diff --git a/EVIL SOLOS SHOW.png b/EVIL SOLOS SHOW.png new file mode 100644 index 0000000..6d8ea87 Binary files /dev/null and b/EVIL SOLOS SHOW.png differ diff --git a/shucks-pumpkin-panic/ShucksPumpkinPanic.icon.png b/shucks-pumpkin-panic/ShucksPumpkinPanic.icon.png new file mode 100644 index 0000000..c98fbb6 Binary files /dev/null and b/shucks-pumpkin-panic/ShucksPumpkinPanic.icon.png differ diff --git a/shucks-pumpkin-panic/ShucksPumpkinPanic.js b/shucks-pumpkin-panic/ShucksPumpkinPanic.js new file mode 100644 index 0000000..b05ef9c --- /dev/null +++ b/shucks-pumpkin-panic/ShucksPumpkinPanic.js @@ -0,0 +1,14611 @@ +var Godot = (() => { + var _scriptDir = typeof document !== 'undefined' && document.currentScript ? document.currentScript.src : undefined; + + return ( + function(Godot) { + Godot = Godot || {}; + + var Module = typeof Godot != "undefined" ? Godot : {}; + var readyPromiseResolve, readyPromiseReject; + Module["ready"] = new Promise(function(resolve, reject) { + readyPromiseResolve = resolve; + readyPromiseReject = reject + }); + var moduleOverrides = Object.assign({}, Module); + var arguments_ = []; + var thisProgram = "./this.program"; + var quit_ = (status, toThrow) => { + throw toThrow + }; + var ENVIRONMENT_IS_WEB = typeof window == "object"; + var ENVIRONMENT_IS_WORKER = typeof importScripts == "function"; + var ENVIRONMENT_IS_NODE = typeof process == "object" && typeof process.versions == "object" && typeof process.versions.node == "string"; + var scriptDirectory = ""; + + function locateFile(path) { + if (Module["locateFile"]) { + return Module["locateFile"](path, scriptDirectory) + } + return scriptDirectory + path + } + var read_, readAsync, readBinary, setWindowTitle; + if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { + if (ENVIRONMENT_IS_WORKER) { + scriptDirectory = self.location.href + } else if (typeof document != "undefined" && document.currentScript) { + scriptDirectory = document.currentScript.src + } + if (_scriptDir) { + scriptDirectory = _scriptDir + } + if (scriptDirectory.indexOf("blob:") !== 0) { + scriptDirectory = scriptDirectory.substr(0, scriptDirectory.replace(/[?#].*/, "").lastIndexOf("/") + 1) + } else { + scriptDirectory = "" + } { + read_ = url => { + var xhr = new XMLHttpRequest; + xhr.open("GET", url, false); + xhr.send(null); + return xhr.responseText + }; + if (ENVIRONMENT_IS_WORKER) { + readBinary = url => { + var xhr = new XMLHttpRequest; + xhr.open("GET", url, false); + xhr.responseType = "arraybuffer"; + xhr.send(null); + return new Uint8Array(xhr.response) + } + } + readAsync = (url, onload, onerror) => { + var xhr = new XMLHttpRequest; + xhr.open("GET", url, true); + xhr.responseType = "arraybuffer"; + xhr.onload = () => { + if (xhr.status == 200 || xhr.status == 0 && xhr.response) { + onload(xhr.response); + return + } + onerror() + }; + xhr.onerror = onerror; + xhr.send(null) + } + } + setWindowTitle = title => document.title = title + } else {} + var out = Module["print"] || console.log.bind(console); + var err = Module["printErr"] || console.warn.bind(console); + Object.assign(Module, moduleOverrides); + moduleOverrides = null; + if (Module["arguments"]) arguments_ = Module["arguments"]; + if (Module["thisProgram"]) thisProgram = Module["thisProgram"]; + if (Module["quit"]) quit_ = Module["quit"]; + + function warnOnce(text) { + if (!warnOnce.shown) warnOnce.shown = {}; + if (!warnOnce.shown[text]) { + warnOnce.shown[text] = 1; + err(text) + } + } + var tempRet0 = 0; + var setTempRet0 = value => { + tempRet0 = value + }; + var getTempRet0 = () => tempRet0; + var wasmBinary; + if (Module["wasmBinary"]) wasmBinary = Module["wasmBinary"]; + var noExitRuntime = Module["noExitRuntime"] || false; + if (typeof WebAssembly != "object") { + abort("no native wasm support detected") + } + var wasmMemory; + var ABORT = false; + var EXITSTATUS; + + function assert(condition, text) { + if (!condition) { + abort(text) + } + } + + function getCFunc(ident) { + var func = Module["_" + ident]; + return func + } + + function ccall(ident, returnType, argTypes, args, opts) { + var toC = { + "string": function(str) { + var ret = 0; + if (str !== null && str !== undefined && str !== 0) { + var len = (str.length << 2) + 1; + ret = stackAlloc(len); + stringToUTF8(str, ret, len) + } + return ret + }, + "array": function(arr) { + var ret = stackAlloc(arr.length); + writeArrayToMemory(arr, ret); + return ret + } + }; + + function convertReturnValue(ret) { + if (returnType === "string") { + return UTF8ToString(ret) + } + if (returnType === "boolean") return Boolean(ret); + return ret + } + var func = getCFunc(ident); + var cArgs = []; + var stack = 0; + if (args) { + for (var i = 0; i < args.length; i++) { + var converter = toC[argTypes[i]]; + if (converter) { + if (stack === 0) stack = stackSave(); + cArgs[i] = converter(args[i]) + } else { + cArgs[i] = args[i] + } + } + } + var ret = func.apply(null, cArgs); + + function onDone(ret) { + if (stack !== 0) stackRestore(stack); + return convertReturnValue(ret) + } + ret = onDone(ret); + return ret + } + + function cwrap(ident, returnType, argTypes, opts) { + argTypes = argTypes || []; + var numericArgs = argTypes.every(function(type) { + return type === "number" + }); + var numericRet = returnType !== "string"; + if (numericRet && numericArgs && !opts) { + return getCFunc(ident) + } + return function() { + return ccall(ident, returnType, argTypes, arguments, opts) + } + } + var UTF8Decoder = typeof TextDecoder != "undefined" ? new TextDecoder("utf8") : undefined; + + function UTF8ArrayToString(heapOrArray, idx, maxBytesToRead) { + var endIdx = idx + maxBytesToRead; + var endPtr = idx; + while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr; + if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) { + return UTF8Decoder.decode(heapOrArray.subarray(idx, endPtr)) + } else { + var str = ""; + while (idx < endPtr) { + var u0 = heapOrArray[idx++]; + if (!(u0 & 128)) { + str += String.fromCharCode(u0); + continue + } + var u1 = heapOrArray[idx++] & 63; + if ((u0 & 224) == 192) { + str += String.fromCharCode((u0 & 31) << 6 | u1); + continue + } + var u2 = heapOrArray[idx++] & 63; + if ((u0 & 240) == 224) { + u0 = (u0 & 15) << 12 | u1 << 6 | u2 + } else { + u0 = (u0 & 7) << 18 | u1 << 12 | u2 << 6 | heapOrArray[idx++] & 63 + } + if (u0 < 65536) { + str += String.fromCharCode(u0) + } else { + var ch = u0 - 65536; + str += String.fromCharCode(55296 | ch >> 10, 56320 | ch & 1023) + } + } + } + return str + } + + function UTF8ToString(ptr, maxBytesToRead) { + return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : "" + } + + function stringToUTF8Array(str, heap, outIdx, maxBytesToWrite) { + if (!(maxBytesToWrite > 0)) return 0; + var startIdx = outIdx; + var endIdx = outIdx + maxBytesToWrite - 1; + for (var i = 0; i < str.length; ++i) { + var u = str.charCodeAt(i); + if (u >= 55296 && u <= 57343) { + var u1 = str.charCodeAt(++i); + u = 65536 + ((u & 1023) << 10) | u1 & 1023 + } + if (u <= 127) { + if (outIdx >= endIdx) break; + heap[outIdx++] = u + } else if (u <= 2047) { + if (outIdx + 1 >= endIdx) break; + heap[outIdx++] = 192 | u >> 6; + heap[outIdx++] = 128 | u & 63 + } else if (u <= 65535) { + if (outIdx + 2 >= endIdx) break; + heap[outIdx++] = 224 | u >> 12; + heap[outIdx++] = 128 | u >> 6 & 63; + heap[outIdx++] = 128 | u & 63 + } else { + if (outIdx + 3 >= endIdx) break; + heap[outIdx++] = 240 | u >> 18; + heap[outIdx++] = 128 | u >> 12 & 63; + heap[outIdx++] = 128 | u >> 6 & 63; + heap[outIdx++] = 128 | u & 63 + } + } + heap[outIdx] = 0; + return outIdx - startIdx + } + + function stringToUTF8(str, outPtr, maxBytesToWrite) { + return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite) + } + + function lengthBytesUTF8(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + var u = str.charCodeAt(i); + if (u >= 55296 && u <= 57343) u = 65536 + ((u & 1023) << 10) | str.charCodeAt(++i) & 1023; + if (u <= 127) ++len; + else if (u <= 2047) len += 2; + else if (u <= 65535) len += 3; + else len += 4 + } + return len + } + + function allocateUTF8(str) { + var size = lengthBytesUTF8(str) + 1; + var ret = _malloc(size); + if (ret) stringToUTF8Array(str, HEAP8, ret, size); + return ret + } + + function allocateUTF8OnStack(str) { + var size = lengthBytesUTF8(str) + 1; + var ret = stackAlloc(size); + stringToUTF8Array(str, HEAP8, ret, size); + return ret + } + + function writeArrayToMemory(array, buffer) { + HEAP8.set(array, buffer) + } + + function writeAsciiToMemory(str, buffer, dontAddNull) { + for (var i = 0; i < str.length; ++i) { + HEAP8[buffer++ >> 0] = str.charCodeAt(i) + } + if (!dontAddNull) HEAP8[buffer >> 0] = 0 + } + var buffer, HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64; + + function updateGlobalBufferAndViews(buf) { + buffer = buf; + Module["HEAP8"] = HEAP8 = new Int8Array(buf); + Module["HEAP16"] = HEAP16 = new Int16Array(buf); + Module["HEAP32"] = HEAP32 = new Int32Array(buf); + Module["HEAPU8"] = HEAPU8 = new Uint8Array(buf); + Module["HEAPU16"] = HEAPU16 = new Uint16Array(buf); + Module["HEAPU32"] = HEAPU32 = new Uint32Array(buf); + Module["HEAPF32"] = HEAPF32 = new Float32Array(buf); + Module["HEAPF64"] = HEAPF64 = new Float64Array(buf) + } + var INITIAL_MEMORY = Module["INITIAL_MEMORY"] || 33554432; + var wasmTable; + var __ATPRERUN__ = []; + var __ATINIT__ = []; + var __ATMAIN__ = []; + var __ATEXIT__ = []; + var __ATPOSTRUN__ = []; + var runtimeInitialized = false; + var runtimeExited = false; + var runtimeKeepaliveCounter = 0; + + function keepRuntimeAlive() { + return noExitRuntime || runtimeKeepaliveCounter > 0 + } + + function preRun() { + if (Module["preRun"]) { + if (typeof Module["preRun"] == "function") Module["preRun"] = [Module["preRun"]]; + while (Module["preRun"].length) { + addOnPreRun(Module["preRun"].shift()) + } + } + callRuntimeCallbacks(__ATPRERUN__) + } + + function initRuntime() { + runtimeInitialized = true; + if (!Module["noFSInit"] && !FS.init.initialized) FS.init(); + FS.ignorePermissions = false; + TTY.init(); + SOCKFS.root = FS.mount(SOCKFS, {}, null); + callRuntimeCallbacks(__ATINIT__) + } + + function preMain() { + callRuntimeCallbacks(__ATMAIN__) + } + + function exitRuntime() { + ___funcs_on_exit(); + callRuntimeCallbacks(__ATEXIT__); + FS.quit(); + TTY.shutdown(); + IDBFS.quit(); + runtimeExited = true + } + + function postRun() { + if (Module["postRun"]) { + if (typeof Module["postRun"] == "function") Module["postRun"] = [Module["postRun"]]; + while (Module["postRun"].length) { + addOnPostRun(Module["postRun"].shift()) + } + } + callRuntimeCallbacks(__ATPOSTRUN__) + } + + function addOnPreRun(cb) { + __ATPRERUN__.unshift(cb) + } + + function addOnInit(cb) { + __ATINIT__.unshift(cb) + } + + function addOnPostRun(cb) { + __ATPOSTRUN__.unshift(cb) + } + var runDependencies = 0; + var runDependencyWatcher = null; + var dependenciesFulfilled = null; + + function getUniqueRunDependency(id) { + return id + } + + function addRunDependency(id) { + runDependencies++; + if (Module["monitorRunDependencies"]) { + Module["monitorRunDependencies"](runDependencies) + } + } + + function removeRunDependency(id) { + runDependencies--; + if (Module["monitorRunDependencies"]) { + Module["monitorRunDependencies"](runDependencies) + } + if (runDependencies == 0) { + if (runDependencyWatcher !== null) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null + } + if (dependenciesFulfilled) { + var callback = dependenciesFulfilled; + dependenciesFulfilled = null; + callback() + } + } + } + + function abort(what) { + { + if (Module["onAbort"]) { + Module["onAbort"](what) + } + } + what = "Aborted(" + what + ")"; + err(what); + ABORT = true; + EXITSTATUS = 1; + what += ". Build with -sASSERTIONS for more info."; + var e = new WebAssembly.RuntimeError(what); + readyPromiseReject(e); + throw e + } + var dataURIPrefix = "data:application/octet-stream;base64,"; + + function isDataURI(filename) { + return filename.startsWith(dataURIPrefix) + } + var wasmBinaryFile; + wasmBinaryFile = "godot.javascript.opt.wasm"; + if (!isDataURI(wasmBinaryFile)) { + wasmBinaryFile = locateFile(wasmBinaryFile) + } + + function getBinary(file) { + try { + if (file == wasmBinaryFile && wasmBinary) { + return new Uint8Array(wasmBinary) + } + if (readBinary) { + return readBinary(file) + } else { + throw "both async and sync fetching of the wasm failed" + } + } catch (err) { + abort(err) + } + } + + function getBinaryPromise() { + if (!wasmBinary && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER)) { + if (typeof fetch == "function") { + return fetch(wasmBinaryFile, { + credentials: "same-origin" + }).then(function(response) { + if (!response["ok"]) { + throw "failed to load wasm binary file at '" + wasmBinaryFile + "'" + } + return response["arrayBuffer"]() + }).catch(function() { + return getBinary(wasmBinaryFile) + }) + } + } + return Promise.resolve().then(function() { + return getBinary(wasmBinaryFile) + }) + } + + function createWasm() { + var info = { + "a": asmLibraryArg + }; + + function receiveInstance(instance, module) { + var exports = instance.exports; + Module["asm"] = exports; + wasmMemory = Module["asm"]["dk"]; + updateGlobalBufferAndViews(wasmMemory.buffer); + wasmTable = Module["asm"]["rk"]; + addOnInit(Module["asm"]["ek"]); + removeRunDependency("wasm-instantiate") + } + addRunDependency("wasm-instantiate"); + + function receiveInstantiationResult(result) { + receiveInstance(result["instance"]) + } + + function instantiateArrayBuffer(receiver) { + return getBinaryPromise().then(function(binary) { + return WebAssembly.instantiate(binary, info) + }).then(function(instance) { + return instance + }).then(receiver, function(reason) { + err("failed to asynchronously prepare wasm: " + reason); + abort(reason) + }) + } + + function instantiateAsync() { + if (!wasmBinary && typeof WebAssembly.instantiateStreaming == "function" && !isDataURI(wasmBinaryFile) && typeof fetch == "function") { + return fetch(wasmBinaryFile, { + credentials: "same-origin" + }).then(function(response) { + var result = WebAssembly.instantiateStreaming(response, info); + return result.then(receiveInstantiationResult, function(reason) { + err("wasm streaming compile failed: " + reason); + err("falling back to ArrayBuffer instantiation"); + return instantiateArrayBuffer(receiveInstantiationResult) + }) + }) + } else { + return instantiateArrayBuffer(receiveInstantiationResult) + } + } + if (Module["instantiateWasm"]) { + try { + var exports = Module["instantiateWasm"](info, receiveInstance); + return exports + } catch (e) { + err("Module.instantiateWasm callback failed with error: " + e); + return false + } + } + instantiateAsync().catch(readyPromiseReject); + return {} + } + var tempDouble; + var tempI64; + + function callRuntimeCallbacks(callbacks) { + while (callbacks.length > 0) { + var callback = callbacks.shift(); + if (typeof callback == "function") { + callback(Module); + continue + } + var func = callback.func; + if (typeof func == "number") { + if (callback.arg === undefined) { + getWasmTableEntry(func)() + } else { + getWasmTableEntry(func)(callback.arg) + } + } else { + func(callback.arg === undefined ? null : callback.arg) + } + } + } + + function getValue(ptr, type = "i8") { + if (type.endsWith("*")) type = "i32"; + switch (type) { + case "i1": + return HEAP8[ptr >> 0]; + case "i8": + return HEAP8[ptr >> 0]; + case "i16": + return HEAP16[ptr >> 1]; + case "i32": + return HEAP32[ptr >> 2]; + case "i64": + return HEAP32[ptr >> 2]; + case "float": + return HEAPF32[ptr >> 2]; + case "double": + return Number(HEAPF64[ptr >> 3]); + default: + abort("invalid type for getValue: " + type) + } + return null + } + + function getWasmTableEntry(funcPtr) { + return wasmTable.get(funcPtr) + } + + function handleException(e) { + if (e instanceof ExitStatus || e == "unwind") { + return EXITSTATUS + } + quit_(1, e) + } + + function setValue(ptr, value, type = "i8") { + if (type.endsWith("*")) type = "i32"; + switch (type) { + case "i1": + HEAP8[ptr >> 0] = value; + break; + case "i8": + HEAP8[ptr >> 0] = value; + break; + case "i16": + HEAP16[ptr >> 1] = value; + break; + case "i32": + HEAP32[ptr >> 2] = value; + break; + case "i64": + tempI64 = [value >>> 0, (tempDouble = value, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0)], HEAP32[ptr >> 2] = tempI64[0], HEAP32[ptr + 4 >> 2] = tempI64[1]; + break; + case "float": + HEAPF32[ptr >> 2] = value; + break; + case "double": + HEAPF64[ptr >> 3] = value; + break; + default: + abort("invalid type for setValue: " + type) + } + } + + function ___call_sighandler(fp, sig) { + getWasmTableEntry(fp)(sig) + } + var PATH = { + isAbs: path => path.charAt(0) === "/", + splitPath: filename => { + var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; + return splitPathRe.exec(filename).slice(1) + }, + normalizeArray: (parts, allowAboveRoot) => { + var up = 0; + for (var i = parts.length - 1; i >= 0; i--) { + var last = parts[i]; + if (last === ".") { + parts.splice(i, 1) + } else if (last === "..") { + parts.splice(i, 1); + up++ + } else if (up) { + parts.splice(i, 1); + up-- + } + } + if (allowAboveRoot) { + for (; up; up--) { + parts.unshift("..") + } + } + return parts + }, + normalize: path => { + var isAbsolute = PATH.isAbs(path), + trailingSlash = path.substr(-1) === "/"; + path = PATH.normalizeArray(path.split("/").filter(p => !!p), !isAbsolute).join("/"); + if (!path && !isAbsolute) { + path = "." + } + if (path && trailingSlash) { + path += "/" + } + return (isAbsolute ? "/" : "") + path + }, + dirname: path => { + var result = PATH.splitPath(path), + root = result[0], + dir = result[1]; + if (!root && !dir) { + return "." + } + if (dir) { + dir = dir.substr(0, dir.length - 1) + } + return root + dir + }, + basename: path => { + if (path === "/") return "/"; + path = PATH.normalize(path); + path = path.replace(/\/$/, ""); + var lastSlash = path.lastIndexOf("/"); + if (lastSlash === -1) return path; + return path.substr(lastSlash + 1) + }, + join: function() { + var paths = Array.prototype.slice.call(arguments, 0); + return PATH.normalize(paths.join("/")) + }, + join2: (l, r) => { + return PATH.normalize(l + "/" + r) + } + }; + + function getRandomDevice() { + if (typeof crypto == "object" && typeof crypto["getRandomValues"] == "function") { + var randomBuffer = new Uint8Array(1); + return function() { + crypto.getRandomValues(randomBuffer); + return randomBuffer[0] + } + } else return function() { + abort("randomDevice") + } + } + var PATH_FS = { + resolve: function() { + var resolvedPath = "", + resolvedAbsolute = false; + for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { + var path = i >= 0 ? arguments[i] : FS.cwd(); + if (typeof path != "string") { + throw new TypeError("Arguments to path.resolve must be strings") + } else if (!path) { + return "" + } + resolvedPath = path + "/" + resolvedPath; + resolvedAbsolute = PATH.isAbs(path) + } + resolvedPath = PATH.normalizeArray(resolvedPath.split("/").filter(p => !!p), !resolvedAbsolute).join("/"); + return (resolvedAbsolute ? "/" : "") + resolvedPath || "." + }, + relative: (from, to) => { + from = PATH_FS.resolve(from).substr(1); + to = PATH_FS.resolve(to).substr(1); + + function trim(arr) { + var start = 0; + for (; start < arr.length; start++) { + if (arr[start] !== "") break + } + var end = arr.length - 1; + for (; end >= 0; end--) { + if (arr[end] !== "") break + } + if (start > end) return []; + return arr.slice(start, end - start + 1) + } + var fromParts = trim(from.split("/")); + var toParts = trim(to.split("/")); + var length = Math.min(fromParts.length, toParts.length); + var samePartsLength = length; + for (var i = 0; i < length; i++) { + if (fromParts[i] !== toParts[i]) { + samePartsLength = i; + break + } + } + var outputParts = []; + for (var i = samePartsLength; i < fromParts.length; i++) { + outputParts.push("..") + } + outputParts = outputParts.concat(toParts.slice(samePartsLength)); + return outputParts.join("/") + } + }; + var TTY = { + ttys: [], + init: function() {}, + shutdown: function() {}, + register: function(dev, ops) { + TTY.ttys[dev] = { + input: [], + output: [], + ops: ops + }; + FS.registerDevice(dev, TTY.stream_ops) + }, + stream_ops: { + open: function(stream) { + var tty = TTY.ttys[stream.node.rdev]; + if (!tty) { + throw new FS.ErrnoError(43) + } + stream.tty = tty; + stream.seekable = false + }, + close: function(stream) { + stream.tty.ops.flush(stream.tty) + }, + flush: function(stream) { + stream.tty.ops.flush(stream.tty) + }, + read: function(stream, buffer, offset, length, pos) { + if (!stream.tty || !stream.tty.ops.get_char) { + throw new FS.ErrnoError(60) + } + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = stream.tty.ops.get_char(stream.tty) + } catch (e) { + throw new FS.ErrnoError(29) + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6) + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset + i] = result + } + if (bytesRead) { + stream.node.timestamp = Date.now() + } + return bytesRead + }, + write: function(stream, buffer, offset, length, pos) { + if (!stream.tty || !stream.tty.ops.put_char) { + throw new FS.ErrnoError(60) + } + try { + for (var i = 0; i < length; i++) { + stream.tty.ops.put_char(stream.tty, buffer[offset + i]) + } + } catch (e) { + throw new FS.ErrnoError(29) + } + if (length) { + stream.node.timestamp = Date.now() + } + return i + } + }, + default_tty_ops: { + get_char: function(tty) { + if (!tty.input.length) { + var result = null; + if (typeof window != "undefined" && typeof window.prompt == "function") { + result = window.prompt("Input: "); + if (result !== null) { + result += "\n" + } + } else if (typeof readline == "function") { + result = readline(); + if (result !== null) { + result += "\n" + } + } + if (!result) { + return null + } + tty.input = intArrayFromString(result, true) + } + return tty.input.shift() + }, + put_char: function(tty, val) { + if (val === null || val === 10) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = [] + } else { + if (val != 0) tty.output.push(val) + } + }, + flush: function(tty) { + if (tty.output && tty.output.length > 0) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = [] + } + } + }, + default_tty1_ops: { + put_char: function(tty, val) { + if (val === null || val === 10) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = [] + } else { + if (val != 0) tty.output.push(val) + } + }, + flush: function(tty) { + if (tty.output && tty.output.length > 0) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = [] + } + } + } + }; + + function zeroMemory(address, size) { + HEAPU8.fill(0, address, address + size) + } + + function mmapAlloc(size) { + abort() + } + var MEMFS = { + ops_table: null, + mount: function(mount) { + return MEMFS.createNode(null, "/", 16384 | 511, 0) + }, + createNode: function(parent, name, mode, dev) { + if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { + throw new FS.ErrnoError(63) + } + if (!MEMFS.ops_table) { + MEMFS.ops_table = { + dir: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + lookup: MEMFS.node_ops.lookup, + mknod: MEMFS.node_ops.mknod, + rename: MEMFS.node_ops.rename, + unlink: MEMFS.node_ops.unlink, + rmdir: MEMFS.node_ops.rmdir, + readdir: MEMFS.node_ops.readdir, + symlink: MEMFS.node_ops.symlink + }, + stream: { + llseek: MEMFS.stream_ops.llseek + } + }, + file: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: { + llseek: MEMFS.stream_ops.llseek, + read: MEMFS.stream_ops.read, + write: MEMFS.stream_ops.write, + allocate: MEMFS.stream_ops.allocate, + mmap: MEMFS.stream_ops.mmap, + msync: MEMFS.stream_ops.msync + } + }, + link: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + readlink: MEMFS.node_ops.readlink + }, + stream: {} + }, + chrdev: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: FS.chrdev_stream_ops + } + } + } + var node = FS.createNode(parent, name, mode, dev); + if (FS.isDir(node.mode)) { + node.node_ops = MEMFS.ops_table.dir.node; + node.stream_ops = MEMFS.ops_table.dir.stream; + node.contents = {} + } else if (FS.isFile(node.mode)) { + node.node_ops = MEMFS.ops_table.file.node; + node.stream_ops = MEMFS.ops_table.file.stream; + node.usedBytes = 0; + node.contents = null + } else if (FS.isLink(node.mode)) { + node.node_ops = MEMFS.ops_table.link.node; + node.stream_ops = MEMFS.ops_table.link.stream + } else if (FS.isChrdev(node.mode)) { + node.node_ops = MEMFS.ops_table.chrdev.node; + node.stream_ops = MEMFS.ops_table.chrdev.stream + } + node.timestamp = Date.now(); + if (parent) { + parent.contents[name] = node; + parent.timestamp = node.timestamp + } + return node + }, + getFileDataAsTypedArray: function(node) { + if (!node.contents) return new Uint8Array(0); + if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); + return new Uint8Array(node.contents) + }, + expandFileStorage: function(node, newCapacity) { + var prevCapacity = node.contents ? node.contents.length : 0; + if (prevCapacity >= newCapacity) return; + var CAPACITY_DOUBLING_MAX = 1024 * 1024; + newCapacity = Math.max(newCapacity, prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2 : 1.125) >>> 0); + if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); + var oldContents = node.contents; + node.contents = new Uint8Array(newCapacity); + if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0) + }, + resizeFileStorage: function(node, newSize) { + if (node.usedBytes == newSize) return; + if (newSize == 0) { + node.contents = null; + node.usedBytes = 0 + } else { + var oldContents = node.contents; + node.contents = new Uint8Array(newSize); + if (oldContents) { + node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))) + } + node.usedBytes = newSize + } + }, + node_ops: { + getattr: function(node) { + var attr = {}; + attr.dev = FS.isChrdev(node.mode) ? node.id : 1; + attr.ino = node.id; + attr.mode = node.mode; + attr.nlink = 1; + attr.uid = 0; + attr.gid = 0; + attr.rdev = node.rdev; + if (FS.isDir(node.mode)) { + attr.size = 4096 + } else if (FS.isFile(node.mode)) { + attr.size = node.usedBytes + } else if (FS.isLink(node.mode)) { + attr.size = node.link.length + } else { + attr.size = 0 + } + attr.atime = new Date(node.timestamp); + attr.mtime = new Date(node.timestamp); + attr.ctime = new Date(node.timestamp); + attr.blksize = 4096; + attr.blocks = Math.ceil(attr.size / attr.blksize); + return attr + }, + setattr: function(node, attr) { + if (attr.mode !== undefined) { + node.mode = attr.mode + } + if (attr.timestamp !== undefined) { + node.timestamp = attr.timestamp + } + if (attr.size !== undefined) { + MEMFS.resizeFileStorage(node, attr.size) + } + }, + lookup: function(parent, name) { + throw FS.genericErrors[44] + }, + mknod: function(parent, name, mode, dev) { + return MEMFS.createNode(parent, name, mode, dev) + }, + rename: function(old_node, new_dir, new_name) { + if (FS.isDir(old_node.mode)) { + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name) + } catch (e) {} + if (new_node) { + for (var i in new_node.contents) { + throw new FS.ErrnoError(55) + } + } + } + delete old_node.parent.contents[old_node.name]; + old_node.parent.timestamp = Date.now(); + old_node.name = new_name; + new_dir.contents[new_name] = old_node; + new_dir.timestamp = old_node.parent.timestamp; + old_node.parent = new_dir + }, + unlink: function(parent, name) { + delete parent.contents[name]; + parent.timestamp = Date.now() + }, + rmdir: function(parent, name) { + var node = FS.lookupNode(parent, name); + for (var i in node.contents) { + throw new FS.ErrnoError(55) + } + delete parent.contents[name]; + parent.timestamp = Date.now() + }, + readdir: function(node) { + var entries = [".", ".."]; + for (var key in node.contents) { + if (!node.contents.hasOwnProperty(key)) { + continue + } + entries.push(key) + } + return entries + }, + symlink: function(parent, newname, oldpath) { + var node = MEMFS.createNode(parent, newname, 511 | 40960, 0); + node.link = oldpath; + return node + }, + readlink: function(node) { + if (!FS.isLink(node.mode)) { + throw new FS.ErrnoError(28) + } + return node.link + } + }, + stream_ops: { + read: function(stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= stream.node.usedBytes) return 0; + var size = Math.min(stream.node.usedBytes - position, length); + if (size > 8 && contents.subarray) { + buffer.set(contents.subarray(position, position + size), offset) + } else { + for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i] + } + return size + }, + write: function(stream, buffer, offset, length, position, canOwn) { + if (buffer.buffer === HEAP8.buffer) { + canOwn = false + } + if (!length) return 0; + var node = stream.node; + node.timestamp = Date.now(); + if (buffer.subarray && (!node.contents || node.contents.subarray)) { + if (canOwn) { + node.contents = buffer.subarray(offset, offset + length); + node.usedBytes = length; + return length + } else if (node.usedBytes === 0 && position === 0) { + node.contents = buffer.slice(offset, offset + length); + node.usedBytes = length; + return length + } else if (position + length <= node.usedBytes) { + node.contents.set(buffer.subarray(offset, offset + length), position); + return length + } + } + MEMFS.expandFileStorage(node, position + length); + if (node.contents.subarray && buffer.subarray) { + node.contents.set(buffer.subarray(offset, offset + length), position) + } else { + for (var i = 0; i < length; i++) { + node.contents[position + i] = buffer[offset + i] + } + } + node.usedBytes = Math.max(node.usedBytes, position + length); + return length + }, + llseek: function(stream, offset, whence) { + var position = offset; + if (whence === 1) { + position += stream.position + } else if (whence === 2) { + if (FS.isFile(stream.node.mode)) { + position += stream.node.usedBytes + } + } + if (position < 0) { + throw new FS.ErrnoError(28) + } + return position + }, + allocate: function(stream, offset, length) { + MEMFS.expandFileStorage(stream.node, offset + length); + stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length) + }, + mmap: function(stream, length, position, prot, flags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43) + } + var ptr; + var allocated; + var contents = stream.node.contents; + if (!(flags & 2) && contents.buffer === buffer) { + allocated = false; + ptr = contents.byteOffset + } else { + if (position > 0 || position + length < contents.length) { + if (contents.subarray) { + contents = contents.subarray(position, position + length) + } else { + contents = Array.prototype.slice.call(contents, position, position + length) + } + } + allocated = true; + ptr = mmapAlloc(length); + if (!ptr) { + throw new FS.ErrnoError(48) + } + HEAP8.set(contents, ptr) + } + return { + ptr: ptr, + allocated: allocated + } + }, + msync: function(stream, buffer, offset, length, mmapFlags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43) + } + if (mmapFlags & 2) { + return 0 + } + var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); + return 0 + } + } + }; + + function asyncLoad(url, onload, onerror, noRunDep) { + var dep = !noRunDep ? getUniqueRunDependency("al " + url) : ""; + readAsync(url, function(arrayBuffer) { + assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).'); + onload(new Uint8Array(arrayBuffer)); + if (dep) removeRunDependency(dep) + }, function(event) { + if (onerror) { + onerror() + } else { + throw 'Loading data file "' + url + '" failed.' + } + }); + if (dep) addRunDependency(dep) + } + var IDBFS = { + dbs: {}, + indexedDB: () => { + if (typeof indexedDB != "undefined") return indexedDB; + var ret = null; + if (typeof window == "object") ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + assert(ret, "IDBFS used, but indexedDB not supported"); + return ret + }, + DB_VERSION: 21, + DB_STORE_NAME: "FILE_DATA", + mount: function(mount) { + return MEMFS.mount.apply(null, arguments) + }, + syncfs: (mount, populate, callback) => { + IDBFS.getLocalSet(mount, (err, local) => { + if (err) return callback(err); + IDBFS.getRemoteSet(mount, (err, remote) => { + if (err) return callback(err); + var src = populate ? remote : local; + var dst = populate ? local : remote; + IDBFS.reconcile(src, dst, callback) + }) + }) + }, + quit: () => { + Object.values(IDBFS.dbs).forEach(value => value.close()); + IDBFS.dbs = {} + }, + getDB: (name, callback) => { + var db = IDBFS.dbs[name]; + if (db) { + return callback(null, db) + } + var req; + try { + req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION) + } catch (e) { + return callback(e) + } + if (!req) { + return callback("Unable to connect to IndexedDB") + } + req.onupgradeneeded = e => { + var db = e.target.result; + var transaction = e.target.transaction; + var fileStore; + if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) { + fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME) + } else { + fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME) + } + if (!fileStore.indexNames.contains("timestamp")) { + fileStore.createIndex("timestamp", "timestamp", { + unique: false + }) + } + }; + req.onsuccess = () => { + db = req.result; + IDBFS.dbs[name] = db; + callback(null, db) + }; + req.onerror = e => { + callback(this.error); + e.preventDefault() + } + }, + getLocalSet: (mount, callback) => { + var entries = {}; + + function isRealDir(p) { + return p !== "." && p !== ".." + } + + function toAbsolute(root) { + return p => { + return PATH.join2(root, p) + } + } + var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint)); + while (check.length) { + var path = check.pop(); + var stat; + try { + stat = FS.stat(path) + } catch (e) { + return callback(e) + } + if (FS.isDir(stat.mode)) { + check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path))) + } + entries[path] = { + "timestamp": stat.mtime + } + } + return callback(null, { + type: "local", + entries: entries + }) + }, + getRemoteSet: (mount, callback) => { + var entries = {}; + IDBFS.getDB(mount.mountpoint, (err, db) => { + if (err) return callback(err); + try { + var transaction = db.transaction([IDBFS.DB_STORE_NAME], "readonly"); + transaction.onerror = e => { + callback(this.error); + e.preventDefault() + }; + var store = transaction.objectStore(IDBFS.DB_STORE_NAME); + var index = store.index("timestamp"); + index.openKeyCursor().onsuccess = event => { + var cursor = event.target.result; + if (!cursor) { + return callback(null, { + type: "remote", + db: db, + entries: entries + }) + } + entries[cursor.primaryKey] = { + "timestamp": cursor.key + }; + cursor.continue() + } + } catch (e) { + return callback(e) + } + }) + }, + loadLocalEntry: (path, callback) => { + var stat, node; + try { + var lookup = FS.lookupPath(path); + node = lookup.node; + stat = FS.stat(path) + } catch (e) { + return callback(e) + } + if (FS.isDir(stat.mode)) { + return callback(null, { + "timestamp": stat.mtime, + "mode": stat.mode + }) + } else if (FS.isFile(stat.mode)) { + node.contents = MEMFS.getFileDataAsTypedArray(node); + return callback(null, { + "timestamp": stat.mtime, + "mode": stat.mode, + "contents": node.contents + }) + } else { + return callback(new Error("node type not supported")) + } + }, + storeLocalEntry: (path, entry, callback) => { + try { + if (FS.isDir(entry["mode"])) { + FS.mkdirTree(path, entry["mode"]) + } else if (FS.isFile(entry["mode"])) { + FS.writeFile(path, entry["contents"], { + canOwn: true + }) + } else { + return callback(new Error("node type not supported")) + } + FS.chmod(path, entry["mode"]); + FS.utime(path, entry["timestamp"], entry["timestamp"]) + } catch (e) { + return callback(e) + } + callback(null) + }, + removeLocalEntry: (path, callback) => { + try { + var stat = FS.stat(path); + if (FS.isDir(stat.mode)) { + FS.rmdir(path) + } else if (FS.isFile(stat.mode)) { + FS.unlink(path) + } + } catch (e) { + return callback(e) + } + callback(null) + }, + loadRemoteEntry: (store, path, callback) => { + var req = store.get(path); + req.onsuccess = event => { + callback(null, event.target.result) + }; + req.onerror = e => { + callback(this.error); + e.preventDefault() + } + }, + storeRemoteEntry: (store, path, entry, callback) => { + try { + var req = store.put(entry, path) + } catch (e) { + callback(e); + return + } + req.onsuccess = () => { + callback(null) + }; + req.onerror = e => { + callback(this.error); + e.preventDefault() + } + }, + removeRemoteEntry: (store, path, callback) => { + var req = store.delete(path); + req.onsuccess = () => { + callback(null) + }; + req.onerror = e => { + callback(this.error); + e.preventDefault() + } + }, + reconcile: (src, dst, callback) => { + var total = 0; + var create = []; + Object.keys(src.entries).forEach(function(key) { + var e = src.entries[key]; + var e2 = dst.entries[key]; + if (!e2 || e["timestamp"].getTime() != e2["timestamp"].getTime()) { + create.push(key); + total++ + } + }); + var remove = []; + Object.keys(dst.entries).forEach(function(key) { + if (!src.entries[key]) { + remove.push(key); + total++ + } + }); + if (!total) { + return callback(null) + } + var errored = false; + var db = src.type === "remote" ? src.db : dst.db; + var transaction = db.transaction([IDBFS.DB_STORE_NAME], "readwrite"); + var store = transaction.objectStore(IDBFS.DB_STORE_NAME); + + function done(err) { + if (err && !errored) { + errored = true; + return callback(err) + } + } + transaction.onerror = e => { + done(this.error); + e.preventDefault() + }; + transaction.oncomplete = e => { + if (!errored) { + callback(null) + } + }; + create.sort().forEach(path => { + if (dst.type === "local") { + IDBFS.loadRemoteEntry(store, path, (err, entry) => { + if (err) return done(err); + IDBFS.storeLocalEntry(path, entry, done) + }) + } else { + IDBFS.loadLocalEntry(path, (err, entry) => { + if (err) return done(err); + IDBFS.storeRemoteEntry(store, path, entry, done) + }) + } + }); + remove.sort().reverse().forEach(path => { + if (dst.type === "local") { + IDBFS.removeLocalEntry(path, done) + } else { + IDBFS.removeRemoteEntry(store, path, done) + } + }) + } + }; + var FS = { + root: null, + mounts: [], + devices: {}, + streams: [], + nextInode: 1, + nameTable: null, + currentPath: "/", + initialized: false, + ignorePermissions: true, + ErrnoError: null, + genericErrors: {}, + filesystems: null, + syncFSRequests: 0, + lookupPath: (path, opts = {}) => { + path = PATH_FS.resolve(FS.cwd(), path); + if (!path) return { + path: "", + node: null + }; + var defaults = { + follow_mount: true, + recurse_count: 0 + }; + opts = Object.assign(defaults, opts); + if (opts.recurse_count > 8) { + throw new FS.ErrnoError(32) + } + var parts = PATH.normalizeArray(path.split("/").filter(p => !!p), false); + var current = FS.root; + var current_path = "/"; + for (var i = 0; i < parts.length; i++) { + var islast = i === parts.length - 1; + if (islast && opts.parent) { + break + } + current = FS.lookupNode(current, parts[i]); + current_path = PATH.join2(current_path, parts[i]); + if (FS.isMountpoint(current)) { + if (!islast || islast && opts.follow_mount) { + current = current.mounted.root + } + } + if (!islast || opts.follow) { + var count = 0; + while (FS.isLink(current.mode)) { + var link = FS.readlink(current_path); + current_path = PATH_FS.resolve(PATH.dirname(current_path), link); + var lookup = FS.lookupPath(current_path, { + recurse_count: opts.recurse_count + 1 + }); + current = lookup.node; + if (count++ > 40) { + throw new FS.ErrnoError(32) + } + } + } + } + return { + path: current_path, + node: current + } + }, + getPath: node => { + var path; + while (true) { + if (FS.isRoot(node)) { + var mount = node.mount.mountpoint; + if (!path) return mount; + return mount[mount.length - 1] !== "/" ? mount + "/" + path : mount + path + } + path = path ? node.name + "/" + path : node.name; + node = node.parent + } + }, + hashName: (parentid, name) => { + var hash = 0; + for (var i = 0; i < name.length; i++) { + hash = (hash << 5) - hash + name.charCodeAt(i) | 0 + } + return (parentid + hash >>> 0) % FS.nameTable.length + }, + hashAddNode: node => { + var hash = FS.hashName(node.parent.id, node.name); + node.name_next = FS.nameTable[hash]; + FS.nameTable[hash] = node + }, + hashRemoveNode: node => { + var hash = FS.hashName(node.parent.id, node.name); + if (FS.nameTable[hash] === node) { + FS.nameTable[hash] = node.name_next + } else { + var current = FS.nameTable[hash]; + while (current) { + if (current.name_next === node) { + current.name_next = node.name_next; + break + } + current = current.name_next + } + } + }, + lookupNode: (parent, name) => { + var errCode = FS.mayLookup(parent); + if (errCode) { + throw new FS.ErrnoError(errCode, parent) + } + var hash = FS.hashName(parent.id, name); + for (var node = FS.nameTable[hash]; node; node = node.name_next) { + var nodeName = node.name; + if (node.parent.id === parent.id && nodeName === name) { + return node + } + } + return FS.lookup(parent, name) + }, + createNode: (parent, name, mode, rdev) => { + var node = new FS.FSNode(parent, name, mode, rdev); + FS.hashAddNode(node); + return node + }, + destroyNode: node => { + FS.hashRemoveNode(node) + }, + isRoot: node => { + return node === node.parent + }, + isMountpoint: node => { + return !!node.mounted + }, + isFile: mode => { + return (mode & 61440) === 32768 + }, + isDir: mode => { + return (mode & 61440) === 16384 + }, + isLink: mode => { + return (mode & 61440) === 40960 + }, + isChrdev: mode => { + return (mode & 61440) === 8192 + }, + isBlkdev: mode => { + return (mode & 61440) === 24576 + }, + isFIFO: mode => { + return (mode & 61440) === 4096 + }, + isSocket: mode => { + return (mode & 49152) === 49152 + }, + flagModes: { + "r": 0, + "r+": 2, + "w": 577, + "w+": 578, + "a": 1089, + "a+": 1090 + }, + modeStringToFlags: str => { + var flags = FS.flagModes[str]; + if (typeof flags == "undefined") { + throw new Error("Unknown file open mode: " + str) + } + return flags + }, + flagsToPermissionString: flag => { + var perms = ["r", "w", "rw"][flag & 3]; + if (flag & 512) { + perms += "w" + } + return perms + }, + nodePermissions: (node, perms) => { + if (FS.ignorePermissions) { + return 0 + } + if (perms.includes("r") && !(node.mode & 292)) { + return 2 + } else if (perms.includes("w") && !(node.mode & 146)) { + return 2 + } else if (perms.includes("x") && !(node.mode & 73)) { + return 2 + } + return 0 + }, + mayLookup: dir => { + var errCode = FS.nodePermissions(dir, "x"); + if (errCode) return errCode; + if (!dir.node_ops.lookup) return 2; + return 0 + }, + mayCreate: (dir, name) => { + try { + var node = FS.lookupNode(dir, name); + return 20 + } catch (e) {} + return FS.nodePermissions(dir, "wx") + }, + mayDelete: (dir, name, isdir) => { + var node; + try { + node = FS.lookupNode(dir, name) + } catch (e) { + return e.errno + } + var errCode = FS.nodePermissions(dir, "wx"); + if (errCode) { + return errCode + } + if (isdir) { + if (!FS.isDir(node.mode)) { + return 54 + } + if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { + return 10 + } + } else { + if (FS.isDir(node.mode)) { + return 31 + } + } + return 0 + }, + mayOpen: (node, flags) => { + if (!node) { + return 44 + } + if (FS.isLink(node.mode)) { + return 32 + } else if (FS.isDir(node.mode)) { + if (FS.flagsToPermissionString(flags) !== "r" || flags & 512) { + return 31 + } + } + return FS.nodePermissions(node, FS.flagsToPermissionString(flags)) + }, + MAX_OPEN_FDS: 4096, + nextfd: (fd_start = 0, fd_end = FS.MAX_OPEN_FDS) => { + for (var fd = fd_start; fd <= fd_end; fd++) { + if (!FS.streams[fd]) { + return fd + } + } + throw new FS.ErrnoError(33) + }, + getStream: fd => FS.streams[fd], + createStream: (stream, fd_start, fd_end) => { + if (!FS.FSStream) { + FS.FSStream = function() { + this.shared = {} + }; + FS.FSStream.prototype = {}; + Object.defineProperties(FS.FSStream.prototype, { + object: { + get: function() { + return this.node + }, + set: function(val) { + this.node = val + } + }, + isRead: { + get: function() { + return (this.flags & 2097155) !== 1 + } + }, + isWrite: { + get: function() { + return (this.flags & 2097155) !== 0 + } + }, + isAppend: { + get: function() { + return this.flags & 1024 + } + }, + flags: { + get: function() { + return this.shared.flags + }, + set: function(val) { + this.shared.flags = val + } + }, + position: { + get: function() { + return this.shared.position + }, + set: function(val) { + this.shared.position = val + } + } + }) + } + stream = Object.assign(new FS.FSStream, stream); + var fd = FS.nextfd(fd_start, fd_end); + stream.fd = fd; + FS.streams[fd] = stream; + return stream + }, + closeStream: fd => { + FS.streams[fd] = null + }, + chrdev_stream_ops: { + open: stream => { + var device = FS.getDevice(stream.node.rdev); + stream.stream_ops = device.stream_ops; + if (stream.stream_ops.open) { + stream.stream_ops.open(stream) + } + }, + llseek: () => { + throw new FS.ErrnoError(70) + } + }, + major: dev => dev >> 8, + minor: dev => dev & 255, + makedev: (ma, mi) => ma << 8 | mi, + registerDevice: (dev, ops) => { + FS.devices[dev] = { + stream_ops: ops + } + }, + getDevice: dev => FS.devices[dev], + getMounts: mount => { + var mounts = []; + var check = [mount]; + while (check.length) { + var m = check.pop(); + mounts.push(m); + check.push.apply(check, m.mounts) + } + return mounts + }, + syncfs: (populate, callback) => { + if (typeof populate == "function") { + callback = populate; + populate = false + } + FS.syncFSRequests++; + if (FS.syncFSRequests > 1) { + err("warning: " + FS.syncFSRequests + " FS.syncfs operations in flight at once, probably just doing extra work") + } + var mounts = FS.getMounts(FS.root.mount); + var completed = 0; + + function doCallback(errCode) { + FS.syncFSRequests--; + return callback(errCode) + } + + function done(errCode) { + if (errCode) { + if (!done.errored) { + done.errored = true; + return doCallback(errCode) + } + return + } + if (++completed >= mounts.length) { + doCallback(null) + } + } + mounts.forEach(mount => { + if (!mount.type.syncfs) { + return done(null) + } + mount.type.syncfs(mount, populate, done) + }) + }, + mount: (type, opts, mountpoint) => { + var root = mountpoint === "/"; + var pseudo = !mountpoint; + var node; + if (root && FS.root) { + throw new FS.ErrnoError(10) + } else if (!root && !pseudo) { + var lookup = FS.lookupPath(mountpoint, { + follow_mount: false + }); + mountpoint = lookup.path; + node = lookup.node; + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10) + } + if (!FS.isDir(node.mode)) { + throw new FS.ErrnoError(54) + } + } + var mount = { + type: type, + opts: opts, + mountpoint: mountpoint, + mounts: [] + }; + var mountRoot = type.mount(mount); + mountRoot.mount = mount; + mount.root = mountRoot; + if (root) { + FS.root = mountRoot + } else if (node) { + node.mounted = mount; + if (node.mount) { + node.mount.mounts.push(mount) + } + } + return mountRoot + }, + unmount: mountpoint => { + var lookup = FS.lookupPath(mountpoint, { + follow_mount: false + }); + if (!FS.isMountpoint(lookup.node)) { + throw new FS.ErrnoError(28) + } + var node = lookup.node; + var mount = node.mounted; + var mounts = FS.getMounts(mount); + Object.keys(FS.nameTable).forEach(hash => { + var current = FS.nameTable[hash]; + while (current) { + var next = current.name_next; + if (mounts.includes(current.mount)) { + FS.destroyNode(current) + } + current = next + } + }); + node.mounted = null; + var idx = node.mount.mounts.indexOf(mount); + node.mount.mounts.splice(idx, 1) + }, + lookup: (parent, name) => { + return parent.node_ops.lookup(parent, name) + }, + mknod: (path, mode, dev) => { + var lookup = FS.lookupPath(path, { + parent: true + }); + var parent = lookup.node; + var name = PATH.basename(path); + if (!name || name === "." || name === "..") { + throw new FS.ErrnoError(28) + } + var errCode = FS.mayCreate(parent, name); + if (errCode) { + throw new FS.ErrnoError(errCode) + } + if (!parent.node_ops.mknod) { + throw new FS.ErrnoError(63) + } + return parent.node_ops.mknod(parent, name, mode, dev) + }, + create: (path, mode) => { + mode = mode !== undefined ? mode : 438; + mode &= 4095; + mode |= 32768; + return FS.mknod(path, mode, 0) + }, + mkdir: (path, mode) => { + mode = mode !== undefined ? mode : 511; + mode &= 511 | 512; + mode |= 16384; + return FS.mknod(path, mode, 0) + }, + mkdirTree: (path, mode) => { + var dirs = path.split("/"); + var d = ""; + for (var i = 0; i < dirs.length; ++i) { + if (!dirs[i]) continue; + d += "/" + dirs[i]; + try { + FS.mkdir(d, mode) + } catch (e) { + if (e.errno != 20) throw e + } + } + }, + mkdev: (path, mode, dev) => { + if (typeof dev == "undefined") { + dev = mode; + mode = 438 + } + mode |= 8192; + return FS.mknod(path, mode, dev) + }, + symlink: (oldpath, newpath) => { + if (!PATH_FS.resolve(oldpath)) { + throw new FS.ErrnoError(44) + } + var lookup = FS.lookupPath(newpath, { + parent: true + }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44) + } + var newname = PATH.basename(newpath); + var errCode = FS.mayCreate(parent, newname); + if (errCode) { + throw new FS.ErrnoError(errCode) + } + if (!parent.node_ops.symlink) { + throw new FS.ErrnoError(63) + } + return parent.node_ops.symlink(parent, newname, oldpath) + }, + rename: (old_path, new_path) => { + var old_dirname = PATH.dirname(old_path); + var new_dirname = PATH.dirname(new_path); + var old_name = PATH.basename(old_path); + var new_name = PATH.basename(new_path); + var lookup, old_dir, new_dir; + lookup = FS.lookupPath(old_path, { + parent: true + }); + old_dir = lookup.node; + lookup = FS.lookupPath(new_path, { + parent: true + }); + new_dir = lookup.node; + if (!old_dir || !new_dir) throw new FS.ErrnoError(44); + if (old_dir.mount !== new_dir.mount) { + throw new FS.ErrnoError(75) + } + var old_node = FS.lookupNode(old_dir, old_name); + var relative = PATH_FS.relative(old_path, new_dirname); + if (relative.charAt(0) !== ".") { + throw new FS.ErrnoError(28) + } + relative = PATH_FS.relative(new_path, old_dirname); + if (relative.charAt(0) !== ".") { + throw new FS.ErrnoError(55) + } + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name) + } catch (e) {} + if (old_node === new_node) { + return + } + var isdir = FS.isDir(old_node.mode); + var errCode = FS.mayDelete(old_dir, old_name, isdir); + if (errCode) { + throw new FS.ErrnoError(errCode) + } + errCode = new_node ? FS.mayDelete(new_dir, new_name, isdir) : FS.mayCreate(new_dir, new_name); + if (errCode) { + throw new FS.ErrnoError(errCode) + } + if (!old_dir.node_ops.rename) { + throw new FS.ErrnoError(63) + } + if (FS.isMountpoint(old_node) || new_node && FS.isMountpoint(new_node)) { + throw new FS.ErrnoError(10) + } + if (new_dir !== old_dir) { + errCode = FS.nodePermissions(old_dir, "w"); + if (errCode) { + throw new FS.ErrnoError(errCode) + } + } + FS.hashRemoveNode(old_node); + try { + old_dir.node_ops.rename(old_node, new_dir, new_name) + } catch (e) { + throw e + } finally { + FS.hashAddNode(old_node) + } + }, + rmdir: path => { + var lookup = FS.lookupPath(path, { + parent: true + }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, true); + if (errCode) { + throw new FS.ErrnoError(errCode) + } + if (!parent.node_ops.rmdir) { + throw new FS.ErrnoError(63) + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10) + } + parent.node_ops.rmdir(parent, name); + FS.destroyNode(node) + }, + readdir: path => { + var lookup = FS.lookupPath(path, { + follow: true + }); + var node = lookup.node; + if (!node.node_ops.readdir) { + throw new FS.ErrnoError(54) + } + return node.node_ops.readdir(node) + }, + unlink: path => { + var lookup = FS.lookupPath(path, { + parent: true + }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44) + } + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, false); + if (errCode) { + throw new FS.ErrnoError(errCode) + } + if (!parent.node_ops.unlink) { + throw new FS.ErrnoError(63) + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10) + } + parent.node_ops.unlink(parent, name); + FS.destroyNode(node) + }, + readlink: path => { + var lookup = FS.lookupPath(path); + var link = lookup.node; + if (!link) { + throw new FS.ErrnoError(44) + } + if (!link.node_ops.readlink) { + throw new FS.ErrnoError(28) + } + return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)) + }, + stat: (path, dontFollow) => { + var lookup = FS.lookupPath(path, { + follow: !dontFollow + }); + var node = lookup.node; + if (!node) { + throw new FS.ErrnoError(44) + } + if (!node.node_ops.getattr) { + throw new FS.ErrnoError(63) + } + return node.node_ops.getattr(node) + }, + lstat: path => { + return FS.stat(path, true) + }, + chmod: (path, mode, dontFollow) => { + var node; + if (typeof path == "string") { + var lookup = FS.lookupPath(path, { + follow: !dontFollow + }); + node = lookup.node + } else { + node = path + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63) + } + node.node_ops.setattr(node, { + mode: mode & 4095 | node.mode & ~4095, + timestamp: Date.now() + }) + }, + lchmod: (path, mode) => { + FS.chmod(path, mode, true) + }, + fchmod: (fd, mode) => { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8) + } + FS.chmod(stream.node, mode) + }, + chown: (path, uid, gid, dontFollow) => { + var node; + if (typeof path == "string") { + var lookup = FS.lookupPath(path, { + follow: !dontFollow + }); + node = lookup.node + } else { + node = path + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63) + } + node.node_ops.setattr(node, { + timestamp: Date.now() + }) + }, + lchown: (path, uid, gid) => { + FS.chown(path, uid, gid, true) + }, + fchown: (fd, uid, gid) => { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8) + } + FS.chown(stream.node, uid, gid) + }, + truncate: (path, len) => { + if (len < 0) { + throw new FS.ErrnoError(28) + } + var node; + if (typeof path == "string") { + var lookup = FS.lookupPath(path, { + follow: true + }); + node = lookup.node + } else { + node = path + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63) + } + if (FS.isDir(node.mode)) { + throw new FS.ErrnoError(31) + } + if (!FS.isFile(node.mode)) { + throw new FS.ErrnoError(28) + } + var errCode = FS.nodePermissions(node, "w"); + if (errCode) { + throw new FS.ErrnoError(errCode) + } + node.node_ops.setattr(node, { + size: len, + timestamp: Date.now() + }) + }, + ftruncate: (fd, len) => { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8) + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(28) + } + FS.truncate(stream.node, len) + }, + utime: (path, atime, mtime) => { + var lookup = FS.lookupPath(path, { + follow: true + }); + var node = lookup.node; + node.node_ops.setattr(node, { + timestamp: Math.max(atime, mtime) + }) + }, + open: (path, flags, mode) => { + if (path === "") { + throw new FS.ErrnoError(44) + } + flags = typeof flags == "string" ? FS.modeStringToFlags(flags) : flags; + mode = typeof mode == "undefined" ? 438 : mode; + if (flags & 64) { + mode = mode & 4095 | 32768 + } else { + mode = 0 + } + var node; + if (typeof path == "object") { + node = path + } else { + path = PATH.normalize(path); + try { + var lookup = FS.lookupPath(path, { + follow: !(flags & 131072) + }); + node = lookup.node + } catch (e) {} + } + var created = false; + if (flags & 64) { + if (node) { + if (flags & 128) { + throw new FS.ErrnoError(20) + } + } else { + node = FS.mknod(path, mode, 0); + created = true + } + } + if (!node) { + throw new FS.ErrnoError(44) + } + if (FS.isChrdev(node.mode)) { + flags &= ~512 + } + if (flags & 65536 && !FS.isDir(node.mode)) { + throw new FS.ErrnoError(54) + } + if (!created) { + var errCode = FS.mayOpen(node, flags); + if (errCode) { + throw new FS.ErrnoError(errCode) + } + } + if (flags & 512 && !created) { + FS.truncate(node, 0) + } + flags &= ~(128 | 512 | 131072); + var stream = FS.createStream({ + node: node, + path: FS.getPath(node), + flags: flags, + seekable: true, + position: 0, + stream_ops: node.stream_ops, + ungotten: [], + error: false + }); + if (stream.stream_ops.open) { + stream.stream_ops.open(stream) + } + if (Module["logReadFiles"] && !(flags & 1)) { + if (!FS.readFiles) FS.readFiles = {}; + if (!(path in FS.readFiles)) { + FS.readFiles[path] = 1 + } + } + return stream + }, + close: stream => { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8) + } + if (stream.getdents) stream.getdents = null; + try { + if (stream.stream_ops.close) { + stream.stream_ops.close(stream) + } + } catch (e) { + throw e + } finally { + FS.closeStream(stream.fd) + } + stream.fd = null + }, + isClosed: stream => { + return stream.fd === null + }, + llseek: (stream, offset, whence) => { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8) + } + if (!stream.seekable || !stream.stream_ops.llseek) { + throw new FS.ErrnoError(70) + } + if (whence != 0 && whence != 1 && whence != 2) { + throw new FS.ErrnoError(28) + } + stream.position = stream.stream_ops.llseek(stream, offset, whence); + stream.ungotten = []; + return stream.position + }, + read: (stream, buffer, offset, length, position) => { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28) + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8) + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(8) + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31) + } + if (!stream.stream_ops.read) { + throw new FS.ErrnoError(28) + } + var seeking = typeof position != "undefined"; + if (!seeking) { + position = stream.position + } else if (!stream.seekable) { + throw new FS.ErrnoError(70) + } + var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); + if (!seeking) stream.position += bytesRead; + return bytesRead + }, + write: (stream, buffer, offset, length, position, canOwn) => { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28) + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8) + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8) + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31) + } + if (!stream.stream_ops.write) { + throw new FS.ErrnoError(28) + } + if (stream.seekable && stream.flags & 1024) { + FS.llseek(stream, 0, 2) + } + var seeking = typeof position != "undefined"; + if (!seeking) { + position = stream.position + } else if (!stream.seekable) { + throw new FS.ErrnoError(70) + } + var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); + if (!seeking) stream.position += bytesWritten; + return bytesWritten + }, + allocate: (stream, offset, length) => { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8) + } + if (offset < 0 || length <= 0) { + throw new FS.ErrnoError(28) + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8) + } + if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(43) + } + if (!stream.stream_ops.allocate) { + throw new FS.ErrnoError(138) + } + stream.stream_ops.allocate(stream, offset, length) + }, + mmap: (stream, length, position, prot, flags) => { + if ((prot & 2) !== 0 && (flags & 2) === 0 && (stream.flags & 2097155) !== 2) { + throw new FS.ErrnoError(2) + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(2) + } + if (!stream.stream_ops.mmap) { + throw new FS.ErrnoError(43) + } + return stream.stream_ops.mmap(stream, length, position, prot, flags) + }, + msync: (stream, buffer, offset, length, mmapFlags) => { + if (!stream || !stream.stream_ops.msync) { + return 0 + } + return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags) + }, + munmap: stream => 0, + ioctl: (stream, cmd, arg) => { + if (!stream.stream_ops.ioctl) { + throw new FS.ErrnoError(59) + } + return stream.stream_ops.ioctl(stream, cmd, arg) + }, + readFile: (path, opts = {}) => { + opts.flags = opts.flags || 0; + opts.encoding = opts.encoding || "binary"; + if (opts.encoding !== "utf8" && opts.encoding !== "binary") { + throw new Error('Invalid encoding type "' + opts.encoding + '"') + } + var ret; + var stream = FS.open(path, opts.flags); + var stat = FS.stat(path); + var length = stat.size; + var buf = new Uint8Array(length); + FS.read(stream, buf, 0, length, 0); + if (opts.encoding === "utf8") { + ret = UTF8ArrayToString(buf, 0) + } else if (opts.encoding === "binary") { + ret = buf + } + FS.close(stream); + return ret + }, + writeFile: (path, data, opts = {}) => { + opts.flags = opts.flags || 577; + var stream = FS.open(path, opts.flags, opts.mode); + if (typeof data == "string") { + var buf = new Uint8Array(lengthBytesUTF8(data) + 1); + var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); + FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn) + } else if (ArrayBuffer.isView(data)) { + FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn) + } else { + throw new Error("Unsupported data type") + } + FS.close(stream) + }, + cwd: () => FS.currentPath, + chdir: path => { + var lookup = FS.lookupPath(path, { + follow: true + }); + if (lookup.node === null) { + throw new FS.ErrnoError(44) + } + if (!FS.isDir(lookup.node.mode)) { + throw new FS.ErrnoError(54) + } + var errCode = FS.nodePermissions(lookup.node, "x"); + if (errCode) { + throw new FS.ErrnoError(errCode) + } + FS.currentPath = lookup.path + }, + createDefaultDirectories: () => { + FS.mkdir("/tmp"); + FS.mkdir("/home"); + FS.mkdir("/home/web_user") + }, + createDefaultDevices: () => { + FS.mkdir("/dev"); + FS.registerDevice(FS.makedev(1, 3), { + read: () => 0, + write: (stream, buffer, offset, length, pos) => length + }); + FS.mkdev("/dev/null", FS.makedev(1, 3)); + TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); + TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); + FS.mkdev("/dev/tty", FS.makedev(5, 0)); + FS.mkdev("/dev/tty1", FS.makedev(6, 0)); + var random_device = getRandomDevice(); + FS.createDevice("/dev", "random", random_device); + FS.createDevice("/dev", "urandom", random_device); + FS.mkdir("/dev/shm"); + FS.mkdir("/dev/shm/tmp") + }, + createSpecialDirectories: () => { + FS.mkdir("/proc"); + var proc_self = FS.mkdir("/proc/self"); + FS.mkdir("/proc/self/fd"); + FS.mount({ + mount: () => { + var node = FS.createNode(proc_self, "fd", 16384 | 511, 73); + node.node_ops = { + lookup: (parent, name) => { + var fd = +name; + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + var ret = { + parent: null, + mount: { + mountpoint: "fake" + }, + node_ops: { + readlink: () => stream.path + } + }; + ret.parent = ret; + return ret + } + }; + return node + } + }, {}, "/proc/self/fd") + }, + createStandardStreams: () => { + if (Module["stdin"]) { + FS.createDevice("/dev", "stdin", Module["stdin"]) + } else { + FS.symlink("/dev/tty", "/dev/stdin") + } + if (Module["stdout"]) { + FS.createDevice("/dev", "stdout", null, Module["stdout"]) + } else { + FS.symlink("/dev/tty", "/dev/stdout") + } + if (Module["stderr"]) { + FS.createDevice("/dev", "stderr", null, Module["stderr"]) + } else { + FS.symlink("/dev/tty1", "/dev/stderr") + } + var stdin = FS.open("/dev/stdin", 0); + var stdout = FS.open("/dev/stdout", 1); + var stderr = FS.open("/dev/stderr", 1) + }, + ensureErrnoError: () => { + if (FS.ErrnoError) return; + FS.ErrnoError = function ErrnoError(errno, node) { + this.node = node; + this.setErrno = function(errno) { + this.errno = errno + }; + this.setErrno(errno); + this.message = "FS error" + }; + FS.ErrnoError.prototype = new Error; + FS.ErrnoError.prototype.constructor = FS.ErrnoError; + [44].forEach(code => { + FS.genericErrors[code] = new FS.ErrnoError(code); + FS.genericErrors[code].stack = "" + }) + }, + staticInit: () => { + FS.ensureErrnoError(); + FS.nameTable = new Array(4096); + FS.mount(MEMFS, {}, "/"); + FS.createDefaultDirectories(); + FS.createDefaultDevices(); + FS.createSpecialDirectories(); + FS.filesystems = { + "MEMFS": MEMFS, + "IDBFS": IDBFS + } + }, + init: (input, output, error) => { + FS.init.initialized = true; + FS.ensureErrnoError(); + Module["stdin"] = input || Module["stdin"]; + Module["stdout"] = output || Module["stdout"]; + Module["stderr"] = error || Module["stderr"]; + FS.createStandardStreams() + }, + quit: () => { + FS.init.initialized = false; + _fflush(0); + for (var i = 0; i < FS.streams.length; i++) { + var stream = FS.streams[i]; + if (!stream) { + continue + } + FS.close(stream) + } + }, + getMode: (canRead, canWrite) => { + var mode = 0; + if (canRead) mode |= 292 | 73; + if (canWrite) mode |= 146; + return mode + }, + findObject: (path, dontResolveLastLink) => { + var ret = FS.analyzePath(path, dontResolveLastLink); + if (ret.exists) { + return ret.object + } else { + return null + } + }, + analyzePath: (path, dontResolveLastLink) => { + try { + var lookup = FS.lookupPath(path, { + follow: !dontResolveLastLink + }); + path = lookup.path + } catch (e) {} + var ret = { + isRoot: false, + exists: false, + error: 0, + name: null, + path: null, + object: null, + parentExists: false, + parentPath: null, + parentObject: null + }; + try { + var lookup = FS.lookupPath(path, { + parent: true + }); + ret.parentExists = true; + ret.parentPath = lookup.path; + ret.parentObject = lookup.node; + ret.name = PATH.basename(path); + lookup = FS.lookupPath(path, { + follow: !dontResolveLastLink + }); + ret.exists = true; + ret.path = lookup.path; + ret.object = lookup.node; + ret.name = lookup.node.name; + ret.isRoot = lookup.path === "/" + } catch (e) { + ret.error = e.errno + } + return ret + }, + createPath: (parent, path, canRead, canWrite) => { + parent = typeof parent == "string" ? parent : FS.getPath(parent); + var parts = path.split("/").reverse(); + while (parts.length) { + var part = parts.pop(); + if (!part) continue; + var current = PATH.join2(parent, part); + try { + FS.mkdir(current) + } catch (e) {} + parent = current + } + return current + }, + createFile: (parent, name, properties, canRead, canWrite) => { + var path = PATH.join2(typeof parent == "string" ? parent : FS.getPath(parent), name); + var mode = FS.getMode(canRead, canWrite); + return FS.create(path, mode) + }, + createDataFile: (parent, name, data, canRead, canWrite, canOwn) => { + var path = name; + if (parent) { + parent = typeof parent == "string" ? parent : FS.getPath(parent); + path = name ? PATH.join2(parent, name) : parent + } + var mode = FS.getMode(canRead, canWrite); + var node = FS.create(path, mode); + if (data) { + if (typeof data == "string") { + var arr = new Array(data.length); + for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); + data = arr + } + FS.chmod(node, mode | 146); + var stream = FS.open(node, 577); + FS.write(stream, data, 0, data.length, 0, canOwn); + FS.close(stream); + FS.chmod(node, mode) + } + return node + }, + createDevice: (parent, name, input, output) => { + var path = PATH.join2(typeof parent == "string" ? parent : FS.getPath(parent), name); + var mode = FS.getMode(!!input, !!output); + if (!FS.createDevice.major) FS.createDevice.major = 64; + var dev = FS.makedev(FS.createDevice.major++, 0); + FS.registerDevice(dev, { + open: stream => { + stream.seekable = false + }, + close: stream => { + if (output && output.buffer && output.buffer.length) { + output(10) + } + }, + read: (stream, buffer, offset, length, pos) => { + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = input() + } catch (e) { + throw new FS.ErrnoError(29) + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6) + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset + i] = result + } + if (bytesRead) { + stream.node.timestamp = Date.now() + } + return bytesRead + }, + write: (stream, buffer, offset, length, pos) => { + for (var i = 0; i < length; i++) { + try { + output(buffer[offset + i]) + } catch (e) { + throw new FS.ErrnoError(29) + } + } + if (length) { + stream.node.timestamp = Date.now() + } + return i + } + }); + return FS.mkdev(path, mode, dev) + }, + forceLoadFile: obj => { + if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; + if (typeof XMLHttpRequest != "undefined") { + throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.") + } else if (read_) { + try { + obj.contents = intArrayFromString(read_(obj.url), true); + obj.usedBytes = obj.contents.length + } catch (e) { + throw new FS.ErrnoError(29) + } + } else { + throw new Error("Cannot load without read() or XMLHttpRequest.") + } + }, + createLazyFile: (parent, name, url, canRead, canWrite) => { + function LazyUint8Array() { + this.lengthKnown = false; + this.chunks = [] + } + LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) { + if (idx > this.length - 1 || idx < 0) { + return undefined + } + var chunkOffset = idx % this.chunkSize; + var chunkNum = idx / this.chunkSize | 0; + return this.getter(chunkNum)[chunkOffset] + }; + LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { + this.getter = getter + }; + LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { + var xhr = new XMLHttpRequest; + xhr.open("HEAD", url, false); + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + var datalength = Number(xhr.getResponseHeader("Content-length")); + var header; + var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; + var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip"; + var chunkSize = 1024 * 1024; + if (!hasByteServing) chunkSize = datalength; + var doXHR = (from, to) => { + if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); + if (to > datalength - 1) throw new Error("only " + datalength + " bytes available! programmer error!"); + var xhr = new XMLHttpRequest; + xhr.open("GET", url, false); + if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); + xhr.responseType = "arraybuffer"; + if (xhr.overrideMimeType) { + xhr.overrideMimeType("text/plain; charset=x-user-defined") + } + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + if (xhr.response !== undefined) { + return new Uint8Array(xhr.response || []) + } else { + return intArrayFromString(xhr.responseText || "", true) + } + }; + var lazyArray = this; + lazyArray.setDataGetter(chunkNum => { + var start = chunkNum * chunkSize; + var end = (chunkNum + 1) * chunkSize - 1; + end = Math.min(end, datalength - 1); + if (typeof lazyArray.chunks[chunkNum] == "undefined") { + lazyArray.chunks[chunkNum] = doXHR(start, end) + } + if (typeof lazyArray.chunks[chunkNum] == "undefined") throw new Error("doXHR failed!"); + return lazyArray.chunks[chunkNum] + }); + if (usesGzip || !datalength) { + chunkSize = datalength = 1; + datalength = this.getter(0).length; + chunkSize = datalength; + out("LazyFiles on gzip forces download of the whole file when length is accessed") + } + this._length = datalength; + this._chunkSize = chunkSize; + this.lengthKnown = true + }; + if (typeof XMLHttpRequest != "undefined") { + if (!ENVIRONMENT_IS_WORKER) throw "Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc"; + var lazyArray = new LazyUint8Array; + Object.defineProperties(lazyArray, { + length: { + get: function() { + if (!this.lengthKnown) { + this.cacheLength() + } + return this._length + } + }, + chunkSize: { + get: function() { + if (!this.lengthKnown) { + this.cacheLength() + } + return this._chunkSize + } + } + }); + var properties = { + isDevice: false, + contents: lazyArray + } + } else { + var properties = { + isDevice: false, + url: url + } + } + var node = FS.createFile(parent, name, properties, canRead, canWrite); + if (properties.contents) { + node.contents = properties.contents + } else if (properties.url) { + node.contents = null; + node.url = properties.url + } + Object.defineProperties(node, { + usedBytes: { + get: function() { + return this.contents.length + } + } + }); + var stream_ops = {}; + var keys = Object.keys(node.stream_ops); + keys.forEach(key => { + var fn = node.stream_ops[key]; + stream_ops[key] = function forceLoadLazyFile() { + FS.forceLoadFile(node); + return fn.apply(null, arguments) + } + }); + + function writeChunks(stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= contents.length) return 0; + var size = Math.min(contents.length - position, length); + if (contents.slice) { + for (var i = 0; i < size; i++) { + buffer[offset + i] = contents[position + i] + } + } else { + for (var i = 0; i < size; i++) { + buffer[offset + i] = contents.get(position + i) + } + } + return size + } + stream_ops.read = (stream, buffer, offset, length, position) => { + FS.forceLoadFile(node); + return writeChunks(stream, buffer, offset, length, position) + }; + stream_ops.mmap = (stream, length, position, prot, flags) => { + FS.forceLoadFile(node); + var ptr = mmapAlloc(length); + if (!ptr) { + throw new FS.ErrnoError(48) + } + writeChunks(stream, HEAP8, ptr, length, position); + return { + ptr: ptr, + allocated: true + } + }; + node.stream_ops = stream_ops; + return node + }, + createPreloadedFile: (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) => { + var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent; + var dep = getUniqueRunDependency("cp " + fullname); + + function processData(byteArray) { + function finish(byteArray) { + if (preFinish) preFinish(); + if (!dontCreateFile) { + FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn) + } + if (onload) onload(); + removeRunDependency(dep) + } + if (Browser.handledByPreloadPlugin(byteArray, fullname, finish, () => { + if (onerror) onerror(); + removeRunDependency(dep) + })) { + return + } + finish(byteArray) + } + addRunDependency(dep); + if (typeof url == "string") { + asyncLoad(url, byteArray => processData(byteArray), onerror) + } else { + processData(url) + } + }, + indexedDB: () => { + return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB + }, + DB_NAME: () => { + return "EM_FS_" + window.location.pathname + }, + DB_VERSION: 20, + DB_STORE_NAME: "FILE_DATA", + saveFilesToDB: (paths, onload, onerror) => { + onload = onload || (() => {}); + onerror = onerror || (() => {}); + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION) + } catch (e) { + return onerror(e) + } + openRequest.onupgradeneeded = () => { + out("creating db"); + var db = openRequest.result; + db.createObjectStore(FS.DB_STORE_NAME) + }; + openRequest.onsuccess = () => { + var db = openRequest.result; + var transaction = db.transaction([FS.DB_STORE_NAME], "readwrite"); + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, + fail = 0, + total = paths.length; + + function finish() { + if (fail == 0) onload(); + else onerror() + } + paths.forEach(path => { + var putRequest = files.put(FS.analyzePath(path).object.contents, path); + putRequest.onsuccess = () => { + ok++; + if (ok + fail == total) finish() + }; + putRequest.onerror = () => { + fail++; + if (ok + fail == total) finish() + } + }); + transaction.onerror = onerror + }; + openRequest.onerror = onerror + }, + loadFilesFromDB: (paths, onload, onerror) => { + onload = onload || (() => {}); + onerror = onerror || (() => {}); + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION) + } catch (e) { + return onerror(e) + } + openRequest.onupgradeneeded = onerror; + openRequest.onsuccess = () => { + var db = openRequest.result; + try { + var transaction = db.transaction([FS.DB_STORE_NAME], "readonly") + } catch (e) { + onerror(e); + return + } + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, + fail = 0, + total = paths.length; + + function finish() { + if (fail == 0) onload(); + else onerror() + } + paths.forEach(path => { + var getRequest = files.get(path); + getRequest.onsuccess = () => { + if (FS.analyzePath(path).exists) { + FS.unlink(path) + } + FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); + ok++; + if (ok + fail == total) finish() + }; + getRequest.onerror = () => { + fail++; + if (ok + fail == total) finish() + } + }); + transaction.onerror = onerror + }; + openRequest.onerror = onerror + } + }; + var SYSCALLS = { + DEFAULT_POLLMASK: 5, + calculateAt: function(dirfd, path, allowEmpty) { + if (PATH.isAbs(path)) { + return path + } + var dir; + if (dirfd === -100) { + dir = FS.cwd() + } else { + var dirstream = FS.getStream(dirfd); + if (!dirstream) throw new FS.ErrnoError(8); + dir = dirstream.path + } + if (path.length == 0) { + if (!allowEmpty) { + throw new FS.ErrnoError(44) + } + return dir + } + return PATH.join2(dir, path) + }, + doStat: function(func, path, buf) { + try { + var stat = func(path) + } catch (e) { + if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { + return -54 + } + throw e + } + HEAP32[buf >> 2] = stat.dev; + HEAP32[buf + 4 >> 2] = 0; + HEAP32[buf + 8 >> 2] = stat.ino; + HEAP32[buf + 12 >> 2] = stat.mode; + HEAP32[buf + 16 >> 2] = stat.nlink; + HEAP32[buf + 20 >> 2] = stat.uid; + HEAP32[buf + 24 >> 2] = stat.gid; + HEAP32[buf + 28 >> 2] = stat.rdev; + HEAP32[buf + 32 >> 2] = 0; + tempI64 = [stat.size >>> 0, (tempDouble = stat.size, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0)], HEAP32[buf + 40 >> 2] = tempI64[0], HEAP32[buf + 44 >> 2] = tempI64[1]; + HEAP32[buf + 48 >> 2] = 4096; + HEAP32[buf + 52 >> 2] = stat.blocks; + HEAP32[buf + 56 >> 2] = stat.atime.getTime() / 1e3 | 0; + HEAP32[buf + 60 >> 2] = 0; + HEAP32[buf + 64 >> 2] = stat.mtime.getTime() / 1e3 | 0; + HEAP32[buf + 68 >> 2] = 0; + HEAP32[buf + 72 >> 2] = stat.ctime.getTime() / 1e3 | 0; + HEAP32[buf + 76 >> 2] = 0; + tempI64 = [stat.ino >>> 0, (tempDouble = stat.ino, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0)], HEAP32[buf + 80 >> 2] = tempI64[0], HEAP32[buf + 84 >> 2] = tempI64[1]; + return 0 + }, + doMsync: function(addr, stream, len, flags, offset) { + var buffer = HEAPU8.slice(addr, addr + len); + FS.msync(stream, buffer, offset, len, flags) + }, + varargs: undefined, + get: function() { + SYSCALLS.varargs += 4; + var ret = HEAP32[SYSCALLS.varargs - 4 >> 2]; + return ret + }, + getStr: function(ptr) { + var ret = UTF8ToString(ptr); + return ret + }, + getStreamFromFD: function(fd) { + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + return stream + } + }; + + function ___syscall__newselect(nfds, readfds, writefds, exceptfds, timeout) { + try { + var total = 0; + var srcReadLow = readfds ? HEAP32[readfds >> 2] : 0, + srcReadHigh = readfds ? HEAP32[readfds + 4 >> 2] : 0; + var srcWriteLow = writefds ? HEAP32[writefds >> 2] : 0, + srcWriteHigh = writefds ? HEAP32[writefds + 4 >> 2] : 0; + var srcExceptLow = exceptfds ? HEAP32[exceptfds >> 2] : 0, + srcExceptHigh = exceptfds ? HEAP32[exceptfds + 4 >> 2] : 0; + var dstReadLow = 0, + dstReadHigh = 0; + var dstWriteLow = 0, + dstWriteHigh = 0; + var dstExceptLow = 0, + dstExceptHigh = 0; + var allLow = (readfds ? HEAP32[readfds >> 2] : 0) | (writefds ? HEAP32[writefds >> 2] : 0) | (exceptfds ? HEAP32[exceptfds >> 2] : 0); + var allHigh = (readfds ? HEAP32[readfds + 4 >> 2] : 0) | (writefds ? HEAP32[writefds + 4 >> 2] : 0) | (exceptfds ? HEAP32[exceptfds + 4 >> 2] : 0); + var check = function(fd, low, high, val) { + return fd < 32 ? low & val : high & val + }; + for (var fd = 0; fd < nfds; fd++) { + var mask = 1 << fd % 32; + if (!check(fd, allLow, allHigh, mask)) { + continue + } + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + var flags = SYSCALLS.DEFAULT_POLLMASK; + if (stream.stream_ops.poll) { + flags = stream.stream_ops.poll(stream) + } + if (flags & 1 && check(fd, srcReadLow, srcReadHigh, mask)) { + fd < 32 ? dstReadLow = dstReadLow | mask : dstReadHigh = dstReadHigh | mask; + total++ + } + if (flags & 4 && check(fd, srcWriteLow, srcWriteHigh, mask)) { + fd < 32 ? dstWriteLow = dstWriteLow | mask : dstWriteHigh = dstWriteHigh | mask; + total++ + } + if (flags & 2 && check(fd, srcExceptLow, srcExceptHigh, mask)) { + fd < 32 ? dstExceptLow = dstExceptLow | mask : dstExceptHigh = dstExceptHigh | mask; + total++ + } + } + if (readfds) { + HEAP32[readfds >> 2] = dstReadLow; + HEAP32[readfds + 4 >> 2] = dstReadHigh + } + if (writefds) { + HEAP32[writefds >> 2] = dstWriteLow; + HEAP32[writefds + 4 >> 2] = dstWriteHigh + } + if (exceptfds) { + HEAP32[exceptfds >> 2] = dstExceptLow; + HEAP32[exceptfds + 4 >> 2] = dstExceptHigh + } + return total + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + var SOCKFS = { + mount: function(mount) { + Module["websocket"] = Module["websocket"] && "object" === typeof Module["websocket"] ? Module["websocket"] : {}; + Module["websocket"]._callbacks = {}; + Module["websocket"]["on"] = function(event, callback) { + if ("function" === typeof callback) { + this._callbacks[event] = callback + } + return this + }; + Module["websocket"].emit = function(event, param) { + if ("function" === typeof this._callbacks[event]) { + this._callbacks[event].call(this, param) + } + }; + return FS.createNode(null, "/", 16384 | 511, 0) + }, + createSocket: function(family, type, protocol) { + type &= ~526336; + var streaming = type == 1; + if (streaming && protocol && protocol != 6) { + throw new FS.ErrnoError(66) + } + var sock = { + family: family, + type: type, + protocol: protocol, + server: null, + error: null, + peers: {}, + pending: [], + recv_queue: [], + sock_ops: SOCKFS.websocket_sock_ops + }; + var name = SOCKFS.nextname(); + var node = FS.createNode(SOCKFS.root, name, 49152, 0); + node.sock = sock; + var stream = FS.createStream({ + path: name, + node: node, + flags: 2, + seekable: false, + stream_ops: SOCKFS.stream_ops + }); + sock.stream = stream; + return sock + }, + getSocket: function(fd) { + var stream = FS.getStream(fd); + if (!stream || !FS.isSocket(stream.node.mode)) { + return null + } + return stream.node.sock + }, + stream_ops: { + poll: function(stream) { + var sock = stream.node.sock; + return sock.sock_ops.poll(sock) + }, + ioctl: function(stream, request, varargs) { + var sock = stream.node.sock; + return sock.sock_ops.ioctl(sock, request, varargs) + }, + read: function(stream, buffer, offset, length, position) { + var sock = stream.node.sock; + var msg = sock.sock_ops.recvmsg(sock, length); + if (!msg) { + return 0 + } + buffer.set(msg.buffer, offset); + return msg.buffer.length + }, + write: function(stream, buffer, offset, length, position) { + var sock = stream.node.sock; + return sock.sock_ops.sendmsg(sock, buffer, offset, length) + }, + close: function(stream) { + var sock = stream.node.sock; + sock.sock_ops.close(sock) + } + }, + nextname: function() { + if (!SOCKFS.nextname.current) { + SOCKFS.nextname.current = 0 + } + return "socket[" + SOCKFS.nextname.current++ + "]" + }, + websocket_sock_ops: { + createPeer: function(sock, addr, port) { + var ws; + if (typeof addr == "object") { + ws = addr; + addr = null; + port = null + } + if (ws) { + if (ws._socket) { + addr = ws._socket.remoteAddress; + port = ws._socket.remotePort + } else { + var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url); + if (!result) { + throw new Error("WebSocket URL must be in the format ws(s)://address:port") + } + addr = result[1]; + port = parseInt(result[2], 10) + } + } else { + try { + var runtimeConfig = Module["websocket"] && "object" === typeof Module["websocket"]; + var url = "ws:#".replace("#", "//"); + if (runtimeConfig) { + if ("string" === typeof Module["websocket"]["url"]) { + url = Module["websocket"]["url"] + } + } + if (url === "ws://" || url === "wss://") { + var parts = addr.split("/"); + url = url + parts[0] + ":" + port + "/" + parts.slice(1).join("/") + } + var subProtocols = "binary"; + if (runtimeConfig) { + if ("string" === typeof Module["websocket"]["subprotocol"]) { + subProtocols = Module["websocket"]["subprotocol"] + } + } + var opts = undefined; + if (subProtocols !== "null") { + subProtocols = subProtocols.replace(/^ +| +$/g, "").split(/ *, */); + opts = subProtocols + } + if (runtimeConfig && null === Module["websocket"]["subprotocol"]) { + subProtocols = "null"; + opts = undefined + } + var WebSocketConstructor; { + WebSocketConstructor = WebSocket + } + ws = new WebSocketConstructor(url, opts); + ws.binaryType = "arraybuffer" + } catch (e) { + throw new FS.ErrnoError(23) + } + } + var peer = { + addr: addr, + port: port, + socket: ws, + dgram_send_queue: [] + }; + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer); + if (sock.type === 2 && typeof sock.sport != "undefined") { + peer.dgram_send_queue.push(new Uint8Array([255, 255, 255, 255, "p".charCodeAt(0), "o".charCodeAt(0), "r".charCodeAt(0), "t".charCodeAt(0), (sock.sport & 65280) >> 8, sock.sport & 255])) + } + return peer + }, + getPeer: function(sock, addr, port) { + return sock.peers[addr + ":" + port] + }, + addPeer: function(sock, peer) { + sock.peers[peer.addr + ":" + peer.port] = peer + }, + removePeer: function(sock, peer) { + delete sock.peers[peer.addr + ":" + peer.port] + }, + handlePeerEvents: function(sock, peer) { + var first = true; + var handleOpen = function() { + Module["websocket"].emit("open", sock.stream.fd); + try { + var queued = peer.dgram_send_queue.shift(); + while (queued) { + peer.socket.send(queued); + queued = peer.dgram_send_queue.shift() + } + } catch (e) { + peer.socket.close() + } + }; + + function handleMessage(data) { + if (typeof data == "string") { + var encoder = new TextEncoder; + data = encoder.encode(data) + } else { + assert(data.byteLength !== undefined); + if (data.byteLength == 0) { + return + } else { + data = new Uint8Array(data) + } + } + var wasfirst = first; + first = false; + if (wasfirst && data.length === 10 && data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 && data[4] === "p".charCodeAt(0) && data[5] === "o".charCodeAt(0) && data[6] === "r".charCodeAt(0) && data[7] === "t".charCodeAt(0)) { + var newport = data[8] << 8 | data[9]; + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + peer.port = newport; + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + return + } + sock.recv_queue.push({ + addr: peer.addr, + port: peer.port, + data: data + }); + Module["websocket"].emit("message", sock.stream.fd) + } + if (ENVIRONMENT_IS_NODE) { + peer.socket.on("open", handleOpen); + peer.socket.on("message", function(data, isBinary) { + if (!isBinary) { + return + } + handleMessage(new Uint8Array(data).buffer) + }); + peer.socket.on("close", function() { + Module["websocket"].emit("close", sock.stream.fd) + }); + peer.socket.on("error", function(error) { + sock.error = 14; + Module["websocket"].emit("error", [sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused"]) + }) + } else { + peer.socket.onopen = handleOpen; + peer.socket.onclose = function() { + Module["websocket"].emit("close", sock.stream.fd) + }; + peer.socket.onmessage = function peer_socket_onmessage(event) { + handleMessage(event.data) + }; + peer.socket.onerror = function(error) { + sock.error = 14; + Module["websocket"].emit("error", [sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused"]) + } + } + }, + poll: function(sock) { + if (sock.type === 1 && sock.server) { + return sock.pending.length ? 64 | 1 : 0 + } + var mask = 0; + var dest = sock.type === 1 ? SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) : null; + if (sock.recv_queue.length || !dest || dest && dest.socket.readyState === dest.socket.CLOSING || dest && dest.socket.readyState === dest.socket.CLOSED) { + mask |= 64 | 1 + } + if (!dest || dest && dest.socket.readyState === dest.socket.OPEN) { + mask |= 4 + } + if (dest && dest.socket.readyState === dest.socket.CLOSING || dest && dest.socket.readyState === dest.socket.CLOSED) { + mask |= 16 + } + return mask + }, + ioctl: function(sock, request, arg) { + switch (request) { + case 21531: + var bytes = 0; + if (sock.recv_queue.length) { + bytes = sock.recv_queue[0].data.length + } + HEAP32[arg >> 2] = bytes; + return 0; + default: + return 28 + } + }, + close: function(sock) { + if (sock.server) { + try { + sock.server.close() + } catch (e) {} + sock.server = null + } + var peers = Object.keys(sock.peers); + for (var i = 0; i < peers.length; i++) { + var peer = sock.peers[peers[i]]; + try { + peer.socket.close() + } catch (e) {} + SOCKFS.websocket_sock_ops.removePeer(sock, peer) + } + return 0 + }, + bind: function(sock, addr, port) { + if (typeof sock.saddr != "undefined" || typeof sock.sport != "undefined") { + throw new FS.ErrnoError(28) + } + sock.saddr = addr; + sock.sport = port; + if (sock.type === 2) { + if (sock.server) { + sock.server.close(); + sock.server = null + } + try { + sock.sock_ops.listen(sock, 0) + } catch (e) { + if (!(e instanceof FS.ErrnoError)) throw e; + if (e.errno !== 138) throw e + } + } + }, + connect: function(sock, addr, port) { + if (sock.server) { + throw new FS.ErrnoError(138) + } + if (typeof sock.daddr != "undefined" && typeof sock.dport != "undefined") { + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport); + if (dest) { + if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(7) + } else { + throw new FS.ErrnoError(30) + } + } + } + var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + sock.daddr = peer.addr; + sock.dport = peer.port; + throw new FS.ErrnoError(26) + }, + listen: function(sock, backlog) { + if (!ENVIRONMENT_IS_NODE) { + throw new FS.ErrnoError(138) + } + }, + accept: function(listensock) { + if (!listensock.server || !listensock.pending.length) { + throw new FS.ErrnoError(28) + } + var newsock = listensock.pending.shift(); + newsock.stream.flags = listensock.stream.flags; + return newsock + }, + getname: function(sock, peer) { + var addr, port; + if (peer) { + if (sock.daddr === undefined || sock.dport === undefined) { + throw new FS.ErrnoError(53) + } + addr = sock.daddr; + port = sock.dport + } else { + addr = sock.saddr || 0; + port = sock.sport || 0 + } + return { + addr: addr, + port: port + } + }, + sendmsg: function(sock, buffer, offset, length, addr, port) { + if (sock.type === 2) { + if (addr === undefined || port === undefined) { + addr = sock.daddr; + port = sock.dport + } + if (addr === undefined || port === undefined) { + throw new FS.ErrnoError(17) + } + } else { + addr = sock.daddr; + port = sock.dport + } + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port); + if (sock.type === 1) { + if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + throw new FS.ErrnoError(53) + } else if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(6) + } + } + if (ArrayBuffer.isView(buffer)) { + offset += buffer.byteOffset; + buffer = buffer.buffer + } + var data; + data = buffer.slice(offset, offset + length); + if (sock.type === 2) { + if (!dest || dest.socket.readyState !== dest.socket.OPEN) { + if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port) + } + dest.dgram_send_queue.push(data); + return length + } + } + try { + dest.socket.send(data); + return length + } catch (e) { + throw new FS.ErrnoError(28) + } + }, + recvmsg: function(sock, length) { + if (sock.type === 1 && sock.server) { + throw new FS.ErrnoError(53) + } + var queued = sock.recv_queue.shift(); + if (!queued) { + if (sock.type === 1) { + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport); + if (!dest) { + throw new FS.ErrnoError(53) + } else if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + return null + } else { + throw new FS.ErrnoError(6) + } + } else { + throw new FS.ErrnoError(6) + } + } + var queuedLength = queued.data.byteLength || queued.data.length; + var queuedOffset = queued.data.byteOffset || 0; + var queuedBuffer = queued.data.buffer || queued.data; + var bytesRead = Math.min(length, queuedLength); + var res = { + buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead), + addr: queued.addr, + port: queued.port + }; + if (sock.type === 1 && bytesRead < queuedLength) { + var bytesRemaining = queuedLength - bytesRead; + queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining); + sock.recv_queue.unshift(queued) + } + return res + } + } + }; + + function getSocketFromFD(fd) { + var socket = SOCKFS.getSocket(fd); + if (!socket) throw new FS.ErrnoError(8); + return socket + } + + function setErrNo(value) { + HEAP32[___errno_location() >> 2] = value; + return value + } + + function inetPton4(str) { + var b = str.split("."); + for (var i = 0; i < 4; i++) { + var tmp = Number(b[i]); + if (isNaN(tmp)) return null; + b[i] = tmp + } + return (b[0] | b[1] << 8 | b[2] << 16 | b[3] << 24) >>> 0 + } + + function jstoi_q(str) { + return parseInt(str) + } + + function inetPton6(str) { + var words; + var w, offset, z; + var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i; + var parts = []; + if (!valid6regx.test(str)) { + return null + } + if (str === "::") { + return [0, 0, 0, 0, 0, 0, 0, 0] + } + if (str.startsWith("::")) { + str = str.replace("::", "Z:") + } else { + str = str.replace("::", ":Z:") + } + if (str.indexOf(".") > 0) { + str = str.replace(new RegExp("[.]", "g"), ":"); + words = str.split(":"); + words[words.length - 4] = jstoi_q(words[words.length - 4]) + jstoi_q(words[words.length - 3]) * 256; + words[words.length - 3] = jstoi_q(words[words.length - 2]) + jstoi_q(words[words.length - 1]) * 256; + words = words.slice(0, words.length - 2) + } else { + words = str.split(":") + } + offset = 0; + z = 0; + for (w = 0; w < words.length; w++) { + if (typeof words[w] == "string") { + if (words[w] === "Z") { + for (z = 0; z < 8 - words.length + 1; z++) { + parts[w + z] = 0 + } + offset = z - 1 + } else { + parts[w + offset] = _htons(parseInt(words[w], 16)) + } + } else { + parts[w + offset] = words[w] + } + } + return [parts[1] << 16 | parts[0], parts[3] << 16 | parts[2], parts[5] << 16 | parts[4], parts[7] << 16 | parts[6]] + } + + function writeSockaddr(sa, family, addr, port, addrlen) { + switch (family) { + case 2: + addr = inetPton4(addr); + zeroMemory(sa, 16); + if (addrlen) { + HEAP32[addrlen >> 2] = 16 + } + HEAP16[sa >> 1] = family; + HEAP32[sa + 4 >> 2] = addr; + HEAP16[sa + 2 >> 1] = _htons(port); + break; + case 10: + addr = inetPton6(addr); + zeroMemory(sa, 28); + if (addrlen) { + HEAP32[addrlen >> 2] = 28 + } + HEAP32[sa >> 2] = family; + HEAP32[sa + 8 >> 2] = addr[0]; + HEAP32[sa + 12 >> 2] = addr[1]; + HEAP32[sa + 16 >> 2] = addr[2]; + HEAP32[sa + 20 >> 2] = addr[3]; + HEAP16[sa + 2 >> 1] = _htons(port); + break; + default: + return 5 + } + return 0 + } + var DNS = { + address_map: { + id: 1, + addrs: {}, + names: {} + }, + lookup_name: function(name) { + var res = inetPton4(name); + if (res !== null) { + return name + } + res = inetPton6(name); + if (res !== null) { + return name + } + var addr; + if (DNS.address_map.addrs[name]) { + addr = DNS.address_map.addrs[name] + } else { + var id = DNS.address_map.id++; + assert(id < 65535, "exceeded max address mappings of 65535"); + addr = "172.29." + (id & 255) + "." + (id & 65280); + DNS.address_map.names[addr] = name; + DNS.address_map.addrs[name] = addr + } + return addr + }, + lookup_addr: function(addr) { + if (DNS.address_map.names[addr]) { + return DNS.address_map.names[addr] + } + return null + } + }; + + function ___syscall_accept4(fd, addr, addrlen, flags) { + try { + var sock = getSocketFromFD(fd); + var newsock = sock.sock_ops.accept(sock); + if (addr) { + var errno = writeSockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport, addrlen) + } + return newsock.stream.fd + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function inetNtop4(addr) { + return (addr & 255) + "." + (addr >> 8 & 255) + "." + (addr >> 16 & 255) + "." + (addr >> 24 & 255) + } + + function inetNtop6(ints) { + var str = ""; + var word = 0; + var longest = 0; + var lastzero = 0; + var zstart = 0; + var len = 0; + var i = 0; + var parts = [ints[0] & 65535, ints[0] >> 16, ints[1] & 65535, ints[1] >> 16, ints[2] & 65535, ints[2] >> 16, ints[3] & 65535, ints[3] >> 16]; + var hasipv4 = true; + var v4part = ""; + for (i = 0; i < 5; i++) { + if (parts[i] !== 0) { + hasipv4 = false; + break + } + } + if (hasipv4) { + v4part = inetNtop4(parts[6] | parts[7] << 16); + if (parts[5] === -1) { + str = "::ffff:"; + str += v4part; + return str + } + if (parts[5] === 0) { + str = "::"; + if (v4part === "0.0.0.0") v4part = ""; + if (v4part === "0.0.0.1") v4part = "1"; + str += v4part; + return str + } + } + for (word = 0; word < 8; word++) { + if (parts[word] === 0) { + if (word - lastzero > 1) { + len = 0 + } + lastzero = word; + len++ + } + if (len > longest) { + longest = len; + zstart = word - longest + 1 + } + } + for (word = 0; word < 8; word++) { + if (longest > 1) { + if (parts[word] === 0 && word >= zstart && word < zstart + longest) { + if (word === zstart) { + str += ":"; + if (zstart === 0) str += ":" + } + continue + } + } + str += Number(_ntohs(parts[word] & 65535)).toString(16); + str += word < 7 ? ":" : "" + } + return str + } + + function readSockaddr(sa, salen) { + var family = HEAP16[sa >> 1]; + var port = _ntohs(HEAPU16[sa + 2 >> 1]); + var addr; + switch (family) { + case 2: + if (salen !== 16) { + return { + errno: 28 + } + } + addr = HEAP32[sa + 4 >> 2]; + addr = inetNtop4(addr); + break; + case 10: + if (salen !== 28) { + return { + errno: 28 + } + } + addr = [HEAP32[sa + 8 >> 2], HEAP32[sa + 12 >> 2], HEAP32[sa + 16 >> 2], HEAP32[sa + 20 >> 2]]; + addr = inetNtop6(addr); + break; + default: + return { + errno: 5 + } + } + return { + family: family, + addr: addr, + port: port + } + } + + function getSocketAddress(addrp, addrlen, allowNull) { + if (allowNull && addrp === 0) return null; + var info = readSockaddr(addrp, addrlen); + if (info.errno) throw new FS.ErrnoError(info.errno); + info.addr = DNS.lookup_addr(info.addr) || info.addr; + return info + } + + function ___syscall_bind(fd, addr, addrlen) { + try { + var sock = getSocketFromFD(fd); + var info = getSocketAddress(addr, addrlen); + sock.sock_ops.bind(sock, info.addr, info.port); + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_chdir(path) { + try { + path = SYSCALLS.getStr(path); + FS.chdir(path); + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_chmod(path, mode) { + try { + path = SYSCALLS.getStr(path); + FS.chmod(path, mode); + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_connect(fd, addr, addrlen) { + try { + var sock = getSocketFromFD(fd); + var info = getSocketAddress(addr, addrlen); + sock.sock_ops.connect(sock, info.addr, info.port); + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_faccessat(dirfd, path, amode, flags) { + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + if (amode & ~7) { + return -28 + } + var lookup = FS.lookupPath(path, { + follow: true + }); + var node = lookup.node; + if (!node) { + return -44 + } + var perms = ""; + if (amode & 4) perms += "r"; + if (amode & 2) perms += "w"; + if (amode & 1) perms += "x"; + if (perms && FS.nodePermissions(node, perms)) { + return -2 + } + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_fcntl64(fd, cmd, varargs) { + SYSCALLS.varargs = varargs; + try { + var stream = SYSCALLS.getStreamFromFD(fd); + switch (cmd) { + case 0: + { + var arg = SYSCALLS.get(); + if (arg < 0) { + return -28 + } + var newStream;newStream = FS.createStream(stream, arg); + return newStream.fd + } + case 1: + case 2: + return 0; + case 3: + return stream.flags; + case 4: + { + var arg = SYSCALLS.get();stream.flags |= arg; + return 0 + } + case 5: + { + var arg = SYSCALLS.get(); + var offset = 0;HEAP16[arg + offset >> 1] = 2; + return 0 + } + case 6: + case 7: + return 0; + case 16: + case 8: + return -28; + case 9: + setErrNo(28); + return -1; + default: + { + return -28 + } + } + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_getcwd(buf, size) { + try { + if (size === 0) return -28; + var cwd = FS.cwd(); + var cwdLengthInBytes = lengthBytesUTF8(cwd) + 1; + if (size < cwdLengthInBytes) return -68; + stringToUTF8(cwd, buf, size); + return cwdLengthInBytes + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_getdents64(fd, dirp, count) { + try { + var stream = SYSCALLS.getStreamFromFD(fd); + if (!stream.getdents) { + stream.getdents = FS.readdir(stream.path) + } + var struct_size = 280; + var pos = 0; + var off = FS.llseek(stream, 0, 1); + var idx = Math.floor(off / struct_size); + while (idx < stream.getdents.length && pos + struct_size <= count) { + var id; + var type; + var name = stream.getdents[idx]; + if (name === ".") { + id = stream.node.id; + type = 4 + } else if (name === "..") { + var lookup = FS.lookupPath(stream.path, { + parent: true + }); + id = lookup.node.id; + type = 4 + } else { + var child = FS.lookupNode(stream.node, name); + id = child.id; + type = FS.isChrdev(child.mode) ? 2 : FS.isDir(child.mode) ? 4 : FS.isLink(child.mode) ? 10 : 8 + } + tempI64 = [id >>> 0, (tempDouble = id, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0)], HEAP32[dirp + pos >> 2] = tempI64[0], HEAP32[dirp + pos + 4 >> 2] = tempI64[1]; + tempI64 = [(idx + 1) * struct_size >>> 0, (tempDouble = (idx + 1) * struct_size, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0)], HEAP32[dirp + pos + 8 >> 2] = tempI64[0], HEAP32[dirp + pos + 12 >> 2] = tempI64[1]; + HEAP16[dirp + pos + 16 >> 1] = 280; + HEAP8[dirp + pos + 18 >> 0] = type; + stringToUTF8(name, dirp + pos + 19, 256); + pos += struct_size; + idx += 1 + } + FS.llseek(stream, idx * struct_size, 0); + return pos + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_getsockname(fd, addr, addrlen) { + try { + err("__syscall_getsockname " + fd); + var sock = getSocketFromFD(fd); + var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(sock.saddr || "0.0.0.0"), sock.sport, addrlen); + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_getsockopt(fd, level, optname, optval, optlen) { + try { + var sock = getSocketFromFD(fd); + if (level === 1) { + if (optname === 4) { + HEAP32[optval >> 2] = sock.error; + HEAP32[optlen >> 2] = 4; + sock.error = null; + return 0 + } + } + return -50 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_ioctl(fd, op, varargs) { + SYSCALLS.varargs = varargs; + try { + var stream = SYSCALLS.getStreamFromFD(fd); + switch (op) { + case 21509: + case 21505: + { + if (!stream.tty) return -59; + return 0 + } + case 21510: + case 21511: + case 21512: + case 21506: + case 21507: + case 21508: + { + if (!stream.tty) return -59; + return 0 + } + case 21519: + { + if (!stream.tty) return -59; + var argp = SYSCALLS.get();HEAP32[argp >> 2] = 0; + return 0 + } + case 21520: + { + if (!stream.tty) return -59; + return -28 + } + case 21531: + { + var argp = SYSCALLS.get(); + return FS.ioctl(stream, op, argp) + } + case 21523: + { + if (!stream.tty) return -59; + return 0 + } + case 21524: + { + if (!stream.tty) return -59; + return 0 + } + default: + abort("bad ioctl syscall " + op) + } + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_listen(fd, backlog) { + try { + var sock = getSocketFromFD(fd); + sock.sock_ops.listen(sock, backlog); + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_lstat64(path, buf) { + try { + path = SYSCALLS.getStr(path); + return SYSCALLS.doStat(FS.lstat, path, buf) + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_mkdirat(dirfd, path, mode) { + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + path = PATH.normalize(path); + if (path[path.length - 1] === "/") path = path.substr(0, path.length - 1); + FS.mkdir(path, mode, 0); + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_newfstatat(dirfd, path, buf, flags) { + try { + path = SYSCALLS.getStr(path); + var nofollow = flags & 256; + var allowEmpty = flags & 4096; + flags = flags & ~4352; + path = SYSCALLS.calculateAt(dirfd, path, allowEmpty); + return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf) + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_openat(dirfd, path, flags, varargs) { + SYSCALLS.varargs = varargs; + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + var mode = varargs ? SYSCALLS.get() : 0; + return FS.open(path, flags, mode).fd + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_poll(fds, nfds, timeout) { + try { + var nonzero = 0; + for (var i = 0; i < nfds; i++) { + var pollfd = fds + 8 * i; + var fd = HEAP32[pollfd >> 2]; + var events = HEAP16[pollfd + 4 >> 1]; + var mask = 32; + var stream = FS.getStream(fd); + if (stream) { + mask = SYSCALLS.DEFAULT_POLLMASK; + if (stream.stream_ops.poll) { + mask = stream.stream_ops.poll(stream) + } + } + mask &= events | 8 | 16; + if (mask) nonzero++; + HEAP16[pollfd + 6 >> 1] = mask + } + return nonzero + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_readlinkat(dirfd, path, buf, bufsize) { + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + if (bufsize <= 0) return -28; + var ret = FS.readlink(path); + var len = Math.min(bufsize, lengthBytesUTF8(ret)); + var endChar = HEAP8[buf + len]; + stringToUTF8(ret, buf, bufsize + 1); + HEAP8[buf + len] = endChar; + return len + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) { + try { + var sock = getSocketFromFD(fd); + var msg = sock.sock_ops.recvmsg(sock, len); + if (!msg) return 0; + if (addr) { + var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port, addrlen) + } + HEAPU8.set(msg.buffer, buf); + return msg.buffer.byteLength + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) { + try { + oldpath = SYSCALLS.getStr(oldpath); + newpath = SYSCALLS.getStr(newpath); + oldpath = SYSCALLS.calculateAt(olddirfd, oldpath); + newpath = SYSCALLS.calculateAt(newdirfd, newpath); + FS.rename(oldpath, newpath); + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_rmdir(path) { + try { + path = SYSCALLS.getStr(path); + FS.rmdir(path); + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_sendto(fd, message, length, flags, addr, addr_len) { + try { + var sock = getSocketFromFD(fd); + var dest = getSocketAddress(addr, addr_len, true); + if (!dest) { + return FS.write(sock.stream, HEAP8, message, length) + } else { + return sock.sock_ops.sendmsg(sock, HEAP8, message, length, dest.addr, dest.port) + } + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_socket(domain, type, protocol) { + try { + var sock = SOCKFS.createSocket(domain, type, protocol); + return sock.stream.fd + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_stat64(path, buf) { + try { + path = SYSCALLS.getStr(path); + return SYSCALLS.doStat(FS.stat, path, buf) + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_statfs64(path, size, buf) { + try { + path = SYSCALLS.getStr(path); + HEAP32[buf + 4 >> 2] = 4096; + HEAP32[buf + 40 >> 2] = 4096; + HEAP32[buf + 8 >> 2] = 1e6; + HEAP32[buf + 12 >> 2] = 5e5; + HEAP32[buf + 16 >> 2] = 5e5; + HEAP32[buf + 20 >> 2] = FS.nextInode; + HEAP32[buf + 24 >> 2] = 1e6; + HEAP32[buf + 28 >> 2] = 42; + HEAP32[buf + 44 >> 2] = 2; + HEAP32[buf + 36 >> 2] = 255; + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_symlink(target, linkpath) { + try { + target = SYSCALLS.getStr(target); + linkpath = SYSCALLS.getStr(linkpath); + FS.symlink(target, linkpath); + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function ___syscall_unlinkat(dirfd, path, flags) { + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + if (flags === 0) { + FS.unlink(path) + } else if (flags === 512) { + FS.rmdir(path) + } else { + abort("Invalid flags passed to unlinkat") + } + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno + } + } + + function __dlinit(main_dso_handle) {} + var dlopenMissingError = "To use dlopen, you need enable dynamic linking, see https://github.com/emscripten-core/emscripten/wiki/Linking"; + + function __dlopen_js(filename, flag) { + abort(dlopenMissingError) + } + + function __dlsym_js(handle, symbol) { + abort(dlopenMissingError) + } + + function __emscripten_date_now() { + return Date.now() + } + var nowIsMonotonic = true; + + function __emscripten_get_now_is_monotonic() { + return nowIsMonotonic + } + + function __emscripten_throw_longjmp() { + throw Infinity + } + + function __gmtime_js(time, tmPtr) { + var date = new Date(HEAP32[time >> 2] * 1e3); + HEAP32[tmPtr >> 2] = date.getUTCSeconds(); + HEAP32[tmPtr + 4 >> 2] = date.getUTCMinutes(); + HEAP32[tmPtr + 8 >> 2] = date.getUTCHours(); + HEAP32[tmPtr + 12 >> 2] = date.getUTCDate(); + HEAP32[tmPtr + 16 >> 2] = date.getUTCMonth(); + HEAP32[tmPtr + 20 >> 2] = date.getUTCFullYear() - 1900; + HEAP32[tmPtr + 24 >> 2] = date.getUTCDay(); + var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0); + var yday = (date.getTime() - start) / (1e3 * 60 * 60 * 24) | 0; + HEAP32[tmPtr + 28 >> 2] = yday + } + + function __localtime_js(time, tmPtr) { + var date = new Date(HEAP32[time >> 2] * 1e3); + HEAP32[tmPtr >> 2] = date.getSeconds(); + HEAP32[tmPtr + 4 >> 2] = date.getMinutes(); + HEAP32[tmPtr + 8 >> 2] = date.getHours(); + HEAP32[tmPtr + 12 >> 2] = date.getDate(); + HEAP32[tmPtr + 16 >> 2] = date.getMonth(); + HEAP32[tmPtr + 20 >> 2] = date.getFullYear() - 1900; + HEAP32[tmPtr + 24 >> 2] = date.getDay(); + var start = new Date(date.getFullYear(), 0, 1); + var yday = (date.getTime() - start.getTime()) / (1e3 * 60 * 60 * 24) | 0; + HEAP32[tmPtr + 28 >> 2] = yday; + HEAP32[tmPtr + 36 >> 2] = -(date.getTimezoneOffset() * 60); + var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset(); + var winterOffset = start.getTimezoneOffset(); + var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset)) | 0; + HEAP32[tmPtr + 32 >> 2] = dst + } + + function _tzset_impl(timezone, daylight, tzname) { + var currentYear = (new Date).getFullYear(); + var winter = new Date(currentYear, 0, 1); + var summer = new Date(currentYear, 6, 1); + var winterOffset = winter.getTimezoneOffset(); + var summerOffset = summer.getTimezoneOffset(); + var stdTimezoneOffset = Math.max(winterOffset, summerOffset); + HEAP32[timezone >> 2] = stdTimezoneOffset * 60; + HEAP32[daylight >> 2] = Number(winterOffset != summerOffset); + + function extractZone(date) { + var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/); + return match ? match[1] : "GMT" + } + var winterName = extractZone(winter); + var summerName = extractZone(summer); + var winterNamePtr = allocateUTF8(winterName); + var summerNamePtr = allocateUTF8(summerName); + if (summerOffset < winterOffset) { + HEAPU32[tzname >> 2] = winterNamePtr; + HEAPU32[tzname + 4 >> 2] = summerNamePtr + } else { + HEAPU32[tzname >> 2] = summerNamePtr; + HEAPU32[tzname + 4 >> 2] = winterNamePtr + } + } + + function __tzset_js(timezone, daylight, tzname) { + if (__tzset_js.called) return; + __tzset_js.called = true; + _tzset_impl(timezone, daylight, tzname) + } + + function _abort() { + abort("") + } + + function _emscripten_set_main_loop_timing(mode, value) { + Browser.mainLoop.timingMode = mode; + Browser.mainLoop.timingValue = value; + if (!Browser.mainLoop.func) { + return 1 + } + if (!Browser.mainLoop.running) { + runtimeKeepalivePush(); + Browser.mainLoop.running = true + } + if (mode == 0) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() { + var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now()) | 0; + setTimeout(Browser.mainLoop.runner, timeUntilNextTick) + }; + Browser.mainLoop.method = "timeout" + } else if (mode == 1) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() { + Browser.requestAnimationFrame(Browser.mainLoop.runner) + }; + Browser.mainLoop.method = "rAF" + } else if (mode == 2) { + if (typeof setImmediate == "undefined") { + var setImmediates = []; + var emscriptenMainLoopMessageId = "setimmediate"; + var Browser_setImmediate_messageHandler = function(event) { + if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) { + event.stopPropagation(); + setImmediates.shift()() + } + }; + addEventListener("message", Browser_setImmediate_messageHandler, true); + setImmediate = function Browser_emulated_setImmediate(func) { + setImmediates.push(func); + if (ENVIRONMENT_IS_WORKER) { + if (Module["setImmediates"] === undefined) Module["setImmediates"] = []; + Module["setImmediates"].push(func); + postMessage({ + target: emscriptenMainLoopMessageId + }) + } else postMessage(emscriptenMainLoopMessageId, "*") + } + } + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() { + setImmediate(Browser.mainLoop.runner) + }; + Browser.mainLoop.method = "immediate" + } + return 0 + } + var _emscripten_get_now; + _emscripten_get_now = () => performance.now(); + + function _emscripten_webgl_do_commit_frame() { + if (!GL.currentContext || !GL.currentContext.GLctx) { + return -3 + } + if (GL.currentContext.defaultFbo) { + GL.blitOffscreenFramebuffer(GL.currentContext); + return 0 + } + if (!GL.currentContext.attributes.explicitSwapControl) { + return -3 + } + return 0 + } + + function _emscripten_webgl_commit_frame() { + return _emscripten_webgl_do_commit_frame() + } + + function runtimeKeepalivePush() { + runtimeKeepaliveCounter += 1 + } + + function _exit(status) { + exit(status) + } + + function maybeExit() { + if (!keepRuntimeAlive()) { + try { + _exit(EXITSTATUS) + } catch (e) { + handleException(e) + } + } + } + + function setMainLoop(browserIterationFunc, fps, simulateInfiniteLoop, arg, noSetTiming) { + assert(!Browser.mainLoop.func, "emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters."); + Browser.mainLoop.func = browserIterationFunc; + Browser.mainLoop.arg = arg; + var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop; + + function checkIsRunning() { + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) { + runtimeKeepalivePop(); + maybeExit(); + return false + } + return true + } + Browser.mainLoop.running = false; + Browser.mainLoop.runner = function Browser_mainLoop_runner() { + if (ABORT) return; + if (Browser.mainLoop.queue.length > 0) { + var start = Date.now(); + var blocker = Browser.mainLoop.queue.shift(); + blocker.func(blocker.arg); + if (Browser.mainLoop.remainingBlockers) { + var remaining = Browser.mainLoop.remainingBlockers; + var next = remaining % 1 == 0 ? remaining - 1 : Math.floor(remaining); + if (blocker.counted) { + Browser.mainLoop.remainingBlockers = next + } else { + next = next + .5; + Browser.mainLoop.remainingBlockers = (8 * remaining + next) / 9 + } + } + out('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + " ms"); + Browser.mainLoop.updateStatus(); + if (!checkIsRunning()) return; + setTimeout(Browser.mainLoop.runner, 0); + return + } + if (!checkIsRunning()) return; + Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0; + if (Browser.mainLoop.timingMode == 1 && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) { + Browser.mainLoop.scheduler(); + return + } else if (Browser.mainLoop.timingMode == 0) { + Browser.mainLoop.tickStartTime = _emscripten_get_now() + } + Browser.mainLoop.runIter(browserIterationFunc); + if (!checkIsRunning()) return; + if (typeof SDL == "object" && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData(); + Browser.mainLoop.scheduler() + }; + if (!noSetTiming) { + if (fps && fps > 0) _emscripten_set_main_loop_timing(0, 1e3 / fps); + else _emscripten_set_main_loop_timing(1, 1); + Browser.mainLoop.scheduler() + } + if (simulateInfiniteLoop) { + throw "unwind" + } + } + + function callUserCallback(func, synchronous) { + if (runtimeExited || ABORT) { + return + } + if (synchronous) { + func(); + return + } + try { + func(); + maybeExit() + } catch (e) { + handleException(e) + } + } + + function runtimeKeepalivePop() { + runtimeKeepaliveCounter -= 1 + } + + function safeSetTimeout(func, timeout) { + runtimeKeepalivePush(); + return setTimeout(function() { + runtimeKeepalivePop(); + callUserCallback(func) + }, timeout) + } + var Browser = { + mainLoop: { + running: false, + scheduler: null, + method: "", + currentlyRunningMainloop: 0, + func: null, + arg: 0, + timingMode: 0, + timingValue: 0, + currentFrameNumber: 0, + queue: [], + pause: function() { + Browser.mainLoop.scheduler = null; + Browser.mainLoop.currentlyRunningMainloop++ + }, + resume: function() { + Browser.mainLoop.currentlyRunningMainloop++; + var timingMode = Browser.mainLoop.timingMode; + var timingValue = Browser.mainLoop.timingValue; + var func = Browser.mainLoop.func; + Browser.mainLoop.func = null; + setMainLoop(func, 0, false, Browser.mainLoop.arg, true); + _emscripten_set_main_loop_timing(timingMode, timingValue); + Browser.mainLoop.scheduler() + }, + updateStatus: function() { + if (Module["setStatus"]) { + var message = Module["statusMessage"] || "Please wait..."; + var remaining = Browser.mainLoop.remainingBlockers; + var expected = Browser.mainLoop.expectedBlockers; + if (remaining) { + if (remaining < expected) { + Module["setStatus"](message + " (" + (expected - remaining) + "/" + expected + ")") + } else { + Module["setStatus"](message) + } + } else { + Module["setStatus"]("") + } + } + }, + runIter: function(func) { + if (ABORT) return; + if (Module["preMainLoop"]) { + var preRet = Module["preMainLoop"](); + if (preRet === false) { + return + } + } + callUserCallback(func); + if (Module["postMainLoop"]) Module["postMainLoop"]() + } + }, + isFullscreen: false, + pointerLock: false, + moduleContextCreatedCallbacks: [], + workers: [], + init: function() { + if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; + if (Browser.initted) return; + Browser.initted = true; + try { + new Blob; + Browser.hasBlobConstructor = true + } catch (e) { + Browser.hasBlobConstructor = false; + out("warning: no blob constructor, cannot create blobs with mimetypes") + } + Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : !Browser.hasBlobConstructor ? out("warning: no BlobBuilder") : null; + Browser.URLObject = typeof window != "undefined" ? window.URL ? window.URL : window.webkitURL : undefined; + if (!Module.noImageDecoding && typeof Browser.URLObject == "undefined") { + out("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available."); + Module.noImageDecoding = true + } + var imagePlugin = {}; + imagePlugin["canHandle"] = function imagePlugin_canHandle(name) { + return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name) + }; + imagePlugin["handle"] = function imagePlugin_handle(byteArray, name, onload, onerror) { + var b = null; + if (Browser.hasBlobConstructor) { + try { + b = new Blob([byteArray], { + type: Browser.getMimetype(name) + }); + if (b.size !== byteArray.length) { + b = new Blob([new Uint8Array(byteArray).buffer], { + type: Browser.getMimetype(name) + }) + } + } catch (e) { + warnOnce("Blob constructor present but fails: " + e + "; falling back to blob builder") + } + } + if (!b) { + var bb = new Browser.BlobBuilder; + bb.append(new Uint8Array(byteArray).buffer); + b = bb.getBlob() + } + var url = Browser.URLObject.createObjectURL(b); + var img = new Image; + img.onload = () => { + assert(img.complete, "Image " + name + " could not be decoded"); + var canvas = document.createElement("canvas"); + canvas.width = img.width; + canvas.height = img.height; + var ctx = canvas.getContext("2d"); + ctx.drawImage(img, 0, 0); + preloadedImages[name] = canvas; + Browser.URLObject.revokeObjectURL(url); + if (onload) onload(byteArray) + }; + img.onerror = event => { + out("Image " + url + " could not be decoded"); + if (onerror) onerror() + }; + img.src = url + }; + Module["preloadPlugins"].push(imagePlugin); + var audioPlugin = {}; + audioPlugin["canHandle"] = function audioPlugin_canHandle(name) { + return !Module.noAudioDecoding && name.substr(-4) in { + ".ogg": 1, + ".wav": 1, + ".mp3": 1 + } + }; + audioPlugin["handle"] = function audioPlugin_handle(byteArray, name, onload, onerror) { + var done = false; + + function finish(audio) { + if (done) return; + done = true; + preloadedAudios[name] = audio; + if (onload) onload(byteArray) + } + + function fail() { + if (done) return; + done = true; + preloadedAudios[name] = new Audio; + if (onerror) onerror() + } + if (Browser.hasBlobConstructor) { + try { + var b = new Blob([byteArray], { + type: Browser.getMimetype(name) + }) + } catch (e) { + return fail() + } + var url = Browser.URLObject.createObjectURL(b); + var audio = new Audio; + audio.addEventListener("canplaythrough", function() { + finish(audio) + }, false); + audio.onerror = function audio_onerror(event) { + if (done) return; + out("warning: browser could not fully decode audio " + name + ", trying slower base64 approach"); + + function encode64(data) { + var BASE = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; + var PAD = "="; + var ret = ""; + var leftchar = 0; + var leftbits = 0; + for (var i = 0; i < data.length; i++) { + leftchar = leftchar << 8 | data[i]; + leftbits += 8; + while (leftbits >= 6) { + var curr = leftchar >> leftbits - 6 & 63; + leftbits -= 6; + ret += BASE[curr] + } + } + if (leftbits == 2) { + ret += BASE[(leftchar & 3) << 4]; + ret += PAD + PAD + } else if (leftbits == 4) { + ret += BASE[(leftchar & 15) << 2]; + ret += PAD + } + return ret + } + audio.src = "data:audio/x-" + name.substr(-3) + ";base64," + encode64(byteArray); + finish(audio) + }; + audio.src = url; + safeSetTimeout(function() { + finish(audio) + }, 1e4) + } else { + return fail() + } + }; + Module["preloadPlugins"].push(audioPlugin); + + function pointerLockChange() { + Browser.pointerLock = document["pointerLockElement"] === Module["canvas"] || document["mozPointerLockElement"] === Module["canvas"] || document["webkitPointerLockElement"] === Module["canvas"] || document["msPointerLockElement"] === Module["canvas"] + } + var canvas = Module["canvas"]; + if (canvas) { + canvas.requestPointerLock = canvas["requestPointerLock"] || canvas["mozRequestPointerLock"] || canvas["webkitRequestPointerLock"] || canvas["msRequestPointerLock"] || function() {}; + canvas.exitPointerLock = document["exitPointerLock"] || document["mozExitPointerLock"] || document["webkitExitPointerLock"] || document["msExitPointerLock"] || function() {}; + canvas.exitPointerLock = canvas.exitPointerLock.bind(document); + document.addEventListener("pointerlockchange", pointerLockChange, false); + document.addEventListener("mozpointerlockchange", pointerLockChange, false); + document.addEventListener("webkitpointerlockchange", pointerLockChange, false); + document.addEventListener("mspointerlockchange", pointerLockChange, false); + if (Module["elementPointerLock"]) { + canvas.addEventListener("click", function(ev) { + if (!Browser.pointerLock && Module["canvas"].requestPointerLock) { + Module["canvas"].requestPointerLock(); + ev.preventDefault() + } + }, false) + } + } + }, + handledByPreloadPlugin: function(byteArray, fullname, finish, onerror) { + Browser.init(); + var handled = false; + Module["preloadPlugins"].forEach(function(plugin) { + if (handled) return; + if (plugin["canHandle"](fullname)) { + plugin["handle"](byteArray, fullname, finish, onerror); + handled = true + } + }); + return handled + }, + createContext: function(canvas, useWebGL, setInModule, webGLContextAttributes) { + if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; + var ctx; + var contextHandle; + if (useWebGL) { + var contextAttributes = { + antialias: false, + alpha: false, + majorVersion: typeof WebGL2RenderingContext != "undefined" ? 2 : 1 + }; + if (webGLContextAttributes) { + for (var attribute in webGLContextAttributes) { + contextAttributes[attribute] = webGLContextAttributes[attribute] + } + } + if (typeof GL != "undefined") { + contextHandle = GL.createContext(canvas, contextAttributes); + if (contextHandle) { + ctx = GL.getContext(contextHandle).GLctx + } + } + } else { + ctx = canvas.getContext("2d") + } + if (!ctx) return null; + if (setInModule) { + if (!useWebGL) assert(typeof GLctx == "undefined", "cannot set in module if GLctx is used, but we are a non-GL context that would replace it"); + Module.ctx = ctx; + if (useWebGL) GL.makeContextCurrent(contextHandle); + Module.useWebGL = useWebGL; + Browser.moduleContextCreatedCallbacks.forEach(function(callback) { + callback() + }); + Browser.init() + } + return ctx + }, + destroyContext: function(canvas, useWebGL, setInModule) {}, + fullscreenHandlersInstalled: false, + lockPointer: undefined, + resizeCanvas: undefined, + requestFullscreen: function(lockPointer, resizeCanvas) { + Browser.lockPointer = lockPointer; + Browser.resizeCanvas = resizeCanvas; + if (typeof Browser.lockPointer == "undefined") Browser.lockPointer = true; + if (typeof Browser.resizeCanvas == "undefined") Browser.resizeCanvas = false; + var canvas = Module["canvas"]; + + function fullscreenChange() { + Browser.isFullscreen = false; + var canvasContainer = canvas.parentNode; + if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvasContainer) { + canvas.exitFullscreen = Browser.exitFullscreen; + if (Browser.lockPointer) canvas.requestPointerLock(); + Browser.isFullscreen = true; + if (Browser.resizeCanvas) { + Browser.setFullscreenCanvasSize() + } else { + Browser.updateCanvasDimensions(canvas) + } + } else { + canvasContainer.parentNode.insertBefore(canvas, canvasContainer); + canvasContainer.parentNode.removeChild(canvasContainer); + if (Browser.resizeCanvas) { + Browser.setWindowedCanvasSize() + } else { + Browser.updateCanvasDimensions(canvas) + } + } + if (Module["onFullScreen"]) Module["onFullScreen"](Browser.isFullscreen); + if (Module["onFullscreen"]) Module["onFullscreen"](Browser.isFullscreen) + } + if (!Browser.fullscreenHandlersInstalled) { + Browser.fullscreenHandlersInstalled = true; + document.addEventListener("fullscreenchange", fullscreenChange, false); + document.addEventListener("mozfullscreenchange", fullscreenChange, false); + document.addEventListener("webkitfullscreenchange", fullscreenChange, false); + document.addEventListener("MSFullscreenChange", fullscreenChange, false) + } + var canvasContainer = document.createElement("div"); + canvas.parentNode.insertBefore(canvasContainer, canvas); + canvasContainer.appendChild(canvas); + canvasContainer.requestFullscreen = canvasContainer["requestFullscreen"] || canvasContainer["mozRequestFullScreen"] || canvasContainer["msRequestFullscreen"] || (canvasContainer["webkitRequestFullscreen"] ? function() { + canvasContainer["webkitRequestFullscreen"](Element["ALLOW_KEYBOARD_INPUT"]) + } : null) || (canvasContainer["webkitRequestFullScreen"] ? function() { + canvasContainer["webkitRequestFullScreen"](Element["ALLOW_KEYBOARD_INPUT"]) + } : null); + canvasContainer.requestFullscreen() + }, + exitFullscreen: function() { + if (!Browser.isFullscreen) { + return false + } + var CFS = document["exitFullscreen"] || document["cancelFullScreen"] || document["mozCancelFullScreen"] || document["msExitFullscreen"] || document["webkitCancelFullScreen"] || function() {}; + CFS.apply(document, []); + return true + }, + nextRAF: 0, + fakeRequestAnimationFrame: function(func) { + var now = Date.now(); + if (Browser.nextRAF === 0) { + Browser.nextRAF = now + 1e3 / 60 + } else { + while (now + 2 >= Browser.nextRAF) { + Browser.nextRAF += 1e3 / 60 + } + } + var delay = Math.max(Browser.nextRAF - now, 0); + setTimeout(func, delay) + }, + requestAnimationFrame: function(func) { + if (typeof requestAnimationFrame == "function") { + requestAnimationFrame(func); + return + } + var RAF = Browser.fakeRequestAnimationFrame; + RAF(func) + }, + safeSetTimeout: function(func) { + return safeSetTimeout(func) + }, + safeRequestAnimationFrame: function(func) { + runtimeKeepalivePush(); + return Browser.requestAnimationFrame(function() { + runtimeKeepalivePop(); + callUserCallback(func) + }) + }, + getMimetype: function(name) { + return { + "jpg": "image/jpeg", + "jpeg": "image/jpeg", + "png": "image/png", + "bmp": "image/bmp", + "ogg": "audio/ogg", + "wav": "audio/wav", + "mp3": "audio/mpeg" + }[name.substr(name.lastIndexOf(".") + 1)] + }, + getUserMedia: function(func) { + if (!window.getUserMedia) { + window.getUserMedia = navigator["getUserMedia"] || navigator["mozGetUserMedia"] + } + window.getUserMedia(func) + }, + getMovementX: function(event) { + return event["movementX"] || event["mozMovementX"] || event["webkitMovementX"] || 0 + }, + getMovementY: function(event) { + return event["movementY"] || event["mozMovementY"] || event["webkitMovementY"] || 0 + }, + getMouseWheelDelta: function(event) { + var delta = 0; + switch (event.type) { + case "DOMMouseScroll": + delta = event.detail / 3; + break; + case "mousewheel": + delta = event.wheelDelta / 120; + break; + case "wheel": + delta = event.deltaY; + switch (event.deltaMode) { + case 0: + delta /= 100; + break; + case 1: + delta /= 3; + break; + case 2: + delta *= 80; + break; + default: + throw "unrecognized mouse wheel delta mode: " + event.deltaMode + } + break; + default: + throw "unrecognized mouse wheel event: " + event.type + } + return delta + }, + mouseX: 0, + mouseY: 0, + mouseMovementX: 0, + mouseMovementY: 0, + touches: {}, + lastTouches: {}, + calculateMouseEvent: function(event) { + if (Browser.pointerLock) { + if (event.type != "mousemove" && "mozMovementX" in event) { + Browser.mouseMovementX = Browser.mouseMovementY = 0 + } else { + Browser.mouseMovementX = Browser.getMovementX(event); + Browser.mouseMovementY = Browser.getMovementY(event) + } + if (typeof SDL != "undefined") { + Browser.mouseX = SDL.mouseX + Browser.mouseMovementX; + Browser.mouseY = SDL.mouseY + Browser.mouseMovementY + } else { + Browser.mouseX += Browser.mouseMovementX; + Browser.mouseY += Browser.mouseMovementY + } + } else { + var rect = Module["canvas"].getBoundingClientRect(); + var cw = Module["canvas"].width; + var ch = Module["canvas"].height; + var scrollX = typeof window.scrollX != "undefined" ? window.scrollX : window.pageXOffset; + var scrollY = typeof window.scrollY != "undefined" ? window.scrollY : window.pageYOffset; + if (event.type === "touchstart" || event.type === "touchend" || event.type === "touchmove") { + var touch = event.touch; + if (touch === undefined) { + return + } + var adjustedX = touch.pageX - (scrollX + rect.left); + var adjustedY = touch.pageY - (scrollY + rect.top); + adjustedX = adjustedX * (cw / rect.width); + adjustedY = adjustedY * (ch / rect.height); + var coords = { + x: adjustedX, + y: adjustedY + }; + if (event.type === "touchstart") { + Browser.lastTouches[touch.identifier] = coords; + Browser.touches[touch.identifier] = coords + } else if (event.type === "touchend" || event.type === "touchmove") { + var last = Browser.touches[touch.identifier]; + if (!last) last = coords; + Browser.lastTouches[touch.identifier] = last; + Browser.touches[touch.identifier] = coords + } + return + } + var x = event.pageX - (scrollX + rect.left); + var y = event.pageY - (scrollY + rect.top); + x = x * (cw / rect.width); + y = y * (ch / rect.height); + Browser.mouseMovementX = x - Browser.mouseX; + Browser.mouseMovementY = y - Browser.mouseY; + Browser.mouseX = x; + Browser.mouseY = y + } + }, + resizeListeners: [], + updateResizeListeners: function() { + var canvas = Module["canvas"]; + Browser.resizeListeners.forEach(function(listener) { + listener(canvas.width, canvas.height) + }) + }, + setCanvasSize: function(width, height, noUpdates) { + var canvas = Module["canvas"]; + Browser.updateCanvasDimensions(canvas, width, height); + if (!noUpdates) Browser.updateResizeListeners() + }, + windowedWidth: 0, + windowedHeight: 0, + setFullscreenCanvasSize: function() { + if (typeof SDL != "undefined") { + var flags = HEAPU32[SDL.screen >> 2]; + flags = flags | 8388608; + HEAP32[SDL.screen >> 2] = flags + } + Browser.updateCanvasDimensions(Module["canvas"]); + Browser.updateResizeListeners() + }, + setWindowedCanvasSize: function() { + if (typeof SDL != "undefined") { + var flags = HEAPU32[SDL.screen >> 2]; + flags = flags & ~8388608; + HEAP32[SDL.screen >> 2] = flags + } + Browser.updateCanvasDimensions(Module["canvas"]); + Browser.updateResizeListeners() + }, + updateCanvasDimensions: function(canvas, wNative, hNative) { + if (wNative && hNative) { + canvas.widthNative = wNative; + canvas.heightNative = hNative + } else { + wNative = canvas.widthNative; + hNative = canvas.heightNative + } + var w = wNative; + var h = hNative; + if (Module["forcedAspectRatio"] && Module["forcedAspectRatio"] > 0) { + if (w / h < Module["forcedAspectRatio"]) { + w = Math.round(h * Module["forcedAspectRatio"]) + } else { + h = Math.round(w / Module["forcedAspectRatio"]) + } + } + if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvas.parentNode && typeof screen != "undefined") { + var factor = Math.min(screen.width / w, screen.height / h); + w = Math.round(w * factor); + h = Math.round(h * factor) + } + if (Browser.resizeCanvas) { + if (canvas.width != w) canvas.width = w; + if (canvas.height != h) canvas.height = h; + if (typeof canvas.style != "undefined") { + canvas.style.removeProperty("width"); + canvas.style.removeProperty("height") + } + } else { + if (canvas.width != wNative) canvas.width = wNative; + if (canvas.height != hNative) canvas.height = hNative; + if (typeof canvas.style != "undefined") { + if (w != wNative || h != hNative) { + canvas.style.setProperty("width", w + "px", "important"); + canvas.style.setProperty("height", h + "px", "important") + } else { + canvas.style.removeProperty("width"); + canvas.style.removeProperty("height") + } + } + } + } + }; + + function _emscripten_cancel_main_loop() { + Browser.mainLoop.pause(); + Browser.mainLoop.func = null + } + + function _emscripten_force_exit(status) { + noExitRuntime = false; + runtimeKeepaliveCounter = 0; + exit(status) + } + + function __webgl_enable_ANGLE_instanced_arrays(ctx) { + var ext = ctx.getExtension("ANGLE_instanced_arrays"); + if (ext) { + ctx["vertexAttribDivisor"] = function(index, divisor) { + ext["vertexAttribDivisorANGLE"](index, divisor) + }; + ctx["drawArraysInstanced"] = function(mode, first, count, primcount) { + ext["drawArraysInstancedANGLE"](mode, first, count, primcount) + }; + ctx["drawElementsInstanced"] = function(mode, count, type, indices, primcount) { + ext["drawElementsInstancedANGLE"](mode, count, type, indices, primcount) + }; + return 1 + } + } + + function __webgl_enable_OES_vertex_array_object(ctx) { + var ext = ctx.getExtension("OES_vertex_array_object"); + if (ext) { + ctx["createVertexArray"] = function() { + return ext["createVertexArrayOES"]() + }; + ctx["deleteVertexArray"] = function(vao) { + ext["deleteVertexArrayOES"](vao) + }; + ctx["bindVertexArray"] = function(vao) { + ext["bindVertexArrayOES"](vao) + }; + ctx["isVertexArray"] = function(vao) { + return ext["isVertexArrayOES"](vao) + }; + return 1 + } + } + + function __webgl_enable_WEBGL_draw_buffers(ctx) { + var ext = ctx.getExtension("WEBGL_draw_buffers"); + if (ext) { + ctx["drawBuffers"] = function(n, bufs) { + ext["drawBuffersWEBGL"](n, bufs) + }; + return 1 + } + } + + function __webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(ctx) { + return !!(ctx.dibvbi = ctx.getExtension("WEBGL_draw_instanced_base_vertex_base_instance")) + } + + function __webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(ctx) { + return !!(ctx.mdibvbi = ctx.getExtension("WEBGL_multi_draw_instanced_base_vertex_base_instance")) + } + + function __webgl_enable_WEBGL_multi_draw(ctx) { + return !!(ctx.multiDrawWebgl = ctx.getExtension("WEBGL_multi_draw")) + } + var GL = { + counter: 1, + buffers: [], + programs: [], + framebuffers: [], + renderbuffers: [], + textures: [], + shaders: [], + vaos: [], + contexts: [], + offscreenCanvases: {}, + queries: [], + samplers: [], + transformFeedbacks: [], + syncs: [], + stringCache: {}, + stringiCache: {}, + unpackAlignment: 4, + recordError: function recordError(errorCode) { + if (!GL.lastError) { + GL.lastError = errorCode + } + }, + getNewId: function(table) { + var ret = GL.counter++; + for (var i = table.length; i < ret; i++) { + table[i] = null + } + return ret + }, + getSource: function(shader, count, string, length) { + var source = ""; + for (var i = 0; i < count; ++i) { + var len = length ? HEAP32[length + i * 4 >> 2] : -1; + source += UTF8ToString(HEAP32[string + i * 4 >> 2], len < 0 ? undefined : len) + } + return source + }, + createContext: function(canvas, webGLContextAttributes) { + if (webGLContextAttributes.renderViaOffscreenBackBuffer) webGLContextAttributes["preserveDrawingBuffer"] = true; + if (!canvas.getContextSafariWebGL2Fixed) { + canvas.getContextSafariWebGL2Fixed = canvas.getContext; + + function fixedGetContext(ver, attrs) { + var gl = canvas.getContextSafariWebGL2Fixed(ver, attrs); + return ver == "webgl" == gl instanceof WebGLRenderingContext ? gl : null + } + canvas.getContext = fixedGetContext + } + var ctx = webGLContextAttributes.majorVersion > 1 ? canvas.getContext("webgl2", webGLContextAttributes) : canvas.getContext("webgl", webGLContextAttributes); + if (!ctx) return 0; + var handle = GL.registerContext(ctx, webGLContextAttributes); + return handle + }, + enableOffscreenFramebufferAttributes: function(webGLContextAttributes) { + webGLContextAttributes.renderViaOffscreenBackBuffer = true; + webGLContextAttributes.preserveDrawingBuffer = true + }, + createOffscreenFramebuffer: function(context) { + var gl = context.GLctx; + var fbo = gl.createFramebuffer(); + gl.bindFramebuffer(36160, fbo); + context.defaultFbo = fbo; + context.defaultFboForbidBlitFramebuffer = false; + if (gl.getContextAttributes().antialias) { + context.defaultFboForbidBlitFramebuffer = true + } else { + var firefoxMatch = navigator.userAgent.toLowerCase().match(/firefox\/(\d\d)/); + if (firefoxMatch != null) { + var firefoxVersion = firefoxMatch[1]; + context.defaultFboForbidBlitFramebuffer = firefoxVersion < 67 + } + } + context.defaultColorTarget = gl.createTexture(); + context.defaultDepthTarget = gl.createRenderbuffer(); + GL.resizeOffscreenFramebuffer(context); + gl.bindTexture(3553, context.defaultColorTarget); + gl.texParameteri(3553, 10241, 9728); + gl.texParameteri(3553, 10240, 9728); + gl.texParameteri(3553, 10242, 33071); + gl.texParameteri(3553, 10243, 33071); + gl.texImage2D(3553, 0, 6408, gl.canvas.width, gl.canvas.height, 0, 6408, 5121, null); + gl.framebufferTexture2D(36160, 36064, 3553, context.defaultColorTarget, 0); + gl.bindTexture(3553, null); + var depthTarget = gl.createRenderbuffer(); + gl.bindRenderbuffer(36161, context.defaultDepthTarget); + gl.renderbufferStorage(36161, 33189, gl.canvas.width, gl.canvas.height); + gl.framebufferRenderbuffer(36160, 36096, 36161, context.defaultDepthTarget); + gl.bindRenderbuffer(36161, null); + var vertices = [-1, -1, -1, 1, 1, -1, 1, 1]; + var vb = gl.createBuffer(); + gl.bindBuffer(34962, vb); + gl.bufferData(34962, new Float32Array(vertices), 35044); + gl.bindBuffer(34962, null); + context.blitVB = vb; + var vsCode = "attribute vec2 pos;" + "varying lowp vec2 tex;" + "void main() { tex = pos * 0.5 + vec2(0.5,0.5); gl_Position = vec4(pos, 0.0, 1.0); }"; + var vs = gl.createShader(35633); + gl.shaderSource(vs, vsCode); + gl.compileShader(vs); + var fsCode = "varying lowp vec2 tex;" + "uniform sampler2D sampler;" + "void main() { gl_FragColor = texture2D(sampler, tex); }"; + var fs = gl.createShader(35632); + gl.shaderSource(fs, fsCode); + gl.compileShader(fs); + var blitProgram = gl.createProgram(); + gl.attachShader(blitProgram, vs); + gl.attachShader(blitProgram, fs); + gl.linkProgram(blitProgram); + context.blitProgram = blitProgram; + context.blitPosLoc = gl.getAttribLocation(blitProgram, "pos"); + gl.useProgram(blitProgram); + gl.uniform1i(gl.getUniformLocation(blitProgram, "sampler"), 0); + gl.useProgram(null); + context.defaultVao = undefined; + if (gl.createVertexArray) { + context.defaultVao = gl.createVertexArray(); + gl.bindVertexArray(context.defaultVao); + gl.enableVertexAttribArray(context.blitPosLoc); + gl.bindVertexArray(null) + } + }, + resizeOffscreenFramebuffer: function(context) { + var gl = context.GLctx; + if (context.defaultColorTarget) { + var prevTextureBinding = gl.getParameter(32873); + gl.bindTexture(3553, context.defaultColorTarget); + gl.texImage2D(3553, 0, 6408, gl.drawingBufferWidth, gl.drawingBufferHeight, 0, 6408, 5121, null); + gl.bindTexture(3553, prevTextureBinding) + } + if (context.defaultDepthTarget) { + var prevRenderBufferBinding = gl.getParameter(36007); + gl.bindRenderbuffer(36161, context.defaultDepthTarget); + gl.renderbufferStorage(36161, 33189, gl.drawingBufferWidth, gl.drawingBufferHeight); + gl.bindRenderbuffer(36161, prevRenderBufferBinding) + } + }, + blitOffscreenFramebuffer: function(context) { + var gl = context.GLctx; + var prevScissorTest = gl.getParameter(3089); + if (prevScissorTest) gl.disable(3089); + var prevFbo = gl.getParameter(36006); + if (gl.blitFramebuffer && !context.defaultFboForbidBlitFramebuffer) { + gl.bindFramebuffer(36008, context.defaultFbo); + gl.bindFramebuffer(36009, null); + gl.blitFramebuffer(0, 0, gl.canvas.width, gl.canvas.height, 0, 0, gl.canvas.width, gl.canvas.height, 16384, 9728) + } else { + gl.bindFramebuffer(36160, null); + var prevProgram = gl.getParameter(35725); + gl.useProgram(context.blitProgram); + var prevVB = gl.getParameter(34964); + gl.bindBuffer(34962, context.blitVB); + var prevActiveTexture = gl.getParameter(34016); + gl.activeTexture(33984); + var prevTextureBinding = gl.getParameter(32873); + gl.bindTexture(3553, context.defaultColorTarget); + var prevBlend = gl.getParameter(3042); + if (prevBlend) gl.disable(3042); + var prevCullFace = gl.getParameter(2884); + if (prevCullFace) gl.disable(2884); + var prevDepthTest = gl.getParameter(2929); + if (prevDepthTest) gl.disable(2929); + var prevStencilTest = gl.getParameter(2960); + if (prevStencilTest) gl.disable(2960); + + function draw() { + gl.vertexAttribPointer(context.blitPosLoc, 2, 5126, false, 0, 0); + gl.drawArrays(5, 0, 4) + } + if (context.defaultVao) { + var prevVAO = gl.getParameter(34229); + gl.bindVertexArray(context.defaultVao); + draw(); + gl.bindVertexArray(prevVAO) + } else { + var prevVertexAttribPointer = { + buffer: gl.getVertexAttrib(context.blitPosLoc, 34975), + size: gl.getVertexAttrib(context.blitPosLoc, 34339), + stride: gl.getVertexAttrib(context.blitPosLoc, 34340), + type: gl.getVertexAttrib(context.blitPosLoc, 34341), + normalized: gl.getVertexAttrib(context.blitPosLoc, 34922), + pointer: gl.getVertexAttribOffset(context.blitPosLoc, 34373) + }; + var maxVertexAttribs = gl.getParameter(34921); + var prevVertexAttribEnables = []; + for (var i = 0; i < maxVertexAttribs; ++i) { + var prevEnabled = gl.getVertexAttrib(i, 34338); + var wantEnabled = i == context.blitPosLoc; + if (prevEnabled && !wantEnabled) { + gl.disableVertexAttribArray(i) + } + if (!prevEnabled && wantEnabled) { + gl.enableVertexAttribArray(i) + } + prevVertexAttribEnables[i] = prevEnabled + } + draw(); + for (var i = 0; i < maxVertexAttribs; ++i) { + var prevEnabled = prevVertexAttribEnables[i]; + var nowEnabled = i == context.blitPosLoc; + if (prevEnabled && !nowEnabled) { + gl.enableVertexAttribArray(i) + } + if (!prevEnabled && nowEnabled) { + gl.disableVertexAttribArray(i) + } + } + gl.bindBuffer(34962, prevVertexAttribPointer.buffer); + gl.vertexAttribPointer(context.blitPosLoc, prevVertexAttribPointer.size, prevVertexAttribPointer.type, prevVertexAttribPointer.normalized, prevVertexAttribPointer.stride, prevVertexAttribPointer.offset) + } + if (prevStencilTest) gl.enable(2960); + if (prevDepthTest) gl.enable(2929); + if (prevCullFace) gl.enable(2884); + if (prevBlend) gl.enable(3042); + gl.bindTexture(3553, prevTextureBinding); + gl.activeTexture(prevActiveTexture); + gl.bindBuffer(34962, prevVB); + gl.useProgram(prevProgram) + } + gl.bindFramebuffer(36160, prevFbo); + if (prevScissorTest) gl.enable(3089) + }, + registerContext: function(ctx, webGLContextAttributes) { + var handle = GL.getNewId(GL.contexts); + var context = { + handle: handle, + attributes: webGLContextAttributes, + version: webGLContextAttributes.majorVersion, + GLctx: ctx + }; + if (ctx.canvas) ctx.canvas.GLctxObject = context; + GL.contexts[handle] = context; + if (typeof webGLContextAttributes.enableExtensionsByDefault == "undefined" || webGLContextAttributes.enableExtensionsByDefault) { + GL.initExtensions(context) + } + if (webGLContextAttributes.renderViaOffscreenBackBuffer) GL.createOffscreenFramebuffer(context); + return handle + }, + makeContextCurrent: function(contextHandle) { + GL.currentContext = GL.contexts[contextHandle]; + Module.ctx = GLctx = GL.currentContext && GL.currentContext.GLctx; + return !(contextHandle && !GLctx) + }, + getContext: function(contextHandle) { + return GL.contexts[contextHandle] + }, + deleteContext: function(contextHandle) { + if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null; + if (typeof JSEvents == "object") JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); + if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; + GL.contexts[contextHandle] = null + }, + initExtensions: function(context) { + if (!context) context = GL.currentContext; + if (context.initExtensionsDone) return; + context.initExtensionsDone = true; + var GLctx = context.GLctx; + __webgl_enable_ANGLE_instanced_arrays(GLctx); + __webgl_enable_OES_vertex_array_object(GLctx); + __webgl_enable_WEBGL_draw_buffers(GLctx); + __webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(GLctx); + __webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(GLctx); + if (context.version >= 2) { + GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query_webgl2") + } + if (context.version < 2 || !GLctx.disjointTimerQueryExt) { + GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query") + } + __webgl_enable_WEBGL_multi_draw(GLctx); + var exts = GLctx.getSupportedExtensions() || []; + exts.forEach(function(ext) { + if (!ext.includes("lose_context") && !ext.includes("debug")) { + GLctx.getExtension(ext) + } + }) + } + }; + + function _emscripten_glActiveTexture(x0) { + GLctx["activeTexture"](x0) + } + + function _emscripten_glAttachShader(program, shader) { + GLctx.attachShader(GL.programs[program], GL.shaders[shader]) + } + + function _emscripten_glBeginQuery(target, id) { + GLctx["beginQuery"](target, GL.queries[id]) + } + + function _emscripten_glBeginQueryEXT(target, id) { + GLctx.disjointTimerQueryExt["beginQueryEXT"](target, GL.queries[id]) + } + + function _emscripten_glBeginTransformFeedback(x0) { + GLctx["beginTransformFeedback"](x0) + } + + function _emscripten_glBindAttribLocation(program, index, name) { + GLctx.bindAttribLocation(GL.programs[program], index, UTF8ToString(name)) + } + + function _emscripten_glBindBuffer(target, buffer) { + if (target == 35051) { + GLctx.currentPixelPackBufferBinding = buffer + } else if (target == 35052) { + GLctx.currentPixelUnpackBufferBinding = buffer + } + GLctx.bindBuffer(target, GL.buffers[buffer]) + } + + function _emscripten_glBindBufferBase(target, index, buffer) { + GLctx["bindBufferBase"](target, index, GL.buffers[buffer]) + } + + function _emscripten_glBindBufferRange(target, index, buffer, offset, ptrsize) { + GLctx["bindBufferRange"](target, index, GL.buffers[buffer], offset, ptrsize) + } + + function _emscripten_glBindFramebuffer(target, framebuffer) { + GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : GL.currentContext.defaultFbo) + } + + function _emscripten_glBindRenderbuffer(target, renderbuffer) { + GLctx.bindRenderbuffer(target, GL.renderbuffers[renderbuffer]) + } + + function _emscripten_glBindSampler(unit, sampler) { + GLctx["bindSampler"](unit, GL.samplers[sampler]) + } + + function _emscripten_glBindTexture(target, texture) { + GLctx.bindTexture(target, GL.textures[texture]) + } + + function _emscripten_glBindTransformFeedback(target, id) { + GLctx["bindTransformFeedback"](target, GL.transformFeedbacks[id]) + } + + function _emscripten_glBindVertexArray(vao) { + GLctx["bindVertexArray"](GL.vaos[vao]) + } + + function _emscripten_glBindVertexArrayOES(vao) { + GLctx["bindVertexArray"](GL.vaos[vao]) + } + + function _emscripten_glBlendColor(x0, x1, x2, x3) { + GLctx["blendColor"](x0, x1, x2, x3) + } + + function _emscripten_glBlendEquation(x0) { + GLctx["blendEquation"](x0) + } + + function _emscripten_glBlendEquationSeparate(x0, x1) { + GLctx["blendEquationSeparate"](x0, x1) + } + + function _emscripten_glBlendFunc(x0, x1) { + GLctx["blendFunc"](x0, x1) + } + + function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { + GLctx["blendFuncSeparate"](x0, x1, x2, x3) + } + + function _emscripten_glBlitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) { + GLctx["blitFramebuffer"](x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) + } + + function _emscripten_glBufferData(target, size, data, usage) { + if (GL.currentContext.version >= 2) { + if (data && size) { + GLctx.bufferData(target, HEAPU8, usage, data, size) + } else { + GLctx.bufferData(target, size, usage) + } + } else { + GLctx.bufferData(target, data ? HEAPU8.subarray(data, data + size) : size, usage) + } + } + + function _emscripten_glBufferSubData(target, offset, size, data) { + if (GL.currentContext.version >= 2) { + size && GLctx.bufferSubData(target, offset, HEAPU8, data, size); + return + } + GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data + size)) + } + + function _emscripten_glCheckFramebufferStatus(x0) { + return GLctx["checkFramebufferStatus"](x0) + } + + function _emscripten_glClear(x0) { + GLctx["clear"](x0) + } + + function _emscripten_glClearBufferfi(x0, x1, x2, x3) { + GLctx["clearBufferfi"](x0, x1, x2, x3) + } + + function _emscripten_glClearBufferfv(buffer, drawbuffer, value) { + GLctx["clearBufferfv"](buffer, drawbuffer, HEAPF32, value >> 2) + } + + function _emscripten_glClearBufferiv(buffer, drawbuffer, value) { + GLctx["clearBufferiv"](buffer, drawbuffer, HEAP32, value >> 2) + } + + function _emscripten_glClearBufferuiv(buffer, drawbuffer, value) { + GLctx["clearBufferuiv"](buffer, drawbuffer, HEAPU32, value >> 2) + } + + function _emscripten_glClearColor(x0, x1, x2, x3) { + GLctx["clearColor"](x0, x1, x2, x3) + } + + function _emscripten_glClearDepthf(x0) { + GLctx["clearDepth"](x0) + } + + function _emscripten_glClearStencil(x0) { + GLctx["clearStencil"](x0) + } + + function convertI32PairToI53(lo, hi) { + return (lo >>> 0) + hi * 4294967296 + } + + function _emscripten_glClientWaitSync(sync, flags, timeoutLo, timeoutHi) { + return GLctx.clientWaitSync(GL.syncs[sync], flags, convertI32PairToI53(timeoutLo, timeoutHi)) + } + + function _emscripten_glColorMask(red, green, blue, alpha) { + GLctx.colorMask(!!red, !!green, !!blue, !!alpha) + } + + function _emscripten_glCompileShader(shader) { + GLctx.compileShader(GL.shaders[shader]) + } + + function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelUnpackBufferBinding || !imageSize) { + GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, imageSize, data) + } else { + GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, HEAPU8, data, imageSize) + } + return + } + GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray(data, data + imageSize) : null) + } + + function _emscripten_glCompressedTexImage3D(target, level, internalFormat, width, height, depth, border, imageSize, data) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx["compressedTexImage3D"](target, level, internalFormat, width, height, depth, border, imageSize, data) + } else { + GLctx["compressedTexImage3D"](target, level, internalFormat, width, height, depth, border, HEAPU8, data, imageSize) + } + } + + function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelUnpackBufferBinding || !imageSize) { + GLctx["compressedTexSubImage2D"](target, level, xoffset, yoffset, width, height, format, imageSize, data) + } else { + GLctx["compressedTexSubImage2D"](target, level, xoffset, yoffset, width, height, format, HEAPU8, data, imageSize) + } + return + } + GLctx["compressedTexSubImage2D"](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray(data, data + imageSize) : null) + } + + function _emscripten_glCompressedTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx["compressedTexSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data) + } else { + GLctx["compressedTexSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, HEAPU8, data, imageSize) + } + } + + function _emscripten_glCopyBufferSubData(x0, x1, x2, x3, x4) { + GLctx["copyBufferSubData"](x0, x1, x2, x3, x4) + } + + function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { + GLctx["copyTexImage2D"](x0, x1, x2, x3, x4, x5, x6, x7) + } + + function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { + GLctx["copyTexSubImage2D"](x0, x1, x2, x3, x4, x5, x6, x7) + } + + function _emscripten_glCopyTexSubImage3D(x0, x1, x2, x3, x4, x5, x6, x7, x8) { + GLctx["copyTexSubImage3D"](x0, x1, x2, x3, x4, x5, x6, x7, x8) + } + + function _emscripten_glCreateProgram() { + var id = GL.getNewId(GL.programs); + var program = GLctx.createProgram(); + program.name = id; + program.maxUniformLength = program.maxAttributeLength = program.maxUniformBlockNameLength = 0; + program.uniformIdCounter = 1; + GL.programs[id] = program; + return id + } + + function _emscripten_glCreateShader(shaderType) { + var id = GL.getNewId(GL.shaders); + GL.shaders[id] = GLctx.createShader(shaderType); + return id + } + + function _emscripten_glCullFace(x0) { + GLctx["cullFace"](x0) + } + + function _emscripten_glDeleteBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[buffers + i * 4 >> 2]; + var buffer = GL.buffers[id]; + if (!buffer) continue; + GLctx.deleteBuffer(buffer); + buffer.name = 0; + GL.buffers[id] = null; + if (id == GLctx.currentPixelPackBufferBinding) GLctx.currentPixelPackBufferBinding = 0; + if (id == GLctx.currentPixelUnpackBufferBinding) GLctx.currentPixelUnpackBufferBinding = 0 + } + } + + function _emscripten_glDeleteFramebuffers(n, framebuffers) { + for (var i = 0; i < n; ++i) { + var id = HEAP32[framebuffers + i * 4 >> 2]; + var framebuffer = GL.framebuffers[id]; + if (!framebuffer) continue; + GLctx.deleteFramebuffer(framebuffer); + framebuffer.name = 0; + GL.framebuffers[id] = null + } + } + + function _emscripten_glDeleteProgram(id) { + if (!id) return; + var program = GL.programs[id]; + if (!program) { + GL.recordError(1281); + return + } + GLctx.deleteProgram(program); + program.name = 0; + GL.programs[id] = null + } + + function _emscripten_glDeleteQueries(n, ids) { + for (var i = 0; i < n; i++) { + var id = HEAP32[ids + i * 4 >> 2]; + var query = GL.queries[id]; + if (!query) continue; + GLctx["deleteQuery"](query); + GL.queries[id] = null + } + } + + function _emscripten_glDeleteQueriesEXT(n, ids) { + for (var i = 0; i < n; i++) { + var id = HEAP32[ids + i * 4 >> 2]; + var query = GL.queries[id]; + if (!query) continue; + GLctx.disjointTimerQueryExt["deleteQueryEXT"](query); + GL.queries[id] = null + } + } + + function _emscripten_glDeleteRenderbuffers(n, renderbuffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[renderbuffers + i * 4 >> 2]; + var renderbuffer = GL.renderbuffers[id]; + if (!renderbuffer) continue; + GLctx.deleteRenderbuffer(renderbuffer); + renderbuffer.name = 0; + GL.renderbuffers[id] = null + } + } + + function _emscripten_glDeleteSamplers(n, samplers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[samplers + i * 4 >> 2]; + var sampler = GL.samplers[id]; + if (!sampler) continue; + GLctx["deleteSampler"](sampler); + sampler.name = 0; + GL.samplers[id] = null + } + } + + function _emscripten_glDeleteShader(id) { + if (!id) return; + var shader = GL.shaders[id]; + if (!shader) { + GL.recordError(1281); + return + } + GLctx.deleteShader(shader); + GL.shaders[id] = null + } + + function _emscripten_glDeleteSync(id) { + if (!id) return; + var sync = GL.syncs[id]; + if (!sync) { + GL.recordError(1281); + return + } + GLctx.deleteSync(sync); + sync.name = 0; + GL.syncs[id] = null + } + + function _emscripten_glDeleteTextures(n, textures) { + for (var i = 0; i < n; i++) { + var id = HEAP32[textures + i * 4 >> 2]; + var texture = GL.textures[id]; + if (!texture) continue; + GLctx.deleteTexture(texture); + texture.name = 0; + GL.textures[id] = null + } + } + + function _emscripten_glDeleteTransformFeedbacks(n, ids) { + for (var i = 0; i < n; i++) { + var id = HEAP32[ids + i * 4 >> 2]; + var transformFeedback = GL.transformFeedbacks[id]; + if (!transformFeedback) continue; + GLctx["deleteTransformFeedback"](transformFeedback); + transformFeedback.name = 0; + GL.transformFeedbacks[id] = null + } + } + + function _emscripten_glDeleteVertexArrays(n, vaos) { + for (var i = 0; i < n; i++) { + var id = HEAP32[vaos + i * 4 >> 2]; + GLctx["deleteVertexArray"](GL.vaos[id]); + GL.vaos[id] = null + } + } + + function _emscripten_glDeleteVertexArraysOES(n, vaos) { + for (var i = 0; i < n; i++) { + var id = HEAP32[vaos + i * 4 >> 2]; + GLctx["deleteVertexArray"](GL.vaos[id]); + GL.vaos[id] = null + } + } + + function _emscripten_glDepthFunc(x0) { + GLctx["depthFunc"](x0) + } + + function _emscripten_glDepthMask(flag) { + GLctx.depthMask(!!flag) + } + + function _emscripten_glDepthRangef(x0, x1) { + GLctx["depthRange"](x0, x1) + } + + function _emscripten_glDetachShader(program, shader) { + GLctx.detachShader(GL.programs[program], GL.shaders[shader]) + } + + function _emscripten_glDisable(x0) { + GLctx["disable"](x0) + } + + function _emscripten_glDisableVertexAttribArray(index) { + GLctx.disableVertexAttribArray(index) + } + + function _emscripten_glDrawArrays(mode, first, count) { + GLctx.drawArrays(mode, first, count) + } + + function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) { + GLctx["drawArraysInstanced"](mode, first, count, primcount) + } + + function _emscripten_glDrawArraysInstancedANGLE(mode, first, count, primcount) { + GLctx["drawArraysInstanced"](mode, first, count, primcount) + } + + function _emscripten_glDrawArraysInstancedARB(mode, first, count, primcount) { + GLctx["drawArraysInstanced"](mode, first, count, primcount) + } + + function _emscripten_glDrawArraysInstancedEXT(mode, first, count, primcount) { + GLctx["drawArraysInstanced"](mode, first, count, primcount) + } + + function _emscripten_glDrawArraysInstancedNV(mode, first, count, primcount) { + GLctx["drawArraysInstanced"](mode, first, count, primcount) + } + var tempFixedLengthArray = []; + + function _emscripten_glDrawBuffers(n, bufs) { + var bufArray = tempFixedLengthArray[n]; + for (var i = 0; i < n; i++) { + bufArray[i] = HEAP32[bufs + i * 4 >> 2] + } + GLctx["drawBuffers"](bufArray) + } + + function _emscripten_glDrawBuffersEXT(n, bufs) { + var bufArray = tempFixedLengthArray[n]; + for (var i = 0; i < n; i++) { + bufArray[i] = HEAP32[bufs + i * 4 >> 2] + } + GLctx["drawBuffers"](bufArray) + } + + function _emscripten_glDrawBuffersWEBGL(n, bufs) { + var bufArray = tempFixedLengthArray[n]; + for (var i = 0; i < n; i++) { + bufArray[i] = HEAP32[bufs + i * 4 >> 2] + } + GLctx["drawBuffers"](bufArray) + } + + function _emscripten_glDrawElements(mode, count, type, indices) { + GLctx.drawElements(mode, count, type, indices) + } + + function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) { + GLctx["drawElementsInstanced"](mode, count, type, indices, primcount) + } + + function _emscripten_glDrawElementsInstancedANGLE(mode, count, type, indices, primcount) { + GLctx["drawElementsInstanced"](mode, count, type, indices, primcount) + } + + function _emscripten_glDrawElementsInstancedARB(mode, count, type, indices, primcount) { + GLctx["drawElementsInstanced"](mode, count, type, indices, primcount) + } + + function _emscripten_glDrawElementsInstancedEXT(mode, count, type, indices, primcount) { + GLctx["drawElementsInstanced"](mode, count, type, indices, primcount) + } + + function _emscripten_glDrawElementsInstancedNV(mode, count, type, indices, primcount) { + GLctx["drawElementsInstanced"](mode, count, type, indices, primcount) + } + + function _glDrawElements(mode, count, type, indices) { + GLctx.drawElements(mode, count, type, indices) + } + + function _emscripten_glDrawRangeElements(mode, start, end, count, type, indices) { + _glDrawElements(mode, count, type, indices) + } + + function _emscripten_glEnable(x0) { + GLctx["enable"](x0) + } + + function _emscripten_glEnableVertexAttribArray(index) { + GLctx.enableVertexAttribArray(index) + } + + function _emscripten_glEndQuery(x0) { + GLctx["endQuery"](x0) + } + + function _emscripten_glEndQueryEXT(target) { + GLctx.disjointTimerQueryExt["endQueryEXT"](target) + } + + function _emscripten_glEndTransformFeedback() { + GLctx["endTransformFeedback"]() + } + + function _emscripten_glFenceSync(condition, flags) { + var sync = GLctx.fenceSync(condition, flags); + if (sync) { + var id = GL.getNewId(GL.syncs); + sync.name = id; + GL.syncs[id] = sync; + return id + } else { + return 0 + } + } + + function _emscripten_glFinish() { + GLctx["finish"]() + } + + function _emscripten_glFlush() { + GLctx["flush"]() + } + + function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) { + GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, GL.renderbuffers[renderbuffer]) + } + + function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) { + GLctx.framebufferTexture2D(target, attachment, textarget, GL.textures[texture], level) + } + + function _emscripten_glFramebufferTextureLayer(target, attachment, texture, level, layer) { + GLctx.framebufferTextureLayer(target, attachment, GL.textures[texture], level, layer) + } + + function _emscripten_glFrontFace(x0) { + GLctx["frontFace"](x0) + } + + function __glGenObject(n, buffers, createFunction, objectTable) { + for (var i = 0; i < n; i++) { + var buffer = GLctx[createFunction](); + var id = buffer && GL.getNewId(objectTable); + if (buffer) { + buffer.name = id; + objectTable[id] = buffer + } else { + GL.recordError(1282) + } + HEAP32[buffers + i * 4 >> 2] = id + } + } + + function _emscripten_glGenBuffers(n, buffers) { + __glGenObject(n, buffers, "createBuffer", GL.buffers) + } + + function _emscripten_glGenFramebuffers(n, ids) { + __glGenObject(n, ids, "createFramebuffer", GL.framebuffers) + } + + function _emscripten_glGenQueries(n, ids) { + __glGenObject(n, ids, "createQuery", GL.queries) + } + + function _emscripten_glGenQueriesEXT(n, ids) { + for (var i = 0; i < n; i++) { + var query = GLctx.disjointTimerQueryExt["createQueryEXT"](); + if (!query) { + GL.recordError(1282); + while (i < n) HEAP32[ids + i++ * 4 >> 2] = 0; + return + } + var id = GL.getNewId(GL.queries); + query.name = id; + GL.queries[id] = query; + HEAP32[ids + i * 4 >> 2] = id + } + } + + function _emscripten_glGenRenderbuffers(n, renderbuffers) { + __glGenObject(n, renderbuffers, "createRenderbuffer", GL.renderbuffers) + } + + function _emscripten_glGenSamplers(n, samplers) { + __glGenObject(n, samplers, "createSampler", GL.samplers) + } + + function _emscripten_glGenTextures(n, textures) { + __glGenObject(n, textures, "createTexture", GL.textures) + } + + function _emscripten_glGenTransformFeedbacks(n, ids) { + __glGenObject(n, ids, "createTransformFeedback", GL.transformFeedbacks) + } + + function _emscripten_glGenVertexArrays(n, arrays) { + __glGenObject(n, arrays, "createVertexArray", GL.vaos) + } + + function _emscripten_glGenVertexArraysOES(n, arrays) { + __glGenObject(n, arrays, "createVertexArray", GL.vaos) + } + + function _emscripten_glGenerateMipmap(x0) { + GLctx["generateMipmap"](x0) + } + + function __glGetActiveAttribOrUniform(funcName, program, index, bufSize, length, size, type, name) { + program = GL.programs[program]; + var info = GLctx[funcName](program, index); + if (info) { + var numBytesWrittenExclNull = name && stringToUTF8(info.name, name, bufSize); + if (length) HEAP32[length >> 2] = numBytesWrittenExclNull; + if (size) HEAP32[size >> 2] = info.size; + if (type) HEAP32[type >> 2] = info.type + } + } + + function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) { + __glGetActiveAttribOrUniform("getActiveAttrib", program, index, bufSize, length, size, type, name) + } + + function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) { + __glGetActiveAttribOrUniform("getActiveUniform", program, index, bufSize, length, size, type, name) + } + + function _emscripten_glGetActiveUniformBlockName(program, uniformBlockIndex, bufSize, length, uniformBlockName) { + program = GL.programs[program]; + var result = GLctx["getActiveUniformBlockName"](program, uniformBlockIndex); + if (!result) return; + if (uniformBlockName && bufSize > 0) { + var numBytesWrittenExclNull = stringToUTF8(result, uniformBlockName, bufSize); + if (length) HEAP32[length >> 2] = numBytesWrittenExclNull + } else { + if (length) HEAP32[length >> 2] = 0 + } + } + + function _emscripten_glGetActiveUniformBlockiv(program, uniformBlockIndex, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + program = GL.programs[program]; + if (pname == 35393) { + var name = GLctx["getActiveUniformBlockName"](program, uniformBlockIndex); + HEAP32[params >> 2] = name.length + 1; + return + } + var result = GLctx["getActiveUniformBlockParameter"](program, uniformBlockIndex, pname); + if (result === null) return; + if (pname == 35395) { + for (var i = 0; i < result.length; i++) { + HEAP32[params + i * 4 >> 2] = result[i] + } + } else { + HEAP32[params >> 2] = result + } + } + + function _emscripten_glGetActiveUniformsiv(program, uniformCount, uniformIndices, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + if (uniformCount > 0 && uniformIndices == 0) { + GL.recordError(1281); + return + } + program = GL.programs[program]; + var ids = []; + for (var i = 0; i < uniformCount; i++) { + ids.push(HEAP32[uniformIndices + i * 4 >> 2]) + } + var result = GLctx["getActiveUniforms"](program, ids, pname); + if (!result) return; + var len = result.length; + for (var i = 0; i < len; i++) { + HEAP32[params + i * 4 >> 2] = result[i] + } + } + + function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) { + var result = GLctx.getAttachedShaders(GL.programs[program]); + var len = result.length; + if (len > maxCount) { + len = maxCount + } + HEAP32[count >> 2] = len; + for (var i = 0; i < len; ++i) { + var id = GL.shaders.indexOf(result[i]); + HEAP32[shaders + i * 4 >> 2] = id + } + } + + function _emscripten_glGetAttribLocation(program, name) { + return GLctx.getAttribLocation(GL.programs[program], UTF8ToString(name)) + } + + function writeI53ToI64(ptr, num) { + HEAPU32[ptr >> 2] = num; + HEAPU32[ptr + 4 >> 2] = (num - HEAPU32[ptr >> 2]) / 4294967296 + } + + function emscriptenWebGLGet(name_, p, type) { + if (!p) { + GL.recordError(1281); + return + } + var ret = undefined; + switch (name_) { + case 36346: + ret = 1; + break; + case 36344: + if (type != 0 && type != 1) { + GL.recordError(1280) + } + return; + case 34814: + case 36345: + ret = 0; + break; + case 34466: + var formats = GLctx.getParameter(34467); + ret = formats ? formats.length : 0; + break; + case 33309: + if (GL.currentContext.version < 2) { + GL.recordError(1282); + return + } + var exts = GLctx.getSupportedExtensions() || []; + ret = 2 * exts.length; + break; + case 33307: + case 33308: + if (GL.currentContext.version < 2) { + GL.recordError(1280); + return + } + ret = name_ == 33307 ? 3 : 0; + break + } + if (ret === undefined) { + var result = GLctx.getParameter(name_); + switch (typeof result) { + case "number": + ret = result; + break; + case "boolean": + ret = result ? 1 : 0; + break; + case "string": + GL.recordError(1280); + return; + case "object": + if (result === null) { + switch (name_) { + case 34964: + case 35725: + case 34965: + case 36006: + case 36007: + case 32873: + case 34229: + case 36662: + case 36663: + case 35053: + case 35055: + case 36010: + case 35097: + case 35869: + case 32874: + case 36389: + case 35983: + case 35368: + case 34068: + { + ret = 0; + break + } + default: + { + GL.recordError(1280); + return + } + } + } else if (result instanceof Float32Array || result instanceof Uint32Array || result instanceof Int32Array || result instanceof Array) { + for (var i = 0; i < result.length; ++i) { + switch (type) { + case 0: + HEAP32[p + i * 4 >> 2] = result[i]; + break; + case 2: + HEAPF32[p + i * 4 >> 2] = result[i]; + break; + case 4: + HEAP8[p + i >> 0] = result[i] ? 1 : 0; + break + } + } + return + } else { + try { + ret = result.name | 0 + } catch (e) { + GL.recordError(1280); + err("GL_INVALID_ENUM in glGet" + type + "v: Unknown object returned from WebGL getParameter(" + name_ + ")! (error: " + e + ")"); + return + } + } + break; + default: + GL.recordError(1280); + err("GL_INVALID_ENUM in glGet" + type + "v: Native code calling glGet" + type + "v(" + name_ + ") and it returns " + result + " of type " + typeof result + "!"); + return + } + } + switch (type) { + case 1: + writeI53ToI64(p, ret); + break; + case 0: + HEAP32[p >> 2] = ret; + break; + case 2: + HEAPF32[p >> 2] = ret; + break; + case 4: + HEAP8[p >> 0] = ret ? 1 : 0; + break + } + } + + function _emscripten_glGetBooleanv(name_, p) { + emscriptenWebGLGet(name_, p, 4) + } + + function _emscripten_glGetBufferParameteri64v(target, value, data) { + if (!data) { + GL.recordError(1281); + return + } + writeI53ToI64(data, GLctx.getBufferParameter(target, value)) + } + + function _emscripten_glGetBufferParameteriv(target, value, data) { + if (!data) { + GL.recordError(1281); + return + } + HEAP32[data >> 2] = GLctx.getBufferParameter(target, value) + } + + function _emscripten_glGetError() { + var error = GLctx.getError() || GL.lastError; + GL.lastError = 0; + return error + } + + function _emscripten_glGetFloatv(name_, p) { + emscriptenWebGLGet(name_, p, 2) + } + + function _emscripten_glGetFragDataLocation(program, name) { + return GLctx["getFragDataLocation"](GL.programs[program], UTF8ToString(name)) + } + + function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) { + var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname); + if (result instanceof WebGLRenderbuffer || result instanceof WebGLTexture) { + result = result.name | 0 + } + HEAP32[params >> 2] = result + } + + function emscriptenWebGLGetIndexed(target, index, data, type) { + if (!data) { + GL.recordError(1281); + return + } + var result = GLctx["getIndexedParameter"](target, index); + var ret; + switch (typeof result) { + case "boolean": + ret = result ? 1 : 0; + break; + case "number": + ret = result; + break; + case "object": + if (result === null) { + switch (target) { + case 35983: + case 35368: + ret = 0; + break; + default: + { + GL.recordError(1280); + return + } + } + } else if (result instanceof WebGLBuffer) { + ret = result.name | 0 + } else { + GL.recordError(1280); + return + } + break; + default: + GL.recordError(1280); + return + } + switch (type) { + case 1: + writeI53ToI64(data, ret); + break; + case 0: + HEAP32[data >> 2] = ret; + break; + case 2: + HEAPF32[data >> 2] = ret; + break; + case 4: + HEAP8[data >> 0] = ret ? 1 : 0; + break; + default: + throw "internal emscriptenWebGLGetIndexed() error, bad type: " + type + } + } + + function _emscripten_glGetInteger64i_v(target, index, data) { + emscriptenWebGLGetIndexed(target, index, data, 1) + } + + function _emscripten_glGetInteger64v(name_, p) { + emscriptenWebGLGet(name_, p, 1) + } + + function _emscripten_glGetIntegeri_v(target, index, data) { + emscriptenWebGLGetIndexed(target, index, data, 0) + } + + function _emscripten_glGetIntegerv(name_, p) { + emscriptenWebGLGet(name_, p, 0) + } + + function _emscripten_glGetInternalformativ(target, internalformat, pname, bufSize, params) { + if (bufSize < 0) { + GL.recordError(1281); + return + } + if (!params) { + GL.recordError(1281); + return + } + var ret = GLctx["getInternalformatParameter"](target, internalformat, pname); + if (ret === null) return; + for (var i = 0; i < ret.length && i < bufSize; ++i) { + HEAP32[params + i * 4 >> 2] = ret[i] + } + } + + function _emscripten_glGetProgramBinary(program, bufSize, length, binaryFormat, binary) { + GL.recordError(1282) + } + + function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) { + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = "(unknown error)"; + var numBytesWrittenExclNull = maxLength > 0 && infoLog ? stringToUTF8(log, infoLog, maxLength) : 0; + if (length) HEAP32[length >> 2] = numBytesWrittenExclNull + } + + function _emscripten_glGetProgramiv(program, pname, p) { + if (!p) { + GL.recordError(1281); + return + } + if (program >= GL.counter) { + GL.recordError(1281); + return + } + program = GL.programs[program]; + if (pname == 35716) { + var log = GLctx.getProgramInfoLog(program); + if (log === null) log = "(unknown error)"; + HEAP32[p >> 2] = log.length + 1 + } else if (pname == 35719) { + if (!program.maxUniformLength) { + for (var i = 0; i < GLctx.getProgramParameter(program, 35718); ++i) { + program.maxUniformLength = Math.max(program.maxUniformLength, GLctx.getActiveUniform(program, i).name.length + 1) + } + } + HEAP32[p >> 2] = program.maxUniformLength + } else if (pname == 35722) { + if (!program.maxAttributeLength) { + for (var i = 0; i < GLctx.getProgramParameter(program, 35721); ++i) { + program.maxAttributeLength = Math.max(program.maxAttributeLength, GLctx.getActiveAttrib(program, i).name.length + 1) + } + } + HEAP32[p >> 2] = program.maxAttributeLength + } else if (pname == 35381) { + if (!program.maxUniformBlockNameLength) { + for (var i = 0; i < GLctx.getProgramParameter(program, 35382); ++i) { + program.maxUniformBlockNameLength = Math.max(program.maxUniformBlockNameLength, GLctx.getActiveUniformBlockName(program, i).length + 1) + } + } + HEAP32[p >> 2] = program.maxUniformBlockNameLength + } else { + HEAP32[p >> 2] = GLctx.getProgramParameter(program, pname) + } + } + + function _emscripten_glGetQueryObjecti64vEXT(id, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + var query = GL.queries[id]; + var param; + if (GL.currentContext.version < 2) { + param = GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query, pname) + } else { + param = GLctx["getQueryParameter"](query, pname) + } + var ret; + if (typeof param == "boolean") { + ret = param ? 1 : 0 + } else { + ret = param + } + writeI53ToI64(params, ret) + } + + function _emscripten_glGetQueryObjectivEXT(id, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + var query = GL.queries[id]; + var param = GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query, pname); + var ret; + if (typeof param == "boolean") { + ret = param ? 1 : 0 + } else { + ret = param + } + HEAP32[params >> 2] = ret + } + + function _emscripten_glGetQueryObjectui64vEXT(id, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + var query = GL.queries[id]; + var param; + if (GL.currentContext.version < 2) { + param = GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query, pname) + } else { + param = GLctx["getQueryParameter"](query, pname) + } + var ret; + if (typeof param == "boolean") { + ret = param ? 1 : 0 + } else { + ret = param + } + writeI53ToI64(params, ret) + } + + function _emscripten_glGetQueryObjectuiv(id, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + var query = GL.queries[id]; + var param = GLctx["getQueryParameter"](query, pname); + var ret; + if (typeof param == "boolean") { + ret = param ? 1 : 0 + } else { + ret = param + } + HEAP32[params >> 2] = ret + } + + function _emscripten_glGetQueryObjectuivEXT(id, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + var query = GL.queries[id]; + var param = GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query, pname); + var ret; + if (typeof param == "boolean") { + ret = param ? 1 : 0 + } else { + ret = param + } + HEAP32[params >> 2] = ret + } + + function _emscripten_glGetQueryiv(target, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + HEAP32[params >> 2] = GLctx["getQuery"](target, pname) + } + + function _emscripten_glGetQueryivEXT(target, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + HEAP32[params >> 2] = GLctx.disjointTimerQueryExt["getQueryEXT"](target, pname) + } + + function _emscripten_glGetRenderbufferParameteriv(target, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + HEAP32[params >> 2] = GLctx.getRenderbufferParameter(target, pname) + } + + function _emscripten_glGetSamplerParameterfv(sampler, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + HEAPF32[params >> 2] = GLctx["getSamplerParameter"](GL.samplers[sampler], pname) + } + + function _emscripten_glGetSamplerParameteriv(sampler, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + HEAP32[params >> 2] = GLctx["getSamplerParameter"](GL.samplers[sampler], pname) + } + + function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = "(unknown error)"; + var numBytesWrittenExclNull = maxLength > 0 && infoLog ? stringToUTF8(log, infoLog, maxLength) : 0; + if (length) HEAP32[length >> 2] = numBytesWrittenExclNull + } + + function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) { + var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType); + HEAP32[range >> 2] = result.rangeMin; + HEAP32[range + 4 >> 2] = result.rangeMax; + HEAP32[precision >> 2] = result.precision + } + + function _emscripten_glGetShaderSource(shader, bufSize, length, source) { + var result = GLctx.getShaderSource(GL.shaders[shader]); + if (!result) return; + var numBytesWrittenExclNull = bufSize > 0 && source ? stringToUTF8(result, source, bufSize) : 0; + if (length) HEAP32[length >> 2] = numBytesWrittenExclNull + } + + function _emscripten_glGetShaderiv(shader, pname, p) { + if (!p) { + GL.recordError(1281); + return + } + if (pname == 35716) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = "(unknown error)"; + var logLength = log ? log.length + 1 : 0; + HEAP32[p >> 2] = logLength + } else if (pname == 35720) { + var source = GLctx.getShaderSource(GL.shaders[shader]); + var sourceLength = source ? source.length + 1 : 0; + HEAP32[p >> 2] = sourceLength + } else { + HEAP32[p >> 2] = GLctx.getShaderParameter(GL.shaders[shader], pname) + } + } + + function stringToNewUTF8(jsString) { + var length = lengthBytesUTF8(jsString) + 1; + var cString = _malloc(length); + stringToUTF8(jsString, cString, length); + return cString + } + + function _emscripten_glGetString(name_) { + var ret = GL.stringCache[name_]; + if (!ret) { + switch (name_) { + case 7939: + var exts = GLctx.getSupportedExtensions() || []; + exts = exts.concat(exts.map(function(e) { + return "GL_" + e + })); + ret = stringToNewUTF8(exts.join(" ")); + break; + case 7936: + case 7937: + case 37445: + case 37446: + var s = GLctx.getParameter(name_); + if (!s) { + GL.recordError(1280) + } + ret = s && stringToNewUTF8(s); + break; + case 7938: + var glVersion = GLctx.getParameter(7938); + if (GL.currentContext.version >= 2) glVersion = "OpenGL ES 3.0 (" + glVersion + ")"; + else { + glVersion = "OpenGL ES 2.0 (" + glVersion + ")" + } + ret = stringToNewUTF8(glVersion); + break; + case 35724: + var glslVersion = GLctx.getParameter(35724); + var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/; + var ver_num = glslVersion.match(ver_re); + if (ver_num !== null) { + if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + "0"; + glslVersion = "OpenGL ES GLSL ES " + ver_num[1] + " (" + glslVersion + ")" + } + ret = stringToNewUTF8(glslVersion); + break; + default: + GL.recordError(1280) + } + GL.stringCache[name_] = ret + } + return ret + } + + function _emscripten_glGetStringi(name, index) { + if (GL.currentContext.version < 2) { + GL.recordError(1282); + return 0 + } + var stringiCache = GL.stringiCache[name]; + if (stringiCache) { + if (index < 0 || index >= stringiCache.length) { + GL.recordError(1281); + return 0 + } + return stringiCache[index] + } + switch (name) { + case 7939: + var exts = GLctx.getSupportedExtensions() || []; + exts = exts.concat(exts.map(function(e) { + return "GL_" + e + })); + exts = exts.map(function(e) { + return stringToNewUTF8(e) + }); + stringiCache = GL.stringiCache[name] = exts; + if (index < 0 || index >= stringiCache.length) { + GL.recordError(1281); + return 0 + } + return stringiCache[index]; + default: + GL.recordError(1280); + return 0 + } + } + + function _emscripten_glGetSynciv(sync, pname, bufSize, length, values) { + if (bufSize < 0) { + GL.recordError(1281); + return + } + if (!values) { + GL.recordError(1281); + return + } + var ret = GLctx.getSyncParameter(GL.syncs[sync], pname); + if (ret !== null) { + HEAP32[values >> 2] = ret; + if (length) HEAP32[length >> 2] = 1 + } + } + + function _emscripten_glGetTexParameterfv(target, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + HEAPF32[params >> 2] = GLctx.getTexParameter(target, pname) + } + + function _emscripten_glGetTexParameteriv(target, pname, params) { + if (!params) { + GL.recordError(1281); + return + } + HEAP32[params >> 2] = GLctx.getTexParameter(target, pname) + } + + function _emscripten_glGetTransformFeedbackVarying(program, index, bufSize, length, size, type, name) { + program = GL.programs[program]; + var info = GLctx["getTransformFeedbackVarying"](program, index); + if (!info) return; + if (name && bufSize > 0) { + var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize); + if (length) HEAP32[length >> 2] = numBytesWrittenExclNull + } else { + if (length) HEAP32[length >> 2] = 0 + } + if (size) HEAP32[size >> 2] = info.size; + if (type) HEAP32[type >> 2] = info.type + } + + function _emscripten_glGetUniformBlockIndex(program, uniformBlockName) { + return GLctx["getUniformBlockIndex"](GL.programs[program], UTF8ToString(uniformBlockName)) + } + + function _emscripten_glGetUniformIndices(program, uniformCount, uniformNames, uniformIndices) { + if (!uniformIndices) { + GL.recordError(1281); + return + } + if (uniformCount > 0 && (uniformNames == 0 || uniformIndices == 0)) { + GL.recordError(1281); + return + } + program = GL.programs[program]; + var names = []; + for (var i = 0; i < uniformCount; i++) names.push(UTF8ToString(HEAP32[uniformNames + i * 4 >> 2])); + var result = GLctx["getUniformIndices"](program, names); + if (!result) return; + var len = result.length; + for (var i = 0; i < len; i++) { + HEAP32[uniformIndices + i * 4 >> 2] = result[i] + } + } + + function webglGetLeftBracePos(name) { + return name.slice(-1) == "]" && name.lastIndexOf("[") + } + + function webglPrepareUniformLocationsBeforeFirstUse(program) { + var uniformLocsById = program.uniformLocsById, + uniformSizeAndIdsByName = program.uniformSizeAndIdsByName, + i, j; + if (!uniformLocsById) { + program.uniformLocsById = uniformLocsById = {}; + program.uniformArrayNamesById = {}; + for (i = 0; i < GLctx.getProgramParameter(program, 35718); ++i) { + var u = GLctx.getActiveUniform(program, i); + var nm = u.name; + var sz = u.size; + var lb = webglGetLeftBracePos(nm); + var arrayName = lb > 0 ? nm.slice(0, lb) : nm; + var id = program.uniformIdCounter; + program.uniformIdCounter += sz; + uniformSizeAndIdsByName[arrayName] = [sz, id]; + for (j = 0; j < sz; ++j) { + uniformLocsById[id] = j; + program.uniformArrayNamesById[id++] = arrayName + } + } + } + } + + function _emscripten_glGetUniformLocation(program, name) { + name = UTF8ToString(name); + if (program = GL.programs[program]) { + webglPrepareUniformLocationsBeforeFirstUse(program); + var uniformLocsById = program.uniformLocsById; + var arrayIndex = 0; + var uniformBaseName = name; + var leftBrace = webglGetLeftBracePos(name); + if (leftBrace > 0) { + arrayIndex = jstoi_q(name.slice(leftBrace + 1)) >>> 0; + uniformBaseName = name.slice(0, leftBrace) + } + var sizeAndId = program.uniformSizeAndIdsByName[uniformBaseName]; + if (sizeAndId && arrayIndex < sizeAndId[0]) { + arrayIndex += sizeAndId[1]; + if (uniformLocsById[arrayIndex] = uniformLocsById[arrayIndex] || GLctx.getUniformLocation(program, name)) { + return arrayIndex + } + } + } else { + GL.recordError(1281) + } + return -1 + } + + function webglGetUniformLocation(location) { + var p = GLctx.currentProgram; + if (p) { + var webglLoc = p.uniformLocsById[location]; + if (typeof webglLoc == "number") { + p.uniformLocsById[location] = webglLoc = GLctx.getUniformLocation(p, p.uniformArrayNamesById[location] + (webglLoc > 0 ? "[" + webglLoc + "]" : "")) + } + return webglLoc + } else { + GL.recordError(1282) + } + } + + function emscriptenWebGLGetUniform(program, location, params, type) { + if (!params) { + GL.recordError(1281); + return + } + program = GL.programs[program]; + webglPrepareUniformLocationsBeforeFirstUse(program); + var data = GLctx.getUniform(program, webglGetUniformLocation(location)); + if (typeof data == "number" || typeof data == "boolean") { + switch (type) { + case 0: + HEAP32[params >> 2] = data; + break; + case 2: + HEAPF32[params >> 2] = data; + break + } + } else { + for (var i = 0; i < data.length; i++) { + switch (type) { + case 0: + HEAP32[params + i * 4 >> 2] = data[i]; + break; + case 2: + HEAPF32[params + i * 4 >> 2] = data[i]; + break + } + } + } + } + + function _emscripten_glGetUniformfv(program, location, params) { + emscriptenWebGLGetUniform(program, location, params, 2) + } + + function _emscripten_glGetUniformiv(program, location, params) { + emscriptenWebGLGetUniform(program, location, params, 0) + } + + function _emscripten_glGetUniformuiv(program, location, params) { + emscriptenWebGLGetUniform(program, location, params, 0) + } + + function emscriptenWebGLGetVertexAttrib(index, pname, params, type) { + if (!params) { + GL.recordError(1281); + return + } + var data = GLctx.getVertexAttrib(index, pname); + if (pname == 34975) { + HEAP32[params >> 2] = data && data["name"] + } else if (typeof data == "number" || typeof data == "boolean") { + switch (type) { + case 0: + HEAP32[params >> 2] = data; + break; + case 2: + HEAPF32[params >> 2] = data; + break; + case 5: + HEAP32[params >> 2] = Math.fround(data); + break + } + } else { + for (var i = 0; i < data.length; i++) { + switch (type) { + case 0: + HEAP32[params + i * 4 >> 2] = data[i]; + break; + case 2: + HEAPF32[params + i * 4 >> 2] = data[i]; + break; + case 5: + HEAP32[params + i * 4 >> 2] = Math.fround(data[i]); + break + } + } + } + } + + function _emscripten_glGetVertexAttribIiv(index, pname, params) { + emscriptenWebGLGetVertexAttrib(index, pname, params, 0) + } + + function _emscripten_glGetVertexAttribIuiv(index, pname, params) { + emscriptenWebGLGetVertexAttrib(index, pname, params, 0) + } + + function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) { + if (!pointer) { + GL.recordError(1281); + return + } + HEAP32[pointer >> 2] = GLctx.getVertexAttribOffset(index, pname) + } + + function _emscripten_glGetVertexAttribfv(index, pname, params) { + emscriptenWebGLGetVertexAttrib(index, pname, params, 2) + } + + function _emscripten_glGetVertexAttribiv(index, pname, params) { + emscriptenWebGLGetVertexAttrib(index, pname, params, 5) + } + + function _emscripten_glHint(x0, x1) { + GLctx["hint"](x0, x1) + } + + function _emscripten_glInvalidateFramebuffer(target, numAttachments, attachments) { + var list = tempFixedLengthArray[numAttachments]; + for (var i = 0; i < numAttachments; i++) { + list[i] = HEAP32[attachments + i * 4 >> 2] + } + GLctx["invalidateFramebuffer"](target, list) + } + + function _emscripten_glInvalidateSubFramebuffer(target, numAttachments, attachments, x, y, width, height) { + var list = tempFixedLengthArray[numAttachments]; + for (var i = 0; i < numAttachments; i++) { + list[i] = HEAP32[attachments + i * 4 >> 2] + } + GLctx["invalidateSubFramebuffer"](target, list, x, y, width, height) + } + + function _emscripten_glIsBuffer(buffer) { + var b = GL.buffers[buffer]; + if (!b) return 0; + return GLctx.isBuffer(b) + } + + function _emscripten_glIsEnabled(x0) { + return GLctx["isEnabled"](x0) + } + + function _emscripten_glIsFramebuffer(framebuffer) { + var fb = GL.framebuffers[framebuffer]; + if (!fb) return 0; + return GLctx.isFramebuffer(fb) + } + + function _emscripten_glIsProgram(program) { + program = GL.programs[program]; + if (!program) return 0; + return GLctx.isProgram(program) + } + + function _emscripten_glIsQuery(id) { + var query = GL.queries[id]; + if (!query) return 0; + return GLctx["isQuery"](query) + } + + function _emscripten_glIsQueryEXT(id) { + var query = GL.queries[id]; + if (!query) return 0; + return GLctx.disjointTimerQueryExt["isQueryEXT"](query) + } + + function _emscripten_glIsRenderbuffer(renderbuffer) { + var rb = GL.renderbuffers[renderbuffer]; + if (!rb) return 0; + return GLctx.isRenderbuffer(rb) + } + + function _emscripten_glIsSampler(id) { + var sampler = GL.samplers[id]; + if (!sampler) return 0; + return GLctx["isSampler"](sampler) + } + + function _emscripten_glIsShader(shader) { + var s = GL.shaders[shader]; + if (!s) return 0; + return GLctx.isShader(s) + } + + function _emscripten_glIsSync(sync) { + return GLctx.isSync(GL.syncs[sync]) + } + + function _emscripten_glIsTexture(id) { + var texture = GL.textures[id]; + if (!texture) return 0; + return GLctx.isTexture(texture) + } + + function _emscripten_glIsTransformFeedback(id) { + return GLctx["isTransformFeedback"](GL.transformFeedbacks[id]) + } + + function _emscripten_glIsVertexArray(array) { + var vao = GL.vaos[array]; + if (!vao) return 0; + return GLctx["isVertexArray"](vao) + } + + function _emscripten_glIsVertexArrayOES(array) { + var vao = GL.vaos[array]; + if (!vao) return 0; + return GLctx["isVertexArray"](vao) + } + + function _emscripten_glLineWidth(x0) { + GLctx["lineWidth"](x0) + } + + function _emscripten_glLinkProgram(program) { + program = GL.programs[program]; + GLctx.linkProgram(program); + program.uniformLocsById = 0; + program.uniformSizeAndIdsByName = {} + } + + function _emscripten_glPauseTransformFeedback() { + GLctx["pauseTransformFeedback"]() + } + + function _emscripten_glPixelStorei(pname, param) { + if (pname == 3317) { + GL.unpackAlignment = param + } + GLctx.pixelStorei(pname, param) + } + + function _emscripten_glPolygonOffset(x0, x1) { + GLctx["polygonOffset"](x0, x1) + } + + function _emscripten_glProgramBinary(program, binaryFormat, binary, length) { + GL.recordError(1280) + } + + function _emscripten_glProgramParameteri(program, pname, value) { + GL.recordError(1280) + } + + function _emscripten_glQueryCounterEXT(id, target) { + GLctx.disjointTimerQueryExt["queryCounterEXT"](GL.queries[id], target) + } + + function _emscripten_glReadBuffer(x0) { + GLctx["readBuffer"](x0) + } + + function computeUnpackAlignedImageSize(width, height, sizePerPixel, alignment) { + function roundedToNextMultipleOf(x, y) { + return x + y - 1 & -y + } + var plainRowSize = width * sizePerPixel; + var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment); + return height * alignedRowSize + } + + function __colorChannelsInGlTextureFormat(format) { + var colorChannels = { + 5: 3, + 6: 4, + 8: 2, + 29502: 3, + 29504: 4, + 26917: 2, + 26918: 2, + 29846: 3, + 29847: 4 + }; + return colorChannels[format - 6402] || 1 + } + + function heapObjectForWebGLType(type) { + type -= 5120; + if (type == 0) return HEAP8; + if (type == 1) return HEAPU8; + if (type == 2) return HEAP16; + if (type == 4) return HEAP32; + if (type == 6) return HEAPF32; + if (type == 5 || type == 28922 || type == 28520 || type == 30779 || type == 30782) return HEAPU32; + return HEAPU16 + } + + function heapAccessShiftForWebGLHeap(heap) { + return 31 - Math.clz32(heap.BYTES_PER_ELEMENT) + } + + function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) { + var heap = heapObjectForWebGLType(type); + var shift = heapAccessShiftForWebGLHeap(heap); + var byteSize = 1 << shift; + var sizePerPixel = __colorChannelsInGlTextureFormat(format) * byteSize; + var bytes = computeUnpackAlignedImageSize(width, height, sizePerPixel, GL.unpackAlignment); + return heap.subarray(pixels >> shift, pixels + bytes >> shift) + } + + function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelPackBufferBinding) { + GLctx.readPixels(x, y, width, height, format, type, pixels) + } else { + var heap = heapObjectForWebGLType(type); + GLctx.readPixels(x, y, width, height, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)) + } + return + } + var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format); + if (!pixelData) { + GL.recordError(1280); + return + } + GLctx.readPixels(x, y, width, height, format, type, pixelData) + } + + function _emscripten_glReleaseShaderCompiler() {} + + function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { + GLctx["renderbufferStorage"](x0, x1, x2, x3) + } + + function _emscripten_glRenderbufferStorageMultisample(x0, x1, x2, x3, x4) { + GLctx["renderbufferStorageMultisample"](x0, x1, x2, x3, x4) + } + + function _emscripten_glResumeTransformFeedback() { + GLctx["resumeTransformFeedback"]() + } + + function _emscripten_glSampleCoverage(value, invert) { + GLctx.sampleCoverage(value, !!invert) + } + + function _emscripten_glSamplerParameterf(sampler, pname, param) { + GLctx["samplerParameterf"](GL.samplers[sampler], pname, param) + } + + function _emscripten_glSamplerParameterfv(sampler, pname, params) { + var param = HEAPF32[params >> 2]; + GLctx["samplerParameterf"](GL.samplers[sampler], pname, param) + } + + function _emscripten_glSamplerParameteri(sampler, pname, param) { + GLctx["samplerParameteri"](GL.samplers[sampler], pname, param) + } + + function _emscripten_glSamplerParameteriv(sampler, pname, params) { + var param = HEAP32[params >> 2]; + GLctx["samplerParameteri"](GL.samplers[sampler], pname, param) + } + + function _emscripten_glScissor(x0, x1, x2, x3) { + GLctx["scissor"](x0, x1, x2, x3) + } + + function _emscripten_glShaderBinary() { + GL.recordError(1280) + } + + function _emscripten_glShaderSource(shader, count, string, length) { + var source = GL.getSource(shader, count, string, length); + GLctx.shaderSource(GL.shaders[shader], source) + } + + function _emscripten_glStencilFunc(x0, x1, x2) { + GLctx["stencilFunc"](x0, x1, x2) + } + + function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { + GLctx["stencilFuncSeparate"](x0, x1, x2, x3) + } + + function _emscripten_glStencilMask(x0) { + GLctx["stencilMask"](x0) + } + + function _emscripten_glStencilMaskSeparate(x0, x1) { + GLctx["stencilMaskSeparate"](x0, x1) + } + + function _emscripten_glStencilOp(x0, x1, x2) { + GLctx["stencilOp"](x0, x1, x2) + } + + function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { + GLctx["stencilOpSeparate"](x0, x1, x2, x3) + } + + function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels) + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)) + } else { + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, null) + } + return + } + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null) + } + + function _emscripten_glTexImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, pixels) + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)) + } else { + GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, null) + } + } + + function _emscripten_glTexParameterf(x0, x1, x2) { + GLctx["texParameterf"](x0, x1, x2) + } + + function _emscripten_glTexParameterfv(target, pname, params) { + var param = HEAPF32[params >> 2]; + GLctx.texParameterf(target, pname, param) + } + + function _emscripten_glTexParameteri(x0, x1, x2) { + GLctx["texParameteri"](x0, x1, x2) + } + + function _emscripten_glTexParameteriv(target, pname, params) { + var param = HEAP32[params >> 2]; + GLctx.texParameteri(target, pname, param) + } + + function _emscripten_glTexStorage2D(x0, x1, x2, x3, x4) { + GLctx["texStorage2D"](x0, x1, x2, x3, x4) + } + + function _emscripten_glTexStorage3D(x0, x1, x2, x3, x4, x5) { + GLctx["texStorage3D"](x0, x1, x2, x3, x4, x5) + } + + function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)) + } else { + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, null) + } + return + } + var pixelData = null; + if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0); + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData) + } + + function _emscripten_glTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)) + } else { + GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, null) + } + } + + function _emscripten_glTransformFeedbackVaryings(program, count, varyings, bufferMode) { + program = GL.programs[program]; + var vars = []; + for (var i = 0; i < count; i++) vars.push(UTF8ToString(HEAP32[varyings + i * 4 >> 2])); + GLctx["transformFeedbackVaryings"](program, vars, bufferMode) + } + + function _emscripten_glUniform1f(location, v0) { + GLctx.uniform1f(webglGetUniformLocation(location), v0) + } + var miniTempWebGLFloatBuffers = []; + + function _emscripten_glUniform1fv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform1fv(webglGetUniformLocation(location), HEAPF32, value >> 2, count); + return + } + if (count <= 288) { + var view = miniTempWebGLFloatBuffers[count - 1]; + for (var i = 0; i < count; ++i) { + view[i] = HEAPF32[value + 4 * i >> 2] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 4 >> 2) + } + GLctx.uniform1fv(webglGetUniformLocation(location), view) + } + + function _emscripten_glUniform1i(location, v0) { + GLctx.uniform1i(webglGetUniformLocation(location), v0) + } + var __miniTempWebGLIntBuffers = []; + + function _emscripten_glUniform1iv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform1iv(webglGetUniformLocation(location), HEAP32, value >> 2, count); + return + } + if (count <= 288) { + var view = __miniTempWebGLIntBuffers[count - 1]; + for (var i = 0; i < count; ++i) { + view[i] = HEAP32[value + 4 * i >> 2] + } + } else { + var view = HEAP32.subarray(value >> 2, value + count * 4 >> 2) + } + GLctx.uniform1iv(webglGetUniformLocation(location), view) + } + + function _emscripten_glUniform1ui(location, v0) { + GLctx.uniform1ui(webglGetUniformLocation(location), v0) + } + + function _emscripten_glUniform1uiv(location, count, value) { + count && GLctx.uniform1uiv(webglGetUniformLocation(location), HEAPU32, value >> 2, count) + } + + function _emscripten_glUniform2f(location, v0, v1) { + GLctx.uniform2f(webglGetUniformLocation(location), v0, v1) + } + + function _emscripten_glUniform2fv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform2fv(webglGetUniformLocation(location), HEAPF32, value >> 2, count * 2); + return + } + if (count <= 144) { + var view = miniTempWebGLFloatBuffers[2 * count - 1]; + for (var i = 0; i < 2 * count; i += 2) { + view[i] = HEAPF32[value + 4 * i >> 2]; + view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 8 >> 2) + } + GLctx.uniform2fv(webglGetUniformLocation(location), view) + } + + function _emscripten_glUniform2i(location, v0, v1) { + GLctx.uniform2i(webglGetUniformLocation(location), v0, v1) + } + + function _emscripten_glUniform2iv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform2iv(webglGetUniformLocation(location), HEAP32, value >> 2, count * 2); + return + } + if (count <= 144) { + var view = __miniTempWebGLIntBuffers[2 * count - 1]; + for (var i = 0; i < 2 * count; i += 2) { + view[i] = HEAP32[value + 4 * i >> 2]; + view[i + 1] = HEAP32[value + (4 * i + 4) >> 2] + } + } else { + var view = HEAP32.subarray(value >> 2, value + count * 8 >> 2) + } + GLctx.uniform2iv(webglGetUniformLocation(location), view) + } + + function _emscripten_glUniform2ui(location, v0, v1) { + GLctx.uniform2ui(webglGetUniformLocation(location), v0, v1) + } + + function _emscripten_glUniform2uiv(location, count, value) { + count && GLctx.uniform2uiv(webglGetUniformLocation(location), HEAPU32, value >> 2, count * 2) + } + + function _emscripten_glUniform3f(location, v0, v1, v2) { + GLctx.uniform3f(webglGetUniformLocation(location), v0, v1, v2) + } + + function _emscripten_glUniform3fv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform3fv(webglGetUniformLocation(location), HEAPF32, value >> 2, count * 3); + return + } + if (count <= 96) { + var view = miniTempWebGLFloatBuffers[3 * count - 1]; + for (var i = 0; i < 3 * count; i += 3) { + view[i] = HEAPF32[value + 4 * i >> 2]; + view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2]; + view[i + 2] = HEAPF32[value + (4 * i + 8) >> 2] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 12 >> 2) + } + GLctx.uniform3fv(webglGetUniformLocation(location), view) + } + + function _emscripten_glUniform3i(location, v0, v1, v2) { + GLctx.uniform3i(webglGetUniformLocation(location), v0, v1, v2) + } + + function _emscripten_glUniform3iv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform3iv(webglGetUniformLocation(location), HEAP32, value >> 2, count * 3); + return + } + if (count <= 96) { + var view = __miniTempWebGLIntBuffers[3 * count - 1]; + for (var i = 0; i < 3 * count; i += 3) { + view[i] = HEAP32[value + 4 * i >> 2]; + view[i + 1] = HEAP32[value + (4 * i + 4) >> 2]; + view[i + 2] = HEAP32[value + (4 * i + 8) >> 2] + } + } else { + var view = HEAP32.subarray(value >> 2, value + count * 12 >> 2) + } + GLctx.uniform3iv(webglGetUniformLocation(location), view) + } + + function _emscripten_glUniform3ui(location, v0, v1, v2) { + GLctx.uniform3ui(webglGetUniformLocation(location), v0, v1, v2) + } + + function _emscripten_glUniform3uiv(location, count, value) { + count && GLctx.uniform3uiv(webglGetUniformLocation(location), HEAPU32, value >> 2, count * 3) + } + + function _emscripten_glUniform4f(location, v0, v1, v2, v3) { + GLctx.uniform4f(webglGetUniformLocation(location), v0, v1, v2, v3) + } + + function _emscripten_glUniform4fv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform4fv(webglGetUniformLocation(location), HEAPF32, value >> 2, count * 4); + return + } + if (count <= 72) { + var view = miniTempWebGLFloatBuffers[4 * count - 1]; + var heap = HEAPF32; + value >>= 2; + for (var i = 0; i < 4 * count; i += 4) { + var dst = value + i; + view[i] = heap[dst]; + view[i + 1] = heap[dst + 1]; + view[i + 2] = heap[dst + 2]; + view[i + 3] = heap[dst + 3] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 16 >> 2) + } + GLctx.uniform4fv(webglGetUniformLocation(location), view) + } + + function _emscripten_glUniform4i(location, v0, v1, v2, v3) { + GLctx.uniform4i(webglGetUniformLocation(location), v0, v1, v2, v3) + } + + function _emscripten_glUniform4iv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform4iv(webglGetUniformLocation(location), HEAP32, value >> 2, count * 4); + return + } + if (count <= 72) { + var view = __miniTempWebGLIntBuffers[4 * count - 1]; + for (var i = 0; i < 4 * count; i += 4) { + view[i] = HEAP32[value + 4 * i >> 2]; + view[i + 1] = HEAP32[value + (4 * i + 4) >> 2]; + view[i + 2] = HEAP32[value + (4 * i + 8) >> 2]; + view[i + 3] = HEAP32[value + (4 * i + 12) >> 2] + } + } else { + var view = HEAP32.subarray(value >> 2, value + count * 16 >> 2) + } + GLctx.uniform4iv(webglGetUniformLocation(location), view) + } + + function _emscripten_glUniform4ui(location, v0, v1, v2, v3) { + GLctx.uniform4ui(webglGetUniformLocation(location), v0, v1, v2, v3) + } + + function _emscripten_glUniform4uiv(location, count, value) { + count && GLctx.uniform4uiv(webglGetUniformLocation(location), HEAPU32, value >> 2, count * 4) + } + + function _emscripten_glUniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding) { + program = GL.programs[program]; + GLctx["uniformBlockBinding"](program, uniformBlockIndex, uniformBlockBinding) + } + + function _emscripten_glUniformMatrix2fv(location, count, transpose, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniformMatrix2fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value >> 2, count * 4); + return + } + if (count <= 72) { + var view = miniTempWebGLFloatBuffers[4 * count - 1]; + for (var i = 0; i < 4 * count; i += 4) { + view[i] = HEAPF32[value + 4 * i >> 2]; + view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2]; + view[i + 2] = HEAPF32[value + (4 * i + 8) >> 2]; + view[i + 3] = HEAPF32[value + (4 * i + 12) >> 2] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 16 >> 2) + } + GLctx.uniformMatrix2fv(webglGetUniformLocation(location), !!transpose, view) + } + + function _emscripten_glUniformMatrix2x3fv(location, count, transpose, value) { + count && GLctx.uniformMatrix2x3fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value >> 2, count * 6) + } + + function _emscripten_glUniformMatrix2x4fv(location, count, transpose, value) { + count && GLctx.uniformMatrix2x4fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value >> 2, count * 8) + } + + function _emscripten_glUniformMatrix3fv(location, count, transpose, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniformMatrix3fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value >> 2, count * 9); + return + } + if (count <= 32) { + var view = miniTempWebGLFloatBuffers[9 * count - 1]; + for (var i = 0; i < 9 * count; i += 9) { + view[i] = HEAPF32[value + 4 * i >> 2]; + view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2]; + view[i + 2] = HEAPF32[value + (4 * i + 8) >> 2]; + view[i + 3] = HEAPF32[value + (4 * i + 12) >> 2]; + view[i + 4] = HEAPF32[value + (4 * i + 16) >> 2]; + view[i + 5] = HEAPF32[value + (4 * i + 20) >> 2]; + view[i + 6] = HEAPF32[value + (4 * i + 24) >> 2]; + view[i + 7] = HEAPF32[value + (4 * i + 28) >> 2]; + view[i + 8] = HEAPF32[value + (4 * i + 32) >> 2] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 36 >> 2) + } + GLctx.uniformMatrix3fv(webglGetUniformLocation(location), !!transpose, view) + } + + function _emscripten_glUniformMatrix3x2fv(location, count, transpose, value) { + count && GLctx.uniformMatrix3x2fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value >> 2, count * 6) + } + + function _emscripten_glUniformMatrix3x4fv(location, count, transpose, value) { + count && GLctx.uniformMatrix3x4fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value >> 2, count * 12) + } + + function _emscripten_glUniformMatrix4fv(location, count, transpose, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value >> 2, count * 16); + return + } + if (count <= 18) { + var view = miniTempWebGLFloatBuffers[16 * count - 1]; + var heap = HEAPF32; + value >>= 2; + for (var i = 0; i < 16 * count; i += 16) { + var dst = value + i; + view[i] = heap[dst]; + view[i + 1] = heap[dst + 1]; + view[i + 2] = heap[dst + 2]; + view[i + 3] = heap[dst + 3]; + view[i + 4] = heap[dst + 4]; + view[i + 5] = heap[dst + 5]; + view[i + 6] = heap[dst + 6]; + view[i + 7] = heap[dst + 7]; + view[i + 8] = heap[dst + 8]; + view[i + 9] = heap[dst + 9]; + view[i + 10] = heap[dst + 10]; + view[i + 11] = heap[dst + 11]; + view[i + 12] = heap[dst + 12]; + view[i + 13] = heap[dst + 13]; + view[i + 14] = heap[dst + 14]; + view[i + 15] = heap[dst + 15] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 64 >> 2) + } + GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, view) + } + + function _emscripten_glUniformMatrix4x2fv(location, count, transpose, value) { + count && GLctx.uniformMatrix4x2fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value >> 2, count * 8) + } + + function _emscripten_glUniformMatrix4x3fv(location, count, transpose, value) { + count && GLctx.uniformMatrix4x3fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value >> 2, count * 12) + } + + function _emscripten_glUseProgram(program) { + program = GL.programs[program]; + GLctx.useProgram(program); + GLctx.currentProgram = program + } + + function _emscripten_glValidateProgram(program) { + GLctx.validateProgram(GL.programs[program]) + } + + function _emscripten_glVertexAttrib1f(x0, x1) { + GLctx["vertexAttrib1f"](x0, x1) + } + + function _emscripten_glVertexAttrib1fv(index, v) { + GLctx.vertexAttrib1f(index, HEAPF32[v >> 2]) + } + + function _emscripten_glVertexAttrib2f(x0, x1, x2) { + GLctx["vertexAttrib2f"](x0, x1, x2) + } + + function _emscripten_glVertexAttrib2fv(index, v) { + GLctx.vertexAttrib2f(index, HEAPF32[v >> 2], HEAPF32[v + 4 >> 2]) + } + + function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { + GLctx["vertexAttrib3f"](x0, x1, x2, x3) + } + + function _emscripten_glVertexAttrib3fv(index, v) { + GLctx.vertexAttrib3f(index, HEAPF32[v >> 2], HEAPF32[v + 4 >> 2], HEAPF32[v + 8 >> 2]) + } + + function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { + GLctx["vertexAttrib4f"](x0, x1, x2, x3, x4) + } + + function _emscripten_glVertexAttrib4fv(index, v) { + GLctx.vertexAttrib4f(index, HEAPF32[v >> 2], HEAPF32[v + 4 >> 2], HEAPF32[v + 8 >> 2], HEAPF32[v + 12 >> 2]) + } + + function _emscripten_glVertexAttribDivisor(index, divisor) { + GLctx["vertexAttribDivisor"](index, divisor) + } + + function _emscripten_glVertexAttribDivisorANGLE(index, divisor) { + GLctx["vertexAttribDivisor"](index, divisor) + } + + function _emscripten_glVertexAttribDivisorARB(index, divisor) { + GLctx["vertexAttribDivisor"](index, divisor) + } + + function _emscripten_glVertexAttribDivisorEXT(index, divisor) { + GLctx["vertexAttribDivisor"](index, divisor) + } + + function _emscripten_glVertexAttribDivisorNV(index, divisor) { + GLctx["vertexAttribDivisor"](index, divisor) + } + + function _emscripten_glVertexAttribI4i(x0, x1, x2, x3, x4) { + GLctx["vertexAttribI4i"](x0, x1, x2, x3, x4) + } + + function _emscripten_glVertexAttribI4iv(index, v) { + GLctx.vertexAttribI4i(index, HEAP32[v >> 2], HEAP32[v + 4 >> 2], HEAP32[v + 8 >> 2], HEAP32[v + 12 >> 2]) + } + + function _emscripten_glVertexAttribI4ui(x0, x1, x2, x3, x4) { + GLctx["vertexAttribI4ui"](x0, x1, x2, x3, x4) + } + + function _emscripten_glVertexAttribI4uiv(index, v) { + GLctx.vertexAttribI4ui(index, HEAPU32[v >> 2], HEAPU32[v + 4 >> 2], HEAPU32[v + 8 >> 2], HEAPU32[v + 12 >> 2]) + } + + function _emscripten_glVertexAttribIPointer(index, size, type, stride, ptr) { + GLctx["vertexAttribIPointer"](index, size, type, stride, ptr) + } + + function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) { + GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr) + } + + function _emscripten_glViewport(x0, x1, x2, x3) { + GLctx["viewport"](x0, x1, x2, x3) + } + + function _emscripten_glWaitSync(sync, flags, timeoutLo, timeoutHi) { + GLctx.waitSync(GL.syncs[sync], flags, convertI32PairToI53(timeoutLo, timeoutHi)) + } + + function _emscripten_memcpy_big(dest, src, num) { + HEAPU8.copyWithin(dest, src, src + num) + } + + function getHeapMax() { + return 2147483648 + } + + function emscripten_realloc_buffer(size) { + try { + wasmMemory.grow(size - buffer.byteLength + 65535 >>> 16); + updateGlobalBufferAndViews(wasmMemory.buffer); + return 1 + } catch (e) {} + } + + function _emscripten_resize_heap(requestedSize) { + var oldSize = HEAPU8.length; + requestedSize = requestedSize >>> 0; + var maxHeapSize = getHeapMax(); + if (requestedSize > maxHeapSize) { + return false + } + let alignUp = (x, multiple) => x + (multiple - x % multiple) % multiple; + for (var cutDown = 1; cutDown <= 4; cutDown *= 2) { + var overGrownHeapSize = oldSize * (1 + .2 / cutDown); + overGrownHeapSize = Math.min(overGrownHeapSize, requestedSize + 100663296); + var newSize = Math.min(maxHeapSize, alignUp(Math.max(requestedSize, overGrownHeapSize), 65536)); + var replacement = emscripten_realloc_buffer(newSize); + if (replacement) { + return true + } + } + return false + } + + function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop) { + var browserIterationFunc = getWasmTableEntry(func); + setMainLoop(browserIterationFunc, fps, simulateInfiniteLoop) + } + var JSEvents = { + inEventHandler: 0, + removeAllEventListeners: function() { + for (var i = JSEvents.eventHandlers.length - 1; i >= 0; --i) { + JSEvents._removeHandler(i) + } + JSEvents.eventHandlers = []; + JSEvents.deferredCalls = [] + }, + registerRemoveEventListeners: function() { + if (!JSEvents.removeEventListenersRegistered) { + __ATEXIT__.push(JSEvents.removeAllEventListeners); + JSEvents.removeEventListenersRegistered = true + } + }, + deferredCalls: [], + deferCall: function(targetFunction, precedence, argsList) { + function arraysHaveEqualContent(arrA, arrB) { + if (arrA.length != arrB.length) return false; + for (var i in arrA) { + if (arrA[i] != arrB[i]) return false + } + return true + } + for (var i in JSEvents.deferredCalls) { + var call = JSEvents.deferredCalls[i]; + if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) { + return + } + } + JSEvents.deferredCalls.push({ + targetFunction: targetFunction, + precedence: precedence, + argsList: argsList + }); + JSEvents.deferredCalls.sort(function(x, y) { + return x.precedence < y.precedence + }) + }, + removeDeferredCalls: function(targetFunction) { + for (var i = 0; i < JSEvents.deferredCalls.length; ++i) { + if (JSEvents.deferredCalls[i].targetFunction == targetFunction) { + JSEvents.deferredCalls.splice(i, 1); + --i + } + } + }, + canPerformEventHandlerRequests: function() { + return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls + }, + runDeferredCalls: function() { + if (!JSEvents.canPerformEventHandlerRequests()) { + return + } + for (var i = 0; i < JSEvents.deferredCalls.length; ++i) { + var call = JSEvents.deferredCalls[i]; + JSEvents.deferredCalls.splice(i, 1); + --i; + call.targetFunction.apply(null, call.argsList) + } + }, + eventHandlers: [], + removeAllHandlersOnTarget: function(target, eventTypeString) { + for (var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == target && (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) { + JSEvents._removeHandler(i--) + } + } + }, + _removeHandler: function(i) { + var h = JSEvents.eventHandlers[i]; + h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture); + JSEvents.eventHandlers.splice(i, 1) + }, + registerOrRemoveHandler: function(eventHandler) { + var jsEventHandler = function jsEventHandler(event) { + ++JSEvents.inEventHandler; + JSEvents.currentEventHandler = eventHandler; + JSEvents.runDeferredCalls(); + eventHandler.handlerFunc(event); + JSEvents.runDeferredCalls(); + --JSEvents.inEventHandler + }; + if (eventHandler.callbackfunc) { + eventHandler.eventListenerFunc = jsEventHandler; + eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture); + JSEvents.eventHandlers.push(eventHandler); + JSEvents.registerRemoveEventListeners() + } else { + for (var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == eventHandler.target && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) { + JSEvents._removeHandler(i--) + } + } + } + }, + getNodeNameForTarget: function(target) { + if (!target) return ""; + if (target == window) return "#window"; + if (target == screen) return "#screen"; + return target && target.nodeName ? target.nodeName : "" + }, + fullscreenEnabled: function() { + return document.fullscreenEnabled || document.webkitFullscreenEnabled + } + }; + var __emscripten_webgl_power_preferences = ["default", "low-power", "high-performance"]; + + function maybeCStringToJsString(cString) { + return cString > 2 ? UTF8ToString(cString) : cString + } + var specialHTMLTargets = [0, typeof document != "undefined" ? document : 0, typeof window != "undefined" ? window : 0]; + + function findEventTarget(target) { + target = maybeCStringToJsString(target); + var domElement = specialHTMLTargets[target] || (typeof document != "undefined" ? document.querySelector(target) : undefined); + return domElement + } + + function findCanvasEventTarget(target) { + return findEventTarget(target) + } + + function _emscripten_webgl_do_create_context(target, attributes) { + var a = attributes >> 2; + var powerPreference = HEAP32[a + (24 >> 2)]; + var contextAttributes = { + "alpha": !!HEAP32[a + (0 >> 2)], + "depth": !!HEAP32[a + (4 >> 2)], + "stencil": !!HEAP32[a + (8 >> 2)], + "antialias": !!HEAP32[a + (12 >> 2)], + "premultipliedAlpha": !!HEAP32[a + (16 >> 2)], + "preserveDrawingBuffer": !!HEAP32[a + (20 >> 2)], + "powerPreference": __emscripten_webgl_power_preferences[powerPreference], + "failIfMajorPerformanceCaveat": !!HEAP32[a + (28 >> 2)], + majorVersion: HEAP32[a + (32 >> 2)], + minorVersion: HEAP32[a + (36 >> 2)], + enableExtensionsByDefault: HEAP32[a + (40 >> 2)], + explicitSwapControl: HEAP32[a + (44 >> 2)], + proxyContextToMainThread: HEAP32[a + (48 >> 2)], + renderViaOffscreenBackBuffer: HEAP32[a + (52 >> 2)] + }; + var canvas = findCanvasEventTarget(target); + if (!canvas) { + return 0 + } + if (contextAttributes.explicitSwapControl && !contextAttributes.renderViaOffscreenBackBuffer) { + contextAttributes.renderViaOffscreenBackBuffer = true + } + var contextHandle = GL.createContext(canvas, contextAttributes); + return contextHandle + } + + function _emscripten_webgl_create_context(a0, a1) { + return _emscripten_webgl_do_create_context(a0, a1) + } + + function _emscripten_webgl_destroy_context(contextHandle) { + if (GL.currentContext == contextHandle) GL.currentContext = 0; + GL.deleteContext(contextHandle) + } + + function _emscripten_webgl_init_context_attributes(attributes) { + var a = attributes >> 2; + for (var i = 0; i < 56 >> 2; ++i) { + HEAP32[a + i] = 0 + } + HEAP32[a + (0 >> 2)] = HEAP32[a + (4 >> 2)] = HEAP32[a + (12 >> 2)] = HEAP32[a + (16 >> 2)] = HEAP32[a + (32 >> 2)] = HEAP32[a + (40 >> 2)] = 1 + } + + function _emscripten_webgl_make_context_current(contextHandle) { + var success = GL.makeContextCurrent(contextHandle); + return success ? 0 : -5 + } + var ENV = {}; + + function getExecutableName() { + return thisProgram || "./this.program" + } + + function getEnvStrings() { + if (!getEnvStrings.strings) { + var lang = (typeof navigator == "object" && navigator.languages && navigator.languages[0] || "C").replace("-", "_") + ".UTF-8"; + var env = { + "USER": "web_user", + "LOGNAME": "web_user", + "PATH": "/", + "PWD": "/", + "HOME": "/home/web_user", + "LANG": lang, + "_": getExecutableName() + }; + for (var x in ENV) { + if (ENV[x] === undefined) delete env[x]; + else env[x] = ENV[x] + } + var strings = []; + for (var x in env) { + strings.push(x + "=" + env[x]) + } + getEnvStrings.strings = strings + } + return getEnvStrings.strings + } + + function _environ_get(__environ, environ_buf) { + var bufSize = 0; + getEnvStrings().forEach(function(string, i) { + var ptr = environ_buf + bufSize; + HEAPU32[__environ + i * 4 >> 2] = ptr; + writeAsciiToMemory(string, ptr); + bufSize += string.length + 1 + }); + return 0 + } + + function _environ_sizes_get(penviron_count, penviron_buf_size) { + var strings = getEnvStrings(); + HEAPU32[penviron_count >> 2] = strings.length; + var bufSize = 0; + strings.forEach(function(string) { + bufSize += string.length + 1 + }); + HEAPU32[penviron_buf_size >> 2] = bufSize; + return 0 + } + + function _fd_close(fd) { + try { + var stream = SYSCALLS.getStreamFromFD(fd); + FS.close(stream); + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return e.errno + } + } + + function _fd_fdstat_get(fd, pbuf) { + try { + var stream = SYSCALLS.getStreamFromFD(fd); + var type = stream.tty ? 2 : FS.isDir(stream.mode) ? 3 : FS.isLink(stream.mode) ? 7 : 4; + HEAP8[pbuf >> 0] = type; + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return e.errno + } + } + + function doReadv(stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAPU32[iov >> 2]; + var len = HEAPU32[iov + 4 >> 2]; + iov += 8; + var curr = FS.read(stream, HEAP8, ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (curr < len) break + } + return ret + } + + function _fd_read(fd, iov, iovcnt, pnum) { + try { + var stream = SYSCALLS.getStreamFromFD(fd); + var num = doReadv(stream, iov, iovcnt); + HEAP32[pnum >> 2] = num; + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return e.errno + } + } + + function convertI32PairToI53Checked(lo, hi) { + return hi + 2097152 >>> 0 < 4194305 - !!lo ? (lo >>> 0) + hi * 4294967296 : NaN + } + + function _fd_seek(fd, offset_low, offset_high, whence, newOffset) { + try { + var offset = convertI32PairToI53Checked(offset_low, offset_high); + if (isNaN(offset)) return 61; + var stream = SYSCALLS.getStreamFromFD(fd); + FS.llseek(stream, offset, whence); + tempI64 = [stream.position >>> 0, (tempDouble = stream.position, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0)], HEAP32[newOffset >> 2] = tempI64[0], HEAP32[newOffset + 4 >> 2] = tempI64[1]; + if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return e.errno + } + } + + function doWritev(stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAPU32[iov >> 2]; + var len = HEAPU32[iov + 4 >> 2]; + iov += 8; + var curr = FS.write(stream, HEAP8, ptr, len, offset); + if (curr < 0) return -1; + ret += curr + } + return ret + } + + function _fd_write(fd, iov, iovcnt, pnum) { + try { + var stream = SYSCALLS.getStreamFromFD(fd); + var num = doWritev(stream, iov, iovcnt); + HEAPU32[pnum >> 2] = num; + return 0 + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return e.errno + } + } + + function _getTempRet0() { + return getTempRet0() + } + + function _getaddrinfo(node, service, hint, out) { + var addr = 0; + var port = 0; + var flags = 0; + var family = 0; + var type = 0; + var proto = 0; + var ai; + + function allocaddrinfo(family, type, proto, canon, addr, port) { + var sa, salen, ai; + var errno; + salen = family === 10 ? 28 : 16; + addr = family === 10 ? inetNtop6(addr) : inetNtop4(addr); + sa = _malloc(salen); + errno = writeSockaddr(sa, family, addr, port); + assert(!errno); + ai = _malloc(32); + HEAP32[ai + 4 >> 2] = family; + HEAP32[ai + 8 >> 2] = type; + HEAP32[ai + 12 >> 2] = proto; + HEAP32[ai + 24 >> 2] = canon; + HEAPU32[ai + 20 >> 2] = sa; + if (family === 10) { + HEAP32[ai + 16 >> 2] = 28 + } else { + HEAP32[ai + 16 >> 2] = 16 + } + HEAP32[ai + 28 >> 2] = 0; + return ai + } + if (hint) { + flags = HEAP32[hint >> 2]; + family = HEAP32[hint + 4 >> 2]; + type = HEAP32[hint + 8 >> 2]; + proto = HEAP32[hint + 12 >> 2] + } + if (type && !proto) { + proto = type === 2 ? 17 : 6 + } + if (!type && proto) { + type = proto === 17 ? 2 : 1 + } + if (proto === 0) { + proto = 6 + } + if (type === 0) { + type = 1 + } + if (!node && !service) { + return -2 + } + if (flags & ~(1 | 2 | 4 | 1024 | 8 | 16 | 32)) { + return -1 + } + if (hint !== 0 && HEAP32[hint >> 2] & 2 && !node) { + return -1 + } + if (flags & 32) { + return -2 + } + if (type !== 0 && type !== 1 && type !== 2) { + return -7 + } + if (family !== 0 && family !== 2 && family !== 10) { + return -6 + } + if (service) { + service = UTF8ToString(service); + port = parseInt(service, 10); + if (isNaN(port)) { + if (flags & 1024) { + return -2 + } + return -8 + } + } + if (!node) { + if (family === 0) { + family = 2 + } + if ((flags & 1) === 0) { + if (family === 2) { + addr = _htonl(2130706433) + } else { + addr = [0, 0, 0, 1] + } + } + ai = allocaddrinfo(family, type, proto, null, addr, port); + HEAPU32[out >> 2] = ai; + return 0 + } + node = UTF8ToString(node); + addr = inetPton4(node); + if (addr !== null) { + if (family === 0 || family === 2) { + family = 2 + } else if (family === 10 && flags & 8) { + addr = [0, 0, _htonl(65535), addr]; + family = 10 + } else { + return -2 + } + } else { + addr = inetPton6(node); + if (addr !== null) { + if (family === 0 || family === 10) { + family = 10 + } else { + return -2 + } + } + } + if (addr != null) { + ai = allocaddrinfo(family, type, proto, node, addr, port); + HEAPU32[out >> 2] = ai; + return 0 + } + if (flags & 4) { + return -2 + } + node = DNS.lookup_name(node); + addr = inetPton4(node); + if (family === 0) { + family = 2 + } else if (family === 10) { + addr = [0, 0, _htonl(65535), addr] + } + ai = allocaddrinfo(family, type, proto, null, addr, port); + HEAPU32[out >> 2] = ai; + return 0 + } + + function _getnameinfo(sa, salen, node, nodelen, serv, servlen, flags) { + var info = readSockaddr(sa, salen); + if (info.errno) { + return -6 + } + var port = info.port; + var addr = info.addr; + var overflowed = false; + if (node && nodelen) { + var lookup; + if (flags & 1 || !(lookup = DNS.lookup_addr(addr))) { + if (flags & 8) { + return -2 + } + } else { + addr = lookup + } + var numBytesWrittenExclNull = stringToUTF8(addr, node, nodelen); + if (numBytesWrittenExclNull + 1 >= nodelen) { + overflowed = true + } + } + if (serv && servlen) { + port = "" + port; + var numBytesWrittenExclNull = stringToUTF8(port, serv, servlen); + if (numBytesWrittenExclNull + 1 >= servlen) { + overflowed = true + } + } + if (overflowed) { + return -12 + } + return 0 + } + + function _glActiveTexture(x0) { + GLctx["activeTexture"](x0) + } + + function _glAttachShader(program, shader) { + GLctx.attachShader(GL.programs[program], GL.shaders[shader]) + } + + function _glBeginTransformFeedback(x0) { + GLctx["beginTransformFeedback"](x0) + } + + function _glBindAttribLocation(program, index, name) { + GLctx.bindAttribLocation(GL.programs[program], index, UTF8ToString(name)) + } + + function _glBindBuffer(target, buffer) { + if (target == 35051) { + GLctx.currentPixelPackBufferBinding = buffer + } else if (target == 35052) { + GLctx.currentPixelUnpackBufferBinding = buffer + } + GLctx.bindBuffer(target, GL.buffers[buffer]) + } + + function _glBindBufferBase(target, index, buffer) { + GLctx["bindBufferBase"](target, index, GL.buffers[buffer]) + } + + function _glBindFramebuffer(target, framebuffer) { + GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : GL.currentContext.defaultFbo) + } + + function _glBindRenderbuffer(target, renderbuffer) { + GLctx.bindRenderbuffer(target, GL.renderbuffers[renderbuffer]) + } + + function _glBindTexture(target, texture) { + GLctx.bindTexture(target, GL.textures[texture]) + } + + function _glBindVertexArray(vao) { + GLctx["bindVertexArray"](GL.vaos[vao]) + } + + function _glBlendEquation(x0) { + GLctx["blendEquation"](x0) + } + + function _glBlendFunc(x0, x1) { + GLctx["blendFunc"](x0, x1) + } + + function _glBlendFuncSeparate(x0, x1, x2, x3) { + GLctx["blendFuncSeparate"](x0, x1, x2, x3) + } + + function _glBlitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) { + GLctx["blitFramebuffer"](x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) + } + + function _glBufferData(target, size, data, usage) { + if (GL.currentContext.version >= 2) { + if (data && size) { + GLctx.bufferData(target, HEAPU8, usage, data, size) + } else { + GLctx.bufferData(target, size, usage) + } + } else { + GLctx.bufferData(target, data ? HEAPU8.subarray(data, data + size) : size, usage) + } + } + + function _glBufferSubData(target, offset, size, data) { + if (GL.currentContext.version >= 2) { + size && GLctx.bufferSubData(target, offset, HEAPU8, data, size); + return + } + GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data + size)) + } + + function _glCheckFramebufferStatus(x0) { + return GLctx["checkFramebufferStatus"](x0) + } + + function _glClear(x0) { + GLctx["clear"](x0) + } + + function _glClearBufferfv(buffer, drawbuffer, value) { + GLctx["clearBufferfv"](buffer, drawbuffer, HEAPF32, value >> 2) + } + + function _glClearColor(x0, x1, x2, x3) { + GLctx["clearColor"](x0, x1, x2, x3) + } + + function _glClearDepthf(x0) { + GLctx["clearDepth"](x0) + } + + function _glColorMask(red, green, blue, alpha) { + GLctx.colorMask(!!red, !!green, !!blue, !!alpha) + } + + function _glCompileShader(shader) { + GLctx.compileShader(GL.shaders[shader]) + } + + function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelUnpackBufferBinding || !imageSize) { + GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, imageSize, data) + } else { + GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, HEAPU8, data, imageSize) + } + return + } + GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray(data, data + imageSize) : null) + } + + function _glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelUnpackBufferBinding || !imageSize) { + GLctx["compressedTexSubImage2D"](target, level, xoffset, yoffset, width, height, format, imageSize, data) + } else { + GLctx["compressedTexSubImage2D"](target, level, xoffset, yoffset, width, height, format, HEAPU8, data, imageSize) + } + return + } + GLctx["compressedTexSubImage2D"](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray(data, data + imageSize) : null) + } + + function _glCompressedTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx["compressedTexSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data) + } else { + GLctx["compressedTexSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, HEAPU8, data, imageSize) + } + } + + function _glCopyBufferSubData(x0, x1, x2, x3, x4) { + GLctx["copyBufferSubData"](x0, x1, x2, x3, x4) + } + + function _glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { + GLctx["copyTexSubImage2D"](x0, x1, x2, x3, x4, x5, x6, x7) + } + + function _glCreateProgram() { + var id = GL.getNewId(GL.programs); + var program = GLctx.createProgram(); + program.name = id; + program.maxUniformLength = program.maxAttributeLength = program.maxUniformBlockNameLength = 0; + program.uniformIdCounter = 1; + GL.programs[id] = program; + return id + } + + function _glCreateShader(shaderType) { + var id = GL.getNewId(GL.shaders); + GL.shaders[id] = GLctx.createShader(shaderType); + return id + } + + function _glCullFace(x0) { + GLctx["cullFace"](x0) + } + + function _glDeleteBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[buffers + i * 4 >> 2]; + var buffer = GL.buffers[id]; + if (!buffer) continue; + GLctx.deleteBuffer(buffer); + buffer.name = 0; + GL.buffers[id] = null; + if (id == GLctx.currentPixelPackBufferBinding) GLctx.currentPixelPackBufferBinding = 0; + if (id == GLctx.currentPixelUnpackBufferBinding) GLctx.currentPixelUnpackBufferBinding = 0 + } + } + + function _glDeleteFramebuffers(n, framebuffers) { + for (var i = 0; i < n; ++i) { + var id = HEAP32[framebuffers + i * 4 >> 2]; + var framebuffer = GL.framebuffers[id]; + if (!framebuffer) continue; + GLctx.deleteFramebuffer(framebuffer); + framebuffer.name = 0; + GL.framebuffers[id] = null + } + } + + function _glDeleteProgram(id) { + if (!id) return; + var program = GL.programs[id]; + if (!program) { + GL.recordError(1281); + return + } + GLctx.deleteProgram(program); + program.name = 0; + GL.programs[id] = null + } + + function _glDeleteRenderbuffers(n, renderbuffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[renderbuffers + i * 4 >> 2]; + var renderbuffer = GL.renderbuffers[id]; + if (!renderbuffer) continue; + GLctx.deleteRenderbuffer(renderbuffer); + renderbuffer.name = 0; + GL.renderbuffers[id] = null + } + } + + function _glDeleteShader(id) { + if (!id) return; + var shader = GL.shaders[id]; + if (!shader) { + GL.recordError(1281); + return + } + GLctx.deleteShader(shader); + GL.shaders[id] = null + } + + function _glDeleteTextures(n, textures) { + for (var i = 0; i < n; i++) { + var id = HEAP32[textures + i * 4 >> 2]; + var texture = GL.textures[id]; + if (!texture) continue; + GLctx.deleteTexture(texture); + texture.name = 0; + GL.textures[id] = null + } + } + + function _glDeleteVertexArrays(n, vaos) { + for (var i = 0; i < n; i++) { + var id = HEAP32[vaos + i * 4 >> 2]; + GLctx["deleteVertexArray"](GL.vaos[id]); + GL.vaos[id] = null + } + } + + function _glDepthFunc(x0) { + GLctx["depthFunc"](x0) + } + + function _glDepthMask(flag) { + GLctx.depthMask(!!flag) + } + + function _glDisable(x0) { + GLctx["disable"](x0) + } + + function _glDisableVertexAttribArray(index) { + GLctx.disableVertexAttribArray(index) + } + + function _glDrawArrays(mode, first, count) { + GLctx.drawArrays(mode, first, count) + } + + function _glDrawArraysInstanced(mode, first, count, primcount) { + GLctx["drawArraysInstanced"](mode, first, count, primcount) + } + + function _glDrawBuffers(n, bufs) { + var bufArray = tempFixedLengthArray[n]; + for (var i = 0; i < n; i++) { + bufArray[i] = HEAP32[bufs + i * 4 >> 2] + } + GLctx["drawBuffers"](bufArray) + } + + function _glDrawElementsInstanced(mode, count, type, indices, primcount) { + GLctx["drawElementsInstanced"](mode, count, type, indices, primcount) + } + + function _glEnable(x0) { + GLctx["enable"](x0) + } + + function _glEnableVertexAttribArray(index) { + GLctx.enableVertexAttribArray(index) + } + + function _glEndTransformFeedback() { + GLctx["endTransformFeedback"]() + } + + function _glFinish() { + GLctx["finish"]() + } + + function _glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) { + GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, GL.renderbuffers[renderbuffer]) + } + + function _glFramebufferTexture2D(target, attachment, textarget, texture, level) { + GLctx.framebufferTexture2D(target, attachment, textarget, GL.textures[texture], level) + } + + function _glFramebufferTextureLayer(target, attachment, texture, level, layer) { + GLctx.framebufferTextureLayer(target, attachment, GL.textures[texture], level, layer) + } + + function _glFrontFace(x0) { + GLctx["frontFace"](x0) + } + + function _glGenBuffers(n, buffers) { + __glGenObject(n, buffers, "createBuffer", GL.buffers) + } + + function _glGenFramebuffers(n, ids) { + __glGenObject(n, ids, "createFramebuffer", GL.framebuffers) + } + + function _glGenRenderbuffers(n, renderbuffers) { + __glGenObject(n, renderbuffers, "createRenderbuffer", GL.renderbuffers) + } + + function _glGenTextures(n, textures) { + __glGenObject(n, textures, "createTexture", GL.textures) + } + + function _glGenVertexArrays(n, arrays) { + __glGenObject(n, arrays, "createVertexArray", GL.vaos) + } + + function _glGenerateMipmap(x0) { + GLctx["generateMipmap"](x0) + } + + function _glGetError() { + var error = GLctx.getError() || GL.lastError; + GL.lastError = 0; + return error + } + + function _glGetFloatv(name_, p) { + emscriptenWebGLGet(name_, p, 2) + } + + function _glGetIntegerv(name_, p) { + emscriptenWebGLGet(name_, p, 0) + } + + function _glGetProgramBinary(program, bufSize, length, binaryFormat, binary) { + GL.recordError(1282) + } + + function _glGetProgramInfoLog(program, maxLength, length, infoLog) { + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = "(unknown error)"; + var numBytesWrittenExclNull = maxLength > 0 && infoLog ? stringToUTF8(log, infoLog, maxLength) : 0; + if (length) HEAP32[length >> 2] = numBytesWrittenExclNull + } + + function _glGetProgramiv(program, pname, p) { + if (!p) { + GL.recordError(1281); + return + } + if (program >= GL.counter) { + GL.recordError(1281); + return + } + program = GL.programs[program]; + if (pname == 35716) { + var log = GLctx.getProgramInfoLog(program); + if (log === null) log = "(unknown error)"; + HEAP32[p >> 2] = log.length + 1 + } else if (pname == 35719) { + if (!program.maxUniformLength) { + for (var i = 0; i < GLctx.getProgramParameter(program, 35718); ++i) { + program.maxUniformLength = Math.max(program.maxUniformLength, GLctx.getActiveUniform(program, i).name.length + 1) + } + } + HEAP32[p >> 2] = program.maxUniformLength + } else if (pname == 35722) { + if (!program.maxAttributeLength) { + for (var i = 0; i < GLctx.getProgramParameter(program, 35721); ++i) { + program.maxAttributeLength = Math.max(program.maxAttributeLength, GLctx.getActiveAttrib(program, i).name.length + 1) + } + } + HEAP32[p >> 2] = program.maxAttributeLength + } else if (pname == 35381) { + if (!program.maxUniformBlockNameLength) { + for (var i = 0; i < GLctx.getProgramParameter(program, 35382); ++i) { + program.maxUniformBlockNameLength = Math.max(program.maxUniformBlockNameLength, GLctx.getActiveUniformBlockName(program, i).length + 1) + } + } + HEAP32[p >> 2] = program.maxUniformBlockNameLength + } else { + HEAP32[p >> 2] = GLctx.getProgramParameter(program, pname) + } + } + + function _glGetShaderInfoLog(shader, maxLength, length, infoLog) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = "(unknown error)"; + var numBytesWrittenExclNull = maxLength > 0 && infoLog ? stringToUTF8(log, infoLog, maxLength) : 0; + if (length) HEAP32[length >> 2] = numBytesWrittenExclNull + } + + function _glGetShaderSource(shader, bufSize, length, source) { + var result = GLctx.getShaderSource(GL.shaders[shader]); + if (!result) return; + var numBytesWrittenExclNull = bufSize > 0 && source ? stringToUTF8(result, source, bufSize) : 0; + if (length) HEAP32[length >> 2] = numBytesWrittenExclNull + } + + function _glGetShaderiv(shader, pname, p) { + if (!p) { + GL.recordError(1281); + return + } + if (pname == 35716) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = "(unknown error)"; + var logLength = log ? log.length + 1 : 0; + HEAP32[p >> 2] = logLength + } else if (pname == 35720) { + var source = GLctx.getShaderSource(GL.shaders[shader]); + var sourceLength = source ? source.length + 1 : 0; + HEAP32[p >> 2] = sourceLength + } else { + HEAP32[p >> 2] = GLctx.getShaderParameter(GL.shaders[shader], pname) + } + } + + function _glGetString(name_) { + var ret = GL.stringCache[name_]; + if (!ret) { + switch (name_) { + case 7939: + var exts = GLctx.getSupportedExtensions() || []; + exts = exts.concat(exts.map(function(e) { + return "GL_" + e + })); + ret = stringToNewUTF8(exts.join(" ")); + break; + case 7936: + case 7937: + case 37445: + case 37446: + var s = GLctx.getParameter(name_); + if (!s) { + GL.recordError(1280) + } + ret = s && stringToNewUTF8(s); + break; + case 7938: + var glVersion = GLctx.getParameter(7938); + if (GL.currentContext.version >= 2) glVersion = "OpenGL ES 3.0 (" + glVersion + ")"; + else { + glVersion = "OpenGL ES 2.0 (" + glVersion + ")" + } + ret = stringToNewUTF8(glVersion); + break; + case 35724: + var glslVersion = GLctx.getParameter(35724); + var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/; + var ver_num = glslVersion.match(ver_re); + if (ver_num !== null) { + if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + "0"; + glslVersion = "OpenGL ES GLSL ES " + ver_num[1] + " (" + glslVersion + ")" + } + ret = stringToNewUTF8(glslVersion); + break; + default: + GL.recordError(1280) + } + GL.stringCache[name_] = ret + } + return ret + } + + function _glGetStringi(name, index) { + if (GL.currentContext.version < 2) { + GL.recordError(1282); + return 0 + } + var stringiCache = GL.stringiCache[name]; + if (stringiCache) { + if (index < 0 || index >= stringiCache.length) { + GL.recordError(1281); + return 0 + } + return stringiCache[index] + } + switch (name) { + case 7939: + var exts = GLctx.getSupportedExtensions() || []; + exts = exts.concat(exts.map(function(e) { + return "GL_" + e + })); + exts = exts.map(function(e) { + return stringToNewUTF8(e) + }); + stringiCache = GL.stringiCache[name] = exts; + if (index < 0 || index >= stringiCache.length) { + GL.recordError(1281); + return 0 + } + return stringiCache[index]; + default: + GL.recordError(1280); + return 0 + } + } + + function _glGetUniformBlockIndex(program, uniformBlockName) { + return GLctx["getUniformBlockIndex"](GL.programs[program], UTF8ToString(uniformBlockName)) + } + + function _glGetUniformLocation(program, name) { + name = UTF8ToString(name); + if (program = GL.programs[program]) { + webglPrepareUniformLocationsBeforeFirstUse(program); + var uniformLocsById = program.uniformLocsById; + var arrayIndex = 0; + var uniformBaseName = name; + var leftBrace = webglGetLeftBracePos(name); + if (leftBrace > 0) { + arrayIndex = jstoi_q(name.slice(leftBrace + 1)) >>> 0; + uniformBaseName = name.slice(0, leftBrace) + } + var sizeAndId = program.uniformSizeAndIdsByName[uniformBaseName]; + if (sizeAndId && arrayIndex < sizeAndId[0]) { + arrayIndex += sizeAndId[1]; + if (uniformLocsById[arrayIndex] = uniformLocsById[arrayIndex] || GLctx.getUniformLocation(program, name)) { + return arrayIndex + } + } + } else { + GL.recordError(1281) + } + return -1 + } + + function _glInvalidateFramebuffer(target, numAttachments, attachments) { + var list = tempFixedLengthArray[numAttachments]; + for (var i = 0; i < numAttachments; i++) { + list[i] = HEAP32[attachments + i * 4 >> 2] + } + GLctx["invalidateFramebuffer"](target, list) + } + + function _glLinkProgram(program) { + program = GL.programs[program]; + GLctx.linkProgram(program); + program.uniformLocsById = 0; + program.uniformSizeAndIdsByName = {} + } + + function _glPixelStorei(pname, param) { + if (pname == 3317) { + GL.unpackAlignment = param + } + GLctx.pixelStorei(pname, param) + } + + function _glProgramBinary(program, binaryFormat, binary, length) { + GL.recordError(1280) + } + + function _glProgramParameteri(program, pname, value) { + GL.recordError(1280) + } + + function _glReadBuffer(x0) { + GLctx["readBuffer"](x0) + } + + function _glReadPixels(x, y, width, height, format, type, pixels) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelPackBufferBinding) { + GLctx.readPixels(x, y, width, height, format, type, pixels) + } else { + var heap = heapObjectForWebGLType(type); + GLctx.readPixels(x, y, width, height, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)) + } + return + } + var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format); + if (!pixelData) { + GL.recordError(1280); + return + } + GLctx.readPixels(x, y, width, height, format, type, pixelData) + } + + function _glRenderbufferStorage(x0, x1, x2, x3) { + GLctx["renderbufferStorage"](x0, x1, x2, x3) + } + + function _glRenderbufferStorageMultisample(x0, x1, x2, x3, x4) { + GLctx["renderbufferStorageMultisample"](x0, x1, x2, x3, x4) + } + + function _glScissor(x0, x1, x2, x3) { + GLctx["scissor"](x0, x1, x2, x3) + } + + function _glShaderSource(shader, count, string, length) { + var source = GL.getSource(shader, count, string, length); + GLctx.shaderSource(GL.shaders[shader], source) + } + + function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels) + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)) + } else { + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, null) + } + return + } + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null) + } + + function _glTexImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, pixels) + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)) + } else { + GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, null) + } + } + + function _glTexParameterf(x0, x1, x2) { + GLctx["texParameterf"](x0, x1, x2) + } + + function _glTexParameteri(x0, x1, x2) { + GLctx["texParameteri"](x0, x1, x2) + } + + function _glTexStorage2D(x0, x1, x2, x3, x4) { + GLctx["texStorage2D"](x0, x1, x2, x3, x4) + } + + function _glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)) + } else { + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, null) + } + return + } + var pixelData = null; + if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0); + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData) + } + + function _glTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)) + } else { + GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, null) + } + } + + function _glTransformFeedbackVaryings(program, count, varyings, bufferMode) { + program = GL.programs[program]; + var vars = []; + for (var i = 0; i < count; i++) vars.push(UTF8ToString(HEAP32[varyings + i * 4 >> 2])); + GLctx["transformFeedbackVaryings"](program, vars, bufferMode) + } + + function _glUniform1f(location, v0) { + GLctx.uniform1f(webglGetUniformLocation(location), v0) + } + + function _glUniform1i(location, v0) { + GLctx.uniform1i(webglGetUniformLocation(location), v0) + } + + function _glUniform1iv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform1iv(webglGetUniformLocation(location), HEAP32, value >> 2, count); + return + } + if (count <= 288) { + var view = __miniTempWebGLIntBuffers[count - 1]; + for (var i = 0; i < count; ++i) { + view[i] = HEAP32[value + 4 * i >> 2] + } + } else { + var view = HEAP32.subarray(value >> 2, value + count * 4 >> 2) + } + GLctx.uniform1iv(webglGetUniformLocation(location), view) + } + + function _glUniform1ui(location, v0) { + GLctx.uniform1ui(webglGetUniformLocation(location), v0) + } + + function _glUniform2f(location, v0, v1) { + GLctx.uniform2f(webglGetUniformLocation(location), v0, v1) + } + + function _glUniform2fv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform2fv(webglGetUniformLocation(location), HEAPF32, value >> 2, count * 2); + return + } + if (count <= 144) { + var view = miniTempWebGLFloatBuffers[2 * count - 1]; + for (var i = 0; i < 2 * count; i += 2) { + view[i] = HEAPF32[value + 4 * i >> 2]; + view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 8 >> 2) + } + GLctx.uniform2fv(webglGetUniformLocation(location), view) + } + + function _glUniform2i(location, v0, v1) { + GLctx.uniform2i(webglGetUniformLocation(location), v0, v1) + } + + function _glUniform2iv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform2iv(webglGetUniformLocation(location), HEAP32, value >> 2, count * 2); + return + } + if (count <= 144) { + var view = __miniTempWebGLIntBuffers[2 * count - 1]; + for (var i = 0; i < 2 * count; i += 2) { + view[i] = HEAP32[value + 4 * i >> 2]; + view[i + 1] = HEAP32[value + (4 * i + 4) >> 2] + } + } else { + var view = HEAP32.subarray(value >> 2, value + count * 8 >> 2) + } + GLctx.uniform2iv(webglGetUniformLocation(location), view) + } + + function _glUniform3f(location, v0, v1, v2) { + GLctx.uniform3f(webglGetUniformLocation(location), v0, v1, v2) + } + + function _glUniform3fv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform3fv(webglGetUniformLocation(location), HEAPF32, value >> 2, count * 3); + return + } + if (count <= 96) { + var view = miniTempWebGLFloatBuffers[3 * count - 1]; + for (var i = 0; i < 3 * count; i += 3) { + view[i] = HEAPF32[value + 4 * i >> 2]; + view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2]; + view[i + 2] = HEAPF32[value + (4 * i + 8) >> 2] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 12 >> 2) + } + GLctx.uniform3fv(webglGetUniformLocation(location), view) + } + + function _glUniform3i(location, v0, v1, v2) { + GLctx.uniform3i(webglGetUniformLocation(location), v0, v1, v2) + } + + function _glUniform4f(location, v0, v1, v2, v3) { + GLctx.uniform4f(webglGetUniformLocation(location), v0, v1, v2, v3) + } + + function _glUniform4fv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform4fv(webglGetUniformLocation(location), HEAPF32, value >> 2, count * 4); + return + } + if (count <= 72) { + var view = miniTempWebGLFloatBuffers[4 * count - 1]; + var heap = HEAPF32; + value >>= 2; + for (var i = 0; i < 4 * count; i += 4) { + var dst = value + i; + view[i] = heap[dst]; + view[i + 1] = heap[dst + 1]; + view[i + 2] = heap[dst + 2]; + view[i + 3] = heap[dst + 3] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 16 >> 2) + } + GLctx.uniform4fv(webglGetUniformLocation(location), view) + } + + function _glUniform4i(location, v0, v1, v2, v3) { + GLctx.uniform4i(webglGetUniformLocation(location), v0, v1, v2, v3) + } + + function _glUniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding) { + program = GL.programs[program]; + GLctx["uniformBlockBinding"](program, uniformBlockIndex, uniformBlockBinding) + } + + function _glUniformMatrix2fv(location, count, transpose, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniformMatrix2fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value >> 2, count * 4); + return + } + if (count <= 72) { + var view = miniTempWebGLFloatBuffers[4 * count - 1]; + for (var i = 0; i < 4 * count; i += 4) { + view[i] = HEAPF32[value + 4 * i >> 2]; + view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2]; + view[i + 2] = HEAPF32[value + (4 * i + 8) >> 2]; + view[i + 3] = HEAPF32[value + (4 * i + 12) >> 2] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 16 >> 2) + } + GLctx.uniformMatrix2fv(webglGetUniformLocation(location), !!transpose, view) + } + + function _glUniformMatrix3fv(location, count, transpose, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniformMatrix3fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value >> 2, count * 9); + return + } + if (count <= 32) { + var view = miniTempWebGLFloatBuffers[9 * count - 1]; + for (var i = 0; i < 9 * count; i += 9) { + view[i] = HEAPF32[value + 4 * i >> 2]; + view[i + 1] = HEAPF32[value + (4 * i + 4) >> 2]; + view[i + 2] = HEAPF32[value + (4 * i + 8) >> 2]; + view[i + 3] = HEAPF32[value + (4 * i + 12) >> 2]; + view[i + 4] = HEAPF32[value + (4 * i + 16) >> 2]; + view[i + 5] = HEAPF32[value + (4 * i + 20) >> 2]; + view[i + 6] = HEAPF32[value + (4 * i + 24) >> 2]; + view[i + 7] = HEAPF32[value + (4 * i + 28) >> 2]; + view[i + 8] = HEAPF32[value + (4 * i + 32) >> 2] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 36 >> 2) + } + GLctx.uniformMatrix3fv(webglGetUniformLocation(location), !!transpose, view) + } + + function _glUniformMatrix4fv(location, count, transpose, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value >> 2, count * 16); + return + } + if (count <= 18) { + var view = miniTempWebGLFloatBuffers[16 * count - 1]; + var heap = HEAPF32; + value >>= 2; + for (var i = 0; i < 16 * count; i += 16) { + var dst = value + i; + view[i] = heap[dst]; + view[i + 1] = heap[dst + 1]; + view[i + 2] = heap[dst + 2]; + view[i + 3] = heap[dst + 3]; + view[i + 4] = heap[dst + 4]; + view[i + 5] = heap[dst + 5]; + view[i + 6] = heap[dst + 6]; + view[i + 7] = heap[dst + 7]; + view[i + 8] = heap[dst + 8]; + view[i + 9] = heap[dst + 9]; + view[i + 10] = heap[dst + 10]; + view[i + 11] = heap[dst + 11]; + view[i + 12] = heap[dst + 12]; + view[i + 13] = heap[dst + 13]; + view[i + 14] = heap[dst + 14]; + view[i + 15] = heap[dst + 15] + } + } else { + var view = HEAPF32.subarray(value >> 2, value + count * 64 >> 2) + } + GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, view) + } + + function _glUseProgram(program) { + program = GL.programs[program]; + GLctx.useProgram(program); + GLctx.currentProgram = program + } + + function _glVertexAttrib4f(x0, x1, x2, x3, x4) { + GLctx["vertexAttrib4f"](x0, x1, x2, x3, x4) + } + + function _glVertexAttrib4fv(index, v) { + GLctx.vertexAttrib4f(index, HEAPF32[v >> 2], HEAPF32[v + 4 >> 2], HEAPF32[v + 8 >> 2], HEAPF32[v + 12 >> 2]) + } + + function _glVertexAttribDivisor(index, divisor) { + GLctx["vertexAttribDivisor"](index, divisor) + } + + function _glVertexAttribI4ui(x0, x1, x2, x3, x4) { + GLctx["vertexAttribI4ui"](x0, x1, x2, x3, x4) + } + + function _glVertexAttribIPointer(index, size, type, stride, ptr) { + GLctx["vertexAttribIPointer"](index, size, type, stride, ptr) + } + + function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) { + GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr) + } + + function _glViewport(x0, x1, x2, x3) { + GLctx["viewport"](x0, x1, x2, x3) + } + var GodotRuntime = { + get_func: function(ptr) { + return wasmTable.get(ptr) + }, + error: function() { + err.apply(null, Array.from(arguments)) + }, + print: function() { + out.apply(null, Array.from(arguments)) + }, + malloc: function(p_size) { + return _malloc(p_size) + }, + free: function(p_ptr) { + _free(p_ptr) + }, + getHeapValue: function(p_ptr, p_type) { + return getValue(p_ptr, p_type) + }, + setHeapValue: function(p_ptr, p_value, p_type) { + setValue(p_ptr, p_value, p_type) + }, + heapSub: function(p_heap, p_ptr, p_len) { + const bytes = p_heap.BYTES_PER_ELEMENT; + return p_heap.subarray(p_ptr / bytes, p_ptr / bytes + p_len) + }, + heapSlice: function(p_heap, p_ptr, p_len) { + const bytes = p_heap.BYTES_PER_ELEMENT; + return p_heap.slice(p_ptr / bytes, p_ptr / bytes + p_len) + }, + heapCopy: function(p_dst, p_src, p_ptr) { + const bytes = p_src.BYTES_PER_ELEMENT; + return p_dst.set(p_src, p_ptr / bytes) + }, + parseString: function(p_ptr) { + return UTF8ToString(p_ptr) + }, + parseStringArray: function(p_ptr, p_size) { + const strings = []; + const ptrs = GodotRuntime.heapSub(HEAP32, p_ptr, p_size); + ptrs.forEach(function(ptr) { + strings.push(GodotRuntime.parseString(ptr)) + }); + return strings + }, + strlen: function(p_str) { + return lengthBytesUTF8(p_str) + }, + allocString: function(p_str) { + const length = GodotRuntime.strlen(p_str) + 1; + const c_str = GodotRuntime.malloc(length); + stringToUTF8(p_str, c_str, length); + return c_str + }, + allocStringArray: function(p_strings) { + const size = p_strings.length; + const c_ptr = GodotRuntime.malloc(size * 4); + for (let i = 0; i < size; i++) { + HEAP32[(c_ptr >> 2) + i] = GodotRuntime.allocString(p_strings[i]) + } + return c_ptr + }, + freeStringArray: function(p_ptr, p_len) { + for (let i = 0; i < p_len; i++) { + GodotRuntime.free(HEAP32[(p_ptr >> 2) + i]) + } + GodotRuntime.free(p_ptr) + }, + stringToHeap: function(p_str, p_ptr, p_len) { + return stringToUTF8Array(p_str, HEAP8, p_ptr, p_len) + } + }; + var GodotConfig = { + canvas: null, + locale: "en", + canvas_resize_policy: 2, + virtual_keyboard: false, + persistent_drops: false, + on_execute: null, + on_exit: null, + init_config: function(p_opts) { + GodotConfig.canvas_resize_policy = p_opts["canvasResizePolicy"]; + GodotConfig.canvas = p_opts["canvas"]; + GodotConfig.locale = p_opts["locale"] || GodotConfig.locale; + GodotConfig.virtual_keyboard = p_opts["virtualKeyboard"]; + GodotConfig.persistent_drops = !!p_opts["persistentDrops"]; + GodotConfig.on_execute = p_opts["onExecute"]; + GodotConfig.on_exit = p_opts["onExit"]; + if (p_opts["focusCanvas"]) { + GodotConfig.canvas.focus() + } + }, + locate_file: function(file) { + return Module["locateFile"](file) + }, + clear: function() { + GodotConfig.canvas = null; + GodotConfig.locale = "en"; + GodotConfig.canvas_resize_policy = 2; + GodotConfig.virtual_keyboard = false; + GodotConfig.persistent_drops = false; + GodotConfig.on_execute = null; + GodotConfig.on_exit = null + } + }; + var ERRNO_CODES = {}; + var GodotFS = { + _idbfs: false, + _syncing: false, + _mount_points: [], + is_persistent: function() { + return GodotFS._idbfs ? 1 : 0 + }, + init: function(persistentPaths) { + GodotFS._idbfs = false; + if (!Array.isArray(persistentPaths)) { + return Promise.reject(new Error("Persistent paths must be an array")) + } + if (!persistentPaths.length) { + return Promise.resolve() + } + GodotFS._mount_points = persistentPaths.slice(); + + function createRecursive(dir) { + try { + FS.stat(dir) + } catch (e) { + if (e.errno !== ERRNO_CODES.ENOENT) { + throw e + } + FS.mkdirTree(dir) + } + } + GodotFS._mount_points.forEach(function(path) { + createRecursive(path); + FS.mount(IDBFS, {}, path) + }); + return new Promise(function(resolve, reject) { + FS.syncfs(true, function(err) { + if (err) { + GodotFS._mount_points = []; + GodotFS._idbfs = false; + GodotRuntime.print(`IndexedDB not available: ${err.message}`) + } else { + GodotFS._idbfs = true + } + resolve(err) + }) + }) + }, + deinit: function() { + GodotFS._mount_points.forEach(function(path) { + try { + FS.unmount(path) + } catch (e) { + GodotRuntime.print("Already unmounted", e) + } + if (GodotFS._idbfs && IDBFS.dbs[path]) { + IDBFS.dbs[path].close(); + delete IDBFS.dbs[path] + } + }); + GodotFS._mount_points = []; + GodotFS._idbfs = false; + GodotFS._syncing = false + }, + sync: function() { + if (GodotFS._syncing) { + GodotRuntime.error("Already syncing!"); + return Promise.resolve() + } + GodotFS._syncing = true; + return new Promise(function(resolve, reject) { + FS.syncfs(false, function(error) { + if (error) { + GodotRuntime.error(`Failed to save IDB file system: ${error.message}`) + } + GodotFS._syncing = false; + resolve(error) + }) + }) + }, + copy_to_fs: function(path, buffer) { + const idx = path.lastIndexOf("/"); + let dir = "/"; + if (idx > 0) { + dir = path.slice(0, idx) + } + try { + FS.stat(dir) + } catch (e) { + if (e.errno !== ERRNO_CODES.ENOENT) { + throw e + } + FS.mkdirTree(dir) + } + FS.writeFile(path, new Uint8Array(buffer)) + } + }; + var GodotOS = { + request_quit: function() {}, + _async_cbs: [], + _fs_sync_promise: null, + atexit: function(p_promise_cb) { + GodotOS._async_cbs.push(p_promise_cb) + }, + cleanup: function(exit_code) { + const cb = GodotConfig.on_exit; + GodotFS.deinit(); + GodotConfig.clear(); + if (cb) { + cb(exit_code) + } + }, + finish_async: function(callback) { + GodotOS._fs_sync_promise.then(function(err) { + const promises = []; + GodotOS._async_cbs.forEach(function(cb) { + promises.push(new Promise(cb)) + }); + return Promise.all(promises) + }).then(function() { + return GodotFS.sync() + }).then(function(err) { + setTimeout(function() { + callback() + }, 0) + }) + } + }; + var GodotAudio = { + ctx: null, + input: null, + driver: null, + interval: 0, + init: function(mix_rate, latency, onstatechange, onlatencyupdate) { + const opts = {}; + if (mix_rate) { + opts["sampleRate"] = mix_rate + } + const ctx = new(window.AudioContext || window.webkitAudioContext)(opts); + GodotAudio.ctx = ctx; + ctx.onstatechange = function() { + let state = 0; + switch (ctx.state) { + case "suspended": + state = 0; + break; + case "running": + state = 1; + break; + case "closed": + state = 2; + break + } + onstatechange(state) + }; + ctx.onstatechange(); + GodotAudio.interval = setInterval(function() { + let computed_latency = 0; + if (ctx.baseLatency) { + computed_latency += GodotAudio.ctx.baseLatency + } + if (ctx.outputLatency) { + computed_latency += GodotAudio.ctx.outputLatency + } + onlatencyupdate(computed_latency) + }, 1e3); + GodotOS.atexit(GodotAudio.close_async); + return ctx.destination.channelCount + }, + create_input: function(callback) { + if (GodotAudio.input) { + return 0 + } + + function gotMediaInput(stream) { + try { + GodotAudio.input = GodotAudio.ctx.createMediaStreamSource(stream); + callback(GodotAudio.input) + } catch (e) { + GodotRuntime.error("Failed creaating input.", e) + } + } + if (navigator.mediaDevices && navigator.mediaDevices.getUserMedia) { + navigator.mediaDevices.getUserMedia({ + "audio": true + }).then(gotMediaInput, function(e) { + GodotRuntime.error("Error getting user media.", e) + }) + } else { + if (!navigator.getUserMedia) { + navigator.getUserMedia = navigator.webkitGetUserMedia || navigator.mozGetUserMedia + } + if (!navigator.getUserMedia) { + GodotRuntime.error("getUserMedia not available."); + return 1 + } + navigator.getUserMedia({ + "audio": true + }, gotMediaInput, function(e) { + GodotRuntime.print(e) + }) + } + return 0 + }, + close_async: function(resolve, reject) { + const ctx = GodotAudio.ctx; + GodotAudio.ctx = null; + if (!ctx) { + resolve(); + return + } + if (GodotAudio.interval) { + clearInterval(GodotAudio.interval); + GodotAudio.interval = 0 + } + if (GodotAudio.input) { + GodotAudio.input.disconnect(); + GodotAudio.input = null + } + let closed = Promise.resolve(); + if (GodotAudio.driver) { + closed = GodotAudio.driver.close() + } + closed.then(function() { + return ctx.close() + }).then(function() { + ctx.onstatechange = null; + resolve() + }).catch(function(e) { + ctx.onstatechange = null; + GodotRuntime.error("Error closing AudioContext", e); + resolve() + }) + } + }; + + function _godot_audio_capture_start() { + return GodotAudio.create_input(function(input) { + input.connect(GodotAudio.driver.get_node()) + }) + } + + function _godot_audio_capture_stop() { + if (GodotAudio.input) { + const tracks = GodotAudio.input["mediaStream"]["getTracks"](); + for (let i = 0; i < tracks.length; i++) { + tracks[i]["stop"]() + } + GodotAudio.input.disconnect(); + GodotAudio.input = null + } + } + + function _godot_audio_has_script_processor() { + return GodotAudio.ctx && GodotAudio.ctx.createScriptProcessor ? 1 : 0 + } + + function _godot_audio_has_worklet() { + return GodotAudio.ctx && GodotAudio.ctx.audioWorklet ? 1 : 0 + } + + function _godot_audio_init(p_mix_rate, p_latency, p_state_change, p_latency_update) { + const statechange = GodotRuntime.get_func(p_state_change); + const latencyupdate = GodotRuntime.get_func(p_latency_update); + const mix_rate = GodotRuntime.getHeapValue(p_mix_rate, "i32"); + const channels = GodotAudio.init(mix_rate, p_latency, statechange, latencyupdate); + GodotRuntime.setHeapValue(p_mix_rate, GodotAudio.ctx.sampleRate, "i32"); + return channels + } + + function _godot_audio_is_available() { + if (!(window.AudioContext || window.webkitAudioContext)) { + return 0 + } + return 1 + } + + function _godot_audio_resume() { + if (GodotAudio.ctx && GodotAudio.ctx.state !== "running") { + GodotAudio.ctx.resume() + } + } + var GodotAudioScript = { + script: null, + create: function(buffer_length, channel_count) { + GodotAudioScript.script = GodotAudio.ctx.createScriptProcessor(buffer_length, 2, channel_count); + GodotAudio.driver = GodotAudioScript; + return GodotAudioScript.script.bufferSize + }, + start: function(p_in_buf, p_in_size, p_out_buf, p_out_size, onprocess) { + GodotAudioScript.script.onaudioprocess = function(event) { + const inb = GodotRuntime.heapSub(HEAPF32, p_in_buf, p_in_size); + const input = event.inputBuffer; + if (GodotAudio.input) { + const inlen = input.getChannelData(0).length; + for (let ch = 0; ch < 2; ch++) { + const data = input.getChannelData(ch); + for (let s = 0; s < inlen; s++) { + inb[s * 2 + ch] = data[s] + } + } + } + onprocess(); + const outb = GodotRuntime.heapSub(HEAPF32, p_out_buf, p_out_size); + const output = event.outputBuffer; + const channels = output.numberOfChannels; + for (let ch = 0; ch < channels; ch++) { + const data = output.getChannelData(ch); + for (let sample = 0; sample < data.length; sample++) { + data[sample] = outb[sample * channels + ch] + } + } + }; + GodotAudioScript.script.connect(GodotAudio.ctx.destination) + }, + get_node: function() { + return GodotAudioScript.script + }, + close: function() { + return new Promise(function(resolve, reject) { + GodotAudioScript.script.disconnect(); + GodotAudioScript.script.onaudioprocess = null; + GodotAudioScript.script = null; + resolve() + }) + } + }; + + function _godot_audio_script_create(buffer_length, channel_count) { + const buf_len = GodotRuntime.getHeapValue(buffer_length, "i32"); + try { + const out_len = GodotAudioScript.create(buf_len, channel_count); + GodotRuntime.setHeapValue(buffer_length, out_len, "i32") + } catch (e) { + GodotRuntime.error("Error starting AudioDriverScriptProcessor", e); + return 1 + } + return 0 + } + + function _godot_audio_script_start(p_in_buf, p_in_size, p_out_buf, p_out_size, p_cb) { + const onprocess = GodotRuntime.get_func(p_cb); + GodotAudioScript.start(p_in_buf, p_in_size, p_out_buf, p_out_size, onprocess) + } + var GodotAudioWorklet = { + promise: null, + worklet: null, + ring_buffer: null, + create: function(channels) { + const path = GodotConfig.locate_file("godot.audio.worklet.js"); + GodotAudioWorklet.promise = GodotAudio.ctx.audioWorklet.addModule(path).then(function() { + GodotAudioWorklet.worklet = new AudioWorkletNode(GodotAudio.ctx, "godot-processor", { + "outputChannelCount": [channels] + }); + return Promise.resolve() + }); + GodotAudio.driver = GodotAudioWorklet + }, + start: function(in_buf, out_buf, state) { + GodotAudioWorklet.promise.then(function() { + const node = GodotAudioWorklet.worklet; + node.connect(GodotAudio.ctx.destination); + node.port.postMessage({ + "cmd": "start", + "data": [state, in_buf, out_buf] + }); + node.port.onmessage = function(event) { + GodotRuntime.error(event.data) + } + }) + }, + start_no_threads: function(p_out_buf, p_out_size, out_callback, p_in_buf, p_in_size, in_callback) { + function RingBuffer() { + let wpos = 0; + let rpos = 0; + let pending_samples = 0; + const wbuf = new Float32Array(p_out_size); + + function send(port) { + if (pending_samples === 0) { + return + } + const buffer = GodotRuntime.heapSub(HEAPF32, p_out_buf, p_out_size); + const size = buffer.length; + const tot_sent = pending_samples; + out_callback(wpos, pending_samples); + if (wpos + pending_samples >= size) { + const high = size - wpos; + wbuf.set(buffer.subarray(wpos, size)); + pending_samples -= high; + wpos = 0 + } + if (pending_samples > 0) { + wbuf.set(buffer.subarray(wpos, wpos + pending_samples), tot_sent - pending_samples) + } + port.postMessage({ + "cmd": "chunk", + "data": wbuf.subarray(0, tot_sent) + }); + wpos += pending_samples; + pending_samples = 0 + } + this.receive = function(recv_buf) { + const buffer = GodotRuntime.heapSub(HEAPF32, p_in_buf, p_in_size); + const from = rpos; + let to_write = recv_buf.length; + let high = 0; + if (rpos + to_write >= p_in_size) { + high = p_in_size - rpos; + buffer.set(recv_buf.subarray(0, high), rpos); + to_write -= high; + rpos = 0 + } + if (to_write) { + buffer.set(recv_buf.subarray(high, to_write), rpos) + } + in_callback(from, recv_buf.length); + rpos += to_write + }; + this.consumed = function(size, port) { + pending_samples += size; + send(port) + } + } + GodotAudioWorklet.ring_buffer = new RingBuffer; + GodotAudioWorklet.promise.then(function() { + const node = GodotAudioWorklet.worklet; + const buffer = GodotRuntime.heapSlice(HEAPF32, p_out_buf, p_out_size); + node.connect(GodotAudio.ctx.destination); + node.port.postMessage({ + "cmd": "start_nothreads", + "data": [buffer, p_in_size] + }); + node.port.onmessage = function(event) { + if (!GodotAudioWorklet.worklet) { + return + } + if (event.data["cmd"] === "read") { + const read = event.data["data"]; + GodotAudioWorklet.ring_buffer.consumed(read, GodotAudioWorklet.worklet.port) + } else if (event.data["cmd"] === "input") { + const buf = event.data["data"]; + if (buf.length > p_in_size) { + GodotRuntime.error("Input chunk is too big"); + return + } + GodotAudioWorklet.ring_buffer.receive(buf) + } else { + GodotRuntime.error(event.data) + } + } + }) + }, + get_node: function() { + return GodotAudioWorklet.worklet + }, + close: function() { + return new Promise(function(resolve, reject) { + if (GodotAudioWorklet.promise === null) { + return + } + GodotAudioWorklet.promise.then(function() { + GodotAudioWorklet.worklet.port.postMessage({ + "cmd": "stop", + "data": null + }); + GodotAudioWorklet.worklet.disconnect(); + GodotAudioWorklet.worklet = null; + GodotAudioWorklet.promise = null; + resolve() + }).catch(function(err) {}) + }) + } + }; + + function _godot_audio_worklet_create(channels) { + try { + GodotAudioWorklet.create(channels) + } catch (e) { + GodotRuntime.error("Error starting AudioDriverWorklet", e); + return 1 + } + return 0 + } + + function _godot_audio_worklet_start_no_threads(p_out_buf, p_out_size, p_out_callback, p_in_buf, p_in_size, p_in_callback) { + const out_callback = GodotRuntime.get_func(p_out_callback); + const in_callback = GodotRuntime.get_func(p_in_callback); + GodotAudioWorklet.start_no_threads(p_out_buf, p_out_size, out_callback, p_in_buf, p_in_size, in_callback) + } + + function _godot_js_config_canvas_id_get(p_ptr, p_ptr_max) { + GodotRuntime.stringToHeap(`#${GodotConfig.canvas.id}`, p_ptr, p_ptr_max) + } + + function _godot_js_config_locale_get(p_ptr, p_ptr_max) { + GodotRuntime.stringToHeap(GodotConfig.locale, p_ptr, p_ptr_max) + } + var GodotDisplayCursor = { + shape: "auto", + visible: true, + cursors: {}, + set_style: function(style) { + GodotConfig.canvas.style.cursor = style + }, + set_shape: function(shape) { + GodotDisplayCursor.shape = shape; + let css = shape; + if (shape in GodotDisplayCursor.cursors) { + const c = GodotDisplayCursor.cursors[shape]; + css = `url("${c.url}") ${c.x} ${c.y}, auto` + } + if (GodotDisplayCursor.visible) { + GodotDisplayCursor.set_style(css) + } + }, + clear: function() { + GodotDisplayCursor.set_style(""); + GodotDisplayCursor.shape = "auto"; + GodotDisplayCursor.visible = true; + Object.keys(GodotDisplayCursor.cursors).forEach(function(key) { + URL.revokeObjectURL(GodotDisplayCursor.cursors[key]); + delete GodotDisplayCursor.cursors[key] + }) + }, + lockPointer: function() { + const canvas = GodotConfig.canvas; + if (canvas.requestPointerLock) { + canvas.requestPointerLock() + } + }, + releasePointer: function() { + if (document.exitPointerLock) { + document.exitPointerLock() + } + }, + isPointerLocked: function() { + return document.pointerLockElement === GodotConfig.canvas + } + }; + var GodotEventListeners = { + handlers: [], + has: function(target, event, method, capture) { + return GodotEventListeners.handlers.findIndex(function(e) { + return e.target === target && e.event === event && e.method === method && e.capture === capture + }) !== -1 + }, + add: function(target, event, method, capture) { + if (GodotEventListeners.has(target, event, method, capture)) { + return + } + + function Handler(p_target, p_event, p_method, p_capture) { + this.target = p_target; + this.event = p_event; + this.method = p_method; + this.capture = p_capture + } + GodotEventListeners.handlers.push(new Handler(target, event, method, capture)); + target.addEventListener(event, method, capture) + }, + clear: function() { + GodotEventListeners.handlers.forEach(function(h) { + h.target.removeEventListener(h.event, h.method, h.capture) + }); + GodotEventListeners.handlers.length = 0 + } + }; + + function _emscripten_webgl_do_get_current_context() { + return GL.currentContext ? GL.currentContext.handle : 0 + } + + function _emscripten_webgl_get_current_context() { + return _emscripten_webgl_do_get_current_context() + } + var GodotDisplayScreen = { + desired_size: [0, 0], + hidpi: true, + getPixelRatio: function() { + return GodotDisplayScreen.hidpi ? window.devicePixelRatio || 1 : 1 + }, + isFullscreen: function() { + const elem = document.fullscreenElement || document.mozFullscreenElement || document.webkitFullscreenElement || document.msFullscreenElement; + if (elem) { + return elem === GodotConfig.canvas + } + return document.fullscreen || document.mozFullScreen || document.webkitIsFullscreen + }, + hasFullscreen: function() { + return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled + }, + requestFullscreen: function() { + if (!GodotDisplayScreen.hasFullscreen()) { + return 1 + } + const canvas = GodotConfig.canvas; + try { + const promise = (canvas.requestFullscreen || canvas.msRequestFullscreen || canvas.mozRequestFullScreen || canvas.mozRequestFullscreen || canvas.webkitRequestFullscreen).call(canvas); + if (promise) { + promise.catch(function() {}) + } + } catch (e) { + return 1 + } + return 0 + }, + exitFullscreen: function() { + if (!GodotDisplayScreen.isFullscreen()) { + return 0 + } + try { + const promise = document.exitFullscreen(); + if (promise) { + promise.catch(function() {}) + } + } catch (e) { + return 1 + } + return 0 + }, + _updateGL: function() { + const gl_context_handle = _emscripten_webgl_get_current_context(); + const gl = GL.getContext(gl_context_handle); + if (gl) { + GL.resizeOffscreenFramebuffer(gl) + } + }, + updateSize: function() { + const isFullscreen = GodotDisplayScreen.isFullscreen(); + const wantsFullWindow = GodotConfig.canvas_resize_policy === 2; + const noResize = GodotConfig.canvas_resize_policy === 0; + const wwidth = GodotDisplayScreen.desired_size[0]; + const wheight = GodotDisplayScreen.desired_size[1]; + const canvas = GodotConfig.canvas; + let width = wwidth; + let height = wheight; + if (noResize) { + if (canvas.width !== width || canvas.height !== height) { + GodotDisplayScreen.desired_size = [canvas.width, canvas.height]; + GodotDisplayScreen._updateGL(); + return 1 + } + return 0 + } + const scale = GodotDisplayScreen.getPixelRatio(); + if (isFullscreen || wantsFullWindow) { + width = window.innerWidth * scale; + height = window.innerHeight * scale + } + const csw = `${width/scale}px`; + const csh = `${height/scale}px`; + if (canvas.style.width !== csw || canvas.style.height !== csh || canvas.width !== width || canvas.height !== height) { + canvas.width = width; + canvas.height = height; + canvas.style.width = csw; + canvas.style.height = csh; + GodotDisplayScreen._updateGL(); + return 1 + } + return 0 + } + }; + var GodotDisplayVK = { + textinput: null, + textarea: null, + available: function() { + return GodotConfig.virtual_keyboard && "ontouchstart" in window + }, + init: function(input_cb) { + function create(what) { + const elem = document.createElement(what); + elem.style.display = "none"; + elem.style.position = "absolute"; + elem.style.zIndex = "-1"; + elem.style.background = "transparent"; + elem.style.padding = "0px"; + elem.style.margin = "0px"; + elem.style.overflow = "hidden"; + elem.style.width = "0px"; + elem.style.height = "0px"; + elem.style.border = "0px"; + elem.style.outline = "none"; + elem.readonly = true; + elem.disabled = true; + GodotEventListeners.add(elem, "input", function(evt) { + const c_str = GodotRuntime.allocString(elem.value); + input_cb(c_str, elem.selectionEnd); + GodotRuntime.free(c_str) + }, false); + GodotEventListeners.add(elem, "blur", function(evt) { + elem.style.display = "none"; + elem.readonly = true; + elem.disabled = true + }, false); + GodotConfig.canvas.insertAdjacentElement("beforebegin", elem); + return elem + } + GodotDisplayVK.textinput = create("input"); + GodotDisplayVK.textarea = create("textarea"); + GodotDisplayVK.updateSize() + }, + show: function(text, multiline, start, end) { + if (!GodotDisplayVK.textinput || !GodotDisplayVK.textarea) { + return + } + if (GodotDisplayVK.textinput.style.display !== "" || GodotDisplayVK.textarea.style.display !== "") { + GodotDisplayVK.hide() + } + GodotDisplayVK.updateSize(); + const elem = multiline ? GodotDisplayVK.textarea : GodotDisplayVK.textinput; + elem.readonly = false; + elem.disabled = false; + elem.value = text; + elem.style.display = "block"; + elem.focus(); + elem.setSelectionRange(start, end) + }, + hide: function() { + if (!GodotDisplayVK.textinput || !GodotDisplayVK.textarea) { + return + }[GodotDisplayVK.textinput, GodotDisplayVK.textarea].forEach(function(elem) { + elem.blur(); + elem.style.display = "none"; + elem.value = "" + }) + }, + updateSize: function() { + if (!GodotDisplayVK.textinput || !GodotDisplayVK.textarea) { + return + } + const rect = GodotConfig.canvas.getBoundingClientRect(); + + function update(elem) { + elem.style.left = `${rect.left}px`; + elem.style.top = `${rect.top}px`; + elem.style.width = `${rect.width}px`; + elem.style.height = `${rect.height}px` + } + update(GodotDisplayVK.textinput); + update(GodotDisplayVK.textarea) + }, + clear: function() { + if (GodotDisplayVK.textinput) { + GodotDisplayVK.textinput.remove(); + GodotDisplayVK.textinput = null + } + if (GodotDisplayVK.textarea) { + GodotDisplayVK.textarea.remove(); + GodotDisplayVK.textarea = null + } + } + }; + var GodotDisplay = { + window_icon: "", + findDPI: function() { + function testDPI(dpi) { + return window.matchMedia(`(max-resolution: ${dpi}dpi)`).matches + } + + function bisect(low, high, func) { + const mid = parseInt((high - low) / 2 + low, 10); + if (high - low <= 1) { + return func(high) ? high : low + } + if (func(mid)) { + return bisect(low, mid, func) + } + return bisect(mid, high, func) + } + try { + const dpi = bisect(0, 800, testDPI); + return dpi >= 96 ? dpi : 96 + } catch (e) { + return 96 + } + } + }; + + function _godot_js_display_alert(p_text) { + window.alert(GodotRuntime.parseString(p_text)) + } + + function _godot_js_display_canvas_focus() { + GodotConfig.canvas.focus() + } + + function _godot_js_display_canvas_is_focused() { + return document.activeElement === GodotConfig.canvas + } + + function _godot_js_display_clipboard_get(callback) { + const func = GodotRuntime.get_func(callback); + try { + navigator.clipboard.readText().then(function(result) { + const ptr = GodotRuntime.allocString(result); + func(ptr); + GodotRuntime.free(ptr) + }).catch(function(e) {}) + } catch (e) {} + } + + function _godot_js_display_clipboard_set(p_text) { + const text = GodotRuntime.parseString(p_text); + if (!navigator.clipboard || !navigator.clipboard.writeText) { + return 1 + } + navigator.clipboard.writeText(text).catch(function(e) { + GodotRuntime.error("Setting OS clipboard is only possible from an input callback for the HTML5 plafrom. Exception:", e) + }); + return 0 + } + + function _godot_js_display_cursor_is_hidden() { + return !GodotDisplayCursor.visible + } + + function _godot_js_display_cursor_is_locked() { + return GodotDisplayCursor.isPointerLocked() ? 1 : 0 + } + + function _godot_js_display_cursor_lock_set(p_lock) { + if (p_lock) { + GodotDisplayCursor.lockPointer() + } else { + GodotDisplayCursor.releasePointer() + } + } + + function _godot_js_display_cursor_set_custom_shape(p_shape, p_ptr, p_len, p_hotspot_x, p_hotspot_y) { + const shape = GodotRuntime.parseString(p_shape); + const old_shape = GodotDisplayCursor.cursors[shape]; + if (p_len > 0) { + const png = new Blob([GodotRuntime.heapSlice(HEAPU8, p_ptr, p_len)], { + type: "image/png" + }); + const url = URL.createObjectURL(png); + GodotDisplayCursor.cursors[shape] = { + url: url, + x: p_hotspot_x, + y: p_hotspot_y + } + } else { + delete GodotDisplayCursor.cursors[shape] + } + if (shape === GodotDisplayCursor.shape) { + GodotDisplayCursor.set_shape(GodotDisplayCursor.shape) + } + if (old_shape) { + URL.revokeObjectURL(old_shape.url) + } + } + + function _godot_js_display_cursor_set_shape(p_string) { + GodotDisplayCursor.set_shape(GodotRuntime.parseString(p_string)) + } + + function _godot_js_display_cursor_set_visible(p_visible) { + const visible = p_visible !== 0; + if (visible === GodotDisplayCursor.visible) { + return + } + GodotDisplayCursor.visible = visible; + if (visible) { + GodotDisplayCursor.set_shape(GodotDisplayCursor.shape) + } else { + GodotDisplayCursor.set_style("none") + } + } + + function _godot_js_display_desired_size_set(width, height) { + GodotDisplayScreen.desired_size = [width, height]; + GodotDisplayScreen.updateSize() + } + + function _godot_js_display_fullscreen_cb(callback) { + const canvas = GodotConfig.canvas; + const func = GodotRuntime.get_func(callback); + + function change_cb(evt) { + if (evt.target === canvas) { + func(GodotDisplayScreen.isFullscreen()) + } + } + GodotEventListeners.add(document, "fullscreenchange", change_cb, false); + GodotEventListeners.add(document, "mozfullscreenchange", change_cb, false); + GodotEventListeners.add(document, "webkitfullscreenchange", change_cb, false) + } + + function _godot_js_display_fullscreen_exit() { + return GodotDisplayScreen.exitFullscreen() + } + + function _godot_js_display_fullscreen_request() { + return GodotDisplayScreen.requestFullscreen() + } + + function _godot_js_display_glGetBufferSubData(target, offset, size, data) { + const gl_context_handle = _emscripten_webgl_get_current_context(); + const gl = GL.getContext(gl_context_handle); + if (gl) { + gl.GLctx["getBufferSubData"](target, offset, HEAPU8, data, size) + } + } + + function _godot_js_display_has_webgl(p_version) { + if (p_version !== 1 && p_version !== 2) { + return false + } + try { + return !!document.createElement("canvas").getContext(p_version === 2 ? "webgl2" : "webgl") + } catch (e) {} + return false + } + + function _godot_js_display_is_swap_ok_cancel() { + const win = ["Windows", "Win64", "Win32", "WinCE"]; + const plat = navigator.platform || ""; + if (win.indexOf(plat) !== -1) { + return 1 + } + return 0 + } + + function _godot_js_display_notification_cb(callback, p_enter, p_exit, p_in, p_out) { + const canvas = GodotConfig.canvas; + const func = GodotRuntime.get_func(callback); + const notif = [p_enter, p_exit, p_in, p_out]; + ["mouseover", "mouseleave", "focus", "blur"].forEach(function(evt_name, idx) { + GodotEventListeners.add(canvas, evt_name, function() { + func(notif[idx]) + }, true) + }) + } + + function _godot_js_display_pixel_ratio_get() { + return GodotDisplayScreen.getPixelRatio() + } + + function _godot_js_display_screen_dpi_get() { + return GodotDisplay.findDPI() + } + + function _godot_js_display_screen_size_get(width, height) { + const scale = GodotDisplayScreen.getPixelRatio(); + GodotRuntime.setHeapValue(width, window.screen.width * scale, "i32"); + GodotRuntime.setHeapValue(height, window.screen.height * scale, "i32") + } + + function _godot_js_display_setup_canvas(p_width, p_height, p_fullscreen, p_hidpi) { + const canvas = GodotConfig.canvas; + GodotEventListeners.add(canvas, "contextmenu", function(ev) { + ev.preventDefault() + }, false); + GodotEventListeners.add(canvas, "webglcontextlost", function(ev) { + alert("WebGL context lost, please reload the page"); + ev.preventDefault() + }, false); + GodotDisplayScreen.hidpi = !!p_hidpi; + switch (GodotConfig.canvas_resize_policy) { + case 0: + GodotDisplayScreen.desired_size = [canvas.width, canvas.height]; + break; + case 1: + GodotDisplayScreen.desired_size = [p_width, p_height]; + break; + default: + canvas.style.position = "absolute"; + canvas.style.top = 0; + canvas.style.left = 0; + break + } + GodotDisplayScreen.updateSize(); + if (p_fullscreen) { + GodotDisplayScreen.requestFullscreen() + } + } + + function _godot_js_display_size_update() { + const updated = GodotDisplayScreen.updateSize(); + if (updated) { + GodotDisplayVK.updateSize() + } + return updated + } + + function _godot_js_display_touchscreen_is_available() { + return "ontouchstart" in window + } + + function _godot_js_display_vk_available() { + return GodotDisplayVK.available() + } + + function _godot_js_display_vk_cb(p_input_cb) { + const input_cb = GodotRuntime.get_func(p_input_cb); + if (GodotDisplayVK.available()) { + GodotDisplayVK.init(input_cb) + } + } + + function _godot_js_display_vk_hide() { + GodotDisplayVK.hide() + } + + function _godot_js_display_vk_show(p_text, p_multiline, p_start, p_end) { + const text = GodotRuntime.parseString(p_text); + const start = p_start > 0 ? p_start : 0; + const end = p_end > 0 ? p_end : start; + GodotDisplayVK.show(text, p_multiline, start, end) + } + + function _godot_js_display_window_blur_cb(callback) { + const func = GodotRuntime.get_func(callback); + GodotEventListeners.add(window, "blur", function() { + func() + }, false) + } + + function _godot_js_display_window_icon_set(p_ptr, p_len) { + let link = document.getElementById("-gd-engine-icon"); + if (link === null) { + link = document.createElement("link"); + link.rel = "icon"; + link.id = "-gd-engine-icon"; + document.head.appendChild(link) + } + const old_icon = GodotDisplay.window_icon; + const png = new Blob([GodotRuntime.heapSlice(HEAPU8, p_ptr, p_len)], { + type: "image/png" + }); + GodotDisplay.window_icon = URL.createObjectURL(png); + link.href = GodotDisplay.window_icon; + if (old_icon) { + URL.revokeObjectURL(old_icon) + } + } + + function _godot_js_display_window_size_get(p_width, p_height) { + GodotRuntime.setHeapValue(p_width, GodotConfig.canvas.width, "i32"); + GodotRuntime.setHeapValue(p_height, GodotConfig.canvas.height, "i32") + } + + function _godot_js_display_window_title_set(p_data) { + document.title = GodotRuntime.parseString(p_data) + } + + function _godot_js_eval(p_js, p_use_global_ctx, p_union_ptr, p_byte_arr, p_byte_arr_write, p_callback) { + const js_code = GodotRuntime.parseString(p_js); + let eval_ret = null; + try { + if (p_use_global_ctx) { + const global_eval = eval; + eval_ret = global_eval(js_code) + } else { + eval_ret = eval(js_code) + } + } catch (e) { + GodotRuntime.error(e) + } + switch (typeof eval_ret) { + case "boolean": + GodotRuntime.setHeapValue(p_union_ptr, eval_ret, "i32"); + return 1; + case "number": + GodotRuntime.setHeapValue(p_union_ptr, eval_ret, "double"); + return 3; + case "string": + GodotRuntime.setHeapValue(p_union_ptr, GodotRuntime.allocString(eval_ret), "*"); + return 4; + case "object": + if (eval_ret === null) { + break + } + if (ArrayBuffer.isView(eval_ret) && !(eval_ret instanceof Uint8Array)) { + eval_ret = new Uint8Array(eval_ret.buffer) + } else if (eval_ret instanceof ArrayBuffer) { + eval_ret = new Uint8Array(eval_ret) + } + if (eval_ret instanceof Uint8Array) { + const func = GodotRuntime.get_func(p_callback); + const bytes_ptr = func(p_byte_arr, p_byte_arr_write, eval_ret.length); + HEAPU8.set(eval_ret, bytes_ptr); + return 20 + } + break + } + return 0 + } + var IDHandler = { + _last_id: 0, + _references: {}, + get: function(p_id) { + return IDHandler._references[p_id] + }, + add: function(p_data) { + const id = ++IDHandler._last_id; + IDHandler._references[id] = p_data; + return id + }, + remove: function(p_id) { + delete IDHandler._references[p_id] + } + }; + var GodotFetch = { + onread: function(id, result) { + const obj = IDHandler.get(id); + if (!obj) { + return + } + if (result.value) { + obj.chunks.push(result.value) + } + obj.reading = false; + obj.done = result.done + }, + onresponse: function(id, response) { + const obj = IDHandler.get(id); + if (!obj) { + return + } + let chunked = false; + response.headers.forEach(function(value, header) { + const v = value.toLowerCase().trim(); + const h = header.toLowerCase().trim(); + if (h === "transfer-encoding" && v === "chunked") { + chunked = true + } + }); + obj.status = response.status; + obj.response = response; + obj.reader = response.body.getReader(); + obj.chunked = chunked + }, + onerror: function(id, err) { + GodotRuntime.error(err); + const obj = IDHandler.get(id); + if (!obj) { + return + } + obj.error = err + }, + create: function(method, url, headers, body) { + const obj = { + request: null, + response: null, + reader: null, + error: null, + done: false, + reading: false, + status: 0, + chunks: [], + bodySize: -1 + }; + const id = IDHandler.add(obj); + const init = { + method: method, + headers: headers, + body: body + }; + obj.request = fetch(url, init); + obj.request.then(GodotFetch.onresponse.bind(null, id)).catch(GodotFetch.onerror.bind(null, id)); + return id + }, + free: function(id) { + const obj = IDHandler.get(id); + if (!obj) { + return + } + IDHandler.remove(id); + if (!obj.request) { + return + } + obj.request.then(function(response) { + response.abort() + }).catch(function(e) {}) + }, + read: function(id) { + const obj = IDHandler.get(id); + if (!obj) { + return + } + if (obj.reader && !obj.reading) { + if (obj.done) { + obj.reader = null; + return + } + obj.reading = true; + obj.reader.read().then(GodotFetch.onread.bind(null, id)).catch(GodotFetch.onerror.bind(null, id)) + } + } + }; + + function _godot_js_fetch_body_length_get(p_id) { + const obj = IDHandler.get(p_id); + if (!obj || !obj.response) { + return -1 + } + return obj.bodySize + } + + function _godot_js_fetch_create(p_method, p_url, p_headers, p_headers_size, p_body, p_body_size) { + const method = GodotRuntime.parseString(p_method); + const url = GodotRuntime.parseString(p_url); + const headers = GodotRuntime.parseStringArray(p_headers, p_headers_size); + const body = p_body_size ? GodotRuntime.heapSlice(HEAP8, p_body, p_body_size) : null; + return GodotFetch.create(method, url, headers.map(function(hv) { + const idx = hv.indexOf(":"); + if (idx <= 0) { + return [] + } + return [hv.slice(0, idx).trim(), hv.slice(idx + 1).trim()] + }).filter(function(v) { + return v.length === 2 + }), body) + } + + function _godot_js_fetch_free(id) { + GodotFetch.free(id) + } + + function _godot_js_fetch_http_status_get(p_id) { + const obj = IDHandler.get(p_id); + if (!obj || !obj.response) { + return 0 + } + return obj.status + } + + function _godot_js_fetch_is_chunked(p_id) { + const obj = IDHandler.get(p_id); + if (!obj || !obj.response) { + return -1 + } + return obj.chunked ? 1 : 0 + } + + function _godot_js_fetch_read_chunk(p_id, p_buf, p_buf_size) { + const obj = IDHandler.get(p_id); + if (!obj || !obj.response) { + return 0 + } + let to_read = p_buf_size; + const chunks = obj.chunks; + while (to_read && chunks.length) { + const chunk = obj.chunks[0]; + if (chunk.length > to_read) { + GodotRuntime.heapCopy(HEAP8, chunk.slice(0, to_read), p_buf); + chunks[0] = chunk.slice(to_read); + to_read = 0 + } else { + GodotRuntime.heapCopy(HEAP8, chunk, p_buf); + to_read -= chunk.length; + chunks.pop() + } + } + if (!chunks.length) { + GodotFetch.read(p_id) + } + return p_buf_size - to_read + } + + function _godot_js_fetch_read_headers(p_id, p_parse_cb, p_ref) { + const obj = IDHandler.get(p_id); + if (!obj || !obj.response) { + return 1 + } + const cb = GodotRuntime.get_func(p_parse_cb); + const arr = []; + obj.response.headers.forEach(function(v, h) { + arr.push(`${h}:${v}`) + }); + const c_ptr = GodotRuntime.allocStringArray(arr); + cb(arr.length, c_ptr, p_ref); + GodotRuntime.freeStringArray(c_ptr, arr.length); + return 0 + } + + function _godot_js_fetch_state_get(p_id) { + const obj = IDHandler.get(p_id); + if (!obj) { + return -1 + } + if (obj.error) { + return -1 + } + if (!obj.response) { + return 0 + } + if (obj.reader) { + return 1 + } + if (obj.done) { + return 2 + } + return -1 + } + var GodotInputGamepads = { + samples: [], + get_pads: function() { + try { + const pads = navigator.getGamepads(); + if (pads) { + return pads + } + return [] + } catch (e) { + return [] + } + }, + get_samples: function() { + return GodotInputGamepads.samples + }, + get_sample: function(index) { + const samples = GodotInputGamepads.samples; + return index < samples.length ? samples[index] : null + }, + sample: function() { + const pads = GodotInputGamepads.get_pads(); + const samples = []; + for (let i = 0; i < pads.length; i++) { + const pad = pads[i]; + if (!pad) { + samples.push(null); + continue + } + const s = { + standard: pad.mapping === "standard", + buttons: [], + axes: [], + connected: pad.connected + }; + for (let b = 0; b < pad.buttons.length; b++) { + s.buttons.push(pad.buttons[b].value) + } + for (let a = 0; a < pad.axes.length; a++) { + s.axes.push(pad.axes[a]) + } + samples.push(s) + } + GodotInputGamepads.samples = samples + }, + init: function(onchange) { + GodotInputGamepads.samples = []; + + function add(pad) { + const guid = GodotInputGamepads.get_guid(pad); + const c_id = GodotRuntime.allocString(pad.id); + const c_guid = GodotRuntime.allocString(guid); + onchange(pad.index, 1, c_id, c_guid); + GodotRuntime.free(c_id); + GodotRuntime.free(c_guid) + } + const pads = GodotInputGamepads.get_pads(); + for (let i = 0; i < pads.length; i++) { + if (pads[i]) { + add(pads[i]) + } + } + GodotEventListeners.add(window, "gamepadconnected", function(evt) { + if (evt.gamepad) { + add(evt.gamepad) + } + }, false); + GodotEventListeners.add(window, "gamepaddisconnected", function(evt) { + if (evt.gamepad) { + onchange(evt.gamepad.index, 0) + } + }, false) + }, + get_guid: function(pad) { + if (pad.mapping) { + return pad.mapping + } + const ua = navigator.userAgent; + let os = "Unknown"; + if (ua.indexOf("Android") >= 0) { + os = "Android" + } else if (ua.indexOf("Linux") >= 0) { + os = "Linux" + } else if (ua.indexOf("iPhone") >= 0) { + os = "iOS" + } else if (ua.indexOf("Macintosh") >= 0) { + os = "MacOSX" + } else if (ua.indexOf("Windows") >= 0) { + os = "Windows" + } + const id = pad.id; + const exp1 = /vendor: ([0-9a-f]{4}) product: ([0-9a-f]{4})/i; + const exp2 = /^([0-9a-f]+)-([0-9a-f]+)-/i; + let vendor = ""; + let product = ""; + if (exp1.test(id)) { + const match = exp1.exec(id); + vendor = match[1].padStart(4, "0"); + product = match[2].padStart(4, "0") + } else if (exp2.test(id)) { + const match = exp2.exec(id); + vendor = match[1].padStart(4, "0"); + product = match[2].padStart(4, "0") + } + if (!vendor || !product) { + return `${os}Unknown` + } + return os + vendor + product + } + }; + var GodotInputDragDrop = { + promises: [], + pending_files: [], + add_entry: function(entry) { + if (entry.isDirectory) { + GodotInputDragDrop.add_dir(entry) + } else if (entry.isFile) { + GodotInputDragDrop.add_file(entry) + } else { + GodotRuntime.error("Unrecognized entry...", entry) + } + }, + add_dir: function(entry) { + GodotInputDragDrop.promises.push(new Promise(function(resolve, reject) { + const reader = entry.createReader(); + reader.readEntries(function(entries) { + for (let i = 0; i < entries.length; i++) { + GodotInputDragDrop.add_entry(entries[i]) + } + resolve() + }) + })) + }, + add_file: function(entry) { + GodotInputDragDrop.promises.push(new Promise(function(resolve, reject) { + entry.file(function(file) { + const reader = new FileReader; + reader.onload = function() { + const f = { + "path": file.relativePath || file.webkitRelativePath, + "name": file.name, + "type": file.type, + "size": file.size, + "data": reader.result + }; + if (!f["path"]) { + f["path"] = f["name"] + } + GodotInputDragDrop.pending_files.push(f); + resolve() + }; + reader.onerror = function() { + GodotRuntime.print("Error reading file"); + reject() + }; + reader.readAsArrayBuffer(file) + }, function(err) { + GodotRuntime.print("Error!"); + reject() + }) + })) + }, + process: function(resolve, reject) { + if (GodotInputDragDrop.promises.length === 0) { + resolve(); + return + } + GodotInputDragDrop.promises.pop().then(function() { + setTimeout(function() { + GodotInputDragDrop.process(resolve, reject) + }, 0) + }) + }, + _process_event: function(ev, callback) { + ev.preventDefault(); + if (ev.dataTransfer.items) { + for (let i = 0; i < ev.dataTransfer.items.length; i++) { + const item = ev.dataTransfer.items[i]; + let entry = null; + if ("getAsEntry" in item) { + entry = item.getAsEntry() + } else if ("webkitGetAsEntry" in item) { + entry = item.webkitGetAsEntry() + } + if (entry) { + GodotInputDragDrop.add_entry(entry) + } + } + } else { + GodotRuntime.error("File upload not supported") + } + new Promise(GodotInputDragDrop.process).then(function() { + const DROP = `/tmp/drop-${parseInt(Math.random()*(1<<30),10)}/`; + const drops = []; + const files = []; + FS.mkdir(DROP.slice(0, -1)); + GodotInputDragDrop.pending_files.forEach(elem => { + const path = elem["path"]; + GodotFS.copy_to_fs(DROP + path, elem["data"]); + let idx = path.indexOf("/"); + if (idx === -1) { + drops.push(DROP + path) + } else { + const sub = path.substr(0, idx); + idx = sub.indexOf("/"); + if (idx < 0 && drops.indexOf(DROP + sub) === -1) { + drops.push(DROP + sub) + } + } + files.push(DROP + path) + }); + GodotInputDragDrop.promises = []; + GodotInputDragDrop.pending_files = []; + callback(drops); + if (GodotConfig.persistent_drops) { + GodotOS.atexit(function(resolve, reject) { + GodotInputDragDrop.remove_drop(files, DROP); + resolve() + }) + } else { + GodotInputDragDrop.remove_drop(files, DROP) + } + }) + }, + remove_drop: function(files, drop_path) { + const dirs = [drop_path.substr(0, drop_path.length - 1)]; + files.forEach(function(file) { + FS.unlink(file); + let dir = file.replace(drop_path, ""); + let idx = dir.lastIndexOf("/"); + while (idx > 0) { + dir = dir.substr(0, idx); + if (dirs.indexOf(drop_path + dir) === -1) { + dirs.push(drop_path + dir) + } + idx = dir.lastIndexOf("/") + } + }); + dirs.sort(function(a, b) { + const al = (a.match(/\//g) || []).length; + const bl = (b.match(/\//g) || []).length; + if (al > bl) { + return -1 + } else if (al < bl) { + return 1 + } + return 0 + }).forEach(function(dir) { + FS.rmdir(dir) + }) + }, + handler: function(callback) { + return function(ev) { + GodotInputDragDrop._process_event(ev, callback) + } + } + }; + var GodotInput = { + getModifiers: function(evt) { + return evt.shiftKey + 0 + (evt.altKey + 0 << 1) + (evt.ctrlKey + 0 << 2) + (evt.metaKey + 0 << 3) + }, + computePosition: function(evt, rect) { + const canvas = GodotConfig.canvas; + const rw = canvas.width / rect.width; + const rh = canvas.height / rect.height; + const x = (evt.clientX - rect.x) * rw; + const y = (evt.clientY - rect.y) * rh; + return [x, y] + } + }; + + function _godot_js_input_drop_files_cb(callback) { + const func = GodotRuntime.get_func(callback); + const dropFiles = function(files) { + const args = files || []; + if (!args.length) { + return + } + const argc = args.length; + const argv = GodotRuntime.allocStringArray(args); + func(argv, argc); + GodotRuntime.freeStringArray(argv, argc) + }; + const canvas = GodotConfig.canvas; + GodotEventListeners.add(canvas, "dragover", function(ev) { + ev.preventDefault() + }, false); + GodotEventListeners.add(canvas, "drop", GodotInputDragDrop.handler(dropFiles)) + } + + function _godot_js_input_gamepad_cb(change_cb) { + const onchange = GodotRuntime.get_func(change_cb); + GodotInputGamepads.init(onchange) + } + + function _godot_js_input_gamepad_sample() { + GodotInputGamepads.sample(); + return 0 + } + + function _godot_js_input_gamepad_sample_count() { + return GodotInputGamepads.get_samples().length + } + + function _godot_js_input_gamepad_sample_get(p_index, r_btns, r_btns_num, r_axes, r_axes_num, r_standard) { + const sample = GodotInputGamepads.get_sample(p_index); + if (!sample || !sample.connected) { + return 1 + } + const btns = sample.buttons; + const btns_len = btns.length < 16 ? btns.length : 16; + for (let i = 0; i < btns_len; i++) { + GodotRuntime.setHeapValue(r_btns + (i << 2), btns[i], "float") + } + GodotRuntime.setHeapValue(r_btns_num, btns_len, "i32"); + const axes = sample.axes; + const axes_len = axes.length < 10 ? axes.length : 10; + for (let i = 0; i < axes_len; i++) { + GodotRuntime.setHeapValue(r_axes + (i << 2), axes[i], "float") + } + GodotRuntime.setHeapValue(r_axes_num, axes_len, "i32"); + const is_standard = sample.standard ? 1 : 0; + GodotRuntime.setHeapValue(r_standard, is_standard, "i32"); + return 0 + } + + function _godot_js_input_key_cb(callback, code, key) { + const func = GodotRuntime.get_func(callback); + + function key_cb(pressed, evt) { + const modifiers = GodotInput.getModifiers(evt); + GodotRuntime.stringToHeap(evt.code, code, 32); + GodotRuntime.stringToHeap(evt.key, key, 32); + func(pressed, evt.repeat, modifiers); + evt.preventDefault() + } + GodotEventListeners.add(GodotConfig.canvas, "keydown", key_cb.bind(null, 1), false); + GodotEventListeners.add(GodotConfig.canvas, "keyup", key_cb.bind(null, 0), false) + } + + function _godot_js_input_mouse_button_cb(callback) { + const func = GodotRuntime.get_func(callback); + const canvas = GodotConfig.canvas; + + function button_cb(p_pressed, evt) { + const rect = canvas.getBoundingClientRect(); + const pos = GodotInput.computePosition(evt, rect); + const modifiers = GodotInput.getModifiers(evt); + if (p_pressed) { + GodotConfig.canvas.focus() + } + if (func(p_pressed, evt.button, pos[0], pos[1], modifiers)) { + evt.preventDefault() + } + } + GodotEventListeners.add(canvas, "mousedown", button_cb.bind(null, 1), false); + GodotEventListeners.add(window, "mouseup", button_cb.bind(null, 0), false) + } + + function _godot_js_input_mouse_move_cb(callback) { + const func = GodotRuntime.get_func(callback); + const canvas = GodotConfig.canvas; + + function move_cb(evt) { + const rect = canvas.getBoundingClientRect(); + const pos = GodotInput.computePosition(evt, rect); + const rw = canvas.width / rect.width; + const rh = canvas.height / rect.height; + const rel_pos_x = evt.movementX * rw; + const rel_pos_y = evt.movementY * rh; + const modifiers = GodotInput.getModifiers(evt); + func(pos[0], pos[1], rel_pos_x, rel_pos_y, modifiers) + } + GodotEventListeners.add(window, "mousemove", move_cb, false) + } + + function _godot_js_input_mouse_wheel_cb(callback) { + const func = GodotRuntime.get_func(callback); + + function wheel_cb(evt) { + if (func(evt["deltaX"] || 0, evt["deltaY"] || 0)) { + evt.preventDefault() + } + } + GodotEventListeners.add(GodotConfig.canvas, "wheel", wheel_cb, false) + } + + function _godot_js_input_paste_cb(callback) { + const func = GodotRuntime.get_func(callback); + GodotEventListeners.add(window, "paste", function(evt) { + const text = evt.clipboardData.getData("text"); + const ptr = GodotRuntime.allocString(text); + func(ptr); + GodotRuntime.free(ptr) + }, false) + } + + function _godot_js_input_touch_cb(callback, ids, coords) { + const func = GodotRuntime.get_func(callback); + const canvas = GodotConfig.canvas; + + function touch_cb(type, evt) { + if (type === 0) { + GodotConfig.canvas.focus() + } + const rect = canvas.getBoundingClientRect(); + const touches = evt.changedTouches; + for (let i = 0; i < touches.length; i++) { + const touch = touches[i]; + const pos = GodotInput.computePosition(touch, rect); + GodotRuntime.setHeapValue(coords + i * 2 * 8, pos[0], "double"); + GodotRuntime.setHeapValue(coords + (i * 2 + 1) * 8, pos[1], "double"); + GodotRuntime.setHeapValue(ids + i * 4, touch.identifier, "i32") + } + func(type, touches.length); + if (evt.cancelable) { + evt.preventDefault() + } + } + GodotEventListeners.add(canvas, "touchstart", touch_cb.bind(null, 0), false); + GodotEventListeners.add(canvas, "touchend", touch_cb.bind(null, 1), false); + GodotEventListeners.add(canvas, "touchcancel", touch_cb.bind(null, 1), false); + GodotEventListeners.add(canvas, "touchmove", touch_cb.bind(null, 2), false) + } + + function _godot_js_input_vibrate_handheld(p_duration_ms) { + if (typeof navigator.vibrate !== "function") { + GodotRuntime.print("This browser does not support vibration.") + } else { + navigator.vibrate(p_duration_ms) + } + } + + function _godot_js_os_download_buffer(p_ptr, p_size, p_name, p_mime) { + const buf = GodotRuntime.heapSlice(HEAP8, p_ptr, p_size); + const name = GodotRuntime.parseString(p_name); + const mime = GodotRuntime.parseString(p_mime); + const blob = new Blob([buf], { + type: mime + }); + const url = window.URL.createObjectURL(blob); + const a = document.createElement("a"); + a.href = url; + a.download = name; + a.style.display = "none"; + document.body.appendChild(a); + a.click(); + a.remove(); + window.URL.revokeObjectURL(url) + } + + function _godot_js_os_execute(p_json) { + const json_args = GodotRuntime.parseString(p_json); + const args = JSON.parse(json_args); + if (GodotConfig.on_execute) { + GodotConfig.on_execute(args); + return 0 + } + return 1 + } + + function _godot_js_os_finish_async(p_callback) { + const func = GodotRuntime.get_func(p_callback); + GodotOS.finish_async(func) + } + + function _godot_js_os_fs_is_persistent() { + return GodotFS.is_persistent() + } + + function _godot_js_os_fs_sync(callback) { + const func = GodotRuntime.get_func(callback); + GodotOS._fs_sync_promise = GodotFS.sync(); + GodotOS._fs_sync_promise.then(function(err) { + func() + }) + } + + function _godot_js_os_hw_concurrency_get() { + return navigator.hardwareConcurrency || 1 + } + + function _godot_js_os_request_quit_cb(p_callback) { + GodotOS.request_quit = GodotRuntime.get_func(p_callback) + } + + function _godot_js_os_shell_open(p_uri) { + window.open(GodotRuntime.parseString(p_uri), "_blank") + } + var GodotPWA = { + hasUpdate: false, + updateState: function(cb, reg) { + if (!reg) { + return + } + if (!reg.active) { + return + } + if (reg.waiting) { + GodotPWA.hasUpdate = true; + cb() + } + GodotEventListeners.add(reg, "updatefound", function() { + const installing = reg.installing; + GodotEventListeners.add(installing, "statechange", function() { + if (installing.state === "installed") { + GodotPWA.hasUpdate = true; + cb() + } + }) + }) + } + }; + + function _godot_js_pwa_cb(p_update_cb) { + if ("serviceWorker" in navigator) { + const cb = GodotRuntime.get_func(p_update_cb); + navigator.serviceWorker.getRegistration().then(GodotPWA.updateState.bind(null, cb)) + } + } + + function _godot_js_pwa_update() { + if ("serviceWorker" in navigator && GodotPWA.hasUpdate) { + navigator.serviceWorker.getRegistration().then(function(reg) { + if (!reg || !reg.waiting) { + return + } + reg.waiting.postMessage("update") + }); + return 0 + } + return 1 + } + var GodotRTCDataChannel = { + connect: function(p_id, p_on_open, p_on_message, p_on_error, p_on_close) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + ref.binaryType = "arraybuffer"; + ref.onopen = function(event) { + p_on_open() + }; + ref.onclose = function(event) { + p_on_close() + }; + ref.onerror = function(event) { + p_on_error() + }; + ref.onmessage = function(event) { + let buffer; + let is_string = 0; + if (event.data instanceof ArrayBuffer) { + buffer = new Uint8Array(event.data) + } else if (event.data instanceof Blob) { + GodotRuntime.error("Blob type not supported"); + return + } else if (typeof event.data === "string") { + is_string = 1; + const enc = new TextEncoder("utf-8"); + buffer = new Uint8Array(enc.encode(event.data)) + } else { + GodotRuntime.error("Unknown message type"); + return + } + const len = buffer.length * buffer.BYTES_PER_ELEMENT; + const out = GodotRuntime.malloc(len); + HEAPU8.set(buffer, out); + p_on_message(out, len, is_string); + GodotRuntime.free(out) + } + }, + close: function(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + ref.onopen = null; + ref.onmessage = null; + ref.onerror = null; + ref.onclose = null; + ref.close() + }, + get_prop: function(p_id, p_prop, p_def) { + const ref = IDHandler.get(p_id); + return ref && ref[p_prop] !== undefined ? ref[p_prop] : p_def + } + }; + + function _godot_js_rtc_datachannel_close(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + GodotRTCDataChannel.close(p_id) + } + + function _godot_js_rtc_datachannel_connect(p_id, p_ref, p_on_open, p_on_message, p_on_error, p_on_close) { + const onopen = GodotRuntime.get_func(p_on_open).bind(null, p_ref); + const onmessage = GodotRuntime.get_func(p_on_message).bind(null, p_ref); + const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_ref); + const onclose = GodotRuntime.get_func(p_on_close).bind(null, p_ref); + GodotRTCDataChannel.connect(p_id, onopen, onmessage, onerror, onclose) + } + + function _godot_js_rtc_datachannel_destroy(p_id) { + GodotRTCDataChannel.close(p_id); + IDHandler.remove(p_id) + } + + function _godot_js_rtc_datachannel_get_buffered_amount(p_id) { + return GodotRTCDataChannel.get_prop(p_id, "bufferedAmount", 0) + } + + function _godot_js_rtc_datachannel_id_get(p_id) { + return GodotRTCDataChannel.get_prop(p_id, "id", 65535) + } + + function _godot_js_rtc_datachannel_is_negotiated(p_id) { + return GodotRTCDataChannel.get_prop(p_id, "negotiated", 65535) + } + + function _godot_js_rtc_datachannel_is_ordered(p_id) { + return GodotRTCDataChannel.get_prop(p_id, "ordered", true) + } + + function _godot_js_rtc_datachannel_label_get(p_id) { + const ref = IDHandler.get(p_id); + if (!ref || !ref.label) { + return 0 + } + return GodotRuntime.allocString(ref.label) + } + + function _godot_js_rtc_datachannel_max_packet_lifetime_get(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return 65535 + } + if (ref["maxPacketLifeTime"] !== undefined) { + return ref["maxPacketLifeTime"] + } else if (ref["maxRetransmitTime"] !== undefined) { + return ref["maxRetransmitTime"] + } + return 65535 + } + + function _godot_js_rtc_datachannel_max_retransmits_get(p_id) { + return GodotRTCDataChannel.get_prop(p_id, "maxRetransmits", 65535) + } + + function _godot_js_rtc_datachannel_protocol_get(p_id) { + const ref = IDHandler.get(p_id); + if (!ref || !ref.protocol) { + return 0 + } + return GodotRuntime.allocString(ref.protocol) + } + + function _godot_js_rtc_datachannel_ready_state_get(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return 3 + } + switch (ref.readyState) { + case "connecting": + return 0; + case "open": + return 1; + case "closing": + return 2; + case "closed": + default: + return 3 + } + } + + function _godot_js_rtc_datachannel_send(p_id, p_buffer, p_length, p_raw) { + const ref = IDHandler.get(p_id); + if (!ref) { + return 1 + } + const bytes_array = new Uint8Array(p_length); + for (let i = 0; i < p_length; i++) { + bytes_array[i] = GodotRuntime.getHeapValue(p_buffer + i, "i8") + } + if (p_raw) { + ref.send(bytes_array.buffer) + } else { + const string = new TextDecoder("utf-8").decode(bytes_array); + ref.send(string) + } + return 0 + } + var GodotRTCPeerConnection = { + onstatechange: function(p_id, p_conn, callback, event) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + let state; + switch (p_conn.iceConnectionState) { + case "new": + state = 0; + break; + case "checking": + state = 1; + break; + case "connected": + case "completed": + state = 2; + break; + case "disconnected": + state = 3; + break; + case "failed": + state = 4; + break; + case "closed": + default: + state = 5; + break + } + callback(state) + }, + onicecandidate: function(p_id, callback, event) { + const ref = IDHandler.get(p_id); + if (!ref || !event.candidate) { + return + } + const c = event.candidate; + const candidate_str = GodotRuntime.allocString(c.candidate); + const mid_str = GodotRuntime.allocString(c.sdpMid); + callback(mid_str, c.sdpMLineIndex, candidate_str); + GodotRuntime.free(candidate_str); + GodotRuntime.free(mid_str) + }, + ondatachannel: function(p_id, callback, event) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + const cid = IDHandler.add(event.channel); + callback(cid) + }, + onsession: function(p_id, callback, session) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + const type_str = GodotRuntime.allocString(session.type); + const sdp_str = GodotRuntime.allocString(session.sdp); + callback(type_str, sdp_str); + GodotRuntime.free(type_str); + GodotRuntime.free(sdp_str) + }, + onerror: function(p_id, callback, error) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + GodotRuntime.error(error); + callback() + } + }; + + function _godot_js_rtc_pc_close(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + ref.close() + } + + function _godot_js_rtc_pc_create(p_config, p_ref, p_on_state_change, p_on_candidate, p_on_datachannel) { + const onstatechange = GodotRuntime.get_func(p_on_state_change).bind(null, p_ref); + const oncandidate = GodotRuntime.get_func(p_on_candidate).bind(null, p_ref); + const ondatachannel = GodotRuntime.get_func(p_on_datachannel).bind(null, p_ref); + const config = JSON.parse(GodotRuntime.parseString(p_config)); + let conn = null; + try { + conn = new RTCPeerConnection(config) + } catch (e) { + GodotRuntime.error(e); + return 0 + } + const base = GodotRTCPeerConnection; + const id = IDHandler.add(conn); + conn.oniceconnectionstatechange = base.onstatechange.bind(null, id, conn, onstatechange); + conn.onicecandidate = base.onicecandidate.bind(null, id, oncandidate); + conn.ondatachannel = base.ondatachannel.bind(null, id, ondatachannel); + return id + } + + function _godot_js_rtc_pc_datachannel_create(p_id, p_label, p_config) { + try { + const ref = IDHandler.get(p_id); + if (!ref) { + return 0 + } + const label = GodotRuntime.parseString(p_label); + const config = JSON.parse(GodotRuntime.parseString(p_config)); + const channel = ref.createDataChannel(label, config); + return IDHandler.add(channel) + } catch (e) { + GodotRuntime.error(e); + return 0 + } + } + + function _godot_js_rtc_pc_destroy(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + ref.oniceconnectionstatechange = null; + ref.onicecandidate = null; + ref.ondatachannel = null; + IDHandler.remove(p_id) + } + + function _godot_js_rtc_pc_ice_candidate_add(p_id, p_mid_name, p_mline_idx, p_sdp) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + const sdpMidName = GodotRuntime.parseString(p_mid_name); + const sdpName = GodotRuntime.parseString(p_sdp); + ref.addIceCandidate(new RTCIceCandidate({ + "candidate": sdpName, + "sdpMid": sdpMidName, + "sdpMlineIndex": p_mline_idx + })) + } + + function _godot_js_rtc_pc_local_description_set(p_id, p_type, p_sdp, p_obj, p_on_error) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + const type = GodotRuntime.parseString(p_type); + const sdp = GodotRuntime.parseString(p_sdp); + const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_obj); + ref.setLocalDescription({ + "sdp": sdp, + "type": type + }).catch(function(error) { + GodotRTCPeerConnection.onerror(p_id, onerror, error) + }) + } + + function _godot_js_rtc_pc_offer_create(p_id, p_obj, p_on_session, p_on_error) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + const onsession = GodotRuntime.get_func(p_on_session).bind(null, p_obj); + const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_obj); + ref.createOffer().then(function(session) { + GodotRTCPeerConnection.onsession(p_id, onsession, session) + }).catch(function(error) { + GodotRTCPeerConnection.onerror(p_id, onerror, error) + }) + } + + function _godot_js_rtc_pc_remote_description_set(p_id, p_type, p_sdp, p_obj, p_session_created, p_on_error) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + const type = GodotRuntime.parseString(p_type); + const sdp = GodotRuntime.parseString(p_sdp); + const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_obj); + const onsession = GodotRuntime.get_func(p_session_created).bind(null, p_obj); + ref.setRemoteDescription({ + "sdp": sdp, + "type": type + }).then(function() { + if (type !== "offer") { + return Promise.resolve() + } + return ref.createAnswer().then(function(session) { + GodotRTCPeerConnection.onsession(p_id, onsession, session) + }) + }).catch(function(error) { + GodotRTCPeerConnection.onerror(p_id, onerror, error) + }) + } + var GodotWebSocket = { + _onopen: function(p_id, callback, event) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + const c_str = GodotRuntime.allocString(ref.protocol); + callback(c_str); + GodotRuntime.free(c_str) + }, + _onmessage: function(p_id, callback, event) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + let buffer; + let is_string = 0; + if (event.data instanceof ArrayBuffer) { + buffer = new Uint8Array(event.data) + } else if (event.data instanceof Blob) { + GodotRuntime.error("Blob type not supported"); + return + } else if (typeof event.data === "string") { + is_string = 1; + const enc = new TextEncoder("utf-8"); + buffer = new Uint8Array(enc.encode(event.data)) + } else { + GodotRuntime.error("Unknown message type"); + return + } + const len = buffer.length * buffer.BYTES_PER_ELEMENT; + const out = GodotRuntime.malloc(len); + HEAPU8.set(buffer, out); + callback(out, len, is_string); + GodotRuntime.free(out) + }, + _onerror: function(p_id, callback, event) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + callback() + }, + _onclose: function(p_id, callback, event) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + const c_str = GodotRuntime.allocString(event.reason); + callback(event.code, c_str, event.wasClean ? 1 : 0); + GodotRuntime.free(c_str) + }, + send: function(p_id, p_data) { + const ref = IDHandler.get(p_id); + if (!ref || ref.readyState !== ref.OPEN) { + return 1 + } + ref.send(p_data); + return 0 + }, + bufferedAmount: function(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return 0 + } + return ref.bufferedAmount + }, + create: function(socket, p_on_open, p_on_message, p_on_error, p_on_close) { + const id = IDHandler.add(socket); + socket.onopen = GodotWebSocket._onopen.bind(null, id, p_on_open); + socket.onmessage = GodotWebSocket._onmessage.bind(null, id, p_on_message); + socket.onerror = GodotWebSocket._onerror.bind(null, id, p_on_error); + socket.onclose = GodotWebSocket._onclose.bind(null, id, p_on_close); + return id + }, + close: function(p_id, p_code, p_reason) { + const ref = IDHandler.get(p_id); + if (ref && ref.readyState < ref.CLOSING) { + const code = p_code; + const reason = GodotRuntime.parseString(p_reason); + ref.close(code, reason) + } + }, + destroy: function(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return + } + GodotWebSocket.close(p_id, 3001, "destroyed"); + IDHandler.remove(p_id); + ref.onopen = null; + ref.onmessage = null; + ref.onerror = null; + ref.onclose = null + } + }; + + function _godot_js_websocket_buffered_amount(p_id) { + return GodotWebSocket.bufferedAmount(p_id) + } + + function _godot_js_websocket_close(p_id, p_code, p_reason) { + const code = p_code; + const reason = GodotRuntime.parseString(p_reason); + GodotWebSocket.close(p_id, code, reason) + } + + function _godot_js_websocket_create(p_ref, p_url, p_proto, p_on_open, p_on_message, p_on_error, p_on_close) { + const on_open = GodotRuntime.get_func(p_on_open).bind(null, p_ref); + const on_message = GodotRuntime.get_func(p_on_message).bind(null, p_ref); + const on_error = GodotRuntime.get_func(p_on_error).bind(null, p_ref); + const on_close = GodotRuntime.get_func(p_on_close).bind(null, p_ref); + const url = GodotRuntime.parseString(p_url); + const protos = GodotRuntime.parseString(p_proto); + let socket = null; + try { + if (protos) { + socket = new WebSocket(url, protos.split(",")) + } else { + socket = new WebSocket(url) + } + } catch (e) { + return 0 + } + socket.binaryType = "arraybuffer"; + return GodotWebSocket.create(socket, on_open, on_message, on_error, on_close) + } + + function _godot_js_websocket_destroy(p_id) { + GodotWebSocket.destroy(p_id) + } + + function _godot_js_websocket_send(p_id, p_buf, p_buf_len, p_raw) { + const bytes_array = new Uint8Array(p_buf_len); + let i = 0; + for (i = 0; i < p_buf_len; i++) { + bytes_array[i] = GodotRuntime.getHeapValue(p_buf + i, "i8") + } + let out = bytes_array.buffer; + if (!p_raw) { + out = new TextDecoder("utf-8").decode(bytes_array) + } + return GodotWebSocket.send(p_id, out) + } + var GodotJSWrapper = { + proxies: null, + MyProxy: function(val) { + const id = IDHandler.add(this); + GodotJSWrapper.proxies.set(val, id); + let refs = 1; + this.ref = function() { + refs++ + }; + this.unref = function() { + refs--; + if (refs === 0) { + IDHandler.remove(id); + GodotJSWrapper.proxies.delete(val) + } + }; + this.get_val = function() { + return val + }; + this.get_id = function() { + return id + } + }, + get_proxied: function(val) { + const id = GodotJSWrapper.proxies.get(val); + if (id === undefined) { + const proxy = new GodotJSWrapper.MyProxy(val); + return proxy.get_id() + } + IDHandler.get(id).ref(); + return id + }, + get_proxied_value: function(id) { + const proxy = IDHandler.get(id); + if (proxy === undefined) { + return undefined + } + return proxy.get_val() + }, + variant2js: function(type, val) { + switch (type) { + case 0: + return null; + case 1: + return !!GodotRuntime.getHeapValue(val, "i64"); + case 2: + return GodotRuntime.getHeapValue(val, "i64"); + case 3: + return GodotRuntime.getHeapValue(val, "double"); + case 4: + return GodotRuntime.parseString(GodotRuntime.getHeapValue(val, "*")); + case 17: + return GodotJSWrapper.get_proxied_value(GodotRuntime.getHeapValue(val, "i64")); + default: + return undefined + } + }, + js2variant: function(p_val, p_exchange) { + if (p_val === undefined || p_val === null) { + return 0 + } + const type = typeof p_val; + if (type === "boolean") { + GodotRuntime.setHeapValue(p_exchange, p_val, "i64"); + return 1 + } else if (type === "number") { + if (Number.isInteger(p_val)) { + GodotRuntime.setHeapValue(p_exchange, p_val, "i64"); + return 2 + } + GodotRuntime.setHeapValue(p_exchange, p_val, "double"); + return 3 + } else if (type === "string") { + const c_str = GodotRuntime.allocString(p_val); + GodotRuntime.setHeapValue(p_exchange, c_str, "*"); + return 4 + } + const id = GodotJSWrapper.get_proxied(p_val); + GodotRuntime.setHeapValue(p_exchange, id, "i64"); + return 17 + } + }; + + function _godot_js_wrapper_create_cb(p_ref, p_func) { + const func = GodotRuntime.get_func(p_func); + let id = 0; + const cb = function() { + if (!GodotJSWrapper.get_proxied_value(id)) { + return + } + const args = Array.from(arguments); + func(p_ref, GodotJSWrapper.get_proxied(args), args.length) + }; + id = GodotJSWrapper.get_proxied(cb); + return id + } + + function _godot_js_wrapper_create_object(p_object, p_args, p_argc, p_convert_callback, p_exchange, p_lock, p_free_lock_callback) { + const name = GodotRuntime.parseString(p_object); + if (typeof window[name] === "undefined") { + return -1 + } + const convert = GodotRuntime.get_func(p_convert_callback); + const freeLock = GodotRuntime.get_func(p_free_lock_callback); + const args = new Array(p_argc); + for (let i = 0; i < p_argc; i++) { + const type = convert(p_args, i, p_exchange, p_lock); + const lock = GodotRuntime.getHeapValue(p_lock, "*"); + args[i] = GodotJSWrapper.variant2js(type, p_exchange); + if (lock) { + freeLock(p_lock, type) + } + } + try { + const res = new window[name](...args); + return GodotJSWrapper.js2variant(res, p_exchange) + } catch (e) { + GodotRuntime.error(`Error calling constructor ${name} with args:`, args, "error:", e); + return -1 + } + } + + function _godot_js_wrapper_interface_get(p_name) { + const name = GodotRuntime.parseString(p_name); + if (typeof window[name] !== "undefined") { + return GodotJSWrapper.get_proxied(window[name]) + } + return 0 + } + + function _godot_js_wrapper_object_call(p_id, p_method, p_args, p_argc, p_convert_callback, p_exchange, p_lock, p_free_lock_callback) { + const obj = GodotJSWrapper.get_proxied_value(p_id); + if (obj === undefined) { + return -1 + } + const method = GodotRuntime.parseString(p_method); + const convert = GodotRuntime.get_func(p_convert_callback); + const freeLock = GodotRuntime.get_func(p_free_lock_callback); + const args = new Array(p_argc); + for (let i = 0; i < p_argc; i++) { + const type = convert(p_args, i, p_exchange, p_lock); + const lock = GodotRuntime.getHeapValue(p_lock, "*"); + args[i] = GodotJSWrapper.variant2js(type, p_exchange); + if (lock) { + freeLock(p_lock, type) + } + } + try { + const res = obj[method](...args); + return GodotJSWrapper.js2variant(res, p_exchange) + } catch (e) { + GodotRuntime.error(`Error calling method ${method} on:`, obj, "error:", e); + return -1 + } + } + + function _godot_js_wrapper_object_get(p_id, p_exchange, p_prop) { + const obj = GodotJSWrapper.get_proxied_value(p_id); + if (obj === undefined) { + return 0 + } + if (p_prop) { + const prop = GodotRuntime.parseString(p_prop); + try { + return GodotJSWrapper.js2variant(obj[prop], p_exchange) + } catch (e) { + GodotRuntime.error(`Error getting variable ${prop} on object`, obj); + return 0 + } + } + return GodotJSWrapper.js2variant(obj, p_exchange) + } + + function _godot_js_wrapper_object_getvar(p_id, p_type, p_exchange) { + const obj = GodotJSWrapper.get_proxied_value(p_id); + if (obj === undefined) { + return -1 + } + const prop = GodotJSWrapper.variant2js(p_type, p_exchange); + if (prop === undefined || prop === null) { + return -1 + } + try { + return GodotJSWrapper.js2variant(obj[prop], p_exchange) + } catch (e) { + GodotRuntime.error(`Error getting variable ${prop} on object`, obj, e); + return -1 + } + } + + function _godot_js_wrapper_object_set(p_id, p_name, p_type, p_exchange) { + const obj = GodotJSWrapper.get_proxied_value(p_id); + if (obj === undefined) { + return + } + const name = GodotRuntime.parseString(p_name); + try { + obj[name] = GodotJSWrapper.variant2js(p_type, p_exchange) + } catch (e) { + GodotRuntime.error(`Error setting variable ${name} on object`, obj) + } + } + + function _godot_js_wrapper_object_setvar(p_id, p_key_type, p_key_ex, p_val_type, p_val_ex) { + const obj = GodotJSWrapper.get_proxied_value(p_id); + if (obj === undefined) { + return -1 + } + const key = GodotJSWrapper.variant2js(p_key_type, p_key_ex); + try { + obj[key] = GodotJSWrapper.variant2js(p_val_type, p_val_ex); + return 0 + } catch (e) { + GodotRuntime.error(`Error setting variable ${key} on object`, obj); + return -1 + } + } + + function _godot_js_wrapper_object_unref(p_id) { + const proxy = IDHandler.get(p_id); + if (proxy !== undefined) { + proxy.unref() + } + } + var GodotWebXR = { + gl: null, + session: null, + space: null, + frame: null, + pose: null, + orig_requestAnimationFrame: null, + requestAnimationFrame: callback => { + if (GodotWebXR.session && GodotWebXR.space) { + const onFrame = function(time, frame) { + GodotWebXR.frame = frame; + GodotWebXR.pose = frame.getViewerPose(GodotWebXR.space); + callback(time); + GodotWebXR.frame = null; + GodotWebXR.pose = null + }; + GodotWebXR.session.requestAnimationFrame(onFrame) + } else { + GodotWebXR.orig_requestAnimationFrame(callback) + } + }, + monkeyPatchRequestAnimationFrame: enable => { + if (GodotWebXR.orig_requestAnimationFrame === null) { + GodotWebXR.orig_requestAnimationFrame = Browser.requestAnimationFrame + } + Browser.requestAnimationFrame = enable ? GodotWebXR.requestAnimationFrame : GodotWebXR.orig_requestAnimationFrame + }, + pauseResumeMainLoop: () => { + Browser.mainLoop.pause(); + window.setTimeout(function() { + Browser.mainLoop.resume() + }, 0) + }, + shaderProgram: null, + programInfo: null, + buffer: null, + vsSource: "\n\t\t\tconst vec2 scale = vec2(0.5, 0.5);\n\t\t\tattribute vec4 aVertexPosition;\n\n\t\t\tvarying highp vec2 vTextureCoord;\n\n\t\t\tvoid main () {\n\t\t\t\tgl_Position = aVertexPosition;\n\t\t\t\tvTextureCoord = aVertexPosition.xy * scale + scale;\n\t\t\t}\n\t\t", + fsSource: "\n\t\t\tvarying highp vec2 vTextureCoord;\n\n\t\t\tuniform sampler2D uSampler;\n\n\t\t\tvoid main() {\n\t\t\t\tgl_FragColor = texture2D(uSampler, vTextureCoord);\n\t\t\t}\n\t\t", + initShaderProgram: (gl, vsSource, fsSource) => { + const vertexShader = GodotWebXR.loadShader(gl, gl.VERTEX_SHADER, vsSource); + const fragmentShader = GodotWebXR.loadShader(gl, gl.FRAGMENT_SHADER, fsSource); + const shaderProgram = gl.createProgram(); + gl.attachShader(shaderProgram, vertexShader); + gl.attachShader(shaderProgram, fragmentShader); + gl.linkProgram(shaderProgram); + if (!gl.getProgramParameter(shaderProgram, gl.LINK_STATUS)) { + GodotRuntime.error(`Unable to initialize the shader program: ${gl.getProgramInfoLog(shaderProgram)}`); + return null + } + return shaderProgram + }, + loadShader: (gl, type, source) => { + const shader = gl.createShader(type); + gl.shaderSource(shader, source); + gl.compileShader(shader); + if (!gl.getShaderParameter(shader, gl.COMPILE_STATUS)) { + GodotRuntime.error(`An error occurred compiling the shader: ${gl.getShaderInfoLog(shader)}`); + gl.deleteShader(shader); + return null + } + return shader + }, + initBuffer: gl => { + const positionBuffer = gl.createBuffer(); + gl.bindBuffer(gl.ARRAY_BUFFER, positionBuffer); + const positions = [-1, -1, 1, -1, -1, 1, 1, 1]; + gl.bufferData(gl.ARRAY_BUFFER, new Float32Array(positions), gl.STATIC_DRAW); + return positionBuffer + }, + blitTexture: (gl, texture) => { + if (GodotWebXR.shaderProgram === null) { + GodotWebXR.shaderProgram = GodotWebXR.initShaderProgram(gl, GodotWebXR.vsSource, GodotWebXR.fsSource); + GodotWebXR.programInfo = { + program: GodotWebXR.shaderProgram, + attribLocations: { + vertexPosition: gl.getAttribLocation(GodotWebXR.shaderProgram, "aVertexPosition") + }, + uniformLocations: { + uSampler: gl.getUniformLocation(GodotWebXR.shaderProgram, "uSampler") + } + }; + GodotWebXR.buffer = GodotWebXR.initBuffer(gl) + } + const orig_program = gl.getParameter(gl.CURRENT_PROGRAM); + gl.useProgram(GodotWebXR.shaderProgram); + gl.bindBuffer(gl.ARRAY_BUFFER, GodotWebXR.buffer); + gl.vertexAttribPointer(GodotWebXR.programInfo.attribLocations.vertexPosition, 2, gl.FLOAT, false, 0, 0); + gl.enableVertexAttribArray(GodotWebXR.programInfo.attribLocations.vertexPosition); + gl.activeTexture(gl.TEXTURE0); + gl.bindTexture(gl.TEXTURE_2D, texture); + gl.uniform1i(GodotWebXR.programInfo.uniformLocations.uSampler, 0); + gl.drawArrays(gl.TRIANGLE_STRIP, 0, 4); + gl.bindTexture(gl.TEXTURE_2D, null); + gl.disableVertexAttribArray(GodotWebXR.programInfo.attribLocations.vertexPosition); + gl.bindBuffer(gl.ARRAY_BUFFER, null); + gl.useProgram(orig_program) + }, + controllers: [], + sampleControllers: () => { + if (!GodotWebXR.session) { + return + } + let other_index = 2; + const controllers = []; + GodotWebXR.session.inputSources.forEach(input_source => { + if (input_source.targetRayMode === "tracked-pointer") { + if (input_source.handedness === "right") { + controllers[1] = input_source + } else if (input_source.handedness === "left" || !controllers[0]) { + controllers[0] = input_source + } + } else { + controllers[other_index++] = input_source + } + }); + GodotWebXR.controllers = controllers + }, + getControllerId: input_source => GodotWebXR.controllers.indexOf(input_source) + }; + + function _godot_webxr_commit_for_eye(p_eye, p_texture_id) { + if (!GodotWebXR.session || !GodotWebXR.pose) { + return + } + const view_index = p_eye === 2 ? 1 : 0; + const glLayer = GodotWebXR.session.renderState.baseLayer; + const view = GodotWebXR.pose.views[view_index]; + const viewport = glLayer.getViewport(view); + const gl = GodotWebXR.gl; + const orig_framebuffer = gl.getParameter(gl.FRAMEBUFFER_BINDING); + const orig_viewport = gl.getParameter(gl.VIEWPORT); + gl.bindFramebuffer(gl.FRAMEBUFFER, glLayer.framebuffer); + gl.viewport(viewport.x, viewport.y, viewport.width, viewport.height); + GodotWebXR.blitTexture(gl, GL.textures[p_texture_id]); + gl.bindFramebuffer(gl.FRAMEBUFFER, orig_framebuffer); + gl.viewport(orig_viewport[0], orig_viewport[1], orig_viewport[2], orig_viewport[3]) + } + + function _godot_webxr_get_bounds_geometry() { + if (!GodotWebXR.space || !GodotWebXR.space.boundsGeometry) { + return 0 + } + const point_count = GodotWebXR.space.boundsGeometry.length; + if (point_count === 0) { + return 0 + } + const buf = GodotRuntime.malloc((point_count * 3 + 1) * 4); + GodotRuntime.setHeapValue(buf, point_count, "i32"); + for (let i = 0; i < point_count; i++) { + const point = GodotWebXR.space.boundsGeometry[i]; + GodotRuntime.setHeapValue(buf + (i * 3 + 1) * 4, point.x, "float"); + GodotRuntime.setHeapValue(buf + (i * 3 + 2) * 4, point.y, "float"); + GodotRuntime.setHeapValue(buf + (i * 3 + 3) * 4, point.z, "float") + } + return buf + } + + function _godot_webxr_get_controller_axes(p_controller, p_xr_standard_mapping) { + if (GodotWebXR.controllers.length === 0) { + return 0 + } + const controller = GodotWebXR.controllers[p_controller]; + if (!controller || !controller.gamepad) { + return 0 + } + let axes = controller.gamepad.axes; + if (controller.gamepad.mapping === "xr-standard") { + if (p_xr_standard_mapping) { + const trigger_axis = controller.gamepad.buttons[0].value; + const grip_axis = controller.gamepad.buttons[1].value; + axes = [axes[2], axes[3] * -1, trigger_axis, grip_axis, grip_axis, 0, axes[0], axes[1] * -1] + } else { + axes[1] *= -1; + axes[3] *= -1 + } + } + const buf = GodotRuntime.malloc((axes.length + 1) * 4); + GodotRuntime.setHeapValue(buf, axes.length, "i32"); + for (let i = 0; i < axes.length; i++) { + GodotRuntime.setHeapValue(buf + 4 + i * 4, axes[i], "float") + } + return buf + } + + function _godot_webxr_get_controller_buttons(p_controller, p_xr_standard_mapping) { + if (GodotWebXR.controllers.length === 0) { + return 0 + } + const controller = GodotWebXR.controllers[p_controller]; + if (!controller || !controller.gamepad) { + return 0 + } + let buttons = controller.gamepad.buttons; + if (controller.gamepad.mapping === "xr-standard" && p_xr_standard_mapping) { + buttons = [0, buttons[5], buttons[1], buttons[3], buttons[6], buttons[7], buttons[8], buttons[4], buttons[9], buttons[10], buttons[11], buttons[12], buttons[13], buttons[14], buttons[2], buttons[0]] + } + const buf = GodotRuntime.malloc((buttons.length + 1) * 4); + GodotRuntime.setHeapValue(buf, buttons.length, "i32"); + for (let i = 0; i < buttons.length; i++) { + GodotRuntime.setHeapValue(buf + 4 + i * 4, buttons[i] ? buttons[i].value : 0, "float") + } + return buf + } + + function _godot_webxr_get_controller_count() { + if (!GodotWebXR.session || !GodotWebXR.frame) { + return 0 + } + return GodotWebXR.controllers.length + } + + function _godot_webxr_get_controller_target_ray_mode(p_controller) { + if (p_controller < 0 || p_controller >= GodotWebXR.controllers.length) { + return 0 + } + const controller = GodotWebXR.controllers[p_controller]; + if (!controller) { + return 0 + } + switch (controller.targetRayMode) { + case "gaze": + return 1; + case "tracked-pointer": + return 2; + case "screen": + return 3; + default: + break + } + return 0 + } + + function _godot_webxr_get_controller_transform(p_controller) { + if (!GodotWebXR.session || !GodotWebXR.frame) { + return 0 + } + const controller = GodotWebXR.controllers[p_controller]; + if (!controller) { + return 0 + } + const frame = GodotWebXR.frame; + const space = GodotWebXR.space; + const pose = frame.getPose(controller.targetRaySpace, space); + if (!pose) { + return 0 + } + const matrix = pose.transform.matrix; + const buf = GodotRuntime.malloc(16 * 4); + for (let i = 0; i < 16; i++) { + GodotRuntime.setHeapValue(buf + i * 4, matrix[i], "float") + } + return buf + } + + function _godot_webxr_get_projection_for_eye(p_eye) { + if (!GodotWebXR.session || !GodotWebXR.pose) { + return 0 + } + const view_index = p_eye === 2 ? 1 : 0; + const matrix = GodotWebXR.pose.views[view_index].projectionMatrix; + const buf = GodotRuntime.malloc(16 * 4); + for (let i = 0; i < 16; i++) { + GodotRuntime.setHeapValue(buf + i * 4, matrix[i], "float") + } + return buf + } + + function _godot_webxr_get_render_targetsize() { + if (!GodotWebXR.session || !GodotWebXR.pose) { + return 0 + } + const glLayer = GodotWebXR.session.renderState.baseLayer; + const view = GodotWebXR.pose.views[0]; + const viewport = glLayer.getViewport(view); + const buf = GodotRuntime.malloc(2 * 4); + GodotRuntime.setHeapValue(buf + 0, viewport.width, "i32"); + GodotRuntime.setHeapValue(buf + 4, viewport.height, "i32"); + return buf + } + + function _godot_webxr_get_transform_for_eye(p_eye) { + if (!GodotWebXR.session || !GodotWebXR.pose) { + return 0 + } + const views = GodotWebXR.pose.views; + let matrix; + if (p_eye === 0) { + matrix = GodotWebXR.pose.transform.matrix + } else { + matrix = views[p_eye - 1].transform.matrix + } + const buf = GodotRuntime.malloc(16 * 4); + for (let i = 0; i < 16; i++) { + GodotRuntime.setHeapValue(buf + i * 4, matrix[i], "float") + } + return buf + } + + function _godot_webxr_get_view_count() { + if (!GodotWebXR.session || !GodotWebXR.pose) { + return 0 + } + return GodotWebXR.pose.views.length + } + + function _godot_webxr_get_visibility_state() { + if (!GodotWebXR.session || !GodotWebXR.session.visibilityState) { + return 0 + } + return GodotRuntime.allocString(GodotWebXR.session.visibilityState) + } + + function _godot_webxr_initialize(p_session_mode, p_required_features, p_optional_features, p_requested_reference_spaces, p_on_session_started, p_on_session_ended, p_on_session_failed, p_on_controller_changed, p_on_input_event, p_on_simple_event) { + GodotWebXR.monkeyPatchRequestAnimationFrame(true); + const session_mode = GodotRuntime.parseString(p_session_mode); + const required_features = GodotRuntime.parseString(p_required_features).split(",").map(s => s.trim()).filter(s => s !== ""); + const optional_features = GodotRuntime.parseString(p_optional_features).split(",").map(s => s.trim()).filter(s => s !== ""); + const requested_reference_space_types = GodotRuntime.parseString(p_requested_reference_spaces).split(",").map(s => s.trim()); + const onstarted = GodotRuntime.get_func(p_on_session_started); + const onended = GodotRuntime.get_func(p_on_session_ended); + const onfailed = GodotRuntime.get_func(p_on_session_failed); + const oncontroller = GodotRuntime.get_func(p_on_controller_changed); + const oninputevent = GodotRuntime.get_func(p_on_input_event); + const onsimpleevent = GodotRuntime.get_func(p_on_simple_event); + const session_init = {}; + if (required_features.length > 0) { + session_init["requiredFeatures"] = required_features + } + if (optional_features.length > 0) { + session_init["optionalFeatures"] = optional_features + } + navigator.xr.requestSession(session_mode, session_init).then(function(session) { + GodotWebXR.session = session; + session.addEventListener("end", function(evt) { + onended() + }); + session.addEventListener("inputsourceschange", function(evt) { + let controller_changed = false; + [evt.added, evt.removed].forEach(lst => { + lst.forEach(input_source => { + if (input_source.targetRayMode === "tracked-pointer") { + controller_changed = true + } + }) + }); + if (controller_changed) { + oncontroller() + } + }); + ["selectstart", "selectend", "select", "squeezestart", "squeezeend", "squeeze"].forEach((input_event, index) => { + session.addEventListener(input_event, function(evt) { + GodotWebXR.sampleControllers(); + oninputevent(index, GodotWebXR.getControllerId(evt.inputSource)) + }) + }); + session.addEventListener("visibilitychange", function(evt) { + const c_str = GodotRuntime.allocString("visibility_state_changed"); + onsimpleevent(c_str); + GodotRuntime.free(c_str) + }); + const gl_context_handle = _emscripten_webgl_get_current_context(); + const gl = GL.getContext(gl_context_handle).GLctx; + GodotWebXR.gl = gl; + gl.makeXRCompatible().then(function() { + session.updateRenderState({ + baseLayer: new XRWebGLLayer(session, gl) + }); + + function onReferenceSpaceSuccess(reference_space, reference_space_type) { + GodotWebXR.space = reference_space; + reference_space.onreset = function(evt) { + const c_str = GodotRuntime.allocString("reference_space_reset"); + onsimpleevent(c_str); + GodotRuntime.free(c_str) + }; + GodotWebXR.pauseResumeMainLoop(); + window.setTimeout(function() { + const c_str = GodotRuntime.allocString(reference_space_type); + onstarted(c_str); + GodotRuntime.free(c_str) + }, 0) + } + + function requestReferenceSpace() { + const reference_space_type = requested_reference_space_types.shift(); + session.requestReferenceSpace(reference_space_type).then(refSpace => { + onReferenceSpaceSuccess(refSpace, reference_space_type) + }).catch(() => { + if (requested_reference_space_types.length === 0) { + const c_str = GodotRuntime.allocString("Unable to get any of the requested reference space types"); + onfailed(c_str); + GodotRuntime.free(c_str) + } else { + requestReferenceSpace() + } + }) + } + requestReferenceSpace() + }).catch(function(error) { + const c_str = GodotRuntime.allocString(`Unable to make WebGL context compatible with WebXR: ${error}`); + onfailed(c_str); + GodotRuntime.free(c_str) + }) + }).catch(function(error) { + const c_str = GodotRuntime.allocString(`Unable to start session: ${error}`); + onfailed(c_str); + GodotRuntime.free(c_str) + }) + } + + function _godot_webxr_is_controller_connected(p_controller) { + if (!GodotWebXR.session || !GodotWebXR.frame) { + return false + } + return !!GodotWebXR.controllers[p_controller] + } + + function _godot_webxr_is_session_supported(p_session_mode, p_callback) { + const session_mode = GodotRuntime.parseString(p_session_mode); + const cb = GodotRuntime.get_func(p_callback); + if (navigator.xr) { + navigator.xr.isSessionSupported(session_mode).then(function(supported) { + const c_str = GodotRuntime.allocString(session_mode); + cb(c_str, supported ? 1 : 0); + GodotRuntime.free(c_str) + }) + } else { + const c_str = GodotRuntime.allocString(session_mode); + cb(c_str, 0); + GodotRuntime.free(c_str) + } + } + + function _godot_webxr_is_supported() { + return !!navigator.xr + } + + function _godot_webxr_sample_controller_data() { + GodotWebXR.sampleControllers() + } + + function _godot_webxr_uninitialize() { + if (GodotWebXR.session) { + GodotWebXR.session.end().catch(e => {}) + } + GodotWebXR.session = null; + GodotWebXR.space = null; + GodotWebXR.frame = null; + GodotWebXR.pose = null; + GodotWebXR.monkeyPatchRequestAnimationFrame(false); + GodotWebXR.pauseResumeMainLoop() + } + + function _setTempRet0(val) { + setTempRet0(val) + } + + function __isLeapYear(year) { + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0) + } + + function __arraySum(array, index) { + var sum = 0; + for (var i = 0; i <= index; sum += array[i++]) {} + return sum + } + var __MONTH_DAYS_LEAP = [31, 29, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; + var __MONTH_DAYS_REGULAR = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; + + function __addDays(date, days) { + var newDate = new Date(date.getTime()); + while (days > 0) { + var leap = __isLeapYear(newDate.getFullYear()); + var currentMonth = newDate.getMonth(); + var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth]; + if (days > daysInCurrentMonth - newDate.getDate()) { + days -= daysInCurrentMonth - newDate.getDate() + 1; + newDate.setDate(1); + if (currentMonth < 11) { + newDate.setMonth(currentMonth + 1) + } else { + newDate.setMonth(0); + newDate.setFullYear(newDate.getFullYear() + 1) + } + } else { + newDate.setDate(newDate.getDate() + days); + return newDate + } + } + return newDate + } + + function _strftime(s, maxsize, format, tm) { + var tm_zone = HEAP32[tm + 40 >> 2]; + var date = { + tm_sec: HEAP32[tm >> 2], + tm_min: HEAP32[tm + 4 >> 2], + tm_hour: HEAP32[tm + 8 >> 2], + tm_mday: HEAP32[tm + 12 >> 2], + tm_mon: HEAP32[tm + 16 >> 2], + tm_year: HEAP32[tm + 20 >> 2], + tm_wday: HEAP32[tm + 24 >> 2], + tm_yday: HEAP32[tm + 28 >> 2], + tm_isdst: HEAP32[tm + 32 >> 2], + tm_gmtoff: HEAP32[tm + 36 >> 2], + tm_zone: tm_zone ? UTF8ToString(tm_zone) : "" + }; + var pattern = UTF8ToString(format); + var EXPANSION_RULES_1 = { + "%c": "%a %b %d %H:%M:%S %Y", + "%D": "%m/%d/%y", + "%F": "%Y-%m-%d", + "%h": "%b", + "%r": "%I:%M:%S %p", + "%R": "%H:%M", + "%T": "%H:%M:%S", + "%x": "%m/%d/%y", + "%X": "%H:%M:%S", + "%Ec": "%c", + "%EC": "%C", + "%Ex": "%m/%d/%y", + "%EX": "%H:%M:%S", + "%Ey": "%y", + "%EY": "%Y", + "%Od": "%d", + "%Oe": "%e", + "%OH": "%H", + "%OI": "%I", + "%Om": "%m", + "%OM": "%M", + "%OS": "%S", + "%Ou": "%u", + "%OU": "%U", + "%OV": "%V", + "%Ow": "%w", + "%OW": "%W", + "%Oy": "%y" + }; + for (var rule in EXPANSION_RULES_1) { + pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_1[rule]) + } + var WEEKDAYS = ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"]; + var MONTHS = ["January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"]; + + function leadingSomething(value, digits, character) { + var str = typeof value == "number" ? value.toString() : value || ""; + while (str.length < digits) { + str = character[0] + str + } + return str + } + + function leadingNulls(value, digits) { + return leadingSomething(value, digits, "0") + } + + function compareByDay(date1, date2) { + function sgn(value) { + return value < 0 ? -1 : value > 0 ? 1 : 0 + } + var compare; + if ((compare = sgn(date1.getFullYear() - date2.getFullYear())) === 0) { + if ((compare = sgn(date1.getMonth() - date2.getMonth())) === 0) { + compare = sgn(date1.getDate() - date2.getDate()) + } + } + return compare + } + + function getFirstWeekStartDate(janFourth) { + switch (janFourth.getDay()) { + case 0: + return new Date(janFourth.getFullYear() - 1, 11, 29); + case 1: + return janFourth; + case 2: + return new Date(janFourth.getFullYear(), 0, 3); + case 3: + return new Date(janFourth.getFullYear(), 0, 2); + case 4: + return new Date(janFourth.getFullYear(), 0, 1); + case 5: + return new Date(janFourth.getFullYear() - 1, 11, 31); + case 6: + return new Date(janFourth.getFullYear() - 1, 11, 30) + } + } + + function getWeekBasedYear(date) { + var thisDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday); + var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4); + var janFourthNextYear = new Date(thisDate.getFullYear() + 1, 0, 4); + var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); + var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); + if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) { + if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) { + return thisDate.getFullYear() + 1 + } else { + return thisDate.getFullYear() + } + } else { + return thisDate.getFullYear() - 1 + } + } + var EXPANSION_RULES_2 = { + "%a": function(date) { + return WEEKDAYS[date.tm_wday].substring(0, 3) + }, + "%A": function(date) { + return WEEKDAYS[date.tm_wday] + }, + "%b": function(date) { + return MONTHS[date.tm_mon].substring(0, 3) + }, + "%B": function(date) { + return MONTHS[date.tm_mon] + }, + "%C": function(date) { + var year = date.tm_year + 1900; + return leadingNulls(year / 100 | 0, 2) + }, + "%d": function(date) { + return leadingNulls(date.tm_mday, 2) + }, + "%e": function(date) { + return leadingSomething(date.tm_mday, 2, " ") + }, + "%g": function(date) { + return getWeekBasedYear(date).toString().substring(2) + }, + "%G": function(date) { + return getWeekBasedYear(date) + }, + "%H": function(date) { + return leadingNulls(date.tm_hour, 2) + }, + "%I": function(date) { + var twelveHour = date.tm_hour; + if (twelveHour == 0) twelveHour = 12; + else if (twelveHour > 12) twelveHour -= 12; + return leadingNulls(twelveHour, 2) + }, + "%j": function(date) { + return leadingNulls(date.tm_mday + __arraySum(__isLeapYear(date.tm_year + 1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon - 1), 3) + }, + "%m": function(date) { + return leadingNulls(date.tm_mon + 1, 2) + }, + "%M": function(date) { + return leadingNulls(date.tm_min, 2) + }, + "%n": function() { + return "\n" + }, + "%p": function(date) { + if (date.tm_hour >= 0 && date.tm_hour < 12) { + return "AM" + } else { + return "PM" + } + }, + "%S": function(date) { + return leadingNulls(date.tm_sec, 2) + }, + "%t": function() { + return "\t" + }, + "%u": function(date) { + return date.tm_wday || 7 + }, + "%U": function(date) { + var days = date.tm_yday + 7 - date.tm_wday; + return leadingNulls(Math.floor(days / 7), 2) + }, + "%V": function(date) { + var val = Math.floor((date.tm_yday + 7 - (date.tm_wday + 6) % 7) / 7); + if ((date.tm_wday + 371 - date.tm_yday - 2) % 7 <= 2) { + val++ + } + if (!val) { + val = 52; + var dec31 = (date.tm_wday + 7 - date.tm_yday - 1) % 7; + if (dec31 == 4 || dec31 == 5 && __isLeapYear(date.tm_year % 400 - 1)) { + val++ + } + } else if (val == 53) { + var jan1 = (date.tm_wday + 371 - date.tm_yday) % 7; + if (jan1 != 4 && (jan1 != 3 || !__isLeapYear(date.tm_year))) val = 1 + } + return leadingNulls(val, 2) + }, + "%w": function(date) { + return date.tm_wday + }, + "%W": function(date) { + var days = date.tm_yday + 7 - (date.tm_wday + 6) % 7; + return leadingNulls(Math.floor(days / 7), 2) + }, + "%y": function(date) { + return (date.tm_year + 1900).toString().substring(2) + }, + "%Y": function(date) { + return date.tm_year + 1900 + }, + "%z": function(date) { + var off = date.tm_gmtoff; + var ahead = off >= 0; + off = Math.abs(off) / 60; + off = off / 60 * 100 + off % 60; + return (ahead ? "+" : "-") + String("0000" + off).slice(-4) + }, + "%Z": function(date) { + return date.tm_zone + }, + "%%": function() { + return "%" + } + }; + pattern = pattern.replace(/%%/g, "\0\0"); + for (var rule in EXPANSION_RULES_2) { + if (pattern.includes(rule)) { + pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_2[rule](date)) + } + } + pattern = pattern.replace(/\0\0/g, "%"); + var bytes = intArrayFromString(pattern, false); + if (bytes.length > maxsize) { + return 0 + } + writeArrayToMemory(bytes, s); + return bytes.length - 1 + } + + function _strftime_l(s, maxsize, format, tm) { + return _strftime(s, maxsize, format, tm) + } + var FSNode = function(parent, name, mode, rdev) { + if (!parent) { + parent = this + } + this.parent = parent; + this.mount = parent.mount; + this.mounted = null; + this.id = FS.nextInode++; + this.name = name; + this.mode = mode; + this.node_ops = {}; + this.stream_ops = {}; + this.rdev = rdev + }; + var readMode = 292 | 73; + var writeMode = 146; + Object.defineProperties(FSNode.prototype, { + read: { + get: function() { + return (this.mode & readMode) === readMode + }, + set: function(val) { + val ? this.mode |= readMode : this.mode &= ~readMode + } + }, + write: { + get: function() { + return (this.mode & writeMode) === writeMode + }, + set: function(val) { + val ? this.mode |= writeMode : this.mode &= ~writeMode + } + }, + isFolder: { + get: function() { + return FS.isDir(this.mode) + } + }, + isDevice: { + get: function() { + return FS.isChrdev(this.mode) + } + } + }); + FS.FSNode = FSNode; + FS.staticInit(); + Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas) { + Browser.requestFullscreen(lockPointer, resizeCanvas) + }; + Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { + Browser.requestAnimationFrame(func) + }; + Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { + Browser.setCanvasSize(width, height, noUpdates) + }; + Module["pauseMainLoop"] = function Module_pauseMainLoop() { + Browser.mainLoop.pause() + }; + Module["resumeMainLoop"] = function Module_resumeMainLoop() { + Browser.mainLoop.resume() + }; + Module["getUserMedia"] = function Module_getUserMedia() { + Browser.getUserMedia() + }; + Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { + return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) + }; + var preloadedImages = {}; + var preloadedAudios = {}; + var GLctx; + for (var i = 0; i < 32; ++i) tempFixedLengthArray.push(new Array(i)); + var miniTempWebGLFloatBuffersStorage = new Float32Array(288); + for (var i = 0; i < 288; ++i) { + miniTempWebGLFloatBuffers[i] = miniTempWebGLFloatBuffersStorage.subarray(0, i + 1) + } + var __miniTempWebGLIntBuffersStorage = new Int32Array(288); + for (var i = 0; i < 288; ++i) { + __miniTempWebGLIntBuffers[i] = __miniTempWebGLIntBuffersStorage.subarray(0, i + 1) + } + Module["request_quit"] = function() { + GodotOS.request_quit() + }; + Module["onExit"] = GodotOS.cleanup; + GodotOS._fs_sync_promise = Promise.resolve(); + Module["initConfig"] = GodotConfig.init_config; + Module["initFS"] = GodotFS.init; + Module["copyToFS"] = GodotFS.copy_to_fs; + ERRNO_CODES = { + "EPERM": 63, + "ENOENT": 44, + "ESRCH": 71, + "EINTR": 27, + "EIO": 29, + "ENXIO": 60, + "E2BIG": 1, + "ENOEXEC": 45, + "EBADF": 8, + "ECHILD": 12, + "EAGAIN": 6, + "EWOULDBLOCK": 6, + "ENOMEM": 48, + "EACCES": 2, + "EFAULT": 21, + "ENOTBLK": 105, + "EBUSY": 10, + "EEXIST": 20, + "EXDEV": 75, + "ENODEV": 43, + "ENOTDIR": 54, + "EISDIR": 31, + "EINVAL": 28, + "ENFILE": 41, + "EMFILE": 33, + "ENOTTY": 59, + "ETXTBSY": 74, + "EFBIG": 22, + "ENOSPC": 51, + "ESPIPE": 70, + "EROFS": 69, + "EMLINK": 34, + "EPIPE": 64, + "EDOM": 18, + "ERANGE": 68, + "ENOMSG": 49, + "EIDRM": 24, + "ECHRNG": 106, + "EL2NSYNC": 156, + "EL3HLT": 107, + "EL3RST": 108, + "ELNRNG": 109, + "EUNATCH": 110, + "ENOCSI": 111, + "EL2HLT": 112, + "EDEADLK": 16, + "ENOLCK": 46, + "EBADE": 113, + "EBADR": 114, + "EXFULL": 115, + "ENOANO": 104, + "EBADRQC": 103, + "EBADSLT": 102, + "EDEADLOCK": 16, + "EBFONT": 101, + "ENOSTR": 100, + "ENODATA": 116, + "ETIME": 117, + "ENOSR": 118, + "ENONET": 119, + "ENOPKG": 120, + "EREMOTE": 121, + "ENOLINK": 47, + "EADV": 122, + "ESRMNT": 123, + "ECOMM": 124, + "EPROTO": 65, + "EMULTIHOP": 36, + "EDOTDOT": 125, + "EBADMSG": 9, + "ENOTUNIQ": 126, + "EBADFD": 127, + "EREMCHG": 128, + "ELIBACC": 129, + "ELIBBAD": 130, + "ELIBSCN": 131, + "ELIBMAX": 132, + "ELIBEXEC": 133, + "ENOSYS": 52, + "ENOTEMPTY": 55, + "ENAMETOOLONG": 37, + "ELOOP": 32, + "EOPNOTSUPP": 138, + "EPFNOSUPPORT": 139, + "ECONNRESET": 15, + "ENOBUFS": 42, + "EAFNOSUPPORT": 5, + "EPROTOTYPE": 67, + "ENOTSOCK": 57, + "ENOPROTOOPT": 50, + "ESHUTDOWN": 140, + "ECONNREFUSED": 14, + "EADDRINUSE": 3, + "ECONNABORTED": 13, + "ENETUNREACH": 40, + "ENETDOWN": 38, + "ETIMEDOUT": 73, + "EHOSTDOWN": 142, + "EHOSTUNREACH": 23, + "EINPROGRESS": 26, + "EALREADY": 7, + "EDESTADDRREQ": 17, + "EMSGSIZE": 35, + "EPROTONOSUPPORT": 66, + "ESOCKTNOSUPPORT": 137, + "EADDRNOTAVAIL": 4, + "ENETRESET": 39, + "EISCONN": 30, + "ENOTCONN": 53, + "ETOOMANYREFS": 141, + "EUSERS": 136, + "EDQUOT": 19, + "ESTALE": 72, + "ENOTSUP": 138, + "ENOMEDIUM": 148, + "EILSEQ": 25, + "EOVERFLOW": 61, + "ECANCELED": 11, + "ENOTRECOVERABLE": 56, + "EOWNERDEAD": 62, + "ESTRPIPE": 135 + }; + GodotOS.atexit(function(resolve, reject) { + GodotDisplayCursor.clear(); + resolve() + }); + GodotOS.atexit(function(resolve, reject) { + GodotEventListeners.clear(); + resolve() + }); + GodotOS.atexit(function(resolve, reject) { + GodotDisplayVK.clear(); + resolve() + }); + GodotJSWrapper.proxies = new Map; + + function intArrayFromString(stringy, dontAddNull, length) { + var len = length > 0 ? length : lengthBytesUTF8(stringy) + 1; + var u8array = new Array(len); + var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); + if (dontAddNull) u8array.length = numBytesWritten; + return u8array + } + var asmLibraryArg = { + "Xc": ___call_sighandler, + "Rc": ___syscall__newselect, + "Mc": ___syscall_accept4, + "Lc": ___syscall_bind, + "rd": ___syscall_chdir, + "qd": ___syscall_chmod, + "Kc": ___syscall_connect, + "sd": ___syscall_faccessat, + "Fa": ___syscall_fcntl64, + "fd": ___syscall_getcwd, + "Wc": ___syscall_getdents64, + "Jc": ___syscall_getsockname, + "Ic": ___syscall_getsockopt, + "mb": ___syscall_ioctl, + "Hc": ___syscall_listen, + "ad": ___syscall_lstat64, + "_c": ___syscall_mkdirat, + "$c": ___syscall_newfstatat, + "nb": ___syscall_openat, + "Zc": ___syscall_poll, + "Vc": ___syscall_readlinkat, + "Gc": ___syscall_recvfrom, + "Sc": ___syscall_renameat, + "Tc": ___syscall_rmdir, + "Fc": ___syscall_sendto, + "jb": ___syscall_socket, + "bd": ___syscall_stat64, + "Qc": ___syscall_statfs64, + "Pc": ___syscall_symlink, + "Uc": ___syscall_unlinkat, + "nd": __dlinit, + "pd": __dlopen_js, + "od": __dlsym_js, + "Va": __emscripten_date_now, + "id": __emscripten_get_now_is_monotonic, + "Ec": __emscripten_throw_longjmp, + "jd": __gmtime_js, + "kd": __localtime_js, + "md": __tzset_js, + "ja": _abort, + "qb": _emscripten_cancel_main_loop, + "Jh": _emscripten_force_exit, + "Ua": _emscripten_get_now, + "yi": _emscripten_glActiveTexture, + "xi": _emscripten_glAttachShader, + "mf": _emscripten_glBeginQuery, + "Qi": _emscripten_glBeginQueryEXT, + "Ue": _emscripten_glBeginTransformFeedback, + "wi": _emscripten_glBindAttribLocation, + "vi": _emscripten_glBindBuffer, + "Qe": _emscripten_glBindBufferBase, + "Re": _emscripten_glBindBufferRange, + "ui": _emscripten_glBindFramebuffer, + "ti": _emscripten_glBindRenderbuffer, + "Td": _emscripten_glBindSampler, + "si": _emscripten_glBindTexture, + "Kd": _emscripten_glBindTransformFeedback, + "Ze": _emscripten_glBindVertexArray, + "Hi": _emscripten_glBindVertexArrayOES, + "ri": _emscripten_glBlendColor, + "qi": _emscripten_glBlendEquation, + "pi": _emscripten_glBlendEquationSeparate, + "ni": _emscripten_glBlendFunc, + "mi": _emscripten_glBlendFuncSeparate, + "af": _emscripten_glBlitFramebuffer, + "li": _emscripten_glBufferData, + "ki": _emscripten_glBufferSubData, + "ji": _emscripten_glCheckFramebufferStatus, + "ii": _emscripten_glClear, + "re": _emscripten_glClearBufferfi, + "se": _emscripten_glClearBufferfv, + "ue": _emscripten_glClearBufferiv, + "te": _emscripten_glClearBufferuiv, + "hi": _emscripten_glClearColor, + "gi": _emscripten_glClearDepthf, + "fi": _emscripten_glClearStencil, + "ce": _emscripten_glClientWaitSync, + "ei": _emscripten_glColorMask, + "bi": _emscripten_glCompileShader, + "ai": _emscripten_glCompressedTexImage2D, + "rf": _emscripten_glCompressedTexImage3D, + "$h": _emscripten_glCompressedTexSubImage2D, + "qf": _emscripten_glCompressedTexSubImage3D, + "pe": _emscripten_glCopyBufferSubData, + "_h": _emscripten_glCopyTexImage2D, + "Zh": _emscripten_glCopyTexSubImage2D, + "sf": _emscripten_glCopyTexSubImage3D, + "Yh": _emscripten_glCreateProgram, + "Xh": _emscripten_glCreateShader, + "Wh": _emscripten_glCullFace, + "Vh": _emscripten_glDeleteBuffers, + "Uh": _emscripten_glDeleteFramebuffers, + "Th": _emscripten_glDeleteProgram, + "of": _emscripten_glDeleteQueries, + "Si": _emscripten_glDeleteQueriesEXT, + "Sh": _emscripten_glDeleteRenderbuffers, + "Vd": _emscripten_glDeleteSamplers, + "Rh": _emscripten_glDeleteShader, + "de": _emscripten_glDeleteSync, + "Qh": _emscripten_glDeleteTextures, + "Jd": _emscripten_glDeleteTransformFeedbacks, + "Ye": _emscripten_glDeleteVertexArrays, + "Gi": _emscripten_glDeleteVertexArraysOES, + "Ph": _emscripten_glDepthFunc, + "Oh": _emscripten_glDepthMask, + "Nh": _emscripten_glDepthRangef, + "Mh": _emscripten_glDetachShader, + "Lh": _emscripten_glDisable, + "Kh": _emscripten_glDisableVertexAttribArray, + "Ih": _emscripten_glDrawArrays, + "he": _emscripten_glDrawArraysInstanced, + "Ci": _emscripten_glDrawArraysInstancedANGLE, + "Bf": _emscripten_glDrawArraysInstancedARB, + "Cf": _emscripten_glDrawArraysInstancedEXT, + "td": _emscripten_glDrawArraysInstancedNV, + "hf": _emscripten_glDrawBuffers, + "xf": _emscripten_glDrawBuffersEXT, + "Di": _emscripten_glDrawBuffersWEBGL, + "Hh": _emscripten_glDrawElements, + "ge": _emscripten_glDrawElementsInstanced, + "Bi": _emscripten_glDrawElementsInstancedANGLE, + "yf": _emscripten_glDrawElementsInstancedARB, + "zf": _emscripten_glDrawElementsInstancedEXT, + "Af": _emscripten_glDrawElementsInstancedNV, + "vf": _emscripten_glDrawRangeElements, + "Gh": _emscripten_glEnable, + "Fh": _emscripten_glEnableVertexAttribArray, + "lf": _emscripten_glEndQuery, + "Pi": _emscripten_glEndQueryEXT, + "Se": _emscripten_glEndTransformFeedback, + "fe": _emscripten_glFenceSync, + "Eh": _emscripten_glFinish, + "Dh": _emscripten_glFlush, + "Ch": _emscripten_glFramebufferRenderbuffer, + "Bh": _emscripten_glFramebufferTexture2D, + "_e": _emscripten_glFramebufferTextureLayer, + "Ah": _emscripten_glFrontFace, + "zh": _emscripten_glGenBuffers, + "xh": _emscripten_glGenFramebuffers, + "pf": _emscripten_glGenQueries, + "Ti": _emscripten_glGenQueriesEXT, + "wh": _emscripten_glGenRenderbuffers, + "Wd": _emscripten_glGenSamplers, + "vh": _emscripten_glGenTextures, + "Id": _emscripten_glGenTransformFeedbacks, + "Xe": _emscripten_glGenVertexArrays, + "Fi": _emscripten_glGenVertexArraysOES, + "yh": _emscripten_glGenerateMipmap, + "uh": _emscripten_glGetActiveAttrib, + "th": _emscripten_glGetActiveUniform, + "je": _emscripten_glGetActiveUniformBlockName, + "ke": _emscripten_glGetActiveUniformBlockiv, + "ne": _emscripten_glGetActiveUniformsiv, + "sh": _emscripten_glGetAttachedShaders, + "rh": _emscripten_glGetAttribLocation, + "qh": _emscripten_glGetBooleanv, + "Xd": _emscripten_glGetBufferParameteri64v, + "ph": _emscripten_glGetBufferParameteriv, + "nh": _emscripten_glGetError, + "mh": _emscripten_glGetFloatv, + "Ee": _emscripten_glGetFragDataLocation, + "lh": _emscripten_glGetFramebufferAttachmentParameteriv, + "Yd": _emscripten_glGetInteger64i_v, + "_d": _emscripten_glGetInteger64v, + "Ve": _emscripten_glGetIntegeri_v, + "kh": _emscripten_glGetIntegerv, + "wd": _emscripten_glGetInternalformativ, + "Dd": _emscripten_glGetProgramBinary, + "ih": _emscripten_glGetProgramInfoLog, + "jh": _emscripten_glGetProgramiv, + "Ji": _emscripten_glGetQueryObjecti64vEXT, + "Mi": _emscripten_glGetQueryObjectivEXT, + "Ii": _emscripten_glGetQueryObjectui64vEXT, + "jf": _emscripten_glGetQueryObjectuiv, + "Li": _emscripten_glGetQueryObjectuivEXT, + "kf": _emscripten_glGetQueryiv, + "Ni": _emscripten_glGetQueryivEXT, + "hh": _emscripten_glGetRenderbufferParameteriv, + "Md": _emscripten_glGetSamplerParameterfv, + "Nd": _emscripten_glGetSamplerParameteriv, + "fh": _emscripten_glGetShaderInfoLog, + "eh": _emscripten_glGetShaderPrecisionFormat, + "ch": _emscripten_glGetShaderSource, + "gh": _emscripten_glGetShaderiv, + "bh": _emscripten_glGetString, + "qe": _emscripten_glGetStringi, + "Zd": _emscripten_glGetSynciv, + "ah": _emscripten_glGetTexParameterfv, + "$g": _emscripten_glGetTexParameteriv, + "Oe": _emscripten_glGetTransformFeedbackVarying, + "le": _emscripten_glGetUniformBlockIndex, + "oe": _emscripten_glGetUniformIndices, + "Yg": _emscripten_glGetUniformLocation, + "_g": _emscripten_glGetUniformfv, + "Zg": _emscripten_glGetUniformiv, + "Fe": _emscripten_glGetUniformuiv, + "Me": _emscripten_glGetVertexAttribIiv, + "Le": _emscripten_glGetVertexAttribIuiv, + "Vg": _emscripten_glGetVertexAttribPointerv, + "Xg": _emscripten_glGetVertexAttribfv, + "Wg": _emscripten_glGetVertexAttribiv, + "Tg": _emscripten_glHint, + "Ad": _emscripten_glInvalidateFramebuffer, + "zd": _emscripten_glInvalidateSubFramebuffer, + "Sg": _emscripten_glIsBuffer, + "Rg": _emscripten_glIsEnabled, + "Qg": _emscripten_glIsFramebuffer, + "Pg": _emscripten_glIsProgram, + "nf": _emscripten_glIsQuery, + "Ri": _emscripten_glIsQueryEXT, + "Og": _emscripten_glIsRenderbuffer, + "Ud": _emscripten_glIsSampler, + "Ng": _emscripten_glIsShader, + "ee": _emscripten_glIsSync, + "Mg": _emscripten_glIsTexture, + "Hd": _emscripten_glIsTransformFeedback, + "We": _emscripten_glIsVertexArray, + "Ei": _emscripten_glIsVertexArrayOES, + "Lg": _emscripten_glLineWidth, + "Kg": _emscripten_glLinkProgram, + "Fd": _emscripten_glPauseTransformFeedback, + "Ig": _emscripten_glPixelStorei, + "Hg": _emscripten_glPolygonOffset, + "Cd": _emscripten_glProgramBinary, + "Bd": _emscripten_glProgramParameteri, + "Oi": _emscripten_glQueryCounterEXT, + "wf": _emscripten_glReadBuffer, + "Gg": _emscripten_glReadPixels, + "Fg": _emscripten_glReleaseShaderCompiler, + "Eg": _emscripten_glRenderbufferStorage, + "$e": _emscripten_glRenderbufferStorageMultisample, + "Ed": _emscripten_glResumeTransformFeedback, + "Dg": _emscripten_glSampleCoverage, + "Pd": _emscripten_glSamplerParameterf, + "Od": _emscripten_glSamplerParameterfv, + "Sd": _emscripten_glSamplerParameteri, + "Qd": _emscripten_glSamplerParameteriv, + "Cg": _emscripten_glScissor, + "Bg": _emscripten_glShaderBinary, + "Ag": _emscripten_glShaderSource, + "zg": _emscripten_glStencilFunc, + "xg": _emscripten_glStencilFuncSeparate, + "wg": _emscripten_glStencilMask, + "vg": _emscripten_glStencilMaskSeparate, + "ug": _emscripten_glStencilOp, + "tg": _emscripten_glStencilOpSeparate, + "sg": _emscripten_glTexImage2D, + "uf": _emscripten_glTexImage3D, + "rg": _emscripten_glTexParameterf, + "qg": _emscripten_glTexParameterfv, + "pg": _emscripten_glTexParameteri, + "og": _emscripten_glTexParameteriv, + "yd": _emscripten_glTexStorage2D, + "xd": _emscripten_glTexStorage3D, + "mg": _emscripten_glTexSubImage2D, + "tf": _emscripten_glTexSubImage3D, + "Pe": _emscripten_glTransformFeedbackVaryings, + "lg": _emscripten_glUniform1f, + "kg": _emscripten_glUniform1fv, + "jg": _emscripten_glUniform1i, + "ig": _emscripten_glUniform1iv, + "De": _emscripten_glUniform1ui, + "ze": _emscripten_glUniform1uiv, + "hg": _emscripten_glUniform2f, + "gg": _emscripten_glUniform2fv, + "fg": _emscripten_glUniform2i, + "eg": _emscripten_glUniform2iv, + "Ce": _emscripten_glUniform2ui, + "ye": _emscripten_glUniform2uiv, + "dg": _emscripten_glUniform3f, + "ag": _emscripten_glUniform3fv, + "$f": _emscripten_glUniform3i, + "_f": _emscripten_glUniform3iv, + "Be": _emscripten_glUniform3ui, + "we": _emscripten_glUniform3uiv, + "Zf": _emscripten_glUniform4f, + "Yf": _emscripten_glUniform4fv, + "Xf": _emscripten_glUniform4i, + "Wf": _emscripten_glUniform4iv, + "Ae": _emscripten_glUniform4ui, + "ve": _emscripten_glUniform4uiv, + "ie": _emscripten_glUniformBlockBinding, + "Vf": _emscripten_glUniformMatrix2fv, + "gf": _emscripten_glUniformMatrix2x3fv, + "ef": _emscripten_glUniformMatrix2x4fv, + "Uf": _emscripten_glUniformMatrix3fv, + "ff": _emscripten_glUniformMatrix3x2fv, + "cf": _emscripten_glUniformMatrix3x4fv, + "Tf": _emscripten_glUniformMatrix4fv, + "df": _emscripten_glUniformMatrix4x2fv, + "bf": _emscripten_glUniformMatrix4x3fv, + "Rf": _emscripten_glUseProgram, + "Qf": _emscripten_glValidateProgram, + "Pf": _emscripten_glVertexAttrib1f, + "Of": _emscripten_glVertexAttrib1fv, + "Nf": _emscripten_glVertexAttrib2f, + "Mf": _emscripten_glVertexAttrib2fv, + "Lf": _emscripten_glVertexAttrib3f, + "Kf": _emscripten_glVertexAttrib3fv, + "Jf": _emscripten_glVertexAttrib4f, + "If": _emscripten_glVertexAttrib4fv, + "Ld": _emscripten_glVertexAttribDivisor, + "Ai": _emscripten_glVertexAttribDivisorANGLE, + "Df": _emscripten_glVertexAttribDivisorARB, + "Ef": _emscripten_glVertexAttribDivisorEXT, + "ud": _emscripten_glVertexAttribDivisorNV, + "Ke": _emscripten_glVertexAttribI4i, + "He": _emscripten_glVertexAttribI4iv, + "Je": _emscripten_glVertexAttribI4ui, + "Ge": _emscripten_glVertexAttribI4uiv, + "Ne": _emscripten_glVertexAttribIPointer, + "Gf": _emscripten_glVertexAttribPointer, + "Ff": _emscripten_glViewport, + "$d": _emscripten_glWaitSync, + "hd": _emscripten_memcpy_big, + "Ta": _emscripten_resize_heap, + "pb": _emscripten_set_main_loop, + "fb": _emscripten_webgl_commit_frame, + "Cc": _emscripten_webgl_create_context, + "bc": _emscripten_webgl_destroy_context, + "Oc": _emscripten_webgl_init_context_attributes, + "xc": _emscripten_webgl_make_context_current, + "dd": _environ_get, + "ed": _environ_sizes_get, + "ua": _fd_close, + "cd": _fd_fdstat_get, + "lb": _fd_read, + "Ac": _fd_seek, + "kb": _fd_write, + "k": _getTempRet0, + "Sa": _getaddrinfo, + "Pb": _getnameinfo, + "c": _glActiveTexture, + "Na": _glAttachShader, + "bb": _glBeginTransformFeedback, + "vb": _glBindAttribLocation, + "b": _glBindBuffer, + "P": _glBindBufferBase, + "e": _glBindFramebuffer, + "_": _glBindRenderbuffer, + "a": _glBindTexture, + "m": _glBindVertexArray, + "D": _glBlendEquation, + "X": _glBlendFunc, + "w": _glBlendFuncSeparate, + "ha": _glBlitFramebuffer, + "q": _glBufferData, + "K": _glBufferSubData, + "M": _glCheckFramebufferStatus, + "J": _glClear, + "qa": _glClearBufferfv, + "O": _glClearColor, + "aa": _glClearDepthf, + "N": _glColorMask, + "ka": _glCompileShader, + "Ab": _glCompressedTexImage2D, + "gj": _glCompressedTexSubImage2D, + "zb": _glCompressedTexSubImage3D, + "ej": _glCopyBufferSubData, + "_a": _glCopyTexSubImage2D, + "$a": _glCreateProgram, + "Da": _glCreateShader, + "ra": _glCullFace, + "L": _glDeleteBuffers, + "F": _glDeleteFramebuffers, + "Q": _glDeleteProgram, + "U": _glDeleteRenderbuffers, + "I": _glDeleteShader, + "A": _glDeleteTextures, + "ea": _glDeleteVertexArrays, + "Y": _glDepthFunc, + "H": _glDepthMask, + "i": _glDisable, + "p": _glDisableVertexAttribArray, + "B": _glDrawArrays, + "ya": _glDrawArraysInstanced, + "Ja": _glDrawBuffers, + "ba": _glDrawElements, + "Ka": _glDrawElementsInstanced, + "s": _glEnable, + "j": _glEnableVertexAttribArray, + "ab": _glEndTransformFeedback, + "Db": _glFinish, + "Z": _glFramebufferRenderbuffer, + "x": _glFramebufferTexture2D, + "fj": _glFramebufferTextureLayer, + "Bb": _glFrontFace, + "C": _glGenBuffers, + "E": _glGenFramebuffers, + "ga": _glGenRenderbuffers, + "v": _glGenTextures, + "W": _glGenVertexArrays, + "R": _glGenerateMipmap, + "Cb": _glGetError, + "wb": _glGetFloatv, + "$": _glGetIntegerv, + "Zi": _glGetProgramBinary, + "tb": _glGetProgramInfoLog, + "Ea": _glGetProgramiv, + "Oa": _glGetShaderInfoLog, + "Vi": _glGetShaderSource, + "da": _glGetShaderiv, + "wa": _glGetString, + "dj": _glGetStringi, + "Xi": _glGetUniformBlockIndex, + "va": _glGetUniformLocation, + "lj": _glInvalidateFramebuffer, + "ub": _glLinkProgram, + "la": _glPixelStorei, + "bj": _glProgramBinary, + "_i": _glProgramParameteri, + "ia": _glReadBuffer, + "cb": _glReadPixels, + "fa": _glRenderbufferStorage, + "Ga": _glRenderbufferStorageMultisample, + "T": _glScissor, + "Pa": _glShaderSource, + "r": _glTexImage2D, + "Ia": _glTexImage3D, + "g": _glTexParameterf, + "d": _glTexParameteri, + "ij": _glTexStorage2D, + "Ha": _glTexSubImage2D, + "Qa": _glTexSubImage3D, + "$i": _glTransformFeedbackVaryings, + "f": _glUniform1f, + "u": _glUniform1i, + "db": _glUniform1iv, + "xb": _glUniform1ui, + "Za": _glUniform2f, + "n": _glUniform2fv, + "Ca": _glUniform2i, + "ma": _glUniform2iv, + "Ya": _glUniform3f, + "V": _glUniform3fv, + "Ba": _glUniform3i, + "xa": _glUniform4f, + "y": _glUniform4fv, + "Aa": _glUniform4i, + "Wi": _glUniformBlockBinding, + "sb": _glUniformMatrix2fv, + "rb": _glUniformMatrix3fv, + "o": _glUniformMatrix4fv, + "pa": _glUseProgram, + "z": _glVertexAttrib4f, + "S": _glVertexAttrib4fv, + "G": _glVertexAttribDivisor, + "pj": _glVertexAttribI4ui, + "La": _glVertexAttribIPointer, + "h": _glVertexAttribPointer, + "t": _glViewport, + "di": _godot_audio_capture_start, + "cg": _godot_audio_capture_stop, + "be": _godot_audio_has_script_processor, + "dc": _godot_audio_has_worklet, + "bk": _godot_audio_init, + "ck": _godot_audio_is_available, + "kj": _godot_audio_resume, + "yc": _godot_audio_script_create, + "nc": _godot_audio_script_start, + "Ub": _godot_audio_worklet_create, + "ak": _godot_audio_worklet_start_no_threads, + "Sb": _godot_js_config_canvas_id_get, + "dh": _godot_js_config_locale_get, + "_b": _godot_js_display_alert, + "me": _godot_js_display_canvas_focus, + "xe": _godot_js_display_canvas_is_focused, + "ld": _godot_js_display_clipboard_get, + "vd": _godot_js_display_clipboard_set, + "Te": _godot_js_display_cursor_is_hidden, + "Ie": _godot_js_display_cursor_is_locked, + "Wa": _godot_js_display_cursor_lock_set, + "ob": _godot_js_display_cursor_set_custom_shape, + "Hf": _godot_js_display_cursor_set_shape, + "Xa": _godot_js_display_cursor_set_visible, + "yg": _godot_js_display_desired_size_set, + "oc": _godot_js_display_fullscreen_cb, + "Sf": _godot_js_display_fullscreen_exit, + "bg": _godot_js_display_fullscreen_request, + "Rj": _godot_js_display_glGetBufferSubData, + "ib": _godot_js_display_has_webgl, + "Yc": _godot_js_display_is_swap_ok_cancel, + "lc": _godot_js_display_notification_cb, + "cc": _godot_js_display_pixel_ratio_get, + "ec": _godot_js_display_screen_dpi_get, + "Jg": _godot_js_display_screen_size_get, + "gd": _godot_js_display_setup_canvas, + "Ug": _godot_js_display_size_update, + "ae": _godot_js_display_touchscreen_is_available, + "jc": _godot_js_display_vk_available, + "kc": _godot_js_display_vk_cb, + "hc": _godot_js_display_vk_hide, + "ic": _godot_js_display_vk_show, + "mc": _godot_js_display_window_blur_cb, + "Yb": _godot_js_display_window_icon_set, + "ng": _godot_js_display_window_size_get, + "Zb": _godot_js_display_window_title_set, + "zi": _godot_js_eval, + "qj": _godot_js_fetch_body_length_get, + "Aj": _godot_js_fetch_create, + "Jb": _godot_js_fetch_free, + "nj": _godot_js_fetch_http_status_get, + "rj": _godot_js_fetch_is_chunked, + "oj": _godot_js_fetch_read_chunk, + "mj": _godot_js_fetch_read_headers, + "eb": _godot_js_fetch_state_get, + "pc": _godot_js_input_drop_files_cb, + "rc": _godot_js_input_gamepad_cb, + "fc": _godot_js_input_gamepad_sample, + "Rd": _godot_js_input_gamepad_sample_count, + "Gd": _godot_js_input_gamepad_sample_get, + "sc": _godot_js_input_key_cb, + "wc": _godot_js_input_mouse_button_cb, + "vc": _godot_js_input_mouse_move_cb, + "uc": _godot_js_input_mouse_wheel_cb, + "qc": _godot_js_input_paste_cb, + "tc": _godot_js_input_touch_cb, + "Wb": _godot_js_input_vibrate_handheld, + "oi": _godot_js_os_download_buffer, + "ac": _godot_js_os_execute, + "oh": _godot_js_os_finish_async, + "Rb": _godot_js_os_fs_is_persistent, + "gc": _godot_js_os_fs_sync, + "$b": _godot_js_os_hw_concurrency_get, + "Tb": _godot_js_os_request_quit_cb, + "Xb": _godot_js_os_shell_open, + "Qb": _godot_js_pwa_cb, + "Vb": _godot_js_pwa_update, + "Ob": _godot_js_rtc_datachannel_close, + "Vj": _godot_js_rtc_datachannel_connect, + "Sj": _godot_js_rtc_datachannel_destroy, + "Wj": _godot_js_rtc_datachannel_get_buffered_amount, + "_j": _godot_js_rtc_datachannel_id_get, + "Xj": _godot_js_rtc_datachannel_is_negotiated, + "$j": _godot_js_rtc_datachannel_is_ordered, + "Uj": _godot_js_rtc_datachannel_label_get, + "Zj": _godot_js_rtc_datachannel_max_packet_lifetime_get, + "Yj": _godot_js_rtc_datachannel_max_retransmits_get, + "Tj": _godot_js_rtc_datachannel_protocol_get, + "Nb": _godot_js_rtc_datachannel_ready_state_get, + "Mb": _godot_js_rtc_datachannel_send, + "Qj": _godot_js_rtc_pc_close, + "Lj": _godot_js_rtc_pc_create, + "Kj": _godot_js_rtc_pc_datachannel_create, + "Lb": _godot_js_rtc_pc_destroy, + "Mj": _godot_js_rtc_pc_ice_candidate_add, + "Oj": _godot_js_rtc_pc_local_description_set, + "Pj": _godot_js_rtc_pc_offer_create, + "Nj": _godot_js_rtc_pc_remote_description_set, + "Kb": _godot_js_websocket_buffered_amount, + "Ij": _godot_js_websocket_close, + "Hj": _godot_js_websocket_create, + "Ib": _godot_js_websocket_destroy, + "Jj": _godot_js_websocket_send, + "Yi": _godot_js_wrapper_create_cb, + "Ki": _godot_js_wrapper_create_object, + "Ui": _godot_js_wrapper_interface_get, + "aj": _godot_js_wrapper_object_call, + "hj": _godot_js_wrapper_object_get, + "yb": _godot_js_wrapper_object_getvar, + "jj": _godot_js_wrapper_object_set, + "cj": _godot_js_wrapper_object_setvar, + "ci": _godot_js_wrapper_object_unref, + "vj": _godot_webxr_commit_for_eye, + "Ej": _godot_webxr_get_bounds_geometry, + "Fb": _godot_webxr_get_controller_axes, + "sj": _godot_webxr_get_controller_buttons, + "uj": _godot_webxr_get_controller_count, + "Ra": _godot_webxr_get_controller_target_ray_mode, + "tj": _godot_webxr_get_controller_transform, + "wj": _godot_webxr_get_projection_for_eye, + "yj": _godot_webxr_get_render_targetsize, + "xj": _godot_webxr_get_transform_for_eye, + "Dj": _godot_webxr_get_view_count, + "Fj": _godot_webxr_get_visibility_state, + "Bj": _godot_webxr_initialize, + "Gb": _godot_webxr_is_controller_connected, + "Gj": _godot_webxr_is_session_supported, + "Cj": _godot_webxr_is_supported, + "Hb": _godot_webxr_sample_controller_data, + "zj": _godot_webxr_uninitialize, + "za": invoke_ii, + "na": invoke_iii, + "gb": invoke_iiii, + "hb": invoke_iiiii, + "Dc": invoke_iiiiii, + "Bc": invoke_iiiiiii, + "zc": invoke_iij, + "ca": invoke_vi, + "oa": invoke_vii, + "ta": invoke_viii, + "sa": invoke_viiii, + "Ma": invoke_viiiiiii, + "l": _setTempRet0, + "Eb": _strftime, + "Nc": _strftime_l + }; + var asm = createWasm(); + var ___wasm_call_ctors = Module["___wasm_call_ctors"] = function() { + return (___wasm_call_ctors = Module["___wasm_call_ctors"] = Module["asm"]["ek"]).apply(null, arguments) + }; + var _free = Module["_free"] = function() { + return (_free = Module["_free"] = Module["asm"]["fk"]).apply(null, arguments) + }; + var __Z13godot_js_mainiPPc = Module["__Z13godot_js_mainiPPc"] = function() { + return (__Z13godot_js_mainiPPc = Module["__Z13godot_js_mainiPPc"] = Module["asm"]["gk"]).apply(null, arguments) + }; + var _main = Module["_main"] = function() { + return (_main = Module["_main"] = Module["asm"]["hk"]).apply(null, arguments) + }; + var _malloc = Module["_malloc"] = function() { + return (_malloc = Module["_malloc"] = Module["asm"]["ik"]).apply(null, arguments) + }; + var _htonl = Module["_htonl"] = function() { + return (_htonl = Module["_htonl"] = Module["asm"]["jk"]).apply(null, arguments) + }; + var _htons = Module["_htons"] = function() { + return (_htons = Module["_htons"] = Module["asm"]["kk"]).apply(null, arguments) + }; + var _ntohs = Module["_ntohs"] = function() { + return (_ntohs = Module["_ntohs"] = Module["asm"]["lk"]).apply(null, arguments) + }; + var _fflush = Module["_fflush"] = function() { + return (_fflush = Module["_fflush"] = Module["asm"]["mk"]).apply(null, arguments) + }; + var ___errno_location = Module["___errno_location"] = function() { + return (___errno_location = Module["___errno_location"] = Module["asm"]["nk"]).apply(null, arguments) + }; + var __emwebxr_on_input_event = Module["__emwebxr_on_input_event"] = function() { + return (__emwebxr_on_input_event = Module["__emwebxr_on_input_event"] = Module["asm"]["ok"]).apply(null, arguments) + }; + var __emwebxr_on_simple_event = Module["__emwebxr_on_simple_event"] = function() { + return (__emwebxr_on_simple_event = Module["__emwebxr_on_simple_event"] = Module["asm"]["pk"]).apply(null, arguments) + }; + var ___funcs_on_exit = Module["___funcs_on_exit"] = function() { + return (___funcs_on_exit = Module["___funcs_on_exit"] = Module["asm"]["qk"]).apply(null, arguments) + }; + var _setThrew = Module["_setThrew"] = function() { + return (_setThrew = Module["_setThrew"] = Module["asm"]["sk"]).apply(null, arguments) + }; + var stackSave = Module["stackSave"] = function() { + return (stackSave = Module["stackSave"] = Module["asm"]["tk"]).apply(null, arguments) + }; + var stackRestore = Module["stackRestore"] = function() { + return (stackRestore = Module["stackRestore"] = Module["asm"]["uk"]).apply(null, arguments) + }; + var stackAlloc = Module["stackAlloc"] = function() { + return (stackAlloc = Module["stackAlloc"] = Module["asm"]["vk"]).apply(null, arguments) + }; + var dynCall_iij = Module["dynCall_iij"] = function() { + return (dynCall_iij = Module["dynCall_iij"] = Module["asm"]["wk"]).apply(null, arguments) + }; + + function invoke_vii(index, a1, a2) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2) + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0) + } + } + + function invoke_vi(index, a1) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1) + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0) + } + } + + function invoke_viii(index, a1, a2, a3) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2, a3) + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0) + } + } + + function invoke_ii(index, a1) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1) + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0) + } + } + + function invoke_iii(index, a1, a2) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2) + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0) + } + } + + function invoke_iiiii(index, a1, a2, a3, a4) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2, a3, a4) + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0) + } + } + + function invoke_iiiiii(index, a1, a2, a3, a4, a5) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2, a3, a4, a5) + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0) + } + } + + function invoke_viiii(index, a1, a2, a3, a4) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2, a3, a4) + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0) + } + } + + function invoke_iiii(index, a1, a2, a3) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2, a3) + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0) + } + } + + function invoke_viiiiiii(index, a1, a2, a3, a4, a5, a6, a7) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7) + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0) + } + } + + function invoke_iiiiiii(index, a1, a2, a3, a4, a5, a6) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6) + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0) + } + } + + function invoke_iij(index, a1, a2, a3) { + var sp = stackSave(); + try { + return dynCall_iij(index, a1, a2, a3) + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0) + } + } + Module["cwrap"] = cwrap; + Module["callMain"] = callMain; + var calledRun; + + function ExitStatus(status) { + this.name = "ExitStatus"; + this.message = "Program terminated with exit(" + status + ")"; + this.status = status + } + var calledMain = false; + dependenciesFulfilled = function runCaller() { + if (!calledRun) run(); + if (!calledRun) dependenciesFulfilled = runCaller + }; + + function callMain(args) { + var entryFunction = Module["_main"]; + args = args || []; + args.unshift(thisProgram); + var argc = args.length; + var argv = stackAlloc((argc + 1) * 4); + var argv_ptr = argv >> 2; + args.forEach(arg => { + HEAP32[argv_ptr++] = allocateUTF8OnStack(arg) + }); + HEAP32[argv_ptr] = 0; + try { + var ret = entryFunction(argc, argv); + exit(ret, true); + return ret + } catch (e) { + return handleException(e) + } finally { + calledMain = true + } + } + + function run(args) { + args = args || arguments_; + if (runDependencies > 0) { + return + } + preRun(); + if (runDependencies > 0) { + return + } + + function doRun() { + if (calledRun) return; + calledRun = true; + Module["calledRun"] = true; + if (ABORT) return; + initRuntime(); + preMain(); + readyPromiseResolve(Module); + if (Module["onRuntimeInitialized"]) Module["onRuntimeInitialized"](); + if (shouldRunNow) callMain(args); + postRun() + } + if (Module["setStatus"]) { + Module["setStatus"]("Running..."); + setTimeout(function() { + setTimeout(function() { + Module["setStatus"]("") + }, 1); + doRun() + }, 1) + } else { + doRun() + } + } + Module["run"] = run; + + function exit(status, implicit) { + EXITSTATUS = status; + if (!keepRuntimeAlive()) { + exitRuntime() + } + procExit(status) + } + + function procExit(code) { + EXITSTATUS = code; + if (!keepRuntimeAlive()) { + if (Module["onExit"]) Module["onExit"](code); + ABORT = true + } + quit_(code, new ExitStatus(code)) + } + if (Module["preInit"]) { + if (typeof Module["preInit"] == "function") Module["preInit"] = [Module["preInit"]]; + while (Module["preInit"].length > 0) { + Module["preInit"].pop()() + } + } + var shouldRunNow = false; + if (Module["noInitialRun"]) shouldRunNow = false; + run(); + + + return Godot.ready + } + ); +})(); +if (typeof exports === 'object' && typeof module === 'object') + module.exports = Godot; +else if (typeof define === 'function' && define['amd']) + define([], function() { + return Godot; + }); +else if (typeof exports === 'object') + exports["Godot"] = Godot; + +const Preloader = /** @constructor */ function() { // eslint-disable-line no-unused-vars + function getTrackedResponse(response, load_status) { + function onloadprogress(reader, controller) { + return reader.read().then(function(result) { + if (load_status.done) { + return Promise.resolve(); + } + if (result.value) { + controller.enqueue(result.value); + load_status.loaded += result.value.length; + } + if (!result.done) { + return onloadprogress(reader, controller); + } + load_status.done = true; + return Promise.resolve(); + }); + } + const reader = response.body.getReader(); + return new Response(new ReadableStream({ + start: function(controller) { + onloadprogress(reader, controller).then(function() { + controller.close(); + }); + }, + }), { + headers: response.headers + }); + } + + function loadFetch(file, tracker, fileSize, raw) { + tracker[file] = { + total: fileSize || 0, + loaded: 0, + done: false, + }; + return fetch(file).then(function(response) { + if (!response.ok) { + return Promise.reject(new Error(`Failed loading file '${file}'`)); + } + const tr = getTrackedResponse(response, tracker[file]); + if (raw) { + return Promise.resolve(tr); + } + return tr.arrayBuffer(); + }); + } + + function retry(func, attempts = 1) { + function onerror(err) { + if (attempts <= 1) { + return Promise.reject(err); + } + return new Promise(function(resolve, reject) { + setTimeout(function() { + retry(func, attempts - 1).then(resolve).catch(reject); + }, 1000); + }); + } + return func().catch(onerror); + } + + const DOWNLOAD_ATTEMPTS_MAX = 4; + const loadingFiles = {}; + const lastProgress = { + loaded: 0, + total: 0 + }; + let progressFunc = null; + + const animateProgress = function() { + let loaded = 0; + let total = 0; + let totalIsValid = true; + let progressIsFinal = true; + + Object.keys(loadingFiles).forEach(function(file) { + const stat = loadingFiles[file]; + if (!stat.done) { + progressIsFinal = false; + } + if (!totalIsValid || stat.total === 0) { + totalIsValid = false; + total = 0; + } else { + total += stat.total; + } + loaded += stat.loaded; + }); + if (loaded !== lastProgress.loaded || total !== lastProgress.total) { + lastProgress.loaded = loaded; + lastProgress.total = total; + if (typeof progressFunc === 'function') { + progressFunc(loaded, total); + } + } + if (!progressIsFinal) { + requestAnimationFrame(animateProgress); + } + }; + + this.animateProgress = animateProgress; + + this.setProgressFunc = function(callback) { + progressFunc = callback; + }; + + this.loadPromise = function(file, fileSize, raw = false) { + return retry(loadFetch.bind(null, file, loadingFiles, fileSize, raw), DOWNLOAD_ATTEMPTS_MAX); + }; + + this.preloadedFiles = []; + this.preload = function(pathOrBuffer, destPath, fileSize) { + let buffer = null; + if (typeof pathOrBuffer === 'string') { + const me = this; + return this.loadPromise(pathOrBuffer, fileSize).then(function(buf) { + me.preloadedFiles.push({ + path: destPath || pathOrBuffer, + buffer: buf, + }); + return Promise.resolve(); + }); + } else if (pathOrBuffer instanceof ArrayBuffer) { + buffer = new Uint8Array(pathOrBuffer); + } else if (ArrayBuffer.isView(pathOrBuffer)) { + buffer = new Uint8Array(pathOrBuffer.buffer); + } + if (buffer) { + this.preloadedFiles.push({ + path: destPath, + buffer: pathOrBuffer, + }); + return Promise.resolve(); + } + return Promise.reject(new Error('Invalid object for preloading')); + }; +}; + +/** + * An object used to configure the Engine instance based on godot export options, and to override those in custom HTML + * templates if needed. + * + * @header Engine configuration + * @summary The Engine configuration object. This is just a typedef, create it like a regular object, e.g.: + * + * ``const MyConfig = { executable: 'godot', unloadAfterInit: false }`` + * + * @typedef {Object} EngineConfig + */ +const EngineConfig = {}; // eslint-disable-line no-unused-vars + +/** + * @struct + * @constructor + * @ignore + */ +const InternalConfig = function(initConfig) { // eslint-disable-line no-unused-vars + const cfg = /** @lends {InternalConfig.prototype} */ { + /** + * Whether the unload the engine automatically after the instance is initialized. + * + * @memberof EngineConfig + * @default + * @type {boolean} + */ + unloadAfterInit: true, + /** + * The HTML DOM Canvas object to use. + * + * By default, the first canvas element in the document will be used is none is specified. + * + * @memberof EngineConfig + * @default + * @type {?HTMLCanvasElement} + */ + canvas: null, + /** + * The name of the WASM file without the extension. (Set by Godot Editor export process). + * + * @memberof EngineConfig + * @default + * @type {string} + */ + executable: '', + /** + * An alternative name for the game pck to load. The executable name is used otherwise. + * + * @memberof EngineConfig + * @default + * @type {?string} + */ + mainPack: null, + /** + * Specify a language code to select the proper localization for the game. + * + * The browser locale will be used if none is specified. See complete list of + * :ref:`supported locales `. + * + * @memberof EngineConfig + * @type {?string} + * @default + */ + locale: null, + /** + * The canvas resize policy determines how the canvas should be resized by Godot. + * + * ``0`` means Godot won't do any resizing. This is useful if you want to control the canvas size from + * javascript code in your template. + * + * ``1`` means Godot will resize the canvas on start, and when changing window size via engine functions. + * + * ``2`` means Godot will adapt the canvas size to match the whole browser window. + * + * @memberof EngineConfig + * @type {number} + * @default + */ + canvasResizePolicy: 2, + /** + * The arguments to be passed as command line arguments on startup. + * + * See :ref:`command line tutorial `. + * + * **Note**: :js:meth:`startGame ` will always add the ``--main-pack`` argument. + * + * @memberof EngineConfig + * @type {Array} + * @default + */ + args: [], + /** + * When enabled, the game canvas will automatically grab the focus when the engine starts. + * + * @memberof EngineConfig + * @type {boolean} + * @default + */ + focusCanvas: true, + /** + * When enabled, this will turn on experimental virtual keyboard support on mobile. + * + * @memberof EngineConfig + * @type {boolean} + * @default + */ + experimentalVK: false, + /** + * The progressive web app service worker to install. + * @memberof EngineConfig + * @default + * @type {string} + */ + serviceWorker: '', + /** + * @ignore + * @type {Array.} + */ + persistentPaths: ['/userfs'], + /** + * @ignore + * @type {boolean} + */ + persistentDrops: false, + /** + * @ignore + * @type {Array.} + */ + gdnativeLibs: [], + /** + * @ignore + * @type {Array.} + */ + fileSizes: [], + /** + * A callback function for handling Godot's ``OS.execute`` calls. + * + * This is for example used in the Web Editor template to switch between project manager and editor, and for running the game. + * + * @callback EngineConfig.onExecute + * @param {string} path The path that Godot's wants executed. + * @param {Array.} args The arguments of the "command" to execute. + */ + /** + * @ignore + * @type {?function(string, Array.)} + */ + onExecute: null, + /** + * A callback function for being notified when the Godot instance quits. + * + * **Note**: This function will not be called if the engine crashes or become unresponsive. + * + * @callback EngineConfig.onExit + * @param {number} status_code The status code returned by Godot on exit. + */ + /** + * @ignore + * @type {?function(number)} + */ + onExit: null, + /** + * A callback function for displaying download progress. + * + * The function is called once per frame while downloading files, so the usage of ``requestAnimationFrame()`` + * is not necessary. + * + * If the callback function receives a total amount of bytes as 0, this means that it is impossible to calculate. + * Possible reasons include: + * + * - Files are delivered with server-side chunked compression + * - Files are delivered with server-side compression on Chromium + * - Not all file downloads have started yet (usually on servers without multi-threading) + * + * @callback EngineConfig.onProgress + * @param {number} current The current amount of downloaded bytes so far. + * @param {number} total The total amount of bytes to be downloaded. + */ + /** + * @ignore + * @type {?function(number, number)} + */ + onProgress: null, + /** + * A callback function for handling the standard output stream. This method should usually only be used in debug pages. + * + * By default, ``console.log()`` is used. + * + * @callback EngineConfig.onPrint + * @param {...*} [var_args] A variadic number of arguments to be printed. + */ + /** + * @ignore + * @type {?function(...*)} + */ + onPrint: function() { + console.log.apply(console, Array.from(arguments)); // eslint-disable-line no-console + }, + /** + * A callback function for handling the standard error stream. This method should usually only be used in debug pages. + * + * By default, ``console.error()`` is used. + * + * @callback EngineConfig.onPrintError + * @param {...*} [var_args] A variadic number of arguments to be printed as errors. + */ + /** + * @ignore + * @type {?function(...*)} + */ + onPrintError: function(var_args) { + console.error.apply(console, Array.from(arguments)); // eslint-disable-line no-console + }, + }; + + /** + * @ignore + * @struct + * @constructor + * @param {EngineConfig} opts + */ + function Config(opts) { + this.update(opts); + } + + Config.prototype = cfg; + + /** + * @ignore + * @param {EngineConfig} opts + */ + Config.prototype.update = function(opts) { + const config = opts || {}; + // NOTE: We must explicitly pass the default, accessing it via + // the key will fail due to closure compiler renames. + function parse(key, def) { + if (typeof(config[key]) === 'undefined') { + return def; + } + return config[key]; + } + // Module config + this.unloadAfterInit = parse('unloadAfterInit', this.unloadAfterInit); + this.onPrintError = parse('onPrintError', this.onPrintError); + this.onPrint = parse('onPrint', this.onPrint); + this.onProgress = parse('onProgress', this.onProgress); + + // Godot config + this.canvas = parse('canvas', this.canvas); + this.executable = parse('executable', this.executable); + this.mainPack = parse('mainPack', this.mainPack); + this.locale = parse('locale', this.locale); + this.canvasResizePolicy = parse('canvasResizePolicy', this.canvasResizePolicy); + this.persistentPaths = parse('persistentPaths', this.persistentPaths); + this.persistentDrops = parse('persistentDrops', this.persistentDrops); + this.experimentalVK = parse('experimentalVK', this.experimentalVK); + this.focusCanvas = parse('focusCanvas', this.focusCanvas); + this.serviceWorker = parse('serviceWorker', this.serviceWorker); + this.gdnativeLibs = parse('gdnativeLibs', this.gdnativeLibs); + this.fileSizes = parse('fileSizes', this.fileSizes); + this.args = parse('args', this.args); + this.onExecute = parse('onExecute', this.onExecute); + this.onExit = parse('onExit', this.onExit); + }; + + /** + * @ignore + * @param {string} loadPath + * @param {Response} response + */ + Config.prototype.getModuleConfig = function(loadPath, response) { + let r = response; + return { + 'print': this.onPrint, + 'printErr': this.onPrintError, + 'thisProgram': this.executable, + 'noExitRuntime': true, + 'dynamicLibraries': [`${loadPath}.side.wasm`], + 'instantiateWasm': function(imports, onSuccess) { + function done(result) { + onSuccess(result['instance'], result['module']); + } + if (typeof(WebAssembly.instantiateStreaming) !== 'undefined') { + WebAssembly.instantiateStreaming(Promise.resolve(r), imports).then(done); + } else { + r.arrayBuffer().then(function(buffer) { + WebAssembly.instantiate(buffer, imports).then(done); + }); + } + r = null; + return {}; + }, + 'locateFile': function(path) { + if (path.endsWith('.worker.js')) { + return `${loadPath}.worker.js`; + } else if (path.endsWith('.audio.worklet.js')) { + return `${loadPath}.audio.worklet.js`; + } else if (path.endsWith('.js')) { + return `${loadPath}.js`; + } else if (path.endsWith('.side.wasm')) { + return `${loadPath}.side.wasm`; + } else if (path.endsWith('.wasm')) { + return `${loadPath}.wasm`; + } + return path; + }, + }; + }; + + /** + * @ignore + * @param {function()} cleanup + */ + Config.prototype.getGodotConfig = function(cleanup) { + // Try to find a canvas + if (!(this.canvas instanceof HTMLCanvasElement)) { + const nodes = document.getElementsByTagName('canvas'); + if (nodes.length && nodes[0] instanceof HTMLCanvasElement) { + this.canvas = nodes[0]; + } + if (!this.canvas) { + throw new Error('No canvas found in page'); + } + } + // Canvas can grab focus on click, or key events won't work. + if (this.canvas.tabIndex < 0) { + this.canvas.tabIndex = 0; + } + + // Browser locale, or custom one if defined. + let locale = this.locale; + if (!locale) { + locale = navigator.languages ? navigator.languages[0] : navigator.language; + locale = locale.split('.')[0]; + } + locale = locale.replace('-', '_'); + const onExit = this.onExit; + + // Godot configuration. + return { + 'canvas': this.canvas, + 'canvasResizePolicy': this.canvasResizePolicy, + 'locale': locale, + 'persistentDrops': this.persistentDrops, + 'virtualKeyboard': this.experimentalVK, + 'focusCanvas': this.focusCanvas, + 'onExecute': this.onExecute, + 'onExit': function(p_code) { + cleanup(); // We always need to call the cleanup callback to free memory. + if (typeof(onExit) === 'function') { + onExit(p_code); + } + }, + }; + }; + return new Config(initConfig); +}; + +/** + * Projects exported for the Web expose the :js:class:`Engine` class to the JavaScript environment, that allows + * fine control over the engine's start-up process. + * + * This API is built in an asynchronous manner and requires basic understanding + * of `Promises `__. + * + * @module Engine + * @header HTML5 shell class reference + */ +const Engine = (function() { + const preloader = new Preloader(); + + let loadPromise = null; + let loadPath = ''; + let initPromise = null; + + /** + * @classdesc The ``Engine`` class provides methods for loading and starting exported projects on the Web. For default export + * settings, this is already part of the exported HTML page. To understand practical use of the ``Engine`` class, + * see :ref:`Custom HTML page for Web export `. + * + * @description Create a new Engine instance with the given configuration. + * + * @global + * @constructor + * @param {EngineConfig} initConfig The initial config for this instance. + */ + function Engine(initConfig) { // eslint-disable-line no-shadow + this.config = new InternalConfig(initConfig); + this.rtenv = null; + } + + /** + * Load the engine from the specified base path. + * + * @param {string} basePath Base path of the engine to load. + * @param {number=} [size=0] The file size if known. + * @returns {Promise} A Promise that resolves once the engine is loaded. + * + * @function Engine.load + */ + Engine.load = function(basePath, size) { + if (loadPromise == null) { + loadPath = basePath; + loadPromise = preloader.loadPromise(`${loadPath}.wasm`, size, true); + requestAnimationFrame(preloader.animateProgress); + } + return loadPromise; + }; + + /** + * Unload the engine to free memory. + * + * This method will be called automatically depending on the configuration. See :js:attr:`unloadAfterInit`. + * + * @function Engine.unload + */ + Engine.unload = function() { + loadPromise = null; + }; + + /** + * Check whether WebGL is available. Optionally, specify a particular version of WebGL to check for. + * + * @param {number=} [majorVersion=1] The major WebGL version to check for. + * @returns {boolean} If the given major version of WebGL is available. + * @function Engine.isWebGLAvailable + */ + Engine.isWebGLAvailable = function(majorVersion = 1) { + try { + return !!document.createElement('canvas').getContext(['webgl', 'webgl2'][majorVersion - 1]); + } catch (e) { /* Not available */ } + return false; + }; + + /** + * Safe Engine constructor, creates a new prototype for every new instance to avoid prototype pollution. + * @ignore + * @constructor + */ + function SafeEngine(initConfig) { + const proto = /** @lends Engine.prototype */ { + /** + * Initialize the engine instance. Optionally, pass the base path to the engine to load it, + * if it hasn't been loaded yet. See :js:meth:`Engine.load`. + * + * @param {string=} basePath Base path of the engine to load. + * @return {Promise} A ``Promise`` that resolves once the engine is loaded and initialized. + */ + init: function(basePath) { + if (initPromise) { + return initPromise; + } + if (loadPromise == null) { + if (!basePath) { + initPromise = Promise.reject(new Error('A base path must be provided when calling `init` and the engine is not loaded.')); + return initPromise; + } + Engine.load(basePath, this.config.fileSizes[`${basePath}.wasm`]); + } + const me = this; + + function doInit(promise) { + // Care! Promise chaining is bogus with old emscripten versions. + // This caused a regression with the Mono build (which uses an older emscripten version). + // Make sure to test that when refactoring. + return new Promise(function(resolve, reject) { + promise.then(function(response) { + const cloned = new Response(response.clone().body, { + 'headers': [ + ['content-type', 'application/wasm'] + ] + }); + Godot(me.config.getModuleConfig(loadPath, cloned)).then(function(module) { + const paths = me.config.persistentPaths; + module['initFS'](paths).then(function(err) { + me.rtenv = module; + if (me.config.unloadAfterInit) { + Engine.unload(); + } + resolve(); + }); + }); + }); + }); + } + preloader.setProgressFunc(this.config.onProgress); + initPromise = doInit(loadPromise); + return initPromise; + }, + + /** + * Load a file so it is available in the instance's file system once it runs. Must be called **before** starting the + * instance. + * + * If not provided, the ``path`` is derived from the URL of the loaded file. + * + * @param {string|ArrayBuffer} file The file to preload. + * + * If a ``string`` the file will be loaded from that path. + * + * If an ``ArrayBuffer`` or a view on one, the buffer will used as the content of the file. + * + * @param {string=} path Path by which the file will be accessible. Required, if ``file`` is not a string. + * + * @returns {Promise} A Promise that resolves once the file is loaded. + */ + preloadFile: function(file, path) { + return preloader.preload(file, path, this.config.fileSizes[file]); + }, + + /** + * Start the engine instance using the given override configuration (if any). + * :js:meth:`startGame ` can be used in typical cases instead. + * + * This will initialize the instance if it is not initialized. For manual initialization, see :js:meth:`init `. + * The engine must be loaded beforehand. + * + * Fails if a canvas cannot be found on the page, or not specified in the configuration. + * + * @param {EngineConfig} override An optional configuration override. + * @return {Promise} Promise that resolves once the engine started. + */ + start: function(override) { + this.config.update(override); + const me = this; + return me.init().then(function() { + if (!me.rtenv) { + return Promise.reject(new Error('The engine must be initialized before it can be started')); + } + + let config = {}; + try { + config = me.config.getGodotConfig(function() { + me.rtenv = null; + }); + } catch (e) { + return Promise.reject(e); + } + // Godot configuration. + me.rtenv['initConfig'](config); + + // Preload GDNative libraries. + const libs = []; + me.config.gdnativeLibs.forEach(function(lib) { + libs.push(me.rtenv['loadDynamicLibrary'](lib, { + 'loadAsync': true + })); + }); + return Promise.all(libs).then(function() { + return new Promise(function(resolve, reject) { + preloader.preloadedFiles.forEach(function(file) { + me.rtenv['copyToFS'](file.path, file.buffer); + }); + preloader.preloadedFiles.length = 0; // Clear memory + me.rtenv['callMain'](me.config.args); + initPromise = null; + if (me.config.serviceWorker && 'serviceWorker' in navigator) { + navigator.serviceWorker.register(me.config.serviceWorker); + } + resolve(); + }); + }); + }); + }, + + /** + * Start the game instance using the given configuration override (if any). + * + * This will initialize the instance if it is not initialized. For manual initialization, see :js:meth:`init `. + * + * This will load the engine if it is not loaded, and preload the main pck. + * + * This method expects the initial config (or the override) to have both the :js:attr:`executable` and :js:attr:`mainPack` + * properties set (normally done by the editor during export). + * + * @param {EngineConfig} override An optional configuration override. + * @return {Promise} Promise that resolves once the game started. + */ + startGame: function(override) { + this.config.update(override); + // Add main-pack argument. + const exe = this.config.executable; + const pack = this.config.mainPack || `${exe}.pck`; + this.config.args = ['--main-pack', pack].concat(this.config.args); + // Start and init with execName as loadPath if not inited. + const me = this; + return Promise.all([ + this.init(exe), + this.preloadFile(pack, pack), + ]).then(function() { + return me.start.apply(me); + }); + }, + + /** + * Create a file at the specified ``path`` with the passed as ``buffer`` in the instance's file system. + * + * @param {string} path The location where the file will be created. + * @param {ArrayBuffer} buffer The content of the file. + */ + copyToFS: function(path, buffer) { + if (this.rtenv == null) { + throw new Error('Engine must be inited before copying files'); + } + this.rtenv['copyToFS'](path, buffer); + }, + + /** + * Request that the current instance quit. + * + * This is akin the user pressing the close button in the window manager, and will + * have no effect if the engine has crashed, or is stuck in a loop. + * + */ + requestQuit: function() { + if (this.rtenv) { + this.rtenv['request_quit'](); + } + }, + }; + + Engine.prototype = proto; + // Closure compiler exported instance methods. + Engine.prototype['init'] = Engine.prototype.init; + Engine.prototype['preloadFile'] = Engine.prototype.preloadFile; + Engine.prototype['start'] = Engine.prototype.start; + Engine.prototype['startGame'] = Engine.prototype.startGame; + Engine.prototype['copyToFS'] = Engine.prototype.copyToFS; + Engine.prototype['requestQuit'] = Engine.prototype.requestQuit; + // Also expose static methods as instance methods + Engine.prototype['load'] = Engine.load; + Engine.prototype['unload'] = Engine.unload; + Engine.prototype['isWebGLAvailable'] = Engine.isWebGLAvailable; + return new Engine(initConfig); + } + + // Closure compiler exported static methods. + SafeEngine['load'] = Engine.load; + SafeEngine['unload'] = Engine.unload; + SafeEngine['isWebGLAvailable'] = Engine.isWebGLAvailable; + + return SafeEngine; +}()); +if (typeof window !== 'undefined') { + window['Engine'] = Engine; +} \ No newline at end of file diff --git a/shucks-pumpkin-panic/ShucksPumpkinPanic.pck b/shucks-pumpkin-panic/ShucksPumpkinPanic.pck new file mode 100644 index 0000000..76be59f Binary files /dev/null and b/shucks-pumpkin-panic/ShucksPumpkinPanic.pck differ diff --git a/shucks-pumpkin-panic/ShucksPumpkinPanic.wasm b/shucks-pumpkin-panic/ShucksPumpkinPanic.wasm new file mode 100644 index 0000000..5151d56 Binary files /dev/null and b/shucks-pumpkin-panic/ShucksPumpkinPanic.wasm differ diff --git a/shucks-pumpkin-panic/index.html b/shucks-pumpkin-panic/index.html new file mode 100644 index 0000000..e8932dd --- /dev/null +++ b/shucks-pumpkin-panic/index.html @@ -0,0 +1,287 @@ + + + + + + + Shucks Pumpkin Panic + + + + + + + + + HTML5 canvas appears to be unsupported in the current browser.
+ Please try updating or use a different browser. + +
+ + + +
+ + + + + + \ No newline at end of file