diff --git a/go.mod b/go.mod index 67e4e103..0c04f56a 100644 --- a/go.mod +++ b/go.mod @@ -64,7 +64,8 @@ require ( github.com/imdario/mergo v0.3.15 // indirect github.com/jackc/pgpassfile v1.0.0 // indirect github.com/jackc/pgservicefile v0.0.0-20221227161230-091c0ba34f0a // indirect - github.com/jackc/pgx/v5 v5.3.1 // indirect + github.com/jackc/pgx/v5 v5.5.4 // indirect + github.com/jackc/puddle/v2 v2.2.1 // indirect github.com/jinzhu/inflection v1.0.0 // indirect github.com/jinzhu/now v1.1.5 // indirect github.com/josharian/intern v1.0.0 // indirect @@ -94,6 +95,7 @@ require ( golang.org/x/arch v0.3.0 // indirect golang.org/x/mod v0.10.0 // indirect golang.org/x/net v0.17.0 // indirect + golang.org/x/sync v0.2.0 // indirect golang.org/x/sys v0.15.0 // indirect golang.org/x/term v0.15.0 // indirect golang.org/x/text v0.14.0 // indirect diff --git a/go.sum b/go.sum index 2832969e..201e1e6c 100644 --- a/go.sum +++ b/go.sum @@ -151,9 +151,11 @@ github.com/jackc/pgpassfile v1.0.0/go.mod h1:CEx0iS5ambNFdcRtxPj5JhEz+xB6uRky5ey github.com/jackc/pgservicefile v0.0.0-20221227161230-091c0ba34f0a h1:bbPeKD0xmW/Y25WS6cokEszi5g+S0QxI/d45PkRi7Nk= github.com/jackc/pgservicefile v0.0.0-20221227161230-091c0ba34f0a/go.mod h1:5TJZWKEWniPve33vlWYSoGYefn3gLQRzjfDlhSJ9ZKM= github.com/jackc/pgx/v5 v5.3.0/go.mod h1:t3JDKnCBlYIc0ewLF0Q7B8MXmoIaBOZj/ic7iHozM/8= -github.com/jackc/pgx/v5 v5.3.1 h1:Fcr8QJ1ZeLi5zsPZqQeUZhNhxfkkKBOgJuYkJHoBOtU= -github.com/jackc/pgx/v5 v5.3.1/go.mod h1:t3JDKnCBlYIc0ewLF0Q7B8MXmoIaBOZj/ic7iHozM/8= +github.com/jackc/pgx/v5 v5.5.4 h1:Xp2aQS8uXButQdnCMWNmvx6UysWQQC+u1EoizjguY+8= +github.com/jackc/pgx/v5 v5.5.4/go.mod h1:ez9gk+OAat140fv9ErkZDYFWmXLfV+++K0uAOiwgm1A= github.com/jackc/puddle/v2 v2.2.0/go.mod h1:vriiEXHvEE654aYKXXjOvZM39qJ0q+azkZFrfEOc3H4= +github.com/jackc/puddle/v2 v2.2.1 h1:RhxXJtFG022u4ibrCSMSiu5aOq1i77R3OHKNJj77OAk= +github.com/jackc/puddle/v2 v2.2.1/go.mod h1:vriiEXHvEE654aYKXXjOvZM39qJ0q+azkZFrfEOc3H4= github.com/jessevdk/go-flags v1.4.0/go.mod h1:4FA24M0QyGHXBuZZK/XkWh8h0e1EYbRYJSGM75WSRxI= github.com/jinzhu/inflection v1.0.0 h1:K317FqzuhWc8YvSVlFMCCUb36O/S9MCKRDI7QkRKD/E= github.com/jinzhu/inflection v1.0.0/go.mod h1:h+uFLlag+Qp1Va5pdKtLDYj+kHp5pxUVkryuEj+Srlc= @@ -332,6 +334,7 @@ golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJ golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.1.0/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.2.0 h1:PUR+T4wwASmuSTYdKjYHI5TD22Wy5ogLU5qZCOLxBrI= +golang.org/x/sync v0.2.0/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= diff --git a/vendor/github.com/jackc/pgx/v5/CHANGELOG.md b/vendor/github.com/jackc/pgx/v5/CHANGELOG.md index ec90631c..78de6db7 100644 --- a/vendor/github.com/jackc/pgx/v5/CHANGELOG.md +++ b/vendor/github.com/jackc/pgx/v5/CHANGELOG.md @@ -1,3 +1,115 @@ +# 5.5.4 (March 4, 2024) + +Fix CVE-2024-27304 + +SQL injection can occur if an attacker can cause a single query or bind message to exceed 4 GB in size. An integer +overflow in the calculated message size can cause the one large message to be sent as multiple messages under the +attacker's control. + +Thanks to Paul Gerste for reporting this issue. + +* Fix behavior of CollectRows to return empty slice if Rows are empty (Felix) +* Fix simple protocol encoding of json.RawMessage +* Fix *Pipeline.getResults should close pipeline on error +* Fix panic in TryFindUnderlyingTypeScanPlan (David Kurman) +* Fix deallocation of invalidated cached statements in a transaction +* Handle invalid sslkey file +* Fix scan float4 into sql.Scanner +* Fix pgtype.Bits not making copy of data from read buffer. This would cause the data to be corrupted by future reads. + +# 5.5.3 (February 3, 2024) + +* Fix: prepared statement already exists +* Improve CopyFrom auto-conversion of text-ish values +* Add ltree type support (Florent Viel) +* Make some properties of Batch and QueuedQuery public (Pavlo Golub) +* Add AppendRows function (Edoardo Spadolini) +* Optimize convert UUID [16]byte to string (Kirill Malikov) +* Fix: LargeObject Read and Write of more than ~1GB at a time (Mitar) + +# 5.5.2 (January 13, 2024) + +* Allow NamedArgs to start with underscore +* pgproto3: Maximum message body length support (jeremy.spriet) +* Upgrade golang.org/x/crypto to v0.17.0 +* Add snake_case support to RowToStructByName (Tikhon Fedulov) +* Fix: update description cache after exec prepare (James Hartig) +* Fix: pipeline checks if it is closed (James Hartig and Ryan Fowler) +* Fix: normalize timeout / context errors during TLS startup (Samuel Stauffer) +* Add OnPgError for easier centralized error handling (James Hartig) + +# 5.5.1 (December 9, 2023) + +* Add CopyFromFunc helper function. (robford) +* Add PgConn.Deallocate method that uses PostgreSQL protocol Close message. +* pgx uses new PgConn.Deallocate method. This allows deallocating statements to work in a failed transaction. This fixes a case where the prepared statement map could become invalid. +* Fix: Prefer driver.Valuer over json.Marshaler for json fields. (Jacopo) +* Fix: simple protocol SQL sanitizer previously panicked if an invalid $0 placeholder was used. This now returns an error instead. (maksymnevajdev) +* Add pgtype.Numeric.ScanScientific (Eshton Robateau) + +# 5.5.0 (November 4, 2023) + +* Add CollectExactlyOneRow. (Julien GOTTELAND) +* Add OpenDBFromPool to create *database/sql.DB from *pgxpool.Pool. (Lev Zakharov) +* Prepare can automatically choose statement name based on sql. This makes it easier to explicitly manage prepared statements. +* Statement cache now uses deterministic, stable statement names. +* database/sql prepared statement names are deterministically generated. +* Fix: SendBatch wasn't respecting context cancellation. +* Fix: Timeout error from pipeline is now normalized. +* Fix: database/sql encoding json.RawMessage to []byte. +* CancelRequest: Wait for the cancel request to be acknowledged by the server. This should improve PgBouncer compatibility. (Anton Levakin) +* stdlib: Use Ping instead of CheckConn in ResetSession +* Add json.Marshaler and json.Unmarshaler for Float4, Float8 (Kirill Mironov) + +# 5.4.3 (August 5, 2023) + +* Fix: QCharArrayOID was defined with the wrong OID (Christoph Engelbert) +* Fix: connect_timeout for sslmode=allow|prefer (smaher-edb) +* Fix: pgxpool: background health check cannot overflow pool +* Fix: Check for nil in defer when sending batch (recover properly from panic) +* Fix: json scan of non-string pointer to pointer +* Fix: zeronull.Timestamptz should use pgtype.Timestamptz +* Fix: NewConnsCount was not correctly counting connections created by Acquire directly. (James Hartig) +* RowTo(AddrOf)StructByPos ignores fields with "-" db tag +* Optimization: improve text format numeric parsing (horpto) + +# 5.4.2 (July 11, 2023) + +* Fix: RowScanner errors are fatal to Rows +* Fix: Enable failover efforts when pg_hba.conf disallows non-ssl connections (Brandon Kauffman) +* Hstore text codec internal improvements (Evan Jones) +* Fix: Stop timers for background reader when not in use. Fixes memory leak when closing connections (Adrian-Stefan Mares) +* Fix: Stop background reader as soon as possible. +* Add PgConn.SyncConn(). This combined with the above fix makes it safe to directly use the underlying net.Conn. + +# 5.4.1 (June 18, 2023) + +* Fix: concurrency bug with pgtypeDefaultMap and simple protocol (Lev Zakharov) +* Add TxOptions.BeginQuery to allow overriding the default BEGIN query + +# 5.4.0 (June 14, 2023) + +* Replace platform specific syscalls for non-blocking IO with more traditional goroutines and deadlines. This returns to the v4 approach with some additional improvements and fixes. This restores the ability to use a pgx.Conn over an ssh.Conn as well as other non-TCP or Unix socket connections. In addition, it is a significantly simpler implementation that is less likely to have cross platform issues. +* Optimization: The default type registrations are now shared among all connections. This saves about 100KB of memory per connection. `pgtype.Type` and `pgtype.Codec` values are now required to be immutable after registration. This was already necessary in most cases but wasn't documented until now. (Lev Zakharov) +* Fix: Ensure pgxpool.Pool.QueryRow.Scan releases connection on panic +* CancelRequest: don't try to read the reply (Nicola Murino) +* Fix: correctly handle bool type aliases (Wichert Akkerman) +* Fix: pgconn.CancelRequest: Fix unix sockets: don't use RemoteAddr() +* Fix: pgx.Conn memory leak with prepared statement caching (Evan Jones) +* Add BeforeClose to pgxpool.Pool (Evan Cordell) +* Fix: various hstore fixes and optimizations (Evan Jones) +* Fix: RowToStructByPos with embedded unexported struct +* Support different bool string representations (Lev Zakharov) +* Fix: error when using BatchResults.Exec on a select that returns an error after some rows. +* Fix: pipelineBatchResults.Exec() not returning error from ResultReader +* Fix: pipeline batch results not closing pipeline when error occurs while reading directly from results instead of using + a callback. +* Fix: scanning a table type into a struct +* Fix: scan array of record to pointer to slice of struct +* Fix: handle null for json (Cemre Mengu) +* Batch Query callback is called even when there is an error +* Add RowTo(AddrOf)StructByNameLax (Audi P. Risa P) + # 5.3.1 (February 27, 2023) * Fix: Support v4 and v5 stdlib in same program (Tomáš Procházka) diff --git a/vendor/github.com/jackc/pgx/v5/CONTRIBUTING.md b/vendor/github.com/jackc/pgx/v5/CONTRIBUTING.md index 3eb0da5b..6ed3205c 100644 --- a/vendor/github.com/jackc/pgx/v5/CONTRIBUTING.md +++ b/vendor/github.com/jackc/pgx/v5/CONTRIBUTING.md @@ -79,20 +79,11 @@ echo "listen_addresses = '127.0.0.1'" >> .testdb/$POSTGRESQL_DATA_DIR/postgresql echo "port = $PGPORT" >> .testdb/$POSTGRESQL_DATA_DIR/postgresql.conf cat testsetup/postgresql_ssl.conf >> .testdb/$POSTGRESQL_DATA_DIR/postgresql.conf cp testsetup/pg_hba.conf .testdb/$POSTGRESQL_DATA_DIR/pg_hba.conf -cp testsetup/ca.cnf .testdb -cp testsetup/localhost.cnf .testdb -cp testsetup/pgx_sslcert.cnf .testdb cd .testdb -# Generate a CA public / private key pair. -openssl genrsa -out ca.key 4096 -openssl req -x509 -config ca.cnf -new -nodes -key ca.key -sha256 -days 365 -subj '/O=pgx-test-root' -out ca.pem - -# Generate the certificate for localhost (the server). -openssl genrsa -out localhost.key 2048 -openssl req -new -config localhost.cnf -key localhost.key -out localhost.csr -openssl x509 -req -in localhost.csr -CA ca.pem -CAkey ca.key -CAcreateserial -out localhost.crt -days 364 -sha256 -extfile localhost.cnf -extensions v3_req +# Generate CA, server, and encrypted client certificates. +go run ../testsetup/generate_certs.go # Copy certificates to server directory and set permissions. cp ca.pem $POSTGRESQL_DATA_DIR/root.crt @@ -100,11 +91,6 @@ cp localhost.key $POSTGRESQL_DATA_DIR/server.key chmod 600 $POSTGRESQL_DATA_DIR/server.key cp localhost.crt $POSTGRESQL_DATA_DIR/server.crt -# Generate the certificate for client authentication. -openssl genrsa -des3 -out pgx_sslcert.key -passout pass:certpw 2048 -openssl req -new -config pgx_sslcert.cnf -key pgx_sslcert.key -passin pass:certpw -out pgx_sslcert.csr -openssl x509 -req -in pgx_sslcert.csr -CA ca.pem -CAkey ca.key -CAcreateserial -out pgx_sslcert.crt -days 363 -sha256 -extfile pgx_sslcert.cnf -extensions v3_req - cd .. ``` diff --git a/vendor/github.com/jackc/pgx/v5/README.md b/vendor/github.com/jackc/pgx/v5/README.md index 29d9521c..49f2c3d7 100644 --- a/vendor/github.com/jackc/pgx/v5/README.md +++ b/vendor/github.com/jackc/pgx/v5/README.md @@ -1,5 +1,5 @@ [![Go Reference](https://pkg.go.dev/badge/github.com/jackc/pgx/v5.svg)](https://pkg.go.dev/github.com/jackc/pgx/v5) -![Build Status](https://github.com/jackc/pgx/actions/workflows/ci.yml/badge.svg) +[![Build Status](https://github.com/jackc/pgx/actions/workflows/ci.yml/badge.svg)](https://github.com/jackc/pgx/actions/workflows/ci.yml) # pgx - PostgreSQL Driver and Toolkit @@ -86,9 +86,13 @@ It is also possible to use the `database/sql` interface and convert a connection See CONTRIBUTING.md for setup instructions. +## Architecture + +See the presentation at Golang Estonia, [PGX Top to Bottom](https://www.youtube.com/watch?v=sXMSWhcHCf8) for a description of pgx architecture. + ## Supported Go and PostgreSQL Versions -pgx supports the same versions of Go and PostgreSQL that are supported by their respective teams. For [Go](https://golang.org/doc/devel/release.html#policy) that is the two most recent major releases and for [PostgreSQL](https://www.postgresql.org/support/versioning/) the major releases in the last 5 years. This means pgx supports Go 1.19 and higher and PostgreSQL 11 and higher. pgx also is tested against the latest version of [CockroachDB](https://www.cockroachlabs.com/product/). +pgx supports the same versions of Go and PostgreSQL that are supported by their respective teams. For [Go](https://golang.org/doc/devel/release.html#policy) that is the two most recent major releases and for [PostgreSQL](https://www.postgresql.org/support/versioning/) the major releases in the last 5 years. This means pgx supports Go 1.20 and higher and PostgreSQL 12 and higher. pgx also is tested against the latest version of [CockroachDB](https://www.cockroachlabs.com/product/). ## Version Policy @@ -116,6 +120,7 @@ pgerrcode contains constants for the PostgreSQL error codes. * [github.com/jackc/pgx-gofrs-uuid](https://github.com/jackc/pgx-gofrs-uuid) * [github.com/jackc/pgx-shopspring-decimal](https://github.com/jackc/pgx-shopspring-decimal) +* [github.com/twpayne/pgx-geos](https://github.com/twpayne/pgx-geos) ([PostGIS](https://postgis.net/) and [GEOS](https://libgeos.org/) via [go-geos](https://github.com/twpayne/go-geos)) * [github.com/vgarvardt/pgx-google-uuid](https://github.com/vgarvardt/pgx-google-uuid) @@ -132,13 +137,25 @@ These adapters can be used with the tracelog package. * [github.com/jackc/pgx-logrus](https://github.com/jackc/pgx-logrus) * [github.com/jackc/pgx-zap](https://github.com/jackc/pgx-zap) * [github.com/jackc/pgx-zerolog](https://github.com/jackc/pgx-zerolog) +* [github.com/mcosta74/pgx-slog](https://github.com/mcosta74/pgx-slog) +* [github.com/kataras/pgx-golog](https://github.com/kataras/pgx-golog) ## 3rd Party Libraries with PGX Support +### [github.com/pashagolub/pgxmock](https://github.com/pashagolub/pgxmock) + +pgxmock is a mock library implementing pgx interfaces. +pgxmock has one and only purpose - to simulate pgx behavior in tests, without needing a real database connection. + ### [github.com/georgysavva/scany](https://github.com/georgysavva/scany) Library for scanning data from a database into Go structs and more. +### [github.com/vingarcia/ksql](https://github.com/vingarcia/ksql) + +A carefully designed SQL client for making using SQL easier, +more productive, and less error-prone on Golang. + ### [https://github.com/otan/gopgkrb5](https://github.com/otan/gopgkrb5) Adds GSSAPI / Kerberos authentication support. diff --git a/vendor/github.com/jackc/pgx/v5/batch.go b/vendor/github.com/jackc/pgx/v5/batch.go index af62039f..b9b46d1d 100644 --- a/vendor/github.com/jackc/pgx/v5/batch.go +++ b/vendor/github.com/jackc/pgx/v5/batch.go @@ -10,8 +10,8 @@ import ( // QueuedQuery is a query that has been queued for execution via a Batch. type QueuedQuery struct { - query string - arguments []any + SQL string + Arguments []any fn batchItemFunc sd *pgconn.StatementDescription } @@ -21,13 +21,10 @@ type batchItemFunc func(br BatchResults) error // Query sets fn to be called when the response to qq is received. func (qq *QueuedQuery) Query(fn func(rows Rows) error) { qq.fn = func(br BatchResults) error { - rows, err := br.Query() - if err != nil { - return err - } + rows, _ := br.Query() defer rows.Close() - err = fn(rows) + err := fn(rows) if err != nil { return err } @@ -60,22 +57,24 @@ func (qq *QueuedQuery) Exec(fn func(ct pgconn.CommandTag) error) { // Batch queries are a way of bundling multiple queries together to avoid // unnecessary network round trips. A Batch must only be sent once. type Batch struct { - queuedQueries []*QueuedQuery + QueuedQueries []*QueuedQuery } // Queue queues a query to batch b. query can be an SQL query or the name of a prepared statement. +// The only pgx option argument that is supported is QueryRewriter. Queries are executed using the +// connection's DefaultQueryExecMode. func (b *Batch) Queue(query string, arguments ...any) *QueuedQuery { qq := &QueuedQuery{ - query: query, - arguments: arguments, + SQL: query, + Arguments: arguments, } - b.queuedQueries = append(b.queuedQueries, qq) + b.QueuedQueries = append(b.QueuedQueries, qq) return qq } // Len returns number of queries that have been queued so far. func (b *Batch) Len() int { - return len(b.queuedQueries) + return len(b.QueuedQueries) } type BatchResults interface { @@ -142,7 +141,10 @@ func (br *batchResults) Exec() (pgconn.CommandTag, error) { } commandTag, err := br.mrr.ResultReader().Close() - br.err = err + if err != nil { + br.err = err + br.mrr.Close() + } if br.conn.batchTracer != nil { br.conn.batchTracer.TraceBatchQuery(br.ctx, br.conn, TraceBatchQueryData{ @@ -225,10 +227,10 @@ func (br *batchResults) Close() error { } // Read and run fn for all remaining items - for br.err == nil && !br.closed && br.b != nil && br.qqIdx < len(br.b.queuedQueries) { - if br.b.queuedQueries[br.qqIdx].fn != nil { - err := br.b.queuedQueries[br.qqIdx].fn(br) - if err != nil && br.err == nil { + for br.err == nil && !br.closed && br.b != nil && br.qqIdx < len(br.b.QueuedQueries) { + if br.b.QueuedQueries[br.qqIdx].fn != nil { + err := br.b.QueuedQueries[br.qqIdx].fn(br) + if err != nil { br.err = err } } else { @@ -251,10 +253,10 @@ func (br *batchResults) earlyError() error { } func (br *batchResults) nextQueryAndArgs() (query string, args []any, ok bool) { - if br.b != nil && br.qqIdx < len(br.b.queuedQueries) { - bi := br.b.queuedQueries[br.qqIdx] - query = bi.query - args = bi.arguments + if br.b != nil && br.qqIdx < len(br.b.QueuedQueries) { + bi := br.b.QueuedQueries[br.qqIdx] + query = bi.SQL + args = bi.Arguments ok = true br.qqIdx++ } @@ -290,7 +292,7 @@ func (br *pipelineBatchResults) Exec() (pgconn.CommandTag, error) { results, err := br.pipeline.GetResults() if err != nil { br.err = err - return pgconn.CommandTag{}, err + return pgconn.CommandTag{}, br.err } var commandTag pgconn.CommandTag switch results := results.(type) { @@ -309,7 +311,7 @@ func (br *pipelineBatchResults) Exec() (pgconn.CommandTag, error) { }) } - return commandTag, err + return commandTag, br.err } // Query reads the results from the next query in the batch as if the query has been sent with Query. @@ -384,24 +386,20 @@ func (br *pipelineBatchResults) Close() error { } }() - if br.err != nil { - return br.err - } - - if br.lastRows != nil && br.lastRows.err != nil { + if br.err == nil && br.lastRows != nil && br.lastRows.err != nil { br.err = br.lastRows.err return br.err } if br.closed { - return nil + return br.err } // Read and run fn for all remaining items - for br.err == nil && !br.closed && br.b != nil && br.qqIdx < len(br.b.queuedQueries) { - if br.b.queuedQueries[br.qqIdx].fn != nil { - err := br.b.queuedQueries[br.qqIdx].fn(br) - if err != nil && br.err == nil { + for br.err == nil && !br.closed && br.b != nil && br.qqIdx < len(br.b.QueuedQueries) { + if br.b.QueuedQueries[br.qqIdx].fn != nil { + err := br.b.QueuedQueries[br.qqIdx].fn(br) + if err != nil { br.err = err } } else { @@ -424,10 +422,10 @@ func (br *pipelineBatchResults) earlyError() error { } func (br *pipelineBatchResults) nextQueryAndArgs() (query string, args []any, ok bool) { - if br.b != nil && br.qqIdx < len(br.b.queuedQueries) { - bi := br.b.queuedQueries[br.qqIdx] - query = bi.query - args = bi.arguments + if br.b != nil && br.qqIdx < len(br.b.QueuedQueries) { + bi := br.b.QueuedQueries[br.qqIdx] + query = bi.SQL + args = bi.Arguments ok = true br.qqIdx++ } diff --git a/vendor/github.com/jackc/pgx/v5/conn.go b/vendor/github.com/jackc/pgx/v5/conn.go index 92b6f3e4..fc72c732 100644 --- a/vendor/github.com/jackc/pgx/v5/conn.go +++ b/vendor/github.com/jackc/pgx/v5/conn.go @@ -2,6 +2,8 @@ package pgx import ( "context" + "crypto/sha256" + "encoding/hex" "errors" "fmt" "strconv" @@ -35,7 +37,7 @@ type ConnConfig struct { // DefaultQueryExecMode controls the default mode for executing queries. By default pgx uses the extended protocol // and automatically prepares and caches prepared statements. However, this may be incompatible with proxies such as - // PGBouncer. In this case it may be preferrable to use QueryExecModeExec or QueryExecModeSimpleProtocol. The same + // PGBouncer. In this case it may be preferable to use QueryExecModeExec or QueryExecModeSimpleProtocol. The same // functionality can be controlled on a per query basis by passing a QueryExecMode as the first query argument. DefaultQueryExecMode QueryExecMode @@ -99,8 +101,12 @@ func (ident Identifier) Sanitize() string { return strings.Join(parts, ".") } -// ErrNoRows occurs when rows are expected but none are returned. -var ErrNoRows = errors.New("no rows in result set") +var ( + // ErrNoRows occurs when rows are expected but none are returned. + ErrNoRows = errors.New("no rows in result set") + // ErrTooManyRows occurs when more rows than expected are returned. + ErrTooManyRows = errors.New("too many rows in result set") +) var errDisabledStatementCache = fmt.Errorf("cannot use QueryExecModeCacheStatement with disabled statement cache") var errDisabledDescriptionCache = fmt.Errorf("cannot use QueryExecModeCacheDescribe with disabled description cache") @@ -178,7 +184,7 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con case "simple_protocol": defaultQueryExecMode = QueryExecModeSimpleProtocol default: - return nil, fmt.Errorf("invalid default_query_exec_mode: %v", err) + return nil, fmt.Errorf("invalid default_query_exec_mode: %s", s) } } @@ -194,7 +200,7 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con return connConfig, nil } -// ParseConfig creates a ConnConfig from a connection string. ParseConfig handles all options that pgconn.ParseConfig +// ParseConfig creates a ConnConfig from a connection string. ParseConfig handles all options that [pgconn.ParseConfig] // does. In addition, it accepts the following options: // // - default_query_exec_mode. @@ -269,7 +275,7 @@ func connect(ctx context.Context, config *ConnConfig) (c *Conn, err error) { return c, nil } -// Close closes a connection. It is safe to call Close on a already closed +// Close closes a connection. It is safe to call Close on an already closed // connection. func (c *Conn) Close(ctx context.Context) error { if c.IsClosed() { @@ -280,12 +286,15 @@ func (c *Conn) Close(ctx context.Context) error { return err } -// Prepare creates a prepared statement with name and sql. sql can contain placeholders -// for bound parameters. These placeholders are referenced positional as $1, $2, etc. +// Prepare creates a prepared statement with name and sql. sql can contain placeholders for bound parameters. These +// placeholders are referenced positionally as $1, $2, etc. name can be used instead of sql with Query, QueryRow, and +// Exec to execute the statement. It can also be used with Batch.Queue. +// +// The underlying PostgreSQL identifier for the prepared statement will be name if name != sql or a digest of sql if +// name == sql. // -// Prepare is idempotent; i.e. it is safe to call Prepare multiple times with the same -// name and sql arguments. This allows a code path to Prepare and Query/Exec without -// concern for if the statement has already been prepared. +// Prepare is idempotent; i.e. it is safe to call Prepare multiple times with the same name and sql arguments. This +// allows a code path to Prepare and Query/Exec without concern for if the statement has already been prepared. func (c *Conn) Prepare(ctx context.Context, name, sql string) (sd *pgconn.StatementDescription, err error) { if c.prepareTracer != nil { ctx = c.prepareTracer.TracePrepareStart(ctx, c, TracePrepareStartData{Name: name, SQL: sql}) @@ -307,23 +316,48 @@ func (c *Conn) Prepare(ctx context.Context, name, sql string) (sd *pgconn.Statem }() } - sd, err = c.pgConn.Prepare(ctx, name, sql, nil) + var psName, psKey string + if name == sql { + digest := sha256.Sum256([]byte(sql)) + psName = "stmt_" + hex.EncodeToString(digest[0:24]) + psKey = sql + } else { + psName = name + psKey = name + } + + sd, err = c.pgConn.Prepare(ctx, psName, sql, nil) if err != nil { return nil, err } - if name != "" { - c.preparedStatements[name] = sd + if psKey != "" { + c.preparedStatements[psKey] = sd } return sd, nil } -// Deallocate released a prepared statement +// Deallocate releases a prepared statement. Calling Deallocate on a non-existent prepared statement will succeed. func (c *Conn) Deallocate(ctx context.Context, name string) error { - delete(c.preparedStatements, name) - _, err := c.pgConn.Exec(ctx, "deallocate "+quoteIdentifier(name)).ReadAll() - return err + var psName string + sd := c.preparedStatements[name] + if sd != nil { + psName = sd.Name + } else { + psName = name + } + + err := c.pgConn.Deallocate(ctx, psName) + if err != nil { + return err + } + + if sd != nil { + delete(c.preparedStatements, name) + } + + return nil } // DeallocateAll releases all previously prepared statements from the server and client, where it also resets the statement and description cache. @@ -382,11 +416,9 @@ func quoteIdentifier(s string) string { return `"` + strings.ReplaceAll(s, `"`, `""`) + `"` } -// Ping executes an empty sql statement against the *Conn -// If the sql returns without error, the database Ping is considered successful, otherwise, the error is returned. +// Ping delegates to the underlying *pgconn.PgConn.Ping. func (c *Conn) Ping(ctx context.Context) error { - _, err := c.Exec(ctx, ";") - return err + return c.pgConn.Ping(ctx) } // PgConn returns the underlying *pgconn.PgConn. This is an escape hatch method that allows lower level access to the @@ -443,7 +475,7 @@ optionLoop: if queryRewriter != nil { sql, arguments, err = queryRewriter.RewriteQuery(ctx, c, sql, arguments) if err != nil { - return pgconn.CommandTag{}, fmt.Errorf("rewrite query failed: %v", err) + return pgconn.CommandTag{}, fmt.Errorf("rewrite query failed: %w", err) } } @@ -463,7 +495,7 @@ optionLoop: } sd := c.statementCache.Get(sql) if sd == nil { - sd, err = c.Prepare(ctx, stmtcache.NextStatementName(), sql) + sd, err = c.Prepare(ctx, stmtcache.StatementName(sql), sql) if err != nil { return pgconn.CommandTag{}, err } @@ -481,6 +513,7 @@ optionLoop: if err != nil { return pgconn.CommandTag{}, err } + c.descriptionCache.Put(sd) } return c.execParams(ctx, sd, arguments) @@ -509,7 +542,7 @@ func (c *Conn) execSimpleProtocol(ctx context.Context, sql string, arguments []a mrr := c.pgConn.Exec(ctx, sql) for mrr.NextResult() { - commandTag, err = mrr.ResultReader().Close() + commandTag, _ = mrr.ResultReader().Close() } err = mrr.Close() return commandTag, err @@ -575,30 +608,35 @@ type QueryExecMode int32 const ( _ QueryExecMode = iota - // Automatically prepare and cache statements. This uses the extended protocol. Queries are executed in a single - // round trip after the statement is cached. This is the default. + // Automatically prepare and cache statements. This uses the extended protocol. Queries are executed in a single round + // trip after the statement is cached. This is the default. If the database schema is modified or the search_path is + // changed after a statement is cached then the first execution of a previously cached query may fail. e.g. If the + // number of columns returned by a "SELECT *" changes or the type of a column is changed. QueryExecModeCacheStatement - // Cache statement descriptions (i.e. argument and result types) and assume they do not change. This uses the - // extended protocol. Queries are executed in a single round trip after the description is cached. If the database - // schema is modified or the search_path is changed this may result in undetected result decoding errors. + // Cache statement descriptions (i.e. argument and result types) and assume they do not change. This uses the extended + // protocol. Queries are executed in a single round trip after the description is cached. If the database schema is + // modified or the search_path is changed after a statement is cached then the first execution of a previously cached + // query may fail. e.g. If the number of columns returned by a "SELECT *" changes or the type of a column is changed. QueryExecModeCacheDescribe // Get the statement description on every execution. This uses the extended protocol. Queries require two round trips - // to execute. It does not use prepared statements (allowing usage with most connection poolers) and is safe even - // when the the database schema is modified concurrently. + // to execute. It does not use named prepared statements. But it does use the unnamed prepared statement to get the + // statement description on the first round trip and then uses it to execute the query on the second round trip. This + // may cause problems with connection poolers that switch the underlying connection between round trips. It is safe + // even when the the database schema is modified concurrently. QueryExecModeDescribeExec // Assume the PostgreSQL query parameter types based on the Go type of the arguments. This uses the extended protocol // with text formatted parameters and results. Queries are executed in a single round trip. Type mappings can be // registered with pgtype.Map.RegisterDefaultPgType. Queries will be rejected that have arguments that are - // unregistered or ambigious. e.g. A map[string]string may have the PostgreSQL type json or hstore. Modes that know + // unregistered or ambiguous. e.g. A map[string]string may have the PostgreSQL type json or hstore. Modes that know // the PostgreSQL type can use a map[string]string directly as an argument. This mode cannot. QueryExecModeExec // Use the simple protocol. Assume the PostgreSQL query parameter types based on the Go type of the arguments. // Queries are executed in a single round trip. Type mappings can be registered with - // pgtype.Map.RegisterDefaultPgType. Queries will be rejected that have arguments that are unregistered or ambigious. + // pgtype.Map.RegisterDefaultPgType. Queries will be rejected that have arguments that are unregistered or ambiguous. // e.g. A map[string]string may have the PostgreSQL type json or hstore. Modes that know the PostgreSQL type can use // a map[string]string directly as an argument. This mode cannot. // @@ -648,6 +686,9 @@ type QueryRewriter interface { // returned Rows even if an error is returned. The error will be the available in rows.Err() after rows are closed. It // is allowed to ignore the error returned from Query and handle it in Rows. // +// It is possible for a call of FieldDescriptions on the returned Rows to return nil even if the Query call did not +// return an error. +// // It is possible for a query to return one or more rows before encountering an error. In most cases the rows should be // collected before processing rather than processed while receiving each row. This avoids the possibility of the // application processing rows from a query that the server rejected. The CollectRows function is useful here. @@ -702,7 +743,7 @@ optionLoop: sql, args, err = queryRewriter.RewriteQuery(ctx, c, sql, args) if err != nil { rows := c.getRows(ctx, originalSQL, originalArgs) - err = fmt.Errorf("rewrite query failed: %v", err) + err = fmt.Errorf("rewrite query failed: %w", err) rows.fatal(err) return rows, err } @@ -812,7 +853,7 @@ func (c *Conn) getStatementDescription( } sd = c.statementCache.Get(sql) if sd == nil { - sd, err = c.Prepare(ctx, stmtcache.NextStatementName(), sql) + sd, err = c.Prepare(ctx, stmtcache.StatementName(sql), sql) if err != nil { return nil, err } @@ -862,15 +903,14 @@ func (c *Conn) SendBatch(ctx context.Context, b *Batch) (br BatchResults) { return &batchResults{ctx: ctx, conn: c, err: err} } - mode := c.config.DefaultQueryExecMode - - for _, bi := range b.queuedQueries { + for _, bi := range b.QueuedQueries { var queryRewriter QueryRewriter - sql := bi.query - arguments := bi.arguments + sql := bi.SQL + arguments := bi.Arguments optionLoop: for len(arguments) > 0 { + // Update Batch.Queue function comment when additional options are implemented switch arg := arguments[0].(type) { case QueryRewriter: queryRewriter = arg @@ -884,21 +924,23 @@ func (c *Conn) SendBatch(ctx context.Context, b *Batch) (br BatchResults) { var err error sql, arguments, err = queryRewriter.RewriteQuery(ctx, c, sql, arguments) if err != nil { - return &batchResults{ctx: ctx, conn: c, err: fmt.Errorf("rewrite query failed: %v", err)} + return &batchResults{ctx: ctx, conn: c, err: fmt.Errorf("rewrite query failed: %w", err)} } } - bi.query = sql - bi.arguments = arguments + bi.SQL = sql + bi.Arguments = arguments } + // TODO: changing mode per batch? Update Batch.Queue function comment when implemented + mode := c.config.DefaultQueryExecMode if mode == QueryExecModeSimpleProtocol { return c.sendBatchQueryExecModeSimpleProtocol(ctx, b) } // All other modes use extended protocol and thus can use prepared statements. - for _, bi := range b.queuedQueries { - if sd, ok := c.preparedStatements[bi.query]; ok { + for _, bi := range b.QueuedQueries { + if sd, ok := c.preparedStatements[bi.SQL]; ok { bi.sd = sd } } @@ -919,11 +961,11 @@ func (c *Conn) SendBatch(ctx context.Context, b *Batch) (br BatchResults) { func (c *Conn) sendBatchQueryExecModeSimpleProtocol(ctx context.Context, b *Batch) *batchResults { var sb strings.Builder - for i, bi := range b.queuedQueries { + for i, bi := range b.QueuedQueries { if i > 0 { sb.WriteByte(';') } - sql, err := c.sanitizeForSimpleQuery(bi.query, bi.arguments...) + sql, err := c.sanitizeForSimpleQuery(bi.SQL, bi.Arguments...) if err != nil { return &batchResults{ctx: ctx, conn: c, err: err} } @@ -942,21 +984,21 @@ func (c *Conn) sendBatchQueryExecModeSimpleProtocol(ctx context.Context, b *Batc func (c *Conn) sendBatchQueryExecModeExec(ctx context.Context, b *Batch) *batchResults { batch := &pgconn.Batch{} - for _, bi := range b.queuedQueries { + for _, bi := range b.QueuedQueries { sd := bi.sd if sd != nil { - err := c.eqb.Build(c.typeMap, sd, bi.arguments) + err := c.eqb.Build(c.typeMap, sd, bi.Arguments) if err != nil { return &batchResults{ctx: ctx, conn: c, err: err} } batch.ExecPrepared(sd.Name, c.eqb.ParamValues, c.eqb.ParamFormats, c.eqb.ResultFormats) } else { - err := c.eqb.Build(c.typeMap, nil, bi.arguments) + err := c.eqb.Build(c.typeMap, nil, bi.Arguments) if err != nil { return &batchResults{ctx: ctx, conn: c, err: err} } - batch.ExecParams(bi.query, c.eqb.ParamValues, nil, c.eqb.ParamFormats, c.eqb.ResultFormats) + batch.ExecParams(bi.SQL, c.eqb.ParamValues, nil, c.eqb.ParamFormats, c.eqb.ResultFormats) } } @@ -975,24 +1017,24 @@ func (c *Conn) sendBatchQueryExecModeExec(ctx context.Context, b *Batch) *batchR func (c *Conn) sendBatchQueryExecModeCacheStatement(ctx context.Context, b *Batch) (pbr *pipelineBatchResults) { if c.statementCache == nil { - return &pipelineBatchResults{ctx: ctx, conn: c, err: errDisabledStatementCache} + return &pipelineBatchResults{ctx: ctx, conn: c, err: errDisabledStatementCache, closed: true} } distinctNewQueries := []*pgconn.StatementDescription{} distinctNewQueriesIdxMap := make(map[string]int) - for _, bi := range b.queuedQueries { + for _, bi := range b.QueuedQueries { if bi.sd == nil { - sd := c.statementCache.Get(bi.query) + sd := c.statementCache.Get(bi.SQL) if sd != nil { bi.sd = sd } else { - if idx, present := distinctNewQueriesIdxMap[bi.query]; present { + if idx, present := distinctNewQueriesIdxMap[bi.SQL]; present { bi.sd = distinctNewQueries[idx] } else { sd = &pgconn.StatementDescription{ - Name: stmtcache.NextStatementName(), - SQL: bi.query, + Name: stmtcache.StatementName(bi.SQL), + SQL: bi.SQL, } distinctNewQueriesIdxMap[sd.SQL] = len(distinctNewQueries) distinctNewQueries = append(distinctNewQueries, sd) @@ -1007,23 +1049,23 @@ func (c *Conn) sendBatchQueryExecModeCacheStatement(ctx context.Context, b *Batc func (c *Conn) sendBatchQueryExecModeCacheDescribe(ctx context.Context, b *Batch) (pbr *pipelineBatchResults) { if c.descriptionCache == nil { - return &pipelineBatchResults{ctx: ctx, conn: c, err: errDisabledDescriptionCache} + return &pipelineBatchResults{ctx: ctx, conn: c, err: errDisabledDescriptionCache, closed: true} } distinctNewQueries := []*pgconn.StatementDescription{} distinctNewQueriesIdxMap := make(map[string]int) - for _, bi := range b.queuedQueries { + for _, bi := range b.QueuedQueries { if bi.sd == nil { - sd := c.descriptionCache.Get(bi.query) + sd := c.descriptionCache.Get(bi.SQL) if sd != nil { bi.sd = sd } else { - if idx, present := distinctNewQueriesIdxMap[bi.query]; present { + if idx, present := distinctNewQueriesIdxMap[bi.SQL]; present { bi.sd = distinctNewQueries[idx] } else { sd = &pgconn.StatementDescription{ - SQL: bi.query, + SQL: bi.SQL, } distinctNewQueriesIdxMap[sd.SQL] = len(distinctNewQueries) distinctNewQueries = append(distinctNewQueries, sd) @@ -1040,13 +1082,13 @@ func (c *Conn) sendBatchQueryExecModeDescribeExec(ctx context.Context, b *Batch) distinctNewQueries := []*pgconn.StatementDescription{} distinctNewQueriesIdxMap := make(map[string]int) - for _, bi := range b.queuedQueries { + for _, bi := range b.QueuedQueries { if bi.sd == nil { - if idx, present := distinctNewQueriesIdxMap[bi.query]; present { + if idx, present := distinctNewQueriesIdxMap[bi.SQL]; present { bi.sd = distinctNewQueries[idx] } else { sd := &pgconn.StatementDescription{ - SQL: bi.query, + SQL: bi.SQL, } distinctNewQueriesIdxMap[sd.SQL] = len(distinctNewQueries) distinctNewQueries = append(distinctNewQueries, sd) @@ -1059,9 +1101,9 @@ func (c *Conn) sendBatchQueryExecModeDescribeExec(ctx context.Context, b *Batch) } func (c *Conn) sendBatchExtendedWithDescription(ctx context.Context, b *Batch, distinctNewQueries []*pgconn.StatementDescription, sdCache stmtcache.Cache) (pbr *pipelineBatchResults) { - pipeline := c.pgConn.StartPipeline(context.Background()) + pipeline := c.pgConn.StartPipeline(ctx) defer func() { - if pbr.err != nil { + if pbr != nil && pbr.err != nil { pipeline.Close() } }() @@ -1074,18 +1116,18 @@ func (c *Conn) sendBatchExtendedWithDescription(ctx context.Context, b *Batch, d err := pipeline.Sync() if err != nil { - return &pipelineBatchResults{ctx: ctx, conn: c, err: err} + return &pipelineBatchResults{ctx: ctx, conn: c, err: err, closed: true} } for _, sd := range distinctNewQueries { results, err := pipeline.GetResults() if err != nil { - return &pipelineBatchResults{ctx: ctx, conn: c, err: err} + return &pipelineBatchResults{ctx: ctx, conn: c, err: err, closed: true} } resultSD, ok := results.(*pgconn.StatementDescription) if !ok { - return &pipelineBatchResults{ctx: ctx, conn: c, err: fmt.Errorf("expected statement description, got %T", results)} + return &pipelineBatchResults{ctx: ctx, conn: c, err: fmt.Errorf("expected statement description, got %T", results), closed: true} } // Fill in the previously empty / pending statement descriptions. @@ -1095,12 +1137,12 @@ func (c *Conn) sendBatchExtendedWithDescription(ctx context.Context, b *Batch, d results, err := pipeline.GetResults() if err != nil { - return &pipelineBatchResults{ctx: ctx, conn: c, err: err} + return &pipelineBatchResults{ctx: ctx, conn: c, err: err, closed: true} } _, ok := results.(*pgconn.PipelineSync) if !ok { - return &pipelineBatchResults{ctx: ctx, conn: c, err: fmt.Errorf("expected sync, got %T", results)} + return &pipelineBatchResults{ctx: ctx, conn: c, err: fmt.Errorf("expected sync, got %T", results), closed: true} } } @@ -1112,12 +1154,12 @@ func (c *Conn) sendBatchExtendedWithDescription(ctx context.Context, b *Batch, d } // Queue the queries. - for _, bi := range b.queuedQueries { - err := c.eqb.Build(c.typeMap, bi.sd, bi.arguments) + for _, bi := range b.QueuedQueries { + err := c.eqb.Build(c.typeMap, bi.sd, bi.Arguments) if err != nil { // we wrap the error so we the user can understand which query failed inside the batch - err = fmt.Errorf("error building query %s: %w", bi.query, err) - return &pipelineBatchResults{ctx: ctx, conn: c, err: err} + err = fmt.Errorf("error building query %s: %w", bi.SQL, err) + return &pipelineBatchResults{ctx: ctx, conn: c, err: err, closed: true} } if bi.sd.Name == "" { @@ -1129,7 +1171,7 @@ func (c *Conn) sendBatchExtendedWithDescription(ctx context.Context, b *Batch, d err := pipeline.Sync() if err != nil { - return &pipelineBatchResults{ctx: ctx, conn: c, err: err} + return &pipelineBatchResults{ctx: ctx, conn: c, err: err, closed: true} } return &pipelineBatchResults{ @@ -1161,7 +1203,15 @@ func (c *Conn) sanitizeForSimpleQuery(sql string, args ...any) (string, error) { return sanitize.SanitizeSQL(sql, valueArgs...) } -// LoadType inspects the database for typeName and produces a pgtype.Type suitable for registration. +// LoadType inspects the database for typeName and produces a pgtype.Type suitable for registration. typeName must be +// the name of a type where the underlying type(s) is already understood by pgx. It is for derived types. In particular, +// typeName must be one of the following: +// - An array type name of a type that is already registered. e.g. "_foo" when "foo" is registered. +// - A composite type name where all field types are already registered. +// - A domain type name where the base type is already registered. +// - An enum type name. +// - A range type name where the element type is already registered. +// - A multirange type name where the element type is already registered. func (c *Conn) LoadType(ctx context.Context, typeName string) (*pgtype.Type, error) { var oid uint32 @@ -1282,7 +1332,9 @@ func (c *Conn) getCompositeFields(ctx context.Context, oid uint32) ([]pgtype.Com var fieldOID uint32 rows, _ := c.Query(ctx, `select attname, atttypid from pg_attribute -where attrelid=$1 and not attisdropped +where attrelid=$1 + and not attisdropped + and attnum > 0 order by attnum`, typrelid, ) @@ -1302,17 +1354,17 @@ order by attnum`, } func (c *Conn) deallocateInvalidatedCachedStatements(ctx context.Context) error { - if c.pgConn.TxStatus() != 'I' { + if txStatus := c.pgConn.TxStatus(); txStatus != 'I' && txStatus != 'T' { return nil } if c.descriptionCache != nil { - c.descriptionCache.HandleInvalidated() + c.descriptionCache.RemoveInvalidated() } var invalidatedStatements []*pgconn.StatementDescription if c.statementCache != nil { - invalidatedStatements = c.statementCache.HandleInvalidated() + invalidatedStatements = c.statementCache.GetInvalidated() } if len(invalidatedStatements) == 0 { @@ -1336,5 +1388,10 @@ func (c *Conn) deallocateInvalidatedCachedStatements(ctx context.Context) error return fmt.Errorf("failed to deallocate cached statement(s): %w", err) } + c.statementCache.RemoveInvalidated() + for _, sd := range invalidatedStatements { + delete(c.preparedStatements, sd.Name) + } + return nil } diff --git a/vendor/github.com/jackc/pgx/v5/copy_from.go b/vendor/github.com/jackc/pgx/v5/copy_from.go index a2c227fd..abcd2239 100644 --- a/vendor/github.com/jackc/pgx/v5/copy_from.go +++ b/vendor/github.com/jackc/pgx/v5/copy_from.go @@ -64,6 +64,33 @@ func (cts *copyFromSlice) Err() error { return cts.err } +// CopyFromFunc returns a CopyFromSource interface that relies on nxtf for values. +// nxtf returns rows until it either signals an 'end of data' by returning row=nil and err=nil, +// or it returns an error. If nxtf returns an error, the copy is aborted. +func CopyFromFunc(nxtf func() (row []any, err error)) CopyFromSource { + return ©FromFunc{next: nxtf} +} + +type copyFromFunc struct { + next func() ([]any, error) + valueRow []any + err error +} + +func (g *copyFromFunc) Next() bool { + g.valueRow, g.err = g.next() + // only return true if valueRow exists and no error + return g.valueRow != nil && g.err == nil +} + +func (g *copyFromFunc) Values() ([]any, error) { + return g.valueRow, g.err +} + +func (g *copyFromFunc) Err() error { + return g.err +} + // CopyFromSource is the interface used by *Conn.CopyFrom as the source for copy data. type CopyFromSource interface { // Next returns true if there is another row and makes the next row data diff --git a/vendor/github.com/jackc/pgx/v5/doc.go b/vendor/github.com/jackc/pgx/v5/doc.go index 0db8cbb1..db99fc4c 100644 --- a/vendor/github.com/jackc/pgx/v5/doc.go +++ b/vendor/github.com/jackc/pgx/v5/doc.go @@ -7,17 +7,17 @@ details. Establishing a Connection -The primary way of establishing a connection is with `pgx.Connect`. +The primary way of establishing a connection is with [pgx.Connect]: conn, err := pgx.Connect(context.Background(), os.Getenv("DATABASE_URL")) The database connection string can be in URL or DSN format. Both PostgreSQL settings and pgx settings can be specified -here. In addition, a config struct can be created by `ParseConfig` and modified before establishing the connection with -`ConnectConfig` to configure settings such as tracing that cannot be configured with a connection string. +here. In addition, a config struct can be created by [ParseConfig] and modified before establishing the connection with +[ConnectConfig] to configure settings such as tracing that cannot be configured with a connection string. Connection Pool -`*pgx.Conn` represents a single connection to the database and is not concurrency safe. Use package +[*pgx.Conn] represents a single connection to the database and is not concurrency safe. Use package github.com/jackc/pgx/v5/pgxpool for a concurrency safe connection pool. Query Interface @@ -187,7 +187,7 @@ implemented on top of pgconn. The Conn.PgConn() method can be used to access thi PgBouncer -By default pgx automatically uses prepared statements. Prepared statements are incompaptible with PgBouncer. This can be +By default pgx automatically uses prepared statements. Prepared statements are incompatible with PgBouncer. This can be disabled by setting a different QueryExecMode in ConnConfig.DefaultQueryExecMode. */ package pgx diff --git a/vendor/github.com/jackc/pgx/v5/extended_query_builder.go b/vendor/github.com/jackc/pgx/v5/extended_query_builder.go index 0bbdfbb5..9c9de5b2 100644 --- a/vendor/github.com/jackc/pgx/v5/extended_query_builder.go +++ b/vendor/github.com/jackc/pgx/v5/extended_query_builder.go @@ -36,7 +36,7 @@ func (eqb *ExtendedQueryBuilder) Build(m *pgtype.Map, sd *pgconn.StatementDescri for i := range args { err := eqb.appendParam(m, sd.ParamOIDs[i], -1, args[i]) if err != nil { - err = fmt.Errorf("failed to encode args[%d]: %v", i, err) + err = fmt.Errorf("failed to encode args[%d]: %w", i, err) return err } } diff --git a/vendor/github.com/jackc/pgx/v5/internal/nbconn/bufferqueue.go b/vendor/github.com/jackc/pgx/v5/internal/nbconn/bufferqueue.go deleted file mode 100644 index 4bf25481..00000000 --- a/vendor/github.com/jackc/pgx/v5/internal/nbconn/bufferqueue.go +++ /dev/null @@ -1,70 +0,0 @@ -package nbconn - -import ( - "sync" -) - -const minBufferQueueLen = 8 - -type bufferQueue struct { - lock sync.Mutex - queue []*[]byte - r, w int -} - -func (bq *bufferQueue) pushBack(buf *[]byte) { - bq.lock.Lock() - defer bq.lock.Unlock() - - if bq.w >= len(bq.queue) { - bq.growQueue() - } - bq.queue[bq.w] = buf - bq.w++ -} - -func (bq *bufferQueue) pushFront(buf *[]byte) { - bq.lock.Lock() - defer bq.lock.Unlock() - - if bq.w >= len(bq.queue) { - bq.growQueue() - } - copy(bq.queue[bq.r+1:bq.w+1], bq.queue[bq.r:bq.w]) - bq.queue[bq.r] = buf - bq.w++ -} - -func (bq *bufferQueue) popFront() *[]byte { - bq.lock.Lock() - defer bq.lock.Unlock() - - if bq.r == bq.w { - return nil - } - - buf := bq.queue[bq.r] - bq.queue[bq.r] = nil // Clear reference so it can be garbage collected. - bq.r++ - - if bq.r == bq.w { - bq.r = 0 - bq.w = 0 - if len(bq.queue) > minBufferQueueLen { - bq.queue = make([]*[]byte, minBufferQueueLen) - } - } - - return buf -} - -func (bq *bufferQueue) growQueue() { - desiredLen := (len(bq.queue) + 1) * 3 / 2 - if desiredLen < minBufferQueueLen { - desiredLen = minBufferQueueLen - } - - newQueue := make([]*[]byte, desiredLen) - copy(newQueue, bq.queue) - bq.queue = newQueue -} diff --git a/vendor/github.com/jackc/pgx/v5/internal/nbconn/nbconn.go b/vendor/github.com/jackc/pgx/v5/internal/nbconn/nbconn.go deleted file mode 100644 index 7a38383f..00000000 --- a/vendor/github.com/jackc/pgx/v5/internal/nbconn/nbconn.go +++ /dev/null @@ -1,520 +0,0 @@ -// Package nbconn implements a non-blocking net.Conn wrapper. -// -// It is designed to solve three problems. -// -// The first is resolving the deadlock that can occur when both sides of a connection are blocked writing because all -// buffers between are full. See https://github.com/jackc/pgconn/issues/27 for discussion. -// -// The second is the inability to use a write deadline with a TLS.Conn without killing the connection. -// -// The third is to efficiently check if a connection has been closed via a non-blocking read. -package nbconn - -import ( - "crypto/tls" - "errors" - "net" - "os" - "sync" - "sync/atomic" - "syscall" - "time" - - "github.com/jackc/pgx/v5/internal/iobufpool" -) - -var errClosed = errors.New("closed") -var ErrWouldBlock = new(wouldBlockError) - -const fakeNonblockingWriteWaitDuration = 100 * time.Millisecond -const minNonblockingReadWaitDuration = time.Microsecond -const maxNonblockingReadWaitDuration = 100 * time.Millisecond - -// NonBlockingDeadline is a magic value that when passed to Set[Read]Deadline places the connection in non-blocking read -// mode. -var NonBlockingDeadline = time.Date(1900, 1, 1, 0, 0, 0, 608536336, time.UTC) - -// disableSetDeadlineDeadline is a magic value that when passed to Set[Read|Write]Deadline causes those methods to -// ignore all future calls. -var disableSetDeadlineDeadline = time.Date(1900, 1, 1, 0, 0, 0, 968549727, time.UTC) - -// wouldBlockError implements net.Error so tls.Conn will recognize ErrWouldBlock as a temporary error. -type wouldBlockError struct{} - -func (*wouldBlockError) Error() string { - return "would block" -} - -func (*wouldBlockError) Timeout() bool { return true } -func (*wouldBlockError) Temporary() bool { return true } - -// Conn is a net.Conn where Write never blocks and always succeeds. Flush or Read must be called to actually write to -// the underlying connection. -type Conn interface { - net.Conn - - // Flush flushes any buffered writes. - Flush() error - - // BufferReadUntilBlock reads and buffers any successfully read bytes until the read would block. - BufferReadUntilBlock() error -} - -// NetConn is a non-blocking net.Conn wrapper. It implements net.Conn. -type NetConn struct { - // 64 bit fields accessed with atomics must be at beginning of struct to guarantee alignment for certain 32-bit - // architectures. See BUGS section of https://pkg.go.dev/sync/atomic and https://github.com/jackc/pgx/issues/1288 and - // https://github.com/jackc/pgx/issues/1307. Only access with atomics - closed int64 // 0 = not closed, 1 = closed - - conn net.Conn - rawConn syscall.RawConn - - readQueue bufferQueue - writeQueue bufferQueue - - readFlushLock sync.Mutex - // non-blocking writes with syscall.RawConn are done with a callback function. By using these fields instead of the - // callback functions closure to pass the buf argument and receive the n and err results we avoid some allocations. - nonblockWriteFunc func(fd uintptr) (done bool) - nonblockWriteBuf []byte - nonblockWriteErr error - nonblockWriteN int - - // non-blocking reads with syscall.RawConn are done with a callback function. By using these fields instead of the - // callback functions closure to pass the buf argument and receive the n and err results we avoid some allocations. - nonblockReadFunc func(fd uintptr) (done bool) - nonblockReadBuf []byte - nonblockReadErr error - nonblockReadN int - - readDeadlineLock sync.Mutex - readDeadline time.Time - readNonblocking bool - fakeNonBlockingShortReadCount int - fakeNonblockingReadWaitDuration time.Duration - - writeDeadlineLock sync.Mutex - writeDeadline time.Time -} - -func NewNetConn(conn net.Conn, fakeNonBlockingIO bool) *NetConn { - nc := &NetConn{ - conn: conn, - fakeNonblockingReadWaitDuration: maxNonblockingReadWaitDuration, - } - - if !fakeNonBlockingIO { - if sc, ok := conn.(syscall.Conn); ok { - if rawConn, err := sc.SyscallConn(); err == nil { - nc.rawConn = rawConn - } - } - } - - return nc -} - -// Read implements io.Reader. -func (c *NetConn) Read(b []byte) (n int, err error) { - if c.isClosed() { - return 0, errClosed - } - - c.readFlushLock.Lock() - defer c.readFlushLock.Unlock() - - err = c.flush() - if err != nil { - return 0, err - } - - for n < len(b) { - buf := c.readQueue.popFront() - if buf == nil { - break - } - copiedN := copy(b[n:], *buf) - if copiedN < len(*buf) { - *buf = (*buf)[copiedN:] - c.readQueue.pushFront(buf) - } else { - iobufpool.Put(buf) - } - n += copiedN - } - - // If any bytes were already buffered return them without trying to do a Read. Otherwise, when the caller is trying to - // Read up to len(b) bytes but all available bytes have already been buffered the underlying Read would block. - if n > 0 { - return n, nil - } - - var readNonblocking bool - c.readDeadlineLock.Lock() - readNonblocking = c.readNonblocking - c.readDeadlineLock.Unlock() - - var readN int - if readNonblocking { - readN, err = c.nonblockingRead(b[n:]) - } else { - readN, err = c.conn.Read(b[n:]) - } - n += readN - return n, err -} - -// Write implements io.Writer. It never blocks due to buffering all writes. It will only return an error if the Conn is -// closed. Call Flush to actually write to the underlying connection. -func (c *NetConn) Write(b []byte) (n int, err error) { - if c.isClosed() { - return 0, errClosed - } - - buf := iobufpool.Get(len(b)) - copy(*buf, b) - c.writeQueue.pushBack(buf) - return len(b), nil -} - -func (c *NetConn) Close() (err error) { - swapped := atomic.CompareAndSwapInt64(&c.closed, 0, 1) - if !swapped { - return errClosed - } - - defer func() { - closeErr := c.conn.Close() - if err == nil { - err = closeErr - } - }() - - c.readFlushLock.Lock() - defer c.readFlushLock.Unlock() - err = c.flush() - if err != nil { - return err - } - - return nil -} - -func (c *NetConn) LocalAddr() net.Addr { - return c.conn.LocalAddr() -} - -func (c *NetConn) RemoteAddr() net.Addr { - return c.conn.RemoteAddr() -} - -// SetDeadline is the equivalent of calling SetReadDealine(t) and SetWriteDeadline(t). -func (c *NetConn) SetDeadline(t time.Time) error { - err := c.SetReadDeadline(t) - if err != nil { - return err - } - return c.SetWriteDeadline(t) -} - -// SetReadDeadline sets the read deadline as t. If t == NonBlockingDeadline then future reads will be non-blocking. -func (c *NetConn) SetReadDeadline(t time.Time) error { - if c.isClosed() { - return errClosed - } - - c.readDeadlineLock.Lock() - defer c.readDeadlineLock.Unlock() - if c.readDeadline == disableSetDeadlineDeadline { - return nil - } - if t == disableSetDeadlineDeadline { - c.readDeadline = t - return nil - } - - if t == NonBlockingDeadline { - c.readNonblocking = true - t = time.Time{} - } else { - c.readNonblocking = false - } - - c.readDeadline = t - - return c.conn.SetReadDeadline(t) -} - -func (c *NetConn) SetWriteDeadline(t time.Time) error { - if c.isClosed() { - return errClosed - } - - c.writeDeadlineLock.Lock() - defer c.writeDeadlineLock.Unlock() - if c.writeDeadline == disableSetDeadlineDeadline { - return nil - } - if t == disableSetDeadlineDeadline { - c.writeDeadline = t - return nil - } - - c.writeDeadline = t - - return c.conn.SetWriteDeadline(t) -} - -func (c *NetConn) Flush() error { - if c.isClosed() { - return errClosed - } - - c.readFlushLock.Lock() - defer c.readFlushLock.Unlock() - return c.flush() -} - -// flush does the actual work of flushing the writeQueue. readFlushLock must already be held. -func (c *NetConn) flush() error { - var stopChan chan struct{} - var errChan chan error - - defer func() { - if stopChan != nil { - select { - case stopChan <- struct{}{}: - case <-errChan: - } - } - }() - - for buf := c.writeQueue.popFront(); buf != nil; buf = c.writeQueue.popFront() { - remainingBuf := *buf - for len(remainingBuf) > 0 { - n, err := c.nonblockingWrite(remainingBuf) - remainingBuf = remainingBuf[n:] - if err != nil { - if !errors.Is(err, ErrWouldBlock) { - *buf = (*buf)[:len(remainingBuf)] - copy(*buf, remainingBuf) - c.writeQueue.pushFront(buf) - return err - } - - // Writing was blocked. Reading might unblock it. - if stopChan == nil { - stopChan, errChan = c.bufferNonblockingRead() - } - - select { - case err := <-errChan: - stopChan = nil - return err - default: - } - - } - } - iobufpool.Put(buf) - } - - return nil -} - -func (c *NetConn) BufferReadUntilBlock() error { - for { - buf := iobufpool.Get(8 * 1024) - n, err := c.nonblockingRead(*buf) - if n > 0 { - *buf = (*buf)[:n] - c.readQueue.pushBack(buf) - } else if n == 0 { - iobufpool.Put(buf) - } - - if err != nil { - if errors.Is(err, ErrWouldBlock) { - return nil - } else { - return err - } - } - } -} - -func (c *NetConn) bufferNonblockingRead() (stopChan chan struct{}, errChan chan error) { - stopChan = make(chan struct{}) - errChan = make(chan error, 1) - - go func() { - for { - err := c.BufferReadUntilBlock() - if err != nil { - errChan <- err - return - } - - select { - case <-stopChan: - return - default: - } - } - }() - - return stopChan, errChan -} - -func (c *NetConn) isClosed() bool { - closed := atomic.LoadInt64(&c.closed) - return closed == 1 -} - -func (c *NetConn) nonblockingWrite(b []byte) (n int, err error) { - if c.rawConn == nil { - return c.fakeNonblockingWrite(b) - } else { - return c.realNonblockingWrite(b) - } -} - -func (c *NetConn) fakeNonblockingWrite(b []byte) (n int, err error) { - c.writeDeadlineLock.Lock() - defer c.writeDeadlineLock.Unlock() - - deadline := time.Now().Add(fakeNonblockingWriteWaitDuration) - if c.writeDeadline.IsZero() || deadline.Before(c.writeDeadline) { - err = c.conn.SetWriteDeadline(deadline) - if err != nil { - return 0, err - } - defer func() { - // Ignoring error resetting deadline as there is nothing that can reasonably be done if it fails. - c.conn.SetWriteDeadline(c.writeDeadline) - - if err != nil { - if errors.Is(err, os.ErrDeadlineExceeded) { - err = ErrWouldBlock - } - } - }() - } - - return c.conn.Write(b) -} - -func (c *NetConn) nonblockingRead(b []byte) (n int, err error) { - if c.rawConn == nil { - return c.fakeNonblockingRead(b) - } else { - return c.realNonblockingRead(b) - } -} - -func (c *NetConn) fakeNonblockingRead(b []byte) (n int, err error) { - c.readDeadlineLock.Lock() - defer c.readDeadlineLock.Unlock() - - // The first 5 reads only read 1 byte at a time. This should give us 4 chances to read when we are sure the bytes are - // already in Go or the OS's receive buffer. - if c.fakeNonBlockingShortReadCount < 5 && len(b) > 0 && c.fakeNonblockingReadWaitDuration < minNonblockingReadWaitDuration { - b = b[:1] - } - - startTime := time.Now() - deadline := startTime.Add(c.fakeNonblockingReadWaitDuration) - if c.readDeadline.IsZero() || deadline.Before(c.readDeadline) { - err = c.conn.SetReadDeadline(deadline) - if err != nil { - return 0, err - } - defer func() { - // If the read was successful and the wait duration is not already the minimum - if err == nil && c.fakeNonblockingReadWaitDuration > minNonblockingReadWaitDuration { - endTime := time.Now() - - if n > 0 && c.fakeNonBlockingShortReadCount < 5 { - c.fakeNonBlockingShortReadCount++ - } - - // The wait duration should be 2x the fastest read that has occurred. This should give reasonable assurance that - // a Read deadline will not block a read before it has a chance to read data already in Go or the OS's receive - // buffer. - proposedWait := endTime.Sub(startTime) * 2 - if proposedWait < minNonblockingReadWaitDuration { - proposedWait = minNonblockingReadWaitDuration - } - if proposedWait < c.fakeNonblockingReadWaitDuration { - c.fakeNonblockingReadWaitDuration = proposedWait - } - } - - // Ignoring error resetting deadline as there is nothing that can reasonably be done if it fails. - c.conn.SetReadDeadline(c.readDeadline) - - if err != nil { - if errors.Is(err, os.ErrDeadlineExceeded) { - err = ErrWouldBlock - } - } - }() - } - - return c.conn.Read(b) -} - -// syscall.Conn is interface - -// TLSClient establishes a TLS connection as a client over conn using config. -// -// To avoid the first Read on the returned *TLSConn also triggering a Write due to the TLS handshake and thereby -// potentially causing a read and write deadlines to behave unexpectedly, Handshake is called explicitly before the -// *TLSConn is returned. -func TLSClient(conn *NetConn, config *tls.Config) (*TLSConn, error) { - tc := tls.Client(conn, config) - err := tc.Handshake() - if err != nil { - return nil, err - } - - // Ensure last written part of Handshake is actually sent. - err = conn.Flush() - if err != nil { - return nil, err - } - - return &TLSConn{ - tlsConn: tc, - nbConn: conn, - }, nil -} - -// TLSConn is a TLS wrapper around a *Conn. It works around a temporary write error (such as a timeout) being fatal to a -// tls.Conn. -type TLSConn struct { - tlsConn *tls.Conn - nbConn *NetConn -} - -func (tc *TLSConn) Read(b []byte) (n int, err error) { return tc.tlsConn.Read(b) } -func (tc *TLSConn) Write(b []byte) (n int, err error) { return tc.tlsConn.Write(b) } -func (tc *TLSConn) BufferReadUntilBlock() error { return tc.nbConn.BufferReadUntilBlock() } -func (tc *TLSConn) Flush() error { return tc.nbConn.Flush() } -func (tc *TLSConn) LocalAddr() net.Addr { return tc.tlsConn.LocalAddr() } -func (tc *TLSConn) RemoteAddr() net.Addr { return tc.tlsConn.RemoteAddr() } - -func (tc *TLSConn) Close() error { - // tls.Conn.closeNotify() sets a 5 second deadline to avoid blocking, sends a TLS alert close notification, and then - // sets the deadline to now. This causes NetConn's Close not to be able to flush the write buffer. Instead we set our - // own 5 second deadline then make all set deadlines no-op. - tc.tlsConn.SetDeadline(time.Now().Add(time.Second * 5)) - tc.tlsConn.SetDeadline(disableSetDeadlineDeadline) - - return tc.tlsConn.Close() -} - -func (tc *TLSConn) SetDeadline(t time.Time) error { return tc.tlsConn.SetDeadline(t) } -func (tc *TLSConn) SetReadDeadline(t time.Time) error { return tc.tlsConn.SetReadDeadline(t) } -func (tc *TLSConn) SetWriteDeadline(t time.Time) error { return tc.tlsConn.SetWriteDeadline(t) } diff --git a/vendor/github.com/jackc/pgx/v5/internal/nbconn/nbconn_fake_non_block.go b/vendor/github.com/jackc/pgx/v5/internal/nbconn/nbconn_fake_non_block.go deleted file mode 100644 index 4915c621..00000000 --- a/vendor/github.com/jackc/pgx/v5/internal/nbconn/nbconn_fake_non_block.go +++ /dev/null @@ -1,11 +0,0 @@ -//go:build !unix - -package nbconn - -func (c *NetConn) realNonblockingWrite(b []byte) (n int, err error) { - return c.fakeNonblockingWrite(b) -} - -func (c *NetConn) realNonblockingRead(b []byte) (n int, err error) { - return c.fakeNonblockingRead(b) -} diff --git a/vendor/github.com/jackc/pgx/v5/internal/nbconn/nbconn_real_non_block.go b/vendor/github.com/jackc/pgx/v5/internal/nbconn/nbconn_real_non_block.go deleted file mode 100644 index e93372f2..00000000 --- a/vendor/github.com/jackc/pgx/v5/internal/nbconn/nbconn_real_non_block.go +++ /dev/null @@ -1,81 +0,0 @@ -//go:build unix - -package nbconn - -import ( - "errors" - "io" - "syscall" -) - -// realNonblockingWrite does a non-blocking write. readFlushLock must already be held. -func (c *NetConn) realNonblockingWrite(b []byte) (n int, err error) { - if c.nonblockWriteFunc == nil { - c.nonblockWriteFunc = func(fd uintptr) (done bool) { - c.nonblockWriteN, c.nonblockWriteErr = syscall.Write(int(fd), c.nonblockWriteBuf) - return true - } - } - c.nonblockWriteBuf = b - c.nonblockWriteN = 0 - c.nonblockWriteErr = nil - - err = c.rawConn.Write(c.nonblockWriteFunc) - n = c.nonblockWriteN - c.nonblockWriteBuf = nil // ensure that no reference to b is kept. - if err == nil && c.nonblockWriteErr != nil { - if errors.Is(c.nonblockWriteErr, syscall.EWOULDBLOCK) { - err = ErrWouldBlock - } else { - err = c.nonblockWriteErr - } - } - if err != nil { - // n may be -1 when an error occurs. - if n < 0 { - n = 0 - } - - return n, err - } - - return n, nil -} - -func (c *NetConn) realNonblockingRead(b []byte) (n int, err error) { - if c.nonblockReadFunc == nil { - c.nonblockReadFunc = func(fd uintptr) (done bool) { - c.nonblockReadN, c.nonblockReadErr = syscall.Read(int(fd), c.nonblockReadBuf) - return true - } - } - c.nonblockReadBuf = b - c.nonblockReadN = 0 - c.nonblockReadErr = nil - - err = c.rawConn.Read(c.nonblockReadFunc) - n = c.nonblockReadN - c.nonblockReadBuf = nil // ensure that no reference to b is kept. - if err == nil && c.nonblockReadErr != nil { - if errors.Is(c.nonblockReadErr, syscall.EWOULDBLOCK) { - err = ErrWouldBlock - } else { - err = c.nonblockReadErr - } - } - if err != nil { - // n may be -1 when an error occurs. - if n < 0 { - n = 0 - } - - return n, err - } - - // syscall read did not return an error and 0 bytes were read means EOF. - if n == 0 { - return 0, io.EOF - } - - return n, nil -} diff --git a/vendor/github.com/jackc/pgx/v5/internal/sanitize/sanitize.go b/vendor/github.com/jackc/pgx/v5/internal/sanitize/sanitize.go index e9e6d228..08d24fe4 100644 --- a/vendor/github.com/jackc/pgx/v5/internal/sanitize/sanitize.go +++ b/vendor/github.com/jackc/pgx/v5/internal/sanitize/sanitize.go @@ -35,6 +35,11 @@ func (q *Query) Sanitize(args ...any) (string, error) { str = part case int: argIdx := part - 1 + + if argIdx < 0 { + return "", fmt.Errorf("first sql argument must be > 0") + } + if argIdx >= len(args) { return "", fmt.Errorf("insufficient arguments") } @@ -58,6 +63,10 @@ func (q *Query) Sanitize(args ...any) (string, error) { return "", fmt.Errorf("invalid arg type: %T", arg) } argUse[argIdx] = true + + // Prevent SQL injection via Line Comment Creation + // https://github.com/jackc/pgx/security/advisories/GHSA-m7wr-2xf7-cm9p + str = "(" + str + ")" default: return "", fmt.Errorf("invalid Part type: %T", part) } diff --git a/vendor/github.com/jackc/pgx/v5/internal/stmtcache/lru_cache.go b/vendor/github.com/jackc/pgx/v5/internal/stmtcache/lru_cache.go index a25cc8b1..dec83f47 100644 --- a/vendor/github.com/jackc/pgx/v5/internal/stmtcache/lru_cache.go +++ b/vendor/github.com/jackc/pgx/v5/internal/stmtcache/lru_cache.go @@ -34,7 +34,8 @@ func (c *LRUCache) Get(key string) *pgconn.StatementDescription { } -// Put stores sd in the cache. Put panics if sd.SQL is "". Put does nothing if sd.SQL already exists in the cache. +// Put stores sd in the cache. Put panics if sd.SQL is "". Put does nothing if sd.SQL already exists in the cache or +// sd.SQL has been invalidated and HandleInvalidated has not been called yet. func (c *LRUCache) Put(sd *pgconn.StatementDescription) { if sd.SQL == "" { panic("cannot store statement description with empty SQL") @@ -44,6 +45,13 @@ func (c *LRUCache) Put(sd *pgconn.StatementDescription) { return } + // The statement may have been invalidated but not yet handled. Do not readd it to the cache. + for _, invalidSD := range c.invalidStmts { + if invalidSD.SQL == sd.SQL { + return + } + } + if c.l.Len() == c.cap { c.invalidateOldest() } @@ -73,10 +81,16 @@ func (c *LRUCache) InvalidateAll() { c.l = list.New() } -func (c *LRUCache) HandleInvalidated() []*pgconn.StatementDescription { - invalidStmts := c.invalidStmts +// GetInvalidated returns a slice of all statement descriptions invalidated since the last call to RemoveInvalidated. +func (c *LRUCache) GetInvalidated() []*pgconn.StatementDescription { + return c.invalidStmts +} + +// RemoveInvalidated removes all invalidated statement descriptions. No other calls to Cache must be made between a +// call to GetInvalidated and RemoveInvalidated or RemoveInvalidated may remove statement descriptions that were +// never seen by the call to GetInvalidated. +func (c *LRUCache) RemoveInvalidated() { c.invalidStmts = nil - return invalidStmts } // Len returns the number of cached prepared statement descriptions. diff --git a/vendor/github.com/jackc/pgx/v5/internal/stmtcache/stmtcache.go b/vendor/github.com/jackc/pgx/v5/internal/stmtcache/stmtcache.go index e1bdcba5..d57bdd29 100644 --- a/vendor/github.com/jackc/pgx/v5/internal/stmtcache/stmtcache.go +++ b/vendor/github.com/jackc/pgx/v5/internal/stmtcache/stmtcache.go @@ -2,18 +2,17 @@ package stmtcache import ( - "strconv" - "sync/atomic" + "crypto/sha256" + "encoding/hex" "github.com/jackc/pgx/v5/pgconn" ) -var stmtCounter int64 - -// NextStatementName returns a statement name that will be unique for the lifetime of the program. -func NextStatementName() string { - n := atomic.AddInt64(&stmtCounter, 1) - return "stmtcache_" + strconv.FormatInt(n, 10) +// StatementName returns a statement name that will be stable for sql across multiple connections and program +// executions. +func StatementName(sql string) string { + digest := sha256.Sum256([]byte(sql)) + return "stmtcache_" + hex.EncodeToString(digest[0:24]) } // Cache caches statement descriptions. @@ -30,8 +29,13 @@ type Cache interface { // InvalidateAll invalidates all statement descriptions. InvalidateAll() - // HandleInvalidated returns a slice of all statement descriptions invalidated since the last call to HandleInvalidated. - HandleInvalidated() []*pgconn.StatementDescription + // GetInvalidated returns a slice of all statement descriptions invalidated since the last call to RemoveInvalidated. + GetInvalidated() []*pgconn.StatementDescription + + // RemoveInvalidated removes all invalidated statement descriptions. No other calls to Cache must be made between a + // call to GetInvalidated and RemoveInvalidated or RemoveInvalidated may remove statement descriptions that were + // never seen by the call to GetInvalidated. + RemoveInvalidated() // Len returns the number of cached prepared statement descriptions. Len() int @@ -39,19 +43,3 @@ type Cache interface { // Cap returns the maximum number of cached prepared statement descriptions. Cap() int } - -func IsStatementInvalid(err error) bool { - pgErr, ok := err.(*pgconn.PgError) - if !ok { - return false - } - - // https://github.com/jackc/pgx/issues/1162 - // - // We used to look for the message "cached plan must not change result type". However, that message can be localized. - // Unfortunately, error code "0A000" - "FEATURE NOT SUPPORTED" is used for many different errors and the only way to - // tell the difference is by the message. But all that happens is we clear a statement that we otherwise wouldn't - // have so it should be safe. - possibleInvalidCachedPlanError := pgErr.Code == "0A000" - return possibleInvalidCachedPlanError -} diff --git a/vendor/github.com/jackc/pgx/v5/internal/stmtcache/unlimited_cache.go b/vendor/github.com/jackc/pgx/v5/internal/stmtcache/unlimited_cache.go index f5f59396..69641329 100644 --- a/vendor/github.com/jackc/pgx/v5/internal/stmtcache/unlimited_cache.go +++ b/vendor/github.com/jackc/pgx/v5/internal/stmtcache/unlimited_cache.go @@ -54,10 +54,16 @@ func (c *UnlimitedCache) InvalidateAll() { c.m = make(map[string]*pgconn.StatementDescription) } -func (c *UnlimitedCache) HandleInvalidated() []*pgconn.StatementDescription { - invalidStmts := c.invalidStmts +// GetInvalidated returns a slice of all statement descriptions invalidated since the last call to RemoveInvalidated. +func (c *UnlimitedCache) GetInvalidated() []*pgconn.StatementDescription { + return c.invalidStmts +} + +// RemoveInvalidated removes all invalidated statement descriptions. No other calls to Cache must be made between a +// call to GetInvalidated and RemoveInvalidated or RemoveInvalidated may remove statement descriptions that were +// never seen by the call to GetInvalidated. +func (c *UnlimitedCache) RemoveInvalidated() { c.invalidStmts = nil - return invalidStmts } // Len returns the number of cached prepared statement descriptions. diff --git a/vendor/github.com/jackc/pgx/v5/large_objects.go b/vendor/github.com/jackc/pgx/v5/large_objects.go index c238ab9c..a3028b63 100644 --- a/vendor/github.com/jackc/pgx/v5/large_objects.go +++ b/vendor/github.com/jackc/pgx/v5/large_objects.go @@ -6,6 +6,11 @@ import ( "io" ) +// The PostgreSQL wire protocol has a limit of 1 GB - 1 per message. See definition of +// PQ_LARGE_MESSAGE_LIMIT in the PostgreSQL source code. To allow for the other data +// in the message,maxLargeObjectMessageLength should be no larger than 1 GB - 1 KB. +var maxLargeObjectMessageLength = 1024*1024*1024 - 1024 + // LargeObjects is a structure used to access the large objects API. It is only valid within the transaction where it // was created. // @@ -68,32 +73,64 @@ type LargeObject struct { // Write writes p to the large object and returns the number of bytes written and an error if not all of p was written. func (o *LargeObject) Write(p []byte) (int, error) { - var n int - err := o.tx.QueryRow(o.ctx, "select lowrite($1, $2)", o.fd, p).Scan(&n) - if err != nil { - return n, err - } - - if n < 0 { - return 0, errors.New("failed to write to large object") + nTotal := 0 + for { + expected := len(p) - nTotal + if expected == 0 { + break + } else if expected > maxLargeObjectMessageLength { + expected = maxLargeObjectMessageLength + } + + var n int + err := o.tx.QueryRow(o.ctx, "select lowrite($1, $2)", o.fd, p[nTotal:nTotal+expected]).Scan(&n) + if err != nil { + return nTotal, err + } + + if n < 0 { + return nTotal, errors.New("failed to write to large object") + } + + nTotal += n + + if n < expected { + return nTotal, errors.New("short write to large object") + } else if n > expected { + return nTotal, errors.New("invalid write to large object") + } } - return n, nil + return nTotal, nil } // Read reads up to len(p) bytes into p returning the number of bytes read. func (o *LargeObject) Read(p []byte) (int, error) { - var res []byte - err := o.tx.QueryRow(o.ctx, "select loread($1, $2)", o.fd, len(p)).Scan(&res) - copy(p, res) - if err != nil { - return len(res), err + nTotal := 0 + for { + expected := len(p) - nTotal + if expected == 0 { + break + } else if expected > maxLargeObjectMessageLength { + expected = maxLargeObjectMessageLength + } + + var res []byte + err := o.tx.QueryRow(o.ctx, "select loread($1, $2)", o.fd, expected).Scan(&res) + copy(p[nTotal:], res) + nTotal += len(res) + if err != nil { + return nTotal, err + } + + if len(res) < expected { + return nTotal, io.EOF + } else if len(res) > expected { + return nTotal, errors.New("invalid read of large object") + } } - if len(res) < len(p) { - err = io.EOF - } - return len(res), err + return nTotal, nil } // Seek moves the current location pointer to the new location specified by offset. diff --git a/vendor/github.com/jackc/pgx/v5/named_args.go b/vendor/github.com/jackc/pgx/v5/named_args.go index 1bc32337..8367fc63 100644 --- a/vendor/github.com/jackc/pgx/v5/named_args.go +++ b/vendor/github.com/jackc/pgx/v5/named_args.go @@ -14,6 +14,9 @@ import ( // // conn.Query(ctx, "select * from widgets where foo = @foo and bar = @bar", pgx.NamedArgs{"foo": 1, "bar": 2}) // conn.Query(ctx, "select * from widgets where foo = $1 and bar = $2", 1, 2) +// +// Named placeholders are case sensitive and must start with a letter or underscore. Subsequent characters can be +// letters, numbers, or underscores. type NamedArgs map[string]any // RewriteQuery implements the QueryRewriter interface. @@ -80,7 +83,7 @@ func rawState(l *sqlLexer) stateFn { return doubleQuoteState case '@': nextRune, _ := utf8.DecodeRuneInString(l.src[l.pos:]) - if isLetter(nextRune) { + if isLetter(nextRune) || nextRune == '_' { if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos-width]) } diff --git a/vendor/github.com/jackc/pgx/v5/pgconn/auth_scram.go b/vendor/github.com/jackc/pgx/v5/pgconn/auth_scram.go index 6ca9e337..06498361 100644 --- a/vendor/github.com/jackc/pgx/v5/pgconn/auth_scram.go +++ b/vendor/github.com/jackc/pgx/v5/pgconn/auth_scram.go @@ -42,12 +42,12 @@ func (c *PgConn) scramAuth(serverAuthMechanisms []string) error { Data: sc.clientFirstMessage(), } c.frontend.Send(saslInitialResponse) - err = c.frontend.Flush() + err = c.flushWithPotentialWriteReadDeadlock() if err != nil { return err } - // Receive server-first-message payload in a AuthenticationSASLContinue. + // Receive server-first-message payload in an AuthenticationSASLContinue. saslContinue, err := c.rxSASLContinue() if err != nil { return err @@ -62,12 +62,12 @@ func (c *PgConn) scramAuth(serverAuthMechanisms []string) error { Data: []byte(sc.clientFinalMessage()), } c.frontend.Send(saslResponse) - err = c.frontend.Flush() + err = c.flushWithPotentialWriteReadDeadlock() if err != nil { return err } - // Receive server-final-message payload in a AuthenticationSASLFinal. + // Receive server-final-message payload in an AuthenticationSASLFinal. saslFinal, err := c.rxSASLFinal() if err != nil { return err diff --git a/vendor/github.com/jackc/pgx/v5/pgconn/config.go b/vendor/github.com/jackc/pgx/v5/pgconn/config.go index 24bf837c..33a72257 100644 --- a/vendor/github.com/jackc/pgx/v5/pgconn/config.go +++ b/vendor/github.com/jackc/pgx/v5/pgconn/config.go @@ -26,7 +26,7 @@ type AfterConnectFunc func(ctx context.Context, pgconn *PgConn) error type ValidateConnectFunc func(ctx context.Context, pgconn *PgConn) error type GetSSLPasswordFunc func(ctx context.Context) string -// Config is the settings used to establish a connection to a PostgreSQL server. It must be created by ParseConfig. A +// Config is the settings used to establish a connection to a PostgreSQL server. It must be created by [ParseConfig]. A // manually initialized Config will cause ConnectConfig to panic. type Config struct { Host string // host (e.g. localhost) or absolute path to unix domain socket directory (e.g. /private/tmp) @@ -60,6 +60,11 @@ type Config struct { // OnNotification is a callback function called when a notification from the LISTEN/NOTIFY system is received. OnNotification NotificationHandler + // OnPgError is a callback function called when a Postgres error is received by the server. The default handler will close + // the connection on any FATAL errors. If you override this handler you should call the previously set handler or ensure + // that you close on FATAL errors by returning false. + OnPgError PgErrorHandler + createdByParseConfig bool // Used to enforce created by ParseConfig rule. } @@ -232,12 +237,12 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con if strings.HasPrefix(connString, "postgres://") || strings.HasPrefix(connString, "postgresql://") { connStringSettings, err = parseURLSettings(connString) if err != nil { - return nil, &parseConfigError{connString: connString, msg: "failed to parse as URL", err: err} + return nil, &ParseConfigError{ConnString: connString, msg: "failed to parse as URL", err: err} } } else { connStringSettings, err = parseDSNSettings(connString) if err != nil { - return nil, &parseConfigError{connString: connString, msg: "failed to parse as DSN", err: err} + return nil, &ParseConfigError{ConnString: connString, msg: "failed to parse as DSN", err: err} } } } @@ -246,7 +251,7 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con if service, present := settings["service"]; present { serviceSettings, err := parseServiceSettings(settings["servicefile"], service) if err != nil { - return nil, &parseConfigError{connString: connString, msg: "failed to read service", err: err} + return nil, &ParseConfigError{ConnString: connString, msg: "failed to read service", err: err} } settings = mergeSettings(defaultSettings, envSettings, serviceSettings, connStringSettings) @@ -261,12 +266,19 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con BuildFrontend: func(r io.Reader, w io.Writer) *pgproto3.Frontend { return pgproto3.NewFrontend(r, w) }, + OnPgError: func(_ *PgConn, pgErr *PgError) bool { + // we want to automatically close any fatal errors + if strings.EqualFold(pgErr.Severity, "FATAL") { + return false + } + return true + }, } if connectTimeoutSetting, present := settings["connect_timeout"]; present { connectTimeout, err := parseConnectTimeoutSetting(connectTimeoutSetting) if err != nil { - return nil, &parseConfigError{connString: connString, msg: "invalid connect_timeout", err: err} + return nil, &ParseConfigError{ConnString: connString, msg: "invalid connect_timeout", err: err} } config.ConnectTimeout = connectTimeout config.DialFunc = makeConnectTimeoutDialFunc(connectTimeout) @@ -328,7 +340,7 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con port, err := parsePort(portStr) if err != nil { - return nil, &parseConfigError{connString: connString, msg: "invalid port", err: err} + return nil, &ParseConfigError{ConnString: connString, msg: "invalid port", err: err} } var tlsConfigs []*tls.Config @@ -340,7 +352,7 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con var err error tlsConfigs, err = configTLS(settings, host, options) if err != nil { - return nil, &parseConfigError{connString: connString, msg: "failed to configure TLS", err: err} + return nil, &ParseConfigError{ConnString: connString, msg: "failed to configure TLS", err: err} } } @@ -384,7 +396,7 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con case "any": // do nothing default: - return nil, &parseConfigError{connString: connString, msg: fmt.Sprintf("unknown target_session_attrs value: %v", tsa)} + return nil, &ParseConfigError{ConnString: connString, msg: fmt.Sprintf("unknown target_session_attrs value: %v", tsa)} } return config, nil @@ -709,6 +721,9 @@ func configTLS(settings map[string]string, thisHost string, parseConfigOptions P return nil, fmt.Errorf("unable to read sslkey: %w", err) } block, _ := pem.Decode(buf) + if block == nil { + return nil, errors.New("failed to decode sslkey") + } var pemKey []byte var decryptedKey []byte var decryptedError error @@ -809,7 +824,7 @@ func makeConnectTimeoutDialFunc(timeout time.Duration) DialFunc { return d.DialContext } -// ValidateConnectTargetSessionAttrsReadWrite is an ValidateConnectFunc that implements libpq compatible +// ValidateConnectTargetSessionAttrsReadWrite is a ValidateConnectFunc that implements libpq compatible // target_session_attrs=read-write. func ValidateConnectTargetSessionAttrsReadWrite(ctx context.Context, pgConn *PgConn) error { result := pgConn.ExecParams(ctx, "show transaction_read_only", nil, nil, nil, nil).Read() @@ -824,7 +839,7 @@ func ValidateConnectTargetSessionAttrsReadWrite(ctx context.Context, pgConn *PgC return nil } -// ValidateConnectTargetSessionAttrsReadOnly is an ValidateConnectFunc that implements libpq compatible +// ValidateConnectTargetSessionAttrsReadOnly is a ValidateConnectFunc that implements libpq compatible // target_session_attrs=read-only. func ValidateConnectTargetSessionAttrsReadOnly(ctx context.Context, pgConn *PgConn) error { result := pgConn.ExecParams(ctx, "show transaction_read_only", nil, nil, nil, nil).Read() @@ -839,7 +854,7 @@ func ValidateConnectTargetSessionAttrsReadOnly(ctx context.Context, pgConn *PgCo return nil } -// ValidateConnectTargetSessionAttrsStandby is an ValidateConnectFunc that implements libpq compatible +// ValidateConnectTargetSessionAttrsStandby is a ValidateConnectFunc that implements libpq compatible // target_session_attrs=standby. func ValidateConnectTargetSessionAttrsStandby(ctx context.Context, pgConn *PgConn) error { result := pgConn.ExecParams(ctx, "select pg_is_in_recovery()", nil, nil, nil, nil).Read() @@ -854,7 +869,7 @@ func ValidateConnectTargetSessionAttrsStandby(ctx context.Context, pgConn *PgCon return nil } -// ValidateConnectTargetSessionAttrsPrimary is an ValidateConnectFunc that implements libpq compatible +// ValidateConnectTargetSessionAttrsPrimary is a ValidateConnectFunc that implements libpq compatible // target_session_attrs=primary. func ValidateConnectTargetSessionAttrsPrimary(ctx context.Context, pgConn *PgConn) error { result := pgConn.ExecParams(ctx, "select pg_is_in_recovery()", nil, nil, nil, nil).Read() @@ -869,7 +884,7 @@ func ValidateConnectTargetSessionAttrsPrimary(ctx context.Context, pgConn *PgCon return nil } -// ValidateConnectTargetSessionAttrsPreferStandby is an ValidateConnectFunc that implements libpq compatible +// ValidateConnectTargetSessionAttrsPreferStandby is a ValidateConnectFunc that implements libpq compatible // target_session_attrs=prefer-standby. func ValidateConnectTargetSessionAttrsPreferStandby(ctx context.Context, pgConn *PgConn) error { result := pgConn.ExecParams(ctx, "select pg_is_in_recovery()", nil, nil, nil, nil).Read() diff --git a/vendor/github.com/jackc/pgx/v5/pgconn/errors.go b/vendor/github.com/jackc/pgx/v5/pgconn/errors.go index 3c54bbec..c315739a 100644 --- a/vendor/github.com/jackc/pgx/v5/pgconn/errors.go +++ b/vendor/github.com/jackc/pgx/v5/pgconn/errors.go @@ -57,22 +57,23 @@ func (pe *PgError) SQLState() string { return pe.Code } -type connectError struct { - config *Config +// ConnectError is the error returned when a connection attempt fails. +type ConnectError struct { + Config *Config // The configuration that was used in the connection attempt. msg string err error } -func (e *connectError) Error() string { +func (e *ConnectError) Error() string { sb := &strings.Builder{} - fmt.Fprintf(sb, "failed to connect to `host=%s user=%s database=%s`: %s", e.config.Host, e.config.User, e.config.Database, e.msg) + fmt.Fprintf(sb, "failed to connect to `host=%s user=%s database=%s`: %s", e.Config.Host, e.Config.User, e.Config.Database, e.msg) if e.err != nil { fmt.Fprintf(sb, " (%s)", e.err.Error()) } return sb.String() } -func (e *connectError) Unwrap() error { +func (e *ConnectError) Unwrap() error { return e.err } @@ -88,33 +89,38 @@ func (e *connLockError) Error() string { return e.status } -type parseConfigError struct { - connString string +// ParseConfigError is the error returned when a connection string cannot be parsed. +type ParseConfigError struct { + ConnString string // The connection string that could not be parsed. msg string err error } -func (e *parseConfigError) Error() string { - connString := redactPW(e.connString) +func (e *ParseConfigError) Error() string { + // Now that ParseConfigError is public and ConnString is available to the developer, perhaps it would be better only + // return a static string. That would ensure that the error message cannot leak a password. The ConnString field would + // allow access to the original string if desired and Unwrap would allow access to the underlying error. + connString := redactPW(e.ConnString) if e.err == nil { return fmt.Sprintf("cannot parse `%s`: %s", connString, e.msg) } return fmt.Sprintf("cannot parse `%s`: %s (%s)", connString, e.msg, e.err.Error()) } -func (e *parseConfigError) Unwrap() error { +func (e *ParseConfigError) Unwrap() error { return e.err } func normalizeTimeoutError(ctx context.Context, err error) error { - if err, ok := err.(net.Error); ok && err.Timeout() { + var netErr net.Error + if errors.As(err, &netErr) && netErr.Timeout() { if ctx.Err() == context.Canceled { // Since the timeout was caused by a context cancellation, the actual error is context.Canceled not the timeout error. return context.Canceled } else if ctx.Err() == context.DeadlineExceeded { return &errTimeout{err: ctx.Err()} } else { - return &errTimeout{err: err} + return &errTimeout{err: netErr} } } return err diff --git a/vendor/github.com/jackc/pgx/v5/pgconn/internal/bgreader/bgreader.go b/vendor/github.com/jackc/pgx/v5/pgconn/internal/bgreader/bgreader.go new file mode 100644 index 00000000..e65c2c2b --- /dev/null +++ b/vendor/github.com/jackc/pgx/v5/pgconn/internal/bgreader/bgreader.go @@ -0,0 +1,139 @@ +// Package bgreader provides a io.Reader that can optionally buffer reads in the background. +package bgreader + +import ( + "io" + "sync" + + "github.com/jackc/pgx/v5/internal/iobufpool" +) + +const ( + StatusStopped = iota + StatusRunning + StatusStopping +) + +// BGReader is an io.Reader that can optionally buffer reads in the background. It is safe for concurrent use. +type BGReader struct { + r io.Reader + + cond *sync.Cond + status int32 + readResults []readResult +} + +type readResult struct { + buf *[]byte + err error +} + +// Start starts the backgrounder reader. If the background reader is already running this is a no-op. The background +// reader will stop automatically when the underlying reader returns an error. +func (r *BGReader) Start() { + r.cond.L.Lock() + defer r.cond.L.Unlock() + + switch r.status { + case StatusStopped: + r.status = StatusRunning + go r.bgRead() + case StatusRunning: + // no-op + case StatusStopping: + r.status = StatusRunning + } +} + +// Stop tells the background reader to stop after the in progress Read returns. It is safe to call Stop when the +// background reader is not running. +func (r *BGReader) Stop() { + r.cond.L.Lock() + defer r.cond.L.Unlock() + + switch r.status { + case StatusStopped: + // no-op + case StatusRunning: + r.status = StatusStopping + case StatusStopping: + // no-op + } +} + +// Status returns the current status of the background reader. +func (r *BGReader) Status() int32 { + r.cond.L.Lock() + defer r.cond.L.Unlock() + return r.status +} + +func (r *BGReader) bgRead() { + keepReading := true + for keepReading { + buf := iobufpool.Get(8192) + n, err := r.r.Read(*buf) + *buf = (*buf)[:n] + + r.cond.L.Lock() + r.readResults = append(r.readResults, readResult{buf: buf, err: err}) + if r.status == StatusStopping || err != nil { + r.status = StatusStopped + keepReading = false + } + r.cond.L.Unlock() + r.cond.Broadcast() + } +} + +// Read implements the io.Reader interface. +func (r *BGReader) Read(p []byte) (int, error) { + r.cond.L.Lock() + defer r.cond.L.Unlock() + + if len(r.readResults) > 0 { + return r.readFromReadResults(p) + } + + // There are no unread background read results and the background reader is stopped. + if r.status == StatusStopped { + return r.r.Read(p) + } + + // Wait for results from the background reader + for len(r.readResults) == 0 { + r.cond.Wait() + } + return r.readFromReadResults(p) +} + +// readBackgroundResults reads a result previously read by the background reader. r.cond.L must be held. +func (r *BGReader) readFromReadResults(p []byte) (int, error) { + buf := r.readResults[0].buf + var err error + + n := copy(p, *buf) + if n == len(*buf) { + err = r.readResults[0].err + iobufpool.Put(buf) + if len(r.readResults) == 1 { + r.readResults = nil + } else { + r.readResults = r.readResults[1:] + } + } else { + *buf = (*buf)[n:] + r.readResults[0].buf = buf + } + + return n, err +} + +func New(r io.Reader) *BGReader { + return &BGReader{ + r: r, + cond: &sync.Cond{ + L: &sync.Mutex{}, + }, + } +} diff --git a/vendor/github.com/jackc/pgx/v5/pgconn/krb5.go b/vendor/github.com/jackc/pgx/v5/pgconn/krb5.go index 969675fd..3c1af347 100644 --- a/vendor/github.com/jackc/pgx/v5/pgconn/krb5.go +++ b/vendor/github.com/jackc/pgx/v5/pgconn/krb5.go @@ -63,7 +63,7 @@ func (c *PgConn) gssAuth() error { Data: nextData, } c.frontend.Send(gssResponse) - err = c.frontend.Flush() + err = c.flushWithPotentialWriteReadDeadlock() if err != nil { return err } diff --git a/vendor/github.com/jackc/pgx/v5/pgconn/pgconn.go b/vendor/github.com/jackc/pgx/v5/pgconn/pgconn.go index 8656ea51..0bf03f33 100644 --- a/vendor/github.com/jackc/pgx/v5/pgconn/pgconn.go +++ b/vendor/github.com/jackc/pgx/v5/pgconn/pgconn.go @@ -13,11 +13,12 @@ import ( "net" "strconv" "strings" + "sync" "time" "github.com/jackc/pgx/v5/internal/iobufpool" - "github.com/jackc/pgx/v5/internal/nbconn" "github.com/jackc/pgx/v5/internal/pgio" + "github.com/jackc/pgx/v5/pgconn/internal/bgreader" "github.com/jackc/pgx/v5/pgconn/internal/ctxwatch" "github.com/jackc/pgx/v5/pgproto3" ) @@ -51,6 +52,12 @@ type LookupFunc func(ctx context.Context, host string) (addrs []string, err erro // BuildFrontendFunc is a function that can be used to create Frontend implementation for connection. type BuildFrontendFunc func(r io.Reader, w io.Writer) *pgproto3.Frontend +// PgErrorHandler is a function that handles errors returned from Postgres. This function must return true to keep +// the connection open. Returning false will cause the connection to be closed immediately. You should return +// false on any FATAL-severity errors. This will not receive network errors. The *PgConn is provided so the handler is +// aware of the origin of the error, but it must not invoke any query method. +type PgErrorHandler func(*PgConn, *PgError) bool + // NoticeHandler is a function that can handle notices received from the PostgreSQL server. Notices can be received at // any time, usually during handling of a query response. The *PgConn is provided so the handler is aware of the origin // of the notice, but it must not invoke any query method. Be aware that this is distinct from LISTEN/NOTIFY @@ -65,17 +72,25 @@ type NotificationHandler func(*PgConn, *Notification) // PgConn is a low-level PostgreSQL connection handle. It is not safe for concurrent usage. type PgConn struct { - conn nbconn.Conn // the non-blocking wrapper for the underlying TCP or unix domain socket connection + conn net.Conn pid uint32 // backend pid secretKey uint32 // key to use to send a cancel query message to the server parameterStatuses map[string]string // parameters that have been reported by the server txStatus byte frontend *pgproto3.Frontend + bgReader *bgreader.BGReader + slowWriteTimer *time.Timer + bgReaderStarted chan struct{} config *Config status byte // One of connStatus* constants + bufferingReceive bool + bufferingReceiveMux sync.Mutex + bufferingReceiveMsg pgproto3.BackendMessage + bufferingReceiveErr error + peekedMsg pgproto3.BackendMessage // Reusable / preallocated resources @@ -89,7 +104,7 @@ type PgConn struct { } // Connect establishes a connection to a PostgreSQL server using the environment and connString (in URL or DSN format) -// to provide configuration. See documentation for ParseConfig for details. ctx can be used to cancel a connect attempt. +// to provide configuration. See documentation for [ParseConfig] for details. ctx can be used to cancel a connect attempt. func Connect(ctx context.Context, connString string) (*PgConn, error) { config, err := ParseConfig(connString) if err != nil { @@ -100,7 +115,7 @@ func Connect(ctx context.Context, connString string) (*PgConn, error) { } // Connect establishes a connection to a PostgreSQL server using the environment and connString (in URL or DSN format) -// and ParseConfigOptions to provide additional configuration. See documentation for ParseConfig for details. ctx can be +// and ParseConfigOptions to provide additional configuration. See documentation for [ParseConfig] for details. ctx can be // used to cancel a connect attempt. func ConnectWithOptions(ctx context.Context, connString string, parseConfigOptions ParseConfigOptions) (*PgConn, error) { config, err := ParseConfigWithOptions(connString, parseConfigOptions) @@ -112,7 +127,7 @@ func ConnectWithOptions(ctx context.Context, connString string, parseConfigOptio } // Connect establishes a connection to a PostgreSQL server using config. config must have been constructed with -// ParseConfig. ctx can be used to cancel a connect attempt. +// [ParseConfig]. ctx can be used to cancel a connect attempt. // // If config.Fallbacks are present they will sequentially be tried in case of error establishing network connection. An // authentication error will terminate the chain of attempts (like libpq: @@ -137,21 +152,24 @@ func ConnectConfig(octx context.Context, config *Config) (pgConn *PgConn, err er ctx := octx fallbackConfigs, err = expandWithIPs(ctx, config.LookupFunc, fallbackConfigs) if err != nil { - return nil, &connectError{config: config, msg: "hostname resolving error", err: err} + return nil, &ConnectError{Config: config, msg: "hostname resolving error", err: err} } if len(fallbackConfigs) == 0 { - return nil, &connectError{config: config, msg: "hostname resolving error", err: errors.New("ip addr wasn't found")} + return nil, &ConnectError{Config: config, msg: "hostname resolving error", err: errors.New("ip addr wasn't found")} } foundBestServer := false var fallbackConfig *FallbackConfig - for _, fc := range fallbackConfigs { + for i, fc := range fallbackConfigs { // ConnectTimeout restricts the whole connection process. if config.ConnectTimeout != 0 { - var cancel context.CancelFunc - ctx, cancel = context.WithTimeout(octx, config.ConnectTimeout) - defer cancel() + // create new context first time or when previous host was different + if i == 0 || (fallbackConfigs[i].Host != fallbackConfigs[i-1].Host) { + var cancel context.CancelFunc + ctx, cancel = context.WithTimeout(octx, config.ConnectTimeout) + defer cancel() + } } else { ctx = octx } @@ -160,18 +178,18 @@ func ConnectConfig(octx context.Context, config *Config) (pgConn *PgConn, err er foundBestServer = true break } else if pgerr, ok := err.(*PgError); ok { - err = &connectError{config: config, msg: "server error", err: pgerr} + err = &ConnectError{Config: config, msg: "server error", err: pgerr} const ERRCODE_INVALID_PASSWORD = "28P01" // wrong password const ERRCODE_INVALID_AUTHORIZATION_SPECIFICATION = "28000" // wrong password or bad pg_hba.conf settings const ERRCODE_INVALID_CATALOG_NAME = "3D000" // db does not exist const ERRCODE_INSUFFICIENT_PRIVILEGE = "42501" // missing connect privilege if pgerr.Code == ERRCODE_INVALID_PASSWORD || - pgerr.Code == ERRCODE_INVALID_AUTHORIZATION_SPECIFICATION || + pgerr.Code == ERRCODE_INVALID_AUTHORIZATION_SPECIFICATION && fc.TLSConfig != nil || pgerr.Code == ERRCODE_INVALID_CATALOG_NAME || pgerr.Code == ERRCODE_INSUFFICIENT_PRIVILEGE { break } - } else if cerr, ok := err.(*connectError); ok { + } else if cerr, ok := err.(*ConnectError); ok { if _, ok := cerr.err.(*NotPreferredError); ok { fallbackConfig = fc } @@ -181,7 +199,7 @@ func ConnectConfig(octx context.Context, config *Config) (pgConn *PgConn, err er if !foundBestServer && fallbackConfig != nil { pgConn, err = connect(ctx, config, fallbackConfig, true) if pgerr, ok := err.(*PgError); ok { - err = &connectError{config: config, msg: "server error", err: pgerr} + err = &ConnectError{Config: config, msg: "server error", err: pgerr} } } @@ -193,7 +211,7 @@ func ConnectConfig(octx context.Context, config *Config) (pgConn *PgConn, err er err := config.AfterConnect(ctx, pgConn) if err != nil { pgConn.conn.Close() - return nil, &connectError{config: config, msg: "AfterConnect error", err: err} + return nil, &ConnectError{Config: config, msg: "AfterConnect error", err: err} } } @@ -255,7 +273,8 @@ func expandWithIPs(ctx context.Context, lookupFn LookupFunc, fallbacks []*Fallba } func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig, - ignoreNotPreferredErr bool) (*PgConn, error) { + ignoreNotPreferredErr bool, +) (*PgConn, error) { pgConn := new(PgConn) pgConn.config = config pgConn.cleanupDone = make(chan struct{}) @@ -264,20 +283,19 @@ func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig network, address := NetworkAddress(fallbackConfig.Host, fallbackConfig.Port) netConn, err := config.DialFunc(ctx, network, address) if err != nil { - return nil, &connectError{config: config, msg: "dial error", err: normalizeTimeoutError(ctx, err)} + return nil, &ConnectError{Config: config, msg: "dial error", err: normalizeTimeoutError(ctx, err)} } - nbNetConn := nbconn.NewNetConn(netConn, false) - pgConn.conn = nbNetConn - pgConn.contextWatcher = newContextWatcher(nbNetConn) + pgConn.conn = netConn + pgConn.contextWatcher = newContextWatcher(netConn) pgConn.contextWatcher.Watch(ctx) if fallbackConfig.TLSConfig != nil { - nbTLSConn, err := startTLS(nbNetConn, fallbackConfig.TLSConfig) + nbTLSConn, err := startTLS(netConn, fallbackConfig.TLSConfig) pgConn.contextWatcher.Unwatch() // Always unwatch `netConn` after TLS. if err != nil { netConn.Close() - return nil, &connectError{config: config, msg: "tls error", err: err} + return nil, &ConnectError{Config: config, msg: "tls error", err: normalizeTimeoutError(ctx, err)} } pgConn.conn = nbTLSConn @@ -289,7 +307,16 @@ func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig pgConn.parameterStatuses = make(map[string]string) pgConn.status = connStatusConnecting - pgConn.frontend = config.BuildFrontend(pgConn.conn, pgConn.conn) + pgConn.bgReader = bgreader.New(pgConn.conn) + pgConn.slowWriteTimer = time.AfterFunc(time.Duration(math.MaxInt64), + func() { + pgConn.bgReader.Start() + pgConn.bgReaderStarted <- struct{}{} + }, + ) + pgConn.slowWriteTimer.Stop() + pgConn.bgReaderStarted = make(chan struct{}) + pgConn.frontend = config.BuildFrontend(pgConn.bgReader, pgConn.conn) startupMsg := pgproto3.StartupMessage{ ProtocolVersion: pgproto3.ProtocolVersionNumber, @@ -307,9 +334,9 @@ func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig } pgConn.frontend.Send(&startupMsg) - if err := pgConn.frontend.Flush(); err != nil { + if err := pgConn.flushWithPotentialWriteReadDeadlock(); err != nil { pgConn.conn.Close() - return nil, &connectError{config: config, msg: "failed to write startup message", err: err} + return nil, &ConnectError{Config: config, msg: "failed to write startup message", err: normalizeTimeoutError(ctx, err)} } for { @@ -319,7 +346,7 @@ func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig if err, ok := err.(*PgError); ok { return nil, err } - return nil, &connectError{config: config, msg: "failed to receive message", err: normalizeTimeoutError(ctx, err)} + return nil, &ConnectError{Config: config, msg: "failed to receive message", err: normalizeTimeoutError(ctx, err)} } switch msg := msg.(type) { @@ -332,26 +359,26 @@ func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig err = pgConn.txPasswordMessage(pgConn.config.Password) if err != nil { pgConn.conn.Close() - return nil, &connectError{config: config, msg: "failed to write password message", err: err} + return nil, &ConnectError{Config: config, msg: "failed to write password message", err: err} } case *pgproto3.AuthenticationMD5Password: digestedPassword := "md5" + hexMD5(hexMD5(pgConn.config.Password+pgConn.config.User)+string(msg.Salt[:])) err = pgConn.txPasswordMessage(digestedPassword) if err != nil { pgConn.conn.Close() - return nil, &connectError{config: config, msg: "failed to write password message", err: err} + return nil, &ConnectError{Config: config, msg: "failed to write password message", err: err} } case *pgproto3.AuthenticationSASL: err = pgConn.scramAuth(msg.AuthMechanisms) if err != nil { pgConn.conn.Close() - return nil, &connectError{config: config, msg: "failed SASL auth", err: err} + return nil, &ConnectError{Config: config, msg: "failed SASL auth", err: err} } case *pgproto3.AuthenticationGSS: err = pgConn.gssAuth() if err != nil { pgConn.conn.Close() - return nil, &connectError{config: config, msg: "failed GSS auth", err: err} + return nil, &ConnectError{Config: config, msg: "failed GSS auth", err: err} } case *pgproto3.ReadyForQuery: pgConn.status = connStatusIdle @@ -369,7 +396,7 @@ func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig return pgConn, nil } pgConn.conn.Close() - return nil, &connectError{config: config, msg: "ValidateConnect failed", err: err} + return nil, &ConnectError{Config: config, msg: "ValidateConnect failed", err: err} } } return pgConn, nil @@ -380,7 +407,7 @@ func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig return nil, ErrorResponseToPgError(msg) default: pgConn.conn.Close() - return nil, &connectError{config: config, msg: "received unexpected message", err: err} + return nil, &ConnectError{Config: config, msg: "received unexpected message", err: err} } } } @@ -392,7 +419,7 @@ func newContextWatcher(conn net.Conn) *ctxwatch.ContextWatcher { ) } -func startTLS(conn *nbconn.NetConn, tlsConfig *tls.Config) (*nbconn.TLSConn, error) { +func startTLS(conn net.Conn, tlsConfig *tls.Config) (net.Conn, error) { err := binary.Write(conn, binary.BigEndian, []int32{8, 80877103}) if err != nil { return nil, err @@ -407,17 +434,12 @@ func startTLS(conn *nbconn.NetConn, tlsConfig *tls.Config) (*nbconn.TLSConn, err return nil, errors.New("server refused TLS connection") } - tlsConn, err := nbconn.TLSClient(conn, tlsConfig) - if err != nil { - return nil, err - } - - return tlsConn, nil + return tls.Client(conn, tlsConfig), nil } func (pgConn *PgConn) txPasswordMessage(password string) (err error) { pgConn.frontend.Send(&pgproto3.PasswordMessage{Password: password}) - return pgConn.frontend.Flush() + return pgConn.flushWithPotentialWriteReadDeadlock() } func hexMD5(s string) string { @@ -426,6 +448,24 @@ func hexMD5(s string) string { return hex.EncodeToString(hash.Sum(nil)) } +func (pgConn *PgConn) signalMessage() chan struct{} { + if pgConn.bufferingReceive { + panic("BUG: signalMessage when already in progress") + } + + pgConn.bufferingReceive = true + pgConn.bufferingReceiveMux.Lock() + + ch := make(chan struct{}) + go func() { + pgConn.bufferingReceiveMsg, pgConn.bufferingReceiveErr = pgConn.frontend.Receive() + pgConn.bufferingReceiveMux.Unlock() + close(ch) + }() + + return ch +} + // ReceiveMessage receives one wire protocol message from the PostgreSQL server. It must only be used when the // connection is not busy. e.g. It is an error to call ReceiveMessage while reading the result of a query. The messages // are still handled by the core pgconn message handling system so receiving a NotificationResponse will still trigger @@ -454,7 +494,8 @@ func (pgConn *PgConn) ReceiveMessage(ctx context.Context) (pgproto3.BackendMessa err = &pgconnError{ msg: "receive message failed", err: normalizeTimeoutError(ctx, err), - safeToRetry: true} + safeToRetry: true, + } } return msg, err } @@ -465,13 +506,25 @@ func (pgConn *PgConn) peekMessage() (pgproto3.BackendMessage, error) { return pgConn.peekedMsg, nil } - msg, err := pgConn.frontend.Receive() - - if err != nil { - if errors.Is(err, nbconn.ErrWouldBlock) { - return nil, err + var msg pgproto3.BackendMessage + var err error + if pgConn.bufferingReceive { + pgConn.bufferingReceiveMux.Lock() + msg = pgConn.bufferingReceiveMsg + err = pgConn.bufferingReceiveErr + pgConn.bufferingReceiveMux.Unlock() + pgConn.bufferingReceive = false + + // If a timeout error happened in the background try the read again. + var netErr net.Error + if errors.As(err, &netErr) && netErr.Timeout() { + msg, err = pgConn.frontend.Receive() } + } else { + msg, err = pgConn.frontend.Receive() + } + if err != nil { // Close on anything other than timeout error - everything else is fatal var netErr net.Error isNetErr := errors.As(err, &netErr) @@ -500,11 +553,12 @@ func (pgConn *PgConn) receiveMessage() (pgproto3.BackendMessage, error) { case *pgproto3.ParameterStatus: pgConn.parameterStatuses[msg.Name] = msg.Value case *pgproto3.ErrorResponse: - if msg.Severity == "FATAL" { + err := ErrorResponseToPgError(msg) + if pgConn.config.OnPgError != nil && !pgConn.config.OnPgError(pgConn, err) { pgConn.status = connStatusClosed pgConn.conn.Close() // Ignore error as the connection is already broken and there is already an error to return. close(pgConn.cleanupDone) - return nil, ErrorResponseToPgError(msg) + return nil, err } case *pgproto3.NoticeResponse: if pgConn.config.OnNotice != nil { @@ -519,7 +573,8 @@ func (pgConn *PgConn) receiveMessage() (pgproto3.BackendMessage, error) { return msg, nil } -// Conn returns the underlying net.Conn. This rarely necessary. +// Conn returns the underlying net.Conn. This rarely necessary. If the connection will be directly used for reading or +// writing then SyncConn should usually be called before Conn. func (pgConn *PgConn) Conn() net.Conn { return pgConn.conn } @@ -552,7 +607,7 @@ func (pgConn *PgConn) Frontend() *pgproto3.Frontend { return pgConn.frontend } -// Close closes a connection. It is safe to call Close on a already closed connection. Close attempts a clean close by +// Close closes a connection. It is safe to call Close on an already closed connection. Close attempts a clean close by // sending the exit message to PostgreSQL. However, this could block so ctx is available to limit the time to wait. The // underlying net.Conn.Close() will always be called regardless of any other errors. func (pgConn *PgConn) Close(ctx context.Context) error { @@ -582,7 +637,7 @@ func (pgConn *PgConn) Close(ctx context.Context) error { // // See https://github.com/jackc/pgx/issues/637 pgConn.frontend.Send(&pgproto3.Terminate{}) - pgConn.frontend.Flush() + pgConn.flushWithPotentialWriteReadDeadlock() return pgConn.conn.Close() } @@ -609,7 +664,7 @@ func (pgConn *PgConn) asyncClose() { pgConn.conn.SetDeadline(deadline) pgConn.frontend.Send(&pgproto3.Terminate{}) - pgConn.frontend.Flush() + pgConn.flushWithPotentialWriteReadDeadlock() }() } @@ -765,6 +820,9 @@ type StatementDescription struct { // Prepare creates a prepared statement. If the name is empty, the anonymous prepared statement will be used. This // allows Prepare to also to describe statements without creating a server-side prepared statement. +// +// Prepare does not send a PREPARE statement to the server. It uses the PostgreSQL Parse and Describe protocol messages +// directly. func (pgConn *PgConn) Prepare(ctx context.Context, name, sql string, paramOIDs []uint32) (*StatementDescription, error) { if err := pgConn.lock(); err != nil { return nil, err @@ -784,7 +842,7 @@ func (pgConn *PgConn) Prepare(ctx context.Context, name, sql string, paramOIDs [ pgConn.frontend.SendParse(&pgproto3.Parse{Name: name, Query: sql, ParameterOIDs: paramOIDs}) pgConn.frontend.SendDescribe(&pgproto3.Describe{ObjectType: 'S', Name: name}) pgConn.frontend.SendSync(&pgproto3.Sync{}) - err := pgConn.frontend.Flush() + err := pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() return nil, err @@ -821,6 +879,52 @@ readloop: return psd, nil } +// Deallocate deallocates a prepared statement. +// +// Deallocate does not send a DEALLOCATE statement to the server. It uses the PostgreSQL Close protocol message +// directly. This has slightly different behavior than executing DEALLOCATE statement. +// - Deallocate can succeed in an aborted transaction. +// - Deallocating a non-existent prepared statement is not an error. +func (pgConn *PgConn) Deallocate(ctx context.Context, name string) error { + if err := pgConn.lock(); err != nil { + return err + } + defer pgConn.unlock() + + if ctx != context.Background() { + select { + case <-ctx.Done(): + return newContextAlreadyDoneError(ctx) + default: + } + pgConn.contextWatcher.Watch(ctx) + defer pgConn.contextWatcher.Unwatch() + } + + pgConn.frontend.SendClose(&pgproto3.Close{ObjectType: 'S', Name: name}) + pgConn.frontend.SendSync(&pgproto3.Sync{}) + err := pgConn.flushWithPotentialWriteReadDeadlock() + if err != nil { + pgConn.asyncClose() + return err + } + + for { + msg, err := pgConn.receiveMessage() + if err != nil { + pgConn.asyncClose() + return normalizeTimeoutError(ctx, err) + } + + switch msg := msg.(type) { + case *pgproto3.ErrorResponse: + return ErrorResponseToPgError(msg) + case *pgproto3.ReadyForQuery: + return nil + } + } +} + // ErrorResponseToPgError converts a wire protocol error message to a *PgError. func ErrorResponseToPgError(msg *pgproto3.ErrorResponse) *PgError { return &PgError{ @@ -857,9 +961,28 @@ func (pgConn *PgConn) CancelRequest(ctx context.Context) error { // the connection config. This is important in high availability configurations where fallback connections may be // specified or DNS may be used to load balance. serverAddr := pgConn.conn.RemoteAddr() - cancelConn, err := pgConn.config.DialFunc(ctx, serverAddr.Network(), serverAddr.String()) + var serverNetwork string + var serverAddress string + if serverAddr.Network() == "unix" { + // for unix sockets, RemoteAddr() calls getpeername() which returns the name the + // server passed to bind(). For Postgres, this is always a relative path "./.s.PGSQL.5432" + // so connecting to it will fail. Fall back to the config's value + serverNetwork, serverAddress = NetworkAddress(pgConn.config.Host, pgConn.config.Port) + } else { + serverNetwork, serverAddress = serverAddr.Network(), serverAddr.String() + } + cancelConn, err := pgConn.config.DialFunc(ctx, serverNetwork, serverAddress) if err != nil { - return err + // In case of unix sockets, RemoteAddr() returns only the file part of the path. If the + // first connect failed, try the config. + if serverAddr.Network() != "unix" { + return err + } + serverNetwork, serverAddr := NetworkAddress(pgConn.config.Host, pgConn.config.Port) + cancelConn, err = pgConn.config.DialFunc(ctx, serverNetwork, serverAddr) + if err != nil { + return err + } } defer cancelConn.Close() @@ -875,22 +998,21 @@ func (pgConn *PgConn) CancelRequest(ctx context.Context) error { buf := make([]byte, 16) binary.BigEndian.PutUint32(buf[0:4], 16) binary.BigEndian.PutUint32(buf[4:8], 80877102) - binary.BigEndian.PutUint32(buf[8:12], uint32(pgConn.pid)) - binary.BigEndian.PutUint32(buf[12:16], uint32(pgConn.secretKey)) - _, err = cancelConn.Write(buf) - if err != nil { - return err - } + binary.BigEndian.PutUint32(buf[8:12], pgConn.pid) + binary.BigEndian.PutUint32(buf[12:16], pgConn.secretKey) - _, err = cancelConn.Read(buf) - if err != io.EOF { - return err + if _, err := cancelConn.Write(buf); err != nil { + return fmt.Errorf("write to connection for cancellation: %w", err) } + // Wait for the cancel request to be acknowledged by the server. + // It copies the behavior of the libpq: https://github.com/postgres/postgres/blob/REL_16_0/src/interfaces/libpq/fe-connect.c#L4946-L4960 + _, _ = cancelConn.Read(buf) + return nil } -// WaitForNotification waits for a LISTON/NOTIFY message to be received. It returns an error if a notification was not +// WaitForNotification waits for a LISTEN/NOTIFY message to be received. It returns an error if a notification was not // received. func (pgConn *PgConn) WaitForNotification(ctx context.Context) error { if err := pgConn.lock(); err != nil { @@ -953,7 +1075,7 @@ func (pgConn *PgConn) Exec(ctx context.Context, sql string) *MultiResultReader { } pgConn.frontend.SendQuery(&pgproto3.Query{String: sql}) - err := pgConn.frontend.Flush() + err := pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() pgConn.contextWatcher.Unwatch() @@ -1064,7 +1186,7 @@ func (pgConn *PgConn) execExtendedSuffix(result *ResultReader) { pgConn.frontend.SendExecute(&pgproto3.Execute{}) pgConn.frontend.SendSync(&pgproto3.Sync{}) - err := pgConn.frontend.Flush() + err := pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() result.concludeCommand(CommandTag{}, err) @@ -1097,7 +1219,7 @@ func (pgConn *PgConn) CopyTo(ctx context.Context, w io.Writer, sql string) (Comm // Send copy to command pgConn.frontend.SendQuery(&pgproto3.Query{String: sql}) - err := pgConn.frontend.Flush() + err := pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() pgConn.unlock() @@ -1153,85 +1275,91 @@ func (pgConn *PgConn) CopyFrom(ctx context.Context, r io.Reader, sql string) (Co defer pgConn.contextWatcher.Unwatch() } - // Send copy to command + // Send copy from query pgConn.frontend.SendQuery(&pgproto3.Query{String: sql}) - err := pgConn.frontend.Flush() - if err != nil { - pgConn.asyncClose() - return CommandTag{}, err - } - - err = pgConn.conn.SetReadDeadline(nbconn.NonBlockingDeadline) + err := pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() return CommandTag{}, err } - nonblocking := true - defer func() { - if nonblocking { - pgConn.conn.SetReadDeadline(time.Time{}) - } - }() - buf := iobufpool.Get(65536) - defer iobufpool.Put(buf) - (*buf)[0] = 'd' + // Send copy data + abortCopyChan := make(chan struct{}) + copyErrChan := make(chan error, 1) + signalMessageChan := pgConn.signalMessage() + var wg sync.WaitGroup + wg.Add(1) - var readErr, pgErr error - for pgErr == nil { - // Read chunk from r. - var n int - n, readErr = r.Read((*buf)[5:cap(*buf)]) + go func() { + defer wg.Done() + buf := iobufpool.Get(65536) + defer iobufpool.Put(buf) + (*buf)[0] = 'd' - // Send chunk to PostgreSQL. - if n > 0 { - *buf = (*buf)[0 : n+5] - pgio.SetInt32((*buf)[1:], int32(n+4)) + for { + n, readErr := r.Read((*buf)[5:cap(*buf)]) + if n > 0 { + *buf = (*buf)[0 : n+5] + pgio.SetInt32((*buf)[1:], int32(n+4)) + + writeErr := pgConn.frontend.SendUnbufferedEncodedCopyData(*buf) + if writeErr != nil { + // Write errors are always fatal, but we can't use asyncClose because we are in a different goroutine. Not + // setting pgConn.status or closing pgConn.cleanupDone for the same reason. + pgConn.conn.Close() - writeErr := pgConn.frontend.SendUnbufferedEncodedCopyData(*buf) - if writeErr != nil { - pgConn.asyncClose() - return CommandTag{}, err + copyErrChan <- writeErr + return + } + } + if readErr != nil { + copyErrChan <- readErr + return } - } - // Abort loop if there was a read error. - if readErr != nil { - break + select { + case <-abortCopyChan: + return + default: + } } + }() - // Read messages until error or none available. - for pgErr == nil { - msg, err := pgConn.receiveMessage() - if err != nil { - if errors.Is(err, nbconn.ErrWouldBlock) { - break - } - pgConn.asyncClose() + var pgErr error + var copyErr error + for copyErr == nil && pgErr == nil { + select { + case copyErr = <-copyErrChan: + case <-signalMessageChan: + // If pgConn.receiveMessage encounters an error it will call pgConn.asyncClose. But that is a race condition with + // the goroutine. So instead check pgConn.bufferingReceiveErr which will have been set by the signalMessage. If an + // error is found then forcibly close the connection without sending the Terminate message. + if err := pgConn.bufferingReceiveErr; err != nil { + pgConn.status = connStatusClosed + pgConn.conn.Close() + close(pgConn.cleanupDone) return CommandTag{}, normalizeTimeoutError(ctx, err) } + msg, _ := pgConn.receiveMessage() switch msg := msg.(type) { case *pgproto3.ErrorResponse: pgErr = ErrorResponseToPgError(msg) - break + default: + signalMessageChan = pgConn.signalMessage() } } } + close(abortCopyChan) + // Make sure io goroutine finishes before writing. + wg.Wait() - err = pgConn.conn.SetReadDeadline(time.Time{}) - if err != nil { - pgConn.asyncClose() - return CommandTag{}, err - } - nonblocking = false - - if readErr == io.EOF || pgErr != nil { + if copyErr == io.EOF || pgErr != nil { pgConn.frontend.Send(&pgproto3.CopyDone{}) } else { - pgConn.frontend.Send(&pgproto3.CopyFail{Message: readErr.Error()}) + pgConn.frontend.Send(&pgproto3.CopyFail{Message: copyErr.Error()}) } - err = pgConn.frontend.Flush() + err = pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() return CommandTag{}, err @@ -1283,7 +1411,6 @@ func (mrr *MultiResultReader) ReadAll() ([]*Result, error) { func (mrr *MultiResultReader) receiveMessage() (pgproto3.BackendMessage, error) { msg, err := mrr.pgConn.receiveMessage() - if err != nil { mrr.pgConn.contextWatcher.Unwatch() mrr.err = normalizeTimeoutError(mrr.ctx, err) @@ -1426,7 +1553,8 @@ func (rr *ResultReader) NextRow() bool { } // FieldDescriptions returns the field descriptions for the current result set. The returned slice is only valid until -// the ResultReader is closed. +// the ResultReader is closed. It may return nil (for example, if the query did not return a result set or an error was +// encountered.) func (rr *ResultReader) FieldDescriptions() []FieldDescription { return rr.fieldDescriptions } @@ -1546,25 +1674,55 @@ func (rr *ResultReader) concludeCommand(commandTag CommandTag, err error) { // Batch is a collection of queries that can be sent to the PostgreSQL server in a single round-trip. type Batch struct { buf []byte + err error } // ExecParams appends an ExecParams command to the batch. See PgConn.ExecParams for parameter descriptions. func (batch *Batch) ExecParams(sql string, paramValues [][]byte, paramOIDs []uint32, paramFormats []int16, resultFormats []int16) { - batch.buf = (&pgproto3.Parse{Query: sql, ParameterOIDs: paramOIDs}).Encode(batch.buf) + if batch.err != nil { + return + } + + batch.buf, batch.err = (&pgproto3.Parse{Query: sql, ParameterOIDs: paramOIDs}).Encode(batch.buf) + if batch.err != nil { + return + } batch.ExecPrepared("", paramValues, paramFormats, resultFormats) } // ExecPrepared appends an ExecPrepared e command to the batch. See PgConn.ExecPrepared for parameter descriptions. func (batch *Batch) ExecPrepared(stmtName string, paramValues [][]byte, paramFormats []int16, resultFormats []int16) { - batch.buf = (&pgproto3.Bind{PreparedStatement: stmtName, ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats}).Encode(batch.buf) - batch.buf = (&pgproto3.Describe{ObjectType: 'P'}).Encode(batch.buf) - batch.buf = (&pgproto3.Execute{}).Encode(batch.buf) + if batch.err != nil { + return + } + + batch.buf, batch.err = (&pgproto3.Bind{PreparedStatement: stmtName, ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats}).Encode(batch.buf) + if batch.err != nil { + return + } + + batch.buf, batch.err = (&pgproto3.Describe{ObjectType: 'P'}).Encode(batch.buf) + if batch.err != nil { + return + } + + batch.buf, batch.err = (&pgproto3.Execute{}).Encode(batch.buf) + if batch.err != nil { + return + } } // ExecBatch executes all the queries in batch in a single round-trip. Execution is implicitly transactional unless a // transaction is already in progress or SQL contains transaction control statements. This is a simpler way of executing // multiple queries in a single round trip than using pipeline mode. func (pgConn *PgConn) ExecBatch(ctx context.Context, batch *Batch) *MultiResultReader { + if batch.err != nil { + return &MultiResultReader{ + closed: true, + err: batch.err, + } + } + if err := pgConn.lock(); err != nil { return &MultiResultReader{ closed: true, @@ -1590,8 +1748,16 @@ func (pgConn *PgConn) ExecBatch(ctx context.Context, batch *Batch) *MultiResultR pgConn.contextWatcher.Watch(ctx) } - batch.buf = (&pgproto3.Sync{}).Encode(batch.buf) + batch.buf, batch.err = (&pgproto3.Sync{}).Encode(batch.buf) + if batch.err != nil { + multiResult.closed = true + multiResult.err = batch.err + pgConn.unlock() + return multiResult + } + pgConn.enterPotentialWriteReadDeadlock() + defer pgConn.exitPotentialWriteReadDeadlock() _, err := pgConn.conn.Write(batch.buf) if err != nil { multiResult.closed = true @@ -1620,29 +1786,105 @@ func (pgConn *PgConn) EscapeString(s string) (string, error) { return strings.Replace(s, "'", "''", -1), nil } -// CheckConn checks the underlying connection without writing any bytes. This is currently implemented by reading and -// buffering until the read would block or an error occurs. This can be used to check if the server has closed the -// connection. If this is done immediately before sending a query it reduces the chances a query will be sent that fails +// CheckConn checks the underlying connection without writing any bytes. This is currently implemented by doing a read +// with a very short deadline. This can be useful because a TCP connection can be broken such that a write will appear +// to succeed even though it will never actually reach the server. Reading immediately before a write will detect this +// condition. If this is done immediately before sending a query it reduces the chances a query will be sent that fails // without the client knowing whether the server received it or not. +// +// Deprecated: CheckConn is deprecated in favor of Ping. CheckConn cannot detect all types of broken connections where +// the write would still appear to succeed. Prefer Ping unless on a high latency connection. func (pgConn *PgConn) CheckConn() error { - err := pgConn.conn.BufferReadUntilBlock() - if err != nil && !errors.Is(err, nbconn.ErrWouldBlock) { - return err + ctx, cancel := context.WithTimeout(context.Background(), 1*time.Millisecond) + defer cancel() + + _, err := pgConn.ReceiveMessage(ctx) + if err != nil { + if !Timeout(err) { + return err + } } + return nil } +// Ping pings the server. This can be useful because a TCP connection can be broken such that a write will appear to +// succeed even though it will never actually reach the server. Pinging immediately before sending a query reduces the +// chances a query will be sent that fails without the client knowing whether the server received it or not. +func (pgConn *PgConn) Ping(ctx context.Context) error { + return pgConn.Exec(ctx, "-- ping").Close() +} + // makeCommandTag makes a CommandTag. It does not retain a reference to buf or buf's underlying memory. func (pgConn *PgConn) makeCommandTag(buf []byte) CommandTag { return CommandTag{s: string(buf)} } +// enterPotentialWriteReadDeadlock must be called before a write that could deadlock if the server is simultaneously +// blocked writing to us. +func (pgConn *PgConn) enterPotentialWriteReadDeadlock() { + // The time to wait is somewhat arbitrary. A Write should only take as long as the syscall and memcpy to the OS + // outbound network buffer unless the buffer is full (which potentially is a block). It needs to be long enough for + // the normal case, but short enough not to kill performance if a block occurs. + // + // In addition, on Windows the default timer resolution is 15.6ms. So setting the timer to less than that is + // ineffective. + if pgConn.slowWriteTimer.Reset(15 * time.Millisecond) { + panic("BUG: slow write timer already active") + } +} + +// exitPotentialWriteReadDeadlock must be called after a call to enterPotentialWriteReadDeadlock. +func (pgConn *PgConn) exitPotentialWriteReadDeadlock() { + if !pgConn.slowWriteTimer.Stop() { + // The timer starts its function in a separate goroutine. It is necessary to ensure the background reader has + // started before calling Stop. Otherwise, the background reader may not be stopped. That on its own is not a + // serious problem. But what is a serious problem is that the background reader may start at an inopportune time in + // a subsequent query. For example, if a subsequent query was canceled then a deadline may be set on the net.Conn to + // interrupt an in-progress read. After the read is interrupted, but before the deadline is cleared, the background + // reader could start and read a deadline error. Then the next query would receive the an unexpected deadline error. + <-pgConn.bgReaderStarted + pgConn.bgReader.Stop() + } +} + +func (pgConn *PgConn) flushWithPotentialWriteReadDeadlock() error { + pgConn.enterPotentialWriteReadDeadlock() + defer pgConn.exitPotentialWriteReadDeadlock() + err := pgConn.frontend.Flush() + return err +} + +// SyncConn prepares the underlying net.Conn for direct use. PgConn may internally buffer reads or use goroutines for +// background IO. This means that any direct use of the underlying net.Conn may be corrupted if a read is already +// buffered or a read is in progress. SyncConn drains read buffers and stops background IO. In some cases this may +// require sending a ping to the server. ctx can be used to cancel this operation. This should be called before any +// operation that will use the underlying net.Conn directly. e.g. Before Conn() or Hijack(). +// +// This should not be confused with the PostgreSQL protocol Sync message. +func (pgConn *PgConn) SyncConn(ctx context.Context) error { + for i := 0; i < 10; i++ { + if pgConn.bgReader.Status() == bgreader.StatusStopped && pgConn.frontend.ReadBufferLen() == 0 { + return nil + } + + err := pgConn.Ping(ctx) + if err != nil { + return fmt.Errorf("SyncConn: Ping failed while syncing conn: %w", err) + } + } + + // This should never happen. Only way I can imagine this occurring is if the server is constantly sending data such as + // LISTEN/NOTIFY or log notifications such that we never can get an empty buffer. + return errors.New("SyncConn: conn never synchronized") +} + // HijackedConn is the result of hijacking a connection. // // Due to the necessary exposure of internal implementation details, it is not covered by the semantic versioning // compatibility. type HijackedConn struct { - Conn nbconn.Conn // the non-blocking wrapper of the underlying TCP or unix domain socket connection + Conn net.Conn PID uint32 // backend pid SecretKey uint32 // key to use to send a cancel query message to the server ParameterStatuses map[string]string // parameters that have been reported by the server @@ -1651,9 +1893,9 @@ type HijackedConn struct { Config *Config } -// Hijack extracts the internal connection data. pgConn must be in an idle state. pgConn is unusable after hijacking. -// Hijacking is typically only useful when using pgconn to establish a connection, but taking complete control of the -// raw connection after that (e.g. a load balancer or proxy). +// Hijack extracts the internal connection data. pgConn must be in an idle state. SyncConn should be called immediately +// before Hijack. pgConn is unusable after hijacking. Hijacking is typically only useful when using pgconn to establish +// a connection, but taking complete control of the raw connection after that (e.g. a load balancer or proxy). // // Due to the necessary exposure of internal implementation details, it is not covered by the semantic versioning // compatibility. @@ -1677,6 +1919,8 @@ func (pgConn *PgConn) Hijack() (*HijackedConn, error) { // Construct created a PgConn from an already established connection to a PostgreSQL server. This is the inverse of // PgConn.Hijack. The connection must be in an idle state. // +// hc.Frontend is replaced by a new pgproto3.Frontend built by hc.Config.BuildFrontend. +// // Due to the necessary exposure of internal implementation details, it is not covered by the semantic versioning // compatibility. func Construct(hc *HijackedConn) (*PgConn, error) { @@ -1695,6 +1939,16 @@ func Construct(hc *HijackedConn) (*PgConn, error) { } pgConn.contextWatcher = newContextWatcher(pgConn.conn) + pgConn.bgReader = bgreader.New(pgConn.conn) + pgConn.slowWriteTimer = time.AfterFunc(time.Duration(math.MaxInt64), + func() { + pgConn.bgReader.Start() + pgConn.bgReaderStarted <- struct{}{} + }, + ) + pgConn.slowWriteTimer.Stop() + pgConn.bgReaderStarted = make(chan struct{}) + pgConn.frontend = hc.Config.BuildFrontend(pgConn.bgReader, pgConn.conn) return pgConn, nil } @@ -1817,7 +2071,7 @@ func (p *Pipeline) Flush() error { return errors.New("pipeline closed") } - err := p.conn.frontend.Flush() + err := p.conn.flushWithPotentialWriteReadDeadlock() if err != nil { err = normalizeTimeoutError(p.ctx, err) @@ -1835,6 +2089,13 @@ func (p *Pipeline) Flush() error { // Sync establishes a synchronization point and flushes the queued requests. func (p *Pipeline) Sync() error { + if p.closed { + if p.err != nil { + return p.err + } + return errors.New("pipeline closed") + } + p.conn.frontend.SendSync(&pgproto3.Sync{}) err := p.Flush() if err != nil { @@ -1851,14 +2112,28 @@ func (p *Pipeline) Sync() error { // *PipelineSync. If an ErrorResponse is received from the server, results will be nil and err will be a *PgError. If no // results are available, results and err will both be nil. func (p *Pipeline) GetResults() (results any, err error) { + if p.closed { + if p.err != nil { + return nil, p.err + } + return nil, errors.New("pipeline closed") + } + if p.expectedReadyForQueryCount == 0 { return nil, nil } + return p.getResults() +} + +func (p *Pipeline) getResults() (results any, err error) { for { msg, err := p.conn.receiveMessage() if err != nil { - return nil, err + p.closed = true + p.err = err + p.conn.asyncClose() + return nil, normalizeTimeoutError(p.ctx, err) } switch msg := msg.(type) { @@ -1880,7 +2155,8 @@ func (p *Pipeline) GetResults() (results any, err error) { case *pgproto3.ParseComplete: peekedMsg, err := p.conn.peekMessage() if err != nil { - return nil, err + p.conn.asyncClose() + return nil, normalizeTimeoutError(p.ctx, err) } if _, ok := peekedMsg.(*pgproto3.ParameterDescription); ok { return p.getResultsPrepare() @@ -1896,7 +2172,6 @@ func (p *Pipeline) GetResults() (results any, err error) { } } - } func (p *Pipeline) getResultsPrepare() (*StatementDescription, error) { @@ -1941,6 +2216,7 @@ func (p *Pipeline) Close() error { if p.closed { return p.err } + p.closed = true if p.pendingSync { @@ -1953,7 +2229,7 @@ func (p *Pipeline) Close() error { } for p.expectedReadyForQueryCount > 0 { - _, err := p.GetResults() + _, err := p.getResults() if err != nil { p.err = err var pgErr *PgError diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/README.md b/vendor/github.com/jackc/pgx/v5/pgproto3/README.md index 79d3a68b..7a26f1cb 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/README.md +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/README.md @@ -1,6 +1,6 @@ # pgproto3 -Package pgproto3 is a encoder and decoder of the PostgreSQL wire protocol version 3. +Package pgproto3 is an encoder and decoder of the PostgreSQL wire protocol version 3. pgproto3 can be used as a foundation for PostgreSQL drivers, proxies, mock servers, load balancers and more. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_cleartext_password.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_cleartext_password.go index d8f98b9a..ac2962e9 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_cleartext_password.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_cleartext_password.go @@ -35,11 +35,10 @@ func (dst *AuthenticationCleartextPassword) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *AuthenticationCleartextPassword) Encode(dst []byte) []byte { - dst = append(dst, 'R') - dst = pgio.AppendInt32(dst, 8) +func (src *AuthenticationCleartextPassword) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeCleartextPassword) - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss.go index 0d234222..178ef31d 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss.go @@ -27,11 +27,10 @@ func (a *AuthenticationGSS) Decode(src []byte) error { return nil } -func (a *AuthenticationGSS) Encode(dst []byte) []byte { - dst = append(dst, 'R') - dst = pgio.AppendInt32(dst, 4) +func (a *AuthenticationGSS) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeGSS) - return dst + return finishMessage(dst, sp) } func (a *AuthenticationGSS) MarshalJSON() ([]byte, error) { diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss_continue.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss_continue.go index 63789dc1..2ba3f3b3 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss_continue.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss_continue.go @@ -31,12 +31,11 @@ func (a *AuthenticationGSSContinue) Decode(src []byte) error { return nil } -func (a *AuthenticationGSSContinue) Encode(dst []byte) []byte { - dst = append(dst, 'R') - dst = pgio.AppendInt32(dst, int32(len(a.Data))+8) +func (a *AuthenticationGSSContinue) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeGSSCont) dst = append(dst, a.Data...) - return dst + return finishMessage(dst, sp) } func (a *AuthenticationGSSContinue) MarshalJSON() ([]byte, error) { diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_md5_password.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_md5_password.go index 5671c84c..854c6404 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_md5_password.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_md5_password.go @@ -38,12 +38,11 @@ func (dst *AuthenticationMD5Password) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *AuthenticationMD5Password) Encode(dst []byte) []byte { - dst = append(dst, 'R') - dst = pgio.AppendInt32(dst, 12) +func (src *AuthenticationMD5Password) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeMD5Password) dst = append(dst, src.Salt[:]...) - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_ok.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_ok.go index 88d648ae..ec11d39f 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_ok.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_ok.go @@ -35,11 +35,10 @@ func (dst *AuthenticationOk) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *AuthenticationOk) Encode(dst []byte) []byte { - dst = append(dst, 'R') - dst = pgio.AppendInt32(dst, 8) +func (src *AuthenticationOk) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeOk) - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl.go index 59650d4c..e66580f4 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl.go @@ -47,10 +47,8 @@ func (dst *AuthenticationSASL) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *AuthenticationSASL) Encode(dst []byte) []byte { - dst = append(dst, 'R') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *AuthenticationSASL) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeSASL) for _, s := range src.AuthMechanisms { @@ -59,9 +57,7 @@ func (src *AuthenticationSASL) Encode(dst []byte) []byte { } dst = append(dst, 0) - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_continue.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_continue.go index 2ce70a47..70fba4a6 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_continue.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_continue.go @@ -38,17 +38,11 @@ func (dst *AuthenticationSASLContinue) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *AuthenticationSASLContinue) Encode(dst []byte) []byte { - dst = append(dst, 'R') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *AuthenticationSASLContinue) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeSASLContinue) - dst = append(dst, src.Data...) - - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_final.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_final.go index a38a8b91..84976c2a 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_final.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_final.go @@ -38,17 +38,11 @@ func (dst *AuthenticationSASLFinal) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *AuthenticationSASLFinal) Encode(dst []byte) []byte { - dst = append(dst, 'R') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *AuthenticationSASLFinal) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeSASLFinal) - dst = append(dst, src.Data...) - - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Unmarshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/backend.go b/vendor/github.com/jackc/pgx/v5/pgproto3/backend.go index 6db77e4a..d146c338 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/backend.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/backend.go @@ -16,7 +16,8 @@ type Backend struct { // before it is actually transmitted (i.e. before Flush). tracer *tracer - wbuf []byte + wbuf []byte + encodeError error // Frontend message flyweights bind Bind @@ -38,6 +39,7 @@ type Backend struct { terminate Terminate bodyLen int + maxBodyLen int // maxBodyLen is the maximum length of a message body in octets. If a message body exceeds this length, Receive will return an error. msgType byte partialMsg bool authType uint32 @@ -54,11 +56,21 @@ func NewBackend(r io.Reader, w io.Writer) *Backend { return &Backend{cr: cr, w: w} } -// Send sends a message to the frontend (i.e. the client). The message is not guaranteed to be written until Flush is -// called. +// Send sends a message to the frontend (i.e. the client). The message is buffered until Flush is called. Any error +// encountered will be returned from Flush. func (b *Backend) Send(msg BackendMessage) { + if b.encodeError != nil { + return + } + prevLen := len(b.wbuf) - b.wbuf = msg.Encode(b.wbuf) + newBuf, err := msg.Encode(b.wbuf) + if err != nil { + b.encodeError = err + return + } + b.wbuf = newBuf + if b.tracer != nil { b.tracer.traceMessage('B', int32(len(b.wbuf)-prevLen), msg) } @@ -66,6 +78,12 @@ func (b *Backend) Send(msg BackendMessage) { // Flush writes any pending messages to the frontend (i.e. the client). func (b *Backend) Flush() error { + if err := b.encodeError; err != nil { + b.encodeError = nil + b.wbuf = b.wbuf[:0] + return &writeError{err: err, safeToRetry: true} + } + n, err := b.w.Write(b.wbuf) const maxLen = 1024 @@ -158,6 +176,9 @@ func (b *Backend) Receive() (FrontendMessage, error) { b.msgType = header[0] b.bodyLen = int(binary.BigEndian.Uint32(header[1:])) - 4 + if b.maxBodyLen > 0 && b.bodyLen > b.maxBodyLen { + return nil, &ExceededMaxBodyLenErr{b.maxBodyLen, b.bodyLen} + } b.partialMsg = true } @@ -260,3 +281,12 @@ func (b *Backend) SetAuthType(authType uint32) error { return nil } + +// SetMaxBodyLen sets the maximum length of a message body in octets. If a message body exceeds this length, Receive will return +// an error. This is useful for protecting against malicious clients that send large messages with the intent of +// causing memory exhaustion. +// The default value is 0. +// If maxBodyLen is 0, then no maximum is enforced. +func (b *Backend) SetMaxBodyLen(maxBodyLen int) { + b.maxBodyLen = maxBodyLen +} diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/backend_key_data.go b/vendor/github.com/jackc/pgx/v5/pgproto3/backend_key_data.go index 12c60817..23f5da67 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/backend_key_data.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/backend_key_data.go @@ -29,12 +29,11 @@ func (dst *BackendKeyData) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *BackendKeyData) Encode(dst []byte) []byte { - dst = append(dst, 'K') - dst = pgio.AppendUint32(dst, 12) +func (src *BackendKeyData) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'K') dst = pgio.AppendUint32(dst, src.ProcessID) dst = pgio.AppendUint32(dst, src.SecretKey) - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/bind.go b/vendor/github.com/jackc/pgx/v5/pgproto3/bind.go index fdd2d3b8..ad6ac48b 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/bind.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/bind.go @@ -5,7 +5,9 @@ import ( "encoding/binary" "encoding/hex" "encoding/json" + "errors" "fmt" + "math" "github.com/jackc/pgx/v5/internal/pgio" ) @@ -108,21 +110,25 @@ func (dst *Bind) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *Bind) Encode(dst []byte) []byte { - dst = append(dst, 'B') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *Bind) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'B') dst = append(dst, src.DestinationPortal...) dst = append(dst, 0) dst = append(dst, src.PreparedStatement...) dst = append(dst, 0) + if len(src.ParameterFormatCodes) > math.MaxUint16 { + return nil, errors.New("too many parameter format codes") + } dst = pgio.AppendUint16(dst, uint16(len(src.ParameterFormatCodes))) for _, fc := range src.ParameterFormatCodes { dst = pgio.AppendInt16(dst, fc) } + if len(src.Parameters) > math.MaxUint16 { + return nil, errors.New("too many parameters") + } dst = pgio.AppendUint16(dst, uint16(len(src.Parameters))) for _, p := range src.Parameters { if p == nil { @@ -134,14 +140,15 @@ func (src *Bind) Encode(dst []byte) []byte { dst = append(dst, p...) } + if len(src.ResultFormatCodes) > math.MaxUint16 { + return nil, errors.New("too many result format codes") + } dst = pgio.AppendUint16(dst, uint16(len(src.ResultFormatCodes))) for _, fc := range src.ResultFormatCodes { dst = pgio.AppendInt16(dst, fc) } - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/bind_complete.go b/vendor/github.com/jackc/pgx/v5/pgproto3/bind_complete.go index 3be256c8..bacf30d8 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/bind_complete.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/bind_complete.go @@ -20,8 +20,8 @@ func (dst *BindComplete) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *BindComplete) Encode(dst []byte) []byte { - return append(dst, '2', 0, 0, 0, 4) +func (src *BindComplete) Encode(dst []byte) ([]byte, error) { + return append(dst, '2', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/cancel_request.go b/vendor/github.com/jackc/pgx/v5/pgproto3/cancel_request.go index 8fcf8217..6b52dd97 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/cancel_request.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/cancel_request.go @@ -36,12 +36,12 @@ func (dst *CancelRequest) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 4 byte message length. -func (src *CancelRequest) Encode(dst []byte) []byte { +func (src *CancelRequest) Encode(dst []byte) ([]byte, error) { dst = pgio.AppendInt32(dst, 16) dst = pgio.AppendInt32(dst, cancelRequestCode) dst = pgio.AppendUint32(dst, src.ProcessID) dst = pgio.AppendUint32(dst, src.SecretKey) - return dst + return dst, nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/close.go b/vendor/github.com/jackc/pgx/v5/pgproto3/close.go index f99b5943..0b50f27c 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/close.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/close.go @@ -4,8 +4,6 @@ import ( "bytes" "encoding/json" "errors" - - "github.com/jackc/pgx/v5/internal/pgio" ) type Close struct { @@ -37,18 +35,12 @@ func (dst *Close) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *Close) Encode(dst []byte) []byte { - dst = append(dst, 'C') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) - +func (src *Close) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'C') dst = append(dst, src.ObjectType) dst = append(dst, src.Name...) dst = append(dst, 0) - - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/close_complete.go b/vendor/github.com/jackc/pgx/v5/pgproto3/close_complete.go index 1d7b8f08..833f7a12 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/close_complete.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/close_complete.go @@ -20,8 +20,8 @@ func (dst *CloseComplete) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *CloseComplete) Encode(dst []byte) []byte { - return append(dst, '3', 0, 0, 0, 4) +func (src *CloseComplete) Encode(dst []byte) ([]byte, error) { + return append(dst, '3', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/command_complete.go b/vendor/github.com/jackc/pgx/v5/pgproto3/command_complete.go index 814027ca..eba70947 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/command_complete.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/command_complete.go @@ -3,8 +3,6 @@ package pgproto3 import ( "bytes" "encoding/json" - - "github.com/jackc/pgx/v5/internal/pgio" ) type CommandComplete struct { @@ -31,17 +29,11 @@ func (dst *CommandComplete) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *CommandComplete) Encode(dst []byte) []byte { - dst = append(dst, 'C') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) - +func (src *CommandComplete) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'C') dst = append(dst, src.CommandTag...) dst = append(dst, 0) - - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/copy_both_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_both_response.go index 8840a89e..99e1afea 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/copy_both_response.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_both_response.go @@ -5,6 +5,7 @@ import ( "encoding/binary" "encoding/json" "errors" + "math" "github.com/jackc/pgx/v5/internal/pgio" ) @@ -44,19 +45,18 @@ func (dst *CopyBothResponse) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *CopyBothResponse) Encode(dst []byte) []byte { - dst = append(dst, 'W') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *CopyBothResponse) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'W') dst = append(dst, src.OverallFormat) + if len(src.ColumnFormatCodes) > math.MaxUint16 { + return nil, errors.New("too many column format codes") + } dst = pgio.AppendUint16(dst, uint16(len(src.ColumnFormatCodes))) for _, fc := range src.ColumnFormatCodes { dst = pgio.AppendUint16(dst, fc) } - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/copy_data.go b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_data.go index 59e3dd94..89ecdd4d 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/copy_data.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_data.go @@ -3,8 +3,6 @@ package pgproto3 import ( "encoding/hex" "encoding/json" - - "github.com/jackc/pgx/v5/internal/pgio" ) type CopyData struct { @@ -25,11 +23,10 @@ func (dst *CopyData) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *CopyData) Encode(dst []byte) []byte { - dst = append(dst, 'd') - dst = pgio.AppendInt32(dst, int32(4+len(src.Data))) +func (src *CopyData) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'd') dst = append(dst, src.Data...) - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/copy_done.go b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_done.go index 0e13282b..040814db 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/copy_done.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_done.go @@ -24,8 +24,8 @@ func (dst *CopyDone) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *CopyDone) Encode(dst []byte) []byte { - return append(dst, 'c', 0, 0, 0, 4) +func (src *CopyDone) Encode(dst []byte) ([]byte, error) { + return append(dst, 'c', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/copy_fail.go b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_fail.go index 0041bbb1..72a85fd0 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/copy_fail.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_fail.go @@ -3,8 +3,6 @@ package pgproto3 import ( "bytes" "encoding/json" - - "github.com/jackc/pgx/v5/internal/pgio" ) type CopyFail struct { @@ -28,17 +26,11 @@ func (dst *CopyFail) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *CopyFail) Encode(dst []byte) []byte { - dst = append(dst, 'f') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) - +func (src *CopyFail) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'f') dst = append(dst, src.Message...) dst = append(dst, 0) - - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/copy_in_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_in_response.go index 4584f7df..06cf99ce 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/copy_in_response.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_in_response.go @@ -5,6 +5,7 @@ import ( "encoding/binary" "encoding/json" "errors" + "math" "github.com/jackc/pgx/v5/internal/pgio" ) @@ -44,20 +45,19 @@ func (dst *CopyInResponse) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *CopyInResponse) Encode(dst []byte) []byte { - dst = append(dst, 'G') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *CopyInResponse) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'G') dst = append(dst, src.OverallFormat) + if len(src.ColumnFormatCodes) > math.MaxUint16 { + return nil, errors.New("too many column format codes") + } dst = pgio.AppendUint16(dst, uint16(len(src.ColumnFormatCodes))) for _, fc := range src.ColumnFormatCodes { dst = pgio.AppendUint16(dst, fc) } - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/copy_out_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_out_response.go index 3175c6a4..549e916c 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/copy_out_response.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_out_response.go @@ -5,6 +5,7 @@ import ( "encoding/binary" "encoding/json" "errors" + "math" "github.com/jackc/pgx/v5/internal/pgio" ) @@ -43,21 +44,20 @@ func (dst *CopyOutResponse) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *CopyOutResponse) Encode(dst []byte) []byte { - dst = append(dst, 'H') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *CopyOutResponse) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'H') dst = append(dst, src.OverallFormat) + if len(src.ColumnFormatCodes) > math.MaxUint16 { + return nil, errors.New("too many column format codes") + } dst = pgio.AppendUint16(dst, uint16(len(src.ColumnFormatCodes))) for _, fc := range src.ColumnFormatCodes { dst = pgio.AppendUint16(dst, fc) } - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/data_row.go b/vendor/github.com/jackc/pgx/v5/pgproto3/data_row.go index 4de77977..fdfb0f7f 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/data_row.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/data_row.go @@ -4,6 +4,8 @@ import ( "encoding/binary" "encoding/hex" "encoding/json" + "errors" + "math" "github.com/jackc/pgx/v5/internal/pgio" ) @@ -63,11 +65,12 @@ func (dst *DataRow) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *DataRow) Encode(dst []byte) []byte { - dst = append(dst, 'D') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *DataRow) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'D') + if len(src.Values) > math.MaxUint16 { + return nil, errors.New("too many values") + } dst = pgio.AppendUint16(dst, uint16(len(src.Values))) for _, v := range src.Values { if v == nil { @@ -79,9 +82,7 @@ func (src *DataRow) Encode(dst []byte) []byte { dst = append(dst, v...) } - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/describe.go b/vendor/github.com/jackc/pgx/v5/pgproto3/describe.go index f131d1f4..89feff21 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/describe.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/describe.go @@ -4,8 +4,6 @@ import ( "bytes" "encoding/json" "errors" - - "github.com/jackc/pgx/v5/internal/pgio" ) type Describe struct { @@ -37,18 +35,12 @@ func (dst *Describe) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *Describe) Encode(dst []byte) []byte { - dst = append(dst, 'D') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) - +func (src *Describe) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'D') dst = append(dst, src.ObjectType) dst = append(dst, src.Name...) dst = append(dst, 0) - - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/doc.go b/vendor/github.com/jackc/pgx/v5/pgproto3/doc.go index e0e1cf87..0afd18e2 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/doc.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/doc.go @@ -1,7 +1,7 @@ -// Package pgproto3 is a encoder and decoder of the PostgreSQL wire protocol version 3. +// Package pgproto3 is an encoder and decoder of the PostgreSQL wire protocol version 3. // // The primary interfaces are Frontend and Backend. They correspond to a client and server respectively. Messages are -// sent with Send (or a specialized Send variant). Messages are automatically bufferred to minimize small writes. Call +// sent with Send (or a specialized Send variant). Messages are automatically buffered to minimize small writes. Call // Flush to ensure a message has actually been sent. // // The Trace method of Frontend and Backend can be used to examine the wire-level message traffic. It outputs in a diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/empty_query_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/empty_query_response.go index 2b85e744..cb6cca07 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/empty_query_response.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/empty_query_response.go @@ -20,8 +20,8 @@ func (dst *EmptyQueryResponse) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *EmptyQueryResponse) Encode(dst []byte) []byte { - return append(dst, 'I', 0, 0, 0, 4) +func (src *EmptyQueryResponse) Encode(dst []byte) ([]byte, error) { + return append(dst, 'I', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/error_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/error_response.go index 45c9a981..6ef9bd06 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/error_response.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/error_response.go @@ -2,7 +2,6 @@ package pgproto3 import ( "bytes" - "encoding/binary" "encoding/json" "strconv" ) @@ -111,119 +110,113 @@ func (dst *ErrorResponse) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *ErrorResponse) Encode(dst []byte) []byte { - return append(dst, src.marshalBinary('E')...) +func (src *ErrorResponse) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'E') + dst = src.appendFields(dst) + return finishMessage(dst, sp) } -func (src *ErrorResponse) marshalBinary(typeByte byte) []byte { - var bigEndian BigEndianBuf - buf := &bytes.Buffer{} - - buf.WriteByte(typeByte) - buf.Write(bigEndian.Uint32(0)) - +func (src *ErrorResponse) appendFields(dst []byte) []byte { if src.Severity != "" { - buf.WriteByte('S') - buf.WriteString(src.Severity) - buf.WriteByte(0) + dst = append(dst, 'S') + dst = append(dst, src.Severity...) + dst = append(dst, 0) } if src.SeverityUnlocalized != "" { - buf.WriteByte('V') - buf.WriteString(src.SeverityUnlocalized) - buf.WriteByte(0) + dst = append(dst, 'V') + dst = append(dst, src.SeverityUnlocalized...) + dst = append(dst, 0) } if src.Code != "" { - buf.WriteByte('C') - buf.WriteString(src.Code) - buf.WriteByte(0) + dst = append(dst, 'C') + dst = append(dst, src.Code...) + dst = append(dst, 0) } if src.Message != "" { - buf.WriteByte('M') - buf.WriteString(src.Message) - buf.WriteByte(0) + dst = append(dst, 'M') + dst = append(dst, src.Message...) + dst = append(dst, 0) } if src.Detail != "" { - buf.WriteByte('D') - buf.WriteString(src.Detail) - buf.WriteByte(0) + dst = append(dst, 'D') + dst = append(dst, src.Detail...) + dst = append(dst, 0) } if src.Hint != "" { - buf.WriteByte('H') - buf.WriteString(src.Hint) - buf.WriteByte(0) + dst = append(dst, 'H') + dst = append(dst, src.Hint...) + dst = append(dst, 0) } if src.Position != 0 { - buf.WriteByte('P') - buf.WriteString(strconv.Itoa(int(src.Position))) - buf.WriteByte(0) + dst = append(dst, 'P') + dst = append(dst, strconv.Itoa(int(src.Position))...) + dst = append(dst, 0) } if src.InternalPosition != 0 { - buf.WriteByte('p') - buf.WriteString(strconv.Itoa(int(src.InternalPosition))) - buf.WriteByte(0) + dst = append(dst, 'p') + dst = append(dst, strconv.Itoa(int(src.InternalPosition))...) + dst = append(dst, 0) } if src.InternalQuery != "" { - buf.WriteByte('q') - buf.WriteString(src.InternalQuery) - buf.WriteByte(0) + dst = append(dst, 'q') + dst = append(dst, src.InternalQuery...) + dst = append(dst, 0) } if src.Where != "" { - buf.WriteByte('W') - buf.WriteString(src.Where) - buf.WriteByte(0) + dst = append(dst, 'W') + dst = append(dst, src.Where...) + dst = append(dst, 0) } if src.SchemaName != "" { - buf.WriteByte('s') - buf.WriteString(src.SchemaName) - buf.WriteByte(0) + dst = append(dst, 's') + dst = append(dst, src.SchemaName...) + dst = append(dst, 0) } if src.TableName != "" { - buf.WriteByte('t') - buf.WriteString(src.TableName) - buf.WriteByte(0) + dst = append(dst, 't') + dst = append(dst, src.TableName...) + dst = append(dst, 0) } if src.ColumnName != "" { - buf.WriteByte('c') - buf.WriteString(src.ColumnName) - buf.WriteByte(0) + dst = append(dst, 'c') + dst = append(dst, src.ColumnName...) + dst = append(dst, 0) } if src.DataTypeName != "" { - buf.WriteByte('d') - buf.WriteString(src.DataTypeName) - buf.WriteByte(0) + dst = append(dst, 'd') + dst = append(dst, src.DataTypeName...) + dst = append(dst, 0) } if src.ConstraintName != "" { - buf.WriteByte('n') - buf.WriteString(src.ConstraintName) - buf.WriteByte(0) + dst = append(dst, 'n') + dst = append(dst, src.ConstraintName...) + dst = append(dst, 0) } if src.File != "" { - buf.WriteByte('F') - buf.WriteString(src.File) - buf.WriteByte(0) + dst = append(dst, 'F') + dst = append(dst, src.File...) + dst = append(dst, 0) } if src.Line != 0 { - buf.WriteByte('L') - buf.WriteString(strconv.Itoa(int(src.Line))) - buf.WriteByte(0) + dst = append(dst, 'L') + dst = append(dst, strconv.Itoa(int(src.Line))...) + dst = append(dst, 0) } if src.Routine != "" { - buf.WriteByte('R') - buf.WriteString(src.Routine) - buf.WriteByte(0) + dst = append(dst, 'R') + dst = append(dst, src.Routine...) + dst = append(dst, 0) } for k, v := range src.UnknownFields { - buf.WriteByte(k) - buf.WriteString(v) - buf.WriteByte(0) + dst = append(dst, k) + dst = append(dst, v...) + dst = append(dst, 0) } - buf.WriteByte(0) - - binary.BigEndian.PutUint32(buf.Bytes()[1:5], uint32(buf.Len()-1)) + dst = append(dst, 0) - return buf.Bytes() + return dst } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/execute.go b/vendor/github.com/jackc/pgx/v5/pgproto3/execute.go index a5fee7cb..31bc714d 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/execute.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/execute.go @@ -36,19 +36,12 @@ func (dst *Execute) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *Execute) Encode(dst []byte) []byte { - dst = append(dst, 'E') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) - +func (src *Execute) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'E') dst = append(dst, src.Portal...) dst = append(dst, 0) - dst = pgio.AppendUint32(dst, src.MaxRows) - - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/flush.go b/vendor/github.com/jackc/pgx/v5/pgproto3/flush.go index 2725f689..e5dc1fbb 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/flush.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/flush.go @@ -20,8 +20,8 @@ func (dst *Flush) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *Flush) Encode(dst []byte) []byte { - return append(dst, 'H', 0, 0, 0, 4) +func (src *Flush) Encode(dst []byte) ([]byte, error) { + return append(dst, 'H', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/frontend.go b/vendor/github.com/jackc/pgx/v5/pgproto3/frontend.go index 83dea963..b41abbe1 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/frontend.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/frontend.go @@ -18,7 +18,8 @@ type Frontend struct { // idle. Setting and unsetting tracer provides equivalent functionality to PQtrace and PQuntrace in libpq. tracer *tracer - wbuf []byte + wbuf []byte + encodeError error // Backend message flyweights authenticationOk AuthenticationOk @@ -64,16 +65,26 @@ func NewFrontend(r io.Reader, w io.Writer) *Frontend { return &Frontend{cr: cr, w: w} } -// Send sends a message to the backend (i.e. the server). The message is not guaranteed to be written until Flush is -// called. +// Send sends a message to the backend (i.e. the server). The message is buffered until Flush is called. Any error +// encountered will be returned from Flush. // // Send can work with any FrontendMessage. Some commonly used message types such as Bind have specialized send methods // such as SendBind. These methods should be preferred when the type of message is known up front (e.g. when building an // extended query protocol query) as they may be faster due to knowing the type of msg rather than it being hidden // behind an interface. func (f *Frontend) Send(msg FrontendMessage) { + if f.encodeError != nil { + return + } + prevLen := len(f.wbuf) - f.wbuf = msg.Encode(f.wbuf) + newBuf, err := msg.Encode(f.wbuf) + if err != nil { + f.encodeError = err + return + } + f.wbuf = newBuf + if f.tracer != nil { f.tracer.traceMessage('F', int32(len(f.wbuf)-prevLen), msg) } @@ -81,6 +92,12 @@ func (f *Frontend) Send(msg FrontendMessage) { // Flush writes any pending messages to the backend (i.e. the server). func (f *Frontend) Flush() error { + if err := f.encodeError; err != nil { + f.encodeError = nil + f.wbuf = f.wbuf[:0] + return &writeError{err: err, safeToRetry: true} + } + if len(f.wbuf) == 0 { return nil } @@ -116,71 +133,141 @@ func (f *Frontend) Untrace() { f.tracer = nil } -// SendBind sends a Bind message to the backend (i.e. the server). The message is not guaranteed to be written until -// Flush is called. +// SendBind sends a Bind message to the backend (i.e. the server). The message is buffered until Flush is called. Any +// error encountered will be returned from Flush. func (f *Frontend) SendBind(msg *Bind) { + if f.encodeError != nil { + return + } + prevLen := len(f.wbuf) - f.wbuf = msg.Encode(f.wbuf) + newBuf, err := msg.Encode(f.wbuf) + if err != nil { + f.encodeError = err + return + } + f.wbuf = newBuf + if f.tracer != nil { f.tracer.traceBind('F', int32(len(f.wbuf)-prevLen), msg) } } -// SendParse sends a Parse message to the backend (i.e. the server). The message is not guaranteed to be written until -// Flush is called. +// SendParse sends a Parse message to the backend (i.e. the server). The message is buffered until Flush is called. Any +// error encountered will be returned from Flush. func (f *Frontend) SendParse(msg *Parse) { + if f.encodeError != nil { + return + } + prevLen := len(f.wbuf) - f.wbuf = msg.Encode(f.wbuf) + newBuf, err := msg.Encode(f.wbuf) + if err != nil { + f.encodeError = err + return + } + f.wbuf = newBuf + if f.tracer != nil { f.tracer.traceParse('F', int32(len(f.wbuf)-prevLen), msg) } } -// SendClose sends a Close message to the backend (i.e. the server). The message is not guaranteed to be written until -// Flush is called. +// SendClose sends a Close message to the backend (i.e. the server). The message is buffered until Flush is called. Any +// error encountered will be returned from Flush. func (f *Frontend) SendClose(msg *Close) { + if f.encodeError != nil { + return + } + prevLen := len(f.wbuf) - f.wbuf = msg.Encode(f.wbuf) + newBuf, err := msg.Encode(f.wbuf) + if err != nil { + f.encodeError = err + return + } + f.wbuf = newBuf + if f.tracer != nil { f.tracer.traceClose('F', int32(len(f.wbuf)-prevLen), msg) } } -// SendDescribe sends a Describe message to the backend (i.e. the server). The message is not guaranteed to be written until -// Flush is called. +// SendDescribe sends a Describe message to the backend (i.e. the server). The message is buffered until Flush is +// called. Any error encountered will be returned from Flush. func (f *Frontend) SendDescribe(msg *Describe) { + if f.encodeError != nil { + return + } + prevLen := len(f.wbuf) - f.wbuf = msg.Encode(f.wbuf) + newBuf, err := msg.Encode(f.wbuf) + if err != nil { + f.encodeError = err + return + } + f.wbuf = newBuf + if f.tracer != nil { f.tracer.traceDescribe('F', int32(len(f.wbuf)-prevLen), msg) } } -// SendExecute sends a Execute message to the backend (i.e. the server). The message is not guaranteed to be written until -// Flush is called. +// SendExecute sends an Execute message to the backend (i.e. the server). The message is buffered until Flush is called. +// Any error encountered will be returned from Flush. func (f *Frontend) SendExecute(msg *Execute) { + if f.encodeError != nil { + return + } + prevLen := len(f.wbuf) - f.wbuf = msg.Encode(f.wbuf) + newBuf, err := msg.Encode(f.wbuf) + if err != nil { + f.encodeError = err + return + } + f.wbuf = newBuf + if f.tracer != nil { f.tracer.TraceQueryute('F', int32(len(f.wbuf)-prevLen), msg) } } -// SendSync sends a Sync message to the backend (i.e. the server). The message is not guaranteed to be written until -// Flush is called. +// SendSync sends a Sync message to the backend (i.e. the server). The message is buffered until Flush is called. Any +// error encountered will be returned from Flush. func (f *Frontend) SendSync(msg *Sync) { + if f.encodeError != nil { + return + } + prevLen := len(f.wbuf) - f.wbuf = msg.Encode(f.wbuf) + newBuf, err := msg.Encode(f.wbuf) + if err != nil { + f.encodeError = err + return + } + f.wbuf = newBuf + if f.tracer != nil { f.tracer.traceSync('F', int32(len(f.wbuf)-prevLen), msg) } } -// SendQuery sends a Query message to the backend (i.e. the server). The message is not guaranteed to be written until -// Flush is called. +// SendQuery sends a Query message to the backend (i.e. the server). The message is buffered until Flush is called. Any +// error encountered will be returned from Flush. func (f *Frontend) SendQuery(msg *Query) { + if f.encodeError != nil { + return + } + prevLen := len(f.wbuf) - f.wbuf = msg.Encode(f.wbuf) + newBuf, err := msg.Encode(f.wbuf) + if err != nil { + f.encodeError = err + return + } + f.wbuf = newBuf + if f.tracer != nil { f.tracer.traceQuery('F', int32(len(f.wbuf)-prevLen), msg) } @@ -361,3 +448,7 @@ func (f *Frontend) findAuthenticationMessageType(src []byte) (BackendMessage, er func (f *Frontend) GetAuthType() uint32 { return f.authType } + +func (f *Frontend) ReadBufferLen() int { + return f.cr.wp - f.cr.rp +} diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/function_call.go b/vendor/github.com/jackc/pgx/v5/pgproto3/function_call.go index 2c4f38df..7d83579f 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/function_call.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/function_call.go @@ -2,6 +2,8 @@ package pgproto3 import ( "encoding/binary" + "errors" + "math" "github.com/jackc/pgx/v5/internal/pgio" ) @@ -71,15 +73,21 @@ func (dst *FunctionCall) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *FunctionCall) Encode(dst []byte) []byte { - dst = append(dst, 'F') - sp := len(dst) - dst = pgio.AppendUint32(dst, 0) // Unknown length, set it at the end +func (src *FunctionCall) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'F') dst = pgio.AppendUint32(dst, src.Function) + + if len(src.ArgFormatCodes) > math.MaxUint16 { + return nil, errors.New("too many arg format codes") + } dst = pgio.AppendUint16(dst, uint16(len(src.ArgFormatCodes))) for _, argFormatCode := range src.ArgFormatCodes { dst = pgio.AppendUint16(dst, argFormatCode) } + + if len(src.Arguments) > math.MaxUint16 { + return nil, errors.New("too many arguments") + } dst = pgio.AppendUint16(dst, uint16(len(src.Arguments))) for _, argument := range src.Arguments { if argument == nil { @@ -90,6 +98,5 @@ func (src *FunctionCall) Encode(dst []byte) []byte { } } dst = pgio.AppendUint16(dst, src.ResultFormatCode) - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - return dst + return finishMessage(dst, sp) } diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/function_call_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/function_call_response.go index 3d3606dd..1f273495 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/function_call_response.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/function_call_response.go @@ -39,10 +39,8 @@ func (dst *FunctionCallResponse) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *FunctionCallResponse) Encode(dst []byte) []byte { - dst = append(dst, 'V') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *FunctionCallResponse) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'V') if src.Result == nil { dst = pgio.AppendInt32(dst, -1) @@ -51,9 +49,7 @@ func (src *FunctionCallResponse) Encode(dst []byte) []byte { dst = append(dst, src.Result...) } - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/gss_enc_request.go b/vendor/github.com/jackc/pgx/v5/pgproto3/gss_enc_request.go index 30ffc08d..70cb20cd 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/gss_enc_request.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/gss_enc_request.go @@ -31,10 +31,10 @@ func (dst *GSSEncRequest) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 4 byte message length. -func (src *GSSEncRequest) Encode(dst []byte) []byte { +func (src *GSSEncRequest) Encode(dst []byte) ([]byte, error) { dst = pgio.AppendInt32(dst, 8) dst = pgio.AppendInt32(dst, gssEncReqNumber) - return dst + return dst, nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/gss_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/gss_response.go index 64bfbd04..10d93775 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/gss_response.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/gss_response.go @@ -2,8 +2,6 @@ package pgproto3 import ( "encoding/json" - - "github.com/jackc/pgx/v5/internal/pgio" ) type GSSResponse struct { @@ -18,11 +16,10 @@ func (g *GSSResponse) Decode(data []byte) error { return nil } -func (g *GSSResponse) Encode(dst []byte) []byte { - dst = append(dst, 'p') - dst = pgio.AppendInt32(dst, int32(4+len(g.Data))) +func (g *GSSResponse) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'p') dst = append(dst, g.Data...) - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/no_data.go b/vendor/github.com/jackc/pgx/v5/pgproto3/no_data.go index d8f85d38..cbcaad40 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/no_data.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/no_data.go @@ -20,8 +20,8 @@ func (dst *NoData) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *NoData) Encode(dst []byte) []byte { - return append(dst, 'n', 0, 0, 0, 4) +func (src *NoData) Encode(dst []byte) ([]byte, error) { + return append(dst, 'n', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/notice_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/notice_response.go index 4ac28a79..497aba6d 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/notice_response.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/notice_response.go @@ -12,6 +12,8 @@ func (dst *NoticeResponse) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *NoticeResponse) Encode(dst []byte) []byte { - return append(dst, (*ErrorResponse)(src).marshalBinary('N')...) +func (src *NoticeResponse) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'N') + dst = (*ErrorResponse)(src).appendFields(dst) + return finishMessage(dst, sp) } diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/notification_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/notification_response.go index 228e0dac..243b6bf7 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/notification_response.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/notification_response.go @@ -45,20 +45,14 @@ func (dst *NotificationResponse) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *NotificationResponse) Encode(dst []byte) []byte { - dst = append(dst, 'A') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) - +func (src *NotificationResponse) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'A') dst = pgio.AppendUint32(dst, src.PID) dst = append(dst, src.Channel...) dst = append(dst, 0) dst = append(dst, src.Payload...) dst = append(dst, 0) - - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/parameter_description.go b/vendor/github.com/jackc/pgx/v5/pgproto3/parameter_description.go index 374d38a3..1ef27b75 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/parameter_description.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/parameter_description.go @@ -4,6 +4,8 @@ import ( "bytes" "encoding/binary" "encoding/json" + "errors" + "math" "github.com/jackc/pgx/v5/internal/pgio" ) @@ -39,19 +41,18 @@ func (dst *ParameterDescription) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *ParameterDescription) Encode(dst []byte) []byte { - dst = append(dst, 't') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *ParameterDescription) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 't') + if len(src.ParameterOIDs) > math.MaxUint16 { + return nil, errors.New("too many parameter oids") + } dst = pgio.AppendUint16(dst, uint16(len(src.ParameterOIDs))) for _, oid := range src.ParameterOIDs { dst = pgio.AppendUint32(dst, oid) } - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/parameter_status.go b/vendor/github.com/jackc/pgx/v5/pgproto3/parameter_status.go index a303e453..9ee0720b 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/parameter_status.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/parameter_status.go @@ -3,8 +3,6 @@ package pgproto3 import ( "bytes" "encoding/json" - - "github.com/jackc/pgx/v5/internal/pgio" ) type ParameterStatus struct { @@ -37,19 +35,13 @@ func (dst *ParameterStatus) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *ParameterStatus) Encode(dst []byte) []byte { - dst = append(dst, 'S') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) - +func (src *ParameterStatus) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'S') dst = append(dst, src.Name...) dst = append(dst, 0) dst = append(dst, src.Value...) dst = append(dst, 0) - - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/parse.go b/vendor/github.com/jackc/pgx/v5/pgproto3/parse.go index b53200dc..6ba3486c 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/parse.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/parse.go @@ -4,6 +4,8 @@ import ( "bytes" "encoding/binary" "encoding/json" + "errors" + "math" "github.com/jackc/pgx/v5/internal/pgio" ) @@ -52,24 +54,23 @@ func (dst *Parse) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *Parse) Encode(dst []byte) []byte { - dst = append(dst, 'P') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *Parse) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'P') dst = append(dst, src.Name...) dst = append(dst, 0) dst = append(dst, src.Query...) dst = append(dst, 0) + if len(src.ParameterOIDs) > math.MaxUint16 { + return nil, errors.New("too many parameter oids") + } dst = pgio.AppendUint16(dst, uint16(len(src.ParameterOIDs))) for _, oid := range src.ParameterOIDs { dst = pgio.AppendUint32(dst, oid) } - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/parse_complete.go b/vendor/github.com/jackc/pgx/v5/pgproto3/parse_complete.go index 92c9498b..cff9e27d 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/parse_complete.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/parse_complete.go @@ -20,8 +20,8 @@ func (dst *ParseComplete) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *ParseComplete) Encode(dst []byte) []byte { - return append(dst, '1', 0, 0, 0, 4) +func (src *ParseComplete) Encode(dst []byte) ([]byte, error) { + return append(dst, '1', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/password_message.go b/vendor/github.com/jackc/pgx/v5/pgproto3/password_message.go index 41f98692..d820d327 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/password_message.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/password_message.go @@ -3,8 +3,6 @@ package pgproto3 import ( "bytes" "encoding/json" - - "github.com/jackc/pgx/v5/internal/pgio" ) type PasswordMessage struct { @@ -32,14 +30,11 @@ func (dst *PasswordMessage) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *PasswordMessage) Encode(dst []byte) []byte { - dst = append(dst, 'p') - dst = pgio.AppendInt32(dst, int32(4+len(src.Password)+1)) - +func (src *PasswordMessage) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'p') dst = append(dst, src.Password...) dst = append(dst, 0) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/pgproto3.go b/vendor/github.com/jackc/pgx/v5/pgproto3/pgproto3.go index ef5a5489..480abfc0 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/pgproto3.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/pgproto3.go @@ -4,8 +4,14 @@ import ( "encoding/hex" "errors" "fmt" + + "github.com/jackc/pgx/v5/internal/pgio" ) +// maxMessageBodyLen is the maximum length of a message body in bytes. See PG_LARGE_MESSAGE_LIMIT in the PostgreSQL +// source. It is defined as (MaxAllocSize - 1). MaxAllocSize is defined as 0x3fffffff. +const maxMessageBodyLen = (0x3fffffff - 1) + // Message is the interface implemented by an object that can decode and encode // a particular PostgreSQL message. type Message interface { @@ -14,7 +20,7 @@ type Message interface { Decode(data []byte) error // Encode appends itself to dst and returns the new buffer. - Encode(dst []byte) []byte + Encode(dst []byte) ([]byte, error) } // FrontendMessage is a message sent by the frontend (i.e. the client). @@ -70,6 +76,15 @@ func (e *writeError) Unwrap() error { return e.err } +type ExceededMaxBodyLenErr struct { + MaxExpectedBodyLen int + ActualBodyLen int +} + +func (e *ExceededMaxBodyLenErr) Error() string { + return fmt.Sprintf("invalid body length: expected at most %d, but got %d", e.MaxExpectedBodyLen, e.ActualBodyLen) +} + // getValueFromJSON gets the value from a protocol message representation in JSON. func getValueFromJSON(v map[string]string) ([]byte, error) { if v == nil { @@ -83,3 +98,23 @@ func getValueFromJSON(v map[string]string) ([]byte, error) { } return nil, errors.New("unknown protocol representation") } + +// beginMessage begines a new message of type t. It appends the message type and a placeholder for the message length to +// dst. It returns the new buffer and the position of the message length placeholder. +func beginMessage(dst []byte, t byte) ([]byte, int) { + dst = append(dst, t) + sp := len(dst) + dst = pgio.AppendInt32(dst, -1) + return dst, sp +} + +// finishMessage finishes a message that was started with beginMessage. It computes the message length and writes it to +// dst[sp]. If the message length is too large it returns an error. Otherwise it returns the final message buffer. +func finishMessage(dst []byte, sp int) ([]byte, error) { + messageBodyLen := len(dst[sp:]) + if messageBodyLen > maxMessageBodyLen { + return nil, errors.New("message body too large") + } + pgio.SetInt32(dst[sp:], int32(messageBodyLen)) + return dst, nil +} diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/portal_suspended.go b/vendor/github.com/jackc/pgx/v5/pgproto3/portal_suspended.go index 1a9e7bfb..9e2f8cbc 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/portal_suspended.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/portal_suspended.go @@ -20,8 +20,8 @@ func (dst *PortalSuspended) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *PortalSuspended) Encode(dst []byte) []byte { - return append(dst, 's', 0, 0, 0, 4) +func (src *PortalSuspended) Encode(dst []byte) ([]byte, error) { + return append(dst, 's', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/query.go b/vendor/github.com/jackc/pgx/v5/pgproto3/query.go index e963a0ec..aebdfde8 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/query.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/query.go @@ -3,8 +3,6 @@ package pgproto3 import ( "bytes" "encoding/json" - - "github.com/jackc/pgx/v5/internal/pgio" ) type Query struct { @@ -28,14 +26,11 @@ func (dst *Query) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *Query) Encode(dst []byte) []byte { - dst = append(dst, 'Q') - dst = pgio.AppendInt32(dst, int32(4+len(src.String)+1)) - +func (src *Query) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'Q') dst = append(dst, src.String...) dst = append(dst, 0) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/ready_for_query.go b/vendor/github.com/jackc/pgx/v5/pgproto3/ready_for_query.go index 67a39be3..a56af9fb 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/ready_for_query.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/ready_for_query.go @@ -25,8 +25,8 @@ func (dst *ReadyForQuery) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *ReadyForQuery) Encode(dst []byte) []byte { - return append(dst, 'Z', 0, 0, 0, 5, src.TxStatus) +func (src *ReadyForQuery) Encode(dst []byte) ([]byte, error) { + return append(dst, 'Z', 0, 0, 0, 5, src.TxStatus), nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/row_description.go b/vendor/github.com/jackc/pgx/v5/pgproto3/row_description.go index 6f6f0681..dc2a4ddf 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/row_description.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/row_description.go @@ -4,6 +4,8 @@ import ( "bytes" "encoding/binary" "encoding/json" + "errors" + "math" "github.com/jackc/pgx/v5/internal/pgio" ) @@ -99,11 +101,12 @@ func (dst *RowDescription) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *RowDescription) Encode(dst []byte) []byte { - dst = append(dst, 'T') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *RowDescription) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'T') + if len(src.Fields) > math.MaxUint16 { + return nil, errors.New("too many fields") + } dst = pgio.AppendUint16(dst, uint16(len(src.Fields))) for _, fd := range src.Fields { dst = append(dst, fd.Name...) @@ -117,9 +120,7 @@ func (src *RowDescription) Encode(dst []byte) []byte { dst = pgio.AppendInt16(dst, fd.Format) } - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/sasl_initial_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/sasl_initial_response.go index eeda4691..9eb1b6a4 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/sasl_initial_response.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/sasl_initial_response.go @@ -39,10 +39,8 @@ func (dst *SASLInitialResponse) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *SASLInitialResponse) Encode(dst []byte) []byte { - dst = append(dst, 'p') - sp := len(dst) - dst = pgio.AppendInt32(dst, -1) +func (src *SASLInitialResponse) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'p') dst = append(dst, []byte(src.AuthMechanism)...) dst = append(dst, 0) @@ -50,9 +48,7 @@ func (src *SASLInitialResponse) Encode(dst []byte) []byte { dst = pgio.AppendInt32(dst, int32(len(src.Data))) dst = append(dst, src.Data...) - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/sasl_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/sasl_response.go index 54c3d96f..1b604c25 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/sasl_response.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/sasl_response.go @@ -3,8 +3,6 @@ package pgproto3 import ( "encoding/hex" "encoding/json" - - "github.com/jackc/pgx/v5/internal/pgio" ) type SASLResponse struct { @@ -22,13 +20,10 @@ func (dst *SASLResponse) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *SASLResponse) Encode(dst []byte) []byte { - dst = append(dst, 'p') - dst = pgio.AppendInt32(dst, int32(4+len(src.Data))) - +func (src *SASLResponse) Encode(dst []byte) ([]byte, error) { + dst, sp := beginMessage(dst, 'p') dst = append(dst, src.Data...) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/ssl_request.go b/vendor/github.com/jackc/pgx/v5/pgproto3/ssl_request.go index 1b00c16b..b0fc2847 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/ssl_request.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/ssl_request.go @@ -31,10 +31,10 @@ func (dst *SSLRequest) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 4 byte message length. -func (src *SSLRequest) Encode(dst []byte) []byte { +func (src *SSLRequest) Encode(dst []byte) ([]byte, error) { dst = pgio.AppendInt32(dst, 8) dst = pgio.AppendInt32(dst, sslRequestNumber) - return dst + return dst, nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/startup_message.go b/vendor/github.com/jackc/pgx/v5/pgproto3/startup_message.go index 5c974f02..3af4587d 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/startup_message.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/startup_message.go @@ -38,14 +38,14 @@ func (dst *StartupMessage) Decode(src []byte) error { for { idx := bytes.IndexByte(src[rp:], 0) if idx < 0 { - return &invalidMessageFormatErr{messageType: "StartupMesage"} + return &invalidMessageFormatErr{messageType: "StartupMessage"} } key := string(src[rp : rp+idx]) rp += idx + 1 idx = bytes.IndexByte(src[rp:], 0) if idx < 0 { - return &invalidMessageFormatErr{messageType: "StartupMesage"} + return &invalidMessageFormatErr{messageType: "StartupMessage"} } value := string(src[rp : rp+idx]) rp += idx + 1 @@ -64,7 +64,7 @@ func (dst *StartupMessage) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *StartupMessage) Encode(dst []byte) []byte { +func (src *StartupMessage) Encode(dst []byte) ([]byte, error) { sp := len(dst) dst = pgio.AppendInt32(dst, -1) @@ -77,9 +77,7 @@ func (src *StartupMessage) Encode(dst []byte) []byte { } dst = append(dst, 0) - pgio.SetInt32(dst[sp:], int32(len(dst[sp:]))) - - return dst + return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/sync.go b/vendor/github.com/jackc/pgx/v5/pgproto3/sync.go index 5db8e07a..ea4fc959 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/sync.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/sync.go @@ -20,8 +20,8 @@ func (dst *Sync) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *Sync) Encode(dst []byte) []byte { - return append(dst, 'S', 0, 0, 0, 4) +func (src *Sync) Encode(dst []byte) ([]byte, error) { + return append(dst, 'S', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/terminate.go b/vendor/github.com/jackc/pgx/v5/pgproto3/terminate.go index 135191ea..35a9dc83 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/terminate.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/terminate.go @@ -20,8 +20,8 @@ func (dst *Terminate) Decode(src []byte) error { } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. -func (src *Terminate) Encode(dst []byte) []byte { - return append(dst, 'X', 0, 0, 0, 4) +func (src *Terminate) Encode(dst []byte) ([]byte, error) { + return append(dst, 'X', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/trace.go b/vendor/github.com/jackc/pgx/v5/pgproto3/trace.go index c09f68d1..6cc7d3e3 100644 --- a/vendor/github.com/jackc/pgx/v5/pgproto3/trace.go +++ b/vendor/github.com/jackc/pgx/v5/pgproto3/trace.go @@ -6,15 +6,18 @@ import ( "io" "strconv" "strings" + "sync" "time" ) // tracer traces the messages send to and from a Backend or Frontend. The format it produces roughly mimics the // format produced by the libpq C function PQtrace. type tracer struct { + TracerOptions + + mux sync.Mutex w io.Writer buf *bytes.Buffer - TracerOptions } // TracerOptions controls tracing behavior. It is roughly equivalent to the libpq function PQsetTraceFlags. @@ -119,278 +122,255 @@ func (t *tracer) traceMessage(sender byte, encodedLen int32, msg Message) { case *Terminate: t.traceTerminate(sender, encodedLen, msg) default: - t.beginTrace(sender, encodedLen, "Unknown") - t.finishTrace() + t.writeTrace(sender, encodedLen, "Unknown", nil) } } func (t *tracer) traceAuthenticationCleartextPassword(sender byte, encodedLen int32, msg *AuthenticationCleartextPassword) { - t.beginTrace(sender, encodedLen, "AuthenticationCleartextPassword") - t.finishTrace() + t.writeTrace(sender, encodedLen, "AuthenticationCleartextPassword", nil) } func (t *tracer) traceAuthenticationGSS(sender byte, encodedLen int32, msg *AuthenticationGSS) { - t.beginTrace(sender, encodedLen, "AuthenticationGSS") - t.finishTrace() + t.writeTrace(sender, encodedLen, "AuthenticationGSS", nil) } func (t *tracer) traceAuthenticationGSSContinue(sender byte, encodedLen int32, msg *AuthenticationGSSContinue) { - t.beginTrace(sender, encodedLen, "AuthenticationGSSContinue") - t.finishTrace() + t.writeTrace(sender, encodedLen, "AuthenticationGSSContinue", nil) } func (t *tracer) traceAuthenticationMD5Password(sender byte, encodedLen int32, msg *AuthenticationMD5Password) { - t.beginTrace(sender, encodedLen, "AuthenticationMD5Password") - t.finishTrace() + t.writeTrace(sender, encodedLen, "AuthenticationMD5Password", nil) } func (t *tracer) traceAuthenticationOk(sender byte, encodedLen int32, msg *AuthenticationOk) { - t.beginTrace(sender, encodedLen, "AuthenticationOk") - t.finishTrace() + t.writeTrace(sender, encodedLen, "AuthenticationOk", nil) } func (t *tracer) traceAuthenticationSASL(sender byte, encodedLen int32, msg *AuthenticationSASL) { - t.beginTrace(sender, encodedLen, "AuthenticationSASL") - t.finishTrace() + t.writeTrace(sender, encodedLen, "AuthenticationSASL", nil) } func (t *tracer) traceAuthenticationSASLContinue(sender byte, encodedLen int32, msg *AuthenticationSASLContinue) { - t.beginTrace(sender, encodedLen, "AuthenticationSASLContinue") - t.finishTrace() + t.writeTrace(sender, encodedLen, "AuthenticationSASLContinue", nil) } func (t *tracer) traceAuthenticationSASLFinal(sender byte, encodedLen int32, msg *AuthenticationSASLFinal) { - t.beginTrace(sender, encodedLen, "AuthenticationSASLFinal") - t.finishTrace() + t.writeTrace(sender, encodedLen, "AuthenticationSASLFinal", nil) } func (t *tracer) traceBackendKeyData(sender byte, encodedLen int32, msg *BackendKeyData) { - t.beginTrace(sender, encodedLen, "BackendKeyData") - if t.RegressMode { - t.buf.WriteString("\t NNNN NNNN") - } else { - fmt.Fprintf(t.buf, "\t %d %d", msg.ProcessID, msg.SecretKey) - } - t.finishTrace() + t.writeTrace(sender, encodedLen, "BackendKeyData", func() { + if t.RegressMode { + t.buf.WriteString("\t NNNN NNNN") + } else { + fmt.Fprintf(t.buf, "\t %d %d", msg.ProcessID, msg.SecretKey) + } + }) } func (t *tracer) traceBind(sender byte, encodedLen int32, msg *Bind) { - t.beginTrace(sender, encodedLen, "Bind") - fmt.Fprintf(t.buf, "\t %s %s %d", traceDoubleQuotedString([]byte(msg.DestinationPortal)), traceDoubleQuotedString([]byte(msg.PreparedStatement)), len(msg.ParameterFormatCodes)) - for _, fc := range msg.ParameterFormatCodes { - fmt.Fprintf(t.buf, " %d", fc) - } - fmt.Fprintf(t.buf, " %d", len(msg.Parameters)) - for _, p := range msg.Parameters { - fmt.Fprintf(t.buf, " %s", traceSingleQuotedString(p)) - } - fmt.Fprintf(t.buf, " %d", len(msg.ResultFormatCodes)) - for _, fc := range msg.ResultFormatCodes { - fmt.Fprintf(t.buf, " %d", fc) - } - t.finishTrace() + t.writeTrace(sender, encodedLen, "Bind", func() { + fmt.Fprintf(t.buf, "\t %s %s %d", traceDoubleQuotedString([]byte(msg.DestinationPortal)), traceDoubleQuotedString([]byte(msg.PreparedStatement)), len(msg.ParameterFormatCodes)) + for _, fc := range msg.ParameterFormatCodes { + fmt.Fprintf(t.buf, " %d", fc) + } + fmt.Fprintf(t.buf, " %d", len(msg.Parameters)) + for _, p := range msg.Parameters { + fmt.Fprintf(t.buf, " %s", traceSingleQuotedString(p)) + } + fmt.Fprintf(t.buf, " %d", len(msg.ResultFormatCodes)) + for _, fc := range msg.ResultFormatCodes { + fmt.Fprintf(t.buf, " %d", fc) + } + }) } func (t *tracer) traceBindComplete(sender byte, encodedLen int32, msg *BindComplete) { - t.beginTrace(sender, encodedLen, "BindComplete") - t.finishTrace() + t.writeTrace(sender, encodedLen, "BindComplete", nil) } func (t *tracer) traceCancelRequest(sender byte, encodedLen int32, msg *CancelRequest) { - t.beginTrace(sender, encodedLen, "CancelRequest") - t.finishTrace() + t.writeTrace(sender, encodedLen, "CancelRequest", nil) } func (t *tracer) traceClose(sender byte, encodedLen int32, msg *Close) { - t.beginTrace(sender, encodedLen, "Close") - t.finishTrace() + t.writeTrace(sender, encodedLen, "Close", nil) } func (t *tracer) traceCloseComplete(sender byte, encodedLen int32, msg *CloseComplete) { - t.beginTrace(sender, encodedLen, "CloseComplete") - t.finishTrace() + t.writeTrace(sender, encodedLen, "CloseComplete", nil) } func (t *tracer) traceCommandComplete(sender byte, encodedLen int32, msg *CommandComplete) { - t.beginTrace(sender, encodedLen, "CommandComplete") - fmt.Fprintf(t.buf, "\t %s", traceDoubleQuotedString(msg.CommandTag)) - t.finishTrace() + t.writeTrace(sender, encodedLen, "CommandComplete", func() { + fmt.Fprintf(t.buf, "\t %s", traceDoubleQuotedString(msg.CommandTag)) + }) } func (t *tracer) traceCopyBothResponse(sender byte, encodedLen int32, msg *CopyBothResponse) { - t.beginTrace(sender, encodedLen, "CopyBothResponse") - t.finishTrace() + t.writeTrace(sender, encodedLen, "CopyBothResponse", nil) } func (t *tracer) traceCopyData(sender byte, encodedLen int32, msg *CopyData) { - t.beginTrace(sender, encodedLen, "CopyData") - t.finishTrace() + t.writeTrace(sender, encodedLen, "CopyData", nil) } func (t *tracer) traceCopyDone(sender byte, encodedLen int32, msg *CopyDone) { - t.beginTrace(sender, encodedLen, "CopyDone") - t.finishTrace() + t.writeTrace(sender, encodedLen, "CopyDone", nil) } func (t *tracer) traceCopyFail(sender byte, encodedLen int32, msg *CopyFail) { - t.beginTrace(sender, encodedLen, "CopyFail") - fmt.Fprintf(t.buf, "\t %s", traceDoubleQuotedString([]byte(msg.Message))) - t.finishTrace() + t.writeTrace(sender, encodedLen, "CopyFail", func() { + fmt.Fprintf(t.buf, "\t %s", traceDoubleQuotedString([]byte(msg.Message))) + }) } func (t *tracer) traceCopyInResponse(sender byte, encodedLen int32, msg *CopyInResponse) { - t.beginTrace(sender, encodedLen, "CopyInResponse") - t.finishTrace() + t.writeTrace(sender, encodedLen, "CopyInResponse", nil) } func (t *tracer) traceCopyOutResponse(sender byte, encodedLen int32, msg *CopyOutResponse) { - t.beginTrace(sender, encodedLen, "CopyOutResponse") - t.finishTrace() + t.writeTrace(sender, encodedLen, "CopyOutResponse", nil) } func (t *tracer) traceDataRow(sender byte, encodedLen int32, msg *DataRow) { - t.beginTrace(sender, encodedLen, "DataRow") - fmt.Fprintf(t.buf, "\t %d", len(msg.Values)) - for _, v := range msg.Values { - if v == nil { - t.buf.WriteString(" -1") - } else { - fmt.Fprintf(t.buf, " %d %s", len(v), traceSingleQuotedString(v)) + t.writeTrace(sender, encodedLen, "DataRow", func() { + fmt.Fprintf(t.buf, "\t %d", len(msg.Values)) + for _, v := range msg.Values { + if v == nil { + t.buf.WriteString(" -1") + } else { + fmt.Fprintf(t.buf, " %d %s", len(v), traceSingleQuotedString(v)) + } } - } - t.finishTrace() + }) } func (t *tracer) traceDescribe(sender byte, encodedLen int32, msg *Describe) { - t.beginTrace(sender, encodedLen, "Describe") - fmt.Fprintf(t.buf, "\t %c %s", msg.ObjectType, traceDoubleQuotedString([]byte(msg.Name))) - t.finishTrace() + t.writeTrace(sender, encodedLen, "Describe", func() { + fmt.Fprintf(t.buf, "\t %c %s", msg.ObjectType, traceDoubleQuotedString([]byte(msg.Name))) + }) } func (t *tracer) traceEmptyQueryResponse(sender byte, encodedLen int32, msg *EmptyQueryResponse) { - t.beginTrace(sender, encodedLen, "EmptyQueryResponse") - t.finishTrace() + t.writeTrace(sender, encodedLen, "EmptyQueryResponse", nil) } func (t *tracer) traceErrorResponse(sender byte, encodedLen int32, msg *ErrorResponse) { - t.beginTrace(sender, encodedLen, "ErrorResponse") - t.finishTrace() + t.writeTrace(sender, encodedLen, "ErrorResponse", nil) } func (t *tracer) TraceQueryute(sender byte, encodedLen int32, msg *Execute) { - t.beginTrace(sender, encodedLen, "Execute") - fmt.Fprintf(t.buf, "\t %s %d", traceDoubleQuotedString([]byte(msg.Portal)), msg.MaxRows) - t.finishTrace() + t.writeTrace(sender, encodedLen, "Execute", func() { + fmt.Fprintf(t.buf, "\t %s %d", traceDoubleQuotedString([]byte(msg.Portal)), msg.MaxRows) + }) } func (t *tracer) traceFlush(sender byte, encodedLen int32, msg *Flush) { - t.beginTrace(sender, encodedLen, "Flush") - t.finishTrace() + t.writeTrace(sender, encodedLen, "Flush", nil) } func (t *tracer) traceFunctionCall(sender byte, encodedLen int32, msg *FunctionCall) { - t.beginTrace(sender, encodedLen, "FunctionCall") - t.finishTrace() + t.writeTrace(sender, encodedLen, "FunctionCall", nil) } func (t *tracer) traceFunctionCallResponse(sender byte, encodedLen int32, msg *FunctionCallResponse) { - t.beginTrace(sender, encodedLen, "FunctionCallResponse") - t.finishTrace() + t.writeTrace(sender, encodedLen, "FunctionCallResponse", nil) } func (t *tracer) traceGSSEncRequest(sender byte, encodedLen int32, msg *GSSEncRequest) { - t.beginTrace(sender, encodedLen, "GSSEncRequest") - t.finishTrace() + t.writeTrace(sender, encodedLen, "GSSEncRequest", nil) } func (t *tracer) traceNoData(sender byte, encodedLen int32, msg *NoData) { - t.beginTrace(sender, encodedLen, "NoData") - t.finishTrace() + t.writeTrace(sender, encodedLen, "NoData", nil) } func (t *tracer) traceNoticeResponse(sender byte, encodedLen int32, msg *NoticeResponse) { - t.beginTrace(sender, encodedLen, "NoticeResponse") - t.finishTrace() + t.writeTrace(sender, encodedLen, "NoticeResponse", nil) } func (t *tracer) traceNotificationResponse(sender byte, encodedLen int32, msg *NotificationResponse) { - t.beginTrace(sender, encodedLen, "NotificationResponse") - fmt.Fprintf(t.buf, "\t %d %s %s", msg.PID, traceDoubleQuotedString([]byte(msg.Channel)), traceDoubleQuotedString([]byte(msg.Payload))) - t.finishTrace() + t.writeTrace(sender, encodedLen, "NotificationResponse", func() { + fmt.Fprintf(t.buf, "\t %d %s %s", msg.PID, traceDoubleQuotedString([]byte(msg.Channel)), traceDoubleQuotedString([]byte(msg.Payload))) + }) } func (t *tracer) traceParameterDescription(sender byte, encodedLen int32, msg *ParameterDescription) { - t.beginTrace(sender, encodedLen, "ParameterDescription") - t.finishTrace() + t.writeTrace(sender, encodedLen, "ParameterDescription", nil) } func (t *tracer) traceParameterStatus(sender byte, encodedLen int32, msg *ParameterStatus) { - t.beginTrace(sender, encodedLen, "ParameterStatus") - fmt.Fprintf(t.buf, "\t %s %s", traceDoubleQuotedString([]byte(msg.Name)), traceDoubleQuotedString([]byte(msg.Value))) - t.finishTrace() + t.writeTrace(sender, encodedLen, "ParameterStatus", func() { + fmt.Fprintf(t.buf, "\t %s %s", traceDoubleQuotedString([]byte(msg.Name)), traceDoubleQuotedString([]byte(msg.Value))) + }) } func (t *tracer) traceParse(sender byte, encodedLen int32, msg *Parse) { - t.beginTrace(sender, encodedLen, "Parse") - fmt.Fprintf(t.buf, "\t %s %s %d", traceDoubleQuotedString([]byte(msg.Name)), traceDoubleQuotedString([]byte(msg.Query)), len(msg.ParameterOIDs)) - for _, oid := range msg.ParameterOIDs { - fmt.Fprintf(t.buf, " %d", oid) - } - t.finishTrace() + t.writeTrace(sender, encodedLen, "Parse", func() { + fmt.Fprintf(t.buf, "\t %s %s %d", traceDoubleQuotedString([]byte(msg.Name)), traceDoubleQuotedString([]byte(msg.Query)), len(msg.ParameterOIDs)) + for _, oid := range msg.ParameterOIDs { + fmt.Fprintf(t.buf, " %d", oid) + } + }) } func (t *tracer) traceParseComplete(sender byte, encodedLen int32, msg *ParseComplete) { - t.beginTrace(sender, encodedLen, "ParseComplete") - t.finishTrace() + t.writeTrace(sender, encodedLen, "ParseComplete", nil) } func (t *tracer) tracePortalSuspended(sender byte, encodedLen int32, msg *PortalSuspended) { - t.beginTrace(sender, encodedLen, "PortalSuspended") - t.finishTrace() + t.writeTrace(sender, encodedLen, "PortalSuspended", nil) } func (t *tracer) traceQuery(sender byte, encodedLen int32, msg *Query) { - t.beginTrace(sender, encodedLen, "Query") - fmt.Fprintf(t.buf, "\t %s", traceDoubleQuotedString([]byte(msg.String))) - t.finishTrace() + t.writeTrace(sender, encodedLen, "Query", func() { + fmt.Fprintf(t.buf, "\t %s", traceDoubleQuotedString([]byte(msg.String))) + }) } func (t *tracer) traceReadyForQuery(sender byte, encodedLen int32, msg *ReadyForQuery) { - t.beginTrace(sender, encodedLen, "ReadyForQuery") - fmt.Fprintf(t.buf, "\t %c", msg.TxStatus) - t.finishTrace() + t.writeTrace(sender, encodedLen, "ReadyForQuery", func() { + fmt.Fprintf(t.buf, "\t %c", msg.TxStatus) + }) } func (t *tracer) traceRowDescription(sender byte, encodedLen int32, msg *RowDescription) { - t.beginTrace(sender, encodedLen, "RowDescription") - fmt.Fprintf(t.buf, "\t %d", len(msg.Fields)) - for _, fd := range msg.Fields { - fmt.Fprintf(t.buf, ` %s %d %d %d %d %d %d`, traceDoubleQuotedString(fd.Name), fd.TableOID, fd.TableAttributeNumber, fd.DataTypeOID, fd.DataTypeSize, fd.TypeModifier, fd.Format) - } - t.finishTrace() + t.writeTrace(sender, encodedLen, "RowDescription", func() { + fmt.Fprintf(t.buf, "\t %d", len(msg.Fields)) + for _, fd := range msg.Fields { + fmt.Fprintf(t.buf, ` %s %d %d %d %d %d %d`, traceDoubleQuotedString(fd.Name), fd.TableOID, fd.TableAttributeNumber, fd.DataTypeOID, fd.DataTypeSize, fd.TypeModifier, fd.Format) + } + }) } func (t *tracer) traceSSLRequest(sender byte, encodedLen int32, msg *SSLRequest) { - t.beginTrace(sender, encodedLen, "SSLRequest") - t.finishTrace() + t.writeTrace(sender, encodedLen, "SSLRequest", nil) } func (t *tracer) traceStartupMessage(sender byte, encodedLen int32, msg *StartupMessage) { - t.beginTrace(sender, encodedLen, "StartupMessage") - t.finishTrace() + t.writeTrace(sender, encodedLen, "StartupMessage", nil) } func (t *tracer) traceSync(sender byte, encodedLen int32, msg *Sync) { - t.beginTrace(sender, encodedLen, "Sync") - t.finishTrace() + t.writeTrace(sender, encodedLen, "Sync", nil) } func (t *tracer) traceTerminate(sender byte, encodedLen int32, msg *Terminate) { - t.beginTrace(sender, encodedLen, "Terminate") - t.finishTrace() + t.writeTrace(sender, encodedLen, "Terminate", nil) } -func (t *tracer) beginTrace(sender byte, encodedLen int32, msgType string) { +func (t *tracer) writeTrace(sender byte, encodedLen int32, msgType string, writeDetails func()) { + t.mux.Lock() + defer t.mux.Unlock() + defer func() { + if t.buf.Cap() > 1024 { + t.buf = &bytes.Buffer{} + } else { + t.buf.Reset() + } + }() + if !t.SuppressTimestamps { now := time.Now() t.buf.WriteString(now.Format("2006-01-02 15:04:05.000000")) @@ -402,17 +382,13 @@ func (t *tracer) beginTrace(sender byte, encodedLen int32, msgType string) { t.buf.WriteString(msgType) t.buf.WriteByte('\t') t.buf.WriteString(strconv.FormatInt(int64(encodedLen), 10)) -} -func (t *tracer) finishTrace() { + if writeDetails != nil { + writeDetails() + } + t.buf.WriteByte('\n') t.buf.WriteTo(t.w) - - if t.buf.Cap() > 1024 { - t.buf = &bytes.Buffer{} - } else { - t.buf.Reset() - } } // traceDoubleQuotedString returns t.buf as a double-quoted string without any escaping. It is roughly equivalent to diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/array.go b/vendor/github.com/jackc/pgx/v5/pgtype/array.go index 0fa4c129..06b824ad 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/array.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/array.go @@ -5,7 +5,6 @@ import ( "encoding/binary" "fmt" "io" - "reflect" "strconv" "strings" "unicode" @@ -111,7 +110,7 @@ func parseUntypedTextArray(src string) (*untypedTextArray, error) { r, _, err := buf.ReadRune() if err != nil { - return nil, fmt.Errorf("invalid array: %v", err) + return nil, fmt.Errorf("invalid array: %w", err) } var explicitDimensions []ArrayDimension @@ -123,7 +122,7 @@ func parseUntypedTextArray(src string) (*untypedTextArray, error) { for { r, _, err = buf.ReadRune() if err != nil { - return nil, fmt.Errorf("invalid array: %v", err) + return nil, fmt.Errorf("invalid array: %w", err) } if r == '=' { @@ -134,12 +133,12 @@ func parseUntypedTextArray(src string) (*untypedTextArray, error) { lower, err := arrayParseInteger(buf) if err != nil { - return nil, fmt.Errorf("invalid array: %v", err) + return nil, fmt.Errorf("invalid array: %w", err) } r, _, err = buf.ReadRune() if err != nil { - return nil, fmt.Errorf("invalid array: %v", err) + return nil, fmt.Errorf("invalid array: %w", err) } if r != ':' { @@ -148,12 +147,12 @@ func parseUntypedTextArray(src string) (*untypedTextArray, error) { upper, err := arrayParseInteger(buf) if err != nil { - return nil, fmt.Errorf("invalid array: %v", err) + return nil, fmt.Errorf("invalid array: %w", err) } r, _, err = buf.ReadRune() if err != nil { - return nil, fmt.Errorf("invalid array: %v", err) + return nil, fmt.Errorf("invalid array: %w", err) } if r != ']' { @@ -165,12 +164,12 @@ func parseUntypedTextArray(src string) (*untypedTextArray, error) { r, _, err = buf.ReadRune() if err != nil { - return nil, fmt.Errorf("invalid array: %v", err) + return nil, fmt.Errorf("invalid array: %w", err) } } if r != '{' { - return nil, fmt.Errorf("invalid array, expected '{': %v", err) + return nil, fmt.Errorf("invalid array, expected '{' got %v", r) } implicitDimensions := []ArrayDimension{{LowerBound: 1, Length: 0}} @@ -179,7 +178,7 @@ func parseUntypedTextArray(src string) (*untypedTextArray, error) { for { r, _, err = buf.ReadRune() if err != nil { - return nil, fmt.Errorf("invalid array: %v", err) + return nil, fmt.Errorf("invalid array: %w", err) } if r == '{' { @@ -196,7 +195,7 @@ func parseUntypedTextArray(src string) (*untypedTextArray, error) { for { r, _, err = buf.ReadRune() if err != nil { - return nil, fmt.Errorf("invalid array: %v", err) + return nil, fmt.Errorf("invalid array: %w", err) } switch r { @@ -215,7 +214,7 @@ func parseUntypedTextArray(src string) (*untypedTextArray, error) { buf.UnreadRune() value, quoted, err := arrayParseValue(buf) if err != nil { - return nil, fmt.Errorf("invalid array value: %v", err) + return nil, fmt.Errorf("invalid array value: %w", err) } if currentDim == counterDim { implicitDimensions[currentDim].Length++ @@ -363,38 +362,18 @@ func quoteArrayElement(src string) string { } func isSpace(ch byte) bool { - // see https://github.com/postgres/postgres/blob/REL_12_STABLE/src/backend/parser/scansup.c#L224 - return ch == ' ' || ch == '\t' || ch == '\n' || ch == '\r' || ch == '\f' + // see array_isspace: + // https://github.com/postgres/postgres/blob/master/src/backend/utils/adt/arrayfuncs.c + return ch == ' ' || ch == '\t' || ch == '\n' || ch == '\r' || ch == '\v' || ch == '\f' } func quoteArrayElementIfNeeded(src string) string { - if src == "" || (len(src) == 4 && strings.ToLower(src) == "null") || isSpace(src[0]) || isSpace(src[len(src)-1]) || strings.ContainsAny(src, `{},"\`) { + if src == "" || (len(src) == 4 && strings.EqualFold(src, "null")) || isSpace(src[0]) || isSpace(src[len(src)-1]) || strings.ContainsAny(src, `{},"\`) { return quoteArrayElement(src) } return src } -func findDimensionsFromValue(value reflect.Value, dimensions []ArrayDimension, elementsLength int) ([]ArrayDimension, int, bool) { - switch value.Kind() { - case reflect.Array: - fallthrough - case reflect.Slice: - length := value.Len() - if 0 == elementsLength { - elementsLength = length - } else { - elementsLength *= length - } - dimensions = append(dimensions, ArrayDimension{Length: int32(length), LowerBound: 1}) - for i := 0; i < length; i++ { - if d, l, ok := findDimensionsFromValue(value.Index(i), dimensions, elementsLength); ok { - return d, l, true - } - } - } - return dimensions, elementsLength, true -} - // Array represents a PostgreSQL array for T. It implements the ArrayGetter and ArraySetter interfaces. It preserves // PostgreSQL dimensions and custom lower bounds. Use FlatArray if these are not needed. type Array[T any] struct { diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/bits.go b/vendor/github.com/jackc/pgx/v5/pgtype/bits.go index 30558118..e7a1d016 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/bits.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/bits.go @@ -176,8 +176,10 @@ func (scanPlanBinaryBitsToBitsScanner) Scan(src []byte, dst any) error { bitLen := int32(binary.BigEndian.Uint32(src)) rp := 4 + buf := make([]byte, len(src[rp:])) + copy(buf, src[rp:]) - return scanner.ScanBits(Bits{Bytes: src[rp:], Len: bitLen, Valid: true}) + return scanner.ScanBits(Bits{Bytes: buf, Len: bitLen, Valid: true}) } type scanPlanTextAnyToBitsScanner struct{} diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/bool.go b/vendor/github.com/jackc/pgx/v5/pgtype/bool.go index e7be27e2..71caffa7 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/bool.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/bool.go @@ -1,10 +1,12 @@ package pgtype import ( + "bytes" "database/sql/driver" "encoding/json" "fmt" "strconv" + "strings" ) type BoolScanner interface { @@ -264,8 +266,8 @@ func (scanPlanTextAnyToBool) Scan(src []byte, dst any) error { return fmt.Errorf("cannot scan NULL into %T", dst) } - if len(src) != 1 { - return fmt.Errorf("invalid length for bool: %v", len(src)) + if len(src) == 0 { + return fmt.Errorf("cannot scan empty string into %T", dst) } p, ok := (dst).(*bool) @@ -273,7 +275,12 @@ func (scanPlanTextAnyToBool) Scan(src []byte, dst any) error { return ErrScanTargetTypeChanged } - *p = src[0] == 't' + v, err := planTextToBool(src) + if err != nil { + return err + } + + *p = v return nil } @@ -309,9 +316,28 @@ func (scanPlanTextAnyToBoolScanner) Scan(src []byte, dst any) error { return s.ScanBool(Bool{}) } - if len(src) != 1 { - return fmt.Errorf("invalid length for bool: %v", len(src)) + if len(src) == 0 { + return fmt.Errorf("cannot scan empty string into %T", dst) } - return s.ScanBool(Bool{Bool: src[0] == 't', Valid: true}) + v, err := planTextToBool(src) + if err != nil { + return err + } + + return s.ScanBool(Bool{Bool: v, Valid: true}) +} + +// https://www.postgresql.org/docs/11/datatype-boolean.html +func planTextToBool(src []byte) (bool, error) { + s := string(bytes.ToLower(bytes.TrimSpace(src))) + + switch { + case strings.HasPrefix("true", s), strings.HasPrefix("yes", s), s == "on", s == "1": + return true, nil + case strings.HasPrefix("false", s), strings.HasPrefix("no", s), strings.HasPrefix("off", s), s == "0": + return false, nil + default: + return false, fmt.Errorf("unknown boolean string representation %q", src) + } } diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/builtin_wrappers.go b/vendor/github.com/jackc/pgx/v5/pgtype/builtin_wrappers.go index 8bf367c1..b39d3fa1 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/builtin_wrappers.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/builtin_wrappers.go @@ -231,7 +231,7 @@ func (w *uint64Wrapper) ScanNumeric(v Numeric) error { bi, err := v.toBigInt() if err != nil { - return fmt.Errorf("cannot scan into *uint64: %v", err) + return fmt.Errorf("cannot scan into *uint64: %w", err) } if !bi.IsUint64() { @@ -284,7 +284,7 @@ func (w *uintWrapper) ScanNumeric(v Numeric) error { bi, err := v.toBigInt() if err != nil { - return fmt.Errorf("cannot scan into *uint: %v", err) + return fmt.Errorf("cannot scan into *uint: %w", err) } if !bi.IsUint64() { diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/convert.go b/vendor/github.com/jackc/pgx/v5/pgtype/convert.go index 8a2afbe1..8a9cee9c 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/convert.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/convert.go @@ -1,377 +1,9 @@ package pgtype import ( - "database/sql" - "fmt" - "math" "reflect" - "time" ) -const ( - maxUint = ^uint(0) - maxInt = int(maxUint >> 1) - minInt = -maxInt - 1 -) - -// underlyingNumberType gets the underlying type that can be converted to Int2, Int4, Int8, Float4, or Float8 -func underlyingNumberType(val any) (any, bool) { - refVal := reflect.ValueOf(val) - - switch refVal.Kind() { - case reflect.Ptr: - if refVal.IsNil() { - return nil, false - } - convVal := refVal.Elem().Interface() - return convVal, true - case reflect.Int: - convVal := int(refVal.Int()) - return convVal, reflect.TypeOf(convVal) != refVal.Type() - case reflect.Int8: - convVal := int8(refVal.Int()) - return convVal, reflect.TypeOf(convVal) != refVal.Type() - case reflect.Int16: - convVal := int16(refVal.Int()) - return convVal, reflect.TypeOf(convVal) != refVal.Type() - case reflect.Int32: - convVal := int32(refVal.Int()) - return convVal, reflect.TypeOf(convVal) != refVal.Type() - case reflect.Int64: - convVal := int64(refVal.Int()) - return convVal, reflect.TypeOf(convVal) != refVal.Type() - case reflect.Uint: - convVal := uint(refVal.Uint()) - return convVal, reflect.TypeOf(convVal) != refVal.Type() - case reflect.Uint8: - convVal := uint8(refVal.Uint()) - return convVal, reflect.TypeOf(convVal) != refVal.Type() - case reflect.Uint16: - convVal := uint16(refVal.Uint()) - return convVal, reflect.TypeOf(convVal) != refVal.Type() - case reflect.Uint32: - convVal := uint32(refVal.Uint()) - return convVal, reflect.TypeOf(convVal) != refVal.Type() - case reflect.Uint64: - convVal := uint64(refVal.Uint()) - return convVal, reflect.TypeOf(convVal) != refVal.Type() - case reflect.Float32: - convVal := float32(refVal.Float()) - return convVal, reflect.TypeOf(convVal) != refVal.Type() - case reflect.Float64: - convVal := refVal.Float() - return convVal, reflect.TypeOf(convVal) != refVal.Type() - case reflect.String: - convVal := refVal.String() - return convVal, reflect.TypeOf(convVal) != refVal.Type() - } - - return nil, false -} - -// underlyingBoolType gets the underlying type that can be converted to Bool -func underlyingBoolType(val any) (any, bool) { - refVal := reflect.ValueOf(val) - - switch refVal.Kind() { - case reflect.Ptr: - if refVal.IsNil() { - return nil, false - } - convVal := refVal.Elem().Interface() - return convVal, true - case reflect.Bool: - convVal := refVal.Bool() - return convVal, reflect.TypeOf(convVal) != refVal.Type() - } - - return nil, false -} - -// underlyingBytesType gets the underlying type that can be converted to []byte -func underlyingBytesType(val any) (any, bool) { - refVal := reflect.ValueOf(val) - - switch refVal.Kind() { - case reflect.Ptr: - if refVal.IsNil() { - return nil, false - } - convVal := refVal.Elem().Interface() - return convVal, true - case reflect.Slice: - if refVal.Type().Elem().Kind() == reflect.Uint8 { - convVal := refVal.Bytes() - return convVal, reflect.TypeOf(convVal) != refVal.Type() - } - } - - return nil, false -} - -// underlyingStringType gets the underlying type that can be converted to String -func underlyingStringType(val any) (any, bool) { - refVal := reflect.ValueOf(val) - - switch refVal.Kind() { - case reflect.Ptr: - if refVal.IsNil() { - return nil, false - } - convVal := refVal.Elem().Interface() - return convVal, true - case reflect.String: - convVal := refVal.String() - return convVal, reflect.TypeOf(convVal) != refVal.Type() - } - - return nil, false -} - -// underlyingPtrType dereferences a pointer -func underlyingPtrType(val any) (any, bool) { - refVal := reflect.ValueOf(val) - - switch refVal.Kind() { - case reflect.Ptr: - if refVal.IsNil() { - return nil, false - } - convVal := refVal.Elem().Interface() - return convVal, true - } - - return nil, false -} - -// underlyingTimeType gets the underlying type that can be converted to time.Time -func underlyingTimeType(val any) (any, bool) { - refVal := reflect.ValueOf(val) - - switch refVal.Kind() { - case reflect.Ptr: - if refVal.IsNil() { - return nil, false - } - convVal := refVal.Elem().Interface() - return convVal, true - } - - timeType := reflect.TypeOf(time.Time{}) - if refVal.Type().ConvertibleTo(timeType) { - return refVal.Convert(timeType).Interface(), true - } - - return nil, false -} - -// underlyingUUIDType gets the underlying type that can be converted to [16]byte -func underlyingUUIDType(val any) (any, bool) { - refVal := reflect.ValueOf(val) - - switch refVal.Kind() { - case reflect.Ptr: - if refVal.IsNil() { - return time.Time{}, false - } - convVal := refVal.Elem().Interface() - return convVal, true - } - - uuidType := reflect.TypeOf([16]byte{}) - if refVal.Type().ConvertibleTo(uuidType) { - return refVal.Convert(uuidType).Interface(), true - } - - return nil, false -} - -// underlyingSliceType gets the underlying slice type -func underlyingSliceType(val any) (any, bool) { - refVal := reflect.ValueOf(val) - - switch refVal.Kind() { - case reflect.Ptr: - if refVal.IsNil() { - return nil, false - } - convVal := refVal.Elem().Interface() - return convVal, true - case reflect.Slice: - baseSliceType := reflect.SliceOf(refVal.Type().Elem()) - if refVal.Type().ConvertibleTo(baseSliceType) { - convVal := refVal.Convert(baseSliceType) - return convVal.Interface(), reflect.TypeOf(convVal.Interface()) != refVal.Type() - } - } - - return nil, false -} - -func int64AssignTo(srcVal int64, srcValid bool, dst any) error { - if srcValid { - switch v := dst.(type) { - case *int: - if srcVal < int64(minInt) { - return fmt.Errorf("%d is less than minimum value for int", srcVal) - } else if srcVal > int64(maxInt) { - return fmt.Errorf("%d is greater than maximum value for int", srcVal) - } - *v = int(srcVal) - case *int8: - if srcVal < math.MinInt8 { - return fmt.Errorf("%d is less than minimum value for int8", srcVal) - } else if srcVal > math.MaxInt8 { - return fmt.Errorf("%d is greater than maximum value for int8", srcVal) - } - *v = int8(srcVal) - case *int16: - if srcVal < math.MinInt16 { - return fmt.Errorf("%d is less than minimum value for int16", srcVal) - } else if srcVal > math.MaxInt16 { - return fmt.Errorf("%d is greater than maximum value for int16", srcVal) - } - *v = int16(srcVal) - case *int32: - if srcVal < math.MinInt32 { - return fmt.Errorf("%d is less than minimum value for int32", srcVal) - } else if srcVal > math.MaxInt32 { - return fmt.Errorf("%d is greater than maximum value for int32", srcVal) - } - *v = int32(srcVal) - case *int64: - if srcVal < math.MinInt64 { - return fmt.Errorf("%d is less than minimum value for int64", srcVal) - } else if srcVal > math.MaxInt64 { - return fmt.Errorf("%d is greater than maximum value for int64", srcVal) - } - *v = int64(srcVal) - case *uint: - if srcVal < 0 { - return fmt.Errorf("%d is less than zero for uint", srcVal) - } else if uint64(srcVal) > uint64(maxUint) { - return fmt.Errorf("%d is greater than maximum value for uint", srcVal) - } - *v = uint(srcVal) - case *uint8: - if srcVal < 0 { - return fmt.Errorf("%d is less than zero for uint8", srcVal) - } else if srcVal > math.MaxUint8 { - return fmt.Errorf("%d is greater than maximum value for uint8", srcVal) - } - *v = uint8(srcVal) - case *uint16: - if srcVal < 0 { - return fmt.Errorf("%d is less than zero for uint32", srcVal) - } else if srcVal > math.MaxUint16 { - return fmt.Errorf("%d is greater than maximum value for uint16", srcVal) - } - *v = uint16(srcVal) - case *uint32: - if srcVal < 0 { - return fmt.Errorf("%d is less than zero for uint32", srcVal) - } else if srcVal > math.MaxUint32 { - return fmt.Errorf("%d is greater than maximum value for uint32", srcVal) - } - *v = uint32(srcVal) - case *uint64: - if srcVal < 0 { - return fmt.Errorf("%d is less than zero for uint64", srcVal) - } - *v = uint64(srcVal) - case sql.Scanner: - return v.Scan(srcVal) - default: - if v := reflect.ValueOf(dst); v.Kind() == reflect.Ptr { - el := v.Elem() - switch el.Kind() { - // if dst is a pointer to pointer, strip the pointer and try again - case reflect.Ptr: - if el.IsNil() { - // allocate destination - el.Set(reflect.New(el.Type().Elem())) - } - return int64AssignTo(srcVal, srcValid, el.Interface()) - case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: - if el.OverflowInt(int64(srcVal)) { - return fmt.Errorf("cannot put %d into %T", srcVal, dst) - } - el.SetInt(int64(srcVal)) - return nil - case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64: - if srcVal < 0 { - return fmt.Errorf("%d is less than zero for %T", srcVal, dst) - } - if el.OverflowUint(uint64(srcVal)) { - return fmt.Errorf("cannot put %d into %T", srcVal, dst) - } - el.SetUint(uint64(srcVal)) - return nil - } - } - return fmt.Errorf("cannot assign %v into %T", srcVal, dst) - } - return nil - } - - // if dst is a pointer to pointer and srcStatus is not Valid, nil it out - if v := reflect.ValueOf(dst); v.Kind() == reflect.Ptr { - el := v.Elem() - if el.Kind() == reflect.Ptr { - el.Set(reflect.Zero(el.Type())) - return nil - } - } - - return fmt.Errorf("cannot assign %v %v into %T", srcVal, srcValid, dst) -} - -func float64AssignTo(srcVal float64, srcValid bool, dst any) error { - if srcValid { - switch v := dst.(type) { - case *float32: - *v = float32(srcVal) - case *float64: - *v = srcVal - default: - if v := reflect.ValueOf(dst); v.Kind() == reflect.Ptr { - el := v.Elem() - switch el.Kind() { - // if dst is a type alias of a float32 or 64, set dst val - case reflect.Float32, reflect.Float64: - el.SetFloat(srcVal) - return nil - // if dst is a pointer to pointer, strip the pointer and try again - case reflect.Ptr: - if el.IsNil() { - // allocate destination - el.Set(reflect.New(el.Type().Elem())) - } - return float64AssignTo(srcVal, srcValid, el.Interface()) - case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64, reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64: - i64 := int64(srcVal) - if float64(i64) == srcVal { - return int64AssignTo(i64, srcValid, dst) - } - } - } - return fmt.Errorf("cannot assign %v into %T", srcVal, dst) - } - return nil - } - - // if dst is a pointer to pointer and srcStatus is not Valid, nil it out - if v := reflect.ValueOf(dst); v.Kind() == reflect.Ptr { - el := v.Elem() - if el.Kind() == reflect.Ptr { - el.Set(reflect.Zero(el.Type())) - return nil - } - } - - return fmt.Errorf("cannot assign %v %v into %T", srcVal, srcValid, dst) -} - func NullAssignTo(dst any) error { dstPtr := reflect.ValueOf(dst) diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/date.go b/vendor/github.com/jackc/pgx/v5/pgtype/date.go index 009fc0db..784b16de 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/date.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/date.go @@ -282,17 +282,17 @@ func (scanPlanTextAnyToDateScanner) Scan(src []byte, dst any) error { if match != nil { year, err := strconv.ParseInt(match[1], 10, 32) if err != nil { - return fmt.Errorf("BUG: cannot parse date that regexp matched (year): %v", err) + return fmt.Errorf("BUG: cannot parse date that regexp matched (year): %w", err) } month, err := strconv.ParseInt(match[2], 10, 32) if err != nil { - return fmt.Errorf("BUG: cannot parse date that regexp matched (month): %v", err) + return fmt.Errorf("BUG: cannot parse date that regexp matched (month): %w", err) } day, err := strconv.ParseInt(match[3], 10, 32) if err != nil { - return fmt.Errorf("BUG: cannot parse date that regexp matched (month): %v", err) + return fmt.Errorf("BUG: cannot parse date that regexp matched (month): %w", err) } // BC matched diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/doc.go b/vendor/github.com/jackc/pgx/v5/pgtype/doc.go index 6612c896..ec9270ac 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/doc.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/doc.go @@ -67,7 +67,7 @@ See example_custom_type_test.go for an example of a custom type for the PostgreS Sometimes pgx supports a PostgreSQL type such as numeric but the Go type is in an external package that does not have pgx support such as github.com/shopspring/decimal. These types can be registered with pgtype with custom conversion -logic. See https://github.com/jackc/pgx-shopspring-decimal and https://github.com/jackc/pgx-gofrs-uuid for a example +logic. See https://github.com/jackc/pgx-shopspring-decimal and https://github.com/jackc/pgx-gofrs-uuid for example integrations. New PostgreSQL Type Support @@ -149,7 +149,7 @@ Overview of Scanning Implementation The first step is to use the OID to lookup the correct Codec. If the OID is unavailable, Map will try to find the OID from previous calls of Map.RegisterDefaultPgType. The Map will call the Codec's PlanScan method to get a plan for scanning into the Go value. A Codec will support scanning into one or more Go types. Oftentime these Go types are -interfaces rather than explicit types. For example, PointCodec can use any Go type that implments the PointScanner and +interfaces rather than explicit types. For example, PointCodec can use any Go type that implements the PointScanner and PointValuer interfaces. If a Go value is not supported directly by a Codec then Map will try wrapping it with additional logic and try again. diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/float4.go b/vendor/github.com/jackc/pgx/v5/pgtype/float4.go index 2540f9e5..8646d9d2 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/float4.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/float4.go @@ -3,6 +3,7 @@ package pgtype import ( "database/sql/driver" "encoding/binary" + "encoding/json" "fmt" "math" "strconv" @@ -65,6 +66,29 @@ func (f Float4) Value() (driver.Value, error) { return float64(f.Float32), nil } +func (f Float4) MarshalJSON() ([]byte, error) { + if !f.Valid { + return []byte("null"), nil + } + return json.Marshal(f.Float32) +} + +func (f *Float4) UnmarshalJSON(b []byte) error { + var n *float32 + err := json.Unmarshal(b, &n) + if err != nil { + return err + } + + if n == nil { + *f = Float4{} + } else { + *f = Float4{Float32: *n, Valid: true} + } + + return nil +} + type Float4Codec struct{} func (Float4Codec) FormatSupported(format int16) bool { @@ -273,12 +297,12 @@ func (c Float4Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, sr return nil, nil } - var n float64 + var n float32 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } - return n, nil + return float64(n), nil } func (c Float4Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/float8.go b/vendor/github.com/jackc/pgx/v5/pgtype/float8.go index 65e5d8b3..9c923c9a 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/float8.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/float8.go @@ -74,6 +74,29 @@ func (f Float8) Value() (driver.Value, error) { return f.Float64, nil } +func (f Float8) MarshalJSON() ([]byte, error) { + if !f.Valid { + return []byte("null"), nil + } + return json.Marshal(f.Float64) +} + +func (f *Float8) UnmarshalJSON(b []byte) error { + var n *float64 + err := json.Unmarshal(b, &n) + if err != nil { + return err + } + + if n == nil { + *f = Float8{} + } else { + *f = Float8{Float64: *n, Valid: true} + } + + return nil +} + type Float8Codec struct{} func (Float8Codec) FormatSupported(format int16) bool { @@ -109,13 +132,6 @@ func (Float8Codec) PlanEncode(m *Map, oid uint32, format int16, value any) Encod return nil } -func (f *Float8) MarshalJSON() ([]byte, error) { - if !f.Valid { - return []byte("null"), nil - } - return json.Marshal(f.Float64) -} - type encodePlanFloat8CodecBinaryFloat64 struct{} func (encodePlanFloat8CodecBinaryFloat64) Encode(value any, buf []byte) (newBuf []byte, err error) { diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/hstore.go b/vendor/github.com/jackc/pgx/v5/pgtype/hstore.go index 4743643e..2f34f4c9 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/hstore.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/hstore.go @@ -1,14 +1,11 @@ package pgtype import ( - "bytes" "database/sql/driver" "encoding/binary" "errors" "fmt" "strings" - "unicode" - "unicode/utf8" "github.com/jackc/pgx/v5/internal/pgio" ) @@ -43,7 +40,7 @@ func (h *Hstore) Scan(src any) error { switch src := src.(type) { case string: - return scanPlanTextAnyToHstoreScanner{}.Scan([]byte(src), h) + return scanPlanTextAnyToHstoreScanner{}.scanString(src, h) } return fmt.Errorf("cannot scan %T", src) @@ -124,8 +121,15 @@ func (encodePlanHstoreCodecText) Encode(value any, buf []byte) (newBuf []byte, e return nil, err } - if hstore == nil { - return nil, nil + if len(hstore) == 0 { + // distinguish between empty and nil: Not strictly required by Postgres, since its protocol + // explicitly marks NULL column values separately. However, the Binary codec does this, and + // this means we can "round trip" Encode and Scan without data loss. + // nil: []byte(nil); empty: []byte{} + if hstore == nil { + return nil, nil + } + return []byte{}, nil } firstPair := true @@ -134,16 +138,23 @@ func (encodePlanHstoreCodecText) Encode(value any, buf []byte) (newBuf []byte, e if firstPair { firstPair = false } else { - buf = append(buf, ',') + buf = append(buf, ',', ' ') } - buf = append(buf, quoteHstoreElementIfNeeded(k)...) + // unconditionally quote hstore keys/values like Postgres does + // this avoids a Mac OS X Postgres hstore parsing bug: + // https://www.postgresql.org/message-id/CA%2BHWA9awUW0%2BRV_gO9r1ABZwGoZxPztcJxPy8vMFSTbTfi4jig%40mail.gmail.com + buf = append(buf, '"') + buf = append(buf, quoteArrayReplacer.Replace(k)...) + buf = append(buf, '"') buf = append(buf, "=>"...) if v == nil { buf = append(buf, "NULL"...) } else { - buf = append(buf, quoteHstoreElementIfNeeded(*v)...) + buf = append(buf, '"') + buf = append(buf, quoteArrayReplacer.Replace(*v)...) + buf = append(buf, '"') } } @@ -174,25 +185,28 @@ func (scanPlanBinaryHstoreToHstoreScanner) Scan(src []byte, dst any) error { scanner := (dst).(HstoreScanner) if src == nil { - return scanner.ScanHstore(Hstore{}) + return scanner.ScanHstore(Hstore(nil)) } rp := 0 - if len(src[rp:]) < 4 { + const uint32Len = 4 + if len(src[rp:]) < uint32Len { return fmt.Errorf("hstore incomplete %v", src) } pairCount := int(int32(binary.BigEndian.Uint32(src[rp:]))) - rp += 4 + rp += uint32Len hstore := make(Hstore, pairCount) + // one allocation for all *string, rather than one per string, just like text parsing + valueStrings := make([]string, pairCount) for i := 0; i < pairCount; i++ { - if len(src[rp:]) < 4 { + if len(src[rp:]) < uint32Len { return fmt.Errorf("hstore incomplete %v", src) } keyLen := int(int32(binary.BigEndian.Uint32(src[rp:]))) - rp += 4 + rp += uint32Len if len(src[rp:]) < keyLen { return fmt.Errorf("hstore incomplete %v", src) @@ -200,26 +214,17 @@ func (scanPlanBinaryHstoreToHstoreScanner) Scan(src []byte, dst any) error { key := string(src[rp : rp+keyLen]) rp += keyLen - if len(src[rp:]) < 4 { + if len(src[rp:]) < uint32Len { return fmt.Errorf("hstore incomplete %v", src) } valueLen := int(int32(binary.BigEndian.Uint32(src[rp:]))) rp += 4 - var valueBuf []byte if valueLen >= 0 { - valueBuf = src[rp : rp+valueLen] + valueStrings[i] = string(src[rp : rp+valueLen]) rp += valueLen - } - var value Text - err := scanPlanTextAnyToTextScanner{}.Scan(valueBuf, &value) - if err != nil { - return err - } - - if value.Valid { - hstore[key] = &value.String + hstore[key] = &valueStrings[i] } else { hstore[key] = nil } @@ -230,28 +235,22 @@ func (scanPlanBinaryHstoreToHstoreScanner) Scan(src []byte, dst any) error { type scanPlanTextAnyToHstoreScanner struct{} -func (scanPlanTextAnyToHstoreScanner) Scan(src []byte, dst any) error { +func (s scanPlanTextAnyToHstoreScanner) Scan(src []byte, dst any) error { scanner := (dst).(HstoreScanner) if src == nil { - return scanner.ScanHstore(Hstore{}) + return scanner.ScanHstore(Hstore(nil)) } + return s.scanString(string(src), scanner) +} - keys, values, err := parseHstore(string(src)) +// scanString does not return nil hstore values because string cannot be nil. +func (scanPlanTextAnyToHstoreScanner) scanString(src string, scanner HstoreScanner) error { + hstore, err := parseHstore(src) if err != nil { return err } - - m := make(Hstore, len(keys)) - for i := range keys { - if values[i].Valid { - m[keys[i]] = &values[i].String - } else { - m[keys[i]] = nil - } - } - - return scanner.ScanHstore(m) + return scanner.ScanHstore(hstore) } func (c HstoreCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { @@ -271,191 +270,217 @@ func (c HstoreCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) ( return hstore, nil } -var quoteHstoreReplacer = strings.NewReplacer(`\`, `\\`, `"`, `\"`) +type hstoreParser struct { + str string + pos int + nextBackslash int +} + +func newHSP(in string) *hstoreParser { + return &hstoreParser{ + pos: 0, + str: in, + nextBackslash: strings.IndexByte(in, '\\'), + } +} -func quoteHstoreElement(src string) string { - return `"` + quoteArrayReplacer.Replace(src) + `"` +func (p *hstoreParser) atEnd() bool { + return p.pos >= len(p.str) } -func quoteHstoreElementIfNeeded(src string) string { - if src == "" || (len(src) == 4 && strings.ToLower(src) == "null") || strings.ContainsAny(src, ` {},"\=>`) { - return quoteArrayElement(src) +// consume returns the next byte of the string, or end if the string is done. +func (p *hstoreParser) consume() (b byte, end bool) { + if p.pos >= len(p.str) { + return 0, true } - return src + b = p.str[p.pos] + p.pos++ + return b, false } -const ( - hsPre = iota - hsKey - hsSep - hsVal - hsNul - hsNext -) +func unexpectedByteErr(actualB byte, expectedB byte) error { + return fmt.Errorf("expected '%c' ('%#v'); found '%c' ('%#v')", expectedB, expectedB, actualB, actualB) +} -type hstoreParser struct { - str string - pos int +// consumeExpectedByte consumes expectedB from the string, or returns an error. +func (p *hstoreParser) consumeExpectedByte(expectedB byte) error { + nextB, end := p.consume() + if end { + return fmt.Errorf("expected '%c' ('%#v'); found end", expectedB, expectedB) + } + if nextB != expectedB { + return unexpectedByteErr(nextB, expectedB) + } + return nil } -func newHSP(in string) *hstoreParser { - return &hstoreParser{ - pos: 0, - str: in, +// consumeExpected2 consumes two expected bytes or returns an error. +// This was a bit faster than using a string argument (better inlining? Not sure). +func (p *hstoreParser) consumeExpected2(one byte, two byte) error { + if p.pos+2 > len(p.str) { + return errors.New("unexpected end of string") + } + if p.str[p.pos] != one { + return unexpectedByteErr(p.str[p.pos], one) } + if p.str[p.pos+1] != two { + return unexpectedByteErr(p.str[p.pos+1], two) + } + p.pos += 2 + return nil } -func (p *hstoreParser) Consume() (r rune, end bool) { - if p.pos >= len(p.str) { - end = true - return +var errEOSInQuoted = errors.New(`found end before closing double-quote ('"')`) + +// consumeDoubleQuoted consumes a double-quoted string from p. The double quote must have been +// parsed already. This copies the string from the backing string so it can be garbage collected. +func (p *hstoreParser) consumeDoubleQuoted() (string, error) { + // fast path: assume most keys/values do not contain escapes + nextDoubleQuote := strings.IndexByte(p.str[p.pos:], '"') + if nextDoubleQuote == -1 { + return "", errEOSInQuoted + } + nextDoubleQuote += p.pos + if p.nextBackslash == -1 || p.nextBackslash > nextDoubleQuote { + // clone the string from the source string to ensure it can be garbage collected separately + // TODO: use strings.Clone on Go 1.20; this could get optimized away + s := strings.Clone(p.str[p.pos:nextDoubleQuote]) + p.pos = nextDoubleQuote + 1 + return s, nil + } + + // slow path: string contains escapes + s, err := p.consumeDoubleQuotedWithEscapes(p.nextBackslash) + p.nextBackslash = strings.IndexByte(p.str[p.pos:], '\\') + if p.nextBackslash != -1 { + p.nextBackslash += p.pos } - r, w := utf8.DecodeRuneInString(p.str[p.pos:]) - p.pos += w - return + return s, err } -func (p *hstoreParser) Peek() (r rune, end bool) { - if p.pos >= len(p.str) { - end = true - return +// consumeDoubleQuotedWithEscapes consumes a double-quoted string containing escapes, starting +// at p.pos, and with the first backslash at firstBackslash. This copies the string so it can be +// garbage collected separately. +func (p *hstoreParser) consumeDoubleQuotedWithEscapes(firstBackslash int) (string, error) { + // copy the prefix that does not contain backslashes + var builder strings.Builder + builder.WriteString(p.str[p.pos:firstBackslash]) + + // skip to the backslash + p.pos = firstBackslash + + // copy bytes until the end, unescaping backslashes + for { + nextB, end := p.consume() + if end { + return "", errEOSInQuoted + } else if nextB == '"' { + break + } else if nextB == '\\' { + // escape: skip the backslash and copy the char + nextB, end = p.consume() + if end { + return "", errEOSInQuoted + } + if !(nextB == '\\' || nextB == '"') { + return "", fmt.Errorf("unexpected escape in quoted string: found '%#v'", nextB) + } + builder.WriteByte(nextB) + } else { + // normal byte: copy it + builder.WriteByte(nextB) + } } - r, _ = utf8.DecodeRuneInString(p.str[p.pos:]) - return + return builder.String(), nil } -// parseHstore parses the string representation of an hstore column (the same -// you would get from an ordinary SELECT) into two slices of keys and values. it -// is used internally in the default parsing of hstores. -func parseHstore(s string) (k []string, v []Text, err error) { - if s == "" { - return +// consumePairSeparator consumes the Hstore pair separator ", " or returns an error. +func (p *hstoreParser) consumePairSeparator() error { + return p.consumeExpected2(',', ' ') +} + +// consumeKVSeparator consumes the Hstore key/value separator "=>" or returns an error. +func (p *hstoreParser) consumeKVSeparator() error { + return p.consumeExpected2('=', '>') +} + +// consumeDoubleQuotedOrNull consumes the Hstore key/value separator "=>" or returns an error. +func (p *hstoreParser) consumeDoubleQuotedOrNull() (Text, error) { + // peek at the next byte + if p.atEnd() { + return Text{}, errors.New("found end instead of value") + } + next := p.str[p.pos] + if next == 'N' { + // must be the exact string NULL: use consumeExpected2 twice + err := p.consumeExpected2('N', 'U') + if err != nil { + return Text{}, err + } + err = p.consumeExpected2('L', 'L') + if err != nil { + return Text{}, err + } + return Text{String: "", Valid: false}, nil + } else if next != '"' { + return Text{}, unexpectedByteErr(next, '"') + } + + // skip the double quote + p.pos += 1 + s, err := p.consumeDoubleQuoted() + if err != nil { + return Text{}, err } + return Text{String: s, Valid: true}, nil +} - buf := bytes.Buffer{} - keys := []string{} - values := []Text{} +func parseHstore(s string) (Hstore, error) { p := newHSP(s) - r, end := p.Consume() - state := hsPre - - for !end { - switch state { - case hsPre: - if r == '"' { - state = hsKey - } else { - err = errors.New("String does not begin with \"") - } - case hsKey: - switch r { - case '"': //End of the key - keys = append(keys, buf.String()) - buf = bytes.Buffer{} - state = hsSep - case '\\': //Potential escaped character - n, end := p.Consume() - switch { - case end: - err = errors.New("Found EOS in key, expecting character or \"") - case n == '"', n == '\\': - buf.WriteRune(n) - default: - buf.WriteRune(r) - buf.WriteRune(n) - } - default: //Any other character - buf.WriteRune(r) - } - case hsSep: - if r == '=' { - r, end = p.Consume() - switch { - case end: - err = errors.New("Found EOS after '=', expecting '>'") - case r == '>': - r, end = p.Consume() - switch { - case end: - err = errors.New("Found EOS after '=>', expecting '\"' or 'NULL'") - case r == '"': - state = hsVal - case r == 'N': - state = hsNul - default: - err = fmt.Errorf("Invalid character '%c' after '=>', expecting '\"' or 'NULL'", r) - } - default: - err = fmt.Errorf("Invalid character after '=', expecting '>'") - } - } else { - err = fmt.Errorf("Invalid character '%c' after value, expecting '='", r) - } - case hsVal: - switch r { - case '"': //End of the value - values = append(values, Text{String: buf.String(), Valid: true}) - buf = bytes.Buffer{} - state = hsNext - case '\\': //Potential escaped character - n, end := p.Consume() - switch { - case end: - err = errors.New("Found EOS in key, expecting character or \"") - case n == '"', n == '\\': - buf.WriteRune(n) - default: - buf.WriteRune(r) - buf.WriteRune(n) - } - default: //Any other character - buf.WriteRune(r) - } - case hsNul: - nulBuf := make([]rune, 3) - nulBuf[0] = r - for i := 1; i < 3; i++ { - r, end = p.Consume() - if end { - err = errors.New("Found EOS in NULL value") - return - } - nulBuf[i] = r - } - if nulBuf[0] == 'U' && nulBuf[1] == 'L' && nulBuf[2] == 'L' { - values = append(values, Text{}) - state = hsNext - } else { - err = fmt.Errorf("Invalid NULL value: 'N%s'", string(nulBuf)) - } - case hsNext: - if r == ',' { - r, end = p.Consume() - switch { - case end: - err = errors.New("Found EOS after ',', expcting space") - case (unicode.IsSpace(r)): - r, end = p.Consume() - state = hsKey - default: - err = fmt.Errorf("Invalid character '%c' after ', ', expecting \"", r) - } - } else { - err = fmt.Errorf("Invalid character '%c' after value, expecting ','", r) + // This is an over-estimate of the number of key/value pairs. Use '>' because I am guessing it + // is less likely to occur in keys/values than '=' or ','. + numPairsEstimate := strings.Count(s, ">") + // makes one allocation of strings for the entire Hstore, rather than one allocation per value. + valueStrings := make([]string, 0, numPairsEstimate) + result := make(Hstore, numPairsEstimate) + first := true + for !p.atEnd() { + if !first { + err := p.consumePairSeparator() + if err != nil { + return nil, err } + } else { + first = false } + err := p.consumeExpectedByte('"') if err != nil { - return + return nil, err + } + + key, err := p.consumeDoubleQuoted() + if err != nil { + return nil, err + } + + err = p.consumeKVSeparator() + if err != nil { + return nil, err + } + + value, err := p.consumeDoubleQuotedOrNull() + if err != nil { + return nil, err + } + if value.Valid { + valueStrings = append(valueStrings, value.String) + result[key] = &valueStrings[len(valueStrings)-1] + } else { + result[key] = nil } - r, end = p.Consume() - } - if state != hsNext { - err = errors.New("Improperly formatted hstore") - return } - k = keys - v = values - return + + return result, nil } diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/inet.go b/vendor/github.com/jackc/pgx/v5/pgtype/inet.go index a85646d7..6ca10ea0 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/inet.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/inet.go @@ -156,7 +156,7 @@ func (scanPlanBinaryInetToNetipPrefixScanner) Scan(src []byte, dst any) error { } if len(src) != 8 && len(src) != 20 { - return fmt.Errorf("Received an invalid size for a inet: %d", len(src)) + return fmt.Errorf("Received an invalid size for an inet: %d", len(src)) } // ignore family diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/interval.go b/vendor/github.com/jackc/pgx/v5/pgtype/interval.go index a172ecdb..21820938 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/interval.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/interval.go @@ -179,7 +179,7 @@ func (scanPlanBinaryIntervalToIntervalScanner) Scan(src []byte, dst any) error { } if len(src) != 16 { - return fmt.Errorf("Received an invalid size for a interval: %d", len(src)) + return fmt.Errorf("Received an invalid size for an interval: %d", len(src)) } microseconds := int64(binary.BigEndian.Uint64(src)) @@ -242,21 +242,21 @@ func (scanPlanTextAnyToIntervalScanner) Scan(src []byte, dst any) error { return fmt.Errorf("bad interval minute format: %s", timeParts[1]) } - secondParts := strings.SplitN(timeParts[2], ".", 2) + sec, secFrac, secFracFound := strings.Cut(timeParts[2], ".") - seconds, err := strconv.ParseInt(secondParts[0], 10, 64) + seconds, err := strconv.ParseInt(sec, 10, 64) if err != nil { - return fmt.Errorf("bad interval second format: %s", secondParts[0]) + return fmt.Errorf("bad interval second format: %s", sec) } var uSeconds int64 - if len(secondParts) == 2 { - uSeconds, err = strconv.ParseInt(secondParts[1], 10, 64) + if secFracFound { + uSeconds, err = strconv.ParseInt(secFrac, 10, 64) if err != nil { - return fmt.Errorf("bad interval decimal format: %s", secondParts[1]) + return fmt.Errorf("bad interval decimal format: %s", secFrac) } - for i := 0; i < 6-len(secondParts[1]); i++ { + for i := 0; i < 6-len(secFrac); i++ { uSeconds *= 10 } } diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/json.go b/vendor/github.com/jackc/pgx/v5/pgtype/json.go index 69861bf8..99628092 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/json.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/json.go @@ -25,11 +25,26 @@ func (c JSONCodec) PlanEncode(m *Map, oid uint32, format int16, value any) Encod case []byte: return encodePlanJSONCodecEitherFormatByteSlice{} + // Handle json.RawMessage specifically because if it is run through json.Marshal it may be mutated. + // e.g. `{"foo": "bar"}` -> `{"foo":"bar"}`. + case json.RawMessage: + return encodePlanJSONCodecEitherFormatJSONRawMessage{} + // Cannot rely on driver.Valuer being handled later because anything can be marshalled. // // https://github.com/jackc/pgx/issues/1430 + // + // Check for driver.Valuer must come before json.Marshaler so that it is guaranteed to beused + // when both are implemented https://github.com/jackc/pgx/issues/1805 case driver.Valuer: return &encodePlanDriverValuer{m: m, oid: oid, formatCode: format} + + // Must come before trying wrap encode plans because a pointer to a struct may be unwrapped to a struct that can be + // marshalled. + // + // https://github.com/jackc/pgx/issues/1681 + case json.Marshaler: + return encodePlanJSONCodecEitherFormatMarshal{} } // Because anything can be marshalled the normal wrapping in Map.PlanScan doesn't get a chance to run. So try the @@ -69,6 +84,18 @@ func (encodePlanJSONCodecEitherFormatByteSlice) Encode(value any, buf []byte) (n return buf, nil } +type encodePlanJSONCodecEitherFormatJSONRawMessage struct{} + +func (encodePlanJSONCodecEitherFormatJSONRawMessage) Encode(value any, buf []byte) (newBuf []byte, err error) { + jsonBytes := value.(json.RawMessage) + if jsonBytes == nil { + return nil, nil + } + + buf = append(buf, jsonBytes...) + return buf, nil +} + type encodePlanJSONCodecEitherFormatMarshal struct{} func (encodePlanJSONCodecEitherFormatMarshal) Encode(value any, buf []byte) (newBuf []byte, err error) { @@ -85,6 +112,23 @@ func (JSONCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan switch target.(type) { case *string: return scanPlanAnyToString{} + + case **string: + // This is to fix **string scanning. It seems wrong to special case **string, but it's not clear what a better + // solution would be. + // + // https://github.com/jackc/pgx/issues/1470 -- **string + // https://github.com/jackc/pgx/issues/1691 -- ** anything else + + if wrapperPlan, nextDst, ok := TryPointerPointerScanPlan(target); ok { + if nextPlan := m.planScan(oid, format, nextDst); nextPlan != nil { + if _, failed := nextPlan.(*scanPlanFail); !failed { + wrapperPlan.SetNext(nextPlan) + return wrapperPlan + } + } + } + case *[]byte: return scanPlanJSONToByteSlice{} case BytesScanner: @@ -97,19 +141,6 @@ func (JSONCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan return &scanPlanSQLScanner{formatCode: format} } - // This is to fix **string scanning. It seems wrong to special case sql.Scanner and pointer to pointer, but it's not - // clear what a better solution would be. - // - // https://github.com/jackc/pgx/issues/1470 - if wrapperPlan, nextDst, ok := TryPointerPointerScanPlan(target); ok { - if nextPlan := m.planScan(oid, format, nextDst); nextPlan != nil { - if _, failed := nextPlan.(*scanPlanFail); !failed { - wrapperPlan.SetNext(nextPlan) - return wrapperPlan - } - } - } - return scanPlanJSONToJSONUnmarshal{} } @@ -150,7 +181,7 @@ func (scanPlanJSONToJSONUnmarshal) Scan(src []byte, dst any) error { if dstValue.Kind() == reflect.Ptr { el := dstValue.Elem() switch el.Kind() { - case reflect.Ptr, reflect.Slice, reflect.Map: + case reflect.Ptr, reflect.Slice, reflect.Map, reflect.Interface: el.Set(reflect.Zero(el.Type())) return nil } diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/ltree.go b/vendor/github.com/jackc/pgx/v5/pgtype/ltree.go new file mode 100644 index 00000000..6af31779 --- /dev/null +++ b/vendor/github.com/jackc/pgx/v5/pgtype/ltree.go @@ -0,0 +1,122 @@ +package pgtype + +import ( + "database/sql/driver" + "fmt" +) + +type LtreeCodec struct{} + +func (l LtreeCodec) FormatSupported(format int16) bool { + return format == TextFormatCode || format == BinaryFormatCode +} + +// PreferredFormat returns the preferred format. +func (l LtreeCodec) PreferredFormat() int16 { + return TextFormatCode +} + +// PlanEncode returns an EncodePlan for encoding value into PostgreSQL format for oid and format. If no plan can be +// found then nil is returned. +func (l LtreeCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { + switch format { + case TextFormatCode: + return (TextCodec)(l).PlanEncode(m, oid, format, value) + case BinaryFormatCode: + switch value.(type) { + case string: + return encodeLtreeCodecBinaryString{} + case []byte: + return encodeLtreeCodecBinaryByteSlice{} + case TextValuer: + return encodeLtreeCodecBinaryTextValuer{} + } + } + + return nil +} + +type encodeLtreeCodecBinaryString struct{} + +func (encodeLtreeCodecBinaryString) Encode(value any, buf []byte) (newBuf []byte, err error) { + ltree := value.(string) + buf = append(buf, 1) + return append(buf, ltree...), nil +} + +type encodeLtreeCodecBinaryByteSlice struct{} + +func (encodeLtreeCodecBinaryByteSlice) Encode(value any, buf []byte) (newBuf []byte, err error) { + ltree := value.([]byte) + buf = append(buf, 1) + return append(buf, ltree...), nil +} + +type encodeLtreeCodecBinaryTextValuer struct{} + +func (encodeLtreeCodecBinaryTextValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { + t, err := value.(TextValuer).TextValue() + if err != nil { + return nil, err + } + if !t.Valid { + return nil, nil + } + + buf = append(buf, 1) + return append(buf, t.String...), nil +} + +// PlanScan returns a ScanPlan for scanning a PostgreSQL value into a destination with the same type as target. If +// no plan can be found then nil is returned. +func (l LtreeCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { + switch format { + case TextFormatCode: + return (TextCodec)(l).PlanScan(m, oid, format, target) + case BinaryFormatCode: + switch target.(type) { + case *string: + return scanPlanBinaryLtreeToString{} + case TextScanner: + return scanPlanBinaryLtreeToTextScanner{} + } + } + + return nil +} + +type scanPlanBinaryLtreeToString struct{} + +func (scanPlanBinaryLtreeToString) Scan(src []byte, target any) error { + version := src[0] + if version != 1 { + return fmt.Errorf("unsupported ltree version %d", version) + } + + p := (target).(*string) + *p = string(src[1:]) + + return nil +} + +type scanPlanBinaryLtreeToTextScanner struct{} + +func (scanPlanBinaryLtreeToTextScanner) Scan(src []byte, target any) error { + version := src[0] + if version != 1 { + return fmt.Errorf("unsupported ltree version %d", version) + } + + scanner := (target).(TextScanner) + return scanner.ScanText(Text{String: string(src[1:]), Valid: true}) +} + +// DecodeDatabaseSQLValue returns src decoded into a value compatible with the sql.Scanner interface. +func (l LtreeCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { + return (TextCodec)(l).DecodeDatabaseSQLValue(m, oid, format, src) +} + +// DecodeValue returns src decoded into its default format. +func (l LtreeCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { + return (TextCodec)(l).DecodeValue(m, oid, format, src) +} diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/multirange.go b/vendor/github.com/jackc/pgx/v5/pgtype/multirange.go index 34950b34..e5763788 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/multirange.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/multirange.go @@ -339,18 +339,18 @@ func parseUntypedTextMultirange(src []byte) ([]string, error) { r, _, err := buf.ReadRune() if err != nil { - return nil, fmt.Errorf("invalid array: %v", err) + return nil, fmt.Errorf("invalid array: %w", err) } if r != '{' { - return nil, fmt.Errorf("invalid multirange, expected '{': %v", err) + return nil, fmt.Errorf("invalid multirange, expected '{' got %v", r) } parseValueLoop: for { r, _, err = buf.ReadRune() if err != nil { - return nil, fmt.Errorf("invalid multirange: %v", err) + return nil, fmt.Errorf("invalid multirange: %w", err) } switch r { @@ -361,7 +361,7 @@ parseValueLoop: buf.UnreadRune() value, err := parseRange(buf) if err != nil { - return nil, fmt.Errorf("invalid multirange value: %v", err) + return nil, fmt.Errorf("invalid multirange value: %w", err) } elements = append(elements, value) } diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/numeric.go b/vendor/github.com/jackc/pgx/v5/pgtype/numeric.go index 376c03fe..4dbec786 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/numeric.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/numeric.go @@ -33,23 +33,6 @@ var big10 *big.Int = big.NewInt(10) var big100 *big.Int = big.NewInt(100) var big1000 *big.Int = big.NewInt(1000) -var bigMaxInt8 *big.Int = big.NewInt(math.MaxInt8) -var bigMinInt8 *big.Int = big.NewInt(math.MinInt8) -var bigMaxInt16 *big.Int = big.NewInt(math.MaxInt16) -var bigMinInt16 *big.Int = big.NewInt(math.MinInt16) -var bigMaxInt32 *big.Int = big.NewInt(math.MaxInt32) -var bigMinInt32 *big.Int = big.NewInt(math.MinInt32) -var bigMaxInt64 *big.Int = big.NewInt(math.MaxInt64) -var bigMinInt64 *big.Int = big.NewInt(math.MinInt64) -var bigMaxInt *big.Int = big.NewInt(int64(maxInt)) -var bigMinInt *big.Int = big.NewInt(int64(minInt)) - -var bigMaxUint8 *big.Int = big.NewInt(math.MaxUint8) -var bigMaxUint16 *big.Int = big.NewInt(math.MaxUint16) -var bigMaxUint32 *big.Int = big.NewInt(math.MaxUint32) -var bigMaxUint64 *big.Int = (&big.Int{}).SetUint64(uint64(math.MaxUint64)) -var bigMaxUint *big.Int = (&big.Int{}).SetUint64(uint64(maxUint)) - var bigNBase *big.Int = big.NewInt(nbase) var bigNBaseX2 *big.Int = big.NewInt(nbase * nbase) var bigNBaseX3 *big.Int = big.NewInt(nbase * nbase * nbase) @@ -136,6 +119,26 @@ func (n Numeric) Int64Value() (Int8, error) { return Int8{Int64: bi.Int64(), Valid: true}, nil } +func (n *Numeric) ScanScientific(src string) error { + if !strings.ContainsAny("eE", src) { + return scanPlanTextAnyToNumericScanner{}.Scan([]byte(src), n) + } + + if bigF, ok := new(big.Float).SetString(string(src)); ok { + smallF, _ := bigF.Float64() + src = strconv.FormatFloat(smallF, 'f', -1, 64) + } + + num, exp, err := parseNumericString(src) + if err != nil { + return err + } + + *n = Numeric{Int: num, Exp: exp, Valid: true} + + return nil +} + func (n *Numeric) toBigInt() (*big.Int, error) { if n.Exp == 0 { return n.Int, nil @@ -161,20 +164,20 @@ func (n *Numeric) toBigInt() (*big.Int, error) { } func parseNumericString(str string) (n *big.Int, exp int32, err error) { - parts := strings.SplitN(str, ".", 2) - digits := strings.Join(parts, "") + idx := strings.IndexByte(str, '.') - if len(parts) > 1 { - exp = int32(-len(parts[1])) - } else { - for len(digits) > 1 && digits[len(digits)-1] == '0' && digits[len(digits)-2] != '-' { - digits = digits[:len(digits)-1] + if idx == -1 { + for len(str) > 1 && str[len(str)-1] == '0' && str[len(str)-2] != '-' { + str = str[:len(str)-1] exp++ } + } else { + exp = int32(-(len(str) - idx - 1)) + str = str[:idx] + str[idx+1:] } accum := &big.Int{} - if _, ok := accum.SetString(digits, 10); !ok { + if _, ok := accum.SetString(str, 10); !ok { return nil, 0, fmt.Errorf("%s is not a number", str) } @@ -241,11 +244,11 @@ func (n Numeric) MarshalJSON() ([]byte, error) { } func (n *Numeric) UnmarshalJSON(src []byte) error { - if bytes.Compare(src, []byte(`null`)) == 0 { + if bytes.Equal(src, []byte(`null`)) { *n = Numeric{} return nil } - if bytes.Compare(src, []byte(`"NaN"`)) == 0 { + if bytes.Equal(src, []byte(`"NaN"`)) { *n = Numeric{NaN: true, Valid: true} return nil } diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/pgtype.go b/vendor/github.com/jackc/pgx/v5/pgtype/pgtype.go index 83b349ce..534ef6d1 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/pgtype.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/pgtype.go @@ -44,7 +44,7 @@ const ( MacaddrOID = 829 InetOID = 869 BoolArrayOID = 1000 - QCharArrayOID = 1003 + QCharArrayOID = 1002 NameArrayOID = 1003 Int2ArrayOID = 1005 Int4ArrayOID = 1007 @@ -81,6 +81,8 @@ const ( IntervalOID = 1186 IntervalArrayOID = 1187 NumericArrayOID = 1231 + TimetzOID = 1266 + TimetzArrayOID = 1270 BitOID = 1560 BitArrayOID = 1561 VarbitOID = 1562 @@ -147,7 +149,7 @@ const ( BinaryFormatCode = 1 ) -// A Codec converts between Go and PostgreSQL values. +// A Codec converts between Go and PostgreSQL values. A Codec must not be mutated after it is registered with a Map. type Codec interface { // FormatSupported returns true if the format is supported. FormatSupported(int16) bool @@ -178,6 +180,7 @@ func (e *nullAssignmentError) Error() string { return fmt.Sprintf("cannot assign NULL to %T", e.dst) } +// Type represents a PostgreSQL data type. It must not be mutated after it is registered with a Map. type Type struct { Codec Codec Name string @@ -211,7 +214,9 @@ type Map struct { } func NewMap() *Map { - m := &Map{ + defaultMapInitOnce.Do(initDefaultMap) + + return &Map{ oidToType: make(map[uint32]*Type), nameToType: make(map[string]*Type), reflectTypeToName: make(map[reflect.Type]string), @@ -240,184 +245,9 @@ func NewMap() *Map { TryWrapPtrArrayScanPlan, }, } - - // Base types - m.RegisterType(&Type{Name: "aclitem", OID: ACLItemOID, Codec: &TextFormatOnlyCodec{TextCodec{}}}) - m.RegisterType(&Type{Name: "bit", OID: BitOID, Codec: BitsCodec{}}) - m.RegisterType(&Type{Name: "bool", OID: BoolOID, Codec: BoolCodec{}}) - m.RegisterType(&Type{Name: "box", OID: BoxOID, Codec: BoxCodec{}}) - m.RegisterType(&Type{Name: "bpchar", OID: BPCharOID, Codec: TextCodec{}}) - m.RegisterType(&Type{Name: "bytea", OID: ByteaOID, Codec: ByteaCodec{}}) - m.RegisterType(&Type{Name: "char", OID: QCharOID, Codec: QCharCodec{}}) - m.RegisterType(&Type{Name: "cid", OID: CIDOID, Codec: Uint32Codec{}}) - m.RegisterType(&Type{Name: "cidr", OID: CIDROID, Codec: InetCodec{}}) - m.RegisterType(&Type{Name: "circle", OID: CircleOID, Codec: CircleCodec{}}) - m.RegisterType(&Type{Name: "date", OID: DateOID, Codec: DateCodec{}}) - m.RegisterType(&Type{Name: "float4", OID: Float4OID, Codec: Float4Codec{}}) - m.RegisterType(&Type{Name: "float8", OID: Float8OID, Codec: Float8Codec{}}) - m.RegisterType(&Type{Name: "inet", OID: InetOID, Codec: InetCodec{}}) - m.RegisterType(&Type{Name: "int2", OID: Int2OID, Codec: Int2Codec{}}) - m.RegisterType(&Type{Name: "int4", OID: Int4OID, Codec: Int4Codec{}}) - m.RegisterType(&Type{Name: "int8", OID: Int8OID, Codec: Int8Codec{}}) - m.RegisterType(&Type{Name: "interval", OID: IntervalOID, Codec: IntervalCodec{}}) - m.RegisterType(&Type{Name: "json", OID: JSONOID, Codec: JSONCodec{}}) - m.RegisterType(&Type{Name: "jsonb", OID: JSONBOID, Codec: JSONBCodec{}}) - m.RegisterType(&Type{Name: "jsonpath", OID: JSONPathOID, Codec: &TextFormatOnlyCodec{TextCodec{}}}) - m.RegisterType(&Type{Name: "line", OID: LineOID, Codec: LineCodec{}}) - m.RegisterType(&Type{Name: "lseg", OID: LsegOID, Codec: LsegCodec{}}) - m.RegisterType(&Type{Name: "macaddr", OID: MacaddrOID, Codec: MacaddrCodec{}}) - m.RegisterType(&Type{Name: "name", OID: NameOID, Codec: TextCodec{}}) - m.RegisterType(&Type{Name: "numeric", OID: NumericOID, Codec: NumericCodec{}}) - m.RegisterType(&Type{Name: "oid", OID: OIDOID, Codec: Uint32Codec{}}) - m.RegisterType(&Type{Name: "path", OID: PathOID, Codec: PathCodec{}}) - m.RegisterType(&Type{Name: "point", OID: PointOID, Codec: PointCodec{}}) - m.RegisterType(&Type{Name: "polygon", OID: PolygonOID, Codec: PolygonCodec{}}) - m.RegisterType(&Type{Name: "record", OID: RecordOID, Codec: RecordCodec{}}) - m.RegisterType(&Type{Name: "text", OID: TextOID, Codec: TextCodec{}}) - m.RegisterType(&Type{Name: "tid", OID: TIDOID, Codec: TIDCodec{}}) - m.RegisterType(&Type{Name: "time", OID: TimeOID, Codec: TimeCodec{}}) - m.RegisterType(&Type{Name: "timestamp", OID: TimestampOID, Codec: TimestampCodec{}}) - m.RegisterType(&Type{Name: "timestamptz", OID: TimestamptzOID, Codec: TimestamptzCodec{}}) - m.RegisterType(&Type{Name: "unknown", OID: UnknownOID, Codec: TextCodec{}}) - m.RegisterType(&Type{Name: "uuid", OID: UUIDOID, Codec: UUIDCodec{}}) - m.RegisterType(&Type{Name: "varbit", OID: VarbitOID, Codec: BitsCodec{}}) - m.RegisterType(&Type{Name: "varchar", OID: VarcharOID, Codec: TextCodec{}}) - m.RegisterType(&Type{Name: "xid", OID: XIDOID, Codec: Uint32Codec{}}) - - // Range types - m.RegisterType(&Type{Name: "daterange", OID: DaterangeOID, Codec: &RangeCodec{ElementType: m.oidToType[DateOID]}}) - m.RegisterType(&Type{Name: "int4range", OID: Int4rangeOID, Codec: &RangeCodec{ElementType: m.oidToType[Int4OID]}}) - m.RegisterType(&Type{Name: "int8range", OID: Int8rangeOID, Codec: &RangeCodec{ElementType: m.oidToType[Int8OID]}}) - m.RegisterType(&Type{Name: "numrange", OID: NumrangeOID, Codec: &RangeCodec{ElementType: m.oidToType[NumericOID]}}) - m.RegisterType(&Type{Name: "tsrange", OID: TsrangeOID, Codec: &RangeCodec{ElementType: m.oidToType[TimestampOID]}}) - m.RegisterType(&Type{Name: "tstzrange", OID: TstzrangeOID, Codec: &RangeCodec{ElementType: m.oidToType[TimestamptzOID]}}) - - // Multirange types - m.RegisterType(&Type{Name: "datemultirange", OID: DatemultirangeOID, Codec: &MultirangeCodec{ElementType: m.oidToType[DaterangeOID]}}) - m.RegisterType(&Type{Name: "int4multirange", OID: Int4multirangeOID, Codec: &MultirangeCodec{ElementType: m.oidToType[Int4rangeOID]}}) - m.RegisterType(&Type{Name: "int8multirange", OID: Int8multirangeOID, Codec: &MultirangeCodec{ElementType: m.oidToType[Int8rangeOID]}}) - m.RegisterType(&Type{Name: "nummultirange", OID: NummultirangeOID, Codec: &MultirangeCodec{ElementType: m.oidToType[NumrangeOID]}}) - m.RegisterType(&Type{Name: "tsmultirange", OID: TsmultirangeOID, Codec: &MultirangeCodec{ElementType: m.oidToType[TsrangeOID]}}) - m.RegisterType(&Type{Name: "tstzmultirange", OID: TstzmultirangeOID, Codec: &MultirangeCodec{ElementType: m.oidToType[TstzrangeOID]}}) - - // Array types - m.RegisterType(&Type{Name: "_aclitem", OID: ACLItemArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[ACLItemOID]}}) - m.RegisterType(&Type{Name: "_bit", OID: BitArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[BitOID]}}) - m.RegisterType(&Type{Name: "_bool", OID: BoolArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[BoolOID]}}) - m.RegisterType(&Type{Name: "_box", OID: BoxArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[BoxOID]}}) - m.RegisterType(&Type{Name: "_bpchar", OID: BPCharArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[BPCharOID]}}) - m.RegisterType(&Type{Name: "_bytea", OID: ByteaArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[ByteaOID]}}) - m.RegisterType(&Type{Name: "_char", OID: QCharArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[QCharOID]}}) - m.RegisterType(&Type{Name: "_cid", OID: CIDArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[CIDOID]}}) - m.RegisterType(&Type{Name: "_cidr", OID: CIDRArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[CIDROID]}}) - m.RegisterType(&Type{Name: "_circle", OID: CircleArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[CircleOID]}}) - m.RegisterType(&Type{Name: "_date", OID: DateArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[DateOID]}}) - m.RegisterType(&Type{Name: "_daterange", OID: DaterangeArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[DaterangeOID]}}) - m.RegisterType(&Type{Name: "_float4", OID: Float4ArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[Float4OID]}}) - m.RegisterType(&Type{Name: "_float8", OID: Float8ArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[Float8OID]}}) - m.RegisterType(&Type{Name: "_inet", OID: InetArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[InetOID]}}) - m.RegisterType(&Type{Name: "_int2", OID: Int2ArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[Int2OID]}}) - m.RegisterType(&Type{Name: "_int4", OID: Int4ArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[Int4OID]}}) - m.RegisterType(&Type{Name: "_int4range", OID: Int4rangeArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[Int4rangeOID]}}) - m.RegisterType(&Type{Name: "_int8", OID: Int8ArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[Int8OID]}}) - m.RegisterType(&Type{Name: "_int8range", OID: Int8rangeArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[Int8rangeOID]}}) - m.RegisterType(&Type{Name: "_interval", OID: IntervalArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[IntervalOID]}}) - m.RegisterType(&Type{Name: "_json", OID: JSONArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[JSONOID]}}) - m.RegisterType(&Type{Name: "_jsonb", OID: JSONBArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[JSONBOID]}}) - m.RegisterType(&Type{Name: "_jsonpath", OID: JSONPathArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[JSONPathOID]}}) - m.RegisterType(&Type{Name: "_line", OID: LineArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[LineOID]}}) - m.RegisterType(&Type{Name: "_lseg", OID: LsegArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[LsegOID]}}) - m.RegisterType(&Type{Name: "_macaddr", OID: MacaddrArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[MacaddrOID]}}) - m.RegisterType(&Type{Name: "_name", OID: NameArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[NameOID]}}) - m.RegisterType(&Type{Name: "_numeric", OID: NumericArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[NumericOID]}}) - m.RegisterType(&Type{Name: "_numrange", OID: NumrangeArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[NumrangeOID]}}) - m.RegisterType(&Type{Name: "_oid", OID: OIDArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[OIDOID]}}) - m.RegisterType(&Type{Name: "_path", OID: PathArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[PathOID]}}) - m.RegisterType(&Type{Name: "_point", OID: PointArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[PointOID]}}) - m.RegisterType(&Type{Name: "_polygon", OID: PolygonArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[PolygonOID]}}) - m.RegisterType(&Type{Name: "_record", OID: RecordArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[RecordOID]}}) - m.RegisterType(&Type{Name: "_text", OID: TextArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[TextOID]}}) - m.RegisterType(&Type{Name: "_tid", OID: TIDArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[TIDOID]}}) - m.RegisterType(&Type{Name: "_time", OID: TimeArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[TimeOID]}}) - m.RegisterType(&Type{Name: "_timestamp", OID: TimestampArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[TimestampOID]}}) - m.RegisterType(&Type{Name: "_timestamptz", OID: TimestamptzArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[TimestamptzOID]}}) - m.RegisterType(&Type{Name: "_tsrange", OID: TsrangeArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[TsrangeOID]}}) - m.RegisterType(&Type{Name: "_tstzrange", OID: TstzrangeArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[TstzrangeOID]}}) - m.RegisterType(&Type{Name: "_uuid", OID: UUIDArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[UUIDOID]}}) - m.RegisterType(&Type{Name: "_varbit", OID: VarbitArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[VarbitOID]}}) - m.RegisterType(&Type{Name: "_varchar", OID: VarcharArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[VarcharOID]}}) - m.RegisterType(&Type{Name: "_xid", OID: XIDArrayOID, Codec: &ArrayCodec{ElementType: m.oidToType[XIDOID]}}) - - // Integer types that directly map to a PostgreSQL type - registerDefaultPgTypeVariants[int16](m, "int2") - registerDefaultPgTypeVariants[int32](m, "int4") - registerDefaultPgTypeVariants[int64](m, "int8") - - // Integer types that do not have a direct match to a PostgreSQL type - registerDefaultPgTypeVariants[int8](m, "int8") - registerDefaultPgTypeVariants[int](m, "int8") - registerDefaultPgTypeVariants[uint8](m, "int8") - registerDefaultPgTypeVariants[uint16](m, "int8") - registerDefaultPgTypeVariants[uint32](m, "int8") - registerDefaultPgTypeVariants[uint64](m, "numeric") - registerDefaultPgTypeVariants[uint](m, "numeric") - - registerDefaultPgTypeVariants[float32](m, "float4") - registerDefaultPgTypeVariants[float64](m, "float8") - - registerDefaultPgTypeVariants[bool](m, "bool") - registerDefaultPgTypeVariants[time.Time](m, "timestamptz") - registerDefaultPgTypeVariants[time.Duration](m, "interval") - registerDefaultPgTypeVariants[string](m, "text") - registerDefaultPgTypeVariants[[]byte](m, "bytea") - - registerDefaultPgTypeVariants[net.IP](m, "inet") - registerDefaultPgTypeVariants[net.IPNet](m, "cidr") - registerDefaultPgTypeVariants[netip.Addr](m, "inet") - registerDefaultPgTypeVariants[netip.Prefix](m, "cidr") - - // pgtype provided structs - registerDefaultPgTypeVariants[Bits](m, "varbit") - registerDefaultPgTypeVariants[Bool](m, "bool") - registerDefaultPgTypeVariants[Box](m, "box") - registerDefaultPgTypeVariants[Circle](m, "circle") - registerDefaultPgTypeVariants[Date](m, "date") - registerDefaultPgTypeVariants[Range[Date]](m, "daterange") - registerDefaultPgTypeVariants[Multirange[Range[Date]]](m, "datemultirange") - registerDefaultPgTypeVariants[Float4](m, "float4") - registerDefaultPgTypeVariants[Float8](m, "float8") - registerDefaultPgTypeVariants[Range[Float8]](m, "numrange") // There is no PostgreSQL builtin float8range so map it to numrange. - registerDefaultPgTypeVariants[Multirange[Range[Float8]]](m, "nummultirange") // There is no PostgreSQL builtin float8multirange so map it to nummultirange. - registerDefaultPgTypeVariants[Int2](m, "int2") - registerDefaultPgTypeVariants[Int4](m, "int4") - registerDefaultPgTypeVariants[Range[Int4]](m, "int4range") - registerDefaultPgTypeVariants[Multirange[Range[Int4]]](m, "int4multirange") - registerDefaultPgTypeVariants[Int8](m, "int8") - registerDefaultPgTypeVariants[Range[Int8]](m, "int8range") - registerDefaultPgTypeVariants[Multirange[Range[Int8]]](m, "int8multirange") - registerDefaultPgTypeVariants[Interval](m, "interval") - registerDefaultPgTypeVariants[Line](m, "line") - registerDefaultPgTypeVariants[Lseg](m, "lseg") - registerDefaultPgTypeVariants[Numeric](m, "numeric") - registerDefaultPgTypeVariants[Range[Numeric]](m, "numrange") - registerDefaultPgTypeVariants[Multirange[Range[Numeric]]](m, "nummultirange") - registerDefaultPgTypeVariants[Path](m, "path") - registerDefaultPgTypeVariants[Point](m, "point") - registerDefaultPgTypeVariants[Polygon](m, "polygon") - registerDefaultPgTypeVariants[TID](m, "tid") - registerDefaultPgTypeVariants[Text](m, "text") - registerDefaultPgTypeVariants[Time](m, "time") - registerDefaultPgTypeVariants[Timestamp](m, "timestamp") - registerDefaultPgTypeVariants[Timestamptz](m, "timestamptz") - registerDefaultPgTypeVariants[Range[Timestamp]](m, "tsrange") - registerDefaultPgTypeVariants[Multirange[Range[Timestamp]]](m, "tsmultirange") - registerDefaultPgTypeVariants[Range[Timestamptz]](m, "tstzrange") - registerDefaultPgTypeVariants[Multirange[Range[Timestamptz]]](m, "tstzmultirange") - registerDefaultPgTypeVariants[UUID](m, "uuid") - - return m } +// RegisterType registers a data type with the Map. t must not be mutated after it is registered. func (m *Map) RegisterType(t *Type) { m.oidToType[t.OID] = t m.nameToType[t.Name] = t @@ -449,13 +279,22 @@ func (m *Map) RegisterDefaultPgType(value any, name string) { } } +// TypeForOID returns the Type registered for the given OID. The returned Type must not be mutated. func (m *Map) TypeForOID(oid uint32) (*Type, bool) { - dt, ok := m.oidToType[oid] + if dt, ok := m.oidToType[oid]; ok { + return dt, true + } + + dt, ok := defaultMap.oidToType[oid] return dt, ok } +// TypeForName returns the Type registered for the given name. The returned Type must not be mutated. func (m *Map) TypeForName(name string) (*Type, bool) { - dt, ok := m.nameToType[name] + if dt, ok := m.nameToType[name]; ok { + return dt, true + } + dt, ok := defaultMap.nameToType[name] return dt, ok } @@ -463,30 +302,39 @@ func (m *Map) buildReflectTypeToType() { m.reflectTypeToType = make(map[reflect.Type]*Type) for reflectType, name := range m.reflectTypeToName { - if dt, ok := m.nameToType[name]; ok { + if dt, ok := m.TypeForName(name); ok { m.reflectTypeToType[reflectType] = dt } } } // TypeForValue finds a data type suitable for v. Use RegisterType to register types that can encode and decode -// themselves. Use RegisterDefaultPgType to register that can be handled by a registered data type. +// themselves. Use RegisterDefaultPgType to register that can be handled by a registered data type. The returned Type +// must not be mutated. func (m *Map) TypeForValue(v any) (*Type, bool) { if m.reflectTypeToType == nil { m.buildReflectTypeToType() } - dt, ok := m.reflectTypeToType[reflect.TypeOf(v)] + if dt, ok := m.reflectTypeToType[reflect.TypeOf(v)]; ok { + return dt, true + } + + dt, ok := defaultMap.reflectTypeToType[reflect.TypeOf(v)] return dt, ok } // FormatCodeForOID returns the preferred format code for type oid. If the type is not registered it returns the text // format code. func (m *Map) FormatCodeForOID(oid uint32) int16 { - fc, ok := m.oidToFormatCode[oid] - if ok { + if fc, ok := m.oidToFormatCode[oid]; ok { + return fc + } + + if fc, ok := defaultMap.oidToFormatCode[oid]; ok { return fc } + return TextFormatCode } @@ -587,6 +435,14 @@ func (plan *scanPlanFail) Scan(src []byte, dst any) error { return plan.Scan(src, dst) } } + for oid := range defaultMap.oidToType { + if _, ok := plan.m.oidToType[oid]; !ok { + plan := plan.m.planScan(oid, plan.formatCode, dst) + if _, ok := plan.(*scanPlanFail); !ok { + return plan.Scan(src, dst) + } + } + } } var format string @@ -600,7 +456,7 @@ func (plan *scanPlanFail) Scan(src []byte, dst any) error { } var dataTypeName string - if t, ok := plan.m.oidToType[plan.oid]; ok { + if t, ok := plan.m.TypeForOID(plan.oid); ok { dataTypeName = t.Name } else { dataTypeName = "unknown type" @@ -666,6 +522,7 @@ var elemKindToPointerTypes map[reflect.Kind]reflect.Type = map[reflect.Kind]refl reflect.Float32: reflect.TypeOf(new(float32)), reflect.Float64: reflect.TypeOf(new(float64)), reflect.String: reflect.TypeOf(new(string)), + reflect.Bool: reflect.TypeOf(new(bool)), } type underlyingTypeScanPlan struct { @@ -704,7 +561,7 @@ func TryFindUnderlyingTypeScanPlan(dst any) (plan WrappedScanPlanNextSetter, nex } } - if nextDstType != nil && dstValue.Type() != nextDstType { + if nextDstType != nil && dstValue.Type() != nextDstType && dstValue.CanConvert(nextDstType) { return &underlyingTypeScanPlan{dstType: dstValue.Type(), nextDstType: nextDstType}, dstValue.Convert(nextDstType).Interface(), true } @@ -1089,15 +946,16 @@ func TryWrapPtrSliceScanPlan(target any) (plan WrappedScanPlanNextSetter, nextVa return &wrapPtrSliceScanPlan[time.Time]{}, (*FlatArray[time.Time])(target), true } - targetValue := reflect.ValueOf(target) - if targetValue.Kind() != reflect.Ptr { + targetType := reflect.TypeOf(target) + if targetType.Kind() != reflect.Ptr { return nil, nil, false } - targetElemValue := targetValue.Elem() + targetElemType := targetType.Elem() - if targetElemValue.Kind() == reflect.Slice { - return &wrapPtrSliceReflectScanPlan{}, &anySliceArrayReflect{slice: targetElemValue}, true + if targetElemType.Kind() == reflect.Slice { + slice := reflect.New(targetElemType).Elem() + return &wrapPtrSliceReflectScanPlan{}, &anySliceArrayReflect{slice: slice}, true } return nil, nil, false } @@ -1198,6 +1056,10 @@ func (m *Map) PlanScan(oid uint32, formatCode int16, target any) ScanPlan { } func (m *Map) planScan(oid uint32, formatCode int16, target any) ScanPlan { + if target == nil { + return &scanPlanFail{m: m, oid: oid, formatCode: formatCode} + } + if _, ok := target.(*UndecodedBytes); ok { return scanPlanAnyToUndecodedBytes{} } @@ -1280,25 +1142,6 @@ func (m *Map) Scan(oid uint32, formatCode int16, src []byte, dst any) error { return plan.Scan(src, dst) } -func scanUnknownType(oid uint32, formatCode int16, buf []byte, dest any) error { - switch dest := dest.(type) { - case *string: - if formatCode == BinaryFormatCode { - return fmt.Errorf("unknown oid %d in binary format cannot be scanned into %T", oid, dest) - } - *dest = string(buf) - return nil - case *[]byte: - *dest = buf - return nil - default: - if nextDst, retry := GetAssignToDstType(dest); retry { - return scanUnknownType(oid, formatCode, buf, nextDst) - } - return fmt.Errorf("unknown oid %d cannot be scanned into %T", oid, dest) - } -} - var ErrScanTargetTypeChanged = errors.New("scan target type changed") func codecScan(codec Codec, m *Map, oid uint32, format int16, src []byte, dst any) error { @@ -1514,8 +1357,11 @@ var kindToTypes map[reflect.Kind]reflect.Type = map[reflect.Kind]reflect.Type{ reflect.Float32: reflect.TypeOf(float32(0)), reflect.Float64: reflect.TypeOf(float64(0)), reflect.String: reflect.TypeOf(""), + reflect.Bool: reflect.TypeOf(false), } +var byteSliceType = reflect.TypeOf([]byte{}) + type underlyingTypeEncodePlan struct { nextValueType reflect.Type next EncodePlan @@ -1530,6 +1376,10 @@ func (plan *underlyingTypeEncodePlan) Encode(value any, buf []byte) (newBuf []by // TryWrapFindUnderlyingTypeEncodePlan tries to convert to a Go builtin type. e.g. If value was of type MyString and // MyString was defined as a string then a wrapper plan would be returned that converts MyString to string. func TryWrapFindUnderlyingTypeEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) { + if value == nil { + return nil, nil, false + } + if _, ok := value.(driver.Valuer); ok { return nil, nil, false } @@ -1545,6 +1395,15 @@ func TryWrapFindUnderlyingTypeEncodePlan(value any) (plan WrappedEncodePlanNextS return &underlyingTypeEncodePlan{nextValueType: nextValueType}, refValue.Convert(nextValueType).Interface(), true } + // []byte is a special case. It is a slice but we treat it as a scalar type. In the case of a named type like + // json.RawMessage which is defined as []byte the underlying type should be considered as []byte. But any other slice + // does not have a special underlying type. + // + // https://github.com/jackc/pgx/issues/1763 + if refValue.Type() != byteSliceType && refValue.Type().AssignableTo(byteSliceType) { + return &underlyingTypeEncodePlan{nextValueType: byteSliceType}, refValue.Convert(byteSliceType).Interface(), true + } + return nil, nil, false } @@ -2039,13 +1898,13 @@ func newEncodeError(value any, m *Map, oid uint32, formatCode int16, err error) } var dataTypeName string - if t, ok := m.oidToType[oid]; ok { + if t, ok := m.TypeForOID(oid); ok { dataTypeName = t.Name } else { dataTypeName = "unknown type" } - return fmt.Errorf("unable to encode %#v into %s format for %s (OID %d): %s", value, format, dataTypeName, oid, err) + return fmt.Errorf("unable to encode %#v into %s format for %s (OID %d): %w", value, format, dataTypeName, oid, err) } // Encode appends the encoded bytes of value to buf. If value is the SQL value NULL then append nothing and return diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/pgtype_default.go b/vendor/github.com/jackc/pgx/v5/pgtype/pgtype_default.go new file mode 100644 index 00000000..c21ac081 --- /dev/null +++ b/vendor/github.com/jackc/pgx/v5/pgtype/pgtype_default.go @@ -0,0 +1,225 @@ +package pgtype + +import ( + "encoding/json" + "net" + "net/netip" + "reflect" + "sync" + "time" +) + +var ( + // defaultMap contains default mappings between PostgreSQL server types and Go type handling logic. + defaultMap *Map + defaultMapInitOnce = sync.Once{} +) + +func initDefaultMap() { + defaultMap = &Map{ + oidToType: make(map[uint32]*Type), + nameToType: make(map[string]*Type), + reflectTypeToName: make(map[reflect.Type]string), + oidToFormatCode: make(map[uint32]int16), + + memoizedScanPlans: make(map[uint32]map[reflect.Type][2]ScanPlan), + memoizedEncodePlans: make(map[uint32]map[reflect.Type][2]EncodePlan), + + TryWrapEncodePlanFuncs: []TryWrapEncodePlanFunc{ + TryWrapDerefPointerEncodePlan, + TryWrapBuiltinTypeEncodePlan, + TryWrapFindUnderlyingTypeEncodePlan, + TryWrapStructEncodePlan, + TryWrapSliceEncodePlan, + TryWrapMultiDimSliceEncodePlan, + TryWrapArrayEncodePlan, + }, + + TryWrapScanPlanFuncs: []TryWrapScanPlanFunc{ + TryPointerPointerScanPlan, + TryWrapBuiltinTypeScanPlan, + TryFindUnderlyingTypeScanPlan, + TryWrapStructScanPlan, + TryWrapPtrSliceScanPlan, + TryWrapPtrMultiDimSliceScanPlan, + TryWrapPtrArrayScanPlan, + }, + } + + // Base types + defaultMap.RegisterType(&Type{Name: "aclitem", OID: ACLItemOID, Codec: &TextFormatOnlyCodec{TextCodec{}}}) + defaultMap.RegisterType(&Type{Name: "bit", OID: BitOID, Codec: BitsCodec{}}) + defaultMap.RegisterType(&Type{Name: "bool", OID: BoolOID, Codec: BoolCodec{}}) + defaultMap.RegisterType(&Type{Name: "box", OID: BoxOID, Codec: BoxCodec{}}) + defaultMap.RegisterType(&Type{Name: "bpchar", OID: BPCharOID, Codec: TextCodec{}}) + defaultMap.RegisterType(&Type{Name: "bytea", OID: ByteaOID, Codec: ByteaCodec{}}) + defaultMap.RegisterType(&Type{Name: "char", OID: QCharOID, Codec: QCharCodec{}}) + defaultMap.RegisterType(&Type{Name: "cid", OID: CIDOID, Codec: Uint32Codec{}}) + defaultMap.RegisterType(&Type{Name: "cidr", OID: CIDROID, Codec: InetCodec{}}) + defaultMap.RegisterType(&Type{Name: "circle", OID: CircleOID, Codec: CircleCodec{}}) + defaultMap.RegisterType(&Type{Name: "date", OID: DateOID, Codec: DateCodec{}}) + defaultMap.RegisterType(&Type{Name: "float4", OID: Float4OID, Codec: Float4Codec{}}) + defaultMap.RegisterType(&Type{Name: "float8", OID: Float8OID, Codec: Float8Codec{}}) + defaultMap.RegisterType(&Type{Name: "inet", OID: InetOID, Codec: InetCodec{}}) + defaultMap.RegisterType(&Type{Name: "int2", OID: Int2OID, Codec: Int2Codec{}}) + defaultMap.RegisterType(&Type{Name: "int4", OID: Int4OID, Codec: Int4Codec{}}) + defaultMap.RegisterType(&Type{Name: "int8", OID: Int8OID, Codec: Int8Codec{}}) + defaultMap.RegisterType(&Type{Name: "interval", OID: IntervalOID, Codec: IntervalCodec{}}) + defaultMap.RegisterType(&Type{Name: "json", OID: JSONOID, Codec: JSONCodec{}}) + defaultMap.RegisterType(&Type{Name: "jsonb", OID: JSONBOID, Codec: JSONBCodec{}}) + defaultMap.RegisterType(&Type{Name: "jsonpath", OID: JSONPathOID, Codec: &TextFormatOnlyCodec{TextCodec{}}}) + defaultMap.RegisterType(&Type{Name: "line", OID: LineOID, Codec: LineCodec{}}) + defaultMap.RegisterType(&Type{Name: "lseg", OID: LsegOID, Codec: LsegCodec{}}) + defaultMap.RegisterType(&Type{Name: "macaddr", OID: MacaddrOID, Codec: MacaddrCodec{}}) + defaultMap.RegisterType(&Type{Name: "name", OID: NameOID, Codec: TextCodec{}}) + defaultMap.RegisterType(&Type{Name: "numeric", OID: NumericOID, Codec: NumericCodec{}}) + defaultMap.RegisterType(&Type{Name: "oid", OID: OIDOID, Codec: Uint32Codec{}}) + defaultMap.RegisterType(&Type{Name: "path", OID: PathOID, Codec: PathCodec{}}) + defaultMap.RegisterType(&Type{Name: "point", OID: PointOID, Codec: PointCodec{}}) + defaultMap.RegisterType(&Type{Name: "polygon", OID: PolygonOID, Codec: PolygonCodec{}}) + defaultMap.RegisterType(&Type{Name: "record", OID: RecordOID, Codec: RecordCodec{}}) + defaultMap.RegisterType(&Type{Name: "text", OID: TextOID, Codec: TextCodec{}}) + defaultMap.RegisterType(&Type{Name: "tid", OID: TIDOID, Codec: TIDCodec{}}) + defaultMap.RegisterType(&Type{Name: "time", OID: TimeOID, Codec: TimeCodec{}}) + defaultMap.RegisterType(&Type{Name: "timestamp", OID: TimestampOID, Codec: TimestampCodec{}}) + defaultMap.RegisterType(&Type{Name: "timestamptz", OID: TimestamptzOID, Codec: TimestamptzCodec{}}) + defaultMap.RegisterType(&Type{Name: "unknown", OID: UnknownOID, Codec: TextCodec{}}) + defaultMap.RegisterType(&Type{Name: "uuid", OID: UUIDOID, Codec: UUIDCodec{}}) + defaultMap.RegisterType(&Type{Name: "varbit", OID: VarbitOID, Codec: BitsCodec{}}) + defaultMap.RegisterType(&Type{Name: "varchar", OID: VarcharOID, Codec: TextCodec{}}) + defaultMap.RegisterType(&Type{Name: "xid", OID: XIDOID, Codec: Uint32Codec{}}) + + // Range types + defaultMap.RegisterType(&Type{Name: "daterange", OID: DaterangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[DateOID]}}) + defaultMap.RegisterType(&Type{Name: "int4range", OID: Int4rangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[Int4OID]}}) + defaultMap.RegisterType(&Type{Name: "int8range", OID: Int8rangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[Int8OID]}}) + defaultMap.RegisterType(&Type{Name: "numrange", OID: NumrangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[NumericOID]}}) + defaultMap.RegisterType(&Type{Name: "tsrange", OID: TsrangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[TimestampOID]}}) + defaultMap.RegisterType(&Type{Name: "tstzrange", OID: TstzrangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[TimestamptzOID]}}) + + // Multirange types + defaultMap.RegisterType(&Type{Name: "datemultirange", OID: DatemultirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[DaterangeOID]}}) + defaultMap.RegisterType(&Type{Name: "int4multirange", OID: Int4multirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[Int4rangeOID]}}) + defaultMap.RegisterType(&Type{Name: "int8multirange", OID: Int8multirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[Int8rangeOID]}}) + defaultMap.RegisterType(&Type{Name: "nummultirange", OID: NummultirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[NumrangeOID]}}) + defaultMap.RegisterType(&Type{Name: "tsmultirange", OID: TsmultirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[TsrangeOID]}}) + defaultMap.RegisterType(&Type{Name: "tstzmultirange", OID: TstzmultirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[TstzrangeOID]}}) + + // Array types + defaultMap.RegisterType(&Type{Name: "_aclitem", OID: ACLItemArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[ACLItemOID]}}) + defaultMap.RegisterType(&Type{Name: "_bit", OID: BitArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[BitOID]}}) + defaultMap.RegisterType(&Type{Name: "_bool", OID: BoolArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[BoolOID]}}) + defaultMap.RegisterType(&Type{Name: "_box", OID: BoxArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[BoxOID]}}) + defaultMap.RegisterType(&Type{Name: "_bpchar", OID: BPCharArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[BPCharOID]}}) + defaultMap.RegisterType(&Type{Name: "_bytea", OID: ByteaArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[ByteaOID]}}) + defaultMap.RegisterType(&Type{Name: "_char", OID: QCharArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[QCharOID]}}) + defaultMap.RegisterType(&Type{Name: "_cid", OID: CIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[CIDOID]}}) + defaultMap.RegisterType(&Type{Name: "_cidr", OID: CIDRArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[CIDROID]}}) + defaultMap.RegisterType(&Type{Name: "_circle", OID: CircleArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[CircleOID]}}) + defaultMap.RegisterType(&Type{Name: "_date", OID: DateArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[DateOID]}}) + defaultMap.RegisterType(&Type{Name: "_daterange", OID: DaterangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[DaterangeOID]}}) + defaultMap.RegisterType(&Type{Name: "_float4", OID: Float4ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Float4OID]}}) + defaultMap.RegisterType(&Type{Name: "_float8", OID: Float8ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Float8OID]}}) + defaultMap.RegisterType(&Type{Name: "_inet", OID: InetArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[InetOID]}}) + defaultMap.RegisterType(&Type{Name: "_int2", OID: Int2ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int2OID]}}) + defaultMap.RegisterType(&Type{Name: "_int4", OID: Int4ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int4OID]}}) + defaultMap.RegisterType(&Type{Name: "_int4range", OID: Int4rangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int4rangeOID]}}) + defaultMap.RegisterType(&Type{Name: "_int8", OID: Int8ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int8OID]}}) + defaultMap.RegisterType(&Type{Name: "_int8range", OID: Int8rangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int8rangeOID]}}) + defaultMap.RegisterType(&Type{Name: "_interval", OID: IntervalArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[IntervalOID]}}) + defaultMap.RegisterType(&Type{Name: "_json", OID: JSONArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[JSONOID]}}) + defaultMap.RegisterType(&Type{Name: "_jsonb", OID: JSONBArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[JSONBOID]}}) + defaultMap.RegisterType(&Type{Name: "_jsonpath", OID: JSONPathArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[JSONPathOID]}}) + defaultMap.RegisterType(&Type{Name: "_line", OID: LineArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[LineOID]}}) + defaultMap.RegisterType(&Type{Name: "_lseg", OID: LsegArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[LsegOID]}}) + defaultMap.RegisterType(&Type{Name: "_macaddr", OID: MacaddrArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[MacaddrOID]}}) + defaultMap.RegisterType(&Type{Name: "_name", OID: NameArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[NameOID]}}) + defaultMap.RegisterType(&Type{Name: "_numeric", OID: NumericArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[NumericOID]}}) + defaultMap.RegisterType(&Type{Name: "_numrange", OID: NumrangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[NumrangeOID]}}) + defaultMap.RegisterType(&Type{Name: "_oid", OID: OIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[OIDOID]}}) + defaultMap.RegisterType(&Type{Name: "_path", OID: PathArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[PathOID]}}) + defaultMap.RegisterType(&Type{Name: "_point", OID: PointArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[PointOID]}}) + defaultMap.RegisterType(&Type{Name: "_polygon", OID: PolygonArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[PolygonOID]}}) + defaultMap.RegisterType(&Type{Name: "_record", OID: RecordArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[RecordOID]}}) + defaultMap.RegisterType(&Type{Name: "_text", OID: TextArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TextOID]}}) + defaultMap.RegisterType(&Type{Name: "_tid", OID: TIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TIDOID]}}) + defaultMap.RegisterType(&Type{Name: "_time", OID: TimeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TimeOID]}}) + defaultMap.RegisterType(&Type{Name: "_timestamp", OID: TimestampArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TimestampOID]}}) + defaultMap.RegisterType(&Type{Name: "_timestamptz", OID: TimestamptzArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TimestamptzOID]}}) + defaultMap.RegisterType(&Type{Name: "_tsrange", OID: TsrangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TsrangeOID]}}) + defaultMap.RegisterType(&Type{Name: "_tstzrange", OID: TstzrangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TstzrangeOID]}}) + defaultMap.RegisterType(&Type{Name: "_uuid", OID: UUIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[UUIDOID]}}) + defaultMap.RegisterType(&Type{Name: "_varbit", OID: VarbitArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[VarbitOID]}}) + defaultMap.RegisterType(&Type{Name: "_varchar", OID: VarcharArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[VarcharOID]}}) + defaultMap.RegisterType(&Type{Name: "_xid", OID: XIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[XIDOID]}}) + + // Integer types that directly map to a PostgreSQL type + registerDefaultPgTypeVariants[int16](defaultMap, "int2") + registerDefaultPgTypeVariants[int32](defaultMap, "int4") + registerDefaultPgTypeVariants[int64](defaultMap, "int8") + + // Integer types that do not have a direct match to a PostgreSQL type + registerDefaultPgTypeVariants[int8](defaultMap, "int8") + registerDefaultPgTypeVariants[int](defaultMap, "int8") + registerDefaultPgTypeVariants[uint8](defaultMap, "int8") + registerDefaultPgTypeVariants[uint16](defaultMap, "int8") + registerDefaultPgTypeVariants[uint32](defaultMap, "int8") + registerDefaultPgTypeVariants[uint64](defaultMap, "numeric") + registerDefaultPgTypeVariants[uint](defaultMap, "numeric") + + registerDefaultPgTypeVariants[float32](defaultMap, "float4") + registerDefaultPgTypeVariants[float64](defaultMap, "float8") + + registerDefaultPgTypeVariants[bool](defaultMap, "bool") + registerDefaultPgTypeVariants[time.Time](defaultMap, "timestamptz") + registerDefaultPgTypeVariants[time.Duration](defaultMap, "interval") + registerDefaultPgTypeVariants[string](defaultMap, "text") + registerDefaultPgTypeVariants[json.RawMessage](defaultMap, "json") + registerDefaultPgTypeVariants[[]byte](defaultMap, "bytea") + + registerDefaultPgTypeVariants[net.IP](defaultMap, "inet") + registerDefaultPgTypeVariants[net.IPNet](defaultMap, "cidr") + registerDefaultPgTypeVariants[netip.Addr](defaultMap, "inet") + registerDefaultPgTypeVariants[netip.Prefix](defaultMap, "cidr") + + // pgtype provided structs + registerDefaultPgTypeVariants[Bits](defaultMap, "varbit") + registerDefaultPgTypeVariants[Bool](defaultMap, "bool") + registerDefaultPgTypeVariants[Box](defaultMap, "box") + registerDefaultPgTypeVariants[Circle](defaultMap, "circle") + registerDefaultPgTypeVariants[Date](defaultMap, "date") + registerDefaultPgTypeVariants[Range[Date]](defaultMap, "daterange") + registerDefaultPgTypeVariants[Multirange[Range[Date]]](defaultMap, "datemultirange") + registerDefaultPgTypeVariants[Float4](defaultMap, "float4") + registerDefaultPgTypeVariants[Float8](defaultMap, "float8") + registerDefaultPgTypeVariants[Range[Float8]](defaultMap, "numrange") // There is no PostgreSQL builtin float8range so map it to numrange. + registerDefaultPgTypeVariants[Multirange[Range[Float8]]](defaultMap, "nummultirange") // There is no PostgreSQL builtin float8multirange so map it to nummultirange. + registerDefaultPgTypeVariants[Int2](defaultMap, "int2") + registerDefaultPgTypeVariants[Int4](defaultMap, "int4") + registerDefaultPgTypeVariants[Range[Int4]](defaultMap, "int4range") + registerDefaultPgTypeVariants[Multirange[Range[Int4]]](defaultMap, "int4multirange") + registerDefaultPgTypeVariants[Int8](defaultMap, "int8") + registerDefaultPgTypeVariants[Range[Int8]](defaultMap, "int8range") + registerDefaultPgTypeVariants[Multirange[Range[Int8]]](defaultMap, "int8multirange") + registerDefaultPgTypeVariants[Interval](defaultMap, "interval") + registerDefaultPgTypeVariants[Line](defaultMap, "line") + registerDefaultPgTypeVariants[Lseg](defaultMap, "lseg") + registerDefaultPgTypeVariants[Numeric](defaultMap, "numeric") + registerDefaultPgTypeVariants[Range[Numeric]](defaultMap, "numrange") + registerDefaultPgTypeVariants[Multirange[Range[Numeric]]](defaultMap, "nummultirange") + registerDefaultPgTypeVariants[Path](defaultMap, "path") + registerDefaultPgTypeVariants[Point](defaultMap, "point") + registerDefaultPgTypeVariants[Polygon](defaultMap, "polygon") + registerDefaultPgTypeVariants[TID](defaultMap, "tid") + registerDefaultPgTypeVariants[Text](defaultMap, "text") + registerDefaultPgTypeVariants[Time](defaultMap, "time") + registerDefaultPgTypeVariants[Timestamp](defaultMap, "timestamp") + registerDefaultPgTypeVariants[Timestamptz](defaultMap, "timestamptz") + registerDefaultPgTypeVariants[Range[Timestamp]](defaultMap, "tsrange") + registerDefaultPgTypeVariants[Multirange[Range[Timestamp]]](defaultMap, "tsmultirange") + registerDefaultPgTypeVariants[Range[Timestamptz]](defaultMap, "tstzrange") + registerDefaultPgTypeVariants[Multirange[Range[Timestamptz]]](defaultMap, "tstzmultirange") + registerDefaultPgTypeVariants[UUID](defaultMap, "uuid") + + defaultMap.buildReflectTypeToType() +} diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/point.go b/vendor/github.com/jackc/pgx/v5/pgtype/point.go index cfa5a9f1..09b19bb5 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/point.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/point.go @@ -40,7 +40,7 @@ func (p Point) PointValue() (Point, error) { } func parsePoint(src []byte) (*Point, error) { - if src == nil || bytes.Compare(src, []byte("null")) == 0 { + if src == nil || bytes.Equal(src, []byte("null")) { return &Point{}, nil } @@ -50,17 +50,17 @@ func parsePoint(src []byte) (*Point, error) { if src[0] == '"' && src[len(src)-1] == '"' { src = src[1 : len(src)-1] } - parts := strings.SplitN(string(src[1:len(src)-1]), ",", 2) - if len(parts) < 2 { + sx, sy, found := strings.Cut(string(src[1:len(src)-1]), ",") + if !found { return nil, fmt.Errorf("invalid format for point") } - x, err := strconv.ParseFloat(parts[0], 64) + x, err := strconv.ParseFloat(sx, 64) if err != nil { return nil, err } - y, err := strconv.ParseFloat(parts[1], 64) + y, err := strconv.ParseFloat(sy, 64) if err != nil { return nil, err } @@ -247,17 +247,17 @@ func (scanPlanTextAnyToPointScanner) Scan(src []byte, dst any) error { return fmt.Errorf("invalid length for point: %v", len(src)) } - parts := strings.SplitN(string(src[1:len(src)-1]), ",", 2) - if len(parts) < 2 { + sx, sy, found := strings.Cut(string(src[1:len(src)-1]), ",") + if !found { return fmt.Errorf("invalid format for point") } - x, err := strconv.ParseFloat(parts[0], 64) + x, err := strconv.ParseFloat(sx, 64) if err != nil { return err } - y, err := strconv.ParseFloat(parts[1], 64) + y, err := strconv.ParseFloat(sy, 64) if err != nil { return err } diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/range.go b/vendor/github.com/jackc/pgx/v5/pgtype/range.go index 8f408f9f..16427ccc 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/range.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/range.go @@ -40,7 +40,7 @@ func parseUntypedTextRange(src string) (*untypedTextRange, error) { r, _, err := buf.ReadRune() if err != nil { - return nil, fmt.Errorf("invalid lower bound: %v", err) + return nil, fmt.Errorf("invalid lower bound: %w", err) } switch r { case '(': @@ -53,7 +53,7 @@ func parseUntypedTextRange(src string) (*untypedTextRange, error) { r, _, err = buf.ReadRune() if err != nil { - return nil, fmt.Errorf("invalid lower value: %v", err) + return nil, fmt.Errorf("invalid lower value: %w", err) } buf.UnreadRune() @@ -62,13 +62,13 @@ func parseUntypedTextRange(src string) (*untypedTextRange, error) { } else { utr.Lower, err = rangeParseValue(buf) if err != nil { - return nil, fmt.Errorf("invalid lower value: %v", err) + return nil, fmt.Errorf("invalid lower value: %w", err) } } r, _, err = buf.ReadRune() if err != nil { - return nil, fmt.Errorf("missing range separator: %v", err) + return nil, fmt.Errorf("missing range separator: %w", err) } if r != ',' { return nil, fmt.Errorf("missing range separator: %v", r) @@ -76,7 +76,7 @@ func parseUntypedTextRange(src string) (*untypedTextRange, error) { r, _, err = buf.ReadRune() if err != nil { - return nil, fmt.Errorf("invalid upper value: %v", err) + return nil, fmt.Errorf("invalid upper value: %w", err) } if r == ')' || r == ']' { @@ -85,12 +85,12 @@ func parseUntypedTextRange(src string) (*untypedTextRange, error) { buf.UnreadRune() utr.Upper, err = rangeParseValue(buf) if err != nil { - return nil, fmt.Errorf("invalid upper value: %v", err) + return nil, fmt.Errorf("invalid upper value: %w", err) } r, _, err = buf.ReadRune() if err != nil { - return nil, fmt.Errorf("missing upper bound: %v", err) + return nil, fmt.Errorf("missing upper bound: %w", err) } switch r { case ')': diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/range_codec.go b/vendor/github.com/jackc/pgx/v5/pgtype/range_codec.go index 8cfb3a63..684f1bf7 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/range_codec.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/range_codec.go @@ -120,7 +120,7 @@ func (plan *encodePlanRangeCodecRangeValuerToBinary) Encode(value any, buf []byt buf, err = lowerPlan.Encode(lower, buf) if err != nil { - return nil, fmt.Errorf("failed to encode %v as element of range: %v", lower, err) + return nil, fmt.Errorf("failed to encode %v as element of range: %w", lower, err) } if buf == nil { return nil, fmt.Errorf("Lower cannot be NULL unless LowerType is Unbounded") @@ -144,7 +144,7 @@ func (plan *encodePlanRangeCodecRangeValuerToBinary) Encode(value any, buf []byt buf, err = upperPlan.Encode(upper, buf) if err != nil { - return nil, fmt.Errorf("failed to encode %v as element of range: %v", upper, err) + return nil, fmt.Errorf("failed to encode %v as element of range: %w", upper, err) } if buf == nil { return nil, fmt.Errorf("Upper cannot be NULL unless UpperType is Unbounded") @@ -194,7 +194,7 @@ func (plan *encodePlanRangeCodecRangeValuerToText) Encode(value any, buf []byte) buf, err = lowerPlan.Encode(lower, buf) if err != nil { - return nil, fmt.Errorf("failed to encode %v as element of range: %v", lower, err) + return nil, fmt.Errorf("failed to encode %v as element of range: %w", lower, err) } if buf == nil { return nil, fmt.Errorf("Lower cannot be NULL unless LowerType is Unbounded") @@ -215,7 +215,7 @@ func (plan *encodePlanRangeCodecRangeValuerToText) Encode(value any, buf []byte) buf, err = upperPlan.Encode(upper, buf) if err != nil { - return nil, fmt.Errorf("failed to encode %v as element of range: %v", upper, err) + return nil, fmt.Errorf("failed to encode %v as element of range: %w", upper, err) } if buf == nil { return nil, fmt.Errorf("Upper cannot be NULL unless UpperType is Unbounded") @@ -282,7 +282,7 @@ func (plan *scanPlanBinaryRangeToRangeScanner) Scan(src []byte, target any) erro err = lowerPlan.Scan(ubr.Lower, lowerTarget) if err != nil { - return fmt.Errorf("cannot scan into %v from range element: %v", lowerTarget, err) + return fmt.Errorf("cannot scan into %v from range element: %w", lowerTarget, err) } } @@ -294,7 +294,7 @@ func (plan *scanPlanBinaryRangeToRangeScanner) Scan(src []byte, target any) erro err = upperPlan.Scan(ubr.Upper, upperTarget) if err != nil { - return fmt.Errorf("cannot scan into %v from range element: %v", upperTarget, err) + return fmt.Errorf("cannot scan into %v from range element: %w", upperTarget, err) } } @@ -332,7 +332,7 @@ func (plan *scanPlanTextRangeToRangeScanner) Scan(src []byte, target any) error err = lowerPlan.Scan([]byte(utr.Lower), lowerTarget) if err != nil { - return fmt.Errorf("cannot scan into %v from range element: %v", lowerTarget, err) + return fmt.Errorf("cannot scan into %v from range element: %w", lowerTarget, err) } } @@ -344,7 +344,7 @@ func (plan *scanPlanTextRangeToRangeScanner) Scan(src []byte, target any) error err = upperPlan.Scan([]byte(utr.Upper), upperTarget) if err != nil { - return fmt.Errorf("cannot scan into %v from range element: %v", upperTarget, err) + return fmt.Errorf("cannot scan into %v from range element: %w", upperTarget, err) } } diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/tid.go b/vendor/github.com/jackc/pgx/v5/pgtype/tid.go index 5839e874..9bc2c2a1 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/tid.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/tid.go @@ -205,17 +205,17 @@ func (scanPlanTextAnyToTIDScanner) Scan(src []byte, dst any) error { return fmt.Errorf("invalid length for tid: %v", len(src)) } - parts := strings.SplitN(string(src[1:len(src)-1]), ",", 2) - if len(parts) < 2 { + block, offset, found := strings.Cut(string(src[1:len(src)-1]), ",") + if !found { return fmt.Errorf("invalid format for tid") } - blockNumber, err := strconv.ParseUint(parts[0], 10, 32) + blockNumber, err := strconv.ParseUint(block, 10, 32) if err != nil { return err } - offsetNumber, err := strconv.ParseUint(parts[1], 10, 16) + offsetNumber, err := strconv.ParseUint(offset, 10, 16) if err != nil { return err } diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/timestamp.go b/vendor/github.com/jackc/pgx/v5/pgtype/timestamp.go index 9f3de2c5..35d73956 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/timestamp.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/timestamp.go @@ -3,6 +3,7 @@ package pgtype import ( "database/sql/driver" "encoding/binary" + "encoding/json" "fmt" "strings" "time" @@ -66,6 +67,55 @@ func (ts Timestamp) Value() (driver.Value, error) { return ts.Time, nil } +func (ts Timestamp) MarshalJSON() ([]byte, error) { + if !ts.Valid { + return []byte("null"), nil + } + + var s string + + switch ts.InfinityModifier { + case Finite: + s = ts.Time.Format(time.RFC3339Nano) + case Infinity: + s = "infinity" + case NegativeInfinity: + s = "-infinity" + } + + return json.Marshal(s) +} + +func (ts *Timestamp) UnmarshalJSON(b []byte) error { + var s *string + err := json.Unmarshal(b, &s) + if err != nil { + return err + } + + if s == nil { + *ts = Timestamp{} + return nil + } + + switch *s { + case "infinity": + *ts = Timestamp{Valid: true, InfinityModifier: Infinity} + case "-infinity": + *ts = Timestamp{Valid: true, InfinityModifier: -Infinity} + default: + // PostgreSQL uses ISO 8601 for to_json function and casting from a string to timestamptz + tim, err := time.Parse(time.RFC3339Nano, *s) + if err != nil { + return err + } + + *ts = Timestamp{Time: tim, Valid: true} + } + + return nil +} + type TimestampCodec struct{} func (TimestampCodec) FormatSupported(format int16) bool { diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/uuid.go b/vendor/github.com/jackc/pgx/v5/pgtype/uuid.go index 96a4c32f..d57c0f2f 100644 --- a/vendor/github.com/jackc/pgx/v5/pgtype/uuid.go +++ b/vendor/github.com/jackc/pgx/v5/pgtype/uuid.go @@ -52,7 +52,19 @@ func parseUUID(src string) (dst [16]byte, err error) { // encodeUUID converts a uuid byte array to UUID standard string form. func encodeUUID(src [16]byte) string { - return fmt.Sprintf("%x-%x-%x-%x-%x", src[0:4], src[4:6], src[6:8], src[8:10], src[10:16]) + var buf [36]byte + + hex.Encode(buf[0:8], src[:4]) + buf[8] = '-' + hex.Encode(buf[9:13], src[4:6]) + buf[13] = '-' + hex.Encode(buf[14:18], src[6:8]) + buf[18] = '-' + hex.Encode(buf[19:23], src[8:10]) + buf[23] = '-' + hex.Encode(buf[24:], src[10:]) + + return string(buf[:]) } // Scan implements the database/sql Scanner interface. @@ -97,7 +109,7 @@ func (src UUID) MarshalJSON() ([]byte, error) { } func (dst *UUID) UnmarshalJSON(src []byte) error { - if bytes.Compare(src, []byte("null")) == 0 { + if bytes.Equal(src, []byte("null")) { *dst = UUID{} return nil } diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/batch_results.go b/vendor/github.com/jackc/pgx/v5/pgxpool/batch_results.go new file mode 100644 index 00000000..5d5c681d --- /dev/null +++ b/vendor/github.com/jackc/pgx/v5/pgxpool/batch_results.go @@ -0,0 +1,52 @@ +package pgxpool + +import ( + "github.com/jackc/pgx/v5" + "github.com/jackc/pgx/v5/pgconn" +) + +type errBatchResults struct { + err error +} + +func (br errBatchResults) Exec() (pgconn.CommandTag, error) { + return pgconn.CommandTag{}, br.err +} + +func (br errBatchResults) Query() (pgx.Rows, error) { + return errRows{err: br.err}, br.err +} + +func (br errBatchResults) QueryRow() pgx.Row { + return errRow{err: br.err} +} + +func (br errBatchResults) Close() error { + return br.err +} + +type poolBatchResults struct { + br pgx.BatchResults + c *Conn +} + +func (br *poolBatchResults) Exec() (pgconn.CommandTag, error) { + return br.br.Exec() +} + +func (br *poolBatchResults) Query() (pgx.Rows, error) { + return br.br.Query() +} + +func (br *poolBatchResults) QueryRow() pgx.Row { + return br.br.QueryRow() +} + +func (br *poolBatchResults) Close() error { + err := br.br.Close() + if br.c != nil { + br.c.Release() + br.c = nil + } + return err +} diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/conn.go b/vendor/github.com/jackc/pgx/v5/pgxpool/conn.go new file mode 100644 index 00000000..36f90969 --- /dev/null +++ b/vendor/github.com/jackc/pgx/v5/pgxpool/conn.go @@ -0,0 +1,130 @@ +package pgxpool + +import ( + "context" + "sync/atomic" + + "github.com/jackc/pgx/v5" + "github.com/jackc/pgx/v5/pgconn" + "github.com/jackc/puddle/v2" +) + +// Conn is an acquired *pgx.Conn from a Pool. +type Conn struct { + res *puddle.Resource[*connResource] + p *Pool +} + +// Release returns c to the pool it was acquired from. Once Release has been called, other methods must not be called. +// However, it is safe to call Release multiple times. Subsequent calls after the first will be ignored. +func (c *Conn) Release() { + if c.res == nil { + return + } + + conn := c.Conn() + res := c.res + c.res = nil + + if conn.IsClosed() || conn.PgConn().IsBusy() || conn.PgConn().TxStatus() != 'I' { + res.Destroy() + // Signal to the health check to run since we just destroyed a connections + // and we might be below minConns now + c.p.triggerHealthCheck() + return + } + + // If the pool is consistently being used, we might never get to check the + // lifetime of a connection since we only check idle connections in checkConnsHealth + // so we also check the lifetime here and force a health check + if c.p.isExpired(res) { + atomic.AddInt64(&c.p.lifetimeDestroyCount, 1) + res.Destroy() + // Signal to the health check to run since we just destroyed a connections + // and we might be below minConns now + c.p.triggerHealthCheck() + return + } + + if c.p.afterRelease == nil { + res.Release() + return + } + + go func() { + if c.p.afterRelease(conn) { + res.Release() + } else { + res.Destroy() + // Signal to the health check to run since we just destroyed a connections + // and we might be below minConns now + c.p.triggerHealthCheck() + } + }() +} + +// Hijack assumes ownership of the connection from the pool. Caller is responsible for closing the connection. Hijack +// will panic if called on an already released or hijacked connection. +func (c *Conn) Hijack() *pgx.Conn { + if c.res == nil { + panic("cannot hijack already released or hijacked connection") + } + + conn := c.Conn() + res := c.res + c.res = nil + + res.Hijack() + + return conn +} + +func (c *Conn) Exec(ctx context.Context, sql string, arguments ...any) (pgconn.CommandTag, error) { + return c.Conn().Exec(ctx, sql, arguments...) +} + +func (c *Conn) Query(ctx context.Context, sql string, args ...any) (pgx.Rows, error) { + return c.Conn().Query(ctx, sql, args...) +} + +func (c *Conn) QueryRow(ctx context.Context, sql string, args ...any) pgx.Row { + return c.Conn().QueryRow(ctx, sql, args...) +} + +func (c *Conn) SendBatch(ctx context.Context, b *pgx.Batch) pgx.BatchResults { + return c.Conn().SendBatch(ctx, b) +} + +func (c *Conn) CopyFrom(ctx context.Context, tableName pgx.Identifier, columnNames []string, rowSrc pgx.CopyFromSource) (int64, error) { + return c.Conn().CopyFrom(ctx, tableName, columnNames, rowSrc) +} + +// Begin starts a transaction block from the *Conn without explicitly setting a transaction mode (see BeginTx with TxOptions if transaction mode is required). +func (c *Conn) Begin(ctx context.Context) (pgx.Tx, error) { + return c.Conn().Begin(ctx) +} + +// BeginTx starts a transaction block from the *Conn with txOptions determining the transaction mode. +func (c *Conn) BeginTx(ctx context.Context, txOptions pgx.TxOptions) (pgx.Tx, error) { + return c.Conn().BeginTx(ctx, txOptions) +} + +func (c *Conn) Ping(ctx context.Context) error { + return c.Conn().Ping(ctx) +} + +func (c *Conn) Conn() *pgx.Conn { + return c.connResource().conn +} + +func (c *Conn) connResource() *connResource { + return c.res.Value() +} + +func (c *Conn) getPoolRow(r pgx.Row) *poolRow { + return c.connResource().getPoolRow(c, r) +} + +func (c *Conn) getPoolRows(r pgx.Rows) *poolRows { + return c.connResource().getPoolRows(c, r) +} diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/doc.go b/vendor/github.com/jackc/pgx/v5/pgxpool/doc.go new file mode 100644 index 00000000..06cc63d5 --- /dev/null +++ b/vendor/github.com/jackc/pgx/v5/pgxpool/doc.go @@ -0,0 +1,27 @@ +// Package pgxpool is a concurrency-safe connection pool for pgx. +/* +pgxpool implements a nearly identical interface to pgx connections. + +Creating a Pool + +The primary way of creating a pool is with [pgxpool.New]: + + pool, err := pgxpool.New(context.Background(), os.Getenv("DATABASE_URL")) + +The database connection string can be in URL or DSN format. PostgreSQL settings, pgx settings, and pool settings can be +specified here. In addition, a config struct can be created by [ParseConfig]. + + config, err := pgxpool.ParseConfig(os.Getenv("DATABASE_URL")) + if err != nil { + // ... + } + config.AfterConnect = func(ctx context.Context, conn *pgx.Conn) error { + // do something with every new connection + } + + pool, err := pgxpool.NewWithConfig(context.Background(), config) + +A pool returns without waiting for any connections to be established. Acquire a connection immediately after creating +the pool to check if a connection can successfully be established. +*/ +package pgxpool diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/pool.go b/vendor/github.com/jackc/pgx/v5/pgxpool/pool.go new file mode 100644 index 00000000..9f74805e --- /dev/null +++ b/vendor/github.com/jackc/pgx/v5/pgxpool/pool.go @@ -0,0 +1,695 @@ +package pgxpool + +import ( + "context" + "fmt" + "math/rand" + "runtime" + "strconv" + "sync" + "sync/atomic" + "time" + + "github.com/jackc/pgx/v5" + "github.com/jackc/pgx/v5/pgconn" + "github.com/jackc/puddle/v2" +) + +var defaultMaxConns = int32(4) +var defaultMinConns = int32(0) +var defaultMaxConnLifetime = time.Hour +var defaultMaxConnIdleTime = time.Minute * 30 +var defaultHealthCheckPeriod = time.Minute + +type connResource struct { + conn *pgx.Conn + conns []Conn + poolRows []poolRow + poolRowss []poolRows + maxAgeTime time.Time +} + +func (cr *connResource) getConn(p *Pool, res *puddle.Resource[*connResource]) *Conn { + if len(cr.conns) == 0 { + cr.conns = make([]Conn, 128) + } + + c := &cr.conns[len(cr.conns)-1] + cr.conns = cr.conns[0 : len(cr.conns)-1] + + c.res = res + c.p = p + + return c +} + +func (cr *connResource) getPoolRow(c *Conn, r pgx.Row) *poolRow { + if len(cr.poolRows) == 0 { + cr.poolRows = make([]poolRow, 128) + } + + pr := &cr.poolRows[len(cr.poolRows)-1] + cr.poolRows = cr.poolRows[0 : len(cr.poolRows)-1] + + pr.c = c + pr.r = r + + return pr +} + +func (cr *connResource) getPoolRows(c *Conn, r pgx.Rows) *poolRows { + if len(cr.poolRowss) == 0 { + cr.poolRowss = make([]poolRows, 128) + } + + pr := &cr.poolRowss[len(cr.poolRowss)-1] + cr.poolRowss = cr.poolRowss[0 : len(cr.poolRowss)-1] + + pr.c = c + pr.r = r + + return pr +} + +// Pool allows for connection reuse. +type Pool struct { + // 64 bit fields accessed with atomics must be at beginning of struct to guarantee alignment for certain 32-bit + // architectures. See BUGS section of https://pkg.go.dev/sync/atomic and https://github.com/jackc/pgx/issues/1288. + newConnsCount int64 + lifetimeDestroyCount int64 + idleDestroyCount int64 + + p *puddle.Pool[*connResource] + config *Config + beforeConnect func(context.Context, *pgx.ConnConfig) error + afterConnect func(context.Context, *pgx.Conn) error + beforeAcquire func(context.Context, *pgx.Conn) bool + afterRelease func(*pgx.Conn) bool + beforeClose func(*pgx.Conn) + minConns int32 + maxConns int32 + maxConnLifetime time.Duration + maxConnLifetimeJitter time.Duration + maxConnIdleTime time.Duration + healthCheckPeriod time.Duration + + healthCheckChan chan struct{} + + closeOnce sync.Once + closeChan chan struct{} +} + +// Config is the configuration struct for creating a pool. It must be created by [ParseConfig] and then it can be +// modified. +type Config struct { + ConnConfig *pgx.ConnConfig + + // BeforeConnect is called before a new connection is made. It is passed a copy of the underlying pgx.ConnConfig and + // will not impact any existing open connections. + BeforeConnect func(context.Context, *pgx.ConnConfig) error + + // AfterConnect is called after a connection is established, but before it is added to the pool. + AfterConnect func(context.Context, *pgx.Conn) error + + // BeforeAcquire is called before a connection is acquired from the pool. It must return true to allow the + // acquisition or false to indicate that the connection should be destroyed and a different connection should be + // acquired. + BeforeAcquire func(context.Context, *pgx.Conn) bool + + // AfterRelease is called after a connection is released, but before it is returned to the pool. It must return true to + // return the connection to the pool or false to destroy the connection. + AfterRelease func(*pgx.Conn) bool + + // BeforeClose is called right before a connection is closed and removed from the pool. + BeforeClose func(*pgx.Conn) + + // MaxConnLifetime is the duration since creation after which a connection will be automatically closed. + MaxConnLifetime time.Duration + + // MaxConnLifetimeJitter is the duration after MaxConnLifetime to randomly decide to close a connection. + // This helps prevent all connections from being closed at the exact same time, starving the pool. + MaxConnLifetimeJitter time.Duration + + // MaxConnIdleTime is the duration after which an idle connection will be automatically closed by the health check. + MaxConnIdleTime time.Duration + + // MaxConns is the maximum size of the pool. The default is the greater of 4 or runtime.NumCPU(). + MaxConns int32 + + // MinConns is the minimum size of the pool. After connection closes, the pool might dip below MinConns. A low + // number of MinConns might mean the pool is empty after MaxConnLifetime until the health check has a chance + // to create new connections. + MinConns int32 + + // HealthCheckPeriod is the duration between checks of the health of idle connections. + HealthCheckPeriod time.Duration + + createdByParseConfig bool // Used to enforce created by ParseConfig rule. +} + +// Copy returns a deep copy of the config that is safe to use and modify. +// The only exception is the tls.Config: +// according to the tls.Config docs it must not be modified after creation. +func (c *Config) Copy() *Config { + newConfig := new(Config) + *newConfig = *c + newConfig.ConnConfig = c.ConnConfig.Copy() + return newConfig +} + +// ConnString returns the connection string as parsed by pgxpool.ParseConfig into pgxpool.Config. +func (c *Config) ConnString() string { return c.ConnConfig.ConnString() } + +// New creates a new Pool. See [ParseConfig] for information on connString format. +func New(ctx context.Context, connString string) (*Pool, error) { + config, err := ParseConfig(connString) + if err != nil { + return nil, err + } + + return NewWithConfig(ctx, config) +} + +// NewWithConfig creates a new Pool. config must have been created by [ParseConfig]. +func NewWithConfig(ctx context.Context, config *Config) (*Pool, error) { + // Default values are set in ParseConfig. Enforce initial creation by ParseConfig rather than setting defaults from + // zero values. + if !config.createdByParseConfig { + panic("config must be created by ParseConfig") + } + + p := &Pool{ + config: config, + beforeConnect: config.BeforeConnect, + afterConnect: config.AfterConnect, + beforeAcquire: config.BeforeAcquire, + afterRelease: config.AfterRelease, + beforeClose: config.BeforeClose, + minConns: config.MinConns, + maxConns: config.MaxConns, + maxConnLifetime: config.MaxConnLifetime, + maxConnLifetimeJitter: config.MaxConnLifetimeJitter, + maxConnIdleTime: config.MaxConnIdleTime, + healthCheckPeriod: config.HealthCheckPeriod, + healthCheckChan: make(chan struct{}, 1), + closeChan: make(chan struct{}), + } + + var err error + p.p, err = puddle.NewPool( + &puddle.Config[*connResource]{ + Constructor: func(ctx context.Context) (*connResource, error) { + atomic.AddInt64(&p.newConnsCount, 1) + connConfig := p.config.ConnConfig.Copy() + + // Connection will continue in background even if Acquire is canceled. Ensure that a connect won't hang forever. + if connConfig.ConnectTimeout <= 0 { + connConfig.ConnectTimeout = 2 * time.Minute + } + + if p.beforeConnect != nil { + if err := p.beforeConnect(ctx, connConfig); err != nil { + return nil, err + } + } + + conn, err := pgx.ConnectConfig(ctx, connConfig) + if err != nil { + return nil, err + } + + if p.afterConnect != nil { + err = p.afterConnect(ctx, conn) + if err != nil { + conn.Close(ctx) + return nil, err + } + } + + jitterSecs := rand.Float64() * config.MaxConnLifetimeJitter.Seconds() + maxAgeTime := time.Now().Add(config.MaxConnLifetime).Add(time.Duration(jitterSecs) * time.Second) + + cr := &connResource{ + conn: conn, + conns: make([]Conn, 64), + poolRows: make([]poolRow, 64), + poolRowss: make([]poolRows, 64), + maxAgeTime: maxAgeTime, + } + + return cr, nil + }, + Destructor: func(value *connResource) { + ctx, cancel := context.WithTimeout(context.Background(), 15*time.Second) + conn := value.conn + if p.beforeClose != nil { + p.beforeClose(conn) + } + conn.Close(ctx) + select { + case <-conn.PgConn().CleanupDone(): + case <-ctx.Done(): + } + cancel() + }, + MaxSize: config.MaxConns, + }, + ) + if err != nil { + return nil, err + } + + go func() { + p.createIdleResources(ctx, int(p.minConns)) + p.backgroundHealthCheck() + }() + + return p, nil +} + +// ParseConfig builds a Config from connString. It parses connString with the same behavior as [pgx.ParseConfig] with the +// addition of the following variables: +// +// - pool_max_conns: integer greater than 0 +// - pool_min_conns: integer 0 or greater +// - pool_max_conn_lifetime: duration string +// - pool_max_conn_idle_time: duration string +// - pool_health_check_period: duration string +// - pool_max_conn_lifetime_jitter: duration string +// +// See Config for definitions of these arguments. +// +// # Example DSN +// user=jack password=secret host=pg.example.com port=5432 dbname=mydb sslmode=verify-ca pool_max_conns=10 +// +// # Example URL +// postgres://jack:secret@pg.example.com:5432/mydb?sslmode=verify-ca&pool_max_conns=10 +func ParseConfig(connString string) (*Config, error) { + connConfig, err := pgx.ParseConfig(connString) + if err != nil { + return nil, err + } + + config := &Config{ + ConnConfig: connConfig, + createdByParseConfig: true, + } + + if s, ok := config.ConnConfig.Config.RuntimeParams["pool_max_conns"]; ok { + delete(connConfig.Config.RuntimeParams, "pool_max_conns") + n, err := strconv.ParseInt(s, 10, 32) + if err != nil { + return nil, fmt.Errorf("cannot parse pool_max_conns: %w", err) + } + if n < 1 { + return nil, fmt.Errorf("pool_max_conns too small: %d", n) + } + config.MaxConns = int32(n) + } else { + config.MaxConns = defaultMaxConns + if numCPU := int32(runtime.NumCPU()); numCPU > config.MaxConns { + config.MaxConns = numCPU + } + } + + if s, ok := config.ConnConfig.Config.RuntimeParams["pool_min_conns"]; ok { + delete(connConfig.Config.RuntimeParams, "pool_min_conns") + n, err := strconv.ParseInt(s, 10, 32) + if err != nil { + return nil, fmt.Errorf("cannot parse pool_min_conns: %w", err) + } + config.MinConns = int32(n) + } else { + config.MinConns = defaultMinConns + } + + if s, ok := config.ConnConfig.Config.RuntimeParams["pool_max_conn_lifetime"]; ok { + delete(connConfig.Config.RuntimeParams, "pool_max_conn_lifetime") + d, err := time.ParseDuration(s) + if err != nil { + return nil, fmt.Errorf("invalid pool_max_conn_lifetime: %w", err) + } + config.MaxConnLifetime = d + } else { + config.MaxConnLifetime = defaultMaxConnLifetime + } + + if s, ok := config.ConnConfig.Config.RuntimeParams["pool_max_conn_idle_time"]; ok { + delete(connConfig.Config.RuntimeParams, "pool_max_conn_idle_time") + d, err := time.ParseDuration(s) + if err != nil { + return nil, fmt.Errorf("invalid pool_max_conn_idle_time: %w", err) + } + config.MaxConnIdleTime = d + } else { + config.MaxConnIdleTime = defaultMaxConnIdleTime + } + + if s, ok := config.ConnConfig.Config.RuntimeParams["pool_health_check_period"]; ok { + delete(connConfig.Config.RuntimeParams, "pool_health_check_period") + d, err := time.ParseDuration(s) + if err != nil { + return nil, fmt.Errorf("invalid pool_health_check_period: %w", err) + } + config.HealthCheckPeriod = d + } else { + config.HealthCheckPeriod = defaultHealthCheckPeriod + } + + if s, ok := config.ConnConfig.Config.RuntimeParams["pool_max_conn_lifetime_jitter"]; ok { + delete(connConfig.Config.RuntimeParams, "pool_max_conn_lifetime_jitter") + d, err := time.ParseDuration(s) + if err != nil { + return nil, fmt.Errorf("invalid pool_max_conn_lifetime_jitter: %w", err) + } + config.MaxConnLifetimeJitter = d + } + + return config, nil +} + +// Close closes all connections in the pool and rejects future Acquire calls. Blocks until all connections are returned +// to pool and closed. +func (p *Pool) Close() { + p.closeOnce.Do(func() { + close(p.closeChan) + p.p.Close() + }) +} + +func (p *Pool) isExpired(res *puddle.Resource[*connResource]) bool { + return time.Now().After(res.Value().maxAgeTime) +} + +func (p *Pool) triggerHealthCheck() { + go func() { + // Destroy is asynchronous so we give it time to actually remove itself from + // the pool otherwise we might try to check the pool size too soon + time.Sleep(500 * time.Millisecond) + select { + case p.healthCheckChan <- struct{}{}: + default: + } + }() +} + +func (p *Pool) backgroundHealthCheck() { + ticker := time.NewTicker(p.healthCheckPeriod) + defer ticker.Stop() + for { + select { + case <-p.closeChan: + return + case <-p.healthCheckChan: + p.checkHealth() + case <-ticker.C: + p.checkHealth() + } + } +} + +func (p *Pool) checkHealth() { + for { + // If checkMinConns failed we don't destroy any connections since we couldn't + // even get to minConns + if err := p.checkMinConns(); err != nil { + // Should we log this error somewhere? + break + } + if !p.checkConnsHealth() { + // Since we didn't destroy any connections we can stop looping + break + } + // Technically Destroy is asynchronous but 500ms should be enough for it to + // remove it from the underlying pool + select { + case <-p.closeChan: + return + case <-time.After(500 * time.Millisecond): + } + } +} + +// checkConnsHealth will check all idle connections, destroy a connection if +// it's idle or too old, and returns true if any were destroyed +func (p *Pool) checkConnsHealth() bool { + var destroyed bool + totalConns := p.Stat().TotalConns() + resources := p.p.AcquireAllIdle() + for _, res := range resources { + // We're okay going under minConns if the lifetime is up + if p.isExpired(res) && totalConns >= p.minConns { + atomic.AddInt64(&p.lifetimeDestroyCount, 1) + res.Destroy() + destroyed = true + // Since Destroy is async we manually decrement totalConns. + totalConns-- + } else if res.IdleDuration() > p.maxConnIdleTime && totalConns > p.minConns { + atomic.AddInt64(&p.idleDestroyCount, 1) + res.Destroy() + destroyed = true + // Since Destroy is async we manually decrement totalConns. + totalConns-- + } else { + res.ReleaseUnused() + } + } + return destroyed +} + +func (p *Pool) checkMinConns() error { + // TotalConns can include ones that are being destroyed but we should have + // sleep(500ms) around all of the destroys to help prevent that from throwing + // off this check + toCreate := p.minConns - p.Stat().TotalConns() + if toCreate > 0 { + return p.createIdleResources(context.Background(), int(toCreate)) + } + return nil +} + +func (p *Pool) createIdleResources(parentCtx context.Context, targetResources int) error { + ctx, cancel := context.WithCancel(parentCtx) + defer cancel() + + errs := make(chan error, targetResources) + + for i := 0; i < targetResources; i++ { + go func() { + err := p.p.CreateResource(ctx) + // Ignore ErrNotAvailable since it means that the pool has become full since we started creating resource. + if err == puddle.ErrNotAvailable { + err = nil + } + errs <- err + }() + } + + var firstError error + for i := 0; i < targetResources; i++ { + err := <-errs + if err != nil && firstError == nil { + cancel() + firstError = err + } + } + + return firstError +} + +// Acquire returns a connection (*Conn) from the Pool +func (p *Pool) Acquire(ctx context.Context) (*Conn, error) { + for { + res, err := p.p.Acquire(ctx) + if err != nil { + return nil, err + } + + cr := res.Value() + + if res.IdleDuration() > time.Second { + err := cr.conn.Ping(ctx) + if err != nil { + res.Destroy() + continue + } + } + + if p.beforeAcquire == nil || p.beforeAcquire(ctx, cr.conn) { + return cr.getConn(p, res), nil + } + + res.Destroy() + } +} + +// AcquireFunc acquires a *Conn and calls f with that *Conn. ctx will only affect the Acquire. It has no effect on the +// call of f. The return value is either an error acquiring the *Conn or the return value of f. The *Conn is +// automatically released after the call of f. +func (p *Pool) AcquireFunc(ctx context.Context, f func(*Conn) error) error { + conn, err := p.Acquire(ctx) + if err != nil { + return err + } + defer conn.Release() + + return f(conn) +} + +// AcquireAllIdle atomically acquires all currently idle connections. Its intended use is for health check and +// keep-alive functionality. It does not update pool statistics. +func (p *Pool) AcquireAllIdle(ctx context.Context) []*Conn { + resources := p.p.AcquireAllIdle() + conns := make([]*Conn, 0, len(resources)) + for _, res := range resources { + cr := res.Value() + if p.beforeAcquire == nil || p.beforeAcquire(ctx, cr.conn) { + conns = append(conns, cr.getConn(p, res)) + } else { + res.Destroy() + } + } + + return conns +} + +// Reset closes all connections, but leaves the pool open. It is intended for use when an error is detected that would +// disrupt all connections (such as a network interruption or a server state change). +// +// It is safe to reset a pool while connections are checked out. Those connections will be closed when they are returned +// to the pool. +func (p *Pool) Reset() { + p.p.Reset() +} + +// Config returns a copy of config that was used to initialize this pool. +func (p *Pool) Config() *Config { return p.config.Copy() } + +// Stat returns a pgxpool.Stat struct with a snapshot of Pool statistics. +func (p *Pool) Stat() *Stat { + return &Stat{ + s: p.p.Stat(), + newConnsCount: atomic.LoadInt64(&p.newConnsCount), + lifetimeDestroyCount: atomic.LoadInt64(&p.lifetimeDestroyCount), + idleDestroyCount: atomic.LoadInt64(&p.idleDestroyCount), + } +} + +// Exec acquires a connection from the Pool and executes the given SQL. +// SQL can be either a prepared statement name or an SQL string. +// Arguments should be referenced positionally from the SQL string as $1, $2, etc. +// The acquired connection is returned to the pool when the Exec function returns. +func (p *Pool) Exec(ctx context.Context, sql string, arguments ...any) (pgconn.CommandTag, error) { + c, err := p.Acquire(ctx) + if err != nil { + return pgconn.CommandTag{}, err + } + defer c.Release() + + return c.Exec(ctx, sql, arguments...) +} + +// Query acquires a connection and executes a query that returns pgx.Rows. +// Arguments should be referenced positionally from the SQL string as $1, $2, etc. +// See pgx.Rows documentation to close the returned Rows and return the acquired connection to the Pool. +// +// If there is an error, the returned pgx.Rows will be returned in an error state. +// If preferred, ignore the error returned from Query and handle errors using the returned pgx.Rows. +// +// For extra control over how the query is executed, the types QuerySimpleProtocol, QueryResultFormats, and +// QueryResultFormatsByOID may be used as the first args to control exactly how the query is executed. This is rarely +// needed. See the documentation for those types for details. +func (p *Pool) Query(ctx context.Context, sql string, args ...any) (pgx.Rows, error) { + c, err := p.Acquire(ctx) + if err != nil { + return errRows{err: err}, err + } + + rows, err := c.Query(ctx, sql, args...) + if err != nil { + c.Release() + return errRows{err: err}, err + } + + return c.getPoolRows(rows), nil +} + +// QueryRow acquires a connection and executes a query that is expected +// to return at most one row (pgx.Row). Errors are deferred until pgx.Row's +// Scan method is called. If the query selects no rows, pgx.Row's Scan will +// return ErrNoRows. Otherwise, pgx.Row's Scan scans the first selected row +// and discards the rest. The acquired connection is returned to the Pool when +// pgx.Row's Scan method is called. +// +// Arguments should be referenced positionally from the SQL string as $1, $2, etc. +// +// For extra control over how the query is executed, the types QuerySimpleProtocol, QueryResultFormats, and +// QueryResultFormatsByOID may be used as the first args to control exactly how the query is executed. This is rarely +// needed. See the documentation for those types for details. +func (p *Pool) QueryRow(ctx context.Context, sql string, args ...any) pgx.Row { + c, err := p.Acquire(ctx) + if err != nil { + return errRow{err: err} + } + + row := c.QueryRow(ctx, sql, args...) + return c.getPoolRow(row) +} + +func (p *Pool) SendBatch(ctx context.Context, b *pgx.Batch) pgx.BatchResults { + c, err := p.Acquire(ctx) + if err != nil { + return errBatchResults{err: err} + } + + br := c.SendBatch(ctx, b) + return &poolBatchResults{br: br, c: c} +} + +// Begin acquires a connection from the Pool and starts a transaction. Unlike database/sql, the context only affects the begin command. i.e. there is no +// auto-rollback on context cancellation. Begin initiates a transaction block without explicitly setting a transaction mode for the block (see BeginTx with TxOptions if transaction mode is required). +// *pgxpool.Tx is returned, which implements the pgx.Tx interface. +// Commit or Rollback must be called on the returned transaction to finalize the transaction block. +func (p *Pool) Begin(ctx context.Context) (pgx.Tx, error) { + return p.BeginTx(ctx, pgx.TxOptions{}) +} + +// BeginTx acquires a connection from the Pool and starts a transaction with pgx.TxOptions determining the transaction mode. +// Unlike database/sql, the context only affects the begin command. i.e. there is no auto-rollback on context cancellation. +// *pgxpool.Tx is returned, which implements the pgx.Tx interface. +// Commit or Rollback must be called on the returned transaction to finalize the transaction block. +func (p *Pool) BeginTx(ctx context.Context, txOptions pgx.TxOptions) (pgx.Tx, error) { + c, err := p.Acquire(ctx) + if err != nil { + return nil, err + } + + t, err := c.BeginTx(ctx, txOptions) + if err != nil { + c.Release() + return nil, err + } + + return &Tx{t: t, c: c}, nil +} + +func (p *Pool) CopyFrom(ctx context.Context, tableName pgx.Identifier, columnNames []string, rowSrc pgx.CopyFromSource) (int64, error) { + c, err := p.Acquire(ctx) + if err != nil { + return 0, err + } + defer c.Release() + + return c.Conn().CopyFrom(ctx, tableName, columnNames, rowSrc) +} + +// Ping acquires a connection from the Pool and executes an empty sql statement against it. +// If the sql returns without error, the database Ping is considered successful, otherwise, the error is returned. +func (p *Pool) Ping(ctx context.Context) error { + c, err := p.Acquire(ctx) + if err != nil { + return err + } + defer c.Release() + return c.Ping(ctx) +} diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/rows.go b/vendor/github.com/jackc/pgx/v5/pgxpool/rows.go new file mode 100644 index 00000000..f834b7ec --- /dev/null +++ b/vendor/github.com/jackc/pgx/v5/pgxpool/rows.go @@ -0,0 +1,116 @@ +package pgxpool + +import ( + "github.com/jackc/pgx/v5" + "github.com/jackc/pgx/v5/pgconn" +) + +type errRows struct { + err error +} + +func (errRows) Close() {} +func (e errRows) Err() error { return e.err } +func (errRows) CommandTag() pgconn.CommandTag { return pgconn.CommandTag{} } +func (errRows) FieldDescriptions() []pgconn.FieldDescription { return nil } +func (errRows) Next() bool { return false } +func (e errRows) Scan(dest ...any) error { return e.err } +func (e errRows) Values() ([]any, error) { return nil, e.err } +func (e errRows) RawValues() [][]byte { return nil } +func (e errRows) Conn() *pgx.Conn { return nil } + +type errRow struct { + err error +} + +func (e errRow) Scan(dest ...any) error { return e.err } + +type poolRows struct { + r pgx.Rows + c *Conn + err error +} + +func (rows *poolRows) Close() { + rows.r.Close() + if rows.c != nil { + rows.c.Release() + rows.c = nil + } +} + +func (rows *poolRows) Err() error { + if rows.err != nil { + return rows.err + } + return rows.r.Err() +} + +func (rows *poolRows) CommandTag() pgconn.CommandTag { + return rows.r.CommandTag() +} + +func (rows *poolRows) FieldDescriptions() []pgconn.FieldDescription { + return rows.r.FieldDescriptions() +} + +func (rows *poolRows) Next() bool { + if rows.err != nil { + return false + } + + n := rows.r.Next() + if !n { + rows.Close() + } + return n +} + +func (rows *poolRows) Scan(dest ...any) error { + err := rows.r.Scan(dest...) + if err != nil { + rows.Close() + } + return err +} + +func (rows *poolRows) Values() ([]any, error) { + values, err := rows.r.Values() + if err != nil { + rows.Close() + } + return values, err +} + +func (rows *poolRows) RawValues() [][]byte { + return rows.r.RawValues() +} + +func (rows *poolRows) Conn() *pgx.Conn { + return rows.r.Conn() +} + +type poolRow struct { + r pgx.Row + c *Conn + err error +} + +func (row *poolRow) Scan(dest ...any) error { + if row.err != nil { + return row.err + } + + panicked := true + defer func() { + if panicked && row.c != nil { + row.c.Release() + } + }() + err := row.r.Scan(dest...) + panicked = false + if row.c != nil { + row.c.Release() + } + return err +} diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/stat.go b/vendor/github.com/jackc/pgx/v5/pgxpool/stat.go new file mode 100644 index 00000000..cfa0c4c5 --- /dev/null +++ b/vendor/github.com/jackc/pgx/v5/pgxpool/stat.go @@ -0,0 +1,84 @@ +package pgxpool + +import ( + "time" + + "github.com/jackc/puddle/v2" +) + +// Stat is a snapshot of Pool statistics. +type Stat struct { + s *puddle.Stat + newConnsCount int64 + lifetimeDestroyCount int64 + idleDestroyCount int64 +} + +// AcquireCount returns the cumulative count of successful acquires from the pool. +func (s *Stat) AcquireCount() int64 { + return s.s.AcquireCount() +} + +// AcquireDuration returns the total duration of all successful acquires from +// the pool. +func (s *Stat) AcquireDuration() time.Duration { + return s.s.AcquireDuration() +} + +// AcquiredConns returns the number of currently acquired connections in the pool. +func (s *Stat) AcquiredConns() int32 { + return s.s.AcquiredResources() +} + +// CanceledAcquireCount returns the cumulative count of acquires from the pool +// that were canceled by a context. +func (s *Stat) CanceledAcquireCount() int64 { + return s.s.CanceledAcquireCount() +} + +// ConstructingConns returns the number of conns with construction in progress in +// the pool. +func (s *Stat) ConstructingConns() int32 { + return s.s.ConstructingResources() +} + +// EmptyAcquireCount returns the cumulative count of successful acquires from the pool +// that waited for a resource to be released or constructed because the pool was +// empty. +func (s *Stat) EmptyAcquireCount() int64 { + return s.s.EmptyAcquireCount() +} + +// IdleConns returns the number of currently idle conns in the pool. +func (s *Stat) IdleConns() int32 { + return s.s.IdleResources() +} + +// MaxConns returns the maximum size of the pool. +func (s *Stat) MaxConns() int32 { + return s.s.MaxResources() +} + +// TotalConns returns the total number of resources currently in the pool. +// The value is the sum of ConstructingConns, AcquiredConns, and +// IdleConns. +func (s *Stat) TotalConns() int32 { + return s.s.TotalResources() +} + +// NewConnsCount returns the cumulative count of new connections opened. +func (s *Stat) NewConnsCount() int64 { + return s.newConnsCount +} + +// MaxLifetimeDestroyCount returns the cumulative count of connections destroyed +// because they exceeded MaxConnLifetime. +func (s *Stat) MaxLifetimeDestroyCount() int64 { + return s.lifetimeDestroyCount +} + +// MaxIdleDestroyCount returns the cumulative count of connections destroyed because +// they exceeded MaxConnIdleTime. +func (s *Stat) MaxIdleDestroyCount() int64 { + return s.idleDestroyCount +} diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/tx.go b/vendor/github.com/jackc/pgx/v5/pgxpool/tx.go new file mode 100644 index 00000000..74df8593 --- /dev/null +++ b/vendor/github.com/jackc/pgx/v5/pgxpool/tx.go @@ -0,0 +1,82 @@ +package pgxpool + +import ( + "context" + + "github.com/jackc/pgx/v5" + "github.com/jackc/pgx/v5/pgconn" +) + +// Tx represents a database transaction acquired from a Pool. +type Tx struct { + t pgx.Tx + c *Conn +} + +// Begin starts a pseudo nested transaction implemented with a savepoint. +func (tx *Tx) Begin(ctx context.Context) (pgx.Tx, error) { + return tx.t.Begin(ctx) +} + +// Commit commits the transaction and returns the associated connection back to the Pool. Commit will return ErrTxClosed +// if the Tx is already closed, but is otherwise safe to call multiple times. If the commit fails with a rollback status +// (e.g. the transaction was already in a broken state) then ErrTxCommitRollback will be returned. +func (tx *Tx) Commit(ctx context.Context) error { + err := tx.t.Commit(ctx) + if tx.c != nil { + tx.c.Release() + tx.c = nil + } + return err +} + +// Rollback rolls back the transaction and returns the associated connection back to the Pool. Rollback will return ErrTxClosed +// if the Tx is already closed, but is otherwise safe to call multiple times. Hence, defer tx.Rollback() is safe even if +// tx.Commit() will be called first in a non-error condition. +func (tx *Tx) Rollback(ctx context.Context) error { + err := tx.t.Rollback(ctx) + if tx.c != nil { + tx.c.Release() + tx.c = nil + } + return err +} + +func (tx *Tx) CopyFrom(ctx context.Context, tableName pgx.Identifier, columnNames []string, rowSrc pgx.CopyFromSource) (int64, error) { + return tx.t.CopyFrom(ctx, tableName, columnNames, rowSrc) +} + +func (tx *Tx) SendBatch(ctx context.Context, b *pgx.Batch) pgx.BatchResults { + return tx.t.SendBatch(ctx, b) +} + +func (tx *Tx) LargeObjects() pgx.LargeObjects { + return tx.t.LargeObjects() +} + +// Prepare creates a prepared statement with name and sql. If the name is empty, +// an anonymous prepared statement will be used. sql can contain placeholders +// for bound parameters. These placeholders are referenced positionally as $1, $2, etc. +// +// Prepare is idempotent; i.e. it is safe to call Prepare multiple times with the same +// name and sql arguments. This allows a code path to Prepare and Query/Exec without +// needing to first check whether the statement has already been prepared. +func (tx *Tx) Prepare(ctx context.Context, name, sql string) (*pgconn.StatementDescription, error) { + return tx.t.Prepare(ctx, name, sql) +} + +func (tx *Tx) Exec(ctx context.Context, sql string, arguments ...any) (pgconn.CommandTag, error) { + return tx.t.Exec(ctx, sql, arguments...) +} + +func (tx *Tx) Query(ctx context.Context, sql string, args ...any) (pgx.Rows, error) { + return tx.t.Query(ctx, sql, args...) +} + +func (tx *Tx) QueryRow(ctx context.Context, sql string, args ...any) pgx.Row { + return tx.t.QueryRow(ctx, sql, args...) +} + +func (tx *Tx) Conn() *pgx.Conn { + return tx.t.Conn() +} diff --git a/vendor/github.com/jackc/pgx/v5/rows.go b/vendor/github.com/jackc/pgx/v5/rows.go index ffe739b0..78ef5326 100644 --- a/vendor/github.com/jackc/pgx/v5/rows.go +++ b/vendor/github.com/jackc/pgx/v5/rows.go @@ -8,7 +8,6 @@ import ( "strings" "time" - "github.com/jackc/pgx/v5/internal/stmtcache" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgtype" ) @@ -17,7 +16,8 @@ import ( // the *Conn can be used again. Rows are closed by explicitly calling Close(), // calling Next() until it returns false, or when a fatal error occurs. // -// Once a Rows is closed the only methods that may be called are Close(), Err(), and CommandTag(). +// Once a Rows is closed the only methods that may be called are Close(), Err(), +// and CommandTag(). // // Rows is an interface instead of a struct to allow tests to mock Query. However, // adding a method to an interface is technically a breaking change. Because of this @@ -28,17 +28,28 @@ type Rows interface { // to call Close after rows is already closed. Close() - // Err returns any error that occurred while reading. + // Err returns any error that occurred while reading. Err must only be called after the Rows is closed (either by + // calling Close or by Next returning false). If it is called early it may return nil even if there was an error + // executing the query. Err() error // CommandTag returns the command tag from this query. It is only available after Rows is closed. CommandTag() pgconn.CommandTag + // FieldDescriptions returns the field descriptions of the columns. It may return nil. In particular this can occur + // when there was an error executing the query. FieldDescriptions() []pgconn.FieldDescription // Next prepares the next row for reading. It returns true if there is another - // row and false if no more rows are available. It automatically closes rows - // when all rows are read. + // row and false if no more rows are available or a fatal error has occurred. + // It automatically closes rows when all rows are read. + // + // Callers should check rows.Err() after rows.Next() returns false to detect + // whether result-set reading ended prematurely due to an error. See + // Conn.Query for details. + // + // For simpler error handling, consider using the higher-level pgx v5 + // CollectRows() and ForEachRow() helpers instead. Next() bool // Scan reads the values from the current row into dest values positionally. @@ -162,14 +173,12 @@ func (rows *baseRows) Close() { } if rows.err != nil && rows.conn != nil && rows.sql != "" { - if stmtcache.IsStatementInvalid(rows.err) { - if sc := rows.conn.statementCache; sc != nil { - sc.Invalidate(rows.sql) - } + if sc := rows.conn.statementCache; sc != nil { + sc.Invalidate(rows.sql) + } - if sc := rows.conn.descriptionCache; sc != nil { - sc.Invalidate(rows.sql) - } + if sc := rows.conn.descriptionCache; sc != nil { + sc.Invalidate(rows.sql) } } @@ -227,7 +236,11 @@ func (rows *baseRows) Scan(dest ...any) error { if len(dest) == 1 { if rc, ok := dest[0].(RowScanner); ok { - return rc.ScanRow(rows) + err := rc.ScanRow(rows) + if err != nil { + rows.fatal(err) + } + return err } } @@ -298,7 +311,7 @@ func (rows *baseRows) Values() ([]any, error) { copy(newBuf, buf) values = append(values, newBuf) default: - rows.fatal(errors.New("Unknown format code")) + rows.fatal(errors.New("unknown format code")) } } @@ -404,12 +417,10 @@ type CollectableRow interface { // RowToFunc is a function that scans or otherwise converts row to a T. type RowToFunc[T any] func(row CollectableRow) (T, error) -// CollectRows iterates through rows, calling fn for each row, and collecting the results into a slice of T. -func CollectRows[T any](rows Rows, fn RowToFunc[T]) ([]T, error) { +// AppendRows iterates through rows, calling fn for each row, and appending the results into a slice of T. +func AppendRows[T any, S ~[]T](slice S, rows Rows, fn RowToFunc[T]) (S, error) { defer rows.Close() - slice := []T{} - for rows.Next() { value, err := fn(rows) if err != nil { @@ -425,6 +436,11 @@ func CollectRows[T any](rows Rows, fn RowToFunc[T]) ([]T, error) { return slice, nil } +// CollectRows iterates through rows, calling fn for each row, and collecting the results into a slice of T. +func CollectRows[T any](rows Rows, fn RowToFunc[T]) ([]T, error) { + return AppendRows([]T{}, rows, fn) +} + // CollectOneRow calls fn for the first row in rows and returns the result. If no rows are found returns an error where errors.Is(ErrNoRows) is true. // CollectOneRow is to CollectRows as QueryRow is to Query. func CollectOneRow[T any](rows Rows, fn RowToFunc[T]) (T, error) { @@ -449,6 +465,39 @@ func CollectOneRow[T any](rows Rows, fn RowToFunc[T]) (T, error) { return value, rows.Err() } +// CollectExactlyOneRow calls fn for the first row in rows and returns the result. +// - If no rows are found returns an error where errors.Is(ErrNoRows) is true. +// - If more than 1 row is found returns an error where errors.Is(ErrTooManyRows) is true. +func CollectExactlyOneRow[T any](rows Rows, fn RowToFunc[T]) (T, error) { + defer rows.Close() + + var ( + err error + value T + ) + + if !rows.Next() { + if err = rows.Err(); err != nil { + return value, err + } + + return value, ErrNoRows + } + + value, err = fn(rows) + if err != nil { + return value, err + } + + if rows.Next() { + var zero T + + return zero, ErrTooManyRows + } + + return value, rows.Err() +} + // RowTo returns a T scanned from row. func RowTo[T any](row CollectableRow) (T, error) { var value T @@ -488,7 +537,8 @@ func (rs *mapRowScanner) ScanRow(rows Rows) error { } // RowToStructByPos returns a T scanned from row. T must be a struct. T must have the same number a public fields as row -// has fields. The row and T fields will by matched by position. +// has fields. The row and T fields will be matched by position. If the "db" struct tag is "-" then the field will be +// ignored. func RowToStructByPos[T any](row CollectableRow) (T, error) { var value T err := row.Scan(&positionalStructRowScanner{ptrToStruct: &value}) @@ -496,7 +546,8 @@ func RowToStructByPos[T any](row CollectableRow) (T, error) { } // RowToAddrOfStructByPos returns the address of a T scanned from row. T must be a struct. T must have the same number a -// public fields as row has fields. The row and T fields will by matched by position. +// public fields as row has fields. The row and T fields will be matched by position. If the "db" struct tag is "-" then +// the field will be ignored. func RowToAddrOfStructByPos[T any](row CollectableRow) (*T, error) { var value T err := row.Scan(&positionalStructRowScanner{ptrToStruct: &value}) @@ -533,13 +584,16 @@ func (rs *positionalStructRowScanner) appendScanTargets(dstElemValue reflect.Val for i := 0; i < dstElemType.NumField(); i++ { sf := dstElemType.Field(i) - if sf.PkgPath == "" { - // Handle anonymous struct embedding, but do not try to handle embedded pointers. - if sf.Anonymous && sf.Type.Kind() == reflect.Struct { - scanTargets = rs.appendScanTargets(dstElemValue.Field(i), scanTargets) - } else { - scanTargets = append(scanTargets, dstElemValue.Field(i).Addr().Interface()) + // Handle anonymous struct embedding, but do not try to handle embedded pointers. + if sf.Anonymous && sf.Type.Kind() == reflect.Struct { + scanTargets = rs.appendScanTargets(dstElemValue.Field(i), scanTargets) + } else if sf.PkgPath == "" { + dbTag, _ := sf.Tag.Lookup(structTagKey) + if dbTag == "-" { + // Field is ignored, skip it. + continue } + scanTargets = append(scanTargets, dstElemValue.Field(i).Addr().Interface()) } } @@ -547,7 +601,7 @@ func (rs *positionalStructRowScanner) appendScanTargets(dstElemValue reflect.Val } // RowToStructByName returns a T scanned from row. T must be a struct. T must have the same number of named public -// fields as row has fields. The row and T fields will by matched by name. The match is case-insensitive. The database +// fields as row has fields. The row and T fields will be matched by name. The match is case-insensitive. The database // column name can be overridden with a "db" struct tag. If the "db" struct tag is "-" then the field will be ignored. func RowToStructByName[T any](row CollectableRow) (T, error) { var value T @@ -556,7 +610,7 @@ func RowToStructByName[T any](row CollectableRow) (T, error) { } // RowToAddrOfStructByName returns the address of a T scanned from row. T must be a struct. T must have the same number -// of named public fields as row has fields. The row and T fields will by matched by name. The match is +// of named public fields as row has fields. The row and T fields will be matched by name. The match is // case-insensitive. The database column name can be overridden with a "db" struct tag. If the "db" struct tag is "-" // then the field will be ignored. func RowToAddrOfStructByName[T any](row CollectableRow) (*T, error) { @@ -565,8 +619,28 @@ func RowToAddrOfStructByName[T any](row CollectableRow) (*T, error) { return &value, err } +// RowToStructByNameLax returns a T scanned from row. T must be a struct. T must have greater than or equal number of named public +// fields as row has fields. The row and T fields will be matched by name. The match is case-insensitive. The database +// column name can be overridden with a "db" struct tag. If the "db" struct tag is "-" then the field will be ignored. +func RowToStructByNameLax[T any](row CollectableRow) (T, error) { + var value T + err := row.Scan(&namedStructRowScanner{ptrToStruct: &value, lax: true}) + return value, err +} + +// RowToAddrOfStructByNameLax returns the address of a T scanned from row. T must be a struct. T must have greater than or +// equal number of named public fields as row has fields. The row and T fields will be matched by name. The match is +// case-insensitive. The database column name can be overridden with a "db" struct tag. If the "db" struct tag is "-" +// then the field will be ignored. +func RowToAddrOfStructByNameLax[T any](row CollectableRow) (*T, error) { + var value T + err := row.Scan(&namedStructRowScanner{ptrToStruct: &value, lax: true}) + return &value, err +} + type namedStructRowScanner struct { ptrToStruct any + lax bool } func (rs *namedStructRowScanner) ScanRow(rows Rows) error { @@ -578,7 +652,6 @@ func (rs *namedStructRowScanner) ScanRow(rows Rows) error { dstElemValue := dstValue.Elem() scanTargets, err := rs.appendScanTargets(dstElemValue, nil, rows.FieldDescriptions()) - if err != nil { return err } @@ -597,7 +670,12 @@ const structTagKey = "db" func fieldPosByName(fldDescs []pgconn.FieldDescription, field string) (i int) { i = -1 for i, desc := range fldDescs { - if strings.EqualFold(desc.Name, field) { + + // Snake case support. + field = strings.ReplaceAll(field, "_", "") + descName := strings.ReplaceAll(desc.Name, "_", "") + + if strings.EqualFold(descName, field) { return i } } @@ -618,7 +696,7 @@ func (rs *namedStructRowScanner) appendScanTargets(dstElemValue reflect.Value, s // Field is unexported, skip it. continue } - // Handle anoymous struct embedding, but do not try to handle embedded pointers. + // Handle anonymous struct embedding, but do not try to handle embedded pointers. if sf.Anonymous && sf.Type.Kind() == reflect.Struct { scanTargets, err = rs.appendScanTargets(dstElemValue.Field(i), scanTargets, fldDescs) if err != nil { @@ -627,7 +705,7 @@ func (rs *namedStructRowScanner) appendScanTargets(dstElemValue reflect.Value, s } else { dbTag, dbTagPresent := sf.Tag.Lookup(structTagKey) if dbTagPresent { - dbTag = strings.Split(dbTag, ",")[0] + dbTag, _, _ = strings.Cut(dbTag, ",") } if dbTag == "-" { // Field is ignored, skip it. @@ -638,7 +716,13 @@ func (rs *namedStructRowScanner) appendScanTargets(dstElemValue reflect.Value, s colName = sf.Name } fpos := fieldPosByName(fldDescs, colName) - if fpos == -1 || fpos >= len(scanTargets) { + if fpos == -1 { + if rs.lax { + continue + } + return nil, fmt.Errorf("cannot find field %s in returned row", colName) + } + if fpos >= len(scanTargets) && !rs.lax { return nil, fmt.Errorf("cannot find field %s in returned row", colName) } scanTargets[fpos] = dstElemValue.Field(i).Addr().Interface() diff --git a/vendor/github.com/jackc/pgx/v5/stdlib/sql.go b/vendor/github.com/jackc/pgx/v5/stdlib/sql.go index 97ecc9b2..3d65e23a 100644 --- a/vendor/github.com/jackc/pgx/v5/stdlib/sql.go +++ b/vendor/github.com/jackc/pgx/v5/stdlib/sql.go @@ -14,12 +14,21 @@ // return err // } // +// Or from a *pgxpool.Pool. +// +// pool, err := pgxpool.New(context.Background(), os.Getenv("DATABASE_URL")) +// if err != nil { +// return err +// } +// +// db := stdlib.OpenDBFromPool(pool) +// // Or a pgx.ConnConfig can be used to set configuration not accessible via connection string. In this case the // pgx.ConnConfig must first be registered with the driver. This registration returns a connection string which is used // with sql.Open. // // connConfig, _ := pgx.ParseConfig(os.Getenv("DATABASE_URL")) -// connConfig.Logger = myLogger +// connConfig.Tracer = &tracelog.TraceLog{Logger: myLogger, LogLevel: tracelog.LogLevelInfo} // connStr := stdlib.RegisterConnConfig(connConfig) // db, _ := sql.Open("pgx", connStr) // @@ -74,6 +83,7 @@ import ( "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgtype" + "github.com/jackc/pgx/v5/pgxpool" ) // Only intrinsic types should be binary format with database/sql. @@ -125,14 +135,14 @@ func contains(list []string, y string) bool { type OptionOpenDB func(*connector) // OptionBeforeConnect provides a callback for before connect. It is passed a shallow copy of the ConnConfig that will -// be used to connect, so only its immediate members should be modified. +// be used to connect, so only its immediate members should be modified. Used only if db is opened with *pgx.ConnConfig. func OptionBeforeConnect(bc func(context.Context, *pgx.ConnConfig) error) OptionOpenDB { return func(dc *connector) { dc.BeforeConnect = bc } } -// OptionAfterConnect provides a callback for after connect. +// OptionAfterConnect provides a callback for after connect. Used only if db is opened with *pgx.ConnConfig. func OptionAfterConnect(ac func(context.Context, *pgx.Conn) error) OptionOpenDB { return func(dc *connector) { dc.AfterConnect = ac @@ -191,13 +201,42 @@ func GetConnector(config pgx.ConnConfig, opts ...OptionOpenDB) driver.Connector return c } +// GetPoolConnector creates a new driver.Connector from the given *pgxpool.Pool. By using this be sure to set the +// maximum idle connections of the *sql.DB created with this connector to zero since they must be managed from the +// *pgxpool.Pool. This is required to avoid acquiring all the connections from the pgxpool and starving any direct +// users of the pgxpool. +func GetPoolConnector(pool *pgxpool.Pool, opts ...OptionOpenDB) driver.Connector { + c := connector{ + pool: pool, + ResetSession: func(context.Context, *pgx.Conn) error { return nil }, // noop reset session by default + driver: pgxDriver, + } + + for _, opt := range opts { + opt(&c) + } + + return c +} + func OpenDB(config pgx.ConnConfig, opts ...OptionOpenDB) *sql.DB { c := GetConnector(config, opts...) return sql.OpenDB(c) } +// OpenDBFromPool creates a new *sql.DB from the given *pgxpool.Pool. Note that this method automatically sets the +// maximum number of idle connections in *sql.DB to zero, since they must be managed from the *pgxpool.Pool. This is +// required to avoid acquiring all the connections from the pgxpool and starving any direct users of the pgxpool. +func OpenDBFromPool(pool *pgxpool.Pool, opts ...OptionOpenDB) *sql.DB { + c := GetPoolConnector(pool, opts...) + db := sql.OpenDB(c) + db.SetMaxIdleConns(0) + return db +} + type connector struct { pgx.ConnConfig + pool *pgxpool.Pool BeforeConnect func(context.Context, *pgx.ConnConfig) error // function to call before creation of every new connection AfterConnect func(context.Context, *pgx.Conn) error // function to call after creation of every new connection ResetSession func(context.Context, *pgx.Conn) error // function is called before a connection is reused @@ -207,25 +246,53 @@ type connector struct { // Connect implement driver.Connector interface func (c connector) Connect(ctx context.Context) (driver.Conn, error) { var ( - err error - conn *pgx.Conn + connConfig pgx.ConnConfig + conn *pgx.Conn + close func(context.Context) error + err error ) - // Create a shallow copy of the config, so that BeforeConnect can safely modify it - connConfig := c.ConnConfig - if err = c.BeforeConnect(ctx, &connConfig); err != nil { - return nil, err - } + if c.pool == nil { + // Create a shallow copy of the config, so that BeforeConnect can safely modify it + connConfig = c.ConnConfig - if conn, err = pgx.ConnectConfig(ctx, &connConfig); err != nil { - return nil, err - } + if err = c.BeforeConnect(ctx, &connConfig); err != nil { + return nil, err + } - if err = c.AfterConnect(ctx, conn); err != nil { - return nil, err + if conn, err = pgx.ConnectConfig(ctx, &connConfig); err != nil { + return nil, err + } + + if err = c.AfterConnect(ctx, conn); err != nil { + return nil, err + } + + close = conn.Close + } else { + var pconn *pgxpool.Conn + + pconn, err = c.pool.Acquire(ctx) + if err != nil { + return nil, err + } + + conn = pconn.Conn() + + close = func(_ context.Context) error { + pconn.Release() + return nil + } } - return &Conn{conn: conn, driver: c.driver, connConfig: connConfig, resetSessionFunc: c.ResetSession}, nil + return &Conn{ + conn: conn, + close: close, + driver: c.driver, + connConfig: connConfig, + resetSessionFunc: c.ResetSession, + psRefCounts: make(map[*pgconn.StatementDescription]int), + }, nil } // Driver implement driver.Connector interface @@ -302,9 +369,11 @@ func (dc *driverConnector) Connect(ctx context.Context) (driver.Conn, error) { c := &Conn{ conn: conn, + close: conn.Close, driver: dc.driver, connConfig: *connConfig, resetSessionFunc: func(context.Context, *pgx.Conn) error { return nil }, + psRefCounts: make(map[*pgconn.StatementDescription]int), } return c, nil @@ -326,11 +395,19 @@ func UnregisterConnConfig(connStr string) { type Conn struct { conn *pgx.Conn - psCount int64 // Counter used for creating unique prepared statement names + close func(context.Context) error driver *Driver connConfig pgx.ConnConfig resetSessionFunc func(context.Context, *pgx.Conn) error // Function is called before a connection is reused lastResetSessionTime time.Time + + // psRefCounts contains reference counts for prepared statements. Prepare uses the underlying pgx logic to generate + // deterministic statement names from the statement text. If this query has already been prepared then the existing + // *pgconn.StatementDescription will be returned. However, this means that if Close is called on the returned Stmt + // then the underlying prepared statement will be closed even when the underlying prepared statement is still in use + // by another database/sql Stmt. To prevent this psRefCounts keeps track of how many database/sql statements are using + // the same underlying statement and only closes the underlying statement when the reference count reaches 0. + psRefCounts map[*pgconn.StatementDescription]int } // Conn returns the underlying *pgx.Conn @@ -347,13 +424,11 @@ func (c *Conn) PrepareContext(ctx context.Context, query string) (driver.Stmt, e return nil, driver.ErrBadConn } - name := fmt.Sprintf("pgx_%d", c.psCount) - c.psCount++ - - sd, err := c.conn.Prepare(ctx, name, query) + sd, err := c.conn.Prepare(ctx, query, query) if err != nil { return nil, err } + c.psRefCounts[sd]++ return &Stmt{sd: sd, conn: c}, nil } @@ -361,7 +436,7 @@ func (c *Conn) PrepareContext(ctx context.Context, query string) (driver.Stmt, e func (c *Conn) Close() error { ctx, cancel := context.WithTimeout(context.Background(), time.Second*5) defer cancel() - return c.conn.Close(ctx) + return c.close(ctx) } func (c *Conn) Begin() (driver.Tx, error) { @@ -470,7 +545,7 @@ func (c *Conn) ResetSession(ctx context.Context) error { now := time.Now() if now.Sub(c.lastResetSessionTime) > time.Second { - if err := c.conn.PgConn().CheckConn(); err != nil { + if err := c.conn.PgConn().Ping(ctx); err != nil { return driver.ErrBadConn } } @@ -487,7 +562,16 @@ type Stmt struct { func (s *Stmt) Close() error { ctx, cancel := context.WithTimeout(context.Background(), time.Second*5) defer cancel() - return s.conn.conn.Deallocate(ctx, s.sd.Name) + + refCount := s.conn.psRefCounts[s.sd] + if refCount == 1 { + delete(s.conn.psRefCounts, s.sd) + } else { + s.conn.psRefCounts[s.sd]-- + return nil + } + + return s.conn.conn.Deallocate(ctx, s.sd.SQL) } func (s *Stmt) NumInput() int { @@ -499,7 +583,7 @@ func (s *Stmt) Exec(argsV []driver.Value) (driver.Result, error) { } func (s *Stmt) ExecContext(ctx context.Context, argsV []driver.NamedValue) (driver.Result, error) { - return s.conn.ExecContext(ctx, s.sd.Name, argsV) + return s.conn.ExecContext(ctx, s.sd.SQL, argsV) } func (s *Stmt) Query(argsV []driver.Value) (driver.Rows, error) { @@ -507,7 +591,7 @@ func (s *Stmt) Query(argsV []driver.Value) (driver.Rows, error) { } func (s *Stmt) QueryContext(ctx context.Context, argsV []driver.NamedValue) (driver.Rows, error) { - return s.conn.QueryContext(ctx, s.sd.Name, argsV) + return s.conn.QueryContext(ctx, s.sd.SQL, argsV) } type rowValueFunc func(src []byte) (driver.Value, error) @@ -753,7 +837,7 @@ func (r *Rows) Next(dest []driver.Value) error { var err error dest[i], err = r.valueFuncs[i](rv) if err != nil { - return fmt.Errorf("convert field %d failed: %v", i, err) + return fmt.Errorf("convert field %d failed: %w", i, err) } } else { dest[i] = nil diff --git a/vendor/github.com/jackc/pgx/v5/tx.go b/vendor/github.com/jackc/pgx/v5/tx.go index e57142a6..8feeb512 100644 --- a/vendor/github.com/jackc/pgx/v5/tx.go +++ b/vendor/github.com/jackc/pgx/v5/tx.go @@ -44,6 +44,10 @@ type TxOptions struct { IsoLevel TxIsoLevel AccessMode TxAccessMode DeferrableMode TxDeferrableMode + + // BeginQuery is the SQL query that will be executed to begin the transaction. This allows using non-standard syntax + // such as BEGIN PRIORITY HIGH with CockroachDB. If set this will override the other settings. + BeginQuery string } var emptyTxOptions TxOptions @@ -53,6 +57,10 @@ func (txOptions TxOptions) beginSQL() string { return "begin" } + if txOptions.BeginQuery != "" { + return txOptions.BeginQuery + } + var buf strings.Builder buf.Grow(64) // 64 - maximum length of string with available options buf.WriteString("begin") @@ -144,7 +152,6 @@ type Tx interface { // called on the dbTx. type dbTx struct { conn *Conn - err error savepointNum int64 closed bool } diff --git a/vendor/github.com/jackc/pgx/v5/values.go b/vendor/github.com/jackc/pgx/v5/values.go index 19c642fa..cab717d0 100644 --- a/vendor/github.com/jackc/pgx/v5/values.go +++ b/vendor/github.com/jackc/pgx/v5/values.go @@ -55,7 +55,11 @@ func encodeCopyValue(m *pgtype.Map, buf []byte, oid uint32, arg any) ([]byte, er func tryScanStringCopyValueThenEncode(m *pgtype.Map, buf []byte, oid uint32, arg any) ([]byte, error) { s, ok := arg.(string) if !ok { - return nil, errors.New("not a string") + textBuf, err := m.Encode(oid, TextFormatCode, arg, nil) + if err != nil { + return nil, errors.New("not a string and cannot be encoded as text") + } + s = string(textBuf) } var v any diff --git a/vendor/github.com/jackc/puddle/v2/CHANGELOG.md b/vendor/github.com/jackc/puddle/v2/CHANGELOG.md new file mode 100644 index 00000000..a15991c5 --- /dev/null +++ b/vendor/github.com/jackc/puddle/v2/CHANGELOG.md @@ -0,0 +1,74 @@ +# 2.2.1 (July 15, 2023) + +* Fix: CreateResource cannot overflow pool. This changes documented behavior of CreateResource. Previously, + CreateResource could create a resource even if the pool was full. This could cause the pool to overflow. While this + was documented, it was documenting incorrect behavior. CreateResource now returns an error if the pool is full. + +# 2.2.0 (February 11, 2023) + +* Use Go 1.19 atomics and drop go.uber.org/atomic dependency + +# 2.1.2 (November 12, 2022) + +* Restore support to Go 1.18 via go.uber.org/atomic + +# 2.1.1 (November 11, 2022) + +* Fix create resource concurrently with Stat call race + +# 2.1.0 (October 28, 2022) + +* Concurrency control is now implemented with a semaphore. This simplifies some internal logic, resolves a few error conditions (including a deadlock), and improves performance. (Jan Dubsky) +* Go 1.19 is now required for the improved atomic support. + +# 2.0.1 (October 28, 2022) + +* Fix race condition when Close is called concurrently with multiple constructors + +# 2.0.0 (September 17, 2022) + +* Use generics instead of interface{} (Столяров Владимир Алексеевич) +* Add Reset +* Do not cancel resource construction when Acquire is canceled +* NewPool takes Config + +# 1.3.0 (August 27, 2022) + +* Acquire creates resources in background to allow creation to continue after Acquire is canceled (James Hartig) + +# 1.2.1 (December 2, 2021) + +* TryAcquire now does not block when background constructing resource + +# 1.2.0 (November 20, 2021) + +* Add TryAcquire (A. Jensen) +* Fix: remove memory leak / unintentionally pinned memory when shrinking slices (Alexander Staubo) +* Fix: Do not leave pool locked after panic from nil context + +# 1.1.4 (September 11, 2021) + +* Fix: Deadlock in CreateResource if pool was closed during resource acquisition (Dmitriy Matrenichev) + +# 1.1.3 (December 3, 2020) + +* Fix: Failed resource creation could cause concurrent Acquire to hang. (Evgeny Vanslov) + +# 1.1.2 (September 26, 2020) + +* Fix: Resource.Destroy no longer removes itself from the pool before its destructor has completed. +* Fix: Prevent crash when pool is closed while resource is being created. + +# 1.1.1 (April 2, 2020) + +* Pool.Close can be safely called multiple times +* AcquireAllIDle immediately returns nil if pool is closed +* CreateResource checks if pool is closed before taking any action +* Fix potential race condition when CreateResource and Close are called concurrently. CreateResource now checks if pool is closed before adding newly created resource to pool. + +# 1.1.0 (February 5, 2020) + +* Use runtime.nanotime for faster tracking of acquire time and last usage time. +* Track resource idle time to enable client health check logic. (Patrick Ellul) +* Add CreateResource to construct a new resource without acquiring it. (Patrick Ellul) +* Fix deadlock race when acquire is cancelled. (Michael Tharp) diff --git a/vendor/github.com/jackc/puddle/v2/LICENSE b/vendor/github.com/jackc/puddle/v2/LICENSE new file mode 100644 index 00000000..bcc286c5 --- /dev/null +++ b/vendor/github.com/jackc/puddle/v2/LICENSE @@ -0,0 +1,22 @@ +Copyright (c) 2018 Jack Christensen + +MIT License + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/vendor/github.com/jackc/puddle/v2/README.md b/vendor/github.com/jackc/puddle/v2/README.md new file mode 100644 index 00000000..0ad07ec4 --- /dev/null +++ b/vendor/github.com/jackc/puddle/v2/README.md @@ -0,0 +1,80 @@ +[![](https://godoc.org/github.com/jackc/puddle?status.svg)](https://godoc.org/github.com/jackc/puddle) +![Build Status](https://github.com/jackc/puddle/actions/workflows/ci.yml/badge.svg) + +# Puddle + +Puddle is a tiny generic resource pool library for Go that uses the standard +context library to signal cancellation of acquires. It is designed to contain +the minimum functionality required for a resource pool. It can be used directly +or it can be used as the base for a domain specific resource pool. For example, +a database connection pool may use puddle internally and implement health checks +and keep-alive behavior without needing to implement any concurrent code of its +own. + +## Features + +* Acquire cancellation via context standard library +* Statistics API for monitoring pool pressure +* No dependencies outside of standard library and golang.org/x/sync +* High performance +* 100% test coverage of reachable code + +## Example Usage + +```go +package main + +import ( + "context" + "log" + "net" + + "github.com/jackc/puddle/v2" +) + +func main() { + constructor := func(context.Context) (net.Conn, error) { + return net.Dial("tcp", "127.0.0.1:8080") + } + destructor := func(value net.Conn) { + value.Close() + } + maxPoolSize := int32(10) + + pool, err := puddle.NewPool(&puddle.Config[net.Conn]{Constructor: constructor, Destructor: destructor, MaxSize: maxPoolSize}) + if err != nil { + log.Fatal(err) + } + + // Acquire resource from the pool. + res, err := pool.Acquire(context.Background()) + if err != nil { + log.Fatal(err) + } + + // Use resource. + _, err = res.Value().Write([]byte{1}) + if err != nil { + log.Fatal(err) + } + + // Release when done. + res.Release() +} +``` + +## Status + +Puddle is stable and feature complete. + +* Bug reports and fixes are welcome. +* New features will usually not be accepted if they can be feasibly implemented in a wrapper. +* Performance optimizations will usually not be accepted unless the performance issue rises to the level of a bug. + +## Supported Go Versions + +puddle supports the same versions of Go that are supported by the Go project. For [Go](https://golang.org/doc/devel/release.html#policy) that is the two most recent major releases. This means puddle supports Go 1.19 and higher. + +## License + +MIT diff --git a/vendor/github.com/jackc/puddle/v2/context.go b/vendor/github.com/jackc/puddle/v2/context.go new file mode 100644 index 00000000..e19d2a60 --- /dev/null +++ b/vendor/github.com/jackc/puddle/v2/context.go @@ -0,0 +1,24 @@ +package puddle + +import ( + "context" + "time" +) + +// valueCancelCtx combines two contexts into one. One context is used for values and the other is used for cancellation. +type valueCancelCtx struct { + valueCtx context.Context + cancelCtx context.Context +} + +func (ctx *valueCancelCtx) Deadline() (time.Time, bool) { return ctx.cancelCtx.Deadline() } +func (ctx *valueCancelCtx) Done() <-chan struct{} { return ctx.cancelCtx.Done() } +func (ctx *valueCancelCtx) Err() error { return ctx.cancelCtx.Err() } +func (ctx *valueCancelCtx) Value(key any) any { return ctx.valueCtx.Value(key) } + +func newValueCancelCtx(valueCtx, cancelContext context.Context) context.Context { + return &valueCancelCtx{ + valueCtx: valueCtx, + cancelCtx: cancelContext, + } +} diff --git a/vendor/github.com/jackc/puddle/v2/doc.go b/vendor/github.com/jackc/puddle/v2/doc.go new file mode 100644 index 00000000..818e4a69 --- /dev/null +++ b/vendor/github.com/jackc/puddle/v2/doc.go @@ -0,0 +1,11 @@ +// Package puddle is a generic resource pool with type-parametrized api. +/* + +Puddle is a tiny generic resource pool library for Go that uses the standard +context library to signal cancellation of acquires. It is designed to contain +the minimum functionality a resource pool needs that cannot be implemented +without concurrency concerns. For example, a database connection pool may use +puddle internally and implement health checks and keep-alive behavior without +needing to implement any concurrent code of its own. +*/ +package puddle diff --git a/vendor/github.com/jackc/puddle/v2/internal/genstack/gen_stack.go b/vendor/github.com/jackc/puddle/v2/internal/genstack/gen_stack.go new file mode 100644 index 00000000..7e4660c8 --- /dev/null +++ b/vendor/github.com/jackc/puddle/v2/internal/genstack/gen_stack.go @@ -0,0 +1,85 @@ +package genstack + +// GenStack implements a generational stack. +// +// GenStack works as common stack except for the fact that all elements in the +// older generation are guaranteed to be popped before any element in the newer +// generation. New elements are always pushed to the current (newest) +// generation. +// +// We could also say that GenStack behaves as a stack in case of a single +// generation, but it behaves as a queue of individual generation stacks. +type GenStack[T any] struct { + // We can represent arbitrary number of generations using 2 stacks. The + // new stack stores all new pushes and the old stack serves all reads. + // Old stack can represent multiple generations. If old == new, then all + // elements pushed in previous (not current) generations have already + // been popped. + + old *stack[T] + new *stack[T] +} + +// NewGenStack creates a new empty GenStack. +func NewGenStack[T any]() *GenStack[T] { + s := &stack[T]{} + return &GenStack[T]{ + old: s, + new: s, + } +} + +func (s *GenStack[T]) Pop() (T, bool) { + // Pushes always append to the new stack, so if the old once becomes + // empty, it will remail empty forever. + if s.old.len() == 0 && s.old != s.new { + s.old = s.new + } + + if s.old.len() == 0 { + var zero T + return zero, false + } + + return s.old.pop(), true +} + +// Push pushes a new element at the top of the stack. +func (s *GenStack[T]) Push(v T) { s.new.push(v) } + +// NextGen starts a new stack generation. +func (s *GenStack[T]) NextGen() { + if s.old == s.new { + s.new = &stack[T]{} + return + } + + // We need to pop from the old stack to the top of the new stack. Let's + // have an example: + // + // Old: 4 3 2 1 + // New: 8 7 6 5 + // PopOrder: 1 2 3 4 5 6 7 8 + // + // + // To preserve pop order, we have to take all elements from the old + // stack and push them to the top of new stack: + // + // New: 8 7 6 5 4 3 2 1 + // + s.new.push(s.old.takeAll()...) + + // We have the old stack allocated and empty, so why not to reuse it as + // new new stack. + s.old, s.new = s.new, s.old +} + +// Len returns number of elements in the stack. +func (s *GenStack[T]) Len() int { + l := s.old.len() + if s.old != s.new { + l += s.new.len() + } + + return l +} diff --git a/vendor/github.com/jackc/puddle/v2/internal/genstack/stack.go b/vendor/github.com/jackc/puddle/v2/internal/genstack/stack.go new file mode 100644 index 00000000..dbced0c7 --- /dev/null +++ b/vendor/github.com/jackc/puddle/v2/internal/genstack/stack.go @@ -0,0 +1,39 @@ +package genstack + +// stack is a wrapper around an array implementing a stack. +// +// We cannot use slice to represent the stack because append might change the +// pointer value of the slice. That would be an issue in GenStack +// implementation. +type stack[T any] struct { + arr []T +} + +// push pushes a new element at the top of a stack. +func (s *stack[T]) push(vs ...T) { s.arr = append(s.arr, vs...) } + +// pop pops the stack top-most element. +// +// If stack length is zero, this method panics. +func (s *stack[T]) pop() T { + idx := s.len() - 1 + val := s.arr[idx] + + // Avoid memory leak + var zero T + s.arr[idx] = zero + + s.arr = s.arr[:idx] + return val +} + +// takeAll returns all elements in the stack in order as they are stored - i.e. +// the top-most stack element is the last one. +func (s *stack[T]) takeAll() []T { + arr := s.arr + s.arr = nil + return arr +} + +// len returns number of elements in the stack. +func (s *stack[T]) len() int { return len(s.arr) } diff --git a/vendor/github.com/jackc/puddle/v2/log.go b/vendor/github.com/jackc/puddle/v2/log.go new file mode 100644 index 00000000..b21b9463 --- /dev/null +++ b/vendor/github.com/jackc/puddle/v2/log.go @@ -0,0 +1,32 @@ +package puddle + +import "unsafe" + +type ints interface { + int | int8 | int16 | int32 | int64 | uint | uint8 | uint16 | uint32 | uint64 +} + +// log2Int returns log2 of an integer. This function panics if val < 0. For val +// == 0, returns 0. +func log2Int[T ints](val T) uint8 { + if val <= 0 { + panic("log2 of non-positive number does not exist") + } + + return log2IntRange(val, 0, uint8(8*unsafe.Sizeof(val))) +} + +func log2IntRange[T ints](val T, begin, end uint8) uint8 { + length := end - begin + if length == 1 { + return begin + } + + delim := begin + length/2 + mask := T(1) << delim + if mask > val { + return log2IntRange(val, begin, delim) + } else { + return log2IntRange(val, delim, end) + } +} diff --git a/vendor/github.com/jackc/puddle/v2/nanotime_time.go b/vendor/github.com/jackc/puddle/v2/nanotime_time.go new file mode 100644 index 00000000..f8e75938 --- /dev/null +++ b/vendor/github.com/jackc/puddle/v2/nanotime_time.go @@ -0,0 +1,13 @@ +//go:build purego || appengine || js + +// This file contains the safe implementation of nanotime using time.Now(). + +package puddle + +import ( + "time" +) + +func nanotime() int64 { + return time.Now().UnixNano() +} diff --git a/vendor/github.com/jackc/puddle/v2/nanotime_unsafe.go b/vendor/github.com/jackc/puddle/v2/nanotime_unsafe.go new file mode 100644 index 00000000..fc3b8a25 --- /dev/null +++ b/vendor/github.com/jackc/puddle/v2/nanotime_unsafe.go @@ -0,0 +1,12 @@ +//go:build !purego && !appengine && !js + +// This file contains the implementation of nanotime using runtime.nanotime. + +package puddle + +import "unsafe" + +var _ = unsafe.Sizeof(0) + +//go:linkname nanotime runtime.nanotime +func nanotime() int64 diff --git a/vendor/github.com/jackc/puddle/v2/pool.go b/vendor/github.com/jackc/puddle/v2/pool.go new file mode 100644 index 00000000..c8edc0fb --- /dev/null +++ b/vendor/github.com/jackc/puddle/v2/pool.go @@ -0,0 +1,696 @@ +package puddle + +import ( + "context" + "errors" + "sync" + "sync/atomic" + "time" + + "github.com/jackc/puddle/v2/internal/genstack" + "golang.org/x/sync/semaphore" +) + +const ( + resourceStatusConstructing = 0 + resourceStatusIdle = iota + resourceStatusAcquired = iota + resourceStatusHijacked = iota +) + +// ErrClosedPool occurs on an attempt to acquire a connection from a closed pool +// or a pool that is closed while the acquire is waiting. +var ErrClosedPool = errors.New("closed pool") + +// ErrNotAvailable occurs on an attempt to acquire a resource from a pool +// that is at maximum capacity and has no available resources. +var ErrNotAvailable = errors.New("resource not available") + +// Constructor is a function called by the pool to construct a resource. +type Constructor[T any] func(ctx context.Context) (res T, err error) + +// Destructor is a function called by the pool to destroy a resource. +type Destructor[T any] func(res T) + +// Resource is the resource handle returned by acquiring from the pool. +type Resource[T any] struct { + value T + pool *Pool[T] + creationTime time.Time + lastUsedNano int64 + poolResetCount int + status byte +} + +// Value returns the resource value. +func (res *Resource[T]) Value() T { + if !(res.status == resourceStatusAcquired || res.status == resourceStatusHijacked) { + panic("tried to access resource that is not acquired or hijacked") + } + return res.value +} + +// Release returns the resource to the pool. res must not be subsequently used. +func (res *Resource[T]) Release() { + if res.status != resourceStatusAcquired { + panic("tried to release resource that is not acquired") + } + res.pool.releaseAcquiredResource(res, nanotime()) +} + +// ReleaseUnused returns the resource to the pool without updating when it was last used used. i.e. LastUsedNanotime +// will not change. res must not be subsequently used. +func (res *Resource[T]) ReleaseUnused() { + if res.status != resourceStatusAcquired { + panic("tried to release resource that is not acquired") + } + res.pool.releaseAcquiredResource(res, res.lastUsedNano) +} + +// Destroy returns the resource to the pool for destruction. res must not be +// subsequently used. +func (res *Resource[T]) Destroy() { + if res.status != resourceStatusAcquired { + panic("tried to destroy resource that is not acquired") + } + go res.pool.destroyAcquiredResource(res) +} + +// Hijack assumes ownership of the resource from the pool. Caller is responsible +// for cleanup of resource value. +func (res *Resource[T]) Hijack() { + if res.status != resourceStatusAcquired { + panic("tried to hijack resource that is not acquired") + } + res.pool.hijackAcquiredResource(res) +} + +// CreationTime returns when the resource was created by the pool. +func (res *Resource[T]) CreationTime() time.Time { + if !(res.status == resourceStatusAcquired || res.status == resourceStatusHijacked) { + panic("tried to access resource that is not acquired or hijacked") + } + return res.creationTime +} + +// LastUsedNanotime returns when Release was last called on the resource measured in nanoseconds from an arbitrary time +// (a monotonic time). Returns creation time if Release has never been called. This is only useful to compare with +// other calls to LastUsedNanotime. In almost all cases, IdleDuration should be used instead. +func (res *Resource[T]) LastUsedNanotime() int64 { + if !(res.status == resourceStatusAcquired || res.status == resourceStatusHijacked) { + panic("tried to access resource that is not acquired or hijacked") + } + + return res.lastUsedNano +} + +// IdleDuration returns the duration since Release was last called on the resource. This is equivalent to subtracting +// LastUsedNanotime to the current nanotime. +func (res *Resource[T]) IdleDuration() time.Duration { + if !(res.status == resourceStatusAcquired || res.status == resourceStatusHijacked) { + panic("tried to access resource that is not acquired or hijacked") + } + + return time.Duration(nanotime() - res.lastUsedNano) +} + +// Pool is a concurrency-safe resource pool. +type Pool[T any] struct { + // mux is the pool internal lock. Any modification of shared state of + // the pool (but Acquires of acquireSem) must be performed only by + // holder of the lock. Long running operations are not allowed when mux + // is held. + mux sync.Mutex + // acquireSem provides an allowance to acquire a resource. + // + // Releases are allowed only when caller holds mux. Acquires have to + // happen before mux is locked (doesn't apply to semaphore.TryAcquire in + // AcquireAllIdle). + acquireSem *semaphore.Weighted + destructWG sync.WaitGroup + + allResources resList[T] + idleResources *genstack.GenStack[*Resource[T]] + + constructor Constructor[T] + destructor Destructor[T] + maxSize int32 + + acquireCount int64 + acquireDuration time.Duration + emptyAcquireCount int64 + canceledAcquireCount atomic.Int64 + + resetCount int + + baseAcquireCtx context.Context + cancelBaseAcquireCtx context.CancelFunc + closed bool +} + +type Config[T any] struct { + Constructor Constructor[T] + Destructor Destructor[T] + MaxSize int32 +} + +// NewPool creates a new pool. Panics if maxSize is less than 1. +func NewPool[T any](config *Config[T]) (*Pool[T], error) { + if config.MaxSize < 1 { + return nil, errors.New("MaxSize must be >= 1") + } + + baseAcquireCtx, cancelBaseAcquireCtx := context.WithCancel(context.Background()) + + return &Pool[T]{ + acquireSem: semaphore.NewWeighted(int64(config.MaxSize)), + idleResources: genstack.NewGenStack[*Resource[T]](), + maxSize: config.MaxSize, + constructor: config.Constructor, + destructor: config.Destructor, + baseAcquireCtx: baseAcquireCtx, + cancelBaseAcquireCtx: cancelBaseAcquireCtx, + }, nil +} + +// Close destroys all resources in the pool and rejects future Acquire calls. +// Blocks until all resources are returned to pool and destroyed. +func (p *Pool[T]) Close() { + defer p.destructWG.Wait() + + p.mux.Lock() + defer p.mux.Unlock() + + if p.closed { + return + } + p.closed = true + p.cancelBaseAcquireCtx() + + for res, ok := p.idleResources.Pop(); ok; res, ok = p.idleResources.Pop() { + p.allResources.remove(res) + go p.destructResourceValue(res.value) + } +} + +// Stat is a snapshot of Pool statistics. +type Stat struct { + constructingResources int32 + acquiredResources int32 + idleResources int32 + maxResources int32 + acquireCount int64 + acquireDuration time.Duration + emptyAcquireCount int64 + canceledAcquireCount int64 +} + +// TotalResources returns the total number of resources currently in the pool. +// The value is the sum of ConstructingResources, AcquiredResources, and +// IdleResources. +func (s *Stat) TotalResources() int32 { + return s.constructingResources + s.acquiredResources + s.idleResources +} + +// ConstructingResources returns the number of resources with construction in progress in +// the pool. +func (s *Stat) ConstructingResources() int32 { + return s.constructingResources +} + +// AcquiredResources returns the number of currently acquired resources in the pool. +func (s *Stat) AcquiredResources() int32 { + return s.acquiredResources +} + +// IdleResources returns the number of currently idle resources in the pool. +func (s *Stat) IdleResources() int32 { + return s.idleResources +} + +// MaxResources returns the maximum size of the pool. +func (s *Stat) MaxResources() int32 { + return s.maxResources +} + +// AcquireCount returns the cumulative count of successful acquires from the pool. +func (s *Stat) AcquireCount() int64 { + return s.acquireCount +} + +// AcquireDuration returns the total duration of all successful acquires from +// the pool. +func (s *Stat) AcquireDuration() time.Duration { + return s.acquireDuration +} + +// EmptyAcquireCount returns the cumulative count of successful acquires from the pool +// that waited for a resource to be released or constructed because the pool was +// empty. +func (s *Stat) EmptyAcquireCount() int64 { + return s.emptyAcquireCount +} + +// CanceledAcquireCount returns the cumulative count of acquires from the pool +// that were canceled by a context. +func (s *Stat) CanceledAcquireCount() int64 { + return s.canceledAcquireCount +} + +// Stat returns the current pool statistics. +func (p *Pool[T]) Stat() *Stat { + p.mux.Lock() + defer p.mux.Unlock() + + s := &Stat{ + maxResources: p.maxSize, + acquireCount: p.acquireCount, + emptyAcquireCount: p.emptyAcquireCount, + canceledAcquireCount: p.canceledAcquireCount.Load(), + acquireDuration: p.acquireDuration, + } + + for _, res := range p.allResources { + switch res.status { + case resourceStatusConstructing: + s.constructingResources += 1 + case resourceStatusIdle: + s.idleResources += 1 + case resourceStatusAcquired: + s.acquiredResources += 1 + } + } + + return s +} + +// tryAcquireIdleResource checks if there is any idle resource. If there is +// some, this method removes it from idle list and returns it. If the idle pool +// is empty, this method returns nil and doesn't modify the idleResources slice. +// +// WARNING: Caller of this method must hold the pool mutex! +func (p *Pool[T]) tryAcquireIdleResource() *Resource[T] { + res, ok := p.idleResources.Pop() + if !ok { + return nil + } + + res.status = resourceStatusAcquired + return res +} + +// createNewResource creates a new resource and inserts it into list of pool +// resources. +// +// WARNING: Caller of this method must hold the pool mutex! +func (p *Pool[T]) createNewResource() *Resource[T] { + res := &Resource[T]{ + pool: p, + creationTime: time.Now(), + lastUsedNano: nanotime(), + poolResetCount: p.resetCount, + status: resourceStatusConstructing, + } + + p.allResources.append(res) + p.destructWG.Add(1) + + return res +} + +// Acquire gets a resource from the pool. If no resources are available and the pool is not at maximum capacity it will +// create a new resource. If the pool is at maximum capacity it will block until a resource is available. ctx can be +// used to cancel the Acquire. +// +// If Acquire creates a new resource the resource constructor function will receive a context that delegates Value() to +// ctx. Canceling ctx will cause Acquire to return immediately but it will not cancel the resource creation. This avoids +// the problem of it being impossible to create resources when the time to create a resource is greater than any one +// caller of Acquire is willing to wait. +func (p *Pool[T]) Acquire(ctx context.Context) (_ *Resource[T], err error) { + select { + case <-ctx.Done(): + p.canceledAcquireCount.Add(1) + return nil, ctx.Err() + default: + } + + return p.acquire(ctx) +} + +// acquire is a continuation of Acquire function that doesn't check context +// validity. +// +// This function exists solely only for benchmarking purposes. +func (p *Pool[T]) acquire(ctx context.Context) (*Resource[T], error) { + startNano := nanotime() + + var waitedForLock bool + if !p.acquireSem.TryAcquire(1) { + waitedForLock = true + err := p.acquireSem.Acquire(ctx, 1) + if err != nil { + p.canceledAcquireCount.Add(1) + return nil, err + } + } + + p.mux.Lock() + if p.closed { + p.acquireSem.Release(1) + p.mux.Unlock() + return nil, ErrClosedPool + } + + // If a resource is available in the pool. + if res := p.tryAcquireIdleResource(); res != nil { + if waitedForLock { + p.emptyAcquireCount += 1 + } + p.acquireCount += 1 + p.acquireDuration += time.Duration(nanotime() - startNano) + p.mux.Unlock() + return res, nil + } + + if len(p.allResources) >= int(p.maxSize) { + // Unreachable code. + panic("bug: semaphore allowed more acquires than pool allows") + } + + // The resource is not idle, but there is enough space to create one. + res := p.createNewResource() + p.mux.Unlock() + + res, err := p.initResourceValue(ctx, res) + if err != nil { + return nil, err + } + + p.mux.Lock() + defer p.mux.Unlock() + + p.emptyAcquireCount += 1 + p.acquireCount += 1 + p.acquireDuration += time.Duration(nanotime() - startNano) + + return res, nil +} + +func (p *Pool[T]) initResourceValue(ctx context.Context, res *Resource[T]) (*Resource[T], error) { + // Create the resource in a goroutine to immediately return from Acquire + // if ctx is canceled without also canceling the constructor. + // + // See: + // - https://github.com/jackc/pgx/issues/1287 + // - https://github.com/jackc/pgx/issues/1259 + constructErrChan := make(chan error) + go func() { + constructorCtx := newValueCancelCtx(ctx, p.baseAcquireCtx) + value, err := p.constructor(constructorCtx) + if err != nil { + p.mux.Lock() + p.allResources.remove(res) + p.destructWG.Done() + + // The resource won't be acquired because its + // construction failed. We have to allow someone else to + // take that resouce. + p.acquireSem.Release(1) + p.mux.Unlock() + + select { + case constructErrChan <- err: + case <-ctx.Done(): + // The caller is cancelled, so no-one awaits the + // error. This branch avoid goroutine leak. + } + return + } + + // The resource is already in p.allResources where it might be read. So we need to acquire the lock to update its + // status. + p.mux.Lock() + res.value = value + res.status = resourceStatusAcquired + p.mux.Unlock() + + // This select works because the channel is unbuffered. + select { + case constructErrChan <- nil: + case <-ctx.Done(): + p.releaseAcquiredResource(res, res.lastUsedNano) + } + }() + + select { + case <-ctx.Done(): + p.canceledAcquireCount.Add(1) + return nil, ctx.Err() + case err := <-constructErrChan: + if err != nil { + return nil, err + } + return res, nil + } +} + +// TryAcquire gets a resource from the pool if one is immediately available. If not, it returns ErrNotAvailable. If no +// resources are available but the pool has room to grow, a resource will be created in the background. ctx is only +// used to cancel the background creation. +func (p *Pool[T]) TryAcquire(ctx context.Context) (*Resource[T], error) { + if !p.acquireSem.TryAcquire(1) { + return nil, ErrNotAvailable + } + + p.mux.Lock() + defer p.mux.Unlock() + + if p.closed { + p.acquireSem.Release(1) + return nil, ErrClosedPool + } + + // If a resource is available now + if res := p.tryAcquireIdleResource(); res != nil { + p.acquireCount += 1 + return res, nil + } + + if len(p.allResources) >= int(p.maxSize) { + // Unreachable code. + panic("bug: semaphore allowed more acquires than pool allows") + } + + res := p.createNewResource() + go func() { + value, err := p.constructor(ctx) + + p.mux.Lock() + defer p.mux.Unlock() + // We have to create the resource and only then release the + // semaphore - For the time being there is no resource that + // someone could acquire. + defer p.acquireSem.Release(1) + + if err != nil { + p.allResources.remove(res) + p.destructWG.Done() + return + } + + res.value = value + res.status = resourceStatusIdle + p.idleResources.Push(res) + }() + + return nil, ErrNotAvailable +} + +// acquireSemAll tries to acquire num free tokens from sem. This function is +// guaranteed to acquire at least the lowest number of tokens that has been +// available in the semaphore during runtime of this function. +// +// For the time being, semaphore doesn't allow to acquire all tokens atomically +// (see https://github.com/golang/sync/pull/19). We simulate this by trying all +// powers of 2 that are less or equal to num. +// +// For example, let's immagine we have 19 free tokens in the semaphore which in +// total has 24 tokens (i.e. the maxSize of the pool is 24 resources). Then if +// num is 24, the log2Uint(24) is 4 and we try to acquire 16, 8, 4, 2 and 1 +// tokens. Out of those, the acquire of 16, 2 and 1 tokens will succeed. +// +// Naturally, Acquires and Releases of the semaphore might take place +// concurrently. For this reason, it's not guaranteed that absolutely all free +// tokens in the semaphore will be acquired. But it's guaranteed that at least +// the minimal number of tokens that has been present over the whole process +// will be acquired. This is sufficient for the use-case we have in this +// package. +// +// TODO: Replace this with acquireSem.TryAcquireAll() if it gets to +// upstream. https://github.com/golang/sync/pull/19 +func acquireSemAll(sem *semaphore.Weighted, num int) int { + if sem.TryAcquire(int64(num)) { + return num + } + + var acquired int + for i := int(log2Int(num)); i >= 0; i-- { + val := 1 << i + if sem.TryAcquire(int64(val)) { + acquired += val + } + } + + return acquired +} + +// AcquireAllIdle acquires all currently idle resources. Its intended use is for +// health check and keep-alive functionality. It does not update pool +// statistics. +func (p *Pool[T]) AcquireAllIdle() []*Resource[T] { + p.mux.Lock() + defer p.mux.Unlock() + + if p.closed { + return nil + } + + numIdle := p.idleResources.Len() + if numIdle == 0 { + return nil + } + + // In acquireSemAll we use only TryAcquire and not Acquire. Because + // TryAcquire cannot block, the fact that we hold mutex locked and try + // to acquire semaphore cannot result in dead-lock. + // + // Because the mutex is locked, no parallel Release can run. This + // implies that the number of tokens can only decrease because some + // Acquire/TryAcquire call can consume the semaphore token. Consequently + // acquired is always less or equal to numIdle. Moreover if acquired < + // numIdle, then there are some parallel Acquire/TryAcquire calls that + // will take the remaining idle connections. + acquired := acquireSemAll(p.acquireSem, numIdle) + + idle := make([]*Resource[T], acquired) + for i := range idle { + res, _ := p.idleResources.Pop() + res.status = resourceStatusAcquired + idle[i] = res + } + + // We have to bump the generation to ensure that Acquire/TryAcquire + // calls running in parallel (those which caused acquired < numIdle) + // will consume old connections and not freshly released connections + // instead. + p.idleResources.NextGen() + + return idle +} + +// CreateResource constructs a new resource without acquiring it. It goes straight in the IdlePool. If the pool is full +// it returns an error. It can be useful to maintain warm resources under little load. +func (p *Pool[T]) CreateResource(ctx context.Context) error { + if !p.acquireSem.TryAcquire(1) { + return ErrNotAvailable + } + + p.mux.Lock() + if p.closed { + p.acquireSem.Release(1) + p.mux.Unlock() + return ErrClosedPool + } + + if len(p.allResources) >= int(p.maxSize) { + p.acquireSem.Release(1) + p.mux.Unlock() + return ErrNotAvailable + } + + res := p.createNewResource() + p.mux.Unlock() + + value, err := p.constructor(ctx) + p.mux.Lock() + defer p.mux.Unlock() + defer p.acquireSem.Release(1) + if err != nil { + p.allResources.remove(res) + p.destructWG.Done() + return err + } + + res.value = value + res.status = resourceStatusIdle + + // If closed while constructing resource then destroy it and return an error + if p.closed { + go p.destructResourceValue(res.value) + return ErrClosedPool + } + + p.idleResources.Push(res) + + return nil +} + +// Reset destroys all resources, but leaves the pool open. It is intended for use when an error is detected that would +// disrupt all resources (such as a network interruption or a server state change). +// +// It is safe to reset a pool while resources are checked out. Those resources will be destroyed when they are returned +// to the pool. +func (p *Pool[T]) Reset() { + p.mux.Lock() + defer p.mux.Unlock() + + p.resetCount++ + + for res, ok := p.idleResources.Pop(); ok; res, ok = p.idleResources.Pop() { + p.allResources.remove(res) + go p.destructResourceValue(res.value) + } +} + +// releaseAcquiredResource returns res to the the pool. +func (p *Pool[T]) releaseAcquiredResource(res *Resource[T], lastUsedNano int64) { + p.mux.Lock() + defer p.mux.Unlock() + defer p.acquireSem.Release(1) + + if p.closed || res.poolResetCount != p.resetCount { + p.allResources.remove(res) + go p.destructResourceValue(res.value) + } else { + res.lastUsedNano = lastUsedNano + res.status = resourceStatusIdle + p.idleResources.Push(res) + } +} + +// Remove removes res from the pool and closes it. If res is not part of the +// pool Remove will panic. +func (p *Pool[T]) destroyAcquiredResource(res *Resource[T]) { + p.destructResourceValue(res.value) + + p.mux.Lock() + defer p.mux.Unlock() + defer p.acquireSem.Release(1) + + p.allResources.remove(res) +} + +func (p *Pool[T]) hijackAcquiredResource(res *Resource[T]) { + p.mux.Lock() + defer p.mux.Unlock() + defer p.acquireSem.Release(1) + + p.allResources.remove(res) + res.status = resourceStatusHijacked + p.destructWG.Done() // not responsible for destructing hijacked resources +} + +func (p *Pool[T]) destructResourceValue(value T) { + p.destructor(value) + p.destructWG.Done() +} diff --git a/vendor/github.com/jackc/puddle/v2/resource_list.go b/vendor/github.com/jackc/puddle/v2/resource_list.go new file mode 100644 index 00000000..b2430959 --- /dev/null +++ b/vendor/github.com/jackc/puddle/v2/resource_list.go @@ -0,0 +1,28 @@ +package puddle + +type resList[T any] []*Resource[T] + +func (l *resList[T]) append(val *Resource[T]) { *l = append(*l, val) } + +func (l *resList[T]) popBack() *Resource[T] { + idx := len(*l) - 1 + val := (*l)[idx] + (*l)[idx] = nil // Avoid memory leak + *l = (*l)[:idx] + + return val +} + +func (l *resList[T]) remove(val *Resource[T]) { + for i, elem := range *l { + if elem == val { + lastIdx := len(*l) - 1 + (*l)[i] = (*l)[lastIdx] + (*l)[lastIdx] = nil // Avoid memory leak + (*l) = (*l)[:lastIdx] + return + } + } + + panic("BUG: removeResource could not find res in slice") +} diff --git a/vendor/golang.org/x/sync/LICENSE b/vendor/golang.org/x/sync/LICENSE new file mode 100644 index 00000000..6a66aea5 --- /dev/null +++ b/vendor/golang.org/x/sync/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2009 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/golang.org/x/sync/PATENTS b/vendor/golang.org/x/sync/PATENTS new file mode 100644 index 00000000..73309904 --- /dev/null +++ b/vendor/golang.org/x/sync/PATENTS @@ -0,0 +1,22 @@ +Additional IP Rights Grant (Patents) + +"This implementation" means the copyrightable works distributed by +Google as part of the Go project. + +Google hereby grants to You a perpetual, worldwide, non-exclusive, +no-charge, royalty-free, irrevocable (except as stated in this section) +patent license to make, have made, use, offer to sell, sell, import, +transfer and otherwise run, modify and propagate the contents of this +implementation of Go, where such license applies only to those patent +claims, both currently owned or controlled by Google and acquired in +the future, licensable by Google that are necessarily infringed by this +implementation of Go. This grant does not include claims that would be +infringed only as a consequence of further modification of this +implementation. If you or your agent or exclusive licensee institute or +order or agree to the institution of patent litigation against any +entity (including a cross-claim or counterclaim in a lawsuit) alleging +that this implementation of Go or any code incorporated within this +implementation of Go constitutes direct or contributory patent +infringement, or inducement of patent infringement, then any patent +rights granted to you under this License for this implementation of Go +shall terminate as of the date such litigation is filed. diff --git a/vendor/golang.org/x/sync/semaphore/semaphore.go b/vendor/golang.org/x/sync/semaphore/semaphore.go new file mode 100644 index 00000000..30f632c5 --- /dev/null +++ b/vendor/golang.org/x/sync/semaphore/semaphore.go @@ -0,0 +1,136 @@ +// Copyright 2017 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package semaphore provides a weighted semaphore implementation. +package semaphore // import "golang.org/x/sync/semaphore" + +import ( + "container/list" + "context" + "sync" +) + +type waiter struct { + n int64 + ready chan<- struct{} // Closed when semaphore acquired. +} + +// NewWeighted creates a new weighted semaphore with the given +// maximum combined weight for concurrent access. +func NewWeighted(n int64) *Weighted { + w := &Weighted{size: n} + return w +} + +// Weighted provides a way to bound concurrent access to a resource. +// The callers can request access with a given weight. +type Weighted struct { + size int64 + cur int64 + mu sync.Mutex + waiters list.List +} + +// Acquire acquires the semaphore with a weight of n, blocking until resources +// are available or ctx is done. On success, returns nil. On failure, returns +// ctx.Err() and leaves the semaphore unchanged. +// +// If ctx is already done, Acquire may still succeed without blocking. +func (s *Weighted) Acquire(ctx context.Context, n int64) error { + s.mu.Lock() + if s.size-s.cur >= n && s.waiters.Len() == 0 { + s.cur += n + s.mu.Unlock() + return nil + } + + if n > s.size { + // Don't make other Acquire calls block on one that's doomed to fail. + s.mu.Unlock() + <-ctx.Done() + return ctx.Err() + } + + ready := make(chan struct{}) + w := waiter{n: n, ready: ready} + elem := s.waiters.PushBack(w) + s.mu.Unlock() + + select { + case <-ctx.Done(): + err := ctx.Err() + s.mu.Lock() + select { + case <-ready: + // Acquired the semaphore after we were canceled. Rather than trying to + // fix up the queue, just pretend we didn't notice the cancelation. + err = nil + default: + isFront := s.waiters.Front() == elem + s.waiters.Remove(elem) + // If we're at the front and there're extra tokens left, notify other waiters. + if isFront && s.size > s.cur { + s.notifyWaiters() + } + } + s.mu.Unlock() + return err + + case <-ready: + return nil + } +} + +// TryAcquire acquires the semaphore with a weight of n without blocking. +// On success, returns true. On failure, returns false and leaves the semaphore unchanged. +func (s *Weighted) TryAcquire(n int64) bool { + s.mu.Lock() + success := s.size-s.cur >= n && s.waiters.Len() == 0 + if success { + s.cur += n + } + s.mu.Unlock() + return success +} + +// Release releases the semaphore with a weight of n. +func (s *Weighted) Release(n int64) { + s.mu.Lock() + s.cur -= n + if s.cur < 0 { + s.mu.Unlock() + panic("semaphore: released more than held") + } + s.notifyWaiters() + s.mu.Unlock() +} + +func (s *Weighted) notifyWaiters() { + for { + next := s.waiters.Front() + if next == nil { + break // No more waiters blocked. + } + + w := next.Value.(waiter) + if s.size-s.cur < w.n { + // Not enough tokens for the next waiter. We could keep going (to try to + // find a waiter with a smaller request), but under load that could cause + // starvation for large requests; instead, we leave all remaining waiters + // blocked. + // + // Consider a semaphore used as a read-write lock, with N tokens, N + // readers, and one writer. Each reader can Acquire(1) to obtain a read + // lock. The writer can Acquire(N) to obtain a write lock, excluding all + // of the readers. If we allow the readers to jump ahead in the queue, + // the writer will starve — there is always one token available for every + // reader. + break + } + + s.cur += w.n + s.waiters.Remove(next) + close(w.ready) + } +} diff --git a/vendor/modules.txt b/vendor/modules.txt index a4049055..a6939693 100644 --- a/vendor/modules.txt +++ b/vendor/modules.txt @@ -198,20 +198,25 @@ github.com/jackc/pgpassfile # github.com/jackc/pgservicefile v0.0.0-20221227161230-091c0ba34f0a ## explicit; go 1.14 github.com/jackc/pgservicefile -# github.com/jackc/pgx/v5 v5.3.1 +# github.com/jackc/pgx/v5 v5.5.4 ## explicit; go 1.19 github.com/jackc/pgx/v5 github.com/jackc/pgx/v5/internal/anynil github.com/jackc/pgx/v5/internal/iobufpool -github.com/jackc/pgx/v5/internal/nbconn github.com/jackc/pgx/v5/internal/pgio github.com/jackc/pgx/v5/internal/sanitize github.com/jackc/pgx/v5/internal/stmtcache github.com/jackc/pgx/v5/pgconn +github.com/jackc/pgx/v5/pgconn/internal/bgreader github.com/jackc/pgx/v5/pgconn/internal/ctxwatch github.com/jackc/pgx/v5/pgproto3 github.com/jackc/pgx/v5/pgtype +github.com/jackc/pgx/v5/pgxpool github.com/jackc/pgx/v5/stdlib +# github.com/jackc/puddle/v2 v2.2.1 +## explicit; go 1.19 +github.com/jackc/puddle/v2 +github.com/jackc/puddle/v2/internal/genstack # github.com/jinzhu/inflection v1.0.0 ## explicit github.com/jinzhu/inflection @@ -369,6 +374,9 @@ golang.org/x/net/webdav/internal/xml ## explicit; go 1.17 golang.org/x/oauth2 golang.org/x/oauth2/internal +# golang.org/x/sync v0.2.0 +## explicit +golang.org/x/sync/semaphore # golang.org/x/sys v0.15.0 ## explicit; go 1.18 golang.org/x/sys/cpu