(Error("Cannot find JSON.stringify(). Some browsers (e.g., IE < 8) don't support it natively, but you can overcome this by adding a script reference to json2.js, downloadable from http://www.json.org/json2.js"));return JSON.stringify(b.a.d(a),d,c)},Ib:function(a,d,c){var c=c||{},e=c.params||{},f=c.includeFields||this.Ma,g=a;if("object"==typeof a&&"form"===b.a.u(a))for(var g=a.action,h=f.length-1;0<=h;h--)for(var j=b.a.Na(a,f[h]),k=j.length-1;0<=k;k--)e[j[k].name]=j[k].value;var d=b.a.d(d),m=x.createElement("form"); +m.style.display="none";m.action=g;m.method="post";for(var v in d)a=x.createElement("input"),a.name=v,a.value=b.a.wa(b.a.d(d[v])),m.appendChild(a);for(v in e)a=x.createElement("input"),a.name=v,a.value=e[v],m.appendChild(a);x.body.appendChild(m);c.submitter?c.submitter(m):m.submit();setTimeout(function(){m.parentNode.removeChild(m)},0)}}};b.b("utils",b.a);b.b("utils.arrayForEach",b.a.o);b.b("utils.arrayFirst",b.a.kb);b.b("utils.arrayFilter",b.a.fa);b.b("utils.arrayGetDistinctValues",b.a.Fa);b.b("utils.arrayIndexOf", +b.a.i);b.b("utils.arrayMap",b.a.V);b.b("utils.arrayPushAll",b.a.P);b.b("utils.arrayRemoveItem",b.a.ga);b.b("utils.extend",b.a.extend);b.b("utils.fieldsIncludedWithJsonPost",b.a.Ma);b.b("utils.getFormFields",b.a.Na);b.b("utils.peekObservable",b.a.ta);b.b("utils.postJson",b.a.Ib);b.b("utils.parseJson",b.a.Hb);b.b("utils.registerEventHandler",b.a.n);b.b("utils.stringifyJson",b.a.wa);b.b("utils.range",b.a.Kb);b.b("utils.toggleDomNodeCssClass",b.a.da);b.b("utils.triggerEvent",b.a.Aa);b.b("utils.unwrapObservable", +b.a.d);Function.prototype.bind||(Function.prototype.bind=function(a){var b=this,c=Array.prototype.slice.call(arguments),a=c.shift();return function(){return b.apply(a,c.concat(Array.prototype.slice.call(arguments)))}});b.a.f=new function(){var a=0,d="__ko__"+(new Date).getTime(),c={};return{get:function(a,d){var c=b.a.f.getAll(a,q);return c===H?H:c[d]},set:function(a,d,c){c===H&&b.a.f.getAll(a,q)===H||(b.a.f.getAll(a,l)[d]=c)},getAll:function(b,f){var g=b[d];if(!g||!("null"!==g&&c[g])){if(!f)return H; +g=b[d]="ko"+a++;c[g]={}}return c[g]},clear:function(a){var b=a[d];return b?(delete c[b],a[d]=n,l):q}}};b.b("utils.domData",b.a.f);b.b("utils.domData.clear",b.a.f.clear);b.a.F=new function(){function a(a,d){var e=b.a.f.get(a,c);e===H&&d&&(e=[],b.a.f.set(a,c,e));return e}function d(c){var e=a(c,q);if(e)for(var e=e.slice(0),j=0;j",""]||!c.indexOf("",""]||(!c.indexOf("",""]||[0,"",""];a="ignored
      "+c[1]+a+c[2]+"
      ";for("function"==typeof w.innerShiv?d.appendChild(w.innerShiv(a)):d.innerHTML=a;c[0]--;)d=d.lastChild;d=b.a.L(d.lastChild.childNodes)}return d};b.a.ca=function(a,d){b.a.ka(a);d=b.a.d(d);if(d!==n&&d!==H)if("string"!=typeof d&&(d=d.toString()),"undefined"!=typeof E)E(a).html(d);else for(var c= +b.a.sa(d),e=0;e"},gb:function(a,b){var c=Q[a];c===H&&i(Error("Couldn't find any memo with ID "+a+". Perhaps it's already been unmemoized.")); +try{return c.apply(n,b||[]),l}finally{delete Q[a]}},hb:function(a,d){var c=[];ba(a,c);for(var e=0,f=c.length;ec;c++)a=a();return a})};b.toJSON=function(a,d,c){a=b.fb(a);return b.a.wa(a,d,c)};b.b("toJS",b.fb);b.b("toJSON",b.toJSON);b.k={q:function(a){switch(b.a.u(a)){case "option":return a.__ko__hasDomDataOptionValue__=== +l?b.a.f.get(a,b.c.options.ra):7>=b.a.Z?a.getAttributeNode("value").specified?a.value:a.text:a.value;case "select":return 0<=a.selectedIndex?b.k.q(a.options[a.selectedIndex]):H;default:return a.value}},T:function(a,d){switch(b.a.u(a)){case "option":switch(typeof d){case "string":b.a.f.set(a,b.c.options.ra,H);"__ko__hasDomDataOptionValue__"in a&&delete a.__ko__hasDomDataOptionValue__;a.value=d;break;default:b.a.f.set(a,b.c.options.ra,d),a.__ko__hasDomDataOptionValue__=l,a.value="number"===typeof d? +d:""}break;case "select":for(var c=a.options.length-1;0<=c;c--)if(b.k.q(a.options[c])==d){a.selectedIndex=c;break}break;default:if(d===n||d===H)d="";a.value=d}}};b.b("selectExtensions",b.k);b.b("selectExtensions.readValue",b.k.q);b.b("selectExtensions.writeValue",b.k.T);var ja=/\@ko_token_(\d+)\@/g,ma=["true","false"],na=/^(?:[$_a-z][$\w]*|(.+)(\.\s*[$_a-z][$\w]*|\[.+\]))$/i;b.g={Q:[],aa:function(a){var d=b.a.D(a);if(3>d.length)return[];"{"===d.charAt(0)&&(d=d.substring(1,d.length-1));for(var a=[], +c=n,e,f=0;f$/:/^\s*ko(?:\s+(.+\s*\:[\s\S]*))?\s*$/,ha=J?/^<\!--\s*\/ko\s*--\>$/: +/^\s*\/ko\s*$/,oa={ul:l,ol:l};b.e={I:{},childNodes:function(a){return A(a)?$(a):a.childNodes},Y:function(a){if(A(a))for(var a=b.e.childNodes(a),d=0,c=a.length;d=b.a.Z&&e in ea?(e=ea[e],g?a.removeAttribute(e): +a[e]=f):g||a.setAttribute(e,f.toString());"name"===e&&b.a.$a(a,g?"":f.toString())}}};b.c.checked={init:function(a,d,c){b.a.n(a,"click",function(){var e;if("checkbox"==a.type)e=a.checked;else if("radio"==a.type&&a.checked)e=a.value;else return;var f=d(),g=b.a.d(f);"checkbox"==a.type&&g instanceof Array?(e=b.a.i(g,a.value),a.checked&&0>e?f.push(a.value):!a.checked&&0<=e&&f.splice(e,1)):b.g.ea(f,c,"checked",e,l)});"radio"==a.type&&!a.name&&b.c.uniqueName.init(a,t(l))},update:function(a,d){var c=b.a.d(d()); +"checkbox"==a.type?a.checked=c instanceof Array?0<=b.a.i(c,a.value):c:"radio"==a.type&&(a.checked=a.value==c)}};b.c.css={update:function(a,d){var c=b.a.d(d());if("object"==typeof c)for(var e in c){var f=b.a.d(c[e]);b.a.da(a,e,f)}else c=String(c||""),b.a.da(a,a.__ko__cssValue,q),a.__ko__cssValue=c,b.a.da(a,c,l)}};b.c.enable={update:function(a,d){var c=b.a.d(d());c&&a.disabled?a.removeAttribute("disabled"):!c&&!a.disabled&&(a.disabled=l)}};b.c.disable={update:function(a,d){b.c.enable.update(a,function(){return!b.a.d(d())})}}; +b.c.event={init:function(a,d,c,e){var f=d()||{},g;for(g in f)(function(){var f=g;"string"==typeof f&&b.a.n(a,f,function(a){var g,m=d()[f];if(m){var p=c();try{var r=b.a.L(arguments);r.unshift(e);g=m.apply(e,r)}finally{g!==l&&(a.preventDefault?a.preventDefault():a.returnValue=q)}p[f+"Bubble"]===q&&(a.cancelBubble=l,a.stopPropagation&&a.stopPropagation())}})})()}};b.c.foreach={Ra:function(a){return function(){var d=a(),c=b.a.ta(d);if(!c||"number"==typeof c.length)return{foreach:d,templateEngine:b.C.na}; +b.a.d(d);return{foreach:c.data,as:c.as,includeDestroyed:c.includeDestroyed,afterAdd:c.afterAdd,beforeRemove:c.beforeRemove,afterRender:c.afterRender,beforeMove:c.beforeMove,afterMove:c.afterMove,templateEngine:b.C.na}}},init:function(a,d){return b.c.template.init(a,b.c.foreach.Ra(d))},update:function(a,d,c,e,f){return b.c.template.update(a,b.c.foreach.Ra(d),c,e,f)}};b.g.Q.foreach=q;b.e.I.foreach=l;b.c.hasfocus={init:function(a,d,c){function e(e){a.__ko_hasfocusUpdating=l;var f=a.ownerDocument;"activeElement"in +f&&(e=f.activeElement===a);f=d();b.g.ea(f,c,"hasfocus",e,l);a.__ko_hasfocusUpdating=q}var f=e.bind(n,l),g=e.bind(n,q);b.a.n(a,"focus",f);b.a.n(a,"focusin",f);b.a.n(a,"blur",g);b.a.n(a,"focusout",g)},update:function(a,d){var c=b.a.d(d());a.__ko_hasfocusUpdating||(c?a.focus():a.blur(),b.r.K(b.a.Aa,n,[a,c?"focusin":"focusout"]))}};b.c.html={init:function(){return{controlsDescendantBindings:l}},update:function(a,d){b.a.ca(a,d())}};var ca="__ko_withIfBindingData";P("if");P("ifnot",q,l);P("with",l,q,function(a, +b){return a.createChildContext(b)});b.c.options={update:function(a,d,c){"select"!==b.a.u(a)&&i(Error("options binding applies only to SELECT elements"));for(var e=0==a.length,f=b.a.V(b.a.fa(a.childNodes,function(a){return a.tagName&&"option"===b.a.u(a)&&a.selected}),function(a){return b.k.q(a)||a.innerText||a.textContent}),g=a.scrollTop,h=b.a.d(d());0/g;b.ya={ub:function(a, +d,c){d.isTemplateRewritten(a,c)||d.rewriteTemplate(a,function(a){return b.ya.Fb(a,d)},c)},Fb:function(a,b){return a.replace(pa,function(a,e,f,g,h,j,k){return V(k,e,b)}).replace(qa,function(a,e){return V(e,"<\!-- ko --\>",b)})},jb:function(a){return b.s.qa(function(d,c){d.nextSibling&&b.Ea(d.nextSibling,a,c)})}};b.b("__tr_ambtns",b.ya.jb);b.l={};b.l.h=function(a){this.h=a};b.l.h.prototype.text=function(){var a=b.a.u(this.h),a="script"===a?"text":"textarea"===a?"value":"innerHTML";if(0==arguments.length)return this.h[a]; +var d=arguments[0];"innerHTML"===a?b.a.ca(this.h,d):this.h[a]=d};b.l.h.prototype.data=function(a){if(1===arguments.length)return b.a.f.get(this.h,"templateSourceData_"+a);b.a.f.set(this.h,"templateSourceData_"+a,arguments[1])};b.l.O=function(a){this.h=a};b.l.O.prototype=new b.l.h;b.l.O.prototype.text=function(){if(0==arguments.length){var a=b.a.f.get(this.h,"__ko_anon_template__")||{};a.za===H&&a.ia&&(a.za=a.ia.innerHTML);return a.za}b.a.f.set(this.h,"__ko_anon_template__",{za:arguments[0]})};b.l.h.prototype.nodes= +function(){if(0==arguments.length)return(b.a.f.get(this.h,"__ko_anon_template__")||{}).ia;b.a.f.set(this.h,"__ko_anon_template__",{ia:arguments[0]})};b.b("templateSources",b.l);b.b("templateSources.domElement",b.l.h);b.b("templateSources.anonymousTemplate",b.l.O);var N;b.va=function(a){a!=H&&!(a instanceof b.v)&&i(Error("templateEngine must inherit from ko.templateEngine"));N=a};b.ua=function(a,d,c,e,f){c=c||{};(c.templateEngine||N)==H&&i(Error("Set a template engine before calling renderTemplate")); +f=f||"replaceChildren";if(e){var g=M(e);return b.j(function(){var h=d&&d instanceof b.z?d:new b.z(b.a.d(d)),j="function"==typeof a?a(h.$data,h):a,h=S(e,f,j,h,c);"replaceNode"==f&&(e=h,g=M(e))},n,{Ja:function(){return!g||!b.a.X(g)},W:g&&"replaceNode"==f?g.parentNode:g})}return b.s.qa(function(e){b.ua(a,d,c,e,"replaceNode")})};b.Lb=function(a,d,c,e,f){function g(a,b){T(b,j);c.afterRender&&c.afterRender(b,a)}function h(d,e){j=f.createChildContext(b.a.d(d),c.as);j.$index=e;var g="function"==typeof a? +a(d,j):a;return S(n,"ignoreTargetNode",g,j,c)}var j;return b.j(function(){var a=b.a.d(d)||[];"undefined"==typeof a.length&&(a=[a]);a=b.a.fa(a,function(a){return c.includeDestroyed||a===H||a===n||!b.a.d(a._destroy)});b.r.K(b.a.Za,n,[e,a,h,c,g])},n,{W:e})};b.c.template={init:function(a,d){var c=b.a.d(d());if("string"!=typeof c&&!c.name&&(1==a.nodeType||8==a.nodeType))c=1==a.nodeType?a.childNodes:b.e.childNodes(a),c=b.a.Gb(c),(new b.l.O(a)).nodes(c);return{controlsDescendantBindings:l}},update:function(a, +d,c,e,f){var d=b.a.d(d()),c={},e=l,g,h=n;"string"!=typeof d&&(c=d,d=c.name,"if"in c&&(e=b.a.d(c["if"])),e&&"ifnot"in c&&(e=!b.a.d(c.ifnot)),g=b.a.d(c.data));"foreach"in c?h=b.Lb(d||a,e&&c.foreach||[],c,a,f):e?(f="data"in c?f.createChildContext(g,c.as):f,h=b.ua(d||a,f,c,a)):b.e.Y(a);f=h;(g=b.a.f.get(a,"__ko__templateComputedDomDataKey__"))&&"function"==typeof g.B&&g.B();b.a.f.set(a,"__ko__templateComputedDomDataKey__",f&&f.oa()?f:H)}};b.g.Q.template=function(a){a=b.g.aa(a);return 1==a.length&&a[0].unknown|| +b.g.Db(a,"name")?n:"This template engine does not support anonymous templates nested within its templates"};b.e.I.template=l;b.b("setTemplateEngine",b.va);b.b("renderTemplate",b.ua);b.a.Ia=function(a,b,c){a=a||[];b=b||[];return a.length<=b.length?R(a,b,"added","deleted",c):R(b,a,"deleted","added",c)};b.b("utils.compareArrays",b.a.Ia);b.a.Za=function(a,d,c,e,f){function g(a,b){s=k[b];v!==b&&(y[a]=s);s.ma(v++);L(s.M);r.push(s);z.push(s)}function h(a,c){if(a)for(var d=0,e=c.length;db.a.Z)&&a.nodes?a.nodes():n;if(d)return b.a.L(d.cloneNode(l).childNodes);a=a.text();return b.a.sa(a)};b.C.na=new b.C;b.va(b.C.na);b.b("nativeTemplateEngine",b.C);b.pa=function(){var a=this.Cb=function(){if("undefined"==typeof E||!E.tmpl)return 0;try{if(0<=E.tmpl.tag.tmpl.open.toString().indexOf("__"))return 2}catch(a){}return 1}();this.renderTemplateSource=function(b,c,e){e=e||{};2>a&&i(Error("Your version of jQuery.tmpl is too old. Please upgrade to jQuery.tmpl 1.0.0pre or later.")); +var f=b.data("precompiled");f||(f=b.text()||"",f=E.template(n,"{{ko_with $item.koBindingContext}}"+f+"{{/ko_with}}"),b.data("precompiled",f));b=[c.$data];c=E.extend({koBindingContext:c},e.templateOptions);c=E.tmpl(f,b,c);c.appendTo(x.createElement("div"));E.fragments={};return c};this.createJavaScriptEvaluatorBlock=function(a){return"{{ko_code ((function() { return "+a+" })()) }}"};this.addTemplate=function(a,b){x.write("