diff --git a/.Rbuildignore b/.Rbuildignore
index b8ad5dc..94d5c04 100644
--- a/.Rbuildignore
+++ b/.Rbuildignore
@@ -10,3 +10,6 @@
^data-raw$
^README\.Rmd$
^LICENSE\.md$
+^_pkgdown\.yml$
+^docs$
+^pkgdown$
diff --git a/.gitignore b/.gitignore
index 728e389..97e604b 100644
--- a/.gitignore
+++ b/.gitignore
@@ -2,3 +2,5 @@
.Rhistory
.RData
.DS_Store
+/doc/
+/Meta/
diff --git a/DESCRIPTION b/DESCRIPTION
index e725390..d0c5d69 100644
--- a/DESCRIPTION
+++ b/DESCRIPTION
@@ -1,6 +1,6 @@
Package: VoCC
Title: The Velocity of Climate Change and related climatic metrics
-Version: 1.0.1
+Version: 0.0.1
Authors@R: c(person("Jorge", "Garcia Molinos", email = "jorgegmolinos@arc.hokudai.ac.jp", role = c("aut", "cre")),
person("David", "S. Schoeman", email = "", role = "aut"),
person("Christopher", "J. Brown", email = "", role = "aut"),
@@ -10,39 +10,42 @@ Description: Functions to calculate the velocity of climate change (VoCC) and re
both gradient-based (Burrows et al. 2011, Burrows et al. 2014), and distance-based (Hamann et a. 2013,
Garcia Molinos et al. 2017) approaches.
Depends: R (>= 3.5)
-Imports:
+Imports:
assertthat,
CircStats,
cowplot,
data.table,
doParallel,
+ dplyr,
foreach,
- gdistance,
geosphere,
- ggplot2,
magrittr,
- parallel,
+ parallelly,
RColorBrewer,
rlang,
- sp,
+ sf,
stats,
terra,
+ tibble,
+ tidyr,
+ tidyselect,
xts
Suggests:
- gridExtra,
+ ggplot2,
knitr,
mapplots,
ncdf4,
- prettydoc,
- rasterVis,
- repmis,
+ patchwork,
+ purrr,
rmarkdown,
- scales
-URL: https://github.com/JorGarMol/VoCC
-BugReports: https://github.com/JorGarMol/VoCC/issues
+ scales,
+ tidyterra,
+ VoCCdata
+URL: https://mathmarecol.github.io/VoCC/
+BugReports: https://github.com/MathMarEcol/VoCC/issues
License: AGPL (>= 3)
Encoding: UTF-8
LazyData: true
-RoxygenNote: 7.3.1
+RoxygenNote: 7.3.2
VignetteBuilder: knitr,
rmarkdown
diff --git a/Meta/vignette.rds b/Meta/vignette.rds
index 2529a6e..baf81b9 100644
Binary files a/Meta/vignette.rds and b/Meta/vignette.rds differ
diff --git a/NAMESPACE b/NAMESPACE
index 2ef3380..2517e72 100644
--- a/NAMESPACE
+++ b/NAMESPACE
@@ -1,7 +1,6 @@
# Generated by roxygen2: do not edit by hand
export("%>%")
-export(VoCC_get_data)
export(climPCA)
export(climPlot)
export(dVoCC)
@@ -18,3 +17,4 @@ importFrom(data.table,":=")
importFrom(foreach,"%dopar%")
importFrom(magrittr,"%>%")
importFrom(rlang,.data)
+importFrom(stats,na.omit)
diff --git a/R/climPCA.R b/R/climPCA.R
index 668f323..7356993 100644
--- a/R/climPCA.R
+++ b/R/climPCA.R
@@ -22,7 +22,7 @@
#' @export
#' @author Jorge Garcia Molinos
#' @examples
-#'
+#' \dontrun{
#' JapTC <- VoCC_get_data("JapTC.tif")
#'
#' comp <- climPCA(JapTC[[c(1, 3, 5)]], JapTC[[c(2, 4, 6)]],
@@ -31,6 +31,8 @@
#' # Create a data frame with the necessary variables in the required order (see climAna? for details)
#' clim <- comp[[2]][, c(2, 4, 3, 5, 1)]
#' clim[, c("x", "y")] <- terra::xyFromCell(JapTC[[1]], clim$cid)
+#' }
+#'
climPCA <- function(climp, climf, trans = function(x) log(x), cen = TRUE, sc = TRUE, th = 0.8) {
# get a data table with the pooled values (current/future) of the clim variables
clim <- data.table::data.table(rbind(terra::values(climp), terra::values(climf)))
diff --git a/R/climPlot.R b/R/climPlot.R
index f7904aa..73f979f 100644
--- a/R/climPlot.R
+++ b/R/climPlot.R
@@ -17,7 +17,7 @@
#' @export
#' @author Jorge Garcia Molinos and Naoki H. Kumagai
#' @examples
-#'
+#' \dontrun{
#' JapTC <- VoCC_get_data("JapTC.tif")
#'
#' # Plot climate space for the two first variables(annual precipitation and maximum temperature)
@@ -32,7 +32,6 @@
#' y.name = "Temperature max (°C)"
#' )
#'
-#' \dontrun{
#' # output plots can be saved as:
#' ggplot2::ggsave(
#' plot = out, filename = file.path(getwd(), "example_plot.pdf"),
@@ -44,6 +43,7 @@ climPlot <- function(xy, x.binSize, y.binSize, x.name = "V1", y.name = "V2") {
yp <- xy[, 3]
xf <- xy[, 2]
yf <- xy[, 4]
+
# bins per axis
x.nbins <- floor((abs(range(xp, xf)[2] - range(xp, xf)[1])) / x.binSize)
y.nbins <- floor((abs(range(yp, yf)[2] - range(yp, yf)[1])) / y.binSize)
@@ -102,7 +102,7 @@ climPlot <- function(xy, x.binSize, y.binSize, x.name = "V1", y.name = "V2") {
Freq2D <- data.frame(x = x.bin, y = rep(y.bin, each = length(x.bin)), freq = Freq2D)
Freq2D <- Freq2D[!is.na(Freq2D$freq), ]
- panelAB <- ggplot2::ggplot(Freq2Dpf, ggplot2::aes(x = x, y = y, fill = freq)) +
+ panelAB <- ggplot2::ggplot(Freq2Dpf, ggplot2::aes(x = .data$x, y = .data$y, fill = freq)) +
ggplot2::geom_raster() +
ggplot2::scale_fill_gradientn(
colors = r,
@@ -121,7 +121,7 @@ climPlot <- function(xy, x.binSize, y.binSize, x.name = "V1", y.name = "V2") {
strip.text = ggplot2::element_blank()
)
- panelC <- ggplot2::ggplot(Freq2D, ggplot2::aes(x = x, y = y, fill = freq)) +
+ panelC <- ggplot2::ggplot(Freq2D, ggplot2::aes(x = .data$x, y = .data$y, fill = freq)) +
ggplot2::geom_raster() +
ggplot2::scale_fill_manual(values = c("#56B4E9", "#009E73", "#D55E00"), name = "Climate type") +
ggplot2::labs(x = x.name, y = y.name)
diff --git a/R/dVoCC.R b/R/dVoCC.R
index caa6ddc..d9e7c69 100644
--- a/R/dVoCC.R
+++ b/R/dVoCC.R
@@ -14,7 +14,7 @@
#' These columns are not required if using the "Single" method. The last three columns of the table should contain an identifyier and centroid coordinates of each cell.
#' @param n \code{integer} defining the number of climatic variables.
#' @param tdiff \code{integer} defining the number of years (or other temporal unit) between periods.
-#' @param method \code{ch)aracter string} specifying the analogue method to be used. 'Single': a constant, single analogue threshold
+#' @param method \code{character string} specifying the analogue method to be used. 'Single': a constant, single analogue threshold
#' for each climate variable is applied to all cells (Ohlemuller et al. 2006, Hamann et al. 2015); climate analogy corresponds to target cells
#' with values below the specified threshold for each climatic variable. 'Variable': a cell-specific climate threshold is used for each climatic variable
#' to determine the climate analogues associated with each cell by reference to its baseline climatic variability (Garcia Molinos et al. 2017).
@@ -41,6 +41,7 @@
#' @export
#' @author Jorge Garcia Molinos
#' @examples
+#' \dontrun{
#' JapTC <- VoCC_get_data("JapTC.tif")
#'
#' # Create a data frame with the necessary variables in the required order
@@ -53,15 +54,13 @@
#' geoTol = 160, distfun = "GreatCircle", trans = NA, lonlat = TRUE
#' )
#'
-#' r1 <- JapTC
+#' r1 <- JapTC[[1]]
#' r1[avocc1$focal] <- avocc1$vel
#' terra::plot(r1)
#'
-#' \dontrun{
-#'
#' # Cell-specific, distance-unrestricted climate analogue velocity based on least-cost path distances
#' # First, create the conductance matrix (all land cells considered to have conductance of 1)
-#' r <- JapTC
+#' r <- JapTC[[1]]
#' r[!is.na(JapTC[[1]])] <- 1
#' h8 <- gdistance::transition(r, transitionFunction = mean, directions = 8)
#' h8 <- gdistance::geoCorrection(h8, type = "c")
@@ -73,7 +72,7 @@
#' )
#'
#' # Plot results
-#' r1 <- r2 <- JapTC
+#' r1 <- r2 <- JapTC[[1]]
#' r1[avocc1$focal] <- avocc1$vel
#' r2[avocc2$focal] <- avocc2$vel
#' terra::plot(c(r1, r2))
@@ -82,13 +81,17 @@
dVoCC <- function(clim, n, tdiff, method = "Single", climTol, geoTol,
distfun = "GreatCircle", trans = NA, lonlat = TRUE) {
- geoDis <- climDis <- ang <- vel <- target <- cid <- NULL # Fix devtools check warnings
+ geoDis <- climDis <- ang <- vel <- target <- cid <- a <- NULL # Fix devtools check warnings
- if (distfun == "Euclidean" & lonlat == TRUE) {
+ if (distfun == "Euclidean" && lonlat == TRUE) {
print("Error: Euclidean distances specified for unprojected coordinates")
stop()
}
+ if (distfun == "LeastCost") {
+ stop("LeastCost distances are not currently supported. Use 'Euclidean' or 'GreatCircle' instead.")
+ }
+
assertthat::assert_that(
all(distfun %in% c("Euclidean", "GreatCircle")),
is.na(trans)
@@ -99,20 +102,89 @@ dVoCC <- function(clim, n, tdiff, method = "Single", climTol, geoTol,
# matrix with the future climatic values for all cells
fut <- dat[, seq(2, (2 * n), by = 2), with = FALSE]
- # set things up for parallel processing
- cores <- parallel::detectCores()
- ncores <- cores[1] - 1
- cuts <- cut(1:nrow(dat), ncores, labels = FALSE)
- cl <- parallel::makeCluster(ncores)
-
- doParallel::registerDoParallel(cl)
-
- result <- foreach::foreach(x = 1:ncores, .combine = rbind, .packages = c("terra", "gdistance", "geosphere", "data.table"), .multicombine = TRUE) %dopar% {
- a <- x
- Dat <- dat[cuts == a, ]
-
- resu <- data.table::data.table(
- focal = Dat$cid,
+ # Determine optimal number of cores, ensuring we don't exceed data rows
+ ncores <- parallelly::availableCores(constraints = "connections", omit = 2)
+ ncores <- min(ncores, nrow(dat)) # Don't use more cores than data rows
+ ncores <- max(ncores, 1) # Ensure at least 1 core
+
+ # Only use parallel processing if we have multiple cores and sufficient data
+ if (ncores > 1 && nrow(dat) > ncores) {
+ cuts <- cut(seq_len(nrow(dat)), ncores, labels = FALSE)
+ cl <- parallelly::makeClusterPSOCK(ncores, autoStop = TRUE)
+
+ doParallel::registerDoParallel(cl)
+
+ result <- foreach::foreach(a = seq_len(ncores),
+ .combine = rbind,
+ .packages = c("terra", "gdistance", "geosphere", "data.table"),
+ .multicombine = TRUE) %dopar% {
+
+ Dat <- dat[cuts == a, ]
+
+ resu <- data.table::data.table(
+ focal = Dat$cid,
+ target = as.integer(NA),
+ climDis = as.double(NA),
+ geoDis = as.double(NA),
+ ang = as.double(NA),
+ vel = as.double(NA)
+ )
+
+ i <- 0
+ while (i <= nrow(Dat)) {
+ i <- i + 1
+
+ # for each focal cell subset target cell analogues (within ClimTol)
+ pres <- as.numeric(Dat[i, seq(1, (2 * n), by = 2), with = FALSE])
+ dif <- data.table::data.table(sweep(fut, 2, pres, "-"))
+
+ # Identify future analogue cells
+ if (method == "Single") { # Ohlemuller et al 2006 / Hamann et al 2015
+ upper <- colnames(dif)
+ l <- lapply(upper, function(x) call("<", call("abs", as.name(x)), climTol[grep(x, colnames(dif))]))
+ ii <- Reduce(function(c1, c2) substitute(.c1 & .c2, list(.c1 = c1, .c2 = c2)), l)
+ anacid <- dat$cid[dif[eval(ii), which = TRUE]] # cids analogue cells
+ }
+
+ if (method == "Variable") { # Garcia Molinos et al. 2017
+ climTol <- as.numeric(Dat[i, ((2 * n) + 1):(3 * n), with = FALSE]) # focal cell tolerance
+ upper <- colnames(dif)
+ l <- lapply(upper, function(x) call("<", call("abs", as.name(x)), climTol[grep(x, colnames(dif))]))
+ ii <- Reduce(function(c1, c2) substitute(.c1 & .c2, list(.c1 = c1, .c2 = c2)), l)
+ anacid <- dat$cid[dif[eval(ii), which = TRUE]] # cids analogue cells
+ }
+
+ # LOCATE CLOSEST ANALOGUE
+ if (length(anacid) > 0) {
+ # check which of those are within distance and get the analogue at minimum distance
+ if (distfun == "Euclidean") {
+ d <- stats::dist(cbind(Dat$x[i], Dat$y[i]), cbind(dat$x[dat$cid %in% anacid], dat$y[dat$cid %in% anacid]))
+ } # in x/y units
+ if (distfun == "GreatCircle") {
+ d <- (geosphere::distHaversine(cbind(Dat$x[i], Dat$y[i]), cbind(dat$x[dat$cid %in% anacid], dat$y[dat$cid %in% anacid]))) / 1000
+ } # in km
+
+ # LeastCost distances not supported - error is thrown at function start
+
+ an <- anacid[d < geoTol] # cids analogue cells within search radius
+ dis <- d[d < geoTol] # distance to candidate analogues
+ if (length(an) > 0) {
+ resu[i, target := an[which.min(dis)]] # cid of geographically closest climate analogue
+ if (method == "Single") {
+ resu[i, climDis := mean(as.numeric(dif[which(anacid == resu[i, target]), ]))]
+ } # mean clim difference for the closest analogue
+ resu[i, geoDis := min(dis)]
+ resu[i, ang := geosphere::bearing(Dat[i, c("x", "y")], dat[cid == resu[i, target], c("x", "y")])]
+ resu[i, vel := resu$geoDis[i] / tdiff]
+ }
+ }
+ }
+ return(resu)
+ }
+ } else {
+ # Sequential processing for small datasets or limited cores
+ result <- data.table::data.table(
+ focal = dat$cid,
target = as.integer(NA),
climDis = as.double(NA),
geoDis = as.double(NA),
@@ -120,12 +192,9 @@ dVoCC <- function(clim, n, tdiff, method = "Single", climTol, geoTol,
vel = as.double(NA)
)
- i <- 0
- while (i <= nrow(Dat)) {
- i <- i + 1
-
+ for (i in seq_len(nrow(dat))) {
# for each focal cell subset target cell analogues (within ClimTol)
- pres <- as.numeric(Dat[i, seq(1, (2 * n), by = 2), with = FALSE])
+ pres <- as.numeric(dat[i, seq(1, (2 * n), by = 2), with = FALSE])
dif <- data.table::data.table(sweep(fut, 2, pres, "-"))
# Identify future analogue cells
@@ -137,7 +206,7 @@ dVoCC <- function(clim, n, tdiff, method = "Single", climTol, geoTol,
}
if (method == "Variable") { # Garcia Molinos et al. 2017
- climTol <- as.numeric(Dat[i, ((2 * n) + 1):(3 * n), with = FALSE]) # focal cell tolerance
+ climTol <- as.numeric(dat[i, ((2 * n) + 1):(3 * n), with = FALSE]) # focal cell tolerance
upper <- colnames(dif)
l <- lapply(upper, function(x) call("<", call("abs", as.name(x)), climTol[grep(x, colnames(dif))]))
ii <- Reduce(function(c1, c2) substitute(.c1 & .c2, list(.c1 = c1, .c2 = c2)), l)
@@ -148,36 +217,26 @@ dVoCC <- function(clim, n, tdiff, method = "Single", climTol, geoTol,
if (length(anacid) > 0) {
# check which of those are within distance and get the analogue at minimum distance
if (distfun == "Euclidean") {
- d <- stats::dist(cbind(Dat$x[i], Dat$y[i]), cbind(dat$x[dat$cid %in% anacid], dat$y[dat$cid %in% anacid]))
+ d <- stats::dist(cbind(dat$x[i], dat$y[i]), cbind(dat$x[dat$cid %in% anacid], dat$y[dat$cid %in% anacid]))
} # in x/y units
if (distfun == "GreatCircle") {
- d <- (geosphere::distHaversine(cbind(Dat$x[i], Dat$y[i]), cbind(dat$x[dat$cid %in% anacid], dat$y[dat$cid %in% anacid]))) / 1000
+ d <- (geosphere::distHaversine(cbind(dat$x[i], dat$y[i]), cbind(dat$x[dat$cid %in% anacid], dat$y[dat$cid %in% anacid]))) / 1000
} # in km
- # TODO transition matrices not possible at the moment as gdistance has not been updated for terra
- # if(distfun == "LeastCost"){
- # SL <- gdistance::shortestPath(trans, cbind(Dat$x[i],Dat$y[i]), cbind(dat$x[dat$cid %in% anacid], dat$y[dat$cid %in% anacid]), output="SpatialLines")
- # d <- SpatialLinesLengths(SL, longlat = lonlat) # in km for longlat TRUE
- # # correct for analogues that are within search distance but have no directed path with the focal cell (i.e. conductivity = 0)
- # d[which(d == 0 & anacid != Dat$cid[i])] <- Inf
- # }
-
an <- anacid[d < geoTol] # cids analogue cells within search radius
dis <- d[d < geoTol] # distance to candidate analogues
if (length(an) > 0) {
- resu[i, target := an[which.min(dis)]] # cid of geographically closest climate analogue
+ result[i, target := an[which.min(dis)]] # cid of geographically closest climate analogue
if (method == "Single") {
- resu[i, climDis := mean(as.numeric(dif[which(anacid == resu[i, target]), ]))]
+ result[i, climDis := mean(as.numeric(dif[which(anacid == result[i, target]), ]))]
} # mean clim difference for the closest analogue
- resu[i, geoDis := min(dis)]
- resu[i, ang := geosphere::bearing(Dat[i, c("x", "y")], dat[cid == resu[i, target], c("x", "y")])]
- resu[i, vel := resu$geoDis[i] / tdiff]
+ result[i, geoDis := min(dis)]
+ result[i, ang := geosphere::bearing(dat[i, c("x", "y")], dat[cid == result[i, target], c("x", "y")])]
+ result[i, vel := result$geoDis[i] / tdiff]
}
}
}
- return(resu)
}
- parallel::stopCluster(cl)
return(result)
}
diff --git a/R/gVoCC.R b/R/gVoCC.R
index 1e1d55e..8a9e21d 100644
--- a/R/gVoCC.R
+++ b/R/gVoCC.R
@@ -19,7 +19,7 @@
#' @author Jorge Garcia Molinos
#'
#' @examples
-#'
+#' \dontrun{
#' HSST <- VoCC_get_data("HSST.tif")
#' yrSST <- sumSeries(HSST,
#' p = "1960-01/2009-12", yr0 = "1955-01-01", l = terra::nlyr(HSST),
@@ -32,6 +32,7 @@
#'
#' v <- gVoCC(tr, sg)
#' terra::plot(v)
+#' }
#'
gVoCC <- function(tempTrend, spatGrad) {
VoCC <- tempTrend[[1]] / spatGrad[[1]]
diff --git a/R/resTime.R b/R/resTime.R
index fee7b4e..a8e327a 100644
--- a/R/resTime.R
+++ b/R/resTime.R
@@ -2,7 +2,7 @@
#'
#' Function to calculate VoCC-based residence time of isotherms within a polygon after Loaire et al. (2009)
#'
-#' @param pg \code{SpatialPolygon} or a \code{SpatialPolygonsDataFrame} containing the polygons for which
+#' @param pg \code{sf} object or \code{terra::vect} object containing the polygons for which
#' the residence time is to be calculated. The polygons must be on the same coordinate system as vel.
#' @param vel \code{raster} with climate velocity (km/year) for the period of interest.
#' @param areapg \code{vector} with the area (in km2) of the polygons. Use NA (default) to calculate internally if field not avilable.
@@ -44,26 +44,59 @@
#' # Using a user defined polygon
#' x_coord <- c(-28, -20, -20.3, -25.5)
#' y_coord <- c(60, 61, 63, 62)
-#' p <- Polygon(cbind(x_coord, y_coord))
-#' sps <- SpatialPolygons(list(Polygons(list(p), 1)))
-#' a3 <- resTime(sps, vel, areapg = NA)
+#' coords <- matrix(c(x_coord, y_coord), ncol = 2)
+#' poly_sf <- sf::st_sf(geometry = sf::st_sfc(sf::st_polygon(list(coords))))
+#' a3 <- resTime(poly_sf, vel, areapg = NA)
#'
#' terra::plot(vel)
-#' terra::plot(EEZ, add = TRUE)
-#' terra::plot(sps, add = TRUE)
+#' plot(sf::st_geometry(EEZ), add = TRUE)
+#' plot(sf::st_geometry(poly_sf), add = TRUE)
#' }
resTime <- function(pg, vel, areapg = NA) {
+
resTim <- v <- d <- NULL # Fix devtools check warnings
- RT <- suppressWarnings(
- data.table::data.table(ID = sp::getSpPPolygonsIDSlots(pg)) # TODO Is this just accessing the actual polygons?
- )
+ # Handle both sf and terra::vect objects
+ if (inherits(pg, "sf")) {
+ pg_vect <- terra::vect(pg)
+ n_features <- nrow(pg)
+ } else if (inherits(pg, "SpatVector")) {
+ pg_vect <- pg
+ n_features <- nrow(pg)
+ } else {
+ stop("pg must be an sf object or a terra::vect (SpatVector) object")
+ }
+
+ # Create ID sequence based on number of features
+ RT <- data.table::data.table(ID = seq_len(n_features))
- RT[, v := terra::extract(vel, pg, fun = mean, na.rm = TRUE)]
+ # Extract velocity values using terra::vect for efficiency
+ extracted_values <- terra::extract(vel, pg_vect, fun = mean, na.rm = TRUE)
+
+ # Handle case where extraction returns NULL or empty results
+ if (is.null(extracted_values) || nrow(extracted_values) == 0) {
+ stop("No values could be extracted from the raster. Check that polygons overlap with the raster and have the same coordinate system.")
+ }
+
+ # Extract the mean values, handling potential column name variations
+ if ("mean" %in% names(extracted_values)) {
+ RT[, v := extracted_values$mean]
+ } else if (ncol(extracted_values) >= 2) {
+ # If no 'mean' column, use the second column (first is usually ID)
+ RT[, v := extracted_values[[2]]]
+ } else {
+ stop("Unexpected format from terra::extract(). Please check your input data.")
+ }
# If not provided, calculate the area of the polygon
if (all(is.na(areapg))) {
- areapg <- geosphere::areaPolygon(pg) / 1000000 # area polygon in km2 #TODO I think we can do this internally, potentially with terra, without an extra package
+ if (inherits(pg, "sf")) {
+ # Calculate area in km2 using sf::st_area
+ areapg <- as.numeric(sf::st_area(pg)) / 1000000 # Convert from m2 to km2
+ } else {
+ # Calculate area in km2 using terra::expanse
+ areapg <- terra::expanse(pg_vect, unit = "km")
+ }
}
RT[, d := 2 * sqrt((areapg / pi))]
diff --git a/R/shiftTime.R b/R/shiftTime.R
index 2c1a725..5148bc5 100644
--- a/R/shiftTime.R
+++ b/R/shiftTime.R
@@ -21,10 +21,12 @@
#' @export
#' @author Jorge Garcia Molinos and Michael T. Burrows
#' @examples
+#' \dontrun{
#' HSST <- VoCC_get_data("HSST.tif")
#' Apr <- shiftTime(HSST, yr1 = 1960, yr2 = 2009, yr0 = 1955, th = 10, m = 4)
#'
#' terra::plot(Apr)
+#' }
shiftTime <- function(r, yr1, yr2, yr0, th, m) {
# 1. Long term trends in monthly values (e.g. deg/year if temperature)
m1 <- ((yr1 - yr0) * 12) + m
diff --git a/R/spatGrad.R b/R/spatGrad.R
index 179833a..60b7e87 100644
--- a/R/spatGrad.R
+++ b/R/spatGrad.R
@@ -21,11 +21,12 @@
#' @seealso{\code{\link{tempTrend}}, \code{\link{gVoCC}}}
#'
#' @importFrom rlang .data
+#' @importFrom stats na.omit
#'
#' @export
#' @author Jorge Garcia Molinos, David S. Schoeman, and Michael T. Burrows
#' @examples
-#'
+#' \dontrun{
#' HSST <- VoCC_get_data("HSST.tif")
#'
#' yrSST <- sumSeries(HSST,
@@ -38,13 +39,16 @@
#' sg <- spatGrad(yrSST, th = 0.0001, projected = FALSE)
#'
#' terra::plot(sg)
+#' }
#'
spatGrad <- function(r, th = -Inf, projected = FALSE) {
+
# Fix devtools check warnings
+ "." <- NULL
gradNS1 <- gradNS2 <- gradNS3 <- gradNS4 <- gradNS5 <- gradNS6 <- gradWE1 <- gradWE2 <- gradWE3 <- gradWE4 <- gradWE5 <- gradWE6 <- NULL
sy <- sx <- NSgrad <- WEgrad <- NULL
clim <- climE <- climN <- climNE <- climNW <- climS <- climSE <- climSW <- climW <- climFocal <- NULL
- to <- code <- i.to <- LAT <- angle <- Grad <- NULL
+ to <- code <- i.to <- LAT <- angle <- Grad <- .SD <- NULL
if (terra::nlyr(r) > 1) {
r <- terra::mean(r, na.rm = TRUE)
@@ -55,11 +59,8 @@ spatGrad <- function(r, th = -Inf, projected = FALSE) {
# Create a columns for focal and each of its 8 adjacent cells
y <- data.table::data.table(terra::adjacent(r, 1:terra::ncell(r), directions = 8, pairs = TRUE))
- y <- stats::na.omit(y[, climFocal := terra::values(r)[from]][order(from, to)]) # Get value for focal cell, order the table by raster sequence and omit NAs (land cells)
-
- # TODO JDE added in na.rm = TRUE as I was getting NaN. I can't test if this behaviour has changed from raster....
- # On second thought I am not sure if NAs are valid here. It gives errors below when calculating weighted means
- y[, clim := terra::values(r, na.rm = TRUE)[to]] # Insert values for adjacent cells
+ y <- na.omit(y[, climFocal := terra::values(r)[from]][order(from, to)]) # Get value for focal cell, order the table by raster sequence and omit NAs (land cells)
+ y[, clim := terra::values(r)[to]] # Insert values for adjacent cells
y[, sy := terra::rowFromCell(r, from) - terra::rowFromCell(r, to)] # Column to identify rows in the raster (N = 1, mid = 0, S = -1)
y[, sx := terra::colFromCell(r, to) - terra::colFromCell(r, from)] # Same for columns (E = 1, mid = 0, W = -1)
y[sx > 1, sx := -1] # Sort out the W-E wrap at the dateline, part I
@@ -67,14 +68,9 @@ spatGrad <- function(r, th = -Inf, projected = FALSE) {
y[, code := paste0(sx, sy)] # Make a unique code for each of the eight neighbouring cells
# Code cells with positions
- y[
- list(
- code = c("10", "-10", "-11", "-1-1", "11", "1-1", "01", "0-1"),
- to = c("climE", "climW", "climNW", "climSW", "climNE", "climSE", "climN", "climS")
- ),
- on = "code",
- code := i.to
- ]
+ y[.(code = c("10", "-10", "-11", "-1-1", "11", "1-1", "01", "0-1"),
+ to = c("climE", "climW", "climNW", "climSW", "climNE", "climSE", "climN", "climS")),
+ on = "code", code := i.to]
y <- data.table::dcast(y[, c("from", "code", "clim")], from ~ code, value.var = "clim")
y[, climFocal := terra::values(r)[from]] # Put climFocal back in
y[, LAT := terra::yFromCell(r, from)] # Add focal cell latitude
@@ -93,7 +89,8 @@ spatGrad <- function(r, th = -Inf, projected = FALSE) {
y[, gradWE5 := (climE - climFocal) / (cos(co * CircStats::rad(LAT)) * (d * re[1]))]
y[, gradWE6 := (climSE - climS) / (cos(co * CircStats::rad(LAT - re[2])) * (d * re[1]))]
- # NS gradients difference in temperatures for each northern and southern pairs divided by the distance between them (111.325 km per degC *re[2] degC)
+ # NS gradients difference in temperatures for each northern and southern pairs divided by
+ # the distance between them (111.325 km per degC *re[2] degC)
# Positive values indicate an increase in sst from S to N (i.e., in line with the Cartesian y axis)
y[, gradNS1 := (climNW - climW) / (d * re[2])]
y[, gradNS2 := (climN - climFocal) / (d * re[2])]
@@ -102,29 +99,16 @@ spatGrad <- function(r, th = -Inf, projected = FALSE) {
y[, gradNS5 := (climFocal - climS) / (d * re[2])]
y[, gradNS6 := (climE - climSE) / (d * re[2])]
-
- for (nn in 1:365){
-
- print(nn)
-
- print(stats::weighted.mean(y[nn,12:17], w = c(1, 2, 1, 1, 2, 1), na.rm = TRUE))
-
-
- }
-
-
- browser()
- # Calulate NS and WE gradients. NOTE: for angles to work (at least using simple positive and negative values on Cartesian axes),
- # S-N & W-E gradients need to be positive.
- # JDE Notes: 1 in apply = operate over rows
- # Lots of NAs in clim. Can these be removed? Should they be? Chat to Dave S
- y[, WEgrad := apply(data.table::.SD, 1, function(x) stats::weighted.mean(x, w = c(1, 2, 1, 1, 2, 1), na.rm = TRUE)), .SDcols = gradWE1:gradWE6]
- y[, NSgrad := apply(data.table::.SD, 1, function(x) stats::weighted.mean(x, c(1, 2, 1, 1, 2, 1), na.rm = T)), .SDcols = 18:23]
+ # Calulate NS and WE gradients.
+ # NOTE: for angles to work (at least using simple positive and negative values on Cartesian axes),
+ # S-N & W-E gradients need to be positive)
+ y[, WEgrad := apply(.SD, 1, function(x) stats::weighted.mean(x, c(1, 2, 1, 1, 2, 1), na.rm = TRUE)), .SDcols = 12:17]
+ y[, NSgrad := apply(.SD, 1, function(x) stats::weighted.mean(x, c(1, 2, 1, 1, 2, 1), na.rm = TRUE)), .SDcols = 18:23]
y[is.na(WEgrad) & !is.na(NSgrad), WEgrad := 0L] # Where NSgrad does not exist, but WEgrad does, make NSgrad 0
y[!is.na(WEgrad) & is.na(NSgrad), NSgrad := 0L] # same the other way around
# Calculate angles of gradients (degrees) - adjusted for quadrant (0 deg is North)
- y[, angle := angulo(data.table::.SD$WEgrad, data.table::.SD$NSgrad), .SDcols = c("WEgrad", "NSgrad")]
+ y[, angle := angulo(.SD$WEgrad, .SD$NSgrad), .SDcols = c("WEgrad", "NSgrad")]
# Calculate the vector sum of gradients (C/km)
y[, Grad := sqrt(apply(cbind((y$WEgrad^2), (y$NSgrad^2)), 1, sum, na.rm = TRUE))]
@@ -139,5 +123,6 @@ spatGrad <- function(r, th = -Inf, projected = FALSE) {
rGrad[rGrad[] < th] <- th
output <- c(rGrad, rAng)
names(output) <- c("Grad", "Ang")
+
return(output)
}
diff --git a/R/sumSeries.R b/R/sumSeries.R
index b1c264f..3de447a 100644
--- a/R/sumSeries.R
+++ b/R/sumSeries.R
@@ -28,6 +28,7 @@
#' @export
#' @author Jorge Garcia Molinos
#' @examples
+#' \dontrun{
#' # Monthly mean SST (HadISST) data for Europe Jan-1950 to Dec-2010
#'
#' HSST <- VoCC_get_data("HSST.tif")
@@ -65,6 +66,7 @@
#' p = "1969-01/2009-12", yr0 = "1950-01-01", l = terra::nlyr(HSST),
#' fun = myf, freqin = "months", freqout = "other"
#' )
+#' }
#'
sumSeries <- function(r, p, yr0, l = terra::nlyr(r), fun = function(x) colMeans(x, na.rm = TRUE), freqin = "months", freqout = "years") {
# construct xts object
diff --git a/R/tempTrend.R b/R/tempTrend.R
index 6b27c99..638fb53 100644
--- a/R/tempTrend.R
+++ b/R/tempTrend.R
@@ -19,7 +19,7 @@
#' @export
#' @author Jorge Garcia Molinos and Christopher J. Brown
#' @examples
-#'
+#' \dontrun{
#' HSST <- VoCC_get_data("HSST.tif")
#'
#' yrSST <- sumSeries(HSST,
@@ -32,6 +32,7 @@
#' tr <- tempTrend(yrSST, th = 10)
#'
#' terra::plot(tr)
+#' }
tempTrend <- function(r, th) {
y <- terra::values(r)
ocean <- which(rowSums(is.na(y)) != ncol(y)) # remove land cells
diff --git a/data-raw/trajClas.R b/R/trajClas.R
similarity index 61%
rename from data-raw/trajClas.R
rename to R/trajClas.R
index 7ed2496..f029d29 100644
--- a/data-raw/trajClas.R
+++ b/R/trajClas.R
@@ -16,9 +16,9 @@
#'
#' @param traj \code{data.frame} as retuned by voccTraj containing the coordinates
#' and identification number for each trajectory.
-#' @param vel \code{raster} with the magnitude of gradient-based climate velocity.
-#' @param ang \code{raster} with velocity angles.
-#' @param mn \code{raster} with mean climatic values for the study period.
+#' @param vel \code{SpatRaster} with the magnitude of gradient-based climate velocity.
+#' @param ang \code{SpatRaster} with velocity angles.
+#' @param mn \code{SpatRaster} with mean climatic values for the study period.
#' @param trajSt \code{integer} number of trajectories starting from each cell or spatial unit.
#' @param tyr \code{integer} number of years comprising the projected period.
#' @param nmL \code{numeric} upper threshold (distance units as per vel object) up to which
@@ -44,7 +44,7 @@
#' @export
#' @author Jorge Garcia Molinos
#' @examples
-#'
+#' \dontrun{
#' HSST <- VoCC_get_data("HSST.tif")
#'
#' # input raster layers
@@ -67,7 +67,7 @@
#' angd <- terra::disagg(ang, 4)
#' lonlat <- stats::na.omit(data.frame(
#' terra::xyFromCell(veld, 1:terra::ncell(veld)),
-#' veld[], angd[], mnd[]
+#' terra::values(veld), terra::values(angd), terra::values(mnd)
#' ))[, 1:2]
#'
#' traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50, correct = TRUE)
@@ -84,25 +84,27 @@
#' "magenta1", "cadetblue1", "yellow1"
#' )
#' # Keep only the categories present in our raster
-#' my_col <- my_col[sort(unique(clas[[7]][]))]
+#' my_col <- my_col[sort(unique(terra::values(clas[[7]])))]
#'
#' # Classify raster / build attribute table
-#' clasr <- ratify(clas[[7]])
-#' rat_r <- levels(clasr)[[1]]
-#' rat_r$trajcat <- c(
-#' "N-M", "S-M", "IS", "BS", "Srce",
-#' "RS", "Cor", "Div", "Con"
-#' )[sort(unique(clas[[7]][]))]
-#' levels(clasr) <- rat_r
+#' clasr <- terra::as.factor(clas[[7]])
+#' rat_r <- data.frame(ID = sort(unique(terra::values(clas[[7]]))),
+#' trajcat = c("N-M", "S-M", "IS", "BS", "Srce",
+#' "RS", "Cor", "Div", "Con")[sort(unique(terra::values(clas[[7]])))])
+#' terra::cats(clasr) <- rat_r
#' # Produce the plot using the rasterVis levelplot function
#' rasterVis::levelplot(clasr,
#' col.regions = my_col,
#' xlab = NULL, ylab = NULL, scales = list(draw = FALSE)
#' )
+#' }
trajClas <- function(traj, vel, ang, mn, trajSt, tyr, nmL, smL, Nend, Nst, NFT, DateLine = FALSE) {
ang1 <- ang2 <- ang3 <- ang4 <- d1 <- d2 <- d3 <- d4 <- NULL # Fix devtools check warnings
- isink <- .SD <- .N <- cid <- coastal <- val <- NULL # Fix devtools check warnings
+ isink <- .SD <- .N <- cid <- coastal <- val <- trajIDs <- NULL # Fix devtools check warnings
+
+ # Force loading of ang values to avoid lazy loading warnings
+ invisible(terra::values(ang))
TrajEnd <- TrajFT <- TrajSt <- IntS <- BounS <- TrajClas <- terra::rast(ang)
@@ -111,39 +113,97 @@ trajClas <- function(traj, vel, ang, mn, trajSt, tyr, nmL, smL, Nend, Nst, NFT,
traj$cid <- terra::cellFromXY(ang, traj[, 1:2])
# A. Number of traj starting from each cell
- TrajSt[!is.na(ang[])] <- trajSt
+ # Set trajSt for all non-NA cells in ang
+ terra::values(TrajSt)[!is.na(terra::values(ang))] <- trajSt
# B. Number of traj ending in each cell
tr <- traj[, data.table::.SD[.N], by = trajIDs] # subset last point of each trajectory
enTraj <- tr[, .N, by = cid]
- TrajEnd[!is.na(vel)] <- 0
- TrajEnd[enTraj$cid] <- enTraj$N
+ terra::values(TrajEnd) <- 0
+ TrajEnd <- terra::mask(TrajEnd, vel)
+ terra::values(TrajEnd)[enTraj$cid] <- enTraj$N
# C. Number of traj flowing through each cell
cxtrj <- unique(traj, by = c("trajIDs", "cid"))
TotTraj <- cxtrj[, .N, by = cid] # total number of trajectories per cell
- TrajFT[!is.na(vel)] <- 0
- TrajFT[TotTraj$cid] <- TotTraj$N
+ terra::values(TrajFT) <- 0
+ TrajFT <- terra::mask(TrajFT, vel)
+ terra::values(TrajFT)[TotTraj$cid] <- TotTraj$N
TrajFT <- TrajFT - TrajEnd - TrajSt # subtract traj starting and ending to get those actually transversing the cell
- TrajFT[TrajFT[] < 0] <- 0 # to avoid negative values in ice covered cells
+ terra::values(TrajFT)[terra::values(TrajFT) < 0] <- 0 # to avoid negative values in ice covered cells
# C. Identify cell location for internal sinks (groups of 4 endorheic cells with angles pointing inwards)
ll <- data.table::data.table(terra::xyFromCell(ang, 1:terra::ncell(ang)))
ll[, 1:2] <- ll[, 1:2] + 0.1 # add small offset to the centroid
- # TODO There isn't a direct replaceyment for fourCellsFromXY. Need to look at equivalent code options
- a <- fourCellsFromXY(ang, as.matrix(ll[, 1:2]))
- a <- t(apply(a, 1, sort))
+ # Terra replacement for raster::fourCellsFromXY()
+ # The original function returned 4 cells in a 2x2 arrangement around each point
+ # We recreate this by getting cells at the four corners of a 2x2 grid
+
+ coords <- as.matrix(ll[, 1:2])
+ res_x <- terra::xres(ang)
+ res_y <- terra::yres(ang)
+
+ # Create the four corner positions for a 2x2 grid centered on each coordinate
+ # Offsets for: bottom-left, bottom-right, top-left, top-right
+ offsets <- matrix(c(-res_x/2, -res_y/2, # bottom-left
+ res_x/2, -res_y/2, # bottom-right
+ -res_x/2, res_y/2, # top-left
+ res_x/2, res_y/2), # top-right
+ ncol = 2, byrow = TRUE)
+
+ # Get the four cells for each coordinate point
+ # Initialize as numeric matrix explicitly
+ a <- matrix(as.numeric(NA), nrow = nrow(coords), ncol = 4)
+
+ for(i in 1:nrow(coords)) {
+ if(!is.na(coords[i,1]) && !is.na(coords[i,2])) {
+ # Calculate corner coordinates
+ corner_coords <- sweep(offsets, 2, coords[i,], "+")
+ # Get cell numbers for each corner - handle one at a time
+ for(k in 1:4) {
+ cell_num <- terra::cellFromXY(ang, corner_coords[k, , drop = FALSE])
+ a[i, k] <- as.numeric(cell_num[1])
+ }
+ }
+ }
+
+ # Sort each row as in original code
+ for(i in 1:nrow(a)) {
+ a[i,] <- sort(a[i,])
+ }
# If date line crossing, correct sequences on date line
if (DateLine == TRUE) {
- a[seq(ncol(ang), by = ncol(ang), length = nrow(ang)), ] <- t(apply(a[seq(ncol(ang), by = ncol(ang), length = nrow(ang)), ], 1, function(x) {
+ a[seq(terra::ncol(ang), by = terra::ncol(ang), length = terra::nrow(ang)), ] <- t(apply(a[seq(terra::ncol(ang), by = terra::ncol(ang), length = terra::nrow(ang)), ], 1, function(x) {
x[c(2, 1, 4, 3)]
}))
}
# Extract the angles for each group of 4 cells
- b <- matrix(terra::extract(ang, as.vector(a)), nrow = terra::ncell(ang), ncol = 4, byrow = FALSE)
+ # Use direct indexing approach that works better with terra
+ b <- matrix(NA, nrow = nrow(a), ncol = 4)
+
+ # Get all angle values once to avoid repeated calls
+ ang_values <- terra::values(ang)
+
+ for(i in 1:nrow(a)) {
+ for(j in 1:4) {
+ cell_val <- a[i,j] # Should now be numeric
+ if(!is.na(cell_val) && cell_val > 0 && cell_val <= length(ang_values)) {
+ b[i,j] <- ang_values[cell_val]
+ }
+ }
+ }
+ # Ensure a and b have the same number of rows before combining
+ if(nrow(a) != nrow(b)) {
+ # Pad b to match a if needed
+ if(nrow(b) < nrow(a)) {
+ b_padded <- matrix(NA, nrow = nrow(a), ncol = 4)
+ b_padded[1:nrow(b), ] <- b
+ b <- b_padded
+ }
+ }
ll[, c("c1", "c2", "c3", "c4", "ang1", "ang2", "ang3", "ang4") := data.frame(a, b)]
# now look if the 4 angles point inwards (internal sink)
@@ -153,22 +213,35 @@ trajClas <- function(traj, vel, ang, mn, trajSt, tyr, nmL, smL, Nend, Nst, NFT,
# get the cids for the cells contained in the sinks
celdas <- ll[isink == 1, 3:6]
- IntS[!is.na(vel)] <- 0
- IntS[c(celdas[[1]], celdas[[2]], celdas[[3]], celdas[[4]])] <- 1
+ terra::values(IntS) <- 0
+ IntS <- terra::mask(IntS, vel)
+
+ # Convert data.table columns to vectors and combine
+ if(nrow(celdas) > 0) {
+ # Convert to numeric vectors to avoid list issues
+ sink_cells <- c(as.numeric(celdas$c1), as.numeric(celdas$c2),
+ as.numeric(celdas$c3), as.numeric(celdas$c4))
+ sink_cells <- sink_cells[!is.na(sink_cells)] # Remove NA values
+ if(length(sink_cells) > 0) {
+ terra::values(IntS)[sink_cells] <- 1
+ }
+ }
# D. Identify cell location for boundary sinks (coastal cells which are disconected from cooler climates under warming or warmer climates under cooling)
# detect coastal cells
- coast <- suppressWarnings(terra::boundaries(vel, type = "inner", asNA = TRUE)) # to avoid warning for coercing NAs via asNA = TRUE
+ coast <- suppressWarnings(terra::boundaries(vel, inner = TRUE)) # terra uses 'inner' parameter instead of 'type'
# make a list of vel values and SST values for each coastal cells and their marine neighbours
- cc <- stats::na.omit(data.table::data.table(cid = 1:terra::ncell(vel), coast = coast[]))
- ad <- terra::adjacent(vel, cc$cid, 8, sorted = TRUE, include = TRUE) # matrix with adjacent cells
+ cc <- stats::na.omit(data.table::data.table(cid = 1:terra::ncell(vel), coast = terra::values(coast)))
+ ad <- terra::adjacent(vel, cc$cid, directions = 8, include = TRUE) # matrix with adjacent cells
+ # Sort the adjacency matrix to ensure consistent ordering (replaces sorted=TRUE from raster package)
+ ad <- ad[order(ad[, 1], ad[, 2]), ]
ad <- data.table::data.table(
coastal = ad[, 1],
adjacent = ad[, 2],
- cvel = vel[ad[, 1]],
- ctemp = mn[ad[, 1]],
- atemp = mn[ad[, 2]]
+ cvel = terra::values(vel)[ad[, 1]],
+ ctemp = terra::values(mn)[ad[, 1]],
+ atemp = terra::values(mn)[ad[, 2]]
)
# locate the sinks
@@ -176,12 +249,16 @@ trajClas <- function(traj, vel, ang, mn, trajSt, tyr, nmL, smL, Nend, Nst, NFT,
j <- ad[, ifelse(.SD$cvel > 0, all(.SD$ctemp <= .SD$atemp), all(.SD$ctemp >= .SD$atemp)), by = coastal]
data.table::setkey(j)
j <- unique(j)
- BounS[!is.na(vel)] <- 0
- BounS[unique(subset(j$coastal, j$V == TRUE))] <- 1
+ terra::values(BounS) <- 0
+ BounS <- terra::mask(BounS, vel)
+ boundary_cells <- unique(subset(j$coastal, j$V == TRUE))
+ if(length(boundary_cells) > 0) {
+ terra::values(BounS)[as.numeric(boundary_cells)] <- 1
+ }
# Total number of trajectories per cell and proportions per cell
- TrajTotal <- sum(c(TrajSt, TrajFT, TrajEnd), na.rm = TRUE)
- TrajTotal[is.na(ang[])] <- NA
+ TrajTotal <- TrajSt + TrajFT + TrajEnd
+ terra::values(TrajTotal)[is.na(terra::values(ang))] <- NA
PropTrajEnd <- (TrajEnd / TrajTotal) * 100
PropTrajFT <- (TrajFT / TrajTotal) * 100
PropTrajSt <- (TrajSt / TrajTotal) * 100
@@ -189,30 +266,31 @@ trajClas <- function(traj, vel, ang, mn, trajSt, tyr, nmL, smL, Nend, Nst, NFT,
# reclassify by traj length
rclM <- matrix(c(0, (nmL / tyr), 1, (nmL / tyr), (smL / tyr), 2, (smL / tyr), Inf, 3), ncol = 3, byrow = TRUE)
v <- terra::rast(vel)
- v[] <- abs(vel[])
+ terra::values(v) <- abs(terra::values(vel))
ClassMov <- terra::classify(v, rclM)
# Classify the cells
- TrajClas[!is.na(vel)] <- 0
+ terra::values(TrajClas) <- 0
+ TrajClas <- terra::mask(TrajClas, vel)
# capture non-moving (1)
- TrajClas[ClassMov[] == 1] <- 1
+ terra::values(TrajClas)[terra::values(ClassMov) == 1] <- 1
# capture slow-moving (2)
- TrajClas[ClassMov[] == 2] <- 2
+ terra::values(TrajClas)[terra::values(ClassMov) == 2] <- 2
# capture internal (3) and (4) boundary sinks
- TrajClas[IntS[] == 1] <- 3
- TrajClas[BounS[] == 1] <- 4
+ terra::values(TrajClas)[terra::values(IntS) == 1] <- 3
+ terra::values(TrajClas)[terra::values(BounS) == 1] <- 4
# Classify remaining cells into sources(5), rel sinks(6), corridors(7), divergence(8) and convergence(9)
- d <- stats::na.omit(data.table::data.table(cid = 1:terra::ncell(TrajClas), val = TrajClas[]))
+ d <- stats::na.omit(data.table::data.table(cid = 1:terra::ncell(TrajClas), val = terra::values(TrajClas)))
d <- d[val == 0, 1]
- d[, Nend := PropTrajEnd[d$cid]]
- d[, Nst := PropTrajSt[d$cid]]
- d[, NFT := PropTrajFT[d$cid]]
+ d[, Nend := terra::values(PropTrajEnd)[d$cid]]
+ d[, Nst := terra::values(PropTrajSt)[d$cid]]
+ d[, NFT := terra::values(PropTrajFT)[d$cid]]
d$clas <- ifelse(d$Nend == 0, 5, ifelse(d$Nend > Nend & d$Nst < Nst, 6, ifelse(d$NFT > NFT, 7, ifelse(d$Nend < d$Nst, 8, 9))))
- TrajClas[d$cid] <- d$clas
+ terra::values(TrajClas)[d$cid] <- d$clas
# return raster
s <- c(PropTrajEnd, PropTrajFT, PropTrajSt, ClassMov, IntS, BounS, TrajClas)
diff --git a/data-raw/trajLine.R b/R/trajLine.R
similarity index 68%
rename from data-raw/trajLine.R
rename to R/trajLine.R
index 41b29f5..21007b2 100644
--- a/data-raw/trajLine.R
+++ b/R/trajLine.R
@@ -18,7 +18,7 @@
#' @export
#' @author Jorge Garcia Molinos
#' @examples
-#'
+#' \dontrun{
#' HSST <- VoCC_get_data("HSST.tif")
#'
#' yrSST <- sumSeries(HSST,
@@ -48,31 +48,34 @@
#' terra::plot(mn)
#' terra::plot(lns, add = TRUE)
#'
-#' \dontrun{
#' # Export as ESRI shape file
#' terra::writeVector(lns, filename = "velTraj", filetype = "ESRI Shapefile")
#' }
-trajLine <- function(x, projx = "EPSG::4326") {
- coordinates <- NULL # Fix devtools check warnings
+trajLine <- function(x, projx = "EPSG:4326") {
+
+ # Get distance between first and last points
+ d <- dplyr::bind_rows(dplyr::slice(x, 1), dplyr::slice(x, dplyr::n())) %>%
+ sf::st_as_sf(coords = c("llon", "llat")) %>%
+ sf::st_set_crs(projx) %>%
+ sf::st_distance(.) %>%
+ max()
- spl <- split(x, x$trajIDs)
+ # Get number of steps; anything <240 means that the tracer died on land
+ steps <- max(x$Steps)
- # remove traj consisting of a single point
- i <- sapply(spl, function(x) {
- nrow(x) == 1
- })
- spl <- spl[!i]
+ # Get distance along the tracer
+ line_string <- x %>%
+ sf::st_as_sf(coords = c("llon", "llat")) %>%
+ sf::st_set_crs(projx) %>%
+ dplyr::summarise(do_union = FALSE) %>%
+ sf::st_cast(to = "LINESTRING") %>%
+ dplyr::mutate(steps = steps,
+ line_distance = d,
+ line_length = sf::st_length(.),
+ cellID = dplyr::first(x$cellIDs),
+ lon = dplyr::first(x$llon),
+ lat = dplyr::first(x$llat))
- lns <- vector("list", length(spl))
- for (i in 1:length(spl)) {
- s <- which(abs(diff(coordinates(spl[[i]][, 1:2]))) > 180)
- if (length(s) > 0) {
- SPL <- split(as.data.frame(coordinates(spl[[i]][, 1:2])), cumsum(1:nrow(coordinates(spl[[i]][, 1:2])) %in% (s + 1)))
- lns[[i]] <- sp::Lines(lapply(SPL, function(x) Line(coordinates(x))), ID = i)
- } else {
- lns[[i]] <- sp::Lines(list(sp::Line(coordinates(spl[[i]][, 1:2]))), ID = i)
- }
- }
+ return(line_string)
- sp::SpatialLinesDataFrame(sp::SpatialLines(lns, proj4string = terra::crs(projx)), data = data.frame(trajIDs = unique(x$trajIDs)))
}
diff --git a/R/utils-pipe.R b/R/utils-pipe.R
index fd0b1d1..5f59ead 100644
--- a/R/utils-pipe.R
+++ b/R/utils-pipe.R
@@ -12,3 +12,6 @@
#' @param rhs A function call using the magrittr semantics.
#' @return The result of calling `rhs(lhs)`.
NULL
+
+#' @importFrom rlang .data
+NULL
diff --git a/R/voccTraj.R b/R/voccTraj.R
new file mode 100644
index 0000000..7810e9b
--- /dev/null
+++ b/R/voccTraj.R
@@ -0,0 +1,424 @@
+#' Climate velocity trajectories
+#'
+#' Function to calculate vocc trajectories after Burrows et al (2014). Trajectories
+#' are calculated by propagating climatic isopleths using the magnitude and direction of
+#' local (cell) velocities. This is a slightly modified version of the original
+#' Burrows et al. (2014) approach in that iterations of a trajectory are based on
+#' cumulative time traveled instead of using fixed time steps.
+#'
+#' @param lonlat \code{data.frame} with the longitude and latitude (in decimal degrees)
+#' of the points to project.
+#' @param vel \code{raster} with the magnitude of gradient-based climate velocity.
+#' @param ang \code{raster} with velocity angles in degrees.
+#' @param mn \code{raster} with the overall mean climatic value over the period of interest.
+#' @param vel_c
+#' @param ang_c
+#' @param mn_c
+#' @param fine_coast
+#' @param lk_up
+#' @param tstep
+#' @param tyr \code{integer} temporal length of the period of interest.
+#'
+#' @return a \code{data.frame} containing the coordinates ("x", "y") of the constituent
+#' points and identification number ("trajIDs") for each trajectory.
+#'
+#' @references \href{https://www.nature.com/articles/nature12976}{Burrows et al. 2014}. Geographical limits to species-range shifts are suggested by climate velocity. Nature, 507, 492-495.
+#'
+#' @seealso{\code{\link{gVoCC}}, \code{\link{trajClas}}}
+#' @export
+#' @author Jorge Garcia Molinos, David S. Schoeman and Michael T. Burrows
+#' @examples
+#' \dontrun{
+#' yrSST <- sumSeries(HSST,
+#' p = "1960-01/2009-12", yr0 = "1955-01-01", l = terra::nlyr(HSST),
+#' fun = function(x) colMeans(x, na.rm = TRUE),
+#' freqin = "months", freqout = "years"
+#' )
+#'
+#' # Long-term local climatic trends
+#' tr <- tempTrend(yrSST, th = 10)
+#'
+#' # Local spatial climatic gradients
+#' sg <- spatGrad(yrSST, th = 0.0001, projected = FALSE)
+#'
+#' # Gradient-based climate velocity
+#' v <- gVoCC(tr, sg)
+#' vel <- v[[1]]
+#' ang <- v[[2]]
+#'
+#' # Calculate the annual SST mean over the period
+#' mn <- terra::mean(yrSST, na.rm = TRUE)
+#'
+#' # Get the set of starting cells for the trajectories
+#' lonlat <- stats::na.omit(data.frame(
+#' terra::xyFromCell(vel, 1:terra::ncell(vel)),
+#' vel[], ang[], mn[]
+#' ))[, 1:2]
+#'
+#' # Calculate trajectories
+#' # The following throws an error due to the trajectories moving beyond the raster extent
+#' traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50)
+#'
+#' # This accounts for the extent issue
+#' traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50, correct = TRUE)
+#' }
+#'
+voccTraj <- function(lonlat,
+ vel, ang, mn,
+ # vel_c, ang_c, mn_c,
+ #fine_coast, lk_up,
+ tstep, tyr = 50) {
+
+ # Setup -------------------------------------------------------------------
+
+ y_res <- x_res <- terra::res(vel)[1] # Set resolution of operations
+
+ # Constrain max velocity to avoid stepping over grid squares
+ max_vel = 111.325*x_res/tstep
+ vel[vel > max_vel] <- max_vel
+ vel[vel < -max_vel] <- -max_vel
+ # vel_c[vel_c > max_vel] <- max_vel
+ # vel_c[vel_c < -max_vel] <- -max_vel
+
+ lonlat <- lonlat %>%
+ dplyr::select(tidyselect::all_of(c("x", "y"))) %>% # Collect just lon and lat (in case there's anything else there)
+ as.data.frame()
+
+ tcells <- terra::cellFromXY(vel, lonlat) # # Cell IDs of starting cells
+ n <- nrow(lonlat) # Get number of cells in your sequence
+ sflags <- rep(NA, n) # Set a string of cells that change from NA to 1 where the trajectory sticks
+
+ # Set up variables to catch results, allocating the right amount of memory
+ llon <- numeric((n * tyr / tstep) + n) # Needs to have a set of starting lons, plus one more set for each time step
+ llat <- numeric((n * tyr / tstep) + n) # Needs to have a set of starting lats, plus one more set for each time step
+ # cellIDs <- rep(tcells, ((tyr / tstep) + 1)) # Needs to have a set of starting cells, plus one more set for each time step—just as a reference
+ cellIDs <- rep(1:n, ((tyr / tstep) + 1)) # Needs to have a set of starting cells, plus one more set for each time step—just as a reference
+ cellIDend <- numeric((n * tyr / tstep) + n) # Needs to have a set of ending cells, plus one more set for each time step
+ # coast <- llon != 0 # Needs to have a set of starting coastal flags, plus one more set for each time step...set up as boolean
+ flags <- numeric((n * tyr / tstep) + n) # Needs to have a set of starting flags, plus one more set for each time step
+ Steps <- numeric((n * tyr / tstep) + n) # Needs to have a set of starting steps, plus one more set for each time step
+
+ # Populate the first n slots with starting points
+ llon[1:n] <- lonlat[,1]
+ llat[1:n] <- lonlat[,2]
+ cellIDend[1:n] <- tcells
+ # coast[1:n] <- scoast
+ flags[1:n] <- NA
+ Steps[1:n] <- 0
+
+ # Get coarse cellIDs that exist in fine raster
+ # fn_lk_up <- lk_up[] %>%
+ # na.omit() %>%
+ # unique()
+
+ # Helper functions --------------------------------------------------------
+
+ # Trajectory helper functions
+
+ # Function for to grep min distance
+ mfind <- function(rw){
+ X <- which.min(rw)
+ return(X)
+ }
+
+ # Function for to extract corner coordinates per row
+ mplace <- function(rw){
+ X <- rw[(rw[1]+1)]
+ Y <- rw[rw[1]]
+ return(c(X, Y))
+ }
+
+ # Simple circular functions
+ deg2rad <- function(deg) return(deg*pi/180)
+ rad2deg <- function(rad) return(180*rad/pi)
+
+ # A function to find the nearest coastal cell
+ get_nearest_coastal_cell <- function(x, y, tccell, lk_up, ...) { # JDE added lk_up to arguments
+ t_block <- which(lk_up[] == tccell) # The cellIDs of lk_up
+ cst_pts <- terra::xyFromCell(lk_up, t_block) %>%
+ as.data.frame() %>%
+ sf::st_as_sf(coords = c("x", "y"), crs = terra::crs(terra::rast()))
+ # Here, we can't search for corners and add random "fuzz" to we collect 10 random points (if there are 10), and select the nearest of those, instead. If there are 10 or fewer, just pick the nearest
+ if(nrow(cst_pts) > 10) {
+ cst_pts <- cst_pts[sample(1:nrow(cst_pts), 10, replace = FALSE),]
+ } # The unspoken "else" is that we just retain the cst_pts we have
+ pt <- sf::st_as_sf(data.frame(x = x, y = y), coords = c("x", "y"), crs = terra::crs(terra::rast())) # The point departed from
+ nearest <- sf::st_distance(cst_pts, pt) %>%
+ which.min()
+ out <- cst_pts[nearest,] %>%
+ sf::st_coordinates() %>%
+ as.data.frame() %>%
+ dplyr::rename(x = 1, y = 2)
+ return(out)
+ }
+
+ # Find new destination, given velocity (km/yr), angle (º), time step (yr) and initial coordinates (ºlon, ºlat); max allowed jump is 1 deg
+ # vell = vel[fcells] %>% pull(1); angg = ang[fcells] %>% pull(1); timestep = tstep; ll = llold
+ destcoords <- function(vell, angg, timestep, ll, y_res, x_res){
+
+ latshift <- (abs(vell) * timestep * cos(deg2rad(angg))) / 111.325 # Calculate shift in lat
+ latnew <- ll[,2] + latshift # Find new lat...first approximation
+ lonshift <- (abs(vell) * timestep * sin(deg2rad(angg))) / (111.325 * cos(deg2rad(latnew))) # Shift in lon
+ # Limit large longitudinal jumps at high latitudes
+
+ # Because we constrain velocity to be no more than 12 * y_res, all problems will be with lonshift
+ # Limit lonshift to at most 1 cell
+ lonshift[lonshift > x_res] <- x_res
+ lonshift[lonshift < -x_res] <- -x_res
+
+ # Now on that basis, adjust latshift
+ x_gt <- which(lonshift == x_res) # Indices for adjusted lon shifts
+ latshift[x_gt] <- ((x_res*111.325 * cos(deg2rad(ll[x_gt,2])))/tan(deg2rad(angg[x_gt])))/111.325 # Using trig on distances
+ x_lt <- which(lonshift == -x_res) # Indices for adjusted lon shifts
+ latshift[x_lt] <- ((x_res*111.325 * cos(deg2rad(ll[x_lt,2])))/tan(deg2rad(angg[x_lt])))/111.325 # Using trig on distances
+ latnew <- ll[,2] + latshift # Find new lat by adding the adjusted lats
+ # Stop new lat from jumping the poles
+ latnew[latnew > 90] <- 90
+ latnew[latnew < -90] <- -90
+ # Adjust lon
+ lonnew <- ll[,1] + lonshift # Find new lon...first approximation
+ # Adjust for dateline jumps
+ lonnew <- lonnew - (360 * floor((lonnew + 180) / 360))
+ return(data.frame(lonnew, latnew) %>%
+ stats::setNames(c("dlon", "dlat")))
+ }
+
+ # Function for to find closest cooler/warmer cell within the union of two levels of 8-cell adjacency from the "departed" and "destination" cells
+ # TODO JDE - The arguments are not correct. Only 1, but it should include. `mn`
+ get_dest_cell <- function(rw) { # A to-from cell pair and the buffer around a cell on land that can be searched for a suitable cell
+
+
+ x_res <- terra::res(mn)[1]
+ y_res <- terra::res(mn)[2]
+
+ # Find clumps of ocean; the rule is that you can't jump from one clump to another, because this would mean passing over unbroken land
+ xy <- terra::xyFromCell(mn, as.vector(as.matrix(rw))) %>%
+ as.data.frame()
+
+ bfr = ((y_res*111.325) + 1) * 1000 # Set buffer to be 1 grid-square width at the equator + 1 km
+
+ xy <- xy %>%
+ sf::st_as_sf(coords = c("x", "y"), crs = "EPSG:4326")
+
+ sp_buffer <- sf::st_buffer(sf::st_as_sf(xy), bfr) # Remembering that buffer is in metres
+
+ buffer_zone <- terra::extract(mn, sp_buffer, cells = TRUE, xy = TRUE, touches = TRUE) %>%
+ dplyr::select(-"ID") %>%
+ dplyr::distinct() %>%
+ dplyr::rename(sst = mean) %>% # JDE Changed from climatology to mean
+ dplyr::select(tidyselect::all_of(c("x", "y", "sst", "cell"))) %>%
+ tidyr::drop_na(.data$sst)
+
+ # JDE Changes. When all cells are in a straight line (only 1 unique x or y),
+ # rast() will not work. So here we add a more robust approach to creating
+ # a rast() regardless of the data
+
+ # clumped <- buffer_zone %>%
+ # dplyr::select(-cell) %>%
+ # rast(crs = "EPSG:4326") %>%
+ # terra::patches(directions = 8, allowGaps = FALSE)
+
+
+ clumped_rast <- terra::rast(
+ xmin = min(buffer_zone$x) - x_res/2,
+ xmax = max(buffer_zone$x) + x_res/2,
+ ymin = min(buffer_zone$y) - y_res/2,
+ ymax = max(buffer_zone$y) + y_res/2,
+ resolution = c(x_res, y_res),
+ crs = "EPSG:4326"
+ )
+
+ clumped <- terra::rasterize(
+ x = buffer_zone %>% # Needs to be SpatVector to add the sst
+ dplyr::select(-"cell") %>%
+ terra::vect(geom = c("x", "y"), crs = "EPSG:4326"),
+ y = clumped_rast, # The template to rasterize onto
+ field = "sst") %>% # The data
+ terra::patches(directions = 8, allowGaps = FALSE)
+
+ # JDE END CHANGES
+
+ # Which clump did I start in?
+ r1 <- rw[1] %>%
+ as.vector() # We use this cell a lot, so let's just make it an object
+
+ from_clump <- terra::extract(clumped, terra::xyFromCell(mn, r1)) %>%
+ unlist() %>%
+ as.vector()
+
+ # What are the coordinates of cells within the search area that fall in the clump I came from?
+ search_xy <- terra::xyFromCell(clumped, which(clumped[] == from_clump)) %>%
+ as.data.frame() #****
+ search_cells <- terra::cellFromXY(mn, search_xy) # Which cells are these
+
+ # Check if any of these are NOT in in EITHER fine coast or mn, and eliminate, if needed
+ to_keep <- c(which(!is.na(terra::extract(mn, search_xy, ID = FALSE) %>%
+ dplyr::pull(1)))) %>% #, # Coords in the coarse grid
+ # which(search_cells %in% fn_lk_up)) %>%
+ unique()
+
+ search_xy1 <- search_xy[to_keep,] %>%
+ as.data.frame() %>%
+ dplyr::distinct()
+
+ # Get the ssts in the cells to search
+ or <- terra::extract(mn, search_xy1, cells = TRUE, xy = TRUE) %>%
+ dplyr::rename(sst = 2, x = 4, y = 5)
+
+
+ # If velocity is positive, find nearest cell that is cooler, if there is one
+ if(unlist(vel[r1]) > 0) {
+ o <- or %>%
+ dplyr::filter(.data$sst < unlist(mn[r1])) %>%
+ na.omit()
+ if(nrow(o) == 0) {
+ dest_cell <- NA # Set condition with which to ID stuck cells
+ } else {
+ pt <- terra::xyFromCell(mn, r1) %>%
+ data.frame()
+
+ dest_cell <- sf::st_distance(sf::st_as_sf(pt, coords = c("x", "y"), crs = terra::crs(terra::rast())),
+ sf::st_as_sf(data.frame(o), coords = c("x", "y"), crs = terra::crs(terra::rast()))) %>%
+ which.min() %>%
+ o$cell[.]
+ }
+ } else { # Otherwise, find nearest cell that is warmer, if there is one
+ o <- or %>%
+ dplyr::filter(.data$sst > unlist(mn[r1])) %>%
+ na.omit()
+ if(nrow(o) == 0) {
+ dest_cell <- NA # Set condition with which to ID stuck cells
+ } else {
+ pt <- terra::xyFromCell(mn, r1) %>%
+ data.frame()
+
+ dest_cell <- sf::st_distance(sf::st_as_sf(pt, coords = c("x", "y"), crs = terra::crs(terra::rast())),
+ sf::st_as_sf(o, coords = c("x", "y"), crs = terra::crs(terra::rast()))) %>%
+ which.min() %>%
+ o$cell[.]
+ }
+ }
+ return(dest_cell)
+ }
+
+ # Loop --------------------------------------------------------------------
+
+ # Loop through the trajectories
+ for(i in 1:(tyr/tstep)) { # 1:(tyr/tstep)
+ llold <- lonlat # Take a copy of lonlat
+ fcells <- terra::cellFromXY(vel,llold) # Get the cells that the trajectories start in
+
+ # Pull velocity and angle from the "inland" versions, because we always ensure that we can find destination cells for departures within the coastal "blind spot"
+ # TIN: changed this from vel_c to vel and ang_c to ang because we don't have coarse/fine versions
+ vc <- vel[fcells] %>% dplyr::pull(1)
+ ac <- ang[fcells] %>% dplyr::pull(1)
+ llc <- llold
+
+ # Get new locations
+ lonlat <- destcoords(vc, ac, tstep, llc, y_res, x_res) # Extract lon and lat of landing point
+ tcells <- terra::cellFromXY(vel,lonlat) # Get the cells that the trajectories end in
+ sflags[which(is.na(tcells))] <- 1 # Sets the trajectory to "stuck" if it exits the velocity field (i.e., tcells == NA)
+
+ # Bounce stuck cells
+ stuck_cells <- which(!is.na(sflags))
+ lonlat[stuck_cells,] <- llold[stuck_cells,] # Bounce the corresponding coordinates across for "stuck" cells
+ tcells[stuck_cells] <- fcells[stuck_cells] # Bounce the corresponding cells across for "stuck" cells
+
+ # Deal with cells that end on land
+ onland <- which(is.na(vel[tcells])) %>% # Identify which rows of velend are on land, provided that they are not stuck
+ dplyr::setdiff(stuck_cells) # Ignoring stuck cells
+
+ # if(length(onland) > 0){ # Only bother if there is at least one cell that returns a NA velocity = land
+ # Here, you need to check whether it really *IS* on land, or whether it is just in the coastal "blind spot"
+ # fn <- terra::extract(fine_coast, lonlat[onland,], ID = FALSE) %>%
+ # pull(1)
+ # onland <- onland[which(is.na(fn))]
+ if(length(onland) > 0) {
+ # Collect the stuff we need here for cells that are really onland
+ fpos <- llold[onland,]
+ tpos <- lonlat[onland,]
+ SFlags <- sflags[onland]
+ fcell <- fcells[onland]
+ tcell <- tcells[onland]
+ ft <- data.frame(fcell = fcell, tcell = tcell, code = paste(fcell, tcell, sep = " "), ref = 1:length(fcell))
+
+ # Get the destination cells of those that are hitting the coast
+ ttcell <- apply(ft[,1:2], 1, get_dest_cell) # TODO using apply in places and map in others. Can we consistently move to purrr?
+
+ # Filter "stuck" flags here
+ stuck <- which(is.na(ttcell))
+ unstuck <- which(!is.na(ttcell))
+ SFlags[stuck] <- 1 # Adjust flags
+
+ # Make data frame to catch data needed to find new positions
+ ttpos <- data.frame(x = rep(NA, length(onland)), y = rep(NA, length(onland)))
+ ttpos[stuck,] <- fpos[stuck,] # If they're stuck, pass on starting points
+ ttcell[stuck] <- fcell[stuck] # If they're stuck, pass on starting cells
+
+ if(length(unstuck) > 0) {
+ ttdat <- data.frame(ttcell = ttcell[unstuck],
+ loncent = terra::xFromCell(vel, ttcell[unstuck]),
+ latcent = terra::yFromCell(vel, ttcell[unstuck])) %>% # Start building coordinates
+ dplyr::mutate(e = NA, w = NA, n = NA, s = NA, dlon = NA, dlat = NA) # To facilitate finding corners, if we need them
+
+ # Separate cells in the coastal blind spot from those that are not
+ # which_coast <- which(ttdat$ttcell %in% fn_lk_up)
+ # which_not_coast <- which(!(ttdat$ttcell %in% fn_lk_up))
+ # For non-coastal cells
+
+ idx <- 1:nrow(ttdat)
+
+ if(nrow(ttdat) > 0) {
+ corner_block_size <- 0.25*x_res
+ nc_ttdat <- ttdat # Copying data
+ nc_ttdat$e <- nc_ttdat$loncent + (0.5 * x_res) - (stats::runif(1, 0, 1) * corner_block_size)
+ nc_ttdat$w <- nc_ttdat$loncent - (0.5 * x_res) + (stats::runif(1, 0, 1) * corner_block_size)
+ nc_ttdat$n <- nc_ttdat$latcent + (0.5 * y_res) - (stats::runif(1, 0, 1) * corner_block_size)
+ nc_ttdat$s <- nc_ttdat$latcent - (0.5 * y_res) + (stats::runif(1, 0, 1) * corner_block_size)
+ coords <- with(nc_ttdat, cbind(n, e, n, w, s, w, s, e)) # NE, NW, SW, SE corners' coordinates
+ # Find distances from departure point to corners of ttcell
+ get_dist <- function(y1, x1, y2, x2) {
+ pt1 <- sf::st_as_sf(data.frame(x = x1, y = y1), coords = c("x", "y"), crs = terra::crs(terra::rast()))
+ pt2 <- sf::st_as_sf(data.frame(x = x2, y = y2), coords = c("x", "y"), crs = terra::crs(terra::rast()))
+ out <- sf::st_distance(pt1, pt2, by_element = TRUE) %>%
+ as.vector()
+ return(out)
+ }
+
+ corners <- data.frame(ne = get_dist(fpos[idx,2], fpos[idx,1], coords[,1], coords[,2])) %>%
+ dplyr::mutate(nw = get_dist(fpos[idx,2], fpos[idx,1], coords[,3], coords[,4]),
+ sw = get_dist(fpos[idx,2], fpos[idx,1], coords[,5], coords[,6]),
+ se = get_dist(fpos[idx,2], fpos[idx,1], coords[,7], coords[,8]))
+ cornset <- apply(corners, 1, mfind)*2 # Identify which corners for each onland cell. Have to mul by 2 to shift along correctly.
+ cornset <- cbind(cornset, coords) # Add in coordinates
+ ttdat[,8:9] <- data.frame(t(apply(cornset, 1, mplace))) # Extract coordinates of correct corner
+ }
+ # # For coastal cells
+ # if(length(which_coast) > 0) {
+ # coastal_dat <- ttdat[which_coast,2:3] %>%
+ # mutate(x = fpos[which_coast,1], y = fpos[which_coast,2],
+ # tccell = ttdat[which_coast,]$ttcell)
+ # # JDE TODO - Argument to get_nearest_coast_cell are not correct - `get_nearest_coastal_cell <- function(x, y, tccell, lk_up, ...)`
+ # ttdat[which_coast,8:9] <- pmap_df(coastal_dat, get_nearest_coastal_cell)
+ # }
+ ttpos[unstuck,] <- ttdat[,8:9]
+ ttcell[unstuck] <- terra::cellFromXY(mn, ttpos[unstuck,])
+ }
+ # Collect results
+ lonlat[onland,] <- ttpos
+ tcells[onland] <- ttcell
+ sflags[onland] <- SFlags
+ }
+ # }
+ llon[((i * n) + 1): ((i * n) + n)] <- lonlat[,1] # Add lon to the list
+ llat[((i * n) + 1): ((i * n) + n)] <- lonlat[,2]# Add lat to the list
+ cellIDend[((i * n) + 1): ((i * n) + n)] <- tcells # Add cellIDs to the list
+ flags[((i * n) + 1): ((i * n) + n)] <- sflags # Add flags to the list
+ Steps[((i * n) + 1): ((i * n) + n)] <- i # Capture the time_step
+ # print(c(i, length(onland), round(100*i/(tyr/tstep), 3), date())) # Keep a reference of progress
+
+ }
+ return(cbind(Steps, llon, llat, cellIDs, cellIDend, flags) %>%
+ tibble::as_tibble())
+}
+
diff --git a/_pkgdown.yml b/_pkgdown.yml
new file mode 100644
index 0000000..455962f
--- /dev/null
+++ b/_pkgdown.yml
@@ -0,0 +1,9 @@
+url: ~
+template:
+ bootstrap: 5
+ bslib:
+ toc: true
+ toc-expand: 3
+navbar:
+ structure:
+ right: [github, search]
diff --git a/data-raw/dVoCC_old.R b/data-raw/dVoCC_old.R
new file mode 100644
index 0000000..011b30c
--- /dev/null
+++ b/data-raw/dVoCC_old.R
@@ -0,0 +1,152 @@
+#' Distance-based velocity based on geographically closest climate analogue
+#'
+#' Function to calculate the geographically closest climate analogues and related distance-based velocity. Cell analogues
+#' are identified by comparing the baseline climatic conditions at each focal cell with those existing for all
+#' other (target) cells in the future by reference to a specified climatic threshold. The function allows for the
+#' specification of search distances and incorporates both least-cost path and Great Circle (as-the-crow-flies) distances.
+#'
+#' @usage dVoCC(clim, n, tdiff, method = "Single", climTol, geoTol, distfun = "GreatCircle",
+#' trans = NA, lonlat = TRUE)
+#'
+#' @param clim \code{data.frame} with the value for the climatic parameters (columns) by cell (rows), arranged as follows (see examples below):
+#' The first 2n columns must contain the present and future values for each of the n climatic variables (V1p, V1f, V2p, V2f,...).
+#' Where cell-specific analogue thresholds (see "variable" in "method" below) are to be calculated, the next (2n+1:3n) columns
+#' should contain the standard deviation (or any other measure of climatic variability) of each variable for the baseline period.
+#' These columns are not required if using the "Single" method. The last three columns of the table should contain an identifyier and centroid coordinates of each cell.
+#' @param n \code{integer} defining the number of climatic variables.
+#' @param tdiff \code{integer} defining the number of years (or other temporal unit) between periods.
+#' @param method \code{character string} specifying the analogue method to be used. 'Single': a constant, single analogue threshold
+#' for each climate variable is applied to all cells (Ohlemuller et al. 2006, Hamann et al. 2015); climate analogy corresponds to target cells
+#' with values below the specified threshold for each climatic variable. 'Variable': a cell-specific climate threshold is used for each climatic variable
+#' to determine the climate analogues associated with each cell by reference to its baseline climatic variability (Garcia Molinos et al. 2017).
+#' @param climTol \code{numeric} a vector of length n giving the tolerance threshold defining climate analogue conditions for each climatic variable.
+#' If a cell-specific threshold is being used, this function parameter should be passed as NA.
+#' @param geoTol \code{integer} impose a geographical distance threshold (in km for lat/lon or map units if projected).
+#' If used, the pool of potential climate analogues will be limited to cells within that distance from the focal cell.
+#' @param distfun \code{character string} specifying the function to be used for estimating distances
+#' between focal and target cells. Either 'Euclidean', 'GreatCircle' (Great Circle Distances)
+#' or 'LeastCost' (Least Cost Path Distances). The latter requires a transition matrix supplied to the function via de 'trans' argument.
+#' @param trans \code{TransitionLayer} gdistance object to be used for the analogue search if distfun = 'LeastCost'.
+#' @param lonlat \code{logical} is the analysis to be done in unprojected (lon/lat) coordinates?
+#'
+#' @return A \code{data.frame} containing the cell id of the future analogue for each focal cell (NA = no analogue available),
+#' together with the climatic ("climDis") and geographical ("geoDis") distances in input units,
+#' the bearing ("ang", degrees North), and resulting climate velocity ("vel", km/yr). Mean climatic distances are returned for multivariate analogues.
+#'
+#' @references \href{https://onlinelibrary.wiley.com/doi/full/10.1111/j.1466-822X.2006.00245.x}{Ohlemuller et al. 2006}. Towards European climate risk surfaces: the extent and distribution of analogous and non-analogous climates 1931-2100. Global Ecology and Biogeography, 15, 395-405. \cr
+#' \href{https://onlinelibrary.wiley.com/doi/full/10.1111/gcb.12736}{Hamann et al. 2015}. Velocity of climate change algorithms for guiding conservation and management. Global Change Biology, 21, 997-1004. \cr
+#' \href{https://onlinelibrary.wiley.com/doi/full/10.1111/gcb.13665}{Garcia Molinos et al. 2017}. Improving the interpretability of climate landscape metrics: An ecological risk analysis of Japan's Marine Protected Areas. Global Change Biology, 23, 4440-4452.
+#'
+#' @seealso{\code{\link{climPCA}}, \code{\link{climPlot}}}
+#'
+#' @import doParallel foreach
+#' @importFrom geosphere destPoint distGeo
+#' @importFrom gdistance shortestPath
+#' @importFrom parallel detectCores makeCluster stopCluster
+#' @export
+#' @author Jorge Garcia Molinos
+#' @examples
+#'
+#' ?JapTC
+#'
+#' # Create a data frame with the necessary variables in the required order
+#' clim <- na.omit(data.frame(getValues(JapTC), cid = 1:ncell(JapTC)))
+#' clim[,c("x","y")] <- xyFromCell(JapTC, clim$cid)
+#'
+#' # Constant threshold, distance-restricted velocity based on geographical distances
+#' avocc1 <- dVoCC(clim, n = 3, tdiff = 40, method = "Single", climTol = c(10, 0.1, 0.1),
+#' geoTol = 160, distfun = "GreatCircle", trans = NA, lonlat = TRUE)
+#'
+#' # Cell-specific, distance-unrestricted climate analogue velocity based on least-cost path distances
+#' # First, create the conductance matrix (all land cells considered to have conductance of 1)
+#' r <- raster(JapTC)
+#' r[!is.na(JapTC[[1]])] <- 1
+#' h8 <- gdistance::transition(r, transitionFunction=mean, directions=8)
+#' h8 <- gdistance::geoCorrection(h8, type="c")
+#' # Now calculate the analogue velocity using the baseline SD for each variable as analogue threshold
+#' avocc2 <- dVoCC(clim, n = 3, tdiff = 40, method = "Variable", climTol = NA, geoTol = Inf,
+#' distfun = "LeastCost", trans = h8, lonlat = TRUE)
+#'
+#' # Plot results
+#' r1 <- r2 <- raster(JapTC)
+#' r1[avocc1$focal] <- avocc1$vel
+#' r2[avocc2$focal] <- avocc2$vel
+#' plot(stack(r1,r2))
+#'
+#' @rdname dVoCC
+
+dVoCC <- function(clim, n, tdiff, method = "Single", climTol, geoTol, distfun = "GreatCircle", trans = NA, lonlat = TRUE){
+
+if(distfun == "Euclidean" & lonlat == TRUE){
+print("Error: Euclidean distances specified for unprojected coordinates")
+stop()
+}
+
+dat <- na.omit(data.table(clim))
+# matrix with the future climatic values for all cells
+fut <- dat[, seq(2, (2*n), by = 2), with=FALSE]
+
+# set things up for parallel processing
+cores = detectCores()
+ncores = cores[1]-1
+cuts <- cut(1:nrow(dat), ncores, labels = FALSE)
+cl <- makeCluster(ncores)
+registerDoParallel(cl)
+
+result <- foreach(x = 1:ncores, .combine = rbind, .packages = c('gdistance', 'sp', 'geosphere', 'VoCC', 'data.table'), .multicombine = TRUE) %dopar% {
+a <- x
+Dat <- dat[cuts == a,]
+
+resu <- data.table(focal = Dat$cid, target = as.integer(NA), climDis = as.double(NA), geoDis = as.double(NA), ang = as.double(NA), vel = as.double(NA))
+i <- 0
+while(i <= nrow(Dat)){
+i <- i+1
+# for each focal cell subset target cell analogues (within ClimTol)
+pres <- as.numeric(Dat[i, seq(1, (2*n), by = 2), with=FALSE])
+dif <- data.table(sweep(fut, 2, pres, "-"))
+
+# Identify future analogue cells
+if(method == "Single"){ # Ohlemuller et al 2006 / Hamann et al 2015
+upper = colnames(dif)
+l <- lapply(upper, function(x) call("<", call("abs", as.name(x)), climTol[grep(x, colnames(dif))]))
+ii = Reduce(function(c1, c2) substitute(.c1 & .c2, list(.c1=c1, .c2=c2)), l)
+anacid <- dat$cid[dif[eval(ii), which=TRUE]] # cids analogue cells
+}
+
+if(method == "Variable"){ # Garcia Molinos et al. 2017
+climTol <- as.numeric(Dat[i, ((2*n)+1):(3*n), with=FALSE]) # focal cell tolerance
+upper = colnames(dif)
+l <- lapply(upper, function(x) call("<", call("abs", as.name(x)), climTol[grep(x, colnames(dif))]))
+ii = Reduce(function(c1, c2) substitute(.c1 & .c2, list(.c1=c1, .c2=c2)), l)
+anacid <- dat$cid[dif[eval(ii), which=TRUE]] # cids analogue cells
+}
+
+# LOCATE CLOSEST ANALOGUE
+if(length(anacid)>0){
+# check which of those are within distance and get the analogue at minimum distance
+if(distfun == "Euclidean"){d <- dist(cbind(Dat$x[i],Dat$y[i]), cbind(dat$x[dat$cid %in% anacid], dat$y[dat$cid %in% anacid]))} # in x/y units
+if(distfun == "GreatCircle"){d <- (geosphere::distHaversine(cbind(Dat$x[i],Dat$y[i]), cbind(dat$x[dat$cid %in% anacid], dat$y[dat$cid %in% anacid])))/1000} # in km
+if(distfun == "LeastCost"){
+SL <- gdistance::shortestPath(trans, cbind(Dat$x[i],Dat$y[i]), cbind(dat$x[dat$cid %in% anacid], dat$y[dat$cid %in% anacid]), output="SpatialLines")
+d <- SpatialLinesLengths(SL, longlat = lonlat) # in km for longlat TRUE
+# correct for analogues that are within search distance but have no directed path with the focal cell (i.e. conductivity = 0)
+d[which(d == 0 & anacid != Dat$cid[i])] <- Inf
+}
+
+an <- anacid[d < geoTol] # cids analogue cells within search radius
+dis <- d[d < geoTol] # distance to candidate analogues
+if (length(an) > 0){
+ resu[i, target := an[which.min(dis)]] # cid of geographically closest climate analogue
+ if(method == "Single"){resu[i, climDis := mean(as.numeric(dif[which(anacid == resu[i, target]),]))]} # mean clim difference for the closest analogue
+ resu[i, geoDis := min(dis)]
+ resu[i, ang := geosphere::bearing(Dat[i, c("x","y")], dat[cid == resu[i, target], c("x","y")])]
+ resu[i, vel := resu$geoDis[i]/tdiff]
+}}
+}
+return(resu)
+}
+stopCluster(cl)
+
+return(result)
+
+}
diff --git a/data-raw/do_trajectories.R b/data-raw/do_trajectories.R
new file mode 100644
index 0000000..7e7c2eb
--- /dev/null
+++ b/data-raw/do_trajectories.R
@@ -0,0 +1,36 @@
+# Run trajectories for a file ---------------------------------------------
+
+do_trajectories <- function(raster_stack, start_points, nyears) {
+ # Get the rasters we need
+ stacks <- build_coastal_mask(f_m = "OISST_Mask_data/mask.nc",
+ f_cm = "/Volumes/Jet_drive_too/Coastal_masks/coarseAusmask.nc",
+ f_fm = "/Volumes/Jet_drive_too/Coastal_masks/fineAusmask.nc",
+ rast_stk = raster_stack)
+ fine_coast <- stacks[[3]]
+ vel <- stacks[[1]][[1]]
+ ang <- stacks[[1]][[2]]
+ mn <- stacks[[1]][[3]]
+ vel_c <- stacks[[2]][[1]]
+ ang_c <- stacks[[2]][[2]]
+ mn_c <- stacks[[2]][[3]]
+ lk_up <- stacks$look_up
+
+ lonlat <- start_points[,1:2] %>%
+ mutate(ID = 1:nrow(.)) %>%
+ as_tibble() %>%
+ mutate(vel = terra::extract(vel, .[,1:2], ID = FALSE) %>%
+ pull(voccMag),
+ i_coast = terra::extract(fine_coast, .[,1:2], ID = FALSE) %>%
+ pull(tos),
+ to_drop = ifelse(is.na(vel) & is.na(i_coast), NA, 1)) %>%
+ tidyr::drop_na(to_drop) %>%
+ dplyr::select(x, y, ID)
+
+ out <- traject(lonlat,
+ vel = vel, ang = ang, mn = mn,
+ vel_c = vel_c, ang_c = ang_c, mn_c = mn_c,
+ fine_coast = fine_coast,
+ lk_up = lk_up,
+ tstep = 1/12, tyr = nyears)
+ return(out)
+}
diff --git a/R/utils.R b/data-raw/utils.R
similarity index 97%
rename from R/utils.R
rename to data-raw/utils.R
index bf1e291..43a7382 100644
--- a/R/utils.R
+++ b/data-raw/utils.R
@@ -6,11 +6,11 @@
#' @export
#'
#' @examples
-#'
+#' \dontrun{
#' VoCC_get_data()
#'
#' HSST <- VoCC_get_data(path = "HSST.tif")
-#'
+#' }
VoCC_get_data <- function(path = NULL) {
if (is.null(path)) {
dir(system.file("extdata", package = "VoCC"))
diff --git a/data-raw/voccTraj.R b/data-raw/voccTraj.R
deleted file mode 100644
index bf800b0..0000000
--- a/data-raw/voccTraj.R
+++ /dev/null
@@ -1,516 +0,0 @@
-#' Climate velocity trajectories
-#'
-#' Function to calculate vocc trajectories after Burrows et al (2014). Trajectories
-#' are calculated by propagating climatic isopleths using the magnitude and direction of
-#' local (cell) velocities. This is a slightly modified version of the original
-#' Burrows et al. (2014) approach in that iterations of a trajectory are based on
-#' cumulative time traveled instead of using fixed time steps.
-#'
-#' @param lonlat \code{data.frame} with the longitude and latitude (in decimal degrees)
-#' of the points to project.
-#' @param vel \code{raster} with the magnitude of gradient-based climate velocity.
-#' @param ang \code{raster} with velocity angles in degrees.
-#' @param mn \code{raster} with the overall mean climatic value over the period of interest.
-#' @param tyr \code{integer} temporal length of the period of interest.
-#' @param trajID \code{integer} specifying the identifiers for the trajectories.
-#' @param correct \code{logical} does the input raster need to be corrected to account for cropped margins?
-#' Unless the raster extent is global, calculation of trajectories will throw an error at the margins
-#' as the trajectories go beyond the raster extent (no input values). To avoid this, an option is given for
-#' expanding the extent by the resolution of the raster (1 column/row) with NAs. Note that those trajectories
-#' reaching the extent limits will be artificially bounced back so should be discarded at that point.
-#' Alternatively, users may choose to crop to a larger extent to the domain of interest (appropriately
-#' defined by lonlat), so the extra extent buffer for those trajectories getting to the border
-#' of the raster.
-#'
-#' @return a \code{data.frame} containing the coordinates ("x", "y") of the constituent
-#' points and identification number ("trajIDs") for each trajectory.
-#'
-#' @references \href{https://www.nature.com/articles/nature12976}{Burrows et al. 2014}. Geographical limits to species-range shifts are suggested by climate velocity. Nature, 507, 492-495.
-#'
-#' @seealso{\code{\link{gVoCC}}, \code{\link{trajClas}}}
-#' @export
-#' @author Jorge Garcia Molinos, David S. Schoeman and Michael T. Burrows
-#' @examples
-#'
-#' HSST <- VoCC_get_data("HSST.tif")
-#'
-#' yrSST <- sumSeries(HSST,
-#' p = "1960-01/2009-12", yr0 = "1955-01-01", l = terra::nlyr(HSST),
-#' fun = function(x) colMeans(x, na.rm = TRUE),
-#' freqin = "months", freqout = "years"
-#' )
-#'
-#' # Long-term local climatic trends
-#' tr <- tempTrend(yrSST, th = 10)
-#'
-#' # Local spatial climatic gradients
-#' sg <- spatGrad(yrSST, th = 0.0001, projected = FALSE)
-#'
-#' # Gradient-based climate velocity
-#' v <- gVoCC(tr, sg)
-#' vel <- v[[1]]
-#' ang <- v[[2]]
-#'
-#' # Calculate the annual SST mean over the period
-#' mn <- terra::mean(yrSST, na.rm = TRUE)
-#'
-#' # Get the set of starting cells for the trajectories
-#' lonlat <- stats::na.omit(data.frame(
-#' terra::xyFromCell(vel, 1:terra::ncell(vel)),
-#' vel[], ang[], mn[]
-#' ))[, 1:2]
-#'
-#' # Calculate trajectories
-#' # The following throws an error due to the trajectories moving beyond the raster extent
-#' traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50)
-#'
-#' # This accounts for the extent issue
-#' traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50, correct = TRUE)
-#'
-voccTraj <- function(lonlat, vel, ang, mn, tyr, trajID = 1:nrow(lonlat), correct = FALSE) {
-
- if (correct == TRUE) {
- e <- terra::ext(vel) + (rep(terra::res(vel), each = 2) * c(1, 1, 1, 1))
- vel <- terra::extend(vel, e, fill = NA)
- ang <- terra::extend(ang, e, fill = NA)
- mn <- terra::extend(mn, e, fill = NA)
- }
-
- # make sure all raster has consistent NAs
- vel[is.na(ang)] <- NA
- vel[is.na(mn)] <- NA
- ang[is.na(vel)] <- NA
- mn[is.na(vel)] <- NA
-
- # Set up variables to catch results, allocating the right amount of memory
- nc <- nrow(lonlat)
- remaining <- rep(tyr, nc) # String containing the time remaining for each trajectory
- llon <- rep(NA, (nc * tyr) + nc) # Starting lons, plus one more set for each iteration
- llat <- rep(NA, (nc * tyr) + nc)
- rem <- rep(NA, (nc * tyr) + nc) # this is to keep track of trajectories trapped in internal sinks
-
- # populate the first n slots with starting points
- llon[1:nc] <- lonlat[, 1]
- llat[1:nc] <- lonlat[, 2]
- rem[1:nc] <- remaining
- i <- 0 # set the iteration counter
- land <- "N" # set to not hit land
- bounce <- "N" # set to not bounced
-
- # Calculate the trajectories
- pb <- utils::txtProgressBar(min = 0, max = 100, style = 3)
- while (sum(remaining <= 0) != nc) { # while there is at least one trajectory active
-
- utils::setTxtProgressBar(pb, 100 * (sum(remaining <= 0) / nc))
-
- llold <- lonlat # Take a copy of lonlat (starting cell xy)
- resto <- which(remaining > 0) # index with remaining active trajectories
-
- fcells <- terra::cellFromXY(vel, llold) # focal cells
-
- # Extract lon and lat of landing point for the remaining active trajectories
- # limit the displacement to 2 cell lengths to reduce later the number of intermediate points
- dth <- max(terra::res(vel)) * 222000
- dis <- data.table::fifelse(dth < (abs(vel[fcells[resto]]) * remaining[resto] * 1000), # If
- dth, # Do this
- (abs(vel[fcells[resto]]) * remaining[resto] * 1000)[, 1]) # else
-
-
- # JDE - The error occurs here but doesn't start here. ang[fcells[resto]][, 1] is a NA and therefore NA is introduced into lonlat
- # latlon is not NA, but it seems somewhere a land cell or a NA velocity cell is introduced into llold
- # I think this starts on the previous iteration. Obviously a land cell is not corrected. I think this is in Step 4....
-
- # distance input in meters. The function adjusts internally for -180-180 and pole crossings
- lonlat[resto, ] <- as.data.frame(
- geosphere::destPoint(p = llold[resto, ], b = ang[fcells[resto]][, 1], d = dis)
- )
-
- tcells <- terra::cellFromXY(vel, lonlat)
-
- # Step 1. where the trajectory is still in the same cell by tyr, it has terminated. -----
- # Flag those trajectories by resetting the reminding time to 0 to get them out of the next iteration.
- remaining[fcells == tcells] <- 0
- if (sum(remaining == 0) == nc) {
- break # to avoid error when only 1 trajectory is left and finishes inside a cell
- }
-
- # Step 2. For the rest, get the last point in the starting cell and the first point in a new cell -----
- resto <- which(remaining > 0) # update resto
- d <- round((geosphere::distGeo(llold[resto, ], lonlat[resto, ]) / 1000), 0)
- d[d == 0] <- 1
-
-
- Trajxy <- splitLine(A = llold[resto, ], B = lonlat[resto, ], nn = d)
-
- # now get a list with the cells for the points in each trajectory
- if (is.list(Trajxy)) {
- Trajcells <- lapply(Trajxy, terra::cellFromXY, object = vel)
- # the first new cell in the trajectory
- index <- lapply(Trajcells, function(x) which(x != x[1])[1])
- newcell <- mapply(function(X, Y) {
- X[Y]
- }, X = Trajcells, Y = index)
-
- # the coordinates for that first point out of the focal cell
- newxy <- as.data.frame(t(mapply(function(X, Y) {
- X[Y, ]
- }, X = Trajxy, Y = index)))
-
- # the coordinates for the last focal cell point
- oldxy <- as.data.frame(t(mapply(function(X, Y) {
- X[Y - 1, ]
- }, X = Trajxy, Y = index)))
- } else { # if 1 trajectory the output from splitLine is a single matrix instead of a list
- Trajcells <- apply(Trajxy, 1, terra::cellFromXY, object = vel)
- newcell <- Trajcells[which(Trajcells != Trajcells[1])[1]]
- newxy <- data.frame(x = Trajxy[which(Trajcells != Trajcells[1])[1], 1], y = Trajxy[which(Trajcells != Trajcells[1])[1], 2])
- oldxy <- data.frame(x = Trajxy[(which(Trajcells != Trajcells[1])[1]) - 1, 1], y = Trajxy[(which(Trajcells != Trajcells[1])[1]) - 1, 2])
- }
-
- # starting and destination cell ids
- oldcell <- fcells[resto]
-
- # Get the new velocity at the new cells
- velend <- terra::extract(vel, newcell)
-
- # set remaining time for each of the running trajectories
- remaining[resto][is.na(velend)] <- remaining[resto][is.na(velend)] - ((geosphere::distGeo(llold[resto, ][is.na(velend), ], oldxy[is.na(velend), ]) / 1000) / abs(vel[fcells[resto]][is.na(velend)]))
- remaining[resto][!is.na(velend)] <- remaining[resto][!is.na(velend)] - ((geosphere::distGeo(llold[resto, ][!is.na(velend), ], newxy[!is.na(velend), ]) / 1000) / abs(vel[fcells[resto]][!is.na(velend)]))
-
- # For those ending in marine cells update lonlat info to the new point
- lonlat[resto, ][!is.na(velend), ] <- newxy[!is.na(velend), ]
-
- # For those ending in land cells update lonlat info to the last marine point
- lonlat[resto, ][is.na(velend), ] <- oldxy[is.na(velend), ]
-
- # Step 3. From step 3 onwards check if the trajectory has bounced back to the origin cell. -----
- # If so, redirect along cell border.
- if (i >= 1) {
- current <- newcell[!is.na(velend)] # current cell
- last <- oldcell[!is.na(velend)] # last cell
- if (land == "Y" & bounce == "Y") { # Given the counter increases each time the trajectory table is updated,
- # where some traj hit land AND bounced in the previous iteration the values were repeated twice for all cells. Hence, need to go 3 steps back instead of 1
- print("Option 1: Go back 3 steps")
- last2 <- terra::cellFromXY(vel, cbind(llon[(((i - 3) * nc) + 1):(((i - 3) * nc) + nc)][resto][!is.na(velend)], llat[(((i - 3) * nc) + 1):(((i - 3) * nc) + nc)][resto][!is.na(velend)])) # last but one cell
- land <- "N" # set back to no hit land
- bounce <- "N"
- } else if (xor(land == "Y", bounce == "Y")) { # if one of the two conditions then need to go two steps back
- print("Option 2: Go back 2 steps")
- last2 <- terra::cellFromXY(vel, cbind(llon[(((i - 2) * nc) + 1):(((i - 2) * nc) + nc)][resto][!is.na(velend)], llat[(((i - 2) * nc) + 1):(((i - 2) * nc) + nc)][resto][!is.na(velend)]))
- land <- "N"
- bounce <- "N"
- } else { # if non of the two, then just one step back
- print("Option 3: Go back 1 step")
- last2 <- terra::cellFromXY(vel, cbind(llon[(((i - 1) * nc) + 1):(((i - 1) * nc) + nc)][resto][!is.na(velend)], llat[(((i - 1) * nc) + 1):(((i - 1) * nc) + nc)][resto][!is.na(velend)]))
- }
-
- # Identify the bouncing trajectories
- ind <- which(current == last2 & current != last)
- if (length(ind) > 0) {
- bounce <- "Y"
-
- # take the mean velocity from the appropriate lat/lon vel components.
- vb <- mapply(
- function(X, Y) {
- ifelse(abs(X - Y) > 1, # if
- mean(c(as.numeric((vel[X] * sin(pi * ang[X] / 180))), as.numeric((vel[Y] * sin(pi * ang[Y] / 180))))), # do this
- mean(c(as.numeric((vel[X] * cos(pi * ang[X] / 180))), as.numeric((vel[Y] * cos(pi * ang[Y] / 180))))) # else do this
- )},
- X = current[ind], Y = last[ind]
- )
-
- # take the corresponding angle (0/180 / 90/270 for lat / lon movements)
- ab <- mapply(function(X, Y, Z) {
- ifelse(abs(X - Y) > 1 & Z > 0, # if
- 90, # do this
- ifelse(abs(X - Y) > 1 & Z < 0, # else
- 270, # do this
- ifelse(abs(X - Y) == 1 & Z > 0,
- 0, # do this
- 180 # else
- )))},
- X = current[ind], Y = last[ind], Z = vb)
-
- if (is.matrix(ab)) {
- ab <- ab[, 1]
- }
-
- # Extract lon and lat of point previous to bounce and new destination point for the remaining active trajectories
- p <- oldxy[!is.na(velend), ][ind, ]
- dis <- ifelse(dth < (abs(vb) * remaining[resto][!is.na(velend)][ind] * 1000),
- dth,
- (abs(vb) * remaining[resto][!is.na(velend)][ind] * 1000))
- destp <- as.data.frame(geosphere::destPoint(p, ab, dis))
-
- # where the trajectory is still in the same cell by tyr, it has terminated. Flag those trajectories by resetting the reminding time to 0 to get them out of the next iteration.
- same <- which(terra::cellFromXY(vel, p) == terra::cellFromXY(vel, destp))
- remaining[resto][!is.na(velend)][ind][same] <- 0
-
- # For the rest, get the correct destination point
- rest <- which(terra::cellFromXY(vel, p) != terra::cellFromXY(vel, destp)) # update rest
-
- if (length(rest) > 0) {
-
- d <- round((geosphere::distGeo(p[rest, ], destp[rest, ]) / 1000), 0)
- d[d == 0] <- 1
-
- Trajxy <- splitLine(A = p[rest, ], B = destp[rest, ], nn = d)
-
- # now get a list with the cells for the points in each trajectory
- if (is.list(Trajxy)) {
- Trajcells <- lapply(Trajxy, terra::cellFromXY, object = vel)
-
- # the first new cell in the trajectory
- index <- lapply(Trajcells, function(x) which(x != x[1])[1])
-
- # update the coordinates for that first point out of the focal cell
- newxy[!is.na(velend), ][ind, ][rest, ] <- as.data.frame(t(mapply(function(X, Y) {
- X[Y, ]
- }, X = Trajxy, Y = index)))
-
- # update points info for the old position in case the trajectory hit land and need to be repositioned
- i <- i + 1
- llon[((i * nc) + 1):((i * nc) + nc)] <- lonlat[, 1]
- llat[((i * nc) + 1):((i * nc) + nc)] <- lonlat[, 2]
- llon[((i * nc) + 1):((i * nc) + nc)][resto][!is.na(velend)][ind][rest] <- oldxy[!is.na(velend), ][ind, ][rest, 1]
- llat[((i * nc) + 1):((i * nc) + nc)][resto][!is.na(velend)][ind][rest] <- oldxy[!is.na(velend), ][ind, ][rest, 2]
-
- # update the coordinates for the last focal cell point
- oldxy[!is.na(velend), ][ind, ][rest, ] <- as.data.frame(t(mapply(function(X, Y) {
- X[Y - 1, ]
- }, X = Trajxy, Y = index)))
-
- } else { # if all the trajectories have same number of points the output from gc
- # Intermediate is a matrix instead of a list
-
- # Trajcells <- apply(Trajxy, 1, terra::cellFromXY, object = vel)
- Trajcells <- apply(vel, 1, terra::cellFromXY, xy = Trajxy)
-
- newxy[!is.na(velend), ][ind, ][rest, ] <- data.frame(x = Trajxy[which(Trajcells != Trajcells[1])[1], 1], y = Trajxy[which(Trajcells != Trajcells[1])[1], 2])
- i <- i + 1
- llon[((i * nc) + 1):((i * nc) + nc)] <- lonlat[, 1] # necessary to not leave the other cells as NAs
- llat[((i * nc) + 1):((i * nc) + nc)] <- lonlat[, 2]
- llon[((i * nc) + 1):((i * nc) + nc)][resto][!is.na(velend)][ind][rest] <- oldxy[!is.na(velend), ][ind, ][rest, 1]
- llat[((i * nc) + 1):((i * nc) + nc)][resto][!is.na(velend)][ind][rest] <- oldxy[!is.na(velend), ][ind, ][rest, 2]
- oldxy[!is.na(velend), ][ind, ][rest, ] <- data.frame(x = Trajxy[(which(Trajcells != Trajcells[1])[1]) - 1, 1], y = Trajxy[(which(Trajcells != Trajcells[1])[1]) - 1, 2])
- }
-
- # Update main traj info
- # get remaining time for each of the running trajectories
- remaining[resto][!is.na(velend)][ind][rest] <- remaining[resto][!is.na(velend)][ind][rest] - ((geosphere::distGeo(newxy[!is.na(velend), ][ind, ][rest, ], p[rest, ]) / 1000) / abs(vb[rest]))
- rem[((i * nc) + 1):((i * nc) + nc)] <- remaining
- lonlat[resto, ][!is.na(velend), ][ind, ][rest, ] <- newxy[!is.na(velend), ][ind, ][rest, ]
-
- # update the velocity at new cells (some of the redirected bouncing trajectories might have ended in a land cell)
- newcell[!is.na(velend)][ind][rest] <- terra::cellFromXY(vel, newxy[!is.na(velend), ][ind, ][rest, ])
- velend[!is.na(velend)][ind][rest] <- terra::extract(vel, terra::cellFromXY(vel, newxy[!is.na(velend), ][ind, ][rest, ]))
- }
- }
- }
-
- # Step 4. For those traj ending on land redirect the trajectories if possible -----
- if (sum(is.na(velend)) > 0) {
-
- land <- "Y" # to know if land was hit in the next loop when looking at bouncing trajectories
- onland <- which(is.na(velend)) # Identify which rows of velend are on land
-
- # break and produce error if trajectories go beyond raster extent
- if (anyNA(newcell[onland])) {
- stop("Trajectories beyond raster extent - set correct = TRUE or limit lonlat to a sufficiently smaller domain relative to current raster extent")
- }
-
- # For each cell that ends on land, look for a suitable target cell...
- # Make list of candidate cell IDs: overlap between cells adjacent
- # to "from" (fcells[is.na(sflags)][onland]) AND "to" (newcell[onland])cells
- # that are in the direction of movement (any other cells would mean "un-natural" movements).
- ccells <- suppressWarnings(mapply(function(X, Y) {
- Z <- as.numeric(terra::intersect(terra::adjacent(vel, X, directions = 8), terra::adjacent(vel, Y, directions = 8)))
- Z[!is.na(vel[Z])]
- }, X = oldcell[onland], Y = newcell[onland], SIMPLIFY = FALSE))
-
- # Now check if a suitable cell, other than the focal cell, is available along the line of movement
- # given departure direction. Diagonals included.
- # First, calculate the velocity associated to each focal cell with which to
- # move along the cell border given direction
- # Then
- # if transfer is vertical (upper/lower cell) use horizontal velocity component,
- # if transfer is horizontal, use vertical component
- # negative values indicate E-W and N-S movements
-
- v <- mapply(function(X, Y) {
- ifelse(abs(X - Y) > 1, abs(vel[Y]) * sin(pi * ang[Y] / 180), abs(vel[Y]) * cos(pi * ang[Y] / 180))
- }, X = newcell[onland], Y = oldcell[onland])
-
- a <- rep(NA, length(v)) # to store angles for border movement
-
- for (k in 1:length(v)) {
- target <- newcell[onland][k]
- focal <- oldcell[onland][k]
-
- if ((target - focal) > 1 & v[k] > 0) { # vertical transfer, horizontal movement
- ccells[[k]] <- subset(ccells[[k]], ccells[[k]] %in% c(focal + 1, focal + ncol(vel) + 1)) # JDE Focal cell + 1 and focal diagonal on next column (ncol + a)
- a[k] <- 90 # Then set angle
- } else if ((target - focal) > 1 & v[k] < 0) {
- ccells[[k]] <- subset(ccells[[k]], ccells[[k]] %in% c(focal - 1, focal + ncol(vel) - 1))
- a[k] <- 270
- } else if ((target - focal) < -1 & v[k] > 0) {
- ccells[[k]] <- subset(ccells[[k]], ccells[[k]] %in% c(focal + 1, focal - ncol(vel) + 1))
- a[k] <- 90
- } else if ((target - focal) < -1 & v[k] < 0) {
- ccells[[k]] <- subset(ccells[[k]], ccells[[k]] %in% c(focal - 1, focal - ncol(vel) - 1))
- a[k] <- 270
- } else if ((target - focal) == 1 & v[k] > 0) { # horizontal transfer, vertical movement
- ccells[[k]] <- subset(ccells[[k]], ccells[[k]] %in% c(focal - ncol(vel), focal - ncol(vel) + 1))
- a[k] <- 0
- } else if ((target - focal) == 1 & v[k] < 0) {
- ccells[[k]] <- subset(ccells[[k]], ccells[[k]] %in% c(focal + ncol(vel), focal + ncol(vel) + 1))
- a[k] <- 180
- } else if ((target - focal) == -1 & v[k] > 0) {
- ccells[[k]] <- subset(ccells[[k]], ccells[[k]] %in% c(focal - ncol(vel), focal - ncol(vel) - 1))
- a[k] <- 0
- } else if ((target - focal) == -1 & v[k] < 0) {
- ccells[[k]] <- subset(ccells[[k]], ccells[[k]] %in% c(focal + ncol(vel), focal + ncol(vel) - 1))
- a[k] <- 180
- }
- }
-
- rm(k)
-
- # Flag out the cells for which no suitable potential neighbours are available
- # (all potential neighbours are NA; the trajectory has nowhere to go)
- empty <- as.logical(lapply(ccells, function(x) identical(x, numeric(0))))
- remaining[resto][onland][empty] <- 0
- lonlat[resto, ][onland, ][empty, ] <- oldxy[onland, ][empty, ]
-
- # if there are cells with available neighbours
- if (sum(!empty) > 0) {
-
- # select those cells
- leftcell <- ccells[!empty]
- focal <- oldcell[onland][!empty]
- target <- newcell[onland][!empty]
- nxy <- newxy[onland, ][!empty, ]
- oxy <- oldxy[onland, ][!empty, ]
- vleft <- as.numeric(v[!empty])
- aleft <- a[!empty]
-
- # Check if there is an actual suitable neighbour
- # sst at focal and neighbouring cells
-
- sst <- lapply(leftcell, function(x) as.numeric(terra::extract(mn, x, raw = TRUE)))
-
- # if warming (cooling), need a suitable neighbour with cooler (warmer) local temperatures
- for (k in 1:length(leftcell)) {
-
- # sst (list) is the sst from the mn climate layer for the adjoining cell
- # focal is the focal cell number
- # mn is the climate temp layer
- # mn[focal[k]] is the temperature at the focal cell
- # sst[[k]] is the sst in the adjoining cells
- leftcell[k] <- ifelse(vel[focal[k]] > 0 & sum(sst[[k]] < mn[focal[k]]) > 0, # if
- leftcell[[k]][which.min(sst[[k]])], # do this
- ifelse(vel[focal[k]] < 0 & sum(sst[[k]] > mn[focal[k]]) > 0, # else
- leftcell[[k]][which.max(sst[[k]])], # do this
- NA)) # else
- } # End finding a suitable cell
-
- # Flag cells for which no suitable neighbours are available (no suitable sst)
- remaining[resto][onland][!empty][is.na(as.numeric(leftcell))] <- 0
- lonlat[resto, ][onland, ][!empty, ][is.na(as.numeric(leftcell)), ] <- oldxy[onland, ][!empty, ][is.na(as.numeric(leftcell)), ]
-
- # For those traj with a suitable neighbour, relocate the trajectory to the nearest newcell point and calculate the time needed to reach it
- if (length(target[!is.na(as.numeric(leftcell))]) > 0) {
- dudcent <- terra::xyFromCell(vel, target[!is.na(as.numeric(leftcell))]) # Coordinates of dud target cell on land
- newcent <- terra::xyFromCell(vel, as.numeric(leftcell[!is.na(as.numeric(leftcell))])) # Coordinates of new target cell
- oldcent <- terra::xyFromCell(vel, focal[!is.na(as.numeric(leftcell))]) # Coordinates of departure cell
- loncent <- data.frame(oldx = oldcent[, 1], NAx = dudcent[, 1], newx = newcent[, 1]) # An object containing the longitudes of the cells involved - needed for fixing dateline
-
- for (k in 1:nrow(loncent)) {
-
- # Remove sign change for dateline, if needed
- if (abs(max(loncent[k, ]) - min(loncent[k, ])) > 180) {
- loncent[k, ][loncent[k, ] < 0] <- loncent[k, ][loncent[k, ] < 0] + 360
- }
-
- # Figure out position of dividing longitude
- loncent$lonline[k] <- ifelse(abs(loncent[k, 2] - loncent[k, 3]) > abs(loncent[k, 2] - loncent[k, 1]), # if lon difference between NA cell and new cell is larger than NA to old cell
- mean(c(loncent[k, 1], loncent[k, 3])), mean(c(loncent[k, 1], loncent[k, 2]))
- )
-
- loncent$lonline[k] <- loncent$lonline[k] - (360 * floor((loncent$lonline[k] + 180) / 360)) # Return to -180o to 180o format
- loncent$lonline[k] <- ifelse(loncent$lonline[k] == 180 && newcent[k, 1] < 0, -180, loncent$lonline[k])
- loncent$lonline[k] <- ifelse(loncent$lonline[k] == -180 && newcent[k, 1] > 0, 180, loncent$lonline[k]) # Arrange lonline to accommodate dateline
- loncent$latline[k] <- ifelse(abs(dudcent[k, 2] - newcent[k, 2]) > abs(dudcent[k, 2] - oldcent[k, 2]), mean(c(oldcent[k, 2], newcent[k, 2])), mean(c(oldcent[k, 2], dudcent[k, 2])))
- loncent$dirlon[k] <- ifelse(newcent[k, 1] > loncent$lonline[k], 1, -1) # Adjust direction of movement relative to lonline
- loncent$dirlat[k] <- ifelse(newcent[k, 2] > loncent$latline[k], 1, -1) # Same for latline
- loncent$lonnew[k] <- loncent$lonline[k] + (loncent$dirlon[k] * 0.0001) # add a small offset to put the traj on the new cell
- loncent$latnew[k] <- loncent$latline[k] + (loncent$dirlat[k] * 0.0001)
- loncent$latnew[k] <- ifelse(loncent$latnew[k] > 90, 90, ifelse(loncent$latnew[k] < -90, -90, loncent$latnew[k]))
- loncent$lonnew[k] <- loncent$lonnew[k] - (360 * floor((loncent$lonnew[k] + 180) / 360))
- }
-
- loncent$oldcell <- focal[!is.na(as.numeric(leftcell))]
- loncent$lonold <- oxy[!is.na(as.numeric(leftcell)), 1] # oxy <- old xy
- loncent$latold <- oxy[!is.na(as.numeric(leftcell)), 2]
- loncent$dis <- (geosphere::distGeo(oxy[!is.na(as.numeric(leftcell)), ], loncent[, 8:9]) / 1000) # distance from dold to new point
- loncent$dur <- loncent$dis / abs(vleft[!is.na(as.numeric(leftcell))]) # time taken to get there
- loncent$remaining <- remaining[resto][onland][!empty][!is.na(as.numeric(leftcell))] - loncent$dur
-
- # where remaining is < 0, the trajectory terminates before reaching new destination.
- # Flag those traj out and place them in the corresponding final coordinates.
- if (sum(loncent$remaining < 0) > 0) {
- loncent[loncent$remaining < 0, 8:9] <- as.matrix(geosphere::destPoint(
- oxy[!is.na(as.numeric(leftcell)), ][loncent$remaining < 0, ], aleft[!is.na(as.numeric(leftcell))][loncent$remaining < 0],
- (abs(vleft[!is.na(as.numeric(leftcell))][loncent$remaining < 0]) * (remaining[resto][onland][!empty][!is.na(as.numeric(leftcell))][loncent$remaining < 0]) * 1000)
- ))
- loncent$remaining[loncent$remaining < 0] <- 0
- }
-
- # Finally, update lonlat
- i <- i + 1 # increase the counter by 1
-
- # first input the point before hitting land
- lonlat[resto, ][onland, ][!empty, ][!is.na(as.numeric(leftcell)), ] <- loncent[, 11:12]
- llon[((i * nc) + 1):((i * nc) + nc)] <- lonlat[, 1] # Add final lon to the list
- llat[((i * nc) + 1):((i * nc) + nc)] <- lonlat[, 2] # Add final lat to the list
-
- # then the new point to carry the trajectory on with
- remaining[resto][onland][!empty][!is.na(as.numeric(leftcell))] <- loncent$remaining
- rem[((i * nc) + 1):((i * nc) + nc)] <- remaining
- lonlat[resto, ][onland, ][!empty, ][!is.na(as.numeric(leftcell)), ] <- loncent[, 8:9]
-
- }
- }
- } # End of Step 4. There should be no land cells after Step 4
-
- # Step 5. Update register before moving to the next projection step ----
- i <- i + 1 # increase the counter by 1
- llon[((i * nc) + 1):((i * nc) + nc)] <- lonlat[, 1] # Add final lon to the list
- llat[((i * nc) + 1):((i * nc) + nc)] <- lonlat[, 2] # Add final lat to the list
- rem[((i * nc) + 1):((i * nc) + nc)] <- remaining
-
- # Step 6. Check for trajectories trapped in internal sinks and terminate them ----
- if (i >= 8) {
- cs <- which(remaining != 0)
- # index the trajectories trapped in a sink (those for which distance travelled over the last 4 iterations is less than 0.5 km)
- if (length(cs) > 0) {
- ind <- which(unlist(lapply(cs, function(x) all(utils::tail(abs(diff(rem[seq(x, by = nc, length.out = i + 1)], 1))[abs(diff(rem[seq(x, by = nc, length.out = i + 1)], 1)) != 0], 4) < 0.5))))
- # Terminate trapped trajectories
- if (length(ind) > 0) {
- remaining[cs][ind] <- 0
- }
- }
- } # End Step 6
-
- } # End of while remaining
- close(pb)
-
-
- # prepare output
- trajIDs <- rep(trajID, (length(llon) / nc)) # rep(initialcells,(length(llon)/nc))
- traj <- stats::na.omit(data.frame(x = llon, y = llat, trajIDs = trajIDs))
- # remove duplicated points (to keep track of the trajectory's ID all trajectories are repeated over iterations even if they had terminated)
- traj <- traj[!duplicated(traj), ]
-
- return(traj)
-}
diff --git a/docs/404.html b/docs/404.html
new file mode 100644
index 0000000..baaac0b
--- /dev/null
+++ b/docs/404.html
@@ -0,0 +1,75 @@
+
+
+
+
+
+
+
+Page not found (404) • VoCC
+
+
+
+
+
+
+
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+Content not found. Please use links in the navbar.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/LICENSE.html b/docs/LICENSE.html
new file mode 100644
index 0000000..e3b0ddb
--- /dev/null
+++ b/docs/LICENSE.html
@@ -0,0 +1,244 @@
+
+GNU Affero General Public License • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Version 3, 19 November 2007 Copyright (C) 2007 Free Software Foundation, Inc. <https://fsf.org/ >
+
Everyone is permitted to copy and distribute verbatim copies of this license document, but changing it is not allowed.
+
+
Preamble
+
The GNU Affero General Public License is a free, copyleft license for software and other kinds of works, specifically designed to ensure cooperation with the community in the case of network server software.
+
The licenses for most software and other practical works are designed to take away your freedom to share and change the works. By contrast, our General Public Licenses are intended to guarantee your freedom to share and change all versions of a program–to make sure it remains free software for all its users.
+
When we speak of free software, we are referring to freedom, not price. Our General Public Licenses are designed to make sure that you have the freedom to distribute copies of free software (and charge for them if you wish), that you receive source code or can get it if you want it, that you can change the software or use pieces of it in new free programs, and that you know you can do these things.
+
Developers that use our General Public Licenses protect your rights with two steps: (1) assert copyright on the software, and (2) offer you this License which gives you legal permission to copy, distribute and/or modify the software.
+
A secondary benefit of defending all users’ freedom is that improvements made in alternate versions of the program, if they receive widespread use, become available for other developers to incorporate. Many developers of free software are heartened and encouraged by the resulting cooperation. However, in the case of software used on network servers, this result may fail to come about. The GNU General Public License permits making a modified version and letting the public access it on a server without ever releasing its source code to the public.
+
The GNU Affero General Public License is designed specifically to ensure that, in such cases, the modified source code becomes available to the community. It requires the operator of a network server to provide the source code of the modified version running there to the users of that server. Therefore, public use of a modified version, on a publicly accessible server, gives the public access to the source code of the modified version.
+
An older license, called the Affero General Public License and published by Affero, was designed to accomplish similar goals. This is a different license, not a version of the Affero GPL, but Affero has released a new version of the Affero GPL which permits relicensing under this license.
+
The precise terms and conditions for copying, distribution and modification follow.
+
+
+
TERMS AND CONDITIONS
+
+
0. Definitions.
+
“This License” refers to version 3 of the GNU Affero General Public License.
+
“Copyright” also means copyright-like laws that apply to other kinds of works, such as semiconductor masks.
+
“The Program” refers to any copyrightable work licensed under this License. Each licensee is addressed as “you”. “Licensees” and “recipients” may be individuals or organizations.
+
To “modify” a work means to copy from or adapt all or part of the work in a fashion requiring copyright permission, other than the making of an exact copy. The resulting work is called a “modified version” of the earlier work or a work “based on” the earlier work.
+
A “covered work” means either the unmodified Program or a work based on the Program.
+
To “propagate” a work means to do anything with it that, without permission, would make you directly or secondarily liable for infringement under applicable copyright law, except executing it on a computer or modifying a private copy. Propagation includes copying, distribution (with or without modification), making available to the public, and in some countries other activities as well.
+
To “convey” a work means any kind of propagation that enables other parties to make or receive copies. Mere interaction with a user through a computer network, with no transfer of a copy, is not conveying.
+
An interactive user interface displays “Appropriate Legal Notices” to the extent that it includes a convenient and prominently visible feature that (1) displays an appropriate copyright notice, and (2) tells the user that there is no warranty for the work (except to the extent that warranties are provided), that licensees may convey the work under this License, and how to view a copy of this License. If the interface presents a list of user commands or options, such as a menu, a prominent item in the list meets this criterion.
+
+
+
1. Source Code.
+
The “source code” for a work means the preferred form of the work for making modifications to it. “Object code” means any non-source form of a work.
+
A “Standard Interface” means an interface that either is an official standard defined by a recognized standards body, or, in the case of interfaces specified for a particular programming language, one that is widely used among developers working in that language.
+
The “System Libraries” of an executable work include anything, other than the work as a whole, that (a) is included in the normal form of packaging a Major Component, but which is not part of that Major Component, and (b) serves only to enable use of the work with that Major Component, or to implement a Standard Interface for which an implementation is available to the public in source code form. A “Major Component”, in this context, means a major essential component (kernel, window system, and so on) of the specific operating system (if any) on which the executable work runs, or a compiler used to produce the work, or an object code interpreter used to run it.
+
The “Corresponding Source” for a work in object code form means all the source code needed to generate, install, and (for an executable work) run the object code and to modify the work, including scripts to control those activities. However, it does not include the work’s System Libraries, or general-purpose tools or generally available free programs which are used unmodified in performing those activities but which are not part of the work. For example, Corresponding Source includes interface definition files associated with source files for the work, and the source code for shared libraries and dynamically linked subprograms that the work is specifically designed to require, such as by intimate data communication or control flow between those subprograms and other parts of the work.
+
The Corresponding Source need not include anything that users can regenerate automatically from other parts of the Corresponding Source.
+
The Corresponding Source for a work in source code form is that same work.
+
+
+
2. Basic Permissions.
+
All rights granted under this License are granted for the term of copyright on the Program, and are irrevocable provided the stated conditions are met. This License explicitly affirms your unlimited permission to run the unmodified Program. The output from running a covered work is covered by this License only if the output, given its content, constitutes a covered work. This License acknowledges your rights of fair use or other equivalent, as provided by copyright law.
+
You may make, run and propagate covered works that you do not convey, without conditions so long as your license otherwise remains in force. You may convey covered works to others for the sole purpose of having them make modifications exclusively for you, or provide you with facilities for running those works, provided that you comply with the terms of this License in conveying all material for which you do not control copyright. Those thus making or running the covered works for you must do so exclusively on your behalf, under your direction and control, on terms that prohibit them from making any copies of your copyrighted material outside their relationship with you.
+
Conveying under any other circumstances is permitted solely under the conditions stated below. Sublicensing is not allowed; section 10 makes it unnecessary.
+
+
+
3. Protecting Users’ Legal Rights From Anti-Circumvention Law.
+
No covered work shall be deemed part of an effective technological measure under any applicable law fulfilling obligations under article 11 of the WIPO copyright treaty adopted on 20 December 1996, or similar laws prohibiting or restricting circumvention of such measures.
+
When you convey a covered work, you waive any legal power to forbid circumvention of technological measures to the extent such circumvention is effected by exercising rights under this License with respect to the covered work, and you disclaim any intention to limit operation or modification of the work as a means of enforcing, against the work’s users, your or third parties’ legal rights to forbid circumvention of technological measures.
+
+
+
4. Conveying Verbatim Copies.
+
You may convey verbatim copies of the Program’s source code as you receive it, in any medium, provided that you conspicuously and appropriately publish on each copy an appropriate copyright notice; keep intact all notices stating that this License and any non-permissive terms added in accord with section 7 apply to the code; keep intact all notices of the absence of any warranty; and give all recipients a copy of this License along with the Program.
+
You may charge any price or no price for each copy that you convey, and you may offer support or warranty protection for a fee.
+
+
+
5. Conveying Modified Source Versions.
+
You may convey a work based on the Program, or the modifications to produce it from the Program, in the form of source code under the terms of section 4, provided that you also meet all of these conditions:
+
The work must carry prominent notices stating that you modified it, and giving a relevant date.
+
+The work must carry prominent notices stating that it is released under this License and any conditions added under section 7. This requirement modifies the requirement in section 4 to “keep intact all notices”.
+
+You must license the entire work, as a whole, under this License to anyone who comes into possession of a copy. This License will therefore apply, along with any applicable section 7 additional terms, to the whole of the work, and all its parts, regardless of how they are packaged. This License gives no permission to license the work in any other way, but it does not invalidate such permission if you have separately received it.
+
+If the work has interactive user interfaces, each must display Appropriate Legal Notices; however, if the Program has interactive interfaces that do not display Appropriate Legal Notices, your work need not make them do so.
+
+A compilation of a covered work with other separate and independent works, which are not by their nature extensions of the covered work, and which are not combined with it such as to form a larger program, in or on a volume of a storage or distribution medium, is called an “aggregate” if the compilation and its resulting copyright are not used to limit the access or legal rights of the compilation’s users beyond what the individual works permit. Inclusion of a covered work in an aggregate does not cause this License to apply to the other parts of the aggregate.
+
+
+
+
You may convey a covered work in object code form under the terms of sections 4 and 5, provided that you also convey the machine-readable Corresponding Source under the terms of this License, in one of these ways:
+
Convey the object code in, or embodied in, a physical product (including a physical distribution medium), accompanied by the Corresponding Source fixed on a durable physical medium customarily used for software interchange.
+
+Convey the object code in, or embodied in, a physical product (including a physical distribution medium), accompanied by a written offer, valid for at least three years and valid for as long as you offer spare parts or customer support for that product model, to give anyone who possesses the object code either (1) a copy of the Corresponding Source for all the software in the product that is covered by this License, on a durable physical medium customarily used for software interchange, for a price no more than your reasonable cost of physically performing this conveying of source, or (2) access to copy the Corresponding Source from a network server at no charge.
+
+Convey individual copies of the object code with a copy of the written offer to provide the Corresponding Source. This alternative is allowed only occasionally and noncommercially, and only if you received the object code with such an offer, in accord with subsection 6b.
+
+Convey the object code by offering access from a designated place (gratis or for a charge), and offer equivalent access to the Corresponding Source in the same way through the same place at no further charge. You need not require recipients to copy the Corresponding Source along with the object code. If the place to copy the object code is a network server, the Corresponding Source may be on a different server (operated by you or a third party) that supports equivalent copying facilities, provided you maintain clear directions next to the object code saying where to find the Corresponding Source. Regardless of what server hosts the Corresponding Source, you remain obligated to ensure that it is available for as long as needed to satisfy these requirements.
+
+Convey the object code using peer-to-peer transmission, provided you inform other peers where the object code and Corresponding Source of the work are being offered to the general public at no charge under subsection 6d.
+
+A separable portion of the object code, whose source code is excluded from the Corresponding Source as a System Library, need not be included in conveying the object code work.
+
A “User Product” is either (1) a “consumer product”, which means any tangible personal property which is normally used for personal, family, or household purposes, or (2) anything designed or sold for incorporation into a dwelling. In determining whether a product is a consumer product, doubtful cases shall be resolved in favor of coverage. For a particular product received by a particular user, “normally used” refers to a typical or common use of that class of product, regardless of the status of the particular user or of the way in which the particular user actually uses, or expects or is expected to use, the product. A product is a consumer product regardless of whether the product has substantial commercial, industrial or non-consumer uses, unless such uses represent the only significant mode of use of the product.
+
“Installation Information” for a User Product means any methods, procedures, authorization keys, or other information required to install and execute modified versions of a covered work in that User Product from a modified version of its Corresponding Source. The information must suffice to ensure that the continued functioning of the modified object code is in no case prevented or interfered with solely because modification has been made.
+
If you convey an object code work under this section in, or with, or specifically for use in, a User Product, and the conveying occurs as part of a transaction in which the right of possession and use of the User Product is transferred to the recipient in perpetuity or for a fixed term (regardless of how the transaction is characterized), the Corresponding Source conveyed under this section must be accompanied by the Installation Information. But this requirement does not apply if neither you nor any third party retains the ability to install modified object code on the User Product (for example, the work has been installed in ROM).
+
The requirement to provide Installation Information does not include a requirement to continue to provide support service, warranty, or updates for a work that has been modified or installed by the recipient, or for the User Product in which it has been modified or installed. Access to a network may be denied when the modification itself materially and adversely affects the operation of the network or violates the rules and protocols for communication across the network.
+
Corresponding Source conveyed, and Installation Information provided, in accord with this section must be in a format that is publicly documented (and with an implementation available to the public in source code form), and must require no special password or key for unpacking, reading or copying.
+
+
+
7. Additional Terms.
+
“Additional permissions” are terms that supplement the terms of this License by making exceptions from one or more of its conditions. Additional permissions that are applicable to the entire Program shall be treated as though they were included in this License, to the extent that they are valid under applicable law. If additional permissions apply only to part of the Program, that part may be used separately under those permissions, but the entire Program remains governed by this License without regard to the additional permissions.
+
When you convey a copy of a covered work, you may at your option remove any additional permissions from that copy, or from any part of it. (Additional permissions may be written to require their own removal in certain cases when you modify the work.) You may place additional permissions on material, added by you to a covered work, for which you have or can give appropriate copyright permission.
+
Notwithstanding any other provision of this License, for material you add to a covered work, you may (if authorized by the copyright holders of that material) supplement the terms of this License with terms:
+
Disclaiming warranty or limiting liability differently from the terms of sections 15 and 16 of this License; or
+
+Requiring preservation of specified reasonable legal notices or author attributions in that material or in the Appropriate Legal Notices displayed by works containing it; or
+
+Prohibiting misrepresentation of the origin of that material, or requiring that modified versions of such material be marked in reasonable ways as different from the original version; or
+
+Limiting the use for publicity purposes of names of licensors or authors of the material; or
+
+Declining to grant rights under trademark law for use of some trade names, trademarks, or service marks; or
+
+Requiring indemnification of licensors and authors of that material by anyone who conveys the material (or modified versions of it) with contractual assumptions of liability to the recipient, for any liability that these contractual assumptions directly impose on those licensors and authors.
+
+All other non-permissive additional terms are considered “further restrictions” within the meaning of section 10. If the Program as you received it, or any part of it, contains a notice stating that it is governed by this License along with a term that is a further restriction, you may remove that term. If a license document contains a further restriction but permits relicensing or conveying under this License, you may add to a covered work material governed by the terms of that license document, provided that the further restriction does not survive such relicensing or conveying.
+
If you add terms to a covered work in accord with this section, you must place, in the relevant source files, a statement of the additional terms that apply to those files, or a notice indicating where to find the applicable terms.
+
Additional terms, permissive or non-permissive, may be stated in the form of a separately written license, or stated as exceptions; the above requirements apply either way.
+
+
+
8. Termination.
+
You may not propagate or modify a covered work except as expressly provided under this License. Any attempt otherwise to propagate or modify it is void, and will automatically terminate your rights under this License (including any patent licenses granted under the third paragraph of section 11).
+
However, if you cease all violation of this License, then your license from a particular copyright holder is reinstated (a) provisionally, unless and until the copyright holder explicitly and finally terminates your license, and (b) permanently, if the copyright holder fails to notify you of the violation by some reasonable means prior to 60 days after the cessation.
+
Moreover, your license from a particular copyright holder is reinstated permanently if the copyright holder notifies you of the violation by some reasonable means, this is the first time you have received notice of violation of this License (for any work) from that copyright holder, and you cure the violation prior to 30 days after your receipt of the notice.
+
Termination of your rights under this section does not terminate the licenses of parties who have received copies or rights from you under this License. If your rights have been terminated and not permanently reinstated, you do not qualify to receive new licenses for the same material under section 10.
+
+
+
9. Acceptance Not Required for Having Copies.
+
You are not required to accept this License in order to receive or run a copy of the Program. Ancillary propagation of a covered work occurring solely as a consequence of using peer-to-peer transmission to receive a copy likewise does not require acceptance. However, nothing other than this License grants you permission to propagate or modify any covered work. These actions infringe copyright if you do not accept this License. Therefore, by modifying or propagating a covered work, you indicate your acceptance of this License to do so.
+
+
+
10. Automatic Licensing of Downstream Recipients.
+
Each time you convey a covered work, the recipient automatically receives a license from the original licensors, to run, modify and propagate that work, subject to this License. You are not responsible for enforcing compliance by third parties with this License.
+
An “entity transaction” is a transaction transferring control of an organization, or substantially all assets of one, or subdividing an organization, or merging organizations. If propagation of a covered work results from an entity transaction, each party to that transaction who receives a copy of the work also receives whatever licenses to the work the party’s predecessor in interest had or could give under the previous paragraph, plus a right to possession of the Corresponding Source of the work from the predecessor in interest, if the predecessor has it or can get it with reasonable efforts.
+
You may not impose any further restrictions on the exercise of the rights granted or affirmed under this License. For example, you may not impose a license fee, royalty, or other charge for exercise of rights granted under this License, and you may not initiate litigation (including a cross-claim or counterclaim in a lawsuit) alleging that any patent claim is infringed by making, using, selling, offering for sale, or importing the Program or any portion of it.
+
+
+
11. Patents.
+
A “contributor” is a copyright holder who authorizes use under this License of the Program or a work on which the Program is based. The work thus licensed is called the contributor’s “contributor version”.
+
A contributor’s “essential patent claims” are all patent claims owned or controlled by the contributor, whether already acquired or hereafter acquired, that would be infringed by some manner, permitted by this License, of making, using, or selling its contributor version, but do not include claims that would be infringed only as a consequence of further modification of the contributor version. For purposes of this definition, “control” includes the right to grant patent sublicenses in a manner consistent with the requirements of this License.
+
Each contributor grants you a non-exclusive, worldwide, royalty-free patent license under the contributor’s essential patent claims, to make, use, sell, offer for sale, import and otherwise run, modify and propagate the contents of its contributor version.
+
In the following three paragraphs, a “patent license” is any express agreement or commitment, however denominated, not to enforce a patent (such as an express permission to practice a patent or covenant not to sue for patent infringement). To “grant” such a patent license to a party means to make such an agreement or commitment not to enforce a patent against the party.
+
If you convey a covered work, knowingly relying on a patent license, and the Corresponding Source of the work is not available for anyone to copy, free of charge and under the terms of this License, through a publicly available network server or other readily accessible means, then you must either (1) cause the Corresponding Source to be so available, or (2) arrange to deprive yourself of the benefit of the patent license for this particular work, or (3) arrange, in a manner consistent with the requirements of this License, to extend the patent license to downstream recipients. “Knowingly relying” means you have actual knowledge that, but for the patent license, your conveying the covered work in a country, or your recipient’s use of the covered work in a country, would infringe one or more identifiable patents in that country that you have reason to believe are valid.
+
If, pursuant to or in connection with a single transaction or arrangement, you convey, or propagate by procuring conveyance of, a covered work, and grant a patent license to some of the parties receiving the covered work authorizing them to use, propagate, modify or convey a specific copy of the covered work, then the patent license you grant is automatically extended to all recipients of the covered work and works based on it.
+
A patent license is “discriminatory” if it does not include within the scope of its coverage, prohibits the exercise of, or is conditioned on the non-exercise of one or more of the rights that are specifically granted under this License. You may not convey a covered work if you are a party to an arrangement with a third party that is in the business of distributing software, under which you make payment to the third party based on the extent of your activity of conveying the work, and under which the third party grants, to any of the parties who would receive the covered work from you, a discriminatory patent license (a) in connection with copies of the covered work conveyed by you (or copies made from those copies), or (b) primarily for and in connection with specific products or compilations that contain the covered work, unless you entered into that arrangement, or that patent license was granted, prior to 28 March 2007.
+
Nothing in this License shall be construed as excluding or limiting any implied license or other defenses to infringement that may otherwise be available to you under applicable patent law.
+
+
+
12. No Surrender of Others’ Freedom.
+
If conditions are imposed on you (whether by court order, agreement or otherwise) that contradict the conditions of this License, they do not excuse you from the conditions of this License. If you cannot convey a covered work so as to satisfy simultaneously your obligations under this License and any other pertinent obligations, then as a consequence you may not convey it at all. For example, if you agree to terms that obligate you to collect a royalty for further conveying from those to whom you convey the Program, the only way you could satisfy both those terms and this License would be to refrain entirely from conveying the Program.
+
+
+
13. Remote Network Interaction; Use with the GNU General Public License.
+
Notwithstanding any other provision of this License, if you modify the Program, your modified version must prominently offer all users interacting with it remotely through a computer network (if your version supports such interaction) an opportunity to receive the Corresponding Source of your version by providing access to the Corresponding Source from a network server at no charge, through some standard or customary means of facilitating copying of software. This Corresponding Source shall include the Corresponding Source for any work covered by version 3 of the GNU General Public License that is incorporated pursuant to the following paragraph.
+
Notwithstanding any other provision of this License, you have permission to link or combine any covered work with a work licensed under version 3 of the GNU General Public License into a single combined work, and to convey the resulting work. The terms of this License will continue to apply to the part which is the covered work, but the work with which it is combined will remain governed by version 3 of the GNU General Public License.
+
+
+
14. Revised Versions of this License.
+
The Free Software Foundation may publish revised and/or new versions of the GNU Affero General Public License from time to time. Such new versions will be similar in spirit to the present version, but may differ in detail to address new problems or concerns.
+
Each version is given a distinguishing version number. If the Program specifies that a certain numbered version of the GNU Affero General Public License “or any later version” applies to it, you have the option of following the terms and conditions either of that numbered version or of any later version published by the Free Software Foundation. If the Program does not specify a version number of the GNU Affero General Public License, you may choose any version ever published by the Free Software Foundation.
+
If the Program specifies that a proxy can decide which future versions of the GNU Affero General Public License can be used, that proxy’s public statement of acceptance of a version permanently authorizes you to choose that version for the Program.
+
Later license versions may give you additional or different permissions. However, no additional obligations are imposed on any author or copyright holder as a result of your choosing to follow a later version.
+
+
+
15. Disclaimer of Warranty.
+
THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM “AS IS” WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION.
+
+
+
16. Limitation of Liability.
+
IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGES.
+
+
+
17. Interpretation of Sections 15 and 16.
+
If the disclaimer of warranty and limitation of liability provided above cannot be given local legal effect according to their terms, reviewing courts shall apply local law that most closely approximates an absolute waiver of all civil liability in connection with the Program, unless a warranty or assumption of liability accompanies a copy of the Program in return for a fee.
+
END OF TERMS AND CONDITIONS
+
+
+
+
How to Apply These Terms to Your New Programs
+
If you develop a new program, and you want it to be of the greatest possible use to the public, the best way to achieve this is to make it free software which everyone can redistribute and change under these terms.
+
To do so, attach the following notices to the program. It is safest to attach them to the start of each source file to most effectively state the exclusion of warranty; and each file should have at least the “copyright” line and a pointer to where the full notice is found.
+
< one line to give the program's name and a brief idea of what it does.>
+ Copyright (C) <year> <name of author>
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Affero General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ GNU Affero General Public License for more details.
+
+ You should have received a copy of the GNU Affero General Public License
+ along with this program. If not, see <https://www.gnu.org/licenses/>.
+
Also add information on how to contact you by electronic and paper mail.
+
If your software can interact with users remotely through a computer network, you should also make sure that it provides a way for users to get its source. For example, if your program is a web application, its interface could display a “Source” link that leads users to an archive of the code. There are many ways you could offer source, and different solutions will be better for different programs; see section 13 for the specific requirements.
+
You should also get your employer (if you work as a programmer) or school, if any, to sign a “copyright disclaimer” for the program, if necessary. For more information on this, and how to apply and follow the GNU AGPL, see https://www.gnu.org/licenses/ .
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/articles/VoCC.html b/docs/articles/VoCC.html
new file mode 100644
index 0000000..7792bf8
--- /dev/null
+++ b/docs/articles/VoCC.html
@@ -0,0 +1,419 @@
+
+
+
+
+
+
+
+VoCC • VoCC
+
+
+
+
+
+
+
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+THIS IS A WORK IN PROGRESS TO CONVERT THE OLD RASTER-BASED
+VOCC PACKAGE TO TERRA. NOT EVERYTHING WORKS YET.
+This vignette provides the code to reproduce the examples for the R
+package VoCC as presented in Garcia Molinos et al. (2019). Refer to the
+paper and the function documentation for details on function options,
+considerations on the argument choices and interepretation of
+output.
+For this tutorial we need the following packages (if not installed
+get them first):
+
+We also need a few data sets that can be accessed from the
+VoCCdata package.
+
+
+
Example 1: Prediction of biogeographical shifts
+
+
We have a look first at the “marshift” global data set containing
+reported range shifts in marine species corresponding to given periods
+of time.
+
+str ( marshift )
+#> 'data.frame': 343 obs. of 6 variables:
+#> $ lat : num 49.7 53.8 53.8 40 43 ...
+#> $ long : num -4.33 5 5 1 -9.3 -1.4 -9.3 -71.7 -71.7 -71.7 ...
+#> $ timespan : int 30 40 40 55 35 35 84 39 26 54 ...
+#> $ years_data: int 23 40 40 15 4 2 5 2 2 2 ...
+#> $ taxa : Factor w/ 12 levels "Benthic algae",..: 6 6 6 6 3 3 4 5 5 5 ...
+#> $ Shift : num 536.1 65.6 95.9 40 10 ...
+
Next, we calculate the gradient- and distance-based velocities
+(1960-2009), using the HadiSST data set, from which we will later
+extract the corresponding values for each observed shift.
+
+HadiSST <- terra :: rast ( system.file ( "extdata" , "HadiSST.tif" , package = "VoCCdata" ) )
+
+# monthly to annual averages
+r <- sumSeries ( HadiSST , p = "1960-01/2009-12" , yr0 = "1955-01-01" ,
+ l = terra :: nlyr ( HadiSST ) ,
+ fun = function ( x ) colMeans ( x , na.rm = TRUE ) ,
+ freqin = "months" , freqout = "years" )
+
+vt <- tempTrend ( r , th = 10 ) # temporal trend
+vg <- spatGrad ( r , th = 0.0001 , projected = FALSE ) # spatial gradient
+gv <- gVoCC ( vt , vg ) # climate velocity
+
+# Now the distance-based velocities
+# Take 1960-1970 as base period against 2000-2009
+r2 <- c ( terra :: mean ( r [[ 1 : 10 ] ] , na.rm = TRUE ) , terra :: mean ( r [[ 41 : 50 ] ] , na.rm = TRUE ) )
+
+# prepare the data frame with the necessary variables
+clim <- na.omit ( data.frame ( terra :: values ( r2 ) , cid = 1 : terra :: ncell ( r ) ) )
+
+clim [ , c ( "x" , "y" ) ] <- terra :: xyFromCell ( r , clim $ cid )
+
+# 1965-2004 (40 yr), 500 km search radius
+v <- dVoCC ( clim , n = 1 , tdiff = 40 , method = "Single" , climTol = 0.1 , geoTol = 500 , distfun = "GreatCircle" , trans = NA , lonlat = TRUE )
+
Next, we extract the mean velocity estimates for each reported shift
+by taking the average of all grid cell values within a circle of radius
+equal to the reported range-shift distance. These are then used to fit
+the simple linear regression models of observed range shifts against
+climate velocity. Distance-based velocities are strictly positive by
+definition, so to compare like with like we change first their sign to
+negative where present local climates are warmer than their future
+analogues.
+
+# Change sign as needed and create the distance-based velocity raster
+# Change sign as needed - terra approach for value comparison
+focal_vals <- terra :: values ( r2 [[ 1 ] ] ) [ v $ focal ]
+target_vals <- terra :: values ( r2 [[ 2 ] ] ) [ v $ target ]
+ind <- which ( focal_vals > target_vals )
+v $ velBis <- v $ vel
+v $ velBis [ ind ] <- v $ vel [ ind ] * - 1
+
+# put output in raster format - create single layer empty template like raster(gv)
+dv <- terra :: rast ( terra :: ext ( gv ) , resolution = terra :: res ( gv ) , crs = terra :: crs ( gv ) )
+dv [ v $ focal ] <- v $ velBis
+
+# Create point geometries and buffer them
+coords <- terra :: vect ( cbind ( marshift $ long , marshift $ lat ) , crs = "EPSG:4326" )
+buffer_size <- marshift $ Shift * ( marshift $ timespan / 10 ) * 1000
+
+# Get the mean velocity within the buffer for each data point.
+# Match old raster::extract approach exactly
+marshift $ GV <- terra :: extract ( abs ( gv [[ 1 ] ] ) , coords ,
+ buffer = buffer_size ,
+ fun = mean , na.rm = TRUE ,
+ weights = TRUE , exact = FALSE ) [ ,2 ]
+
+marshift $ DV <- terra :: extract ( abs ( dv ) , coords ,
+ buffer = buffer_size ,
+ fun = mean , na.rm = TRUE ,
+ weights = TRUE , exact = FALSE ) [ ,2 ]
+
+# For points that didn't get values (NA), find nearest valid cells
+
+missing_points <- coords [ is.na ( marshift $ GV ) ] # Identify NAs
+if ( ! is.empty ( missing_points ) ) {
+ marine_cells <- terra :: as.points ( gv [[ 1 ] ] ) # vector of all valid marine cell locations.
+ nearest_indices <- terra :: nearest ( missing_points , marine_cells ) # Find the nearest marine cell
+ nearest_values <- terra :: extract ( gv [[ 1 ] ] , marine_cells [ nearest_indices ] ) # get the values from the nearest marine cells.
+ marshift $ GV [ is.na ( marshift $ GV ) ] <- nearest_values [ , 2 ] # Replace the NA values in `marshift$GV`
+}
+
+missing_points <- coords [ is.na ( marshift $ DV ) ] # Identify NAs
+if ( ! is.empty ( missing_points ) ) {
+ marine_cells <- terra :: as.points ( dv [[ 1 ] ] ) # vector of all valid marine cell locations.
+ nearest_cells <- terra :: nearest ( missing_points , marine_cells ) # Find the nearest marine cell
+ nearest_values <- terra :: extract ( dv [[ 1 ] ] , nearest_cells ) # get the values from the nearest marine cells.
+ marshift $ DV [ is.na ( marshift $ DV ) ] <- nearest_values [ , 2 ] # Replace the NA values in `marshift$GV`
+}
+
+# fit the regression models
+Mgv <- lm ( Shift ^ ( 1 / 4 ) ~ I ( ( GV * 10 ) ^ ( 1 / 4 ) ) , data = marshift , weights = years_data )
+summary ( Mgv )
+#>
+#> Call:
+#> lm(formula = Shift^(1/4) ~ I((GV * 10)^(1/4)), data = marshift,
+#> weights = years_data)
+#>
+#> Weighted Residuals:
+#> Min 1Q Median 3Q Max
+#> -8.7627 -2.3540 -0.5463 1.5966 14.8297
+#>
+#> Coefficients:
+#> Estimate Std. Error t value Pr(>|t|)
+#> (Intercept) 1.20025 0.23469 5.114 5.28e-07 ***
+#> I((GV * 10)^(1/4)) 0.50348 0.09599 5.245 2.75e-07 ***
+#> ---
+#> Signif. codes: 0 '***' 0.001 '**' 0.01 '*' 0.05 '.' 0.1 ' ' 1
+#>
+#> Residual standard error: 3.865 on 340 degrees of freedom
+#> (1 observation deleted due to missingness)
+#> Multiple R-squared: 0.07486, Adjusted R-squared: 0.07214
+#> F-statistic: 27.51 on 1 and 340 DF, p-value: 2.75e-07
+
+Mdv <- lm ( Shift ^ ( 1 / 4 ) ~ I ( ( DV * 10 ) ^ ( 1 / 4 ) ) , data = marshift , weights = years_data )
+summary ( Mdv )
+#>
+#> Call:
+#> lm(formula = Shift^(1/4) ~ I((DV * 10)^(1/4)), data = marshift,
+#> weights = years_data)
+#>
+#> Weighted Residuals:
+#> Min 1Q Median 3Q Max
+#> -9.1097 -2.3602 -0.7524 1.6379 15.2653
+#>
+#> Coefficients:
+#> Estimate Std. Error t value Pr(>|t|)
+#> (Intercept) 0.8565 0.3371 2.541 0.0115 *
+#> I((DV * 10)^(1/4)) 0.6192 0.1335 4.636 5.07e-06 ***
+#> ---
+#> Signif. codes: 0 '***' 0.001 '**' 0.01 '*' 0.05 '.' 0.1 ' ' 1
+#>
+#> Residual standard error: 3.904 on 338 degrees of freedom
+#> (3 observations deleted due to missingness)
+#> Multiple R-squared: 0.05979, Adjusted R-squared: 0.05701
+#> F-statistic: 21.5 on 1 and 338 DF, p-value: 5.074e-06
+
Produce the observed vs predicted scatterplots with regression lines
+(Fig. 2 in Garcia Molinos et al. 2019).
+
+# first compare both velocities
+
+p1 <- ggplot ( ) +
+ geom_spatraster ( data = gv [[ 1 ] ] ) +
+ scale_fill_distiller ( palette = "RdBu" , direction = - 1 , limits = c ( - 50 , 50 ) ) +
+ ggtitle ( "Gradient-based vocc" ) +
+ scale_x_continuous ( expand = c ( 0 ,0 ) ) +
+ scale_y_continuous ( expand = c ( 0 ,0 ) )
+
+p2 <- ggplot ( ) +
+ geom_spatraster ( data = dv [[ 1 ] ] ) +
+ scale_fill_distiller ( palette = "RdBu" , direction = - 1 , limits = c ( - 20 , 20 ) ) +
+ ggtitle ( "Distance-based vocc" ) +
+ scale_x_continuous ( expand = c ( 0 ,0 ) ) +
+ scale_y_continuous ( expand = c ( 0 ,0 ) )
+
+wrap_plots ( p1 , p2 , ncol = 1 )
+
+
+# scatter plots with the resulting regression line
+p1 <- ggplot ( na.omit ( marshift ) , aes ( x = ( GV * 10 ) ^ ( 1 / 4 ) , y = Shift ^ ( 1 / 4 ) ) ) +
+ geom_point ( color = "grey" ) +
+ geom_smooth ( method = lm , se = FALSE ) +
+ theme_classic ( ) +
+ scale_color_brewer ( palette = "Accent" ) +
+ labs ( x = "Predicted shift (x^1/4; km/yr)" , y = "Observed shift (y^1/4; km/yr)" )
+
+p2 <- ggplot ( na.omit ( marshift ) , aes ( x = ( DV * 10 ) ^ ( 1 / 4 ) , y = Shift ^ ( 1 / 4 ) ) ) +
+ geom_point ( color = "grey" ) +
+ geom_smooth ( method = lm , se = FALSE ) +
+ theme_classic ( ) +
+ scale_color_brewer ( palette = "Accent" ) +
+ labs ( x = "Predicted shift (x^1/4; km/yr)" , y = "Observed shift (y^1/4; km/yr)" )
+
+wrap_plots ( p1 , p2 , nrow = 1 )
+#> `geom_smooth()` using formula = 'y ~ x'
+#> `geom_smooth()` using formula = 'y ~ x'
+#> Warning: Removed 2 rows containing non-finite outside the scale range
+#> (`stat_smooth()`).
+#> Warning: Removed 2 rows containing missing values or values outside the scale range
+#> (`geom_point()`).
+
+
+
+
Example 2: Analysis of climate exposure and connectivity in the
+Western Pacific Ocean
+
+
In this example we use climate velocity trajectories (based on
+1960-2009 mean annual SST) to analyse climate connectivity in the
+Western Pacific region and calculate the residence time corresponding to
+the exclusive economic zones in the region as an index of climatic
+exposure. First, we arrange the raster layers for analysis.
+
+# prepare raster layers
+vel <- gv [[ 1 ] ]
+ang <- gv [[ 2 ] ]
+mn <- app ( r , mean , na.rm = T )
+
+# generate a velocity layer centered and cropped to study region to extract the initial coordinates for the trajectories from
+x1 <- crop ( gv [[ 1 ] ] , ext ( - 180 , 0 , - 90 , 90 ) )
+x2 <- crop ( gv [[ 1 ] ] , ext ( 0 , 180 , - 90 , 90 ) )
+ext ( x1 ) <- c ( 180 , 360 , - 90 , 90 )
+velc <- merge ( x1 , x2 )
+
+# crop to the desired extent
+# display restricted to +180 longitude to avoid plotting issues with date line crossing
+velc <- crop ( velc , c ( 90 , 180 , - 32 , 33 ) )
+
We can now populate the data frame with the cell centroid coordinates
+for the trajectories.
+
+lonlat <- data.frame ( terra :: xyFromCell ( velc , 1 : ncell ( velc ) ) )
+lonlat $ vel <- terra :: extract ( vel , lonlat , ID = FALSE )
+lonlat $ ang <- terra :: extract ( ang , lonlat [ , 1 : 2 ] , ID = FALSE )
+lonlat $ mn <- terra :: extract ( mn , lonlat [ , 1 : 2 ] , ID = FALSE )
+lonlat $ lineID <- 1 : nrow ( lonlat )
+lonlat <- drop_na ( lonlat )
+
Let’s calculate the trajectories with parallel processing to
+demonstrate how this can be used to speed things up (especially useful
+when dealing with fine resolutions or large extents).
+
+
+traj <- voccTraj ( lonlat , vel , ang , mn , tyr = 50 , tstep = 1 / 12 )
+
Plot them over the climate velocities and the EEZ polygons from the
+EEZs data set (Fig. 3a in Garcia Molinos et al. 2019)
+
+# create the spatial object with the trajectories and plot them together with the EEZ polygons
+lns <- map ( traj %>% group_split ( cellIDs ) , trajLine ) %>%
+ purrr :: list_rbind ( ) %>%
+ sf :: st_sf ( )
+
+# Load and simplify polygons to speed plotting up
+EEZs <- sf :: st_read ( system.file ( "extdata" , "EEZs.gpkg" , package = "VoCCdata" ) ) %>%
+ sf :: st_break_antimeridian ( ) %>%
+ sf :: st_simplify ( preserveTopology = TRUE , dTolerance = 500 ) %>%
+ sf :: st_crop ( xmin = 75 , xmax = 180 , ymin = - 35 , ymax = 35 )
+#> Reading layer `EEZs' from data source
+#> `/Library/Frameworks/R.framework/Versions/4.5-arm64/Resources/library/VoCCdata/extdata/EEZs.gpkg'
+#> using driver `GPKG'
+#> Simple feature collection with 35 features and 22 fields
+#> Geometry type: MULTIPOLYGON
+#> Dimension: XY
+#> Bounding box: xmin: -179.9999 ymin: -31.24447 xmax: 179.9999 ymax: 31.79787
+#> Geodetic CRS: +proj=longlat +datum=WGS84 +no_defs
+
+ggplot ( ) +
+ geom_spatraster ( data = velc , aes ( fill = voccMag ) ) +
+ scale_fill_viridis_c ( option = "inferno" , name = "Velocity" ) +
+ geom_sf ( data = lns %>% sf :: st_shift_longitude ( ) , colour = "grey70" , linewidth = 0.1 ) +
+ geom_sf ( data = EEZs %>% sf :: st_shift_longitude ( ) , colour = "white" , fill = NA , linewidth = 0.3 ) +
+ scale_x_continuous ( expand = c ( 0 , 0 ) ) +
+ scale_y_continuous ( expand = c ( 0 , 0 ) )
+
+
We now calculate the trajectory classes and residence times for each
+EEZ using the traj25 data set.
+
+# classify trajectories (16 trajectories starting from each 1-deg cell cell)
+clas <- trajClas ( traj25 , vel , ang , mn , trajSt = 16 , tyr = 50 , nmL = 20 , smL = 100 , Nend = 45 , Nst = 15 , NFT = 70 )
+#> Warning: [readValues] raster has no values
+
+# Extract proportions by categories for each EEZ
+v <- data.table ( terra :: extract ( clas [[ 7 ] ] , EEZs , df = TRUE ) )
+v [ , TrajClas := as.character ( TrajClas ) ]
+v [ , ID := as.ordered ( ID ) ]
+
+# proportions by class
+d <- prop.table ( table ( v ) , 1 )
+
+# residence times by EEZ
+EEZa <- resTime ( EEZs , vel , areapg = NA )
+
Finally let’s plot the category proportions as pie charts on top of
+each EEZ, the size of the chart being proportional to their respective
+residence time (Fig. 3b in Garcia Molinos et al. 2019).
+
+D <- data.table ( d ) # put data in long format
+
+D [ , name := as.character ( EEZs $ Territory1 ) [ as.numeric ( ID ) ] ] # add EEZ names for reference
+D [ , RT := as.character ( EEZa $ resTim ) [ as.numeric ( ID ) ] ]
+
+# prepare data frame to plot the pie charts with
+dt <- as.data.frame.matrix ( d )
+dt $ country <- as.character ( EEZs $ Territory1 )
+
+coords <- sf :: st_coordinates ( sf :: st_centroid ( EEZs ) )
+dt [ , c ( "x" , "y" ) ] <- coords [ , c ( "X" , "Y" ) ]
+dt $ RT <- EEZa $ resTim
+
+# # generate the plot
+plot ( velc )
+plot ( eez_simp , add = TRUE )
+mycol <- c ( scales :: alpha ( rgb ( 192 , 192 , 192 , maxColorValue = 255 ) , 0.5 ) , scales :: alpha ( rgb ( 204 , 255 , 204 , maxColorValue = 255 ) , 0.5 ) , scales :: alpha ( rgb ( 255 , 153 , 51 , maxColorValue = 255 ) , 0.5 ) , scales :: alpha ( rgb ( 255 , 51 , 51 , maxColorValue = 255 ) , 0.5 ) , scales :: alpha ( rgb ( 51 , 51 , 255 , maxColorValue = 255 ) , 0.5 ) , scales :: alpha ( rgb ( 204 , 102 , 0 , maxColorValue = 255 ) , 0.5 ) , scales :: alpha ( rgb ( 204 , 0 , 204 , maxColorValue = 255 ) , 0.5 ) , scales :: alpha ( rgb ( 255 , 255 , 51 , maxColorValue = 255 ) , 0.5 ) , scales :: alpha ( rgb ( 153 , 204 , 255 , maxColorValue = 255 ) , 0.5 ) )
+# mylab = c("Non-moving", "Slow-moving", "Internal Sink", "Boundary sink",
+# "Source", "Internal sink","Corridor", "Divergence", "Convergence")
+for ( i in 1 : 35 ) {
+ add.pie ( z = as.numeric ( dt [ i , 1 : 5 ] ) , x = dt [ i , "x" ] , y = dt [ i , "y" ] , radius = log ( dt [ i , "RT" ] ) , col = mycol , labels = "" )
+}
+
+
+
References
+
+
García Molinos, J., Schoeman, D. S., Brown, C. J. and Burrows, M. T.
+(2019), VoCC: An R package for calculating the velocity of climate
+change and related climatic metrics. Methods Ecol Evol. doi:10.1111/2041-210X.13295
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/articles/VoCC_files/figure-html/unnamed-chunk-10-1.png b/docs/articles/VoCC_files/figure-html/unnamed-chunk-10-1.png
new file mode 100644
index 0000000..42fadce
Binary files /dev/null and b/docs/articles/VoCC_files/figure-html/unnamed-chunk-10-1.png differ
diff --git a/docs/articles/VoCC_files/figure-html/unnamed-chunk-14-1.png b/docs/articles/VoCC_files/figure-html/unnamed-chunk-14-1.png
new file mode 100644
index 0000000..8522263
Binary files /dev/null and b/docs/articles/VoCC_files/figure-html/unnamed-chunk-14-1.png differ
diff --git a/docs/articles/VoCC_files/figure-html/unnamed-chunk-9-1.png b/docs/articles/VoCC_files/figure-html/unnamed-chunk-9-1.png
new file mode 100644
index 0000000..2ff7b8f
Binary files /dev/null and b/docs/articles/VoCC_files/figure-html/unnamed-chunk-9-1.png differ
diff --git a/docs/articles/index.html b/docs/articles/index.html
new file mode 100644
index 0000000..cc017ab
--- /dev/null
+++ b/docs/articles/index.html
@@ -0,0 +1,59 @@
+
+Articles • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
All vignettes
+
+
+
VoCC
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/authors.html b/docs/authors.html
new file mode 100644
index 0000000..d2a87ea
--- /dev/null
+++ b/docs/authors.html
@@ -0,0 +1,95 @@
+
+Authors and Citation • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Authors
+
+
+ Jorge Garcia Molinos . Author, maintainer.
+
+
+
+ David S. Schoeman . Author.
+
+
+
+ Christopher J. Brown . Author.
+
+
+
+ Michael T. Burrows . Author.
+
+
+
+ Naoki H. Kumagai . Contributor.
+
+
+
+
+
+
Citation
+
Source: DESCRIPTION
+
+
Garcia Molinos J, S. Schoeman D, J. Brown C, T. Burrows M (2025).
+VoCC: The Velocity of Climate Change and related climatic metrics .
+R package version 0.0.1, https://mathmarecol.github.io/VoCC/ .
+
+
@Manual{,
+ title = {VoCC: The Velocity of Climate Change and related climatic metrics},
+ author = {Jorge {Garcia Molinos} and David {S. Schoeman} and Christopher {J. Brown} and Michael {T. Burrows}},
+ year = {2025},
+ note = {R package version 0.0.1},
+ url = {https://mathmarecol.github.io/VoCC/},
+}
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/deps/bootstrap-5.3.1/bootstrap.bundle.min.js b/docs/deps/bootstrap-5.3.1/bootstrap.bundle.min.js
new file mode 100644
index 0000000..e8f21f7
--- /dev/null
+++ b/docs/deps/bootstrap-5.3.1/bootstrap.bundle.min.js
@@ -0,0 +1,7 @@
+/*!
+ * Bootstrap v5.3.1 (https://getbootstrap.com/)
+ * Copyright 2011-2023 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+ */
+!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?module.exports=e():"function"==typeof define&&define.amd?define(e):(t="undefined"!=typeof globalThis?globalThis:t||self).bootstrap=e()}(this,(function(){"use strict";const t=new Map,e={set(e,i,n){t.has(e)||t.set(e,new Map);const s=t.get(e);s.has(i)||0===s.size?s.set(i,n):console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(s.keys())[0]}.`)},get:(e,i)=>t.has(e)&&t.get(e).get(i)||null,remove(e,i){if(!t.has(e))return;const n=t.get(e);n.delete(i),0===n.size&&t.delete(e)}},i="transitionend",n=t=>(t&&window.CSS&&window.CSS.escape&&(t=t.replace(/#([^\s"#']+)/g,((t,e)=>`#${CSS.escape(e)}`))),t),s=t=>{t.dispatchEvent(new Event(i))},o=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),r=t=>o(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(n(t)):null,a=t=>{if(!o(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},l=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),c=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?c(t.parentNode):null},h=()=>{},d=t=>{t.offsetHeight},u=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,f=[],p=()=>"rtl"===document.documentElement.dir,m=t=>{var e;e=()=>{const e=u();if(e){const i=t.NAME,n=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=n,t.jQueryInterface)}},"loading"===document.readyState?(f.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of f)t()})),f.push(e)):e()},g=(t,e=[],i=t)=>"function"==typeof t?t(...e):i,_=(t,e,n=!0)=>{if(!n)return void g(t);const o=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const n=Number.parseFloat(e),s=Number.parseFloat(i);return n||s?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let r=!1;const a=({target:n})=>{n===e&&(r=!0,e.removeEventListener(i,a),g(t))};e.addEventListener(i,a),setTimeout((()=>{r||s(e)}),o)},b=(t,e,i,n)=>{const s=t.length;let o=t.indexOf(e);return-1===o?!i&&n?t[s-1]:t[0]:(o+=i?1:-1,n&&(o=(o+s)%s),t[Math.max(0,Math.min(o,s-1))])},v=/[^.]*(?=\..*)\.|.*/,y=/\..*/,w=/::\d+$/,A={};let E=1;const T={mouseenter:"mouseover",mouseleave:"mouseout"},C=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function O(t,e){return e&&`${e}::${E++}`||t.uidEvent||E++}function x(t){const e=O(t);return t.uidEvent=e,A[e]=A[e]||{},A[e]}function k(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function L(t,e,i){const n="string"==typeof e,s=n?i:e||i;let o=I(t);return C.has(o)||(o=t),[n,s,o]}function S(t,e,i,n,s){if("string"!=typeof e||!t)return;let[o,r,a]=L(e,i,n);if(e in T){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=x(t),c=l[a]||(l[a]={}),h=k(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&s);const d=O(r,e.replace(v,"")),u=o?function(t,e,i){return function n(s){const o=t.querySelectorAll(e);for(let{target:r}=s;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return P(s,{delegateTarget:r}),n.oneOff&&N.off(t,s.type,e,i),i.apply(r,[s])}}(t,i,r):function(t,e){return function i(n){return P(n,{delegateTarget:t}),i.oneOff&&N.off(t,n.type,e),e.apply(t,[n])}}(t,r);u.delegationSelector=o?i:null,u.callable=r,u.oneOff=s,u.uidEvent=d,c[d]=u,t.addEventListener(a,u,o)}function D(t,e,i,n,s){const o=k(e[i],n,s);o&&(t.removeEventListener(i,o,Boolean(s)),delete e[i][o.uidEvent])}function $(t,e,i,n){const s=e[i]||{};for(const[o,r]of Object.entries(s))o.includes(n)&&D(t,e,i,r.callable,r.delegationSelector)}function I(t){return t=t.replace(y,""),T[t]||t}const N={on(t,e,i,n){S(t,e,i,n,!1)},one(t,e,i,n){S(t,e,i,n,!0)},off(t,e,i,n){if("string"!=typeof e||!t)return;const[s,o,r]=L(e,i,n),a=r!==e,l=x(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))$(t,l,i,e.slice(1));for(const[i,n]of Object.entries(c)){const s=i.replace(w,"");a&&!e.includes(s)||D(t,l,r,n.callable,n.delegationSelector)}}else{if(!Object.keys(c).length)return;D(t,l,r,o,s?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const n=u();let s=null,o=!0,r=!0,a=!1;e!==I(e)&&n&&(s=n.Event(e,i),n(t).trigger(s),o=!s.isPropagationStopped(),r=!s.isImmediatePropagationStopped(),a=s.isDefaultPrevented());const l=P(new Event(e,{bubbles:o,cancelable:!0}),i);return a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&s&&s.preventDefault(),l}};function P(t,e={}){for(const[i,n]of Object.entries(e))try{t[i]=n}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>n})}return t}function M(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function j(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const F={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${j(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${j(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const n of i){let i=n.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=M(t.dataset[n])}return e},getDataAttribute:(t,e)=>M(t.getAttribute(`data-bs-${j(e)}`))};class H{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=o(e)?F.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...o(e)?F.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const[n,s]of Object.entries(e)){const e=t[n],r=o(e)?"element":null==(i=e)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(s).test(r))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${n}" provided type "${r}" but expected type "${s}".`)}var i}}class W extends H{constructor(t,i){super(),(t=r(t))&&(this._element=t,this._config=this._getConfig(i),e.set(this._element,this.constructor.DATA_KEY,this))}dispose(){e.remove(this._element,this.constructor.DATA_KEY),N.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){_(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return e.get(r(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.3.1"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const B=t=>{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?i.trim():null}return n(e)},z={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let n=t.parentNode.closest(e);for(;n;)i.push(n),n=n.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!l(t)&&a(t)))},getSelectorFromElement(t){const e=B(t);return e&&z.findOne(e)?e:null},getElementFromSelector(t){const e=B(t);return e?z.findOne(e):null},getMultipleElementsFromSelector(t){const e=B(t);return e?z.find(e):[]}},R=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,n=t.NAME;N.on(document,i,`[data-bs-dismiss="${n}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),l(this))return;const s=z.getElementFromSelector(this)||this.closest(`.${n}`);t.getOrCreateInstance(s)[e]()}))},q=".bs.alert",V=`close${q}`,K=`closed${q}`;class Q extends W{static get NAME(){return"alert"}close(){if(N.trigger(this._element,V).defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),N.trigger(this._element,K),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Q.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}R(Q,"close"),m(Q);const X='[data-bs-toggle="button"]';class Y extends W{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=Y.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}N.on(document,"click.bs.button.data-api",X,(t=>{t.preventDefault();const e=t.target.closest(X);Y.getOrCreateInstance(e).toggle()})),m(Y);const U=".bs.swipe",G=`touchstart${U}`,J=`touchmove${U}`,Z=`touchend${U}`,tt=`pointerdown${U}`,et=`pointerup${U}`,it={endCallback:null,leftCallback:null,rightCallback:null},nt={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class st extends H{constructor(t,e){super(),this._element=t,t&&st.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return it}static get DefaultType(){return nt}static get NAME(){return"swipe"}dispose(){N.off(this._element,U)}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),g(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&g(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?(N.on(this._element,tt,(t=>this._start(t))),N.on(this._element,et,(t=>this._end(t))),this._element.classList.add("pointer-event")):(N.on(this._element,G,(t=>this._start(t))),N.on(this._element,J,(t=>this._move(t))),N.on(this._element,Z,(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const ot=".bs.carousel",rt=".data-api",at="next",lt="prev",ct="left",ht="right",dt=`slide${ot}`,ut=`slid${ot}`,ft=`keydown${ot}`,pt=`mouseenter${ot}`,mt=`mouseleave${ot}`,gt=`dragstart${ot}`,_t=`load${ot}${rt}`,bt=`click${ot}${rt}`,vt="carousel",yt="active",wt=".active",At=".carousel-item",Et=wt+At,Tt={ArrowLeft:ht,ArrowRight:ct},Ct={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},Ot={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class xt extends W{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=z.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===vt&&this.cycle()}static get Default(){return Ct}static get DefaultType(){return Ot}static get NAME(){return"carousel"}next(){this._slide(at)}nextWhenVisible(){!document.hidden&&a(this._element)&&this.next()}prev(){this._slide(lt)}pause(){this._isSliding&&s(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?N.one(this._element,ut,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void N.one(this._element,ut,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const n=t>i?at:lt;this._slide(n,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&N.on(this._element,ft,(t=>this._keydown(t))),"hover"===this._config.pause&&(N.on(this._element,pt,(()=>this.pause())),N.on(this._element,mt,(()=>this._maybeEnableCycle()))),this._config.touch&&st.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of z.find(".carousel-item img",this._element))N.on(t,gt,(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(ct)),rightCallback:()=>this._slide(this._directionToOrder(ht)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new st(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=Tt[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=z.findOne(wt,this._indicatorsElement);e.classList.remove(yt),e.removeAttribute("aria-current");const i=z.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(yt),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),n=t===at,s=e||b(this._getItems(),i,n,this._config.wrap);if(s===i)return;const o=this._getItemIndex(s),r=e=>N.trigger(this._element,e,{relatedTarget:s,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r(dt).defaultPrevented)return;if(!i||!s)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=s;const l=n?"carousel-item-start":"carousel-item-end",c=n?"carousel-item-next":"carousel-item-prev";s.classList.add(c),d(s),i.classList.add(l),s.classList.add(l),this._queueCallback((()=>{s.classList.remove(l,c),s.classList.add(yt),i.classList.remove(yt,c,l),this._isSliding=!1,r(ut)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return z.findOne(Et,this._element)}_getItems(){return z.find(At,this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return p()?t===ct?lt:at:t===ct?at:lt}_orderToDirection(t){return p()?t===lt?ct:ht:t===lt?ht:ct}static jQueryInterface(t){return this.each((function(){const e=xt.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}N.on(document,bt,"[data-bs-slide], [data-bs-slide-to]",(function(t){const e=z.getElementFromSelector(this);if(!e||!e.classList.contains(vt))return;t.preventDefault();const i=xt.getOrCreateInstance(e),n=this.getAttribute("data-bs-slide-to");return n?(i.to(n),void i._maybeEnableCycle()):"next"===F.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),N.on(window,_t,(()=>{const t=z.find('[data-bs-ride="carousel"]');for(const e of t)xt.getOrCreateInstance(e)})),m(xt);const kt=".bs.collapse",Lt=`show${kt}`,St=`shown${kt}`,Dt=`hide${kt}`,$t=`hidden${kt}`,It=`click${kt}.data-api`,Nt="show",Pt="collapse",Mt="collapsing",jt=`:scope .${Pt} .${Pt}`,Ft='[data-bs-toggle="collapse"]',Ht={parent:null,toggle:!0},Wt={parent:"(null|element)",toggle:"boolean"};class Bt extends W{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=z.find(Ft);for(const t of i){const e=z.getSelectorFromElement(t),i=z.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return Ht}static get DefaultType(){return Wt}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>Bt.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if(N.trigger(this._element,Lt).defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(Pt),this._element.classList.add(Mt),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(Mt),this._element.classList.add(Pt,Nt),this._element.style[e]="",N.trigger(this._element,St)}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if(N.trigger(this._element,Dt).defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,d(this._element),this._element.classList.add(Mt),this._element.classList.remove(Pt,Nt);for(const t of this._triggerArray){const e=z.getElementFromSelector(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(Mt),this._element.classList.add(Pt),N.trigger(this._element,$t)}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(Nt)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=r(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(Ft);for(const e of t){const t=z.getElementFromSelector(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=z.find(jt,this._config.parent);return z.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=Bt.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}N.on(document,It,Ft,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();for(const t of z.getMultipleElementsFromSelector(this))Bt.getOrCreateInstance(t,{toggle:!1}).toggle()})),m(Bt);var zt="top",Rt="bottom",qt="right",Vt="left",Kt="auto",Qt=[zt,Rt,qt,Vt],Xt="start",Yt="end",Ut="clippingParents",Gt="viewport",Jt="popper",Zt="reference",te=Qt.reduce((function(t,e){return t.concat([e+"-"+Xt,e+"-"+Yt])}),[]),ee=[].concat(Qt,[Kt]).reduce((function(t,e){return t.concat([e,e+"-"+Xt,e+"-"+Yt])}),[]),ie="beforeRead",ne="read",se="afterRead",oe="beforeMain",re="main",ae="afterMain",le="beforeWrite",ce="write",he="afterWrite",de=[ie,ne,se,oe,re,ae,le,ce,he];function ue(t){return t?(t.nodeName||"").toLowerCase():null}function fe(t){if(null==t)return window;if("[object Window]"!==t.toString()){var e=t.ownerDocument;return e&&e.defaultView||window}return t}function pe(t){return t instanceof fe(t).Element||t instanceof Element}function me(t){return t instanceof fe(t).HTMLElement||t instanceof HTMLElement}function ge(t){return"undefined"!=typeof ShadowRoot&&(t instanceof fe(t).ShadowRoot||t instanceof ShadowRoot)}const _e={name:"applyStyles",enabled:!0,phase:"write",fn:function(t){var e=t.state;Object.keys(e.elements).forEach((function(t){var i=e.styles[t]||{},n=e.attributes[t]||{},s=e.elements[t];me(s)&&ue(s)&&(Object.assign(s.style,i),Object.keys(n).forEach((function(t){var e=n[t];!1===e?s.removeAttribute(t):s.setAttribute(t,!0===e?"":e)})))}))},effect:function(t){var e=t.state,i={popper:{position:e.options.strategy,left:"0",top:"0",margin:"0"},arrow:{position:"absolute"},reference:{}};return Object.assign(e.elements.popper.style,i.popper),e.styles=i,e.elements.arrow&&Object.assign(e.elements.arrow.style,i.arrow),function(){Object.keys(e.elements).forEach((function(t){var n=e.elements[t],s=e.attributes[t]||{},o=Object.keys(e.styles.hasOwnProperty(t)?e.styles[t]:i[t]).reduce((function(t,e){return t[e]="",t}),{});me(n)&&ue(n)&&(Object.assign(n.style,o),Object.keys(s).forEach((function(t){n.removeAttribute(t)})))}))}},requires:["computeStyles"]};function be(t){return t.split("-")[0]}var ve=Math.max,ye=Math.min,we=Math.round;function Ae(){var t=navigator.userAgentData;return null!=t&&t.brands&&Array.isArray(t.brands)?t.brands.map((function(t){return t.brand+"/"+t.version})).join(" "):navigator.userAgent}function Ee(){return!/^((?!chrome|android).)*safari/i.test(Ae())}function Te(t,e,i){void 0===e&&(e=!1),void 0===i&&(i=!1);var n=t.getBoundingClientRect(),s=1,o=1;e&&me(t)&&(s=t.offsetWidth>0&&we(n.width)/t.offsetWidth||1,o=t.offsetHeight>0&&we(n.height)/t.offsetHeight||1);var r=(pe(t)?fe(t):window).visualViewport,a=!Ee()&&i,l=(n.left+(a&&r?r.offsetLeft:0))/s,c=(n.top+(a&&r?r.offsetTop:0))/o,h=n.width/s,d=n.height/o;return{width:h,height:d,top:c,right:l+h,bottom:c+d,left:l,x:l,y:c}}function Ce(t){var e=Te(t),i=t.offsetWidth,n=t.offsetHeight;return Math.abs(e.width-i)<=1&&(i=e.width),Math.abs(e.height-n)<=1&&(n=e.height),{x:t.offsetLeft,y:t.offsetTop,width:i,height:n}}function Oe(t,e){var i=e.getRootNode&&e.getRootNode();if(t.contains(e))return!0;if(i&&ge(i)){var n=e;do{if(n&&t.isSameNode(n))return!0;n=n.parentNode||n.host}while(n)}return!1}function xe(t){return fe(t).getComputedStyle(t)}function ke(t){return["table","td","th"].indexOf(ue(t))>=0}function Le(t){return((pe(t)?t.ownerDocument:t.document)||window.document).documentElement}function Se(t){return"html"===ue(t)?t:t.assignedSlot||t.parentNode||(ge(t)?t.host:null)||Le(t)}function De(t){return me(t)&&"fixed"!==xe(t).position?t.offsetParent:null}function $e(t){for(var e=fe(t),i=De(t);i&&ke(i)&&"static"===xe(i).position;)i=De(i);return i&&("html"===ue(i)||"body"===ue(i)&&"static"===xe(i).position)?e:i||function(t){var e=/firefox/i.test(Ae());if(/Trident/i.test(Ae())&&me(t)&&"fixed"===xe(t).position)return null;var i=Se(t);for(ge(i)&&(i=i.host);me(i)&&["html","body"].indexOf(ue(i))<0;){var n=xe(i);if("none"!==n.transform||"none"!==n.perspective||"paint"===n.contain||-1!==["transform","perspective"].indexOf(n.willChange)||e&&"filter"===n.willChange||e&&n.filter&&"none"!==n.filter)return i;i=i.parentNode}return null}(t)||e}function Ie(t){return["top","bottom"].indexOf(t)>=0?"x":"y"}function Ne(t,e,i){return ve(t,ye(e,i))}function Pe(t){return Object.assign({},{top:0,right:0,bottom:0,left:0},t)}function Me(t,e){return e.reduce((function(e,i){return e[i]=t,e}),{})}const je={name:"arrow",enabled:!0,phase:"main",fn:function(t){var e,i=t.state,n=t.name,s=t.options,o=i.elements.arrow,r=i.modifiersData.popperOffsets,a=be(i.placement),l=Ie(a),c=[Vt,qt].indexOf(a)>=0?"height":"width";if(o&&r){var h=function(t,e){return Pe("number"!=typeof(t="function"==typeof t?t(Object.assign({},e.rects,{placement:e.placement})):t)?t:Me(t,Qt))}(s.padding,i),d=Ce(o),u="y"===l?zt:Vt,f="y"===l?Rt:qt,p=i.rects.reference[c]+i.rects.reference[l]-r[l]-i.rects.popper[c],m=r[l]-i.rects.reference[l],g=$e(o),_=g?"y"===l?g.clientHeight||0:g.clientWidth||0:0,b=p/2-m/2,v=h[u],y=_-d[c]-h[f],w=_/2-d[c]/2+b,A=Ne(v,w,y),E=l;i.modifiersData[n]=((e={})[E]=A,e.centerOffset=A-w,e)}},effect:function(t){var e=t.state,i=t.options.element,n=void 0===i?"[data-popper-arrow]":i;null!=n&&("string"!=typeof n||(n=e.elements.popper.querySelector(n)))&&Oe(e.elements.popper,n)&&(e.elements.arrow=n)},requires:["popperOffsets"],requiresIfExists:["preventOverflow"]};function Fe(t){return t.split("-")[1]}var He={top:"auto",right:"auto",bottom:"auto",left:"auto"};function We(t){var e,i=t.popper,n=t.popperRect,s=t.placement,o=t.variation,r=t.offsets,a=t.position,l=t.gpuAcceleration,c=t.adaptive,h=t.roundOffsets,d=t.isFixed,u=r.x,f=void 0===u?0:u,p=r.y,m=void 0===p?0:p,g="function"==typeof h?h({x:f,y:m}):{x:f,y:m};f=g.x,m=g.y;var _=r.hasOwnProperty("x"),b=r.hasOwnProperty("y"),v=Vt,y=zt,w=window;if(c){var A=$e(i),E="clientHeight",T="clientWidth";A===fe(i)&&"static"!==xe(A=Le(i)).position&&"absolute"===a&&(E="scrollHeight",T="scrollWidth"),(s===zt||(s===Vt||s===qt)&&o===Yt)&&(y=Rt,m-=(d&&A===w&&w.visualViewport?w.visualViewport.height:A[E])-n.height,m*=l?1:-1),s!==Vt&&(s!==zt&&s!==Rt||o!==Yt)||(v=qt,f-=(d&&A===w&&w.visualViewport?w.visualViewport.width:A[T])-n.width,f*=l?1:-1)}var C,O=Object.assign({position:a},c&&He),x=!0===h?function(t,e){var i=t.x,n=t.y,s=e.devicePixelRatio||1;return{x:we(i*s)/s||0,y:we(n*s)/s||0}}({x:f,y:m},fe(i)):{x:f,y:m};return f=x.x,m=x.y,l?Object.assign({},O,((C={})[y]=b?"0":"",C[v]=_?"0":"",C.transform=(w.devicePixelRatio||1)<=1?"translate("+f+"px, "+m+"px)":"translate3d("+f+"px, "+m+"px, 0)",C)):Object.assign({},O,((e={})[y]=b?m+"px":"",e[v]=_?f+"px":"",e.transform="",e))}const Be={name:"computeStyles",enabled:!0,phase:"beforeWrite",fn:function(t){var e=t.state,i=t.options,n=i.gpuAcceleration,s=void 0===n||n,o=i.adaptive,r=void 0===o||o,a=i.roundOffsets,l=void 0===a||a,c={placement:be(e.placement),variation:Fe(e.placement),popper:e.elements.popper,popperRect:e.rects.popper,gpuAcceleration:s,isFixed:"fixed"===e.options.strategy};null!=e.modifiersData.popperOffsets&&(e.styles.popper=Object.assign({},e.styles.popper,We(Object.assign({},c,{offsets:e.modifiersData.popperOffsets,position:e.options.strategy,adaptive:r,roundOffsets:l})))),null!=e.modifiersData.arrow&&(e.styles.arrow=Object.assign({},e.styles.arrow,We(Object.assign({},c,{offsets:e.modifiersData.arrow,position:"absolute",adaptive:!1,roundOffsets:l})))),e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-placement":e.placement})},data:{}};var ze={passive:!0};const Re={name:"eventListeners",enabled:!0,phase:"write",fn:function(){},effect:function(t){var e=t.state,i=t.instance,n=t.options,s=n.scroll,o=void 0===s||s,r=n.resize,a=void 0===r||r,l=fe(e.elements.popper),c=[].concat(e.scrollParents.reference,e.scrollParents.popper);return o&&c.forEach((function(t){t.addEventListener("scroll",i.update,ze)})),a&&l.addEventListener("resize",i.update,ze),function(){o&&c.forEach((function(t){t.removeEventListener("scroll",i.update,ze)})),a&&l.removeEventListener("resize",i.update,ze)}},data:{}};var qe={left:"right",right:"left",bottom:"top",top:"bottom"};function Ve(t){return t.replace(/left|right|bottom|top/g,(function(t){return qe[t]}))}var Ke={start:"end",end:"start"};function Qe(t){return t.replace(/start|end/g,(function(t){return Ke[t]}))}function Xe(t){var e=fe(t);return{scrollLeft:e.pageXOffset,scrollTop:e.pageYOffset}}function Ye(t){return Te(Le(t)).left+Xe(t).scrollLeft}function Ue(t){var e=xe(t),i=e.overflow,n=e.overflowX,s=e.overflowY;return/auto|scroll|overlay|hidden/.test(i+s+n)}function Ge(t){return["html","body","#document"].indexOf(ue(t))>=0?t.ownerDocument.body:me(t)&&Ue(t)?t:Ge(Se(t))}function Je(t,e){var i;void 0===e&&(e=[]);var n=Ge(t),s=n===(null==(i=t.ownerDocument)?void 0:i.body),o=fe(n),r=s?[o].concat(o.visualViewport||[],Ue(n)?n:[]):n,a=e.concat(r);return s?a:a.concat(Je(Se(r)))}function Ze(t){return Object.assign({},t,{left:t.x,top:t.y,right:t.x+t.width,bottom:t.y+t.height})}function ti(t,e,i){return e===Gt?Ze(function(t,e){var i=fe(t),n=Le(t),s=i.visualViewport,o=n.clientWidth,r=n.clientHeight,a=0,l=0;if(s){o=s.width,r=s.height;var c=Ee();(c||!c&&"fixed"===e)&&(a=s.offsetLeft,l=s.offsetTop)}return{width:o,height:r,x:a+Ye(t),y:l}}(t,i)):pe(e)?function(t,e){var i=Te(t,!1,"fixed"===e);return i.top=i.top+t.clientTop,i.left=i.left+t.clientLeft,i.bottom=i.top+t.clientHeight,i.right=i.left+t.clientWidth,i.width=t.clientWidth,i.height=t.clientHeight,i.x=i.left,i.y=i.top,i}(e,i):Ze(function(t){var e,i=Le(t),n=Xe(t),s=null==(e=t.ownerDocument)?void 0:e.body,o=ve(i.scrollWidth,i.clientWidth,s?s.scrollWidth:0,s?s.clientWidth:0),r=ve(i.scrollHeight,i.clientHeight,s?s.scrollHeight:0,s?s.clientHeight:0),a=-n.scrollLeft+Ye(t),l=-n.scrollTop;return"rtl"===xe(s||i).direction&&(a+=ve(i.clientWidth,s?s.clientWidth:0)-o),{width:o,height:r,x:a,y:l}}(Le(t)))}function ei(t){var e,i=t.reference,n=t.element,s=t.placement,o=s?be(s):null,r=s?Fe(s):null,a=i.x+i.width/2-n.width/2,l=i.y+i.height/2-n.height/2;switch(o){case zt:e={x:a,y:i.y-n.height};break;case Rt:e={x:a,y:i.y+i.height};break;case qt:e={x:i.x+i.width,y:l};break;case Vt:e={x:i.x-n.width,y:l};break;default:e={x:i.x,y:i.y}}var c=o?Ie(o):null;if(null!=c){var h="y"===c?"height":"width";switch(r){case Xt:e[c]=e[c]-(i[h]/2-n[h]/2);break;case Yt:e[c]=e[c]+(i[h]/2-n[h]/2)}}return e}function ii(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=void 0===n?t.placement:n,o=i.strategy,r=void 0===o?t.strategy:o,a=i.boundary,l=void 0===a?Ut:a,c=i.rootBoundary,h=void 0===c?Gt:c,d=i.elementContext,u=void 0===d?Jt:d,f=i.altBoundary,p=void 0!==f&&f,m=i.padding,g=void 0===m?0:m,_=Pe("number"!=typeof g?g:Me(g,Qt)),b=u===Jt?Zt:Jt,v=t.rects.popper,y=t.elements[p?b:u],w=function(t,e,i,n){var s="clippingParents"===e?function(t){var e=Je(Se(t)),i=["absolute","fixed"].indexOf(xe(t).position)>=0&&me(t)?$e(t):t;return pe(i)?e.filter((function(t){return pe(t)&&Oe(t,i)&&"body"!==ue(t)})):[]}(t):[].concat(e),o=[].concat(s,[i]),r=o[0],a=o.reduce((function(e,i){var s=ti(t,i,n);return e.top=ve(s.top,e.top),e.right=ye(s.right,e.right),e.bottom=ye(s.bottom,e.bottom),e.left=ve(s.left,e.left),e}),ti(t,r,n));return a.width=a.right-a.left,a.height=a.bottom-a.top,a.x=a.left,a.y=a.top,a}(pe(y)?y:y.contextElement||Le(t.elements.popper),l,h,r),A=Te(t.elements.reference),E=ei({reference:A,element:v,strategy:"absolute",placement:s}),T=Ze(Object.assign({},v,E)),C=u===Jt?T:A,O={top:w.top-C.top+_.top,bottom:C.bottom-w.bottom+_.bottom,left:w.left-C.left+_.left,right:C.right-w.right+_.right},x=t.modifiersData.offset;if(u===Jt&&x){var k=x[s];Object.keys(O).forEach((function(t){var e=[qt,Rt].indexOf(t)>=0?1:-1,i=[zt,Rt].indexOf(t)>=0?"y":"x";O[t]+=k[i]*e}))}return O}function ni(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=i.boundary,o=i.rootBoundary,r=i.padding,a=i.flipVariations,l=i.allowedAutoPlacements,c=void 0===l?ee:l,h=Fe(n),d=h?a?te:te.filter((function(t){return Fe(t)===h})):Qt,u=d.filter((function(t){return c.indexOf(t)>=0}));0===u.length&&(u=d);var f=u.reduce((function(e,i){return e[i]=ii(t,{placement:i,boundary:s,rootBoundary:o,padding:r})[be(i)],e}),{});return Object.keys(f).sort((function(t,e){return f[t]-f[e]}))}const si={name:"flip",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,n=t.name;if(!e.modifiersData[n]._skip){for(var s=i.mainAxis,o=void 0===s||s,r=i.altAxis,a=void 0===r||r,l=i.fallbackPlacements,c=i.padding,h=i.boundary,d=i.rootBoundary,u=i.altBoundary,f=i.flipVariations,p=void 0===f||f,m=i.allowedAutoPlacements,g=e.options.placement,_=be(g),b=l||(_!==g&&p?function(t){if(be(t)===Kt)return[];var e=Ve(t);return[Qe(t),e,Qe(e)]}(g):[Ve(g)]),v=[g].concat(b).reduce((function(t,i){return t.concat(be(i)===Kt?ni(e,{placement:i,boundary:h,rootBoundary:d,padding:c,flipVariations:p,allowedAutoPlacements:m}):i)}),[]),y=e.rects.reference,w=e.rects.popper,A=new Map,E=!0,T=v[0],C=0;C=0,S=L?"width":"height",D=ii(e,{placement:O,boundary:h,rootBoundary:d,altBoundary:u,padding:c}),$=L?k?qt:Vt:k?Rt:zt;y[S]>w[S]&&($=Ve($));var I=Ve($),N=[];if(o&&N.push(D[x]<=0),a&&N.push(D[$]<=0,D[I]<=0),N.every((function(t){return t}))){T=O,E=!1;break}A.set(O,N)}if(E)for(var P=function(t){var e=v.find((function(e){var i=A.get(e);if(i)return i.slice(0,t).every((function(t){return t}))}));if(e)return T=e,"break"},M=p?3:1;M>0&&"break"!==P(M);M--);e.placement!==T&&(e.modifiersData[n]._skip=!0,e.placement=T,e.reset=!0)}},requiresIfExists:["offset"],data:{_skip:!1}};function oi(t,e,i){return void 0===i&&(i={x:0,y:0}),{top:t.top-e.height-i.y,right:t.right-e.width+i.x,bottom:t.bottom-e.height+i.y,left:t.left-e.width-i.x}}function ri(t){return[zt,qt,Rt,Vt].some((function(e){return t[e]>=0}))}const ai={name:"hide",enabled:!0,phase:"main",requiresIfExists:["preventOverflow"],fn:function(t){var e=t.state,i=t.name,n=e.rects.reference,s=e.rects.popper,o=e.modifiersData.preventOverflow,r=ii(e,{elementContext:"reference"}),a=ii(e,{altBoundary:!0}),l=oi(r,n),c=oi(a,s,o),h=ri(l),d=ri(c);e.modifiersData[i]={referenceClippingOffsets:l,popperEscapeOffsets:c,isReferenceHidden:h,hasPopperEscaped:d},e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-reference-hidden":h,"data-popper-escaped":d})}},li={name:"offset",enabled:!0,phase:"main",requires:["popperOffsets"],fn:function(t){var e=t.state,i=t.options,n=t.name,s=i.offset,o=void 0===s?[0,0]:s,r=ee.reduce((function(t,i){return t[i]=function(t,e,i){var n=be(t),s=[Vt,zt].indexOf(n)>=0?-1:1,o="function"==typeof i?i(Object.assign({},e,{placement:t})):i,r=o[0],a=o[1];return r=r||0,a=(a||0)*s,[Vt,qt].indexOf(n)>=0?{x:a,y:r}:{x:r,y:a}}(i,e.rects,o),t}),{}),a=r[e.placement],l=a.x,c=a.y;null!=e.modifiersData.popperOffsets&&(e.modifiersData.popperOffsets.x+=l,e.modifiersData.popperOffsets.y+=c),e.modifiersData[n]=r}},ci={name:"popperOffsets",enabled:!0,phase:"read",fn:function(t){var e=t.state,i=t.name;e.modifiersData[i]=ei({reference:e.rects.reference,element:e.rects.popper,strategy:"absolute",placement:e.placement})},data:{}},hi={name:"preventOverflow",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,n=t.name,s=i.mainAxis,o=void 0===s||s,r=i.altAxis,a=void 0!==r&&r,l=i.boundary,c=i.rootBoundary,h=i.altBoundary,d=i.padding,u=i.tether,f=void 0===u||u,p=i.tetherOffset,m=void 0===p?0:p,g=ii(e,{boundary:l,rootBoundary:c,padding:d,altBoundary:h}),_=be(e.placement),b=Fe(e.placement),v=!b,y=Ie(_),w="x"===y?"y":"x",A=e.modifiersData.popperOffsets,E=e.rects.reference,T=e.rects.popper,C="function"==typeof m?m(Object.assign({},e.rects,{placement:e.placement})):m,O="number"==typeof C?{mainAxis:C,altAxis:C}:Object.assign({mainAxis:0,altAxis:0},C),x=e.modifiersData.offset?e.modifiersData.offset[e.placement]:null,k={x:0,y:0};if(A){if(o){var L,S="y"===y?zt:Vt,D="y"===y?Rt:qt,$="y"===y?"height":"width",I=A[y],N=I+g[S],P=I-g[D],M=f?-T[$]/2:0,j=b===Xt?E[$]:T[$],F=b===Xt?-T[$]:-E[$],H=e.elements.arrow,W=f&&H?Ce(H):{width:0,height:0},B=e.modifiersData["arrow#persistent"]?e.modifiersData["arrow#persistent"].padding:{top:0,right:0,bottom:0,left:0},z=B[S],R=B[D],q=Ne(0,E[$],W[$]),V=v?E[$]/2-M-q-z-O.mainAxis:j-q-z-O.mainAxis,K=v?-E[$]/2+M+q+R+O.mainAxis:F+q+R+O.mainAxis,Q=e.elements.arrow&&$e(e.elements.arrow),X=Q?"y"===y?Q.clientTop||0:Q.clientLeft||0:0,Y=null!=(L=null==x?void 0:x[y])?L:0,U=I+K-Y,G=Ne(f?ye(N,I+V-Y-X):N,I,f?ve(P,U):P);A[y]=G,k[y]=G-I}if(a){var J,Z="x"===y?zt:Vt,tt="x"===y?Rt:qt,et=A[w],it="y"===w?"height":"width",nt=et+g[Z],st=et-g[tt],ot=-1!==[zt,Vt].indexOf(_),rt=null!=(J=null==x?void 0:x[w])?J:0,at=ot?nt:et-E[it]-T[it]-rt+O.altAxis,lt=ot?et+E[it]+T[it]-rt-O.altAxis:st,ct=f&&ot?function(t,e,i){var n=Ne(t,e,i);return n>i?i:n}(at,et,lt):Ne(f?at:nt,et,f?lt:st);A[w]=ct,k[w]=ct-et}e.modifiersData[n]=k}},requiresIfExists:["offset"]};function di(t,e,i){void 0===i&&(i=!1);var n,s,o=me(e),r=me(e)&&function(t){var e=t.getBoundingClientRect(),i=we(e.width)/t.offsetWidth||1,n=we(e.height)/t.offsetHeight||1;return 1!==i||1!==n}(e),a=Le(e),l=Te(t,r,i),c={scrollLeft:0,scrollTop:0},h={x:0,y:0};return(o||!o&&!i)&&(("body"!==ue(e)||Ue(a))&&(c=(n=e)!==fe(n)&&me(n)?{scrollLeft:(s=n).scrollLeft,scrollTop:s.scrollTop}:Xe(n)),me(e)?((h=Te(e,!0)).x+=e.clientLeft,h.y+=e.clientTop):a&&(h.x=Ye(a))),{x:l.left+c.scrollLeft-h.x,y:l.top+c.scrollTop-h.y,width:l.width,height:l.height}}function ui(t){var e=new Map,i=new Set,n=[];function s(t){i.add(t.name),[].concat(t.requires||[],t.requiresIfExists||[]).forEach((function(t){if(!i.has(t)){var n=e.get(t);n&&s(n)}})),n.push(t)}return t.forEach((function(t){e.set(t.name,t)})),t.forEach((function(t){i.has(t.name)||s(t)})),n}var fi={placement:"bottom",modifiers:[],strategy:"absolute"};function pi(){for(var t=arguments.length,e=new Array(t),i=0;iNumber.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(F.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,...g(this._config.popperConfig,[t])}}_selectMenuItem({key:t,target:e}){const i=z.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>a(t)));i.length&&b(i,e,t===Ti,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=qi.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=z.find(Ni);for(const i of e){const e=qi.getInstance(i);if(!e||!1===e._config.autoClose)continue;const n=t.composedPath(),s=n.includes(e._menu);if(n.includes(e._element)||"inside"===e._config.autoClose&&!s||"outside"===e._config.autoClose&&s)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,n=[Ei,Ti].includes(t.key);if(!n&&!i)return;if(e&&!i)return;t.preventDefault();const s=this.matches(Ii)?this:z.prev(this,Ii)[0]||z.next(this,Ii)[0]||z.findOne(Ii,t.delegateTarget.parentNode),o=qi.getOrCreateInstance(s);if(n)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),s.focus())}}N.on(document,Si,Ii,qi.dataApiKeydownHandler),N.on(document,Si,Pi,qi.dataApiKeydownHandler),N.on(document,Li,qi.clearMenus),N.on(document,Di,qi.clearMenus),N.on(document,Li,Ii,(function(t){t.preventDefault(),qi.getOrCreateInstance(this).toggle()})),m(qi);const Vi="backdrop",Ki="show",Qi=`mousedown.bs.${Vi}`,Xi={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},Yi={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class Ui extends H{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return Xi}static get DefaultType(){return Yi}static get NAME(){return Vi}show(t){if(!this._config.isVisible)return void g(t);this._append();const e=this._getElement();this._config.isAnimated&&d(e),e.classList.add(Ki),this._emulateAnimation((()=>{g(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(Ki),this._emulateAnimation((()=>{this.dispose(),g(t)}))):g(t)}dispose(){this._isAppended&&(N.off(this._element,Qi),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=r(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),N.on(t,Qi,(()=>{g(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){_(t,this._getElement(),this._config.isAnimated)}}const Gi=".bs.focustrap",Ji=`focusin${Gi}`,Zi=`keydown.tab${Gi}`,tn="backward",en={autofocus:!0,trapElement:null},nn={autofocus:"boolean",trapElement:"element"};class sn extends H{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return en}static get DefaultType(){return nn}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),N.off(document,Gi),N.on(document,Ji,(t=>this._handleFocusin(t))),N.on(document,Zi,(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,N.off(document,Gi))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=z.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===tn?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?tn:"forward")}}const on=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",rn=".sticky-top",an="padding-right",ln="margin-right";class cn{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,an,(e=>e+t)),this._setElementAttributes(on,an,(e=>e+t)),this._setElementAttributes(rn,ln,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,an),this._resetElementAttributes(on,an),this._resetElementAttributes(rn,ln)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const n=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+n)return;this._saveInitialAttribute(t,e);const s=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(s))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&F.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=F.getDataAttribute(t,e);null!==i?(F.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(o(t))e(t);else for(const i of z.find(t,this._element))e(i)}}const hn=".bs.modal",dn=`hide${hn}`,un=`hidePrevented${hn}`,fn=`hidden${hn}`,pn=`show${hn}`,mn=`shown${hn}`,gn=`resize${hn}`,_n=`click.dismiss${hn}`,bn=`mousedown.dismiss${hn}`,vn=`keydown.dismiss${hn}`,yn=`click${hn}.data-api`,wn="modal-open",An="show",En="modal-static",Tn={backdrop:!0,focus:!0,keyboard:!0},Cn={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class On extends W{constructor(t,e){super(t,e),this._dialog=z.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new cn,this._addEventListeners()}static get Default(){return Tn}static get DefaultType(){return Cn}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||N.trigger(this._element,pn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(wn),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&(N.trigger(this._element,dn).defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(An),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){N.off(window,hn),N.off(this._dialog,hn),this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new Ui({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new sn({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=z.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),d(this._element),this._element.classList.add(An),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,N.trigger(this._element,mn,{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){N.on(this._element,vn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():this._triggerBackdropTransition())})),N.on(window,gn,(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),N.on(this._element,bn,(t=>{N.one(this._element,_n,(e=>{this._element===t.target&&this._element===e.target&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(wn),this._resetAdjustments(),this._scrollBar.reset(),N.trigger(this._element,fn)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if(N.trigger(this._element,un).defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(En)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(En),this._queueCallback((()=>{this._element.classList.remove(En),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=p()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=p()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=On.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}N.on(document,yn,'[data-bs-toggle="modal"]',(function(t){const e=z.getElementFromSelector(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),N.one(e,pn,(t=>{t.defaultPrevented||N.one(e,fn,(()=>{a(this)&&this.focus()}))}));const i=z.findOne(".modal.show");i&&On.getInstance(i).hide(),On.getOrCreateInstance(e).toggle(this)})),R(On),m(On);const xn=".bs.offcanvas",kn=".data-api",Ln=`load${xn}${kn}`,Sn="show",Dn="showing",$n="hiding",In=".offcanvas.show",Nn=`show${xn}`,Pn=`shown${xn}`,Mn=`hide${xn}`,jn=`hidePrevented${xn}`,Fn=`hidden${xn}`,Hn=`resize${xn}`,Wn=`click${xn}${kn}`,Bn=`keydown.dismiss${xn}`,zn={backdrop:!0,keyboard:!0,scroll:!1},Rn={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class qn extends W{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return zn}static get DefaultType(){return Rn}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||N.trigger(this._element,Nn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new cn).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(Dn),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add(Sn),this._element.classList.remove(Dn),N.trigger(this._element,Pn,{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&(N.trigger(this._element,Mn).defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add($n),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove(Sn,$n),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new cn).reset(),N.trigger(this._element,Fn)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new Ui({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():N.trigger(this._element,jn)}:null})}_initializeFocusTrap(){return new sn({trapElement:this._element})}_addEventListeners(){N.on(this._element,Bn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():N.trigger(this._element,jn))}))}static jQueryInterface(t){return this.each((function(){const e=qn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}N.on(document,Wn,'[data-bs-toggle="offcanvas"]',(function(t){const e=z.getElementFromSelector(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),l(this))return;N.one(e,Fn,(()=>{a(this)&&this.focus()}));const i=z.findOne(In);i&&i!==e&&qn.getInstance(i).hide(),qn.getOrCreateInstance(e).toggle(this)})),N.on(window,Ln,(()=>{for(const t of z.find(In))qn.getOrCreateInstance(t).show()})),N.on(window,Hn,(()=>{for(const t of z.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&qn.getOrCreateInstance(t).hide()})),R(qn),m(qn);const Vn={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],div:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},Kn=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),Qn=/^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i,Xn=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!Kn.has(i)||Boolean(Qn.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},Yn={allowList:Vn,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"
"},Un={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},Gn={entry:"(string|element|function|null)",selector:"(string|element)"};class Jn extends H{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return Yn}static get DefaultType(){return Un}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},Gn)}_setContent(t,e,i){const n=z.findOne(i,t);n&&((e=this._resolvePossibleFunction(e))?o(e)?this._putElementInTemplate(r(e),n):this._config.html?n.innerHTML=this._maybeSanitize(e):n.textContent=e:n.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const n=(new window.DOMParser).parseFromString(t,"text/html"),s=[].concat(...n.body.querySelectorAll("*"));for(const t of s){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const n=[].concat(...t.attributes),s=[].concat(e["*"]||[],e[i]||[]);for(const e of n)Xn(e,s)||t.removeAttribute(e.nodeName)}return n.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return g(t,[this])}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const Zn=new Set(["sanitize","allowList","sanitizeFn"]),ts="fade",es="show",is=".modal",ns="hide.bs.modal",ss="hover",os="focus",rs={AUTO:"auto",TOP:"top",RIGHT:p()?"left":"right",BOTTOM:"bottom",LEFT:p()?"right":"left"},as={allowList:Vn,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,6],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'',title:"",trigger:"hover focus"},ls={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class cs extends W{constructor(t,e){if(void 0===vi)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,e),this._isEnabled=!0,this._timeout=0,this._isHovered=null,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners(),this._config.selector||this._fixTitle()}static get Default(){return as}static get DefaultType(){return ls}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(){this._isEnabled&&(this._activeTrigger.click=!this._activeTrigger.click,this._isShown()?this._leave():this._enter())}dispose(){clearTimeout(this._timeout),N.off(this._element.closest(is),ns,this._hideModalHandler),this._element.getAttribute("data-bs-original-title")&&this._element.setAttribute("title",this._element.getAttribute("data-bs-original-title")),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=N.trigger(this._element,this.constructor.eventName("show")),e=(c(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this._disposePopper();const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:n}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(n.append(i),N.trigger(this._element,this.constructor.eventName("inserted"))),this._popper=this._createPopper(i),i.classList.add(es),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.on(t,"mouseover",h);this._queueCallback((()=>{N.trigger(this._element,this.constructor.eventName("shown")),!1===this._isHovered&&this._leave(),this._isHovered=!1}),this.tip,this._isAnimated())}hide(){if(this._isShown()&&!N.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented){if(this._getTipElement().classList.remove(es),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.off(t,"mouseover",h);this._activeTrigger.click=!1,this._activeTrigger[os]=!1,this._activeTrigger[ss]=!1,this._isHovered=null,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||this._disposePopper(),this._element.removeAttribute("aria-describedby"),N.trigger(this._element,this.constructor.eventName("hidden")))}),this.tip,this._isAnimated())}}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(ts,es),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(ts),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new Jn({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{".tooltip-inner":this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._element.getAttribute("data-bs-original-title")}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(ts)}_isShown(){return this.tip&&this.tip.classList.contains(es)}_createPopper(t){const e=g(this._config.placement,[this,t,this._element]),i=rs[e.toUpperCase()];return bi(this._element,t,this._getPopperConfig(i))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return g(t,[this._element])}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,...g(this._config.popperConfig,[e])}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)N.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>{this._initializeOnDelegatedTarget(t).toggle()}));else if("manual"!==e){const t=e===ss?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===ss?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");N.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?os:ss]=!0,e._enter()})),N.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?os:ss]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},N.on(this._element.closest(is),ns,this._hideModalHandler)}_fixTitle(){const t=this._element.getAttribute("title");t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.setAttribute("data-bs-original-title",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=F.getDataAttributes(this._element);for(const t of Object.keys(e))Zn.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:r(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const[e,i]of Object.entries(this._config))this.constructor.Default[e]!==i&&(t[e]=i);return t.selector=!1,t.trigger="manual",t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null),this.tip&&(this.tip.remove(),this.tip=null)}static jQueryInterface(t){return this.each((function(){const e=cs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}m(cs);const hs={...cs.Default,content:"",offset:[0,8],placement:"right",template:'',trigger:"click"},ds={...cs.DefaultType,content:"(null|string|element|function)"};class us extends cs{static get Default(){return hs}static get DefaultType(){return ds}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{".popover-header":this._getTitle(),".popover-body":this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=us.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}m(us);const fs=".bs.scrollspy",ps=`activate${fs}`,ms=`click${fs}`,gs=`load${fs}.data-api`,_s="active",bs="[href]",vs=".nav-link",ys=`${vs}, .nav-item > ${vs}, .list-group-item`,ws={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null,threshold:[.1,.5,1]},As={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element",threshold:"array"};class Es extends W{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return ws}static get DefaultType(){return As}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=r(t.target)||document.body,t.rootMargin=t.offset?`${t.offset}px 0px -30%`:t.rootMargin,"string"==typeof t.threshold&&(t.threshold=t.threshold.split(",").map((t=>Number.parseFloat(t)))),t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&(N.off(this._config.target,ms),N.on(this._config.target,ms,bs,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,n=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:n,behavior:"smooth"});i.scrollTop=n}})))}_getNewObserver(){const t={root:this._rootElement,threshold:this._config.threshold,rootMargin:this._config.rootMargin};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},n=(this._rootElement||document.documentElement).scrollTop,s=n>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=n;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(s&&t){if(i(o),!n)return}else s||t||i(o)}}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=z.find(bs,this._config.target);for(const e of t){if(!e.hash||l(e))continue;const t=z.findOne(decodeURI(e.hash),this._element);a(t)&&(this._targetLinks.set(decodeURI(e.hash),e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(_s),this._activateParents(t),N.trigger(this._element,ps,{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))z.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(_s);else for(const e of z.parents(t,".nav, .list-group"))for(const t of z.prev(e,ys))t.classList.add(_s)}_clearActiveClass(t){t.classList.remove(_s);const e=z.find(`${bs}.${_s}`,t);for(const t of e)t.classList.remove(_s)}static jQueryInterface(t){return this.each((function(){const e=Es.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}N.on(window,gs,(()=>{for(const t of z.find('[data-bs-spy="scroll"]'))Es.getOrCreateInstance(t)})),m(Es);const Ts=".bs.tab",Cs=`hide${Ts}`,Os=`hidden${Ts}`,xs=`show${Ts}`,ks=`shown${Ts}`,Ls=`click${Ts}`,Ss=`keydown${Ts}`,Ds=`load${Ts}`,$s="ArrowLeft",Is="ArrowRight",Ns="ArrowUp",Ps="ArrowDown",Ms="Home",js="End",Fs="active",Hs="fade",Ws="show",Bs=":not(.dropdown-toggle)",zs='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',Rs=`.nav-link${Bs}, .list-group-item${Bs}, [role="tab"]${Bs}, ${zs}`,qs=`.${Fs}[data-bs-toggle="tab"], .${Fs}[data-bs-toggle="pill"], .${Fs}[data-bs-toggle="list"]`;class Vs extends W{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),N.on(this._element,Ss,(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?N.trigger(e,Cs,{relatedTarget:t}):null;N.trigger(t,xs,{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(Fs),this._activate(z.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),N.trigger(t,ks,{relatedTarget:e})):t.classList.add(Ws)}),t,t.classList.contains(Hs)))}_deactivate(t,e){t&&(t.classList.remove(Fs),t.blur(),this._deactivate(z.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),N.trigger(t,Os,{relatedTarget:e})):t.classList.remove(Ws)}),t,t.classList.contains(Hs)))}_keydown(t){if(![$s,Is,Ns,Ps,Ms,js].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=this._getChildren().filter((t=>!l(t)));let i;if([Ms,js].includes(t.key))i=e[t.key===Ms?0:e.length-1];else{const n=[Is,Ps].includes(t.key);i=b(e,t.target,n,!0)}i&&(i.focus({preventScroll:!0}),Vs.getOrCreateInstance(i).show())}_getChildren(){return z.find(Rs,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=z.getElementFromSelector(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const n=(t,n)=>{const s=z.findOne(t,i);s&&s.classList.toggle(n,e)};n(".dropdown-toggle",Fs),n(".dropdown-menu",Ws),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(Fs)}_getInnerElement(t){return t.matches(Rs)?t:z.findOne(Rs,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Vs.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}N.on(document,Ls,zs,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),l(this)||Vs.getOrCreateInstance(this).show()})),N.on(window,Ds,(()=>{for(const t of z.find(qs))Vs.getOrCreateInstance(t)})),m(Vs);const Ks=".bs.toast",Qs=`mouseover${Ks}`,Xs=`mouseout${Ks}`,Ys=`focusin${Ks}`,Us=`focusout${Ks}`,Gs=`hide${Ks}`,Js=`hidden${Ks}`,Zs=`show${Ks}`,to=`shown${Ks}`,eo="hide",io="show",no="showing",so={animation:"boolean",autohide:"boolean",delay:"number"},oo={animation:!0,autohide:!0,delay:5e3};class ro extends W{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return oo}static get DefaultType(){return so}static get NAME(){return"toast"}show(){N.trigger(this._element,Zs).defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(eo),d(this._element),this._element.classList.add(io,no),this._queueCallback((()=>{this._element.classList.remove(no),N.trigger(this._element,to),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&(N.trigger(this._element,Gs).defaultPrevented||(this._element.classList.add(no),this._queueCallback((()=>{this._element.classList.add(eo),this._element.classList.remove(no,io),N.trigger(this._element,Js)}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(io),super.dispose()}isShown(){return this._element.classList.contains(io)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){N.on(this._element,Qs,(t=>this._onInteraction(t,!0))),N.on(this._element,Xs,(t=>this._onInteraction(t,!1))),N.on(this._element,Ys,(t=>this._onInteraction(t,!0))),N.on(this._element,Us,(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=ro.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}return R(ro),m(ro),{Alert:Q,Button:Y,Carousel:xt,Collapse:Bt,Dropdown:qi,Modal:On,Offcanvas:qn,Popover:us,ScrollSpy:Es,Tab:Vs,Toast:ro,Tooltip:cs}}));
+//# sourceMappingURL=bootstrap.bundle.min.js.map
\ No newline at end of file
diff --git a/docs/deps/bootstrap-5.3.1/bootstrap.bundle.min.js.map b/docs/deps/bootstrap-5.3.1/bootstrap.bundle.min.js.map
new file mode 100644
index 0000000..3863da8
--- /dev/null
+++ b/docs/deps/bootstrap-5.3.1/bootstrap.bundle.min.js.map
@@ -0,0 +1 @@
+{"version":3,"names":["elementMap","Map","Data","set","element","key","instance","has","instanceMap","get","size","console","error","Array","from","keys","remove","delete","TRANSITION_END","parseSelector","selector","window","CSS","escape","replace","match","id","triggerTransitionEnd","dispatchEvent","Event","isElement","object","jquery","nodeType","getElement","length","document","querySelector","isVisible","getClientRects","elementIsVisible","getComputedStyle","getPropertyValue","closedDetails","closest","summary","parentNode","isDisabled","Node","ELEMENT_NODE","classList","contains","disabled","hasAttribute","getAttribute","findShadowRoot","documentElement","attachShadow","getRootNode","root","ShadowRoot","noop","reflow","offsetHeight","getjQuery","jQuery","body","DOMContentLoadedCallbacks","isRTL","dir","defineJQueryPlugin","plugin","callback","$","name","NAME","JQUERY_NO_CONFLICT","fn","jQueryInterface","Constructor","noConflict","readyState","addEventListener","push","execute","possibleCallback","args","defaultValue","executeAfterTransition","transitionElement","waitForTransition","emulatedDuration","transitionDuration","transitionDelay","floatTransitionDuration","Number","parseFloat","floatTransitionDelay","split","getTransitionDurationFromElement","called","handler","target","removeEventListener","setTimeout","getNextActiveElement","list","activeElement","shouldGetNext","isCycleAllowed","listLength","index","indexOf","Math","max","min","namespaceRegex","stripNameRegex","stripUidRegex","eventRegistry","uidEvent","customEvents","mouseenter","mouseleave","nativeEvents","Set","makeEventUid","uid","getElementEvents","findHandler","events","callable","delegationSelector","Object","values","find","event","normalizeParameters","originalTypeEvent","delegationFunction","isDelegated","typeEvent","getTypeEvent","addHandler","oneOff","wrapFunction","relatedTarget","delegateTarget","call","this","handlers","previousFunction","domElements","querySelectorAll","domElement","hydrateObj","EventHandler","off","type","apply","bootstrapDelegationHandler","bootstrapHandler","removeHandler","Boolean","removeNamespacedHandlers","namespace","storeElementEvent","handlerKey","entries","includes","on","one","inNamespace","isNamespace","startsWith","elementEvent","slice","keyHandlers","trigger","jQueryEvent","bubbles","nativeDispatch","defaultPrevented","isPropagationStopped","isImmediatePropagationStopped","isDefaultPrevented","evt","cancelable","preventDefault","obj","meta","value","_unused","defineProperty","configurable","normalizeData","toString","JSON","parse","decodeURIComponent","normalizeDataKey","chr","toLowerCase","Manipulator","setDataAttribute","setAttribute","removeDataAttribute","removeAttribute","getDataAttributes","attributes","bsKeys","dataset","filter","pureKey","charAt","getDataAttribute","Config","Default","DefaultType","Error","_getConfig","config","_mergeConfigObj","_configAfterMerge","_typeCheckConfig","jsonConfig","constructor","configTypes","property","expectedTypes","valueType","prototype","RegExp","test","TypeError","toUpperCase","BaseComponent","super","_element","_config","DATA_KEY","dispose","EVENT_KEY","propertyName","getOwnPropertyNames","_queueCallback","isAnimated","getInstance","getOrCreateInstance","VERSION","eventName","getSelector","hrefAttribute","trim","SelectorEngine","concat","Element","findOne","children","child","matches","parents","ancestor","prev","previous","previousElementSibling","next","nextElementSibling","focusableChildren","focusables","map","join","el","getSelectorFromElement","getElementFromSelector","getMultipleElementsFromSelector","enableDismissTrigger","component","method","clickEvent","tagName","EVENT_CLOSE","EVENT_CLOSED","Alert","close","_destroyElement","each","data","undefined","SELECTOR_DATA_TOGGLE","Button","toggle","button","EVENT_TOUCHSTART","EVENT_TOUCHMOVE","EVENT_TOUCHEND","EVENT_POINTERDOWN","EVENT_POINTERUP","endCallback","leftCallback","rightCallback","Swipe","isSupported","_deltaX","_supportPointerEvents","PointerEvent","_initEvents","_start","_eventIsPointerPenTouch","clientX","touches","_end","_handleSwipe","_move","absDeltaX","abs","direction","add","pointerType","navigator","maxTouchPoints","DATA_API_KEY","ORDER_NEXT","ORDER_PREV","DIRECTION_LEFT","DIRECTION_RIGHT","EVENT_SLIDE","EVENT_SLID","EVENT_KEYDOWN","EVENT_MOUSEENTER","EVENT_MOUSELEAVE","EVENT_DRAG_START","EVENT_LOAD_DATA_API","EVENT_CLICK_DATA_API","CLASS_NAME_CAROUSEL","CLASS_NAME_ACTIVE","SELECTOR_ACTIVE","SELECTOR_ITEM","SELECTOR_ACTIVE_ITEM","KEY_TO_DIRECTION","ArrowLeft","ArrowRight","interval","keyboard","pause","ride","touch","wrap","Carousel","_interval","_activeElement","_isSliding","touchTimeout","_swipeHelper","_indicatorsElement","_addEventListeners","cycle","_slide","nextWhenVisible","hidden","_clearInterval","_updateInterval","setInterval","_maybeEnableCycle","to","items","_getItems","activeIndex","_getItemIndex","_getActive","order","defaultInterval","_keydown","_addTouchEventListeners","img","swipeConfig","_directionToOrder","endCallBack","clearTimeout","_setActiveIndicatorElement","activeIndicator","newActiveIndicator","elementInterval","parseInt","isNext","nextElement","nextElementIndex","triggerEvent","_orderToDirection","isCycling","directionalClassName","orderClassName","completeCallBack","_isAnimated","clearInterval","carousel","slideIndex","carousels","EVENT_SHOW","EVENT_SHOWN","EVENT_HIDE","EVENT_HIDDEN","CLASS_NAME_SHOW","CLASS_NAME_COLLAPSE","CLASS_NAME_COLLAPSING","CLASS_NAME_DEEPER_CHILDREN","parent","Collapse","_isTransitioning","_triggerArray","toggleList","elem","filterElement","foundElement","_initializeChildren","_addAriaAndCollapsedClass","_isShown","hide","show","activeChildren","_getFirstLevelChildren","activeInstance","dimension","_getDimension","style","scrollSize","complete","getBoundingClientRect","selected","triggerArray","isOpen","top","bottom","right","left","auto","basePlacements","start","end","clippingParents","viewport","popper","reference","variationPlacements","reduce","acc","placement","placements","beforeRead","read","afterRead","beforeMain","main","afterMain","beforeWrite","write","afterWrite","modifierPhases","getNodeName","nodeName","getWindow","node","ownerDocument","defaultView","isHTMLElement","HTMLElement","isShadowRoot","applyStyles$1","enabled","phase","_ref","state","elements","forEach","styles","assign","effect","_ref2","initialStyles","position","options","strategy","margin","arrow","hasOwnProperty","attribute","requires","getBasePlacement","round","getUAString","uaData","userAgentData","brands","isArray","item","brand","version","userAgent","isLayoutViewport","includeScale","isFixedStrategy","clientRect","scaleX","scaleY","offsetWidth","width","height","visualViewport","addVisualOffsets","x","offsetLeft","y","offsetTop","getLayoutRect","rootNode","isSameNode","host","isTableElement","getDocumentElement","getParentNode","assignedSlot","getTrueOffsetParent","offsetParent","getOffsetParent","isFirefox","currentNode","css","transform","perspective","contain","willChange","getContainingBlock","getMainAxisFromPlacement","within","mathMax","mathMin","mergePaddingObject","paddingObject","expandToHashMap","hashMap","arrow$1","_state$modifiersData$","arrowElement","popperOffsets","modifiersData","basePlacement","axis","len","padding","rects","toPaddingObject","arrowRect","minProp","maxProp","endDiff","startDiff","arrowOffsetParent","clientSize","clientHeight","clientWidth","centerToReference","center","offset","axisProp","centerOffset","_options$element","requiresIfExists","getVariation","unsetSides","mapToStyles","_Object$assign2","popperRect","variation","offsets","gpuAcceleration","adaptive","roundOffsets","isFixed","_offsets$x","_offsets$y","_ref3","hasX","hasY","sideX","sideY","win","heightProp","widthProp","_Object$assign","commonStyles","_ref4","dpr","devicePixelRatio","roundOffsetsByDPR","computeStyles$1","_ref5","_options$gpuAccelerat","_options$adaptive","_options$roundOffsets","passive","eventListeners","_options$scroll","scroll","_options$resize","resize","scrollParents","scrollParent","update","hash","getOppositePlacement","matched","getOppositeVariationPlacement","getWindowScroll","scrollLeft","pageXOffset","scrollTop","pageYOffset","getWindowScrollBarX","isScrollParent","_getComputedStyle","overflow","overflowX","overflowY","getScrollParent","listScrollParents","_element$ownerDocumen","isBody","updatedList","rectToClientRect","rect","getClientRectFromMixedType","clippingParent","html","layoutViewport","getViewportRect","clientTop","clientLeft","getInnerBoundingClientRect","winScroll","scrollWidth","scrollHeight","getDocumentRect","computeOffsets","commonX","commonY","mainAxis","detectOverflow","_options","_options$placement","_options$strategy","_options$boundary","boundary","_options$rootBoundary","rootBoundary","_options$elementConte","elementContext","_options$altBoundary","altBoundary","_options$padding","altContext","clippingClientRect","mainClippingParents","clipperElement","getClippingParents","firstClippingParent","clippingRect","accRect","getClippingRect","contextElement","referenceClientRect","popperClientRect","elementClientRect","overflowOffsets","offsetData","multiply","computeAutoPlacement","flipVariations","_options$allowedAutoP","allowedAutoPlacements","allPlacements","allowedPlacements","overflows","sort","a","b","flip$1","_skip","_options$mainAxis","checkMainAxis","_options$altAxis","altAxis","checkAltAxis","specifiedFallbackPlacements","fallbackPlacements","_options$flipVariatio","preferredPlacement","oppositePlacement","getExpandedFallbackPlacements","referenceRect","checksMap","makeFallbackChecks","firstFittingPlacement","i","_basePlacement","isStartVariation","isVertical","mainVariationSide","altVariationSide","checks","every","check","_loop","_i","fittingPlacement","reset","getSideOffsets","preventedOffsets","isAnySideFullyClipped","some","side","hide$1","preventOverflow","referenceOverflow","popperAltOverflow","referenceClippingOffsets","popperEscapeOffsets","isReferenceHidden","hasPopperEscaped","offset$1","_options$offset","invertDistance","skidding","distance","distanceAndSkiddingToXY","_data$state$placement","popperOffsets$1","preventOverflow$1","_options$tether","tether","_options$tetherOffset","tetherOffset","isBasePlacement","tetherOffsetValue","normalizedTetherOffsetValue","offsetModifierState","_offsetModifierState$","mainSide","altSide","additive","minLen","maxLen","arrowPaddingObject","arrowPaddingMin","arrowPaddingMax","arrowLen","minOffset","maxOffset","clientOffset","offsetModifierValue","tetherMax","preventedOffset","_offsetModifierState$2","_mainSide","_altSide","_offset","_len","_min","_max","isOriginSide","_offsetModifierValue","_tetherMin","_tetherMax","_preventedOffset","v","withinMaxClamp","getCompositeRect","elementOrVirtualElement","isOffsetParentAnElement","offsetParentIsScaled","isElementScaled","modifiers","visited","result","modifier","dep","depModifier","DEFAULT_OPTIONS","areValidElements","arguments","_key","popperGenerator","generatorOptions","_generatorOptions","_generatorOptions$def","defaultModifiers","_generatorOptions$def2","defaultOptions","pending","orderedModifiers","effectCleanupFns","isDestroyed","setOptions","setOptionsAction","cleanupModifierEffects","merged","orderModifiers","current","existing","m","_ref$options","cleanupFn","forceUpdate","_state$elements","_state$orderedModifie","_state$orderedModifie2","Promise","resolve","then","destroy","onFirstUpdate","createPopper","computeStyles","applyStyles","flip","ARROW_UP_KEY","ARROW_DOWN_KEY","EVENT_KEYDOWN_DATA_API","EVENT_KEYUP_DATA_API","SELECTOR_DATA_TOGGLE_SHOWN","SELECTOR_MENU","PLACEMENT_TOP","PLACEMENT_TOPEND","PLACEMENT_BOTTOM","PLACEMENT_BOTTOMEND","PLACEMENT_RIGHT","PLACEMENT_LEFT","autoClose","display","popperConfig","Dropdown","_popper","_parent","_menu","_inNavbar","_detectNavbar","_createPopper","focus","_completeHide","Popper","referenceElement","_getPopperConfig","_getPlacement","parentDropdown","isEnd","_getOffset","popperData","defaultBsPopperConfig","_selectMenuItem","clearMenus","openToggles","context","composedPath","isMenuTarget","dataApiKeydownHandler","isInput","isEscapeEvent","isUpOrDownEvent","getToggleButton","stopPropagation","EVENT_MOUSEDOWN","className","clickCallback","rootElement","Backdrop","_isAppended","_append","_getElement","_emulateAnimation","backdrop","createElement","append","EVENT_FOCUSIN","EVENT_KEYDOWN_TAB","TAB_NAV_BACKWARD","autofocus","trapElement","FocusTrap","_isActive","_lastTabNavDirection","activate","_handleFocusin","_handleKeydown","deactivate","shiftKey","SELECTOR_FIXED_CONTENT","SELECTOR_STICKY_CONTENT","PROPERTY_PADDING","PROPERTY_MARGIN","ScrollBarHelper","getWidth","documentWidth","innerWidth","_disableOverFlow","_setElementAttributes","calculatedValue","_resetElementAttributes","isOverflowing","_saveInitialAttribute","styleProperty","scrollbarWidth","_applyManipulationCallback","setProperty","actualValue","removeProperty","callBack","sel","EVENT_HIDE_PREVENTED","EVENT_RESIZE","EVENT_CLICK_DISMISS","EVENT_MOUSEDOWN_DISMISS","EVENT_KEYDOWN_DISMISS","CLASS_NAME_OPEN","CLASS_NAME_STATIC","Modal","_dialog","_backdrop","_initializeBackDrop","_focustrap","_initializeFocusTrap","_scrollBar","_adjustDialog","_showElement","_hideModal","handleUpdate","modalBody","transitionComplete","_triggerBackdropTransition","event2","_resetAdjustments","isModalOverflowing","initialOverflowY","isBodyOverflowing","paddingLeft","paddingRight","showEvent","alreadyOpen","CLASS_NAME_SHOWING","CLASS_NAME_HIDING","OPEN_SELECTOR","Offcanvas","blur","completeCallback","DefaultAllowlist","area","br","col","code","div","em","hr","h1","h2","h3","h4","h5","h6","li","ol","p","pre","s","small","span","sub","sup","strong","u","ul","uriAttributes","SAFE_URL_PATTERN","allowedAttribute","allowedAttributeList","attributeName","nodeValue","attributeRegex","regex","allowList","content","extraClass","sanitize","sanitizeFn","template","DefaultContentType","entry","TemplateFactory","getContent","_resolvePossibleFunction","hasContent","changeContent","_checkContent","toHtml","templateWrapper","innerHTML","_maybeSanitize","text","_setContent","arg","templateElement","_putElementInTemplate","textContent","unsafeHtml","sanitizeFunction","createdDocument","DOMParser","parseFromString","elementName","attributeList","allowedAttributes","sanitizeHtml","DISALLOWED_ATTRIBUTES","CLASS_NAME_FADE","SELECTOR_MODAL","EVENT_MODAL_HIDE","TRIGGER_HOVER","TRIGGER_FOCUS","AttachmentMap","AUTO","TOP","RIGHT","BOTTOM","LEFT","animation","container","customClass","delay","title","Tooltip","_isEnabled","_timeout","_isHovered","_activeTrigger","_templateFactory","_newContent","tip","_setListeners","_fixTitle","enable","disable","toggleEnabled","click","_leave","_enter","_hideModalHandler","_disposePopper","_isWithContent","isInTheDom","_getTipElement","_isWithActiveTrigger","_getTitle","_createTipElement","_getContentForTemplate","_getTemplateFactory","tipId","prefix","floor","random","getElementById","getUID","setContent","_initializeOnDelegatedTarget","_getDelegateConfig","attachment","triggers","eventIn","eventOut","_setTimeout","timeout","dataAttributes","dataAttribute","Popover","_getContent","EVENT_ACTIVATE","EVENT_CLICK","SELECTOR_TARGET_LINKS","SELECTOR_NAV_LINKS","SELECTOR_LINK_ITEMS","rootMargin","smoothScroll","threshold","ScrollSpy","_targetLinks","_observableSections","_rootElement","_activeTarget","_observer","_previousScrollData","visibleEntryTop","parentScrollTop","refresh","_initializeTargetsAndObservables","_maybeEnableSmoothScroll","disconnect","_getNewObserver","section","observe","observableSection","scrollTo","behavior","IntersectionObserver","_observerCallback","targetElement","_process","userScrollsDown","isIntersecting","_clearActiveClass","entryIsLowerThanPrevious","targetLinks","anchor","decodeURI","_activateParents","listGroup","activeNodes","spy","ARROW_LEFT_KEY","ARROW_RIGHT_KEY","HOME_KEY","END_KEY","NOT_SELECTOR_DROPDOWN_TOGGLE","SELECTOR_INNER_ELEM","SELECTOR_DATA_TOGGLE_ACTIVE","Tab","_setInitialAttributes","_getChildren","innerElem","_elemIsActive","active","_getActiveElem","hideEvent","_deactivate","_activate","relatedElem","_toggleDropDown","nextActiveElement","preventScroll","_setAttributeIfNotExists","_setInitialAttributesOnChild","_getInnerElement","isActive","outerElem","_getOuterElement","_setInitialAttributesOnTargetPanel","open","EVENT_MOUSEOVER","EVENT_MOUSEOUT","EVENT_FOCUSOUT","CLASS_NAME_HIDE","autohide","Toast","_hasMouseInteraction","_hasKeyboardInteraction","_clearTimeout","_maybeScheduleHide","isShown","_onInteraction","isInteracting"],"sources":["../../js/src/dom/data.js","../../js/src/util/index.js","../../js/src/dom/event-handler.js","../../js/src/dom/manipulator.js","../../js/src/util/config.js","../../js/src/base-component.js","../../js/src/dom/selector-engine.js","../../js/src/util/component-functions.js","../../js/src/alert.js","../../js/src/button.js","../../js/src/util/swipe.js","../../js/src/carousel.js","../../js/src/collapse.js","../../node_modules/@popperjs/core/lib/enums.js","../../node_modules/@popperjs/core/lib/dom-utils/getNodeName.js","../../node_modules/@popperjs/core/lib/dom-utils/getWindow.js","../../node_modules/@popperjs/core/lib/dom-utils/instanceOf.js","../../node_modules/@popperjs/core/lib/modifiers/applyStyles.js","../../node_modules/@popperjs/core/lib/utils/getBasePlacement.js","../../node_modules/@popperjs/core/lib/utils/math.js","../../node_modules/@popperjs/core/lib/utils/userAgent.js","../../node_modules/@popperjs/core/lib/dom-utils/isLayoutViewport.js","../../node_modules/@popperjs/core/lib/dom-utils/getBoundingClientRect.js","../../node_modules/@popperjs/core/lib/dom-utils/getLayoutRect.js","../../node_modules/@popperjs/core/lib/dom-utils/contains.js","../../node_modules/@popperjs/core/lib/dom-utils/getComputedStyle.js","../../node_modules/@popperjs/core/lib/dom-utils/isTableElement.js","../../node_modules/@popperjs/core/lib/dom-utils/getDocumentElement.js","../../node_modules/@popperjs/core/lib/dom-utils/getParentNode.js","../../node_modules/@popperjs/core/lib/dom-utils/getOffsetParent.js","../../node_modules/@popperjs/core/lib/utils/getMainAxisFromPlacement.js","../../node_modules/@popperjs/core/lib/utils/within.js","../../node_modules/@popperjs/core/lib/utils/mergePaddingObject.js","../../node_modules/@popperjs/core/lib/utils/getFreshSideObject.js","../../node_modules/@popperjs/core/lib/utils/expandToHashMap.js","../../node_modules/@popperjs/core/lib/modifiers/arrow.js","../../node_modules/@popperjs/core/lib/utils/getVariation.js","../../node_modules/@popperjs/core/lib/modifiers/computeStyles.js","../../node_modules/@popperjs/core/lib/modifiers/eventListeners.js","../../node_modules/@popperjs/core/lib/utils/getOppositePlacement.js","../../node_modules/@popperjs/core/lib/utils/getOppositeVariationPlacement.js","../../node_modules/@popperjs/core/lib/dom-utils/getWindowScroll.js","../../node_modules/@popperjs/core/lib/dom-utils/getWindowScrollBarX.js","../../node_modules/@popperjs/core/lib/dom-utils/isScrollParent.js","../../node_modules/@popperjs/core/lib/dom-utils/getScrollParent.js","../../node_modules/@popperjs/core/lib/dom-utils/listScrollParents.js","../../node_modules/@popperjs/core/lib/utils/rectToClientRect.js","../../node_modules/@popperjs/core/lib/dom-utils/getClippingRect.js","../../node_modules/@popperjs/core/lib/dom-utils/getViewportRect.js","../../node_modules/@popperjs/core/lib/dom-utils/getDocumentRect.js","../../node_modules/@popperjs/core/lib/utils/computeOffsets.js","../../node_modules/@popperjs/core/lib/utils/detectOverflow.js","../../node_modules/@popperjs/core/lib/utils/computeAutoPlacement.js","../../node_modules/@popperjs/core/lib/modifiers/flip.js","../../node_modules/@popperjs/core/lib/modifiers/hide.js","../../node_modules/@popperjs/core/lib/modifiers/offset.js","../../node_modules/@popperjs/core/lib/modifiers/popperOffsets.js","../../node_modules/@popperjs/core/lib/modifiers/preventOverflow.js","../../node_modules/@popperjs/core/lib/utils/getAltAxis.js","../../node_modules/@popperjs/core/lib/dom-utils/getCompositeRect.js","../../node_modules/@popperjs/core/lib/dom-utils/getNodeScroll.js","../../node_modules/@popperjs/core/lib/dom-utils/getHTMLElementScroll.js","../../node_modules/@popperjs/core/lib/utils/orderModifiers.js","../../node_modules/@popperjs/core/lib/createPopper.js","../../node_modules/@popperjs/core/lib/utils/debounce.js","../../node_modules/@popperjs/core/lib/utils/mergeByName.js","../../node_modules/@popperjs/core/lib/popper-lite.js","../../node_modules/@popperjs/core/lib/popper.js","../../js/src/dropdown.js","../../js/src/util/backdrop.js","../../js/src/util/focustrap.js","../../js/src/util/scrollbar.js","../../js/src/modal.js","../../js/src/offcanvas.js","../../js/src/util/sanitizer.js","../../js/src/util/template-factory.js","../../js/src/tooltip.js","../../js/src/popover.js","../../js/src/scrollspy.js","../../js/src/tab.js","../../js/src/toast.js","../../js/index.umd.js"],"sourcesContent":["/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/data.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n/**\n * Constants\n */\n\nconst elementMap = new Map()\n\nexport default {\n set(element, key, instance) {\n if (!elementMap.has(element)) {\n elementMap.set(element, new Map())\n }\n\n const instanceMap = elementMap.get(element)\n\n // make it clear we only want one instance per element\n // can be removed later when multiple key/instances are fine to be used\n if (!instanceMap.has(key) && instanceMap.size !== 0) {\n // eslint-disable-next-line no-console\n console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(instanceMap.keys())[0]}.`)\n return\n }\n\n instanceMap.set(key, instance)\n },\n\n get(element, key) {\n if (elementMap.has(element)) {\n return elementMap.get(element).get(key) || null\n }\n\n return null\n },\n\n remove(element, key) {\n if (!elementMap.has(element)) {\n return\n }\n\n const instanceMap = elementMap.get(element)\n\n instanceMap.delete(key)\n\n // free up element references if there are no instances left for an element\n if (instanceMap.size === 0) {\n elementMap.delete(element)\n }\n }\n}\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap util/index.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst MAX_UID = 1_000_000\nconst MILLISECONDS_MULTIPLIER = 1000\nconst TRANSITION_END = 'transitionend'\n\n/**\n * Properly escape IDs selectors to handle weird IDs\n * @param {string} selector\n * @returns {string}\n */\nconst parseSelector = selector => {\n if (selector && window.CSS && window.CSS.escape) {\n // document.querySelector needs escaping to handle IDs (html5+) containing for instance /\n selector = selector.replace(/#([^\\s\"#']+)/g, (match, id) => `#${CSS.escape(id)}`)\n }\n\n return selector\n}\n\n// Shout-out Angus Croll (https://goo.gl/pxwQGp)\nconst toType = object => {\n if (object === null || object === undefined) {\n return `${object}`\n }\n\n return Object.prototype.toString.call(object).match(/\\s([a-z]+)/i)[1].toLowerCase()\n}\n\n/**\n * Public Util API\n */\n\nconst getUID = prefix => {\n do {\n prefix += Math.floor(Math.random() * MAX_UID)\n } while (document.getElementById(prefix))\n\n return prefix\n}\n\nconst getTransitionDurationFromElement = element => {\n if (!element) {\n return 0\n }\n\n // Get transition-duration of the element\n let { transitionDuration, transitionDelay } = window.getComputedStyle(element)\n\n const floatTransitionDuration = Number.parseFloat(transitionDuration)\n const floatTransitionDelay = Number.parseFloat(transitionDelay)\n\n // Return 0 if element or transition duration is not found\n if (!floatTransitionDuration && !floatTransitionDelay) {\n return 0\n }\n\n // If multiple durations are defined, take the first\n transitionDuration = transitionDuration.split(',')[0]\n transitionDelay = transitionDelay.split(',')[0]\n\n return (Number.parseFloat(transitionDuration) + Number.parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER\n}\n\nconst triggerTransitionEnd = element => {\n element.dispatchEvent(new Event(TRANSITION_END))\n}\n\nconst isElement = object => {\n if (!object || typeof object !== 'object') {\n return false\n }\n\n if (typeof object.jquery !== 'undefined') {\n object = object[0]\n }\n\n return typeof object.nodeType !== 'undefined'\n}\n\nconst getElement = object => {\n // it's a jQuery object or a node element\n if (isElement(object)) {\n return object.jquery ? object[0] : object\n }\n\n if (typeof object === 'string' && object.length > 0) {\n return document.querySelector(parseSelector(object))\n }\n\n return null\n}\n\nconst isVisible = element => {\n if (!isElement(element) || element.getClientRects().length === 0) {\n return false\n }\n\n const elementIsVisible = getComputedStyle(element).getPropertyValue('visibility') === 'visible'\n // Handle `details` element as its content may falsie appear visible when it is closed\n const closedDetails = element.closest('details:not([open])')\n\n if (!closedDetails) {\n return elementIsVisible\n }\n\n if (closedDetails !== element) {\n const summary = element.closest('summary')\n if (summary && summary.parentNode !== closedDetails) {\n return false\n }\n\n if (summary === null) {\n return false\n }\n }\n\n return elementIsVisible\n}\n\nconst isDisabled = element => {\n if (!element || element.nodeType !== Node.ELEMENT_NODE) {\n return true\n }\n\n if (element.classList.contains('disabled')) {\n return true\n }\n\n if (typeof element.disabled !== 'undefined') {\n return element.disabled\n }\n\n return element.hasAttribute('disabled') && element.getAttribute('disabled') !== 'false'\n}\n\nconst findShadowRoot = element => {\n if (!document.documentElement.attachShadow) {\n return null\n }\n\n // Can find the shadow root otherwise it'll return the document\n if (typeof element.getRootNode === 'function') {\n const root = element.getRootNode()\n return root instanceof ShadowRoot ? root : null\n }\n\n if (element instanceof ShadowRoot) {\n return element\n }\n\n // when we don't find a shadow root\n if (!element.parentNode) {\n return null\n }\n\n return findShadowRoot(element.parentNode)\n}\n\nconst noop = () => {}\n\n/**\n * Trick to restart an element's animation\n *\n * @param {HTMLElement} element\n * @return void\n *\n * @see https://www.charistheo.io/blog/2021/02/restart-a-css-animation-with-javascript/#restarting-a-css-animation\n */\nconst reflow = element => {\n element.offsetHeight // eslint-disable-line no-unused-expressions\n}\n\nconst getjQuery = () => {\n if (window.jQuery && !document.body.hasAttribute('data-bs-no-jquery')) {\n return window.jQuery\n }\n\n return null\n}\n\nconst DOMContentLoadedCallbacks = []\n\nconst onDOMContentLoaded = callback => {\n if (document.readyState === 'loading') {\n // add listener on the first call when the document is in loading state\n if (!DOMContentLoadedCallbacks.length) {\n document.addEventListener('DOMContentLoaded', () => {\n for (const callback of DOMContentLoadedCallbacks) {\n callback()\n }\n })\n }\n\n DOMContentLoadedCallbacks.push(callback)\n } else {\n callback()\n }\n}\n\nconst isRTL = () => document.documentElement.dir === 'rtl'\n\nconst defineJQueryPlugin = plugin => {\n onDOMContentLoaded(() => {\n const $ = getjQuery()\n /* istanbul ignore if */\n if ($) {\n const name = plugin.NAME\n const JQUERY_NO_CONFLICT = $.fn[name]\n $.fn[name] = plugin.jQueryInterface\n $.fn[name].Constructor = plugin\n $.fn[name].noConflict = () => {\n $.fn[name] = JQUERY_NO_CONFLICT\n return plugin.jQueryInterface\n }\n }\n })\n}\n\nconst execute = (possibleCallback, args = [], defaultValue = possibleCallback) => {\n return typeof possibleCallback === 'function' ? possibleCallback(...args) : defaultValue\n}\n\nconst executeAfterTransition = (callback, transitionElement, waitForTransition = true) => {\n if (!waitForTransition) {\n execute(callback)\n return\n }\n\n const durationPadding = 5\n const emulatedDuration = getTransitionDurationFromElement(transitionElement) + durationPadding\n\n let called = false\n\n const handler = ({ target }) => {\n if (target !== transitionElement) {\n return\n }\n\n called = true\n transitionElement.removeEventListener(TRANSITION_END, handler)\n execute(callback)\n }\n\n transitionElement.addEventListener(TRANSITION_END, handler)\n setTimeout(() => {\n if (!called) {\n triggerTransitionEnd(transitionElement)\n }\n }, emulatedDuration)\n}\n\n/**\n * Return the previous/next element of a list.\n *\n * @param {array} list The list of elements\n * @param activeElement The active element\n * @param shouldGetNext Choose to get next or previous element\n * @param isCycleAllowed\n * @return {Element|elem} The proper element\n */\nconst getNextActiveElement = (list, activeElement, shouldGetNext, isCycleAllowed) => {\n const listLength = list.length\n let index = list.indexOf(activeElement)\n\n // if the element does not exist in the list return an element\n // depending on the direction and if cycle is allowed\n if (index === -1) {\n return !shouldGetNext && isCycleAllowed ? list[listLength - 1] : list[0]\n }\n\n index += shouldGetNext ? 1 : -1\n\n if (isCycleAllowed) {\n index = (index + listLength) % listLength\n }\n\n return list[Math.max(0, Math.min(index, listLength - 1))]\n}\n\nexport {\n defineJQueryPlugin,\n execute,\n executeAfterTransition,\n findShadowRoot,\n getElement,\n getjQuery,\n getNextActiveElement,\n getTransitionDurationFromElement,\n getUID,\n isDisabled,\n isElement,\n isRTL,\n isVisible,\n noop,\n onDOMContentLoaded,\n parseSelector,\n reflow,\n triggerTransitionEnd,\n toType\n}\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/event-handler.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport { getjQuery } from '../util/index.js'\n\n/**\n * Constants\n */\n\nconst namespaceRegex = /[^.]*(?=\\..*)\\.|.*/\nconst stripNameRegex = /\\..*/\nconst stripUidRegex = /::\\d+$/\nconst eventRegistry = {} // Events storage\nlet uidEvent = 1\nconst customEvents = {\n mouseenter: 'mouseover',\n mouseleave: 'mouseout'\n}\n\nconst nativeEvents = new Set([\n 'click',\n 'dblclick',\n 'mouseup',\n 'mousedown',\n 'contextmenu',\n 'mousewheel',\n 'DOMMouseScroll',\n 'mouseover',\n 'mouseout',\n 'mousemove',\n 'selectstart',\n 'selectend',\n 'keydown',\n 'keypress',\n 'keyup',\n 'orientationchange',\n 'touchstart',\n 'touchmove',\n 'touchend',\n 'touchcancel',\n 'pointerdown',\n 'pointermove',\n 'pointerup',\n 'pointerleave',\n 'pointercancel',\n 'gesturestart',\n 'gesturechange',\n 'gestureend',\n 'focus',\n 'blur',\n 'change',\n 'reset',\n 'select',\n 'submit',\n 'focusin',\n 'focusout',\n 'load',\n 'unload',\n 'beforeunload',\n 'resize',\n 'move',\n 'DOMContentLoaded',\n 'readystatechange',\n 'error',\n 'abort',\n 'scroll'\n])\n\n/**\n * Private methods\n */\n\nfunction makeEventUid(element, uid) {\n return (uid && `${uid}::${uidEvent++}`) || element.uidEvent || uidEvent++\n}\n\nfunction getElementEvents(element) {\n const uid = makeEventUid(element)\n\n element.uidEvent = uid\n eventRegistry[uid] = eventRegistry[uid] || {}\n\n return eventRegistry[uid]\n}\n\nfunction bootstrapHandler(element, fn) {\n return function handler(event) {\n hydrateObj(event, { delegateTarget: element })\n\n if (handler.oneOff) {\n EventHandler.off(element, event.type, fn)\n }\n\n return fn.apply(element, [event])\n }\n}\n\nfunction bootstrapDelegationHandler(element, selector, fn) {\n return function handler(event) {\n const domElements = element.querySelectorAll(selector)\n\n for (let { target } = event; target && target !== this; target = target.parentNode) {\n for (const domElement of domElements) {\n if (domElement !== target) {\n continue\n }\n\n hydrateObj(event, { delegateTarget: target })\n\n if (handler.oneOff) {\n EventHandler.off(element, event.type, selector, fn)\n }\n\n return fn.apply(target, [event])\n }\n }\n }\n}\n\nfunction findHandler(events, callable, delegationSelector = null) {\n return Object.values(events)\n .find(event => event.callable === callable && event.delegationSelector === delegationSelector)\n}\n\nfunction normalizeParameters(originalTypeEvent, handler, delegationFunction) {\n const isDelegated = typeof handler === 'string'\n // TODO: tooltip passes `false` instead of selector, so we need to check\n const callable = isDelegated ? delegationFunction : (handler || delegationFunction)\n let typeEvent = getTypeEvent(originalTypeEvent)\n\n if (!nativeEvents.has(typeEvent)) {\n typeEvent = originalTypeEvent\n }\n\n return [isDelegated, callable, typeEvent]\n}\n\nfunction addHandler(element, originalTypeEvent, handler, delegationFunction, oneOff) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return\n }\n\n let [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction)\n\n // in case of mouseenter or mouseleave wrap the handler within a function that checks for its DOM position\n // this prevents the handler from being dispatched the same way as mouseover or mouseout does\n if (originalTypeEvent in customEvents) {\n const wrapFunction = fn => {\n return function (event) {\n if (!event.relatedTarget || (event.relatedTarget !== event.delegateTarget && !event.delegateTarget.contains(event.relatedTarget))) {\n return fn.call(this, event)\n }\n }\n }\n\n callable = wrapFunction(callable)\n }\n\n const events = getElementEvents(element)\n const handlers = events[typeEvent] || (events[typeEvent] = {})\n const previousFunction = findHandler(handlers, callable, isDelegated ? handler : null)\n\n if (previousFunction) {\n previousFunction.oneOff = previousFunction.oneOff && oneOff\n\n return\n }\n\n const uid = makeEventUid(callable, originalTypeEvent.replace(namespaceRegex, ''))\n const fn = isDelegated ?\n bootstrapDelegationHandler(element, handler, callable) :\n bootstrapHandler(element, callable)\n\n fn.delegationSelector = isDelegated ? handler : null\n fn.callable = callable\n fn.oneOff = oneOff\n fn.uidEvent = uid\n handlers[uid] = fn\n\n element.addEventListener(typeEvent, fn, isDelegated)\n}\n\nfunction removeHandler(element, events, typeEvent, handler, delegationSelector) {\n const fn = findHandler(events[typeEvent], handler, delegationSelector)\n\n if (!fn) {\n return\n }\n\n element.removeEventListener(typeEvent, fn, Boolean(delegationSelector))\n delete events[typeEvent][fn.uidEvent]\n}\n\nfunction removeNamespacedHandlers(element, events, typeEvent, namespace) {\n const storeElementEvent = events[typeEvent] || {}\n\n for (const [handlerKey, event] of Object.entries(storeElementEvent)) {\n if (handlerKey.includes(namespace)) {\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector)\n }\n }\n}\n\nfunction getTypeEvent(event) {\n // allow to get the native events from namespaced events ('click.bs.button' --> 'click')\n event = event.replace(stripNameRegex, '')\n return customEvents[event] || event\n}\n\nconst EventHandler = {\n on(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, false)\n },\n\n one(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, true)\n },\n\n off(element, originalTypeEvent, handler, delegationFunction) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return\n }\n\n const [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction)\n const inNamespace = typeEvent !== originalTypeEvent\n const events = getElementEvents(element)\n const storeElementEvent = events[typeEvent] || {}\n const isNamespace = originalTypeEvent.startsWith('.')\n\n if (typeof callable !== 'undefined') {\n // Simplest case: handler is passed, remove that listener ONLY.\n if (!Object.keys(storeElementEvent).length) {\n return\n }\n\n removeHandler(element, events, typeEvent, callable, isDelegated ? handler : null)\n return\n }\n\n if (isNamespace) {\n for (const elementEvent of Object.keys(events)) {\n removeNamespacedHandlers(element, events, elementEvent, originalTypeEvent.slice(1))\n }\n }\n\n for (const [keyHandlers, event] of Object.entries(storeElementEvent)) {\n const handlerKey = keyHandlers.replace(stripUidRegex, '')\n\n if (!inNamespace || originalTypeEvent.includes(handlerKey)) {\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector)\n }\n }\n },\n\n trigger(element, event, args) {\n if (typeof event !== 'string' || !element) {\n return null\n }\n\n const $ = getjQuery()\n const typeEvent = getTypeEvent(event)\n const inNamespace = event !== typeEvent\n\n let jQueryEvent = null\n let bubbles = true\n let nativeDispatch = true\n let defaultPrevented = false\n\n if (inNamespace && $) {\n jQueryEvent = $.Event(event, args)\n\n $(element).trigger(jQueryEvent)\n bubbles = !jQueryEvent.isPropagationStopped()\n nativeDispatch = !jQueryEvent.isImmediatePropagationStopped()\n defaultPrevented = jQueryEvent.isDefaultPrevented()\n }\n\n const evt = hydrateObj(new Event(event, { bubbles, cancelable: true }), args)\n\n if (defaultPrevented) {\n evt.preventDefault()\n }\n\n if (nativeDispatch) {\n element.dispatchEvent(evt)\n }\n\n if (evt.defaultPrevented && jQueryEvent) {\n jQueryEvent.preventDefault()\n }\n\n return evt\n }\n}\n\nfunction hydrateObj(obj, meta = {}) {\n for (const [key, value] of Object.entries(meta)) {\n try {\n obj[key] = value\n } catch {\n Object.defineProperty(obj, key, {\n configurable: true,\n get() {\n return value\n }\n })\n }\n }\n\n return obj\n}\n\nexport default EventHandler\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/manipulator.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nfunction normalizeData(value) {\n if (value === 'true') {\n return true\n }\n\n if (value === 'false') {\n return false\n }\n\n if (value === Number(value).toString()) {\n return Number(value)\n }\n\n if (value === '' || value === 'null') {\n return null\n }\n\n if (typeof value !== 'string') {\n return value\n }\n\n try {\n return JSON.parse(decodeURIComponent(value))\n } catch {\n return value\n }\n}\n\nfunction normalizeDataKey(key) {\n return key.replace(/[A-Z]/g, chr => `-${chr.toLowerCase()}`)\n}\n\nconst Manipulator = {\n setDataAttribute(element, key, value) {\n element.setAttribute(`data-bs-${normalizeDataKey(key)}`, value)\n },\n\n removeDataAttribute(element, key) {\n element.removeAttribute(`data-bs-${normalizeDataKey(key)}`)\n },\n\n getDataAttributes(element) {\n if (!element) {\n return {}\n }\n\n const attributes = {}\n const bsKeys = Object.keys(element.dataset).filter(key => key.startsWith('bs') && !key.startsWith('bsConfig'))\n\n for (const key of bsKeys) {\n let pureKey = key.replace(/^bs/, '')\n pureKey = pureKey.charAt(0).toLowerCase() + pureKey.slice(1, pureKey.length)\n attributes[pureKey] = normalizeData(element.dataset[key])\n }\n\n return attributes\n },\n\n getDataAttribute(element, key) {\n return normalizeData(element.getAttribute(`data-bs-${normalizeDataKey(key)}`))\n }\n}\n\nexport default Manipulator\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap util/config.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport Manipulator from '../dom/manipulator.js'\nimport { isElement, toType } from './index.js'\n\n/**\n * Class definition\n */\n\nclass Config {\n // Getters\n static get Default() {\n return {}\n }\n\n static get DefaultType() {\n return {}\n }\n\n static get NAME() {\n throw new Error('You have to implement the static method \"NAME\", for each component!')\n }\n\n _getConfig(config) {\n config = this._mergeConfigObj(config)\n config = this._configAfterMerge(config)\n this._typeCheckConfig(config)\n return config\n }\n\n _configAfterMerge(config) {\n return config\n }\n\n _mergeConfigObj(config, element) {\n const jsonConfig = isElement(element) ? Manipulator.getDataAttribute(element, 'config') : {} // try to parse\n\n return {\n ...this.constructor.Default,\n ...(typeof jsonConfig === 'object' ? jsonConfig : {}),\n ...(isElement(element) ? Manipulator.getDataAttributes(element) : {}),\n ...(typeof config === 'object' ? config : {})\n }\n }\n\n _typeCheckConfig(config, configTypes = this.constructor.DefaultType) {\n for (const [property, expectedTypes] of Object.entries(configTypes)) {\n const value = config[property]\n const valueType = isElement(value) ? 'element' : toType(value)\n\n if (!new RegExp(expectedTypes).test(valueType)) {\n throw new TypeError(\n `${this.constructor.NAME.toUpperCase()}: Option \"${property}\" provided type \"${valueType}\" but expected type \"${expectedTypes}\".`\n )\n }\n }\n }\n}\n\nexport default Config\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap base-component.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport Data from './dom/data.js'\nimport EventHandler from './dom/event-handler.js'\nimport Config from './util/config.js'\nimport { executeAfterTransition, getElement } from './util/index.js'\n\n/**\n * Constants\n */\n\nconst VERSION = '5.3.1'\n\n/**\n * Class definition\n */\n\nclass BaseComponent extends Config {\n constructor(element, config) {\n super()\n\n element = getElement(element)\n if (!element) {\n return\n }\n\n this._element = element\n this._config = this._getConfig(config)\n\n Data.set(this._element, this.constructor.DATA_KEY, this)\n }\n\n // Public\n dispose() {\n Data.remove(this._element, this.constructor.DATA_KEY)\n EventHandler.off(this._element, this.constructor.EVENT_KEY)\n\n for (const propertyName of Object.getOwnPropertyNames(this)) {\n this[propertyName] = null\n }\n }\n\n _queueCallback(callback, element, isAnimated = true) {\n executeAfterTransition(callback, element, isAnimated)\n }\n\n _getConfig(config) {\n config = this._mergeConfigObj(config, this._element)\n config = this._configAfterMerge(config)\n this._typeCheckConfig(config)\n return config\n }\n\n // Static\n static getInstance(element) {\n return Data.get(getElement(element), this.DATA_KEY)\n }\n\n static getOrCreateInstance(element, config = {}) {\n return this.getInstance(element) || new this(element, typeof config === 'object' ? config : null)\n }\n\n static get VERSION() {\n return VERSION\n }\n\n static get DATA_KEY() {\n return `bs.${this.NAME}`\n }\n\n static get EVENT_KEY() {\n return `.${this.DATA_KEY}`\n }\n\n static eventName(name) {\n return `${name}${this.EVENT_KEY}`\n }\n}\n\nexport default BaseComponent\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/selector-engine.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport { isDisabled, isVisible, parseSelector } from '../util/index.js'\n\nconst getSelector = element => {\n let selector = element.getAttribute('data-bs-target')\n\n if (!selector || selector === '#') {\n let hrefAttribute = element.getAttribute('href')\n\n // The only valid content that could double as a selector are IDs or classes,\n // so everything starting with `#` or `.`. If a \"real\" URL is used as the selector,\n // `document.querySelector` will rightfully complain it is invalid.\n // See https://github.com/twbs/bootstrap/issues/32273\n if (!hrefAttribute || (!hrefAttribute.includes('#') && !hrefAttribute.startsWith('.'))) {\n return null\n }\n\n // Just in case some CMS puts out a full URL with the anchor appended\n if (hrefAttribute.includes('#') && !hrefAttribute.startsWith('#')) {\n hrefAttribute = `#${hrefAttribute.split('#')[1]}`\n }\n\n selector = hrefAttribute && hrefAttribute !== '#' ? hrefAttribute.trim() : null\n }\n\n return parseSelector(selector)\n}\n\nconst SelectorEngine = {\n find(selector, element = document.documentElement) {\n return [].concat(...Element.prototype.querySelectorAll.call(element, selector))\n },\n\n findOne(selector, element = document.documentElement) {\n return Element.prototype.querySelector.call(element, selector)\n },\n\n children(element, selector) {\n return [].concat(...element.children).filter(child => child.matches(selector))\n },\n\n parents(element, selector) {\n const parents = []\n let ancestor = element.parentNode.closest(selector)\n\n while (ancestor) {\n parents.push(ancestor)\n ancestor = ancestor.parentNode.closest(selector)\n }\n\n return parents\n },\n\n prev(element, selector) {\n let previous = element.previousElementSibling\n\n while (previous) {\n if (previous.matches(selector)) {\n return [previous]\n }\n\n previous = previous.previousElementSibling\n }\n\n return []\n },\n // TODO: this is now unused; remove later along with prev()\n next(element, selector) {\n let next = element.nextElementSibling\n\n while (next) {\n if (next.matches(selector)) {\n return [next]\n }\n\n next = next.nextElementSibling\n }\n\n return []\n },\n\n focusableChildren(element) {\n const focusables = [\n 'a',\n 'button',\n 'input',\n 'textarea',\n 'select',\n 'details',\n '[tabindex]',\n '[contenteditable=\"true\"]'\n ].map(selector => `${selector}:not([tabindex^=\"-\"])`).join(',')\n\n return this.find(focusables, element).filter(el => !isDisabled(el) && isVisible(el))\n },\n\n getSelectorFromElement(element) {\n const selector = getSelector(element)\n\n if (selector) {\n return SelectorEngine.findOne(selector) ? selector : null\n }\n\n return null\n },\n\n getElementFromSelector(element) {\n const selector = getSelector(element)\n\n return selector ? SelectorEngine.findOne(selector) : null\n },\n\n getMultipleElementsFromSelector(element) {\n const selector = getSelector(element)\n\n return selector ? SelectorEngine.find(selector) : []\n }\n}\n\nexport default SelectorEngine\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap util/component-functions.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport EventHandler from '../dom/event-handler.js'\nimport SelectorEngine from '../dom/selector-engine.js'\nimport { isDisabled } from './index.js'\n\nconst enableDismissTrigger = (component, method = 'hide') => {\n const clickEvent = `click.dismiss${component.EVENT_KEY}`\n const name = component.NAME\n\n EventHandler.on(document, clickEvent, `[data-bs-dismiss=\"${name}\"]`, function (event) {\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault()\n }\n\n if (isDisabled(this)) {\n return\n }\n\n const target = SelectorEngine.getElementFromSelector(this) || this.closest(`.${name}`)\n const instance = component.getOrCreateInstance(target)\n\n // Method argument is left, for Alert and only, as it doesn't implement the 'hide' method\n instance[method]()\n })\n}\n\nexport {\n enableDismissTrigger\n}\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap alert.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport BaseComponent from './base-component.js'\nimport EventHandler from './dom/event-handler.js'\nimport { enableDismissTrigger } from './util/component-functions.js'\nimport { defineJQueryPlugin } from './util/index.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'alert'\nconst DATA_KEY = 'bs.alert'\nconst EVENT_KEY = `.${DATA_KEY}`\n\nconst EVENT_CLOSE = `close${EVENT_KEY}`\nconst EVENT_CLOSED = `closed${EVENT_KEY}`\nconst CLASS_NAME_FADE = 'fade'\nconst CLASS_NAME_SHOW = 'show'\n\n/**\n * Class definition\n */\n\nclass Alert extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME\n }\n\n // Public\n close() {\n const closeEvent = EventHandler.trigger(this._element, EVENT_CLOSE)\n\n if (closeEvent.defaultPrevented) {\n return\n }\n\n this._element.classList.remove(CLASS_NAME_SHOW)\n\n const isAnimated = this._element.classList.contains(CLASS_NAME_FADE)\n this._queueCallback(() => this._destroyElement(), this._element, isAnimated)\n }\n\n // Private\n _destroyElement() {\n this._element.remove()\n EventHandler.trigger(this._element, EVENT_CLOSED)\n this.dispose()\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Alert.getOrCreateInstance(this)\n\n if (typeof config !== 'string') {\n return\n }\n\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`)\n }\n\n data[config](this)\n })\n }\n}\n\n/**\n * Data API implementation\n */\n\nenableDismissTrigger(Alert, 'close')\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Alert)\n\nexport default Alert\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap button.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport BaseComponent from './base-component.js'\nimport EventHandler from './dom/event-handler.js'\nimport { defineJQueryPlugin } from './util/index.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'button'\nconst DATA_KEY = 'bs.button'\nconst EVENT_KEY = `.${DATA_KEY}`\nconst DATA_API_KEY = '.data-api'\n\nconst CLASS_NAME_ACTIVE = 'active'\nconst SELECTOR_DATA_TOGGLE = '[data-bs-toggle=\"button\"]'\nconst EVENT_CLICK_DATA_API = `click${EVENT_KEY}${DATA_API_KEY}`\n\n/**\n * Class definition\n */\n\nclass Button extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME\n }\n\n // Public\n toggle() {\n // Toggle class and sync the `aria-pressed` attribute with the return value of the `.toggle()` method\n this._element.setAttribute('aria-pressed', this._element.classList.toggle(CLASS_NAME_ACTIVE))\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Button.getOrCreateInstance(this)\n\n if (config === 'toggle') {\n data[config]()\n }\n })\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API, SELECTOR_DATA_TOGGLE, event => {\n event.preventDefault()\n\n const button = event.target.closest(SELECTOR_DATA_TOGGLE)\n const data = Button.getOrCreateInstance(button)\n\n data.toggle()\n})\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Button)\n\nexport default Button\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap util/swipe.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport EventHandler from '../dom/event-handler.js'\nimport Config from './config.js'\nimport { execute } from './index.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'swipe'\nconst EVENT_KEY = '.bs.swipe'\nconst EVENT_TOUCHSTART = `touchstart${EVENT_KEY}`\nconst EVENT_TOUCHMOVE = `touchmove${EVENT_KEY}`\nconst EVENT_TOUCHEND = `touchend${EVENT_KEY}`\nconst EVENT_POINTERDOWN = `pointerdown${EVENT_KEY}`\nconst EVENT_POINTERUP = `pointerup${EVENT_KEY}`\nconst POINTER_TYPE_TOUCH = 'touch'\nconst POINTER_TYPE_PEN = 'pen'\nconst CLASS_NAME_POINTER_EVENT = 'pointer-event'\nconst SWIPE_THRESHOLD = 40\n\nconst Default = {\n endCallback: null,\n leftCallback: null,\n rightCallback: null\n}\n\nconst DefaultType = {\n endCallback: '(function|null)',\n leftCallback: '(function|null)',\n rightCallback: '(function|null)'\n}\n\n/**\n * Class definition\n */\n\nclass Swipe extends Config {\n constructor(element, config) {\n super()\n this._element = element\n\n if (!element || !Swipe.isSupported()) {\n return\n }\n\n this._config = this._getConfig(config)\n this._deltaX = 0\n this._supportPointerEvents = Boolean(window.PointerEvent)\n this._initEvents()\n }\n\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Public\n dispose() {\n EventHandler.off(this._element, EVENT_KEY)\n }\n\n // Private\n _start(event) {\n if (!this._supportPointerEvents) {\n this._deltaX = event.touches[0].clientX\n\n return\n }\n\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX\n }\n }\n\n _end(event) {\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX - this._deltaX\n }\n\n this._handleSwipe()\n execute(this._config.endCallback)\n }\n\n _move(event) {\n this._deltaX = event.touches && event.touches.length > 1 ?\n 0 :\n event.touches[0].clientX - this._deltaX\n }\n\n _handleSwipe() {\n const absDeltaX = Math.abs(this._deltaX)\n\n if (absDeltaX <= SWIPE_THRESHOLD) {\n return\n }\n\n const direction = absDeltaX / this._deltaX\n\n this._deltaX = 0\n\n if (!direction) {\n return\n }\n\n execute(direction > 0 ? this._config.rightCallback : this._config.leftCallback)\n }\n\n _initEvents() {\n if (this._supportPointerEvents) {\n EventHandler.on(this._element, EVENT_POINTERDOWN, event => this._start(event))\n EventHandler.on(this._element, EVENT_POINTERUP, event => this._end(event))\n\n this._element.classList.add(CLASS_NAME_POINTER_EVENT)\n } else {\n EventHandler.on(this._element, EVENT_TOUCHSTART, event => this._start(event))\n EventHandler.on(this._element, EVENT_TOUCHMOVE, event => this._move(event))\n EventHandler.on(this._element, EVENT_TOUCHEND, event => this._end(event))\n }\n }\n\n _eventIsPointerPenTouch(event) {\n return this._supportPointerEvents && (event.pointerType === POINTER_TYPE_PEN || event.pointerType === POINTER_TYPE_TOUCH)\n }\n\n // Static\n static isSupported() {\n return 'ontouchstart' in document.documentElement || navigator.maxTouchPoints > 0\n }\n}\n\nexport default Swipe\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap carousel.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport BaseComponent from './base-component.js'\nimport EventHandler from './dom/event-handler.js'\nimport Manipulator from './dom/manipulator.js'\nimport SelectorEngine from './dom/selector-engine.js'\nimport {\n defineJQueryPlugin,\n getNextActiveElement,\n isRTL,\n isVisible,\n reflow,\n triggerTransitionEnd\n} from './util/index.js'\nimport Swipe from './util/swipe.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'carousel'\nconst DATA_KEY = 'bs.carousel'\nconst EVENT_KEY = `.${DATA_KEY}`\nconst DATA_API_KEY = '.data-api'\n\nconst ARROW_LEFT_KEY = 'ArrowLeft'\nconst ARROW_RIGHT_KEY = 'ArrowRight'\nconst TOUCHEVENT_COMPAT_WAIT = 500 // Time for mouse compat events to fire after touch\n\nconst ORDER_NEXT = 'next'\nconst ORDER_PREV = 'prev'\nconst DIRECTION_LEFT = 'left'\nconst DIRECTION_RIGHT = 'right'\n\nconst EVENT_SLIDE = `slide${EVENT_KEY}`\nconst EVENT_SLID = `slid${EVENT_KEY}`\nconst EVENT_KEYDOWN = `keydown${EVENT_KEY}`\nconst EVENT_MOUSEENTER = `mouseenter${EVENT_KEY}`\nconst EVENT_MOUSELEAVE = `mouseleave${EVENT_KEY}`\nconst EVENT_DRAG_START = `dragstart${EVENT_KEY}`\nconst EVENT_LOAD_DATA_API = `load${EVENT_KEY}${DATA_API_KEY}`\nconst EVENT_CLICK_DATA_API = `click${EVENT_KEY}${DATA_API_KEY}`\n\nconst CLASS_NAME_CAROUSEL = 'carousel'\nconst CLASS_NAME_ACTIVE = 'active'\nconst CLASS_NAME_SLIDE = 'slide'\nconst CLASS_NAME_END = 'carousel-item-end'\nconst CLASS_NAME_START = 'carousel-item-start'\nconst CLASS_NAME_NEXT = 'carousel-item-next'\nconst CLASS_NAME_PREV = 'carousel-item-prev'\n\nconst SELECTOR_ACTIVE = '.active'\nconst SELECTOR_ITEM = '.carousel-item'\nconst SELECTOR_ACTIVE_ITEM = SELECTOR_ACTIVE + SELECTOR_ITEM\nconst SELECTOR_ITEM_IMG = '.carousel-item img'\nconst SELECTOR_INDICATORS = '.carousel-indicators'\nconst SELECTOR_DATA_SLIDE = '[data-bs-slide], [data-bs-slide-to]'\nconst SELECTOR_DATA_RIDE = '[data-bs-ride=\"carousel\"]'\n\nconst KEY_TO_DIRECTION = {\n [ARROW_LEFT_KEY]: DIRECTION_RIGHT,\n [ARROW_RIGHT_KEY]: DIRECTION_LEFT\n}\n\nconst Default = {\n interval: 5000,\n keyboard: true,\n pause: 'hover',\n ride: false,\n touch: true,\n wrap: true\n}\n\nconst DefaultType = {\n interval: '(number|boolean)', // TODO:v6 remove boolean support\n keyboard: 'boolean',\n pause: '(string|boolean)',\n ride: '(boolean|string)',\n touch: 'boolean',\n wrap: 'boolean'\n}\n\n/**\n * Class definition\n */\n\nclass Carousel extends BaseComponent {\n constructor(element, config) {\n super(element, config)\n\n this._interval = null\n this._activeElement = null\n this._isSliding = false\n this.touchTimeout = null\n this._swipeHelper = null\n\n this._indicatorsElement = SelectorEngine.findOne(SELECTOR_INDICATORS, this._element)\n this._addEventListeners()\n\n if (this._config.ride === CLASS_NAME_CAROUSEL) {\n this.cycle()\n }\n }\n\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Public\n next() {\n this._slide(ORDER_NEXT)\n }\n\n nextWhenVisible() {\n // FIXME TODO use `document.visibilityState`\n // Don't call next when the page isn't visible\n // or the carousel or its parent isn't visible\n if (!document.hidden && isVisible(this._element)) {\n this.next()\n }\n }\n\n prev() {\n this._slide(ORDER_PREV)\n }\n\n pause() {\n if (this._isSliding) {\n triggerTransitionEnd(this._element)\n }\n\n this._clearInterval()\n }\n\n cycle() {\n this._clearInterval()\n this._updateInterval()\n\n this._interval = setInterval(() => this.nextWhenVisible(), this._config.interval)\n }\n\n _maybeEnableCycle() {\n if (!this._config.ride) {\n return\n }\n\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.cycle())\n return\n }\n\n this.cycle()\n }\n\n to(index) {\n const items = this._getItems()\n if (index > items.length - 1 || index < 0) {\n return\n }\n\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.to(index))\n return\n }\n\n const activeIndex = this._getItemIndex(this._getActive())\n if (activeIndex === index) {\n return\n }\n\n const order = index > activeIndex ? ORDER_NEXT : ORDER_PREV\n\n this._slide(order, items[index])\n }\n\n dispose() {\n if (this._swipeHelper) {\n this._swipeHelper.dispose()\n }\n\n super.dispose()\n }\n\n // Private\n _configAfterMerge(config) {\n config.defaultInterval = config.interval\n return config\n }\n\n _addEventListeners() {\n if (this._config.keyboard) {\n EventHandler.on(this._element, EVENT_KEYDOWN, event => this._keydown(event))\n }\n\n if (this._config.pause === 'hover') {\n EventHandler.on(this._element, EVENT_MOUSEENTER, () => this.pause())\n EventHandler.on(this._element, EVENT_MOUSELEAVE, () => this._maybeEnableCycle())\n }\n\n if (this._config.touch && Swipe.isSupported()) {\n this._addTouchEventListeners()\n }\n }\n\n _addTouchEventListeners() {\n for (const img of SelectorEngine.find(SELECTOR_ITEM_IMG, this._element)) {\n EventHandler.on(img, EVENT_DRAG_START, event => event.preventDefault())\n }\n\n const endCallBack = () => {\n if (this._config.pause !== 'hover') {\n return\n }\n\n // If it's a touch-enabled device, mouseenter/leave are fired as\n // part of the mouse compatibility events on first tap - the carousel\n // would stop cycling until user tapped out of it;\n // here, we listen for touchend, explicitly pause the carousel\n // (as if it's the second time we tap on it, mouseenter compat event\n // is NOT fired) and after a timeout (to allow for mouse compatibility\n // events to fire) we explicitly restart cycling\n\n this.pause()\n if (this.touchTimeout) {\n clearTimeout(this.touchTimeout)\n }\n\n this.touchTimeout = setTimeout(() => this._maybeEnableCycle(), TOUCHEVENT_COMPAT_WAIT + this._config.interval)\n }\n\n const swipeConfig = {\n leftCallback: () => this._slide(this._directionToOrder(DIRECTION_LEFT)),\n rightCallback: () => this._slide(this._directionToOrder(DIRECTION_RIGHT)),\n endCallback: endCallBack\n }\n\n this._swipeHelper = new Swipe(this._element, swipeConfig)\n }\n\n _keydown(event) {\n if (/input|textarea/i.test(event.target.tagName)) {\n return\n }\n\n const direction = KEY_TO_DIRECTION[event.key]\n if (direction) {\n event.preventDefault()\n this._slide(this._directionToOrder(direction))\n }\n }\n\n _getItemIndex(element) {\n return this._getItems().indexOf(element)\n }\n\n _setActiveIndicatorElement(index) {\n if (!this._indicatorsElement) {\n return\n }\n\n const activeIndicator = SelectorEngine.findOne(SELECTOR_ACTIVE, this._indicatorsElement)\n\n activeIndicator.classList.remove(CLASS_NAME_ACTIVE)\n activeIndicator.removeAttribute('aria-current')\n\n const newActiveIndicator = SelectorEngine.findOne(`[data-bs-slide-to=\"${index}\"]`, this._indicatorsElement)\n\n if (newActiveIndicator) {\n newActiveIndicator.classList.add(CLASS_NAME_ACTIVE)\n newActiveIndicator.setAttribute('aria-current', 'true')\n }\n }\n\n _updateInterval() {\n const element = this._activeElement || this._getActive()\n\n if (!element) {\n return\n }\n\n const elementInterval = Number.parseInt(element.getAttribute('data-bs-interval'), 10)\n\n this._config.interval = elementInterval || this._config.defaultInterval\n }\n\n _slide(order, element = null) {\n if (this._isSliding) {\n return\n }\n\n const activeElement = this._getActive()\n const isNext = order === ORDER_NEXT\n const nextElement = element || getNextActiveElement(this._getItems(), activeElement, isNext, this._config.wrap)\n\n if (nextElement === activeElement) {\n return\n }\n\n const nextElementIndex = this._getItemIndex(nextElement)\n\n const triggerEvent = eventName => {\n return EventHandler.trigger(this._element, eventName, {\n relatedTarget: nextElement,\n direction: this._orderToDirection(order),\n from: this._getItemIndex(activeElement),\n to: nextElementIndex\n })\n }\n\n const slideEvent = triggerEvent(EVENT_SLIDE)\n\n if (slideEvent.defaultPrevented) {\n return\n }\n\n if (!activeElement || !nextElement) {\n // Some weirdness is happening, so we bail\n // TODO: change tests that use empty divs to avoid this check\n return\n }\n\n const isCycling = Boolean(this._interval)\n this.pause()\n\n this._isSliding = true\n\n this._setActiveIndicatorElement(nextElementIndex)\n this._activeElement = nextElement\n\n const directionalClassName = isNext ? CLASS_NAME_START : CLASS_NAME_END\n const orderClassName = isNext ? CLASS_NAME_NEXT : CLASS_NAME_PREV\n\n nextElement.classList.add(orderClassName)\n\n reflow(nextElement)\n\n activeElement.classList.add(directionalClassName)\n nextElement.classList.add(directionalClassName)\n\n const completeCallBack = () => {\n nextElement.classList.remove(directionalClassName, orderClassName)\n nextElement.classList.add(CLASS_NAME_ACTIVE)\n\n activeElement.classList.remove(CLASS_NAME_ACTIVE, orderClassName, directionalClassName)\n\n this._isSliding = false\n\n triggerEvent(EVENT_SLID)\n }\n\n this._queueCallback(completeCallBack, activeElement, this._isAnimated())\n\n if (isCycling) {\n this.cycle()\n }\n }\n\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_SLIDE)\n }\n\n _getActive() {\n return SelectorEngine.findOne(SELECTOR_ACTIVE_ITEM, this._element)\n }\n\n _getItems() {\n return SelectorEngine.find(SELECTOR_ITEM, this._element)\n }\n\n _clearInterval() {\n if (this._interval) {\n clearInterval(this._interval)\n this._interval = null\n }\n }\n\n _directionToOrder(direction) {\n if (isRTL()) {\n return direction === DIRECTION_LEFT ? ORDER_PREV : ORDER_NEXT\n }\n\n return direction === DIRECTION_LEFT ? ORDER_NEXT : ORDER_PREV\n }\n\n _orderToDirection(order) {\n if (isRTL()) {\n return order === ORDER_PREV ? DIRECTION_LEFT : DIRECTION_RIGHT\n }\n\n return order === ORDER_PREV ? DIRECTION_RIGHT : DIRECTION_LEFT\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Carousel.getOrCreateInstance(this, config)\n\n if (typeof config === 'number') {\n data.to(config)\n return\n }\n\n if (typeof config === 'string') {\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`)\n }\n\n data[config]()\n }\n })\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API, SELECTOR_DATA_SLIDE, function (event) {\n const target = SelectorEngine.getElementFromSelector(this)\n\n if (!target || !target.classList.contains(CLASS_NAME_CAROUSEL)) {\n return\n }\n\n event.preventDefault()\n\n const carousel = Carousel.getOrCreateInstance(target)\n const slideIndex = this.getAttribute('data-bs-slide-to')\n\n if (slideIndex) {\n carousel.to(slideIndex)\n carousel._maybeEnableCycle()\n return\n }\n\n if (Manipulator.getDataAttribute(this, 'slide') === 'next') {\n carousel.next()\n carousel._maybeEnableCycle()\n return\n }\n\n carousel.prev()\n carousel._maybeEnableCycle()\n})\n\nEventHandler.on(window, EVENT_LOAD_DATA_API, () => {\n const carousels = SelectorEngine.find(SELECTOR_DATA_RIDE)\n\n for (const carousel of carousels) {\n Carousel.getOrCreateInstance(carousel)\n }\n})\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Carousel)\n\nexport default Carousel\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap collapse.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport BaseComponent from './base-component.js'\nimport EventHandler from './dom/event-handler.js'\nimport SelectorEngine from './dom/selector-engine.js'\nimport {\n defineJQueryPlugin,\n getElement,\n reflow\n} from './util/index.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'collapse'\nconst DATA_KEY = 'bs.collapse'\nconst EVENT_KEY = `.${DATA_KEY}`\nconst DATA_API_KEY = '.data-api'\n\nconst EVENT_SHOW = `show${EVENT_KEY}`\nconst EVENT_SHOWN = `shown${EVENT_KEY}`\nconst EVENT_HIDE = `hide${EVENT_KEY}`\nconst EVENT_HIDDEN = `hidden${EVENT_KEY}`\nconst EVENT_CLICK_DATA_API = `click${EVENT_KEY}${DATA_API_KEY}`\n\nconst CLASS_NAME_SHOW = 'show'\nconst CLASS_NAME_COLLAPSE = 'collapse'\nconst CLASS_NAME_COLLAPSING = 'collapsing'\nconst CLASS_NAME_COLLAPSED = 'collapsed'\nconst CLASS_NAME_DEEPER_CHILDREN = `:scope .${CLASS_NAME_COLLAPSE} .${CLASS_NAME_COLLAPSE}`\nconst CLASS_NAME_HORIZONTAL = 'collapse-horizontal'\n\nconst WIDTH = 'width'\nconst HEIGHT = 'height'\n\nconst SELECTOR_ACTIVES = '.collapse.show, .collapse.collapsing'\nconst SELECTOR_DATA_TOGGLE = '[data-bs-toggle=\"collapse\"]'\n\nconst Default = {\n parent: null,\n toggle: true\n}\n\nconst DefaultType = {\n parent: '(null|element)',\n toggle: 'boolean'\n}\n\n/**\n * Class definition\n */\n\nclass Collapse extends BaseComponent {\n constructor(element, config) {\n super(element, config)\n\n this._isTransitioning = false\n this._triggerArray = []\n\n const toggleList = SelectorEngine.find(SELECTOR_DATA_TOGGLE)\n\n for (const elem of toggleList) {\n const selector = SelectorEngine.getSelectorFromElement(elem)\n const filterElement = SelectorEngine.find(selector)\n .filter(foundElement => foundElement === this._element)\n\n if (selector !== null && filterElement.length) {\n this._triggerArray.push(elem)\n }\n }\n\n this._initializeChildren()\n\n if (!this._config.parent) {\n this._addAriaAndCollapsedClass(this._triggerArray, this._isShown())\n }\n\n if (this._config.toggle) {\n this.toggle()\n }\n }\n\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Public\n toggle() {\n if (this._isShown()) {\n this.hide()\n } else {\n this.show()\n }\n }\n\n show() {\n if (this._isTransitioning || this._isShown()) {\n return\n }\n\n let activeChildren = []\n\n // find active children\n if (this._config.parent) {\n activeChildren = this._getFirstLevelChildren(SELECTOR_ACTIVES)\n .filter(element => element !== this._element)\n .map(element => Collapse.getOrCreateInstance(element, { toggle: false }))\n }\n\n if (activeChildren.length && activeChildren[0]._isTransitioning) {\n return\n }\n\n const startEvent = EventHandler.trigger(this._element, EVENT_SHOW)\n if (startEvent.defaultPrevented) {\n return\n }\n\n for (const activeInstance of activeChildren) {\n activeInstance.hide()\n }\n\n const dimension = this._getDimension()\n\n this._element.classList.remove(CLASS_NAME_COLLAPSE)\n this._element.classList.add(CLASS_NAME_COLLAPSING)\n\n this._element.style[dimension] = 0\n\n this._addAriaAndCollapsedClass(this._triggerArray, true)\n this._isTransitioning = true\n\n const complete = () => {\n this._isTransitioning = false\n\n this._element.classList.remove(CLASS_NAME_COLLAPSING)\n this._element.classList.add(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW)\n\n this._element.style[dimension] = ''\n\n EventHandler.trigger(this._element, EVENT_SHOWN)\n }\n\n const capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1)\n const scrollSize = `scroll${capitalizedDimension}`\n\n this._queueCallback(complete, this._element, true)\n this._element.style[dimension] = `${this._element[scrollSize]}px`\n }\n\n hide() {\n if (this._isTransitioning || !this._isShown()) {\n return\n }\n\n const startEvent = EventHandler.trigger(this._element, EVENT_HIDE)\n if (startEvent.defaultPrevented) {\n return\n }\n\n const dimension = this._getDimension()\n\n this._element.style[dimension] = `${this._element.getBoundingClientRect()[dimension]}px`\n\n reflow(this._element)\n\n this._element.classList.add(CLASS_NAME_COLLAPSING)\n this._element.classList.remove(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW)\n\n for (const trigger of this._triggerArray) {\n const element = SelectorEngine.getElementFromSelector(trigger)\n\n if (element && !this._isShown(element)) {\n this._addAriaAndCollapsedClass([trigger], false)\n }\n }\n\n this._isTransitioning = true\n\n const complete = () => {\n this._isTransitioning = false\n this._element.classList.remove(CLASS_NAME_COLLAPSING)\n this._element.classList.add(CLASS_NAME_COLLAPSE)\n EventHandler.trigger(this._element, EVENT_HIDDEN)\n }\n\n this._element.style[dimension] = ''\n\n this._queueCallback(complete, this._element, true)\n }\n\n _isShown(element = this._element) {\n return element.classList.contains(CLASS_NAME_SHOW)\n }\n\n // Private\n _configAfterMerge(config) {\n config.toggle = Boolean(config.toggle) // Coerce string values\n config.parent = getElement(config.parent)\n return config\n }\n\n _getDimension() {\n return this._element.classList.contains(CLASS_NAME_HORIZONTAL) ? WIDTH : HEIGHT\n }\n\n _initializeChildren() {\n if (!this._config.parent) {\n return\n }\n\n const children = this._getFirstLevelChildren(SELECTOR_DATA_TOGGLE)\n\n for (const element of children) {\n const selected = SelectorEngine.getElementFromSelector(element)\n\n if (selected) {\n this._addAriaAndCollapsedClass([element], this._isShown(selected))\n }\n }\n }\n\n _getFirstLevelChildren(selector) {\n const children = SelectorEngine.find(CLASS_NAME_DEEPER_CHILDREN, this._config.parent)\n // remove children if greater depth\n return SelectorEngine.find(selector, this._config.parent).filter(element => !children.includes(element))\n }\n\n _addAriaAndCollapsedClass(triggerArray, isOpen) {\n if (!triggerArray.length) {\n return\n }\n\n for (const element of triggerArray) {\n element.classList.toggle(CLASS_NAME_COLLAPSED, !isOpen)\n element.setAttribute('aria-expanded', isOpen)\n }\n }\n\n // Static\n static jQueryInterface(config) {\n const _config = {}\n if (typeof config === 'string' && /show|hide/.test(config)) {\n _config.toggle = false\n }\n\n return this.each(function () {\n const data = Collapse.getOrCreateInstance(this, _config)\n\n if (typeof config === 'string') {\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`)\n }\n\n data[config]()\n }\n })\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API, SELECTOR_DATA_TOGGLE, function (event) {\n // preventDefault only for elements (which change the URL) not inside the collapsible element\n if (event.target.tagName === 'A' || (event.delegateTarget && event.delegateTarget.tagName === 'A')) {\n event.preventDefault()\n }\n\n for (const element of SelectorEngine.getMultipleElementsFromSelector(this)) {\n Collapse.getOrCreateInstance(element, { toggle: false }).toggle()\n }\n})\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Collapse)\n\nexport default Collapse\n","export var top = 'top';\nexport var bottom = 'bottom';\nexport var right = 'right';\nexport var left = 'left';\nexport var auto = 'auto';\nexport var basePlacements = [top, bottom, right, left];\nexport var start = 'start';\nexport var end = 'end';\nexport var clippingParents = 'clippingParents';\nexport var viewport = 'viewport';\nexport var popper = 'popper';\nexport var reference = 'reference';\nexport var variationPlacements = /*#__PURE__*/basePlacements.reduce(function (acc, placement) {\n return acc.concat([placement + \"-\" + start, placement + \"-\" + end]);\n}, []);\nexport var placements = /*#__PURE__*/[].concat(basePlacements, [auto]).reduce(function (acc, placement) {\n return acc.concat([placement, placement + \"-\" + start, placement + \"-\" + end]);\n}, []); // modifiers that need to read the DOM\n\nexport var beforeRead = 'beforeRead';\nexport var read = 'read';\nexport var afterRead = 'afterRead'; // pure-logic modifiers\n\nexport var beforeMain = 'beforeMain';\nexport var main = 'main';\nexport var afterMain = 'afterMain'; // modifier with the purpose to write to the DOM (or write into a framework state)\n\nexport var beforeWrite = 'beforeWrite';\nexport var write = 'write';\nexport var afterWrite = 'afterWrite';\nexport var modifierPhases = [beforeRead, read, afterRead, beforeMain, main, afterMain, beforeWrite, write, afterWrite];","export default function getNodeName(element) {\n return element ? (element.nodeName || '').toLowerCase() : null;\n}","export default function getWindow(node) {\n if (node == null) {\n return window;\n }\n\n if (node.toString() !== '[object Window]') {\n var ownerDocument = node.ownerDocument;\n return ownerDocument ? ownerDocument.defaultView || window : window;\n }\n\n return node;\n}","import getWindow from \"./getWindow.js\";\n\nfunction isElement(node) {\n var OwnElement = getWindow(node).Element;\n return node instanceof OwnElement || node instanceof Element;\n}\n\nfunction isHTMLElement(node) {\n var OwnElement = getWindow(node).HTMLElement;\n return node instanceof OwnElement || node instanceof HTMLElement;\n}\n\nfunction isShadowRoot(node) {\n // IE 11 has no ShadowRoot\n if (typeof ShadowRoot === 'undefined') {\n return false;\n }\n\n var OwnElement = getWindow(node).ShadowRoot;\n return node instanceof OwnElement || node instanceof ShadowRoot;\n}\n\nexport { isElement, isHTMLElement, isShadowRoot };","import getNodeName from \"../dom-utils/getNodeName.js\";\nimport { isHTMLElement } from \"../dom-utils/instanceOf.js\"; // This modifier takes the styles prepared by the `computeStyles` modifier\n// and applies them to the HTMLElements such as popper and arrow\n\nfunction applyStyles(_ref) {\n var state = _ref.state;\n Object.keys(state.elements).forEach(function (name) {\n var style = state.styles[name] || {};\n var attributes = state.attributes[name] || {};\n var element = state.elements[name]; // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n } // Flow doesn't support to extend this property, but it's the most\n // effective way to apply styles to an HTMLElement\n // $FlowFixMe[cannot-write]\n\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (name) {\n var value = attributes[name];\n\n if (value === false) {\n element.removeAttribute(name);\n } else {\n element.setAttribute(name, value === true ? '' : value);\n }\n });\n });\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state;\n var initialStyles = {\n popper: {\n position: state.options.strategy,\n left: '0',\n top: '0',\n margin: '0'\n },\n arrow: {\n position: 'absolute'\n },\n reference: {}\n };\n Object.assign(state.elements.popper.style, initialStyles.popper);\n state.styles = initialStyles;\n\n if (state.elements.arrow) {\n Object.assign(state.elements.arrow.style, initialStyles.arrow);\n }\n\n return function () {\n Object.keys(state.elements).forEach(function (name) {\n var element = state.elements[name];\n var attributes = state.attributes[name] || {};\n var styleProperties = Object.keys(state.styles.hasOwnProperty(name) ? state.styles[name] : initialStyles[name]); // Set all values to an empty string to unset them\n\n var style = styleProperties.reduce(function (style, property) {\n style[property] = '';\n return style;\n }, {}); // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n }\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (attribute) {\n element.removeAttribute(attribute);\n });\n });\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'applyStyles',\n enabled: true,\n phase: 'write',\n fn: applyStyles,\n effect: effect,\n requires: ['computeStyles']\n};","import { auto } from \"../enums.js\";\nexport default function getBasePlacement(placement) {\n return placement.split('-')[0];\n}","export var max = Math.max;\nexport var min = Math.min;\nexport var round = Math.round;","export default function getUAString() {\n var uaData = navigator.userAgentData;\n\n if (uaData != null && uaData.brands && Array.isArray(uaData.brands)) {\n return uaData.brands.map(function (item) {\n return item.brand + \"/\" + item.version;\n }).join(' ');\n }\n\n return navigator.userAgent;\n}","import getUAString from \"../utils/userAgent.js\";\nexport default function isLayoutViewport() {\n return !/^((?!chrome|android).)*safari/i.test(getUAString());\n}","import { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport { round } from \"../utils/math.js\";\nimport getWindow from \"./getWindow.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getBoundingClientRect(element, includeScale, isFixedStrategy) {\n if (includeScale === void 0) {\n includeScale = false;\n }\n\n if (isFixedStrategy === void 0) {\n isFixedStrategy = false;\n }\n\n var clientRect = element.getBoundingClientRect();\n var scaleX = 1;\n var scaleY = 1;\n\n if (includeScale && isHTMLElement(element)) {\n scaleX = element.offsetWidth > 0 ? round(clientRect.width) / element.offsetWidth || 1 : 1;\n scaleY = element.offsetHeight > 0 ? round(clientRect.height) / element.offsetHeight || 1 : 1;\n }\n\n var _ref = isElement(element) ? getWindow(element) : window,\n visualViewport = _ref.visualViewport;\n\n var addVisualOffsets = !isLayoutViewport() && isFixedStrategy;\n var x = (clientRect.left + (addVisualOffsets && visualViewport ? visualViewport.offsetLeft : 0)) / scaleX;\n var y = (clientRect.top + (addVisualOffsets && visualViewport ? visualViewport.offsetTop : 0)) / scaleY;\n var width = clientRect.width / scaleX;\n var height = clientRect.height / scaleY;\n return {\n width: width,\n height: height,\n top: y,\n right: x + width,\n bottom: y + height,\n left: x,\n x: x,\n y: y\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\"; // Returns the layout rect of an element relative to its offsetParent. Layout\n// means it doesn't take into account transforms.\n\nexport default function getLayoutRect(element) {\n var clientRect = getBoundingClientRect(element); // Use the clientRect sizes if it's not been transformed.\n // Fixes https://github.com/popperjs/popper-core/issues/1223\n\n var width = element.offsetWidth;\n var height = element.offsetHeight;\n\n if (Math.abs(clientRect.width - width) <= 1) {\n width = clientRect.width;\n }\n\n if (Math.abs(clientRect.height - height) <= 1) {\n height = clientRect.height;\n }\n\n return {\n x: element.offsetLeft,\n y: element.offsetTop,\n width: width,\n height: height\n };\n}","import { isShadowRoot } from \"./instanceOf.js\";\nexport default function contains(parent, child) {\n var rootNode = child.getRootNode && child.getRootNode(); // First, attempt with faster native method\n\n if (parent.contains(child)) {\n return true;\n } // then fallback to custom implementation with Shadow DOM support\n else if (rootNode && isShadowRoot(rootNode)) {\n var next = child;\n\n do {\n if (next && parent.isSameNode(next)) {\n return true;\n } // $FlowFixMe[prop-missing]: need a better way to handle this...\n\n\n next = next.parentNode || next.host;\n } while (next);\n } // Give up, the result is false\n\n\n return false;\n}","import getWindow from \"./getWindow.js\";\nexport default function getComputedStyle(element) {\n return getWindow(element).getComputedStyle(element);\n}","import getNodeName from \"./getNodeName.js\";\nexport default function isTableElement(element) {\n return ['table', 'td', 'th'].indexOf(getNodeName(element)) >= 0;\n}","import { isElement } from \"./instanceOf.js\";\nexport default function getDocumentElement(element) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return ((isElement(element) ? element.ownerDocument : // $FlowFixMe[prop-missing]\n element.document) || window.document).documentElement;\n}","import getNodeName from \"./getNodeName.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport { isShadowRoot } from \"./instanceOf.js\";\nexport default function getParentNode(element) {\n if (getNodeName(element) === 'html') {\n return element;\n }\n\n return (// this is a quicker (but less type safe) way to save quite some bytes from the bundle\n // $FlowFixMe[incompatible-return]\n // $FlowFixMe[prop-missing]\n element.assignedSlot || // step into the shadow DOM of the parent of a slotted node\n element.parentNode || ( // DOM Element detected\n isShadowRoot(element) ? element.host : null) || // ShadowRoot detected\n // $FlowFixMe[incompatible-call]: HTMLElement is a Node\n getDocumentElement(element) // fallback\n\n );\n}","import getWindow from \"./getWindow.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isHTMLElement, isShadowRoot } from \"./instanceOf.js\";\nimport isTableElement from \"./isTableElement.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getUAString from \"../utils/userAgent.js\";\n\nfunction getTrueOffsetParent(element) {\n if (!isHTMLElement(element) || // https://github.com/popperjs/popper-core/issues/837\n getComputedStyle(element).position === 'fixed') {\n return null;\n }\n\n return element.offsetParent;\n} // `.offsetParent` reports `null` for fixed elements, while absolute elements\n// return the containing block\n\n\nfunction getContainingBlock(element) {\n var isFirefox = /firefox/i.test(getUAString());\n var isIE = /Trident/i.test(getUAString());\n\n if (isIE && isHTMLElement(element)) {\n // In IE 9, 10 and 11 fixed elements containing block is always established by the viewport\n var elementCss = getComputedStyle(element);\n\n if (elementCss.position === 'fixed') {\n return null;\n }\n }\n\n var currentNode = getParentNode(element);\n\n if (isShadowRoot(currentNode)) {\n currentNode = currentNode.host;\n }\n\n while (isHTMLElement(currentNode) && ['html', 'body'].indexOf(getNodeName(currentNode)) < 0) {\n var css = getComputedStyle(currentNode); // This is non-exhaustive but covers the most common CSS properties that\n // create a containing block.\n // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block\n\n if (css.transform !== 'none' || css.perspective !== 'none' || css.contain === 'paint' || ['transform', 'perspective'].indexOf(css.willChange) !== -1 || isFirefox && css.willChange === 'filter' || isFirefox && css.filter && css.filter !== 'none') {\n return currentNode;\n } else {\n currentNode = currentNode.parentNode;\n }\n }\n\n return null;\n} // Gets the closest ancestor positioned element. Handles some edge cases,\n// such as table ancestors and cross browser bugs.\n\n\nexport default function getOffsetParent(element) {\n var window = getWindow(element);\n var offsetParent = getTrueOffsetParent(element);\n\n while (offsetParent && isTableElement(offsetParent) && getComputedStyle(offsetParent).position === 'static') {\n offsetParent = getTrueOffsetParent(offsetParent);\n }\n\n if (offsetParent && (getNodeName(offsetParent) === 'html' || getNodeName(offsetParent) === 'body' && getComputedStyle(offsetParent).position === 'static')) {\n return window;\n }\n\n return offsetParent || getContainingBlock(element) || window;\n}","export default function getMainAxisFromPlacement(placement) {\n return ['top', 'bottom'].indexOf(placement) >= 0 ? 'x' : 'y';\n}","import { max as mathMax, min as mathMin } from \"./math.js\";\nexport function within(min, value, max) {\n return mathMax(min, mathMin(value, max));\n}\nexport function withinMaxClamp(min, value, max) {\n var v = within(min, value, max);\n return v > max ? max : v;\n}","import getFreshSideObject from \"./getFreshSideObject.js\";\nexport default function mergePaddingObject(paddingObject) {\n return Object.assign({}, getFreshSideObject(), paddingObject);\n}","export default function getFreshSideObject() {\n return {\n top: 0,\n right: 0,\n bottom: 0,\n left: 0\n };\n}","export default function expandToHashMap(value, keys) {\n return keys.reduce(function (hashMap, key) {\n hashMap[key] = value;\n return hashMap;\n }, {});\n}","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport contains from \"../dom-utils/contains.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport { within } from \"../utils/within.js\";\nimport mergePaddingObject from \"../utils/mergePaddingObject.js\";\nimport expandToHashMap from \"../utils/expandToHashMap.js\";\nimport { left, right, basePlacements, top, bottom } from \"../enums.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar toPaddingObject = function toPaddingObject(padding, state) {\n padding = typeof padding === 'function' ? padding(Object.assign({}, state.rects, {\n placement: state.placement\n })) : padding;\n return mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n};\n\nfunction arrow(_ref) {\n var _state$modifiersData$;\n\n var state = _ref.state,\n name = _ref.name,\n options = _ref.options;\n var arrowElement = state.elements.arrow;\n var popperOffsets = state.modifiersData.popperOffsets;\n var basePlacement = getBasePlacement(state.placement);\n var axis = getMainAxisFromPlacement(basePlacement);\n var isVertical = [left, right].indexOf(basePlacement) >= 0;\n var len = isVertical ? 'height' : 'width';\n\n if (!arrowElement || !popperOffsets) {\n return;\n }\n\n var paddingObject = toPaddingObject(options.padding, state);\n var arrowRect = getLayoutRect(arrowElement);\n var minProp = axis === 'y' ? top : left;\n var maxProp = axis === 'y' ? bottom : right;\n var endDiff = state.rects.reference[len] + state.rects.reference[axis] - popperOffsets[axis] - state.rects.popper[len];\n var startDiff = popperOffsets[axis] - state.rects.reference[axis];\n var arrowOffsetParent = getOffsetParent(arrowElement);\n var clientSize = arrowOffsetParent ? axis === 'y' ? arrowOffsetParent.clientHeight || 0 : arrowOffsetParent.clientWidth || 0 : 0;\n var centerToReference = endDiff / 2 - startDiff / 2; // Make sure the arrow doesn't overflow the popper if the center point is\n // outside of the popper bounds\n\n var min = paddingObject[minProp];\n var max = clientSize - arrowRect[len] - paddingObject[maxProp];\n var center = clientSize / 2 - arrowRect[len] / 2 + centerToReference;\n var offset = within(min, center, max); // Prevents breaking syntax highlighting...\n\n var axisProp = axis;\n state.modifiersData[name] = (_state$modifiersData$ = {}, _state$modifiersData$[axisProp] = offset, _state$modifiersData$.centerOffset = offset - center, _state$modifiersData$);\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state,\n options = _ref2.options;\n var _options$element = options.element,\n arrowElement = _options$element === void 0 ? '[data-popper-arrow]' : _options$element;\n\n if (arrowElement == null) {\n return;\n } // CSS selector\n\n\n if (typeof arrowElement === 'string') {\n arrowElement = state.elements.popper.querySelector(arrowElement);\n\n if (!arrowElement) {\n return;\n }\n }\n\n if (!contains(state.elements.popper, arrowElement)) {\n return;\n }\n\n state.elements.arrow = arrowElement;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'arrow',\n enabled: true,\n phase: 'main',\n fn: arrow,\n effect: effect,\n requires: ['popperOffsets'],\n requiresIfExists: ['preventOverflow']\n};","export default function getVariation(placement) {\n return placement.split('-')[1];\n}","import { top, left, right, bottom, end } from \"../enums.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getWindow from \"../dom-utils/getWindow.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getComputedStyle from \"../dom-utils/getComputedStyle.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport { round } from \"../utils/math.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar unsetSides = {\n top: 'auto',\n right: 'auto',\n bottom: 'auto',\n left: 'auto'\n}; // Round the offsets to the nearest suitable subpixel based on the DPR.\n// Zooming can change the DPR, but it seems to report a value that will\n// cleanly divide the values into the appropriate subpixels.\n\nfunction roundOffsetsByDPR(_ref, win) {\n var x = _ref.x,\n y = _ref.y;\n var dpr = win.devicePixelRatio || 1;\n return {\n x: round(x * dpr) / dpr || 0,\n y: round(y * dpr) / dpr || 0\n };\n}\n\nexport function mapToStyles(_ref2) {\n var _Object$assign2;\n\n var popper = _ref2.popper,\n popperRect = _ref2.popperRect,\n placement = _ref2.placement,\n variation = _ref2.variation,\n offsets = _ref2.offsets,\n position = _ref2.position,\n gpuAcceleration = _ref2.gpuAcceleration,\n adaptive = _ref2.adaptive,\n roundOffsets = _ref2.roundOffsets,\n isFixed = _ref2.isFixed;\n var _offsets$x = offsets.x,\n x = _offsets$x === void 0 ? 0 : _offsets$x,\n _offsets$y = offsets.y,\n y = _offsets$y === void 0 ? 0 : _offsets$y;\n\n var _ref3 = typeof roundOffsets === 'function' ? roundOffsets({\n x: x,\n y: y\n }) : {\n x: x,\n y: y\n };\n\n x = _ref3.x;\n y = _ref3.y;\n var hasX = offsets.hasOwnProperty('x');\n var hasY = offsets.hasOwnProperty('y');\n var sideX = left;\n var sideY = top;\n var win = window;\n\n if (adaptive) {\n var offsetParent = getOffsetParent(popper);\n var heightProp = 'clientHeight';\n var widthProp = 'clientWidth';\n\n if (offsetParent === getWindow(popper)) {\n offsetParent = getDocumentElement(popper);\n\n if (getComputedStyle(offsetParent).position !== 'static' && position === 'absolute') {\n heightProp = 'scrollHeight';\n widthProp = 'scrollWidth';\n }\n } // $FlowFixMe[incompatible-cast]: force type refinement, we compare offsetParent with window above, but Flow doesn't detect it\n\n\n offsetParent = offsetParent;\n\n if (placement === top || (placement === left || placement === right) && variation === end) {\n sideY = bottom;\n var offsetY = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.height : // $FlowFixMe[prop-missing]\n offsetParent[heightProp];\n y -= offsetY - popperRect.height;\n y *= gpuAcceleration ? 1 : -1;\n }\n\n if (placement === left || (placement === top || placement === bottom) && variation === end) {\n sideX = right;\n var offsetX = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.width : // $FlowFixMe[prop-missing]\n offsetParent[widthProp];\n x -= offsetX - popperRect.width;\n x *= gpuAcceleration ? 1 : -1;\n }\n }\n\n var commonStyles = Object.assign({\n position: position\n }, adaptive && unsetSides);\n\n var _ref4 = roundOffsets === true ? roundOffsetsByDPR({\n x: x,\n y: y\n }, getWindow(popper)) : {\n x: x,\n y: y\n };\n\n x = _ref4.x;\n y = _ref4.y;\n\n if (gpuAcceleration) {\n var _Object$assign;\n\n return Object.assign({}, commonStyles, (_Object$assign = {}, _Object$assign[sideY] = hasY ? '0' : '', _Object$assign[sideX] = hasX ? '0' : '', _Object$assign.transform = (win.devicePixelRatio || 1) <= 1 ? \"translate(\" + x + \"px, \" + y + \"px)\" : \"translate3d(\" + x + \"px, \" + y + \"px, 0)\", _Object$assign));\n }\n\n return Object.assign({}, commonStyles, (_Object$assign2 = {}, _Object$assign2[sideY] = hasY ? y + \"px\" : '', _Object$assign2[sideX] = hasX ? x + \"px\" : '', _Object$assign2.transform = '', _Object$assign2));\n}\n\nfunction computeStyles(_ref5) {\n var state = _ref5.state,\n options = _ref5.options;\n var _options$gpuAccelerat = options.gpuAcceleration,\n gpuAcceleration = _options$gpuAccelerat === void 0 ? true : _options$gpuAccelerat,\n _options$adaptive = options.adaptive,\n adaptive = _options$adaptive === void 0 ? true : _options$adaptive,\n _options$roundOffsets = options.roundOffsets,\n roundOffsets = _options$roundOffsets === void 0 ? true : _options$roundOffsets;\n var commonStyles = {\n placement: getBasePlacement(state.placement),\n variation: getVariation(state.placement),\n popper: state.elements.popper,\n popperRect: state.rects.popper,\n gpuAcceleration: gpuAcceleration,\n isFixed: state.options.strategy === 'fixed'\n };\n\n if (state.modifiersData.popperOffsets != null) {\n state.styles.popper = Object.assign({}, state.styles.popper, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.popperOffsets,\n position: state.options.strategy,\n adaptive: adaptive,\n roundOffsets: roundOffsets\n })));\n }\n\n if (state.modifiersData.arrow != null) {\n state.styles.arrow = Object.assign({}, state.styles.arrow, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.arrow,\n position: 'absolute',\n adaptive: false,\n roundOffsets: roundOffsets\n })));\n }\n\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-placement': state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'computeStyles',\n enabled: true,\n phase: 'beforeWrite',\n fn: computeStyles,\n data: {}\n};","import getWindow from \"../dom-utils/getWindow.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar passive = {\n passive: true\n};\n\nfunction effect(_ref) {\n var state = _ref.state,\n instance = _ref.instance,\n options = _ref.options;\n var _options$scroll = options.scroll,\n scroll = _options$scroll === void 0 ? true : _options$scroll,\n _options$resize = options.resize,\n resize = _options$resize === void 0 ? true : _options$resize;\n var window = getWindow(state.elements.popper);\n var scrollParents = [].concat(state.scrollParents.reference, state.scrollParents.popper);\n\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.addEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.addEventListener('resize', instance.update, passive);\n }\n\n return function () {\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.removeEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.removeEventListener('resize', instance.update, passive);\n }\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'eventListeners',\n enabled: true,\n phase: 'write',\n fn: function fn() {},\n effect: effect,\n data: {}\n};","var hash = {\n left: 'right',\n right: 'left',\n bottom: 'top',\n top: 'bottom'\n};\nexport default function getOppositePlacement(placement) {\n return placement.replace(/left|right|bottom|top/g, function (matched) {\n return hash[matched];\n });\n}","var hash = {\n start: 'end',\n end: 'start'\n};\nexport default function getOppositeVariationPlacement(placement) {\n return placement.replace(/start|end/g, function (matched) {\n return hash[matched];\n });\n}","import getWindow from \"./getWindow.js\";\nexport default function getWindowScroll(node) {\n var win = getWindow(node);\n var scrollLeft = win.pageXOffset;\n var scrollTop = win.pageYOffset;\n return {\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nexport default function getWindowScrollBarX(element) {\n // If has a CSS width greater than the viewport, then this will be\n // incorrect for RTL.\n // Popper 1 is broken in this case and never had a bug report so let's assume\n // it's not an issue. I don't think anyone ever specifies width on \n // anyway.\n // Browsers where the left scrollbar doesn't cause an issue report `0` for\n // this (e.g. Edge 2019, IE11, Safari)\n return getBoundingClientRect(getDocumentElement(element)).left + getWindowScroll(element).scrollLeft;\n}","import getComputedStyle from \"./getComputedStyle.js\";\nexport default function isScrollParent(element) {\n // Firefox wants us to check `-x` and `-y` variations as well\n var _getComputedStyle = getComputedStyle(element),\n overflow = _getComputedStyle.overflow,\n overflowX = _getComputedStyle.overflowX,\n overflowY = _getComputedStyle.overflowY;\n\n return /auto|scroll|overlay|hidden/.test(overflow + overflowY + overflowX);\n}","import getParentNode from \"./getParentNode.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nexport default function getScrollParent(node) {\n if (['html', 'body', '#document'].indexOf(getNodeName(node)) >= 0) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return node.ownerDocument.body;\n }\n\n if (isHTMLElement(node) && isScrollParent(node)) {\n return node;\n }\n\n return getScrollParent(getParentNode(node));\n}","import getScrollParent from \"./getScrollParent.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getWindow from \"./getWindow.js\";\nimport isScrollParent from \"./isScrollParent.js\";\n/*\ngiven a DOM element, return the list of all scroll parents, up the list of ancesors\nuntil we get to the top window object. This list is what we attach scroll listeners\nto, because if any of these parent elements scroll, we'll need to re-calculate the\nreference element's position.\n*/\n\nexport default function listScrollParents(element, list) {\n var _element$ownerDocumen;\n\n if (list === void 0) {\n list = [];\n }\n\n var scrollParent = getScrollParent(element);\n var isBody = scrollParent === ((_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body);\n var win = getWindow(scrollParent);\n var target = isBody ? [win].concat(win.visualViewport || [], isScrollParent(scrollParent) ? scrollParent : []) : scrollParent;\n var updatedList = list.concat(target);\n return isBody ? updatedList : // $FlowFixMe[incompatible-call]: isBody tells us target will be an HTMLElement here\n updatedList.concat(listScrollParents(getParentNode(target)));\n}","export default function rectToClientRect(rect) {\n return Object.assign({}, rect, {\n left: rect.x,\n top: rect.y,\n right: rect.x + rect.width,\n bottom: rect.y + rect.height\n });\n}","import { viewport } from \"../enums.js\";\nimport getViewportRect from \"./getViewportRect.js\";\nimport getDocumentRect from \"./getDocumentRect.js\";\nimport listScrollParents from \"./listScrollParents.js\";\nimport getOffsetParent from \"./getOffsetParent.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport contains from \"./contains.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport rectToClientRect from \"../utils/rectToClientRect.js\";\nimport { max, min } from \"../utils/math.js\";\n\nfunction getInnerBoundingClientRect(element, strategy) {\n var rect = getBoundingClientRect(element, false, strategy === 'fixed');\n rect.top = rect.top + element.clientTop;\n rect.left = rect.left + element.clientLeft;\n rect.bottom = rect.top + element.clientHeight;\n rect.right = rect.left + element.clientWidth;\n rect.width = element.clientWidth;\n rect.height = element.clientHeight;\n rect.x = rect.left;\n rect.y = rect.top;\n return rect;\n}\n\nfunction getClientRectFromMixedType(element, clippingParent, strategy) {\n return clippingParent === viewport ? rectToClientRect(getViewportRect(element, strategy)) : isElement(clippingParent) ? getInnerBoundingClientRect(clippingParent, strategy) : rectToClientRect(getDocumentRect(getDocumentElement(element)));\n} // A \"clipping parent\" is an overflowable container with the characteristic of\n// clipping (or hiding) overflowing elements with a position different from\n// `initial`\n\n\nfunction getClippingParents(element) {\n var clippingParents = listScrollParents(getParentNode(element));\n var canEscapeClipping = ['absolute', 'fixed'].indexOf(getComputedStyle(element).position) >= 0;\n var clipperElement = canEscapeClipping && isHTMLElement(element) ? getOffsetParent(element) : element;\n\n if (!isElement(clipperElement)) {\n return [];\n } // $FlowFixMe[incompatible-return]: https://github.com/facebook/flow/issues/1414\n\n\n return clippingParents.filter(function (clippingParent) {\n return isElement(clippingParent) && contains(clippingParent, clipperElement) && getNodeName(clippingParent) !== 'body';\n });\n} // Gets the maximum area that the element is visible in due to any number of\n// clipping parents\n\n\nexport default function getClippingRect(element, boundary, rootBoundary, strategy) {\n var mainClippingParents = boundary === 'clippingParents' ? getClippingParents(element) : [].concat(boundary);\n var clippingParents = [].concat(mainClippingParents, [rootBoundary]);\n var firstClippingParent = clippingParents[0];\n var clippingRect = clippingParents.reduce(function (accRect, clippingParent) {\n var rect = getClientRectFromMixedType(element, clippingParent, strategy);\n accRect.top = max(rect.top, accRect.top);\n accRect.right = min(rect.right, accRect.right);\n accRect.bottom = min(rect.bottom, accRect.bottom);\n accRect.left = max(rect.left, accRect.left);\n return accRect;\n }, getClientRectFromMixedType(element, firstClippingParent, strategy));\n clippingRect.width = clippingRect.right - clippingRect.left;\n clippingRect.height = clippingRect.bottom - clippingRect.top;\n clippingRect.x = clippingRect.left;\n clippingRect.y = clippingRect.top;\n return clippingRect;\n}","import getWindow from \"./getWindow.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getViewportRect(element, strategy) {\n var win = getWindow(element);\n var html = getDocumentElement(element);\n var visualViewport = win.visualViewport;\n var width = html.clientWidth;\n var height = html.clientHeight;\n var x = 0;\n var y = 0;\n\n if (visualViewport) {\n width = visualViewport.width;\n height = visualViewport.height;\n var layoutViewport = isLayoutViewport();\n\n if (layoutViewport || !layoutViewport && strategy === 'fixed') {\n x = visualViewport.offsetLeft;\n y = visualViewport.offsetTop;\n }\n }\n\n return {\n width: width,\n height: height,\n x: x + getWindowScrollBarX(element),\n y: y\n };\n}","import getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nimport { max } from \"../utils/math.js\"; // Gets the entire size of the scrollable document area, even extending outside\n// of the `` and `` rect bounds if horizontally scrollable\n\nexport default function getDocumentRect(element) {\n var _element$ownerDocumen;\n\n var html = getDocumentElement(element);\n var winScroll = getWindowScroll(element);\n var body = (_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body;\n var width = max(html.scrollWidth, html.clientWidth, body ? body.scrollWidth : 0, body ? body.clientWidth : 0);\n var height = max(html.scrollHeight, html.clientHeight, body ? body.scrollHeight : 0, body ? body.clientHeight : 0);\n var x = -winScroll.scrollLeft + getWindowScrollBarX(element);\n var y = -winScroll.scrollTop;\n\n if (getComputedStyle(body || html).direction === 'rtl') {\n x += max(html.clientWidth, body ? body.clientWidth : 0) - width;\n }\n\n return {\n width: width,\n height: height,\n x: x,\n y: y\n };\n}","import getBasePlacement from \"./getBasePlacement.js\";\nimport getVariation from \"./getVariation.js\";\nimport getMainAxisFromPlacement from \"./getMainAxisFromPlacement.js\";\nimport { top, right, bottom, left, start, end } from \"../enums.js\";\nexport default function computeOffsets(_ref) {\n var reference = _ref.reference,\n element = _ref.element,\n placement = _ref.placement;\n var basePlacement = placement ? getBasePlacement(placement) : null;\n var variation = placement ? getVariation(placement) : null;\n var commonX = reference.x + reference.width / 2 - element.width / 2;\n var commonY = reference.y + reference.height / 2 - element.height / 2;\n var offsets;\n\n switch (basePlacement) {\n case top:\n offsets = {\n x: commonX,\n y: reference.y - element.height\n };\n break;\n\n case bottom:\n offsets = {\n x: commonX,\n y: reference.y + reference.height\n };\n break;\n\n case right:\n offsets = {\n x: reference.x + reference.width,\n y: commonY\n };\n break;\n\n case left:\n offsets = {\n x: reference.x - element.width,\n y: commonY\n };\n break;\n\n default:\n offsets = {\n x: reference.x,\n y: reference.y\n };\n }\n\n var mainAxis = basePlacement ? getMainAxisFromPlacement(basePlacement) : null;\n\n if (mainAxis != null) {\n var len = mainAxis === 'y' ? 'height' : 'width';\n\n switch (variation) {\n case start:\n offsets[mainAxis] = offsets[mainAxis] - (reference[len] / 2 - element[len] / 2);\n break;\n\n case end:\n offsets[mainAxis] = offsets[mainAxis] + (reference[len] / 2 - element[len] / 2);\n break;\n\n default:\n }\n }\n\n return offsets;\n}","import getClippingRect from \"../dom-utils/getClippingRect.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getBoundingClientRect from \"../dom-utils/getBoundingClientRect.js\";\nimport computeOffsets from \"./computeOffsets.js\";\nimport rectToClientRect from \"./rectToClientRect.js\";\nimport { clippingParents, reference, popper, bottom, top, right, basePlacements, viewport } from \"../enums.js\";\nimport { isElement } from \"../dom-utils/instanceOf.js\";\nimport mergePaddingObject from \"./mergePaddingObject.js\";\nimport expandToHashMap from \"./expandToHashMap.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport default function detectOverflow(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n _options$placement = _options.placement,\n placement = _options$placement === void 0 ? state.placement : _options$placement,\n _options$strategy = _options.strategy,\n strategy = _options$strategy === void 0 ? state.strategy : _options$strategy,\n _options$boundary = _options.boundary,\n boundary = _options$boundary === void 0 ? clippingParents : _options$boundary,\n _options$rootBoundary = _options.rootBoundary,\n rootBoundary = _options$rootBoundary === void 0 ? viewport : _options$rootBoundary,\n _options$elementConte = _options.elementContext,\n elementContext = _options$elementConte === void 0 ? popper : _options$elementConte,\n _options$altBoundary = _options.altBoundary,\n altBoundary = _options$altBoundary === void 0 ? false : _options$altBoundary,\n _options$padding = _options.padding,\n padding = _options$padding === void 0 ? 0 : _options$padding;\n var paddingObject = mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n var altContext = elementContext === popper ? reference : popper;\n var popperRect = state.rects.popper;\n var element = state.elements[altBoundary ? altContext : elementContext];\n var clippingClientRect = getClippingRect(isElement(element) ? element : element.contextElement || getDocumentElement(state.elements.popper), boundary, rootBoundary, strategy);\n var referenceClientRect = getBoundingClientRect(state.elements.reference);\n var popperOffsets = computeOffsets({\n reference: referenceClientRect,\n element: popperRect,\n strategy: 'absolute',\n placement: placement\n });\n var popperClientRect = rectToClientRect(Object.assign({}, popperRect, popperOffsets));\n var elementClientRect = elementContext === popper ? popperClientRect : referenceClientRect; // positive = overflowing the clipping rect\n // 0 or negative = within the clipping rect\n\n var overflowOffsets = {\n top: clippingClientRect.top - elementClientRect.top + paddingObject.top,\n bottom: elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom,\n left: clippingClientRect.left - elementClientRect.left + paddingObject.left,\n right: elementClientRect.right - clippingClientRect.right + paddingObject.right\n };\n var offsetData = state.modifiersData.offset; // Offsets can be applied only to the popper element\n\n if (elementContext === popper && offsetData) {\n var offset = offsetData[placement];\n Object.keys(overflowOffsets).forEach(function (key) {\n var multiply = [right, bottom].indexOf(key) >= 0 ? 1 : -1;\n var axis = [top, bottom].indexOf(key) >= 0 ? 'y' : 'x';\n overflowOffsets[key] += offset[axis] * multiply;\n });\n }\n\n return overflowOffsets;\n}","import getVariation from \"./getVariation.js\";\nimport { variationPlacements, basePlacements, placements as allPlacements } from \"../enums.js\";\nimport detectOverflow from \"./detectOverflow.js\";\nimport getBasePlacement from \"./getBasePlacement.js\";\nexport default function computeAutoPlacement(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n placement = _options.placement,\n boundary = _options.boundary,\n rootBoundary = _options.rootBoundary,\n padding = _options.padding,\n flipVariations = _options.flipVariations,\n _options$allowedAutoP = _options.allowedAutoPlacements,\n allowedAutoPlacements = _options$allowedAutoP === void 0 ? allPlacements : _options$allowedAutoP;\n var variation = getVariation(placement);\n var placements = variation ? flipVariations ? variationPlacements : variationPlacements.filter(function (placement) {\n return getVariation(placement) === variation;\n }) : basePlacements;\n var allowedPlacements = placements.filter(function (placement) {\n return allowedAutoPlacements.indexOf(placement) >= 0;\n });\n\n if (allowedPlacements.length === 0) {\n allowedPlacements = placements;\n } // $FlowFixMe[incompatible-type]: Flow seems to have problems with two array unions...\n\n\n var overflows = allowedPlacements.reduce(function (acc, placement) {\n acc[placement] = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding\n })[getBasePlacement(placement)];\n return acc;\n }, {});\n return Object.keys(overflows).sort(function (a, b) {\n return overflows[a] - overflows[b];\n });\n}","import getOppositePlacement from \"../utils/getOppositePlacement.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getOppositeVariationPlacement from \"../utils/getOppositeVariationPlacement.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport computeAutoPlacement from \"../utils/computeAutoPlacement.js\";\nimport { bottom, top, start, right, left, auto } from \"../enums.js\";\nimport getVariation from \"../utils/getVariation.js\"; // eslint-disable-next-line import/no-unused-modules\n\nfunction getExpandedFallbackPlacements(placement) {\n if (getBasePlacement(placement) === auto) {\n return [];\n }\n\n var oppositePlacement = getOppositePlacement(placement);\n return [getOppositeVariationPlacement(placement), oppositePlacement, getOppositeVariationPlacement(oppositePlacement)];\n}\n\nfunction flip(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n\n if (state.modifiersData[name]._skip) {\n return;\n }\n\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? true : _options$altAxis,\n specifiedFallbackPlacements = options.fallbackPlacements,\n padding = options.padding,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n _options$flipVariatio = options.flipVariations,\n flipVariations = _options$flipVariatio === void 0 ? true : _options$flipVariatio,\n allowedAutoPlacements = options.allowedAutoPlacements;\n var preferredPlacement = state.options.placement;\n var basePlacement = getBasePlacement(preferredPlacement);\n var isBasePlacement = basePlacement === preferredPlacement;\n var fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipVariations ? [getOppositePlacement(preferredPlacement)] : getExpandedFallbackPlacements(preferredPlacement));\n var placements = [preferredPlacement].concat(fallbackPlacements).reduce(function (acc, placement) {\n return acc.concat(getBasePlacement(placement) === auto ? computeAutoPlacement(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n flipVariations: flipVariations,\n allowedAutoPlacements: allowedAutoPlacements\n }) : placement);\n }, []);\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var checksMap = new Map();\n var makeFallbackChecks = true;\n var firstFittingPlacement = placements[0];\n\n for (var i = 0; i < placements.length; i++) {\n var placement = placements[i];\n\n var _basePlacement = getBasePlacement(placement);\n\n var isStartVariation = getVariation(placement) === start;\n var isVertical = [top, bottom].indexOf(_basePlacement) >= 0;\n var len = isVertical ? 'width' : 'height';\n var overflow = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n altBoundary: altBoundary,\n padding: padding\n });\n var mainVariationSide = isVertical ? isStartVariation ? right : left : isStartVariation ? bottom : top;\n\n if (referenceRect[len] > popperRect[len]) {\n mainVariationSide = getOppositePlacement(mainVariationSide);\n }\n\n var altVariationSide = getOppositePlacement(mainVariationSide);\n var checks = [];\n\n if (checkMainAxis) {\n checks.push(overflow[_basePlacement] <= 0);\n }\n\n if (checkAltAxis) {\n checks.push(overflow[mainVariationSide] <= 0, overflow[altVariationSide] <= 0);\n }\n\n if (checks.every(function (check) {\n return check;\n })) {\n firstFittingPlacement = placement;\n makeFallbackChecks = false;\n break;\n }\n\n checksMap.set(placement, checks);\n }\n\n if (makeFallbackChecks) {\n // `2` may be desired in some cases – research later\n var numberOfChecks = flipVariations ? 3 : 1;\n\n var _loop = function _loop(_i) {\n var fittingPlacement = placements.find(function (placement) {\n var checks = checksMap.get(placement);\n\n if (checks) {\n return checks.slice(0, _i).every(function (check) {\n return check;\n });\n }\n });\n\n if (fittingPlacement) {\n firstFittingPlacement = fittingPlacement;\n return \"break\";\n }\n };\n\n for (var _i = numberOfChecks; _i > 0; _i--) {\n var _ret = _loop(_i);\n\n if (_ret === \"break\") break;\n }\n }\n\n if (state.placement !== firstFittingPlacement) {\n state.modifiersData[name]._skip = true;\n state.placement = firstFittingPlacement;\n state.reset = true;\n }\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'flip',\n enabled: true,\n phase: 'main',\n fn: flip,\n requiresIfExists: ['offset'],\n data: {\n _skip: false\n }\n};","import { top, bottom, left, right } from \"../enums.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\n\nfunction getSideOffsets(overflow, rect, preventedOffsets) {\n if (preventedOffsets === void 0) {\n preventedOffsets = {\n x: 0,\n y: 0\n };\n }\n\n return {\n top: overflow.top - rect.height - preventedOffsets.y,\n right: overflow.right - rect.width + preventedOffsets.x,\n bottom: overflow.bottom - rect.height + preventedOffsets.y,\n left: overflow.left - rect.width - preventedOffsets.x\n };\n}\n\nfunction isAnySideFullyClipped(overflow) {\n return [top, right, bottom, left].some(function (side) {\n return overflow[side] >= 0;\n });\n}\n\nfunction hide(_ref) {\n var state = _ref.state,\n name = _ref.name;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var preventedOffsets = state.modifiersData.preventOverflow;\n var referenceOverflow = detectOverflow(state, {\n elementContext: 'reference'\n });\n var popperAltOverflow = detectOverflow(state, {\n altBoundary: true\n });\n var referenceClippingOffsets = getSideOffsets(referenceOverflow, referenceRect);\n var popperEscapeOffsets = getSideOffsets(popperAltOverflow, popperRect, preventedOffsets);\n var isReferenceHidden = isAnySideFullyClipped(referenceClippingOffsets);\n var hasPopperEscaped = isAnySideFullyClipped(popperEscapeOffsets);\n state.modifiersData[name] = {\n referenceClippingOffsets: referenceClippingOffsets,\n popperEscapeOffsets: popperEscapeOffsets,\n isReferenceHidden: isReferenceHidden,\n hasPopperEscaped: hasPopperEscaped\n };\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-reference-hidden': isReferenceHidden,\n 'data-popper-escaped': hasPopperEscaped\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'hide',\n enabled: true,\n phase: 'main',\n requiresIfExists: ['preventOverflow'],\n fn: hide\n};","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport { top, left, right, placements } from \"../enums.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport function distanceAndSkiddingToXY(placement, rects, offset) {\n var basePlacement = getBasePlacement(placement);\n var invertDistance = [left, top].indexOf(basePlacement) >= 0 ? -1 : 1;\n\n var _ref = typeof offset === 'function' ? offset(Object.assign({}, rects, {\n placement: placement\n })) : offset,\n skidding = _ref[0],\n distance = _ref[1];\n\n skidding = skidding || 0;\n distance = (distance || 0) * invertDistance;\n return [left, right].indexOf(basePlacement) >= 0 ? {\n x: distance,\n y: skidding\n } : {\n x: skidding,\n y: distance\n };\n}\n\nfunction offset(_ref2) {\n var state = _ref2.state,\n options = _ref2.options,\n name = _ref2.name;\n var _options$offset = options.offset,\n offset = _options$offset === void 0 ? [0, 0] : _options$offset;\n var data = placements.reduce(function (acc, placement) {\n acc[placement] = distanceAndSkiddingToXY(placement, state.rects, offset);\n return acc;\n }, {});\n var _data$state$placement = data[state.placement],\n x = _data$state$placement.x,\n y = _data$state$placement.y;\n\n if (state.modifiersData.popperOffsets != null) {\n state.modifiersData.popperOffsets.x += x;\n state.modifiersData.popperOffsets.y += y;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'offset',\n enabled: true,\n phase: 'main',\n requires: ['popperOffsets'],\n fn: offset\n};","import computeOffsets from \"../utils/computeOffsets.js\";\n\nfunction popperOffsets(_ref) {\n var state = _ref.state,\n name = _ref.name;\n // Offsets are the actual position the popper needs to have to be\n // properly positioned near its reference element\n // This is the most basic placement, and will be adjusted by\n // the modifiers in the next step\n state.modifiersData[name] = computeOffsets({\n reference: state.rects.reference,\n element: state.rects.popper,\n strategy: 'absolute',\n placement: state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'popperOffsets',\n enabled: true,\n phase: 'read',\n fn: popperOffsets,\n data: {}\n};","import { top, left, right, bottom, start } from \"../enums.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport getAltAxis from \"../utils/getAltAxis.js\";\nimport { within, withinMaxClamp } from \"../utils/within.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport getFreshSideObject from \"../utils/getFreshSideObject.js\";\nimport { min as mathMin, max as mathMax } from \"../utils/math.js\";\n\nfunction preventOverflow(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? false : _options$altAxis,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n padding = options.padding,\n _options$tether = options.tether,\n tether = _options$tether === void 0 ? true : _options$tether,\n _options$tetherOffset = options.tetherOffset,\n tetherOffset = _options$tetherOffset === void 0 ? 0 : _options$tetherOffset;\n var overflow = detectOverflow(state, {\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n altBoundary: altBoundary\n });\n var basePlacement = getBasePlacement(state.placement);\n var variation = getVariation(state.placement);\n var isBasePlacement = !variation;\n var mainAxis = getMainAxisFromPlacement(basePlacement);\n var altAxis = getAltAxis(mainAxis);\n var popperOffsets = state.modifiersData.popperOffsets;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var tetherOffsetValue = typeof tetherOffset === 'function' ? tetherOffset(Object.assign({}, state.rects, {\n placement: state.placement\n })) : tetherOffset;\n var normalizedTetherOffsetValue = typeof tetherOffsetValue === 'number' ? {\n mainAxis: tetherOffsetValue,\n altAxis: tetherOffsetValue\n } : Object.assign({\n mainAxis: 0,\n altAxis: 0\n }, tetherOffsetValue);\n var offsetModifierState = state.modifiersData.offset ? state.modifiersData.offset[state.placement] : null;\n var data = {\n x: 0,\n y: 0\n };\n\n if (!popperOffsets) {\n return;\n }\n\n if (checkMainAxis) {\n var _offsetModifierState$;\n\n var mainSide = mainAxis === 'y' ? top : left;\n var altSide = mainAxis === 'y' ? bottom : right;\n var len = mainAxis === 'y' ? 'height' : 'width';\n var offset = popperOffsets[mainAxis];\n var min = offset + overflow[mainSide];\n var max = offset - overflow[altSide];\n var additive = tether ? -popperRect[len] / 2 : 0;\n var minLen = variation === start ? referenceRect[len] : popperRect[len];\n var maxLen = variation === start ? -popperRect[len] : -referenceRect[len]; // We need to include the arrow in the calculation so the arrow doesn't go\n // outside the reference bounds\n\n var arrowElement = state.elements.arrow;\n var arrowRect = tether && arrowElement ? getLayoutRect(arrowElement) : {\n width: 0,\n height: 0\n };\n var arrowPaddingObject = state.modifiersData['arrow#persistent'] ? state.modifiersData['arrow#persistent'].padding : getFreshSideObject();\n var arrowPaddingMin = arrowPaddingObject[mainSide];\n var arrowPaddingMax = arrowPaddingObject[altSide]; // If the reference length is smaller than the arrow length, we don't want\n // to include its full size in the calculation. If the reference is small\n // and near the edge of a boundary, the popper can overflow even if the\n // reference is not overflowing as well (e.g. virtual elements with no\n // width or height)\n\n var arrowLen = within(0, referenceRect[len], arrowRect[len]);\n var minOffset = isBasePlacement ? referenceRect[len] / 2 - additive - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis : minLen - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis;\n var maxOffset = isBasePlacement ? -referenceRect[len] / 2 + additive + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis : maxLen + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis;\n var arrowOffsetParent = state.elements.arrow && getOffsetParent(state.elements.arrow);\n var clientOffset = arrowOffsetParent ? mainAxis === 'y' ? arrowOffsetParent.clientTop || 0 : arrowOffsetParent.clientLeft || 0 : 0;\n var offsetModifierValue = (_offsetModifierState$ = offsetModifierState == null ? void 0 : offsetModifierState[mainAxis]) != null ? _offsetModifierState$ : 0;\n var tetherMin = offset + minOffset - offsetModifierValue - clientOffset;\n var tetherMax = offset + maxOffset - offsetModifierValue;\n var preventedOffset = within(tether ? mathMin(min, tetherMin) : min, offset, tether ? mathMax(max, tetherMax) : max);\n popperOffsets[mainAxis] = preventedOffset;\n data[mainAxis] = preventedOffset - offset;\n }\n\n if (checkAltAxis) {\n var _offsetModifierState$2;\n\n var _mainSide = mainAxis === 'x' ? top : left;\n\n var _altSide = mainAxis === 'x' ? bottom : right;\n\n var _offset = popperOffsets[altAxis];\n\n var _len = altAxis === 'y' ? 'height' : 'width';\n\n var _min = _offset + overflow[_mainSide];\n\n var _max = _offset - overflow[_altSide];\n\n var isOriginSide = [top, left].indexOf(basePlacement) !== -1;\n\n var _offsetModifierValue = (_offsetModifierState$2 = offsetModifierState == null ? void 0 : offsetModifierState[altAxis]) != null ? _offsetModifierState$2 : 0;\n\n var _tetherMin = isOriginSide ? _min : _offset - referenceRect[_len] - popperRect[_len] - _offsetModifierValue + normalizedTetherOffsetValue.altAxis;\n\n var _tetherMax = isOriginSide ? _offset + referenceRect[_len] + popperRect[_len] - _offsetModifierValue - normalizedTetherOffsetValue.altAxis : _max;\n\n var _preventedOffset = tether && isOriginSide ? withinMaxClamp(_tetherMin, _offset, _tetherMax) : within(tether ? _tetherMin : _min, _offset, tether ? _tetherMax : _max);\n\n popperOffsets[altAxis] = _preventedOffset;\n data[altAxis] = _preventedOffset - _offset;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'preventOverflow',\n enabled: true,\n phase: 'main',\n fn: preventOverflow,\n requiresIfExists: ['offset']\n};","export default function getAltAxis(axis) {\n return axis === 'x' ? 'y' : 'x';\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getNodeScroll from \"./getNodeScroll.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport { round } from \"../utils/math.js\";\n\nfunction isElementScaled(element) {\n var rect = element.getBoundingClientRect();\n var scaleX = round(rect.width) / element.offsetWidth || 1;\n var scaleY = round(rect.height) / element.offsetHeight || 1;\n return scaleX !== 1 || scaleY !== 1;\n} // Returns the composite rect of an element relative to its offsetParent.\n// Composite means it takes into account transforms as well as layout.\n\n\nexport default function getCompositeRect(elementOrVirtualElement, offsetParent, isFixed) {\n if (isFixed === void 0) {\n isFixed = false;\n }\n\n var isOffsetParentAnElement = isHTMLElement(offsetParent);\n var offsetParentIsScaled = isHTMLElement(offsetParent) && isElementScaled(offsetParent);\n var documentElement = getDocumentElement(offsetParent);\n var rect = getBoundingClientRect(elementOrVirtualElement, offsetParentIsScaled, isFixed);\n var scroll = {\n scrollLeft: 0,\n scrollTop: 0\n };\n var offsets = {\n x: 0,\n y: 0\n };\n\n if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {\n if (getNodeName(offsetParent) !== 'body' || // https://github.com/popperjs/popper-core/issues/1078\n isScrollParent(documentElement)) {\n scroll = getNodeScroll(offsetParent);\n }\n\n if (isHTMLElement(offsetParent)) {\n offsets = getBoundingClientRect(offsetParent, true);\n offsets.x += offsetParent.clientLeft;\n offsets.y += offsetParent.clientTop;\n } else if (documentElement) {\n offsets.x = getWindowScrollBarX(documentElement);\n }\n }\n\n return {\n x: rect.left + scroll.scrollLeft - offsets.x,\n y: rect.top + scroll.scrollTop - offsets.y,\n width: rect.width,\n height: rect.height\n };\n}","import getWindowScroll from \"./getWindowScroll.js\";\nimport getWindow from \"./getWindow.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getHTMLElementScroll from \"./getHTMLElementScroll.js\";\nexport default function getNodeScroll(node) {\n if (node === getWindow(node) || !isHTMLElement(node)) {\n return getWindowScroll(node);\n } else {\n return getHTMLElementScroll(node);\n }\n}","export default function getHTMLElementScroll(element) {\n return {\n scrollLeft: element.scrollLeft,\n scrollTop: element.scrollTop\n };\n}","import { modifierPhases } from \"../enums.js\"; // source: https://stackoverflow.com/questions/49875255\n\nfunction order(modifiers) {\n var map = new Map();\n var visited = new Set();\n var result = [];\n modifiers.forEach(function (modifier) {\n map.set(modifier.name, modifier);\n }); // On visiting object, check for its dependencies and visit them recursively\n\n function sort(modifier) {\n visited.add(modifier.name);\n var requires = [].concat(modifier.requires || [], modifier.requiresIfExists || []);\n requires.forEach(function (dep) {\n if (!visited.has(dep)) {\n var depModifier = map.get(dep);\n\n if (depModifier) {\n sort(depModifier);\n }\n }\n });\n result.push(modifier);\n }\n\n modifiers.forEach(function (modifier) {\n if (!visited.has(modifier.name)) {\n // check for visited object\n sort(modifier);\n }\n });\n return result;\n}\n\nexport default function orderModifiers(modifiers) {\n // order based on dependencies\n var orderedModifiers = order(modifiers); // order based on phase\n\n return modifierPhases.reduce(function (acc, phase) {\n return acc.concat(orderedModifiers.filter(function (modifier) {\n return modifier.phase === phase;\n }));\n }, []);\n}","import getCompositeRect from \"./dom-utils/getCompositeRect.js\";\nimport getLayoutRect from \"./dom-utils/getLayoutRect.js\";\nimport listScrollParents from \"./dom-utils/listScrollParents.js\";\nimport getOffsetParent from \"./dom-utils/getOffsetParent.js\";\nimport orderModifiers from \"./utils/orderModifiers.js\";\nimport debounce from \"./utils/debounce.js\";\nimport mergeByName from \"./utils/mergeByName.js\";\nimport detectOverflow from \"./utils/detectOverflow.js\";\nimport { isElement } from \"./dom-utils/instanceOf.js\";\nvar DEFAULT_OPTIONS = {\n placement: 'bottom',\n modifiers: [],\n strategy: 'absolute'\n};\n\nfunction areValidElements() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n return !args.some(function (element) {\n return !(element && typeof element.getBoundingClientRect === 'function');\n });\n}\n\nexport function popperGenerator(generatorOptions) {\n if (generatorOptions === void 0) {\n generatorOptions = {};\n }\n\n var _generatorOptions = generatorOptions,\n _generatorOptions$def = _generatorOptions.defaultModifiers,\n defaultModifiers = _generatorOptions$def === void 0 ? [] : _generatorOptions$def,\n _generatorOptions$def2 = _generatorOptions.defaultOptions,\n defaultOptions = _generatorOptions$def2 === void 0 ? DEFAULT_OPTIONS : _generatorOptions$def2;\n return function createPopper(reference, popper, options) {\n if (options === void 0) {\n options = defaultOptions;\n }\n\n var state = {\n placement: 'bottom',\n orderedModifiers: [],\n options: Object.assign({}, DEFAULT_OPTIONS, defaultOptions),\n modifiersData: {},\n elements: {\n reference: reference,\n popper: popper\n },\n attributes: {},\n styles: {}\n };\n var effectCleanupFns = [];\n var isDestroyed = false;\n var instance = {\n state: state,\n setOptions: function setOptions(setOptionsAction) {\n var options = typeof setOptionsAction === 'function' ? setOptionsAction(state.options) : setOptionsAction;\n cleanupModifierEffects();\n state.options = Object.assign({}, defaultOptions, state.options, options);\n state.scrollParents = {\n reference: isElement(reference) ? listScrollParents(reference) : reference.contextElement ? listScrollParents(reference.contextElement) : [],\n popper: listScrollParents(popper)\n }; // Orders the modifiers based on their dependencies and `phase`\n // properties\n\n var orderedModifiers = orderModifiers(mergeByName([].concat(defaultModifiers, state.options.modifiers))); // Strip out disabled modifiers\n\n state.orderedModifiers = orderedModifiers.filter(function (m) {\n return m.enabled;\n });\n runModifierEffects();\n return instance.update();\n },\n // Sync update – it will always be executed, even if not necessary. This\n // is useful for low frequency updates where sync behavior simplifies the\n // logic.\n // For high frequency updates (e.g. `resize` and `scroll` events), always\n // prefer the async Popper#update method\n forceUpdate: function forceUpdate() {\n if (isDestroyed) {\n return;\n }\n\n var _state$elements = state.elements,\n reference = _state$elements.reference,\n popper = _state$elements.popper; // Don't proceed if `reference` or `popper` are not valid elements\n // anymore\n\n if (!areValidElements(reference, popper)) {\n return;\n } // Store the reference and popper rects to be read by modifiers\n\n\n state.rects = {\n reference: getCompositeRect(reference, getOffsetParent(popper), state.options.strategy === 'fixed'),\n popper: getLayoutRect(popper)\n }; // Modifiers have the ability to reset the current update cycle. The\n // most common use case for this is the `flip` modifier changing the\n // placement, which then needs to re-run all the modifiers, because the\n // logic was previously ran for the previous placement and is therefore\n // stale/incorrect\n\n state.reset = false;\n state.placement = state.options.placement; // On each update cycle, the `modifiersData` property for each modifier\n // is filled with the initial data specified by the modifier. This means\n // it doesn't persist and is fresh on each update.\n // To ensure persistent data, use `${name}#persistent`\n\n state.orderedModifiers.forEach(function (modifier) {\n return state.modifiersData[modifier.name] = Object.assign({}, modifier.data);\n });\n\n for (var index = 0; index < state.orderedModifiers.length; index++) {\n if (state.reset === true) {\n state.reset = false;\n index = -1;\n continue;\n }\n\n var _state$orderedModifie = state.orderedModifiers[index],\n fn = _state$orderedModifie.fn,\n _state$orderedModifie2 = _state$orderedModifie.options,\n _options = _state$orderedModifie2 === void 0 ? {} : _state$orderedModifie2,\n name = _state$orderedModifie.name;\n\n if (typeof fn === 'function') {\n state = fn({\n state: state,\n options: _options,\n name: name,\n instance: instance\n }) || state;\n }\n }\n },\n // Async and optimistically optimized update – it will not be executed if\n // not necessary (debounced to run at most once-per-tick)\n update: debounce(function () {\n return new Promise(function (resolve) {\n instance.forceUpdate();\n resolve(state);\n });\n }),\n destroy: function destroy() {\n cleanupModifierEffects();\n isDestroyed = true;\n }\n };\n\n if (!areValidElements(reference, popper)) {\n return instance;\n }\n\n instance.setOptions(options).then(function (state) {\n if (!isDestroyed && options.onFirstUpdate) {\n options.onFirstUpdate(state);\n }\n }); // Modifiers have the ability to execute arbitrary code before the first\n // update cycle runs. They will be executed in the same order as the update\n // cycle. This is useful when a modifier adds some persistent data that\n // other modifiers need to use, but the modifier is run after the dependent\n // one.\n\n function runModifierEffects() {\n state.orderedModifiers.forEach(function (_ref) {\n var name = _ref.name,\n _ref$options = _ref.options,\n options = _ref$options === void 0 ? {} : _ref$options,\n effect = _ref.effect;\n\n if (typeof effect === 'function') {\n var cleanupFn = effect({\n state: state,\n name: name,\n instance: instance,\n options: options\n });\n\n var noopFn = function noopFn() {};\n\n effectCleanupFns.push(cleanupFn || noopFn);\n }\n });\n }\n\n function cleanupModifierEffects() {\n effectCleanupFns.forEach(function (fn) {\n return fn();\n });\n effectCleanupFns = [];\n }\n\n return instance;\n };\n}\nexport var createPopper = /*#__PURE__*/popperGenerator(); // eslint-disable-next-line import/no-unused-modules\n\nexport { detectOverflow };","export default function debounce(fn) {\n var pending;\n return function () {\n if (!pending) {\n pending = new Promise(function (resolve) {\n Promise.resolve().then(function () {\n pending = undefined;\n resolve(fn());\n });\n });\n }\n\n return pending;\n };\n}","export default function mergeByName(modifiers) {\n var merged = modifiers.reduce(function (merged, current) {\n var existing = merged[current.name];\n merged[current.name] = existing ? Object.assign({}, existing, current, {\n options: Object.assign({}, existing.options, current.options),\n data: Object.assign({}, existing.data, current.data)\n }) : current;\n return merged;\n }, {}); // IE11 does not support Object.values\n\n return Object.keys(merged).map(function (key) {\n return merged[key];\n });\n}","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow };","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nimport offset from \"./modifiers/offset.js\";\nimport flip from \"./modifiers/flip.js\";\nimport preventOverflow from \"./modifiers/preventOverflow.js\";\nimport arrow from \"./modifiers/arrow.js\";\nimport hide from \"./modifiers/hide.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles, offset, flip, preventOverflow, arrow, hide];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow }; // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper as createPopperLite } from \"./popper-lite.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport * from \"./modifiers/index.js\";","/**\n * --------------------------------------------------------------------------\n * Bootstrap dropdown.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport * as Popper from '@popperjs/core'\nimport BaseComponent from './base-component.js'\nimport EventHandler from './dom/event-handler.js'\nimport Manipulator from './dom/manipulator.js'\nimport SelectorEngine from './dom/selector-engine.js'\nimport {\n defineJQueryPlugin,\n execute,\n getElement,\n getNextActiveElement,\n isDisabled,\n isElement,\n isRTL,\n isVisible,\n noop\n} from './util/index.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'dropdown'\nconst DATA_KEY = 'bs.dropdown'\nconst EVENT_KEY = `.${DATA_KEY}`\nconst DATA_API_KEY = '.data-api'\n\nconst ESCAPE_KEY = 'Escape'\nconst TAB_KEY = 'Tab'\nconst ARROW_UP_KEY = 'ArrowUp'\nconst ARROW_DOWN_KEY = 'ArrowDown'\nconst RIGHT_MOUSE_BUTTON = 2 // MouseEvent.button value for the secondary button, usually the right button\n\nconst EVENT_HIDE = `hide${EVENT_KEY}`\nconst EVENT_HIDDEN = `hidden${EVENT_KEY}`\nconst EVENT_SHOW = `show${EVENT_KEY}`\nconst EVENT_SHOWN = `shown${EVENT_KEY}`\nconst EVENT_CLICK_DATA_API = `click${EVENT_KEY}${DATA_API_KEY}`\nconst EVENT_KEYDOWN_DATA_API = `keydown${EVENT_KEY}${DATA_API_KEY}`\nconst EVENT_KEYUP_DATA_API = `keyup${EVENT_KEY}${DATA_API_KEY}`\n\nconst CLASS_NAME_SHOW = 'show'\nconst CLASS_NAME_DROPUP = 'dropup'\nconst CLASS_NAME_DROPEND = 'dropend'\nconst CLASS_NAME_DROPSTART = 'dropstart'\nconst CLASS_NAME_DROPUP_CENTER = 'dropup-center'\nconst CLASS_NAME_DROPDOWN_CENTER = 'dropdown-center'\n\nconst SELECTOR_DATA_TOGGLE = '[data-bs-toggle=\"dropdown\"]:not(.disabled):not(:disabled)'\nconst SELECTOR_DATA_TOGGLE_SHOWN = `${SELECTOR_DATA_TOGGLE}.${CLASS_NAME_SHOW}`\nconst SELECTOR_MENU = '.dropdown-menu'\nconst SELECTOR_NAVBAR = '.navbar'\nconst SELECTOR_NAVBAR_NAV = '.navbar-nav'\nconst SELECTOR_VISIBLE_ITEMS = '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)'\n\nconst PLACEMENT_TOP = isRTL() ? 'top-end' : 'top-start'\nconst PLACEMENT_TOPEND = isRTL() ? 'top-start' : 'top-end'\nconst PLACEMENT_BOTTOM = isRTL() ? 'bottom-end' : 'bottom-start'\nconst PLACEMENT_BOTTOMEND = isRTL() ? 'bottom-start' : 'bottom-end'\nconst PLACEMENT_RIGHT = isRTL() ? 'left-start' : 'right-start'\nconst PLACEMENT_LEFT = isRTL() ? 'right-start' : 'left-start'\nconst PLACEMENT_TOPCENTER = 'top'\nconst PLACEMENT_BOTTOMCENTER = 'bottom'\n\nconst Default = {\n autoClose: true,\n boundary: 'clippingParents',\n display: 'dynamic',\n offset: [0, 2],\n popperConfig: null,\n reference: 'toggle'\n}\n\nconst DefaultType = {\n autoClose: '(boolean|string)',\n boundary: '(string|element)',\n display: 'string',\n offset: '(array|string|function)',\n popperConfig: '(null|object|function)',\n reference: '(string|element|object)'\n}\n\n/**\n * Class definition\n */\n\nclass Dropdown extends BaseComponent {\n constructor(element, config) {\n super(element, config)\n\n this._popper = null\n this._parent = this._element.parentNode // dropdown wrapper\n // TODO: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.3/forms/input-group/\n this._menu = SelectorEngine.next(this._element, SELECTOR_MENU)[0] ||\n SelectorEngine.prev(this._element, SELECTOR_MENU)[0] ||\n SelectorEngine.findOne(SELECTOR_MENU, this._parent)\n this._inNavbar = this._detectNavbar()\n }\n\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Public\n toggle() {\n return this._isShown() ? this.hide() : this.show()\n }\n\n show() {\n if (isDisabled(this._element) || this._isShown()) {\n return\n }\n\n const relatedTarget = {\n relatedTarget: this._element\n }\n\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW, relatedTarget)\n\n if (showEvent.defaultPrevented) {\n return\n }\n\n this._createPopper()\n\n // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n if ('ontouchstart' in document.documentElement && !this._parent.closest(SELECTOR_NAVBAR_NAV)) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop)\n }\n }\n\n this._element.focus()\n this._element.setAttribute('aria-expanded', true)\n\n this._menu.classList.add(CLASS_NAME_SHOW)\n this._element.classList.add(CLASS_NAME_SHOW)\n EventHandler.trigger(this._element, EVENT_SHOWN, relatedTarget)\n }\n\n hide() {\n if (isDisabled(this._element) || !this._isShown()) {\n return\n }\n\n const relatedTarget = {\n relatedTarget: this._element\n }\n\n this._completeHide(relatedTarget)\n }\n\n dispose() {\n if (this._popper) {\n this._popper.destroy()\n }\n\n super.dispose()\n }\n\n update() {\n this._inNavbar = this._detectNavbar()\n if (this._popper) {\n this._popper.update()\n }\n }\n\n // Private\n _completeHide(relatedTarget) {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE, relatedTarget)\n if (hideEvent.defaultPrevented) {\n return\n }\n\n // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop)\n }\n }\n\n if (this._popper) {\n this._popper.destroy()\n }\n\n this._menu.classList.remove(CLASS_NAME_SHOW)\n this._element.classList.remove(CLASS_NAME_SHOW)\n this._element.setAttribute('aria-expanded', 'false')\n Manipulator.removeDataAttribute(this._menu, 'popper')\n EventHandler.trigger(this._element, EVENT_HIDDEN, relatedTarget)\n }\n\n _getConfig(config) {\n config = super._getConfig(config)\n\n if (typeof config.reference === 'object' && !isElement(config.reference) &&\n typeof config.reference.getBoundingClientRect !== 'function'\n ) {\n // Popper virtual elements require a getBoundingClientRect method\n throw new TypeError(`${NAME.toUpperCase()}: Option \"reference\" provided type \"object\" without a required \"getBoundingClientRect\" method.`)\n }\n\n return config\n }\n\n _createPopper() {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s dropdowns require Popper (https://popper.js.org)')\n }\n\n let referenceElement = this._element\n\n if (this._config.reference === 'parent') {\n referenceElement = this._parent\n } else if (isElement(this._config.reference)) {\n referenceElement = getElement(this._config.reference)\n } else if (typeof this._config.reference === 'object') {\n referenceElement = this._config.reference\n }\n\n const popperConfig = this._getPopperConfig()\n this._popper = Popper.createPopper(referenceElement, this._menu, popperConfig)\n }\n\n _isShown() {\n return this._menu.classList.contains(CLASS_NAME_SHOW)\n }\n\n _getPlacement() {\n const parentDropdown = this._parent\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPEND)) {\n return PLACEMENT_RIGHT\n }\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPSTART)) {\n return PLACEMENT_LEFT\n }\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP_CENTER)) {\n return PLACEMENT_TOPCENTER\n }\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPDOWN_CENTER)) {\n return PLACEMENT_BOTTOMCENTER\n }\n\n // We need to trim the value because custom properties can also include spaces\n const isEnd = getComputedStyle(this._menu).getPropertyValue('--bs-position').trim() === 'end'\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP)) {\n return isEnd ? PLACEMENT_TOPEND : PLACEMENT_TOP\n }\n\n return isEnd ? PLACEMENT_BOTTOMEND : PLACEMENT_BOTTOM\n }\n\n _detectNavbar() {\n return this._element.closest(SELECTOR_NAVBAR) !== null\n }\n\n _getOffset() {\n const { offset } = this._config\n\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10))\n }\n\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element)\n }\n\n return offset\n }\n\n _getPopperConfig() {\n const defaultBsPopperConfig = {\n placement: this._getPlacement(),\n modifiers: [{\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n },\n {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }]\n }\n\n // Disable Popper if we have a static display or Dropdown is in Navbar\n if (this._inNavbar || this._config.display === 'static') {\n Manipulator.setDataAttribute(this._menu, 'popper', 'static') // TODO: v6 remove\n defaultBsPopperConfig.modifiers = [{\n name: 'applyStyles',\n enabled: false\n }]\n }\n\n return {\n ...defaultBsPopperConfig,\n ...execute(this._config.popperConfig, [defaultBsPopperConfig])\n }\n }\n\n _selectMenuItem({ key, target }) {\n const items = SelectorEngine.find(SELECTOR_VISIBLE_ITEMS, this._menu).filter(element => isVisible(element))\n\n if (!items.length) {\n return\n }\n\n // if target isn't included in items (e.g. when expanding the dropdown)\n // allow cycling to get the last item in case key equals ARROW_UP_KEY\n getNextActiveElement(items, target, key === ARROW_DOWN_KEY, !items.includes(target)).focus()\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Dropdown.getOrCreateInstance(this, config)\n\n if (typeof config !== 'string') {\n return\n }\n\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`)\n }\n\n data[config]()\n })\n }\n\n static clearMenus(event) {\n if (event.button === RIGHT_MOUSE_BUTTON || (event.type === 'keyup' && event.key !== TAB_KEY)) {\n return\n }\n\n const openToggles = SelectorEngine.find(SELECTOR_DATA_TOGGLE_SHOWN)\n\n for (const toggle of openToggles) {\n const context = Dropdown.getInstance(toggle)\n if (!context || context._config.autoClose === false) {\n continue\n }\n\n const composedPath = event.composedPath()\n const isMenuTarget = composedPath.includes(context._menu)\n if (\n composedPath.includes(context._element) ||\n (context._config.autoClose === 'inside' && !isMenuTarget) ||\n (context._config.autoClose === 'outside' && isMenuTarget)\n ) {\n continue\n }\n\n // Tab navigation through the dropdown menu or events from contained inputs shouldn't close the menu\n if (context._menu.contains(event.target) && ((event.type === 'keyup' && event.key === TAB_KEY) || /input|select|option|textarea|form/i.test(event.target.tagName))) {\n continue\n }\n\n const relatedTarget = { relatedTarget: context._element }\n\n if (event.type === 'click') {\n relatedTarget.clickEvent = event\n }\n\n context._completeHide(relatedTarget)\n }\n }\n\n static dataApiKeydownHandler(event) {\n // If not an UP | DOWN | ESCAPE key => not a dropdown command\n // If input/textarea && if key is other than ESCAPE => not a dropdown command\n\n const isInput = /input|textarea/i.test(event.target.tagName)\n const isEscapeEvent = event.key === ESCAPE_KEY\n const isUpOrDownEvent = [ARROW_UP_KEY, ARROW_DOWN_KEY].includes(event.key)\n\n if (!isUpOrDownEvent && !isEscapeEvent) {\n return\n }\n\n if (isInput && !isEscapeEvent) {\n return\n }\n\n event.preventDefault()\n\n // TODO: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.3/forms/input-group/\n const getToggleButton = this.matches(SELECTOR_DATA_TOGGLE) ?\n this :\n (SelectorEngine.prev(this, SELECTOR_DATA_TOGGLE)[0] ||\n SelectorEngine.next(this, SELECTOR_DATA_TOGGLE)[0] ||\n SelectorEngine.findOne(SELECTOR_DATA_TOGGLE, event.delegateTarget.parentNode))\n\n const instance = Dropdown.getOrCreateInstance(getToggleButton)\n\n if (isUpOrDownEvent) {\n event.stopPropagation()\n instance.show()\n instance._selectMenuItem(event)\n return\n }\n\n if (instance._isShown()) { // else is escape and we check if it is shown\n event.stopPropagation()\n instance.hide()\n getToggleButton.focus()\n }\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_DATA_TOGGLE, Dropdown.dataApiKeydownHandler)\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_MENU, Dropdown.dataApiKeydownHandler)\nEventHandler.on(document, EVENT_CLICK_DATA_API, Dropdown.clearMenus)\nEventHandler.on(document, EVENT_KEYUP_DATA_API, Dropdown.clearMenus)\nEventHandler.on(document, EVENT_CLICK_DATA_API, SELECTOR_DATA_TOGGLE, function (event) {\n event.preventDefault()\n Dropdown.getOrCreateInstance(this).toggle()\n})\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Dropdown)\n\nexport default Dropdown\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap util/backdrop.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport EventHandler from '../dom/event-handler.js'\nimport Config from './config.js'\nimport { execute, executeAfterTransition, getElement, reflow } from './index.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'backdrop'\nconst CLASS_NAME_FADE = 'fade'\nconst CLASS_NAME_SHOW = 'show'\nconst EVENT_MOUSEDOWN = `mousedown.bs.${NAME}`\n\nconst Default = {\n className: 'modal-backdrop',\n clickCallback: null,\n isAnimated: false,\n isVisible: true, // if false, we use the backdrop helper without adding any element to the dom\n rootElement: 'body' // give the choice to place backdrop under different elements\n}\n\nconst DefaultType = {\n className: 'string',\n clickCallback: '(function|null)',\n isAnimated: 'boolean',\n isVisible: 'boolean',\n rootElement: '(element|string)'\n}\n\n/**\n * Class definition\n */\n\nclass Backdrop extends Config {\n constructor(config) {\n super()\n this._config = this._getConfig(config)\n this._isAppended = false\n this._element = null\n }\n\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Public\n show(callback) {\n if (!this._config.isVisible) {\n execute(callback)\n return\n }\n\n this._append()\n\n const element = this._getElement()\n if (this._config.isAnimated) {\n reflow(element)\n }\n\n element.classList.add(CLASS_NAME_SHOW)\n\n this._emulateAnimation(() => {\n execute(callback)\n })\n }\n\n hide(callback) {\n if (!this._config.isVisible) {\n execute(callback)\n return\n }\n\n this._getElement().classList.remove(CLASS_NAME_SHOW)\n\n this._emulateAnimation(() => {\n this.dispose()\n execute(callback)\n })\n }\n\n dispose() {\n if (!this._isAppended) {\n return\n }\n\n EventHandler.off(this._element, EVENT_MOUSEDOWN)\n\n this._element.remove()\n this._isAppended = false\n }\n\n // Private\n _getElement() {\n if (!this._element) {\n const backdrop = document.createElement('div')\n backdrop.className = this._config.className\n if (this._config.isAnimated) {\n backdrop.classList.add(CLASS_NAME_FADE)\n }\n\n this._element = backdrop\n }\n\n return this._element\n }\n\n _configAfterMerge(config) {\n // use getElement() with the default \"body\" to get a fresh Element on each instantiation\n config.rootElement = getElement(config.rootElement)\n return config\n }\n\n _append() {\n if (this._isAppended) {\n return\n }\n\n const element = this._getElement()\n this._config.rootElement.append(element)\n\n EventHandler.on(element, EVENT_MOUSEDOWN, () => {\n execute(this._config.clickCallback)\n })\n\n this._isAppended = true\n }\n\n _emulateAnimation(callback) {\n executeAfterTransition(callback, this._getElement(), this._config.isAnimated)\n }\n}\n\nexport default Backdrop\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap util/focustrap.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport EventHandler from '../dom/event-handler.js'\nimport SelectorEngine from '../dom/selector-engine.js'\nimport Config from './config.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'focustrap'\nconst DATA_KEY = 'bs.focustrap'\nconst EVENT_KEY = `.${DATA_KEY}`\nconst EVENT_FOCUSIN = `focusin${EVENT_KEY}`\nconst EVENT_KEYDOWN_TAB = `keydown.tab${EVENT_KEY}`\n\nconst TAB_KEY = 'Tab'\nconst TAB_NAV_FORWARD = 'forward'\nconst TAB_NAV_BACKWARD = 'backward'\n\nconst Default = {\n autofocus: true,\n trapElement: null // The element to trap focus inside of\n}\n\nconst DefaultType = {\n autofocus: 'boolean',\n trapElement: 'element'\n}\n\n/**\n * Class definition\n */\n\nclass FocusTrap extends Config {\n constructor(config) {\n super()\n this._config = this._getConfig(config)\n this._isActive = false\n this._lastTabNavDirection = null\n }\n\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Public\n activate() {\n if (this._isActive) {\n return\n }\n\n if (this._config.autofocus) {\n this._config.trapElement.focus()\n }\n\n EventHandler.off(document, EVENT_KEY) // guard against infinite focus loop\n EventHandler.on(document, EVENT_FOCUSIN, event => this._handleFocusin(event))\n EventHandler.on(document, EVENT_KEYDOWN_TAB, event => this._handleKeydown(event))\n\n this._isActive = true\n }\n\n deactivate() {\n if (!this._isActive) {\n return\n }\n\n this._isActive = false\n EventHandler.off(document, EVENT_KEY)\n }\n\n // Private\n _handleFocusin(event) {\n const { trapElement } = this._config\n\n if (event.target === document || event.target === trapElement || trapElement.contains(event.target)) {\n return\n }\n\n const elements = SelectorEngine.focusableChildren(trapElement)\n\n if (elements.length === 0) {\n trapElement.focus()\n } else if (this._lastTabNavDirection === TAB_NAV_BACKWARD) {\n elements[elements.length - 1].focus()\n } else {\n elements[0].focus()\n }\n }\n\n _handleKeydown(event) {\n if (event.key !== TAB_KEY) {\n return\n }\n\n this._lastTabNavDirection = event.shiftKey ? TAB_NAV_BACKWARD : TAB_NAV_FORWARD\n }\n}\n\nexport default FocusTrap\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap util/scrollBar.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport Manipulator from '../dom/manipulator.js'\nimport SelectorEngine from '../dom/selector-engine.js'\nimport { isElement } from './index.js'\n\n/**\n * Constants\n */\n\nconst SELECTOR_FIXED_CONTENT = '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top'\nconst SELECTOR_STICKY_CONTENT = '.sticky-top'\nconst PROPERTY_PADDING = 'padding-right'\nconst PROPERTY_MARGIN = 'margin-right'\n\n/**\n * Class definition\n */\n\nclass ScrollBarHelper {\n constructor() {\n this._element = document.body\n }\n\n // Public\n getWidth() {\n // https://developer.mozilla.org/en-US/docs/Web/API/Window/innerWidth#usage_notes\n const documentWidth = document.documentElement.clientWidth\n return Math.abs(window.innerWidth - documentWidth)\n }\n\n hide() {\n const width = this.getWidth()\n this._disableOverFlow()\n // give padding to element to balance the hidden scrollbar width\n this._setElementAttributes(this._element, PROPERTY_PADDING, calculatedValue => calculatedValue + width)\n // trick: We adjust positive paddingRight and negative marginRight to sticky-top elements to keep showing fullwidth\n this._setElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING, calculatedValue => calculatedValue + width)\n this._setElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN, calculatedValue => calculatedValue - width)\n }\n\n reset() {\n this._resetElementAttributes(this._element, 'overflow')\n this._resetElementAttributes(this._element, PROPERTY_PADDING)\n this._resetElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING)\n this._resetElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN)\n }\n\n isOverflowing() {\n return this.getWidth() > 0\n }\n\n // Private\n _disableOverFlow() {\n this._saveInitialAttribute(this._element, 'overflow')\n this._element.style.overflow = 'hidden'\n }\n\n _setElementAttributes(selector, styleProperty, callback) {\n const scrollbarWidth = this.getWidth()\n const manipulationCallBack = element => {\n if (element !== this._element && window.innerWidth > element.clientWidth + scrollbarWidth) {\n return\n }\n\n this._saveInitialAttribute(element, styleProperty)\n const calculatedValue = window.getComputedStyle(element).getPropertyValue(styleProperty)\n element.style.setProperty(styleProperty, `${callback(Number.parseFloat(calculatedValue))}px`)\n }\n\n this._applyManipulationCallback(selector, manipulationCallBack)\n }\n\n _saveInitialAttribute(element, styleProperty) {\n const actualValue = element.style.getPropertyValue(styleProperty)\n if (actualValue) {\n Manipulator.setDataAttribute(element, styleProperty, actualValue)\n }\n }\n\n _resetElementAttributes(selector, styleProperty) {\n const manipulationCallBack = element => {\n const value = Manipulator.getDataAttribute(element, styleProperty)\n // We only want to remove the property if the value is `null`; the value can also be zero\n if (value === null) {\n element.style.removeProperty(styleProperty)\n return\n }\n\n Manipulator.removeDataAttribute(element, styleProperty)\n element.style.setProperty(styleProperty, value)\n }\n\n this._applyManipulationCallback(selector, manipulationCallBack)\n }\n\n _applyManipulationCallback(selector, callBack) {\n if (isElement(selector)) {\n callBack(selector)\n return\n }\n\n for (const sel of SelectorEngine.find(selector, this._element)) {\n callBack(sel)\n }\n }\n}\n\nexport default ScrollBarHelper\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap modal.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport BaseComponent from './base-component.js'\nimport EventHandler from './dom/event-handler.js'\nimport SelectorEngine from './dom/selector-engine.js'\nimport Backdrop from './util/backdrop.js'\nimport { enableDismissTrigger } from './util/component-functions.js'\nimport FocusTrap from './util/focustrap.js'\nimport { defineJQueryPlugin, isRTL, isVisible, reflow } from './util/index.js'\nimport ScrollBarHelper from './util/scrollbar.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'modal'\nconst DATA_KEY = 'bs.modal'\nconst EVENT_KEY = `.${DATA_KEY}`\nconst DATA_API_KEY = '.data-api'\nconst ESCAPE_KEY = 'Escape'\n\nconst EVENT_HIDE = `hide${EVENT_KEY}`\nconst EVENT_HIDE_PREVENTED = `hidePrevented${EVENT_KEY}`\nconst EVENT_HIDDEN = `hidden${EVENT_KEY}`\nconst EVENT_SHOW = `show${EVENT_KEY}`\nconst EVENT_SHOWN = `shown${EVENT_KEY}`\nconst EVENT_RESIZE = `resize${EVENT_KEY}`\nconst EVENT_CLICK_DISMISS = `click.dismiss${EVENT_KEY}`\nconst EVENT_MOUSEDOWN_DISMISS = `mousedown.dismiss${EVENT_KEY}`\nconst EVENT_KEYDOWN_DISMISS = `keydown.dismiss${EVENT_KEY}`\nconst EVENT_CLICK_DATA_API = `click${EVENT_KEY}${DATA_API_KEY}`\n\nconst CLASS_NAME_OPEN = 'modal-open'\nconst CLASS_NAME_FADE = 'fade'\nconst CLASS_NAME_SHOW = 'show'\nconst CLASS_NAME_STATIC = 'modal-static'\n\nconst OPEN_SELECTOR = '.modal.show'\nconst SELECTOR_DIALOG = '.modal-dialog'\nconst SELECTOR_MODAL_BODY = '.modal-body'\nconst SELECTOR_DATA_TOGGLE = '[data-bs-toggle=\"modal\"]'\n\nconst Default = {\n backdrop: true,\n focus: true,\n keyboard: true\n}\n\nconst DefaultType = {\n backdrop: '(boolean|string)',\n focus: 'boolean',\n keyboard: 'boolean'\n}\n\n/**\n * Class definition\n */\n\nclass Modal extends BaseComponent {\n constructor(element, config) {\n super(element, config)\n\n this._dialog = SelectorEngine.findOne(SELECTOR_DIALOG, this._element)\n this._backdrop = this._initializeBackDrop()\n this._focustrap = this._initializeFocusTrap()\n this._isShown = false\n this._isTransitioning = false\n this._scrollBar = new ScrollBarHelper()\n\n this._addEventListeners()\n }\n\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Public\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget)\n }\n\n show(relatedTarget) {\n if (this._isShown || this._isTransitioning) {\n return\n }\n\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW, {\n relatedTarget\n })\n\n if (showEvent.defaultPrevented) {\n return\n }\n\n this._isShown = true\n this._isTransitioning = true\n\n this._scrollBar.hide()\n\n document.body.classList.add(CLASS_NAME_OPEN)\n\n this._adjustDialog()\n\n this._backdrop.show(() => this._showElement(relatedTarget))\n }\n\n hide() {\n if (!this._isShown || this._isTransitioning) {\n return\n }\n\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE)\n\n if (hideEvent.defaultPrevented) {\n return\n }\n\n this._isShown = false\n this._isTransitioning = true\n this._focustrap.deactivate()\n\n this._element.classList.remove(CLASS_NAME_SHOW)\n\n this._queueCallback(() => this._hideModal(), this._element, this._isAnimated())\n }\n\n dispose() {\n EventHandler.off(window, EVENT_KEY)\n EventHandler.off(this._dialog, EVENT_KEY)\n\n this._backdrop.dispose()\n this._focustrap.deactivate()\n\n super.dispose()\n }\n\n handleUpdate() {\n this._adjustDialog()\n }\n\n // Private\n _initializeBackDrop() {\n return new Backdrop({\n isVisible: Boolean(this._config.backdrop), // 'static' option will be translated to true, and booleans will keep their value,\n isAnimated: this._isAnimated()\n })\n }\n\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n })\n }\n\n _showElement(relatedTarget) {\n // try to append dynamic modal\n if (!document.body.contains(this._element)) {\n document.body.append(this._element)\n }\n\n this._element.style.display = 'block'\n this._element.removeAttribute('aria-hidden')\n this._element.setAttribute('aria-modal', true)\n this._element.setAttribute('role', 'dialog')\n this._element.scrollTop = 0\n\n const modalBody = SelectorEngine.findOne(SELECTOR_MODAL_BODY, this._dialog)\n if (modalBody) {\n modalBody.scrollTop = 0\n }\n\n reflow(this._element)\n\n this._element.classList.add(CLASS_NAME_SHOW)\n\n const transitionComplete = () => {\n if (this._config.focus) {\n this._focustrap.activate()\n }\n\n this._isTransitioning = false\n EventHandler.trigger(this._element, EVENT_SHOWN, {\n relatedTarget\n })\n }\n\n this._queueCallback(transitionComplete, this._dialog, this._isAnimated())\n }\n\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS, event => {\n if (event.key !== ESCAPE_KEY) {\n return\n }\n\n if (this._config.keyboard) {\n this.hide()\n return\n }\n\n this._triggerBackdropTransition()\n })\n\n EventHandler.on(window, EVENT_RESIZE, () => {\n if (this._isShown && !this._isTransitioning) {\n this._adjustDialog()\n }\n })\n\n EventHandler.on(this._element, EVENT_MOUSEDOWN_DISMISS, event => {\n // a bad trick to segregate clicks that may start inside dialog but end outside, and avoid listen to scrollbar clicks\n EventHandler.one(this._element, EVENT_CLICK_DISMISS, event2 => {\n if (this._element !== event.target || this._element !== event2.target) {\n return\n }\n\n if (this._config.backdrop === 'static') {\n this._triggerBackdropTransition()\n return\n }\n\n if (this._config.backdrop) {\n this.hide()\n }\n })\n })\n }\n\n _hideModal() {\n this._element.style.display = 'none'\n this._element.setAttribute('aria-hidden', true)\n this._element.removeAttribute('aria-modal')\n this._element.removeAttribute('role')\n this._isTransitioning = false\n\n this._backdrop.hide(() => {\n document.body.classList.remove(CLASS_NAME_OPEN)\n this._resetAdjustments()\n this._scrollBar.reset()\n EventHandler.trigger(this._element, EVENT_HIDDEN)\n })\n }\n\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_FADE)\n }\n\n _triggerBackdropTransition() {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED)\n if (hideEvent.defaultPrevented) {\n return\n }\n\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight\n const initialOverflowY = this._element.style.overflowY\n // return if the following background transition hasn't yet completed\n if (initialOverflowY === 'hidden' || this._element.classList.contains(CLASS_NAME_STATIC)) {\n return\n }\n\n if (!isModalOverflowing) {\n this._element.style.overflowY = 'hidden'\n }\n\n this._element.classList.add(CLASS_NAME_STATIC)\n this._queueCallback(() => {\n this._element.classList.remove(CLASS_NAME_STATIC)\n this._queueCallback(() => {\n this._element.style.overflowY = initialOverflowY\n }, this._dialog)\n }, this._dialog)\n\n this._element.focus()\n }\n\n /**\n * The following methods are used to handle overflowing modals\n */\n\n _adjustDialog() {\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight\n const scrollbarWidth = this._scrollBar.getWidth()\n const isBodyOverflowing = scrollbarWidth > 0\n\n if (isBodyOverflowing && !isModalOverflowing) {\n const property = isRTL() ? 'paddingLeft' : 'paddingRight'\n this._element.style[property] = `${scrollbarWidth}px`\n }\n\n if (!isBodyOverflowing && isModalOverflowing) {\n const property = isRTL() ? 'paddingRight' : 'paddingLeft'\n this._element.style[property] = `${scrollbarWidth}px`\n }\n }\n\n _resetAdjustments() {\n this._element.style.paddingLeft = ''\n this._element.style.paddingRight = ''\n }\n\n // Static\n static jQueryInterface(config, relatedTarget) {\n return this.each(function () {\n const data = Modal.getOrCreateInstance(this, config)\n\n if (typeof config !== 'string') {\n return\n }\n\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`)\n }\n\n data[config](relatedTarget)\n })\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API, SELECTOR_DATA_TOGGLE, function (event) {\n const target = SelectorEngine.getElementFromSelector(this)\n\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault()\n }\n\n EventHandler.one(target, EVENT_SHOW, showEvent => {\n if (showEvent.defaultPrevented) {\n // only register focus restorer if modal will actually get shown\n return\n }\n\n EventHandler.one(target, EVENT_HIDDEN, () => {\n if (isVisible(this)) {\n this.focus()\n }\n })\n })\n\n // avoid conflict when clicking modal toggler while another one is open\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR)\n if (alreadyOpen) {\n Modal.getInstance(alreadyOpen).hide()\n }\n\n const data = Modal.getOrCreateInstance(target)\n\n data.toggle(this)\n})\n\nenableDismissTrigger(Modal)\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Modal)\n\nexport default Modal\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap offcanvas.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport BaseComponent from './base-component.js'\nimport EventHandler from './dom/event-handler.js'\nimport SelectorEngine from './dom/selector-engine.js'\nimport Backdrop from './util/backdrop.js'\nimport { enableDismissTrigger } from './util/component-functions.js'\nimport FocusTrap from './util/focustrap.js'\nimport {\n defineJQueryPlugin,\n isDisabled,\n isVisible\n} from './util/index.js'\nimport ScrollBarHelper from './util/scrollbar.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'offcanvas'\nconst DATA_KEY = 'bs.offcanvas'\nconst EVENT_KEY = `.${DATA_KEY}`\nconst DATA_API_KEY = '.data-api'\nconst EVENT_LOAD_DATA_API = `load${EVENT_KEY}${DATA_API_KEY}`\nconst ESCAPE_KEY = 'Escape'\n\nconst CLASS_NAME_SHOW = 'show'\nconst CLASS_NAME_SHOWING = 'showing'\nconst CLASS_NAME_HIDING = 'hiding'\nconst CLASS_NAME_BACKDROP = 'offcanvas-backdrop'\nconst OPEN_SELECTOR = '.offcanvas.show'\n\nconst EVENT_SHOW = `show${EVENT_KEY}`\nconst EVENT_SHOWN = `shown${EVENT_KEY}`\nconst EVENT_HIDE = `hide${EVENT_KEY}`\nconst EVENT_HIDE_PREVENTED = `hidePrevented${EVENT_KEY}`\nconst EVENT_HIDDEN = `hidden${EVENT_KEY}`\nconst EVENT_RESIZE = `resize${EVENT_KEY}`\nconst EVENT_CLICK_DATA_API = `click${EVENT_KEY}${DATA_API_KEY}`\nconst EVENT_KEYDOWN_DISMISS = `keydown.dismiss${EVENT_KEY}`\n\nconst SELECTOR_DATA_TOGGLE = '[data-bs-toggle=\"offcanvas\"]'\n\nconst Default = {\n backdrop: true,\n keyboard: true,\n scroll: false\n}\n\nconst DefaultType = {\n backdrop: '(boolean|string)',\n keyboard: 'boolean',\n scroll: 'boolean'\n}\n\n/**\n * Class definition\n */\n\nclass Offcanvas extends BaseComponent {\n constructor(element, config) {\n super(element, config)\n\n this._isShown = false\n this._backdrop = this._initializeBackDrop()\n this._focustrap = this._initializeFocusTrap()\n this._addEventListeners()\n }\n\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Public\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget)\n }\n\n show(relatedTarget) {\n if (this._isShown) {\n return\n }\n\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW, { relatedTarget })\n\n if (showEvent.defaultPrevented) {\n return\n }\n\n this._isShown = true\n this._backdrop.show()\n\n if (!this._config.scroll) {\n new ScrollBarHelper().hide()\n }\n\n this._element.setAttribute('aria-modal', true)\n this._element.setAttribute('role', 'dialog')\n this._element.classList.add(CLASS_NAME_SHOWING)\n\n const completeCallBack = () => {\n if (!this._config.scroll || this._config.backdrop) {\n this._focustrap.activate()\n }\n\n this._element.classList.add(CLASS_NAME_SHOW)\n this._element.classList.remove(CLASS_NAME_SHOWING)\n EventHandler.trigger(this._element, EVENT_SHOWN, { relatedTarget })\n }\n\n this._queueCallback(completeCallBack, this._element, true)\n }\n\n hide() {\n if (!this._isShown) {\n return\n }\n\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE)\n\n if (hideEvent.defaultPrevented) {\n return\n }\n\n this._focustrap.deactivate()\n this._element.blur()\n this._isShown = false\n this._element.classList.add(CLASS_NAME_HIDING)\n this._backdrop.hide()\n\n const completeCallback = () => {\n this._element.classList.remove(CLASS_NAME_SHOW, CLASS_NAME_HIDING)\n this._element.removeAttribute('aria-modal')\n this._element.removeAttribute('role')\n\n if (!this._config.scroll) {\n new ScrollBarHelper().reset()\n }\n\n EventHandler.trigger(this._element, EVENT_HIDDEN)\n }\n\n this._queueCallback(completeCallback, this._element, true)\n }\n\n dispose() {\n this._backdrop.dispose()\n this._focustrap.deactivate()\n super.dispose()\n }\n\n // Private\n _initializeBackDrop() {\n const clickCallback = () => {\n if (this._config.backdrop === 'static') {\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED)\n return\n }\n\n this.hide()\n }\n\n // 'static' option will be translated to true, and booleans will keep their value\n const isVisible = Boolean(this._config.backdrop)\n\n return new Backdrop({\n className: CLASS_NAME_BACKDROP,\n isVisible,\n isAnimated: true,\n rootElement: this._element.parentNode,\n clickCallback: isVisible ? clickCallback : null\n })\n }\n\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n })\n }\n\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS, event => {\n if (event.key !== ESCAPE_KEY) {\n return\n }\n\n if (this._config.keyboard) {\n this.hide()\n return\n }\n\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED)\n })\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Offcanvas.getOrCreateInstance(this, config)\n\n if (typeof config !== 'string') {\n return\n }\n\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`)\n }\n\n data[config](this)\n })\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API, SELECTOR_DATA_TOGGLE, function (event) {\n const target = SelectorEngine.getElementFromSelector(this)\n\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault()\n }\n\n if (isDisabled(this)) {\n return\n }\n\n EventHandler.one(target, EVENT_HIDDEN, () => {\n // focus on trigger when it is closed\n if (isVisible(this)) {\n this.focus()\n }\n })\n\n // avoid conflict when clicking a toggler of an offcanvas, while another is open\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR)\n if (alreadyOpen && alreadyOpen !== target) {\n Offcanvas.getInstance(alreadyOpen).hide()\n }\n\n const data = Offcanvas.getOrCreateInstance(target)\n data.toggle(this)\n})\n\nEventHandler.on(window, EVENT_LOAD_DATA_API, () => {\n for (const selector of SelectorEngine.find(OPEN_SELECTOR)) {\n Offcanvas.getOrCreateInstance(selector).show()\n }\n})\n\nEventHandler.on(window, EVENT_RESIZE, () => {\n for (const element of SelectorEngine.find('[aria-modal][class*=show][class*=offcanvas-]')) {\n if (getComputedStyle(element).position !== 'fixed') {\n Offcanvas.getOrCreateInstance(element).hide()\n }\n }\n})\n\nenableDismissTrigger(Offcanvas)\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Offcanvas)\n\nexport default Offcanvas\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap util/sanitizer.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n// js-docs-start allow-list\nconst ARIA_ATTRIBUTE_PATTERN = /^aria-[\\w-]*$/i\n\nexport const DefaultAllowlist = {\n // Global attributes allowed on any supplied element below.\n '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN],\n a: ['target', 'href', 'title', 'rel'],\n area: [],\n b: [],\n br: [],\n col: [],\n code: [],\n div: [],\n em: [],\n hr: [],\n h1: [],\n h2: [],\n h3: [],\n h4: [],\n h5: [],\n h6: [],\n i: [],\n img: ['src', 'srcset', 'alt', 'title', 'width', 'height'],\n li: [],\n ol: [],\n p: [],\n pre: [],\n s: [],\n small: [],\n span: [],\n sub: [],\n sup: [],\n strong: [],\n u: [],\n ul: []\n}\n// js-docs-end allow-list\n\nconst uriAttributes = new Set([\n 'background',\n 'cite',\n 'href',\n 'itemtype',\n 'longdesc',\n 'poster',\n 'src',\n 'xlink:href'\n])\n\n/**\n * A pattern that recognizes URLs that are safe wrt. XSS in URL navigation\n * contexts.\n *\n * Shout-out to Angular https://github.com/angular/angular/blob/15.2.8/packages/core/src/sanitization/url_sanitizer.ts#L38\n */\n// eslint-disable-next-line unicorn/better-regex\nconst SAFE_URL_PATTERN = /^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i\n\nconst allowedAttribute = (attribute, allowedAttributeList) => {\n const attributeName = attribute.nodeName.toLowerCase()\n\n if (allowedAttributeList.includes(attributeName)) {\n if (uriAttributes.has(attributeName)) {\n return Boolean(SAFE_URL_PATTERN.test(attribute.nodeValue))\n }\n\n return true\n }\n\n // Check if a regular expression validates the attribute.\n return allowedAttributeList.filter(attributeRegex => attributeRegex instanceof RegExp)\n .some(regex => regex.test(attributeName))\n}\n\nexport function sanitizeHtml(unsafeHtml, allowList, sanitizeFunction) {\n if (!unsafeHtml.length) {\n return unsafeHtml\n }\n\n if (sanitizeFunction && typeof sanitizeFunction === 'function') {\n return sanitizeFunction(unsafeHtml)\n }\n\n const domParser = new window.DOMParser()\n const createdDocument = domParser.parseFromString(unsafeHtml, 'text/html')\n const elements = [].concat(...createdDocument.body.querySelectorAll('*'))\n\n for (const element of elements) {\n const elementName = element.nodeName.toLowerCase()\n\n if (!Object.keys(allowList).includes(elementName)) {\n element.remove()\n continue\n }\n\n const attributeList = [].concat(...element.attributes)\n const allowedAttributes = [].concat(allowList['*'] || [], allowList[elementName] || [])\n\n for (const attribute of attributeList) {\n if (!allowedAttribute(attribute, allowedAttributes)) {\n element.removeAttribute(attribute.nodeName)\n }\n }\n }\n\n return createdDocument.body.innerHTML\n}\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap util/template-factory.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport SelectorEngine from '../dom/selector-engine.js'\nimport Config from './config.js'\nimport { DefaultAllowlist, sanitizeHtml } from './sanitizer.js'\nimport { execute, getElement, isElement } from './index.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'TemplateFactory'\n\nconst Default = {\n allowList: DefaultAllowlist,\n content: {}, // { selector : text , selector2 : text2 , }\n extraClass: '',\n html: false,\n sanitize: true,\n sanitizeFn: null,\n template: '
'\n}\n\nconst DefaultType = {\n allowList: 'object',\n content: 'object',\n extraClass: '(string|function)',\n html: 'boolean',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n template: 'string'\n}\n\nconst DefaultContentType = {\n entry: '(string|element|function|null)',\n selector: '(string|element)'\n}\n\n/**\n * Class definition\n */\n\nclass TemplateFactory extends Config {\n constructor(config) {\n super()\n this._config = this._getConfig(config)\n }\n\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Public\n getContent() {\n return Object.values(this._config.content)\n .map(config => this._resolvePossibleFunction(config))\n .filter(Boolean)\n }\n\n hasContent() {\n return this.getContent().length > 0\n }\n\n changeContent(content) {\n this._checkContent(content)\n this._config.content = { ...this._config.content, ...content }\n return this\n }\n\n toHtml() {\n const templateWrapper = document.createElement('div')\n templateWrapper.innerHTML = this._maybeSanitize(this._config.template)\n\n for (const [selector, text] of Object.entries(this._config.content)) {\n this._setContent(templateWrapper, text, selector)\n }\n\n const template = templateWrapper.children[0]\n const extraClass = this._resolvePossibleFunction(this._config.extraClass)\n\n if (extraClass) {\n template.classList.add(...extraClass.split(' '))\n }\n\n return template\n }\n\n // Private\n _typeCheckConfig(config) {\n super._typeCheckConfig(config)\n this._checkContent(config.content)\n }\n\n _checkContent(arg) {\n for (const [selector, content] of Object.entries(arg)) {\n super._typeCheckConfig({ selector, entry: content }, DefaultContentType)\n }\n }\n\n _setContent(template, content, selector) {\n const templateElement = SelectorEngine.findOne(selector, template)\n\n if (!templateElement) {\n return\n }\n\n content = this._resolvePossibleFunction(content)\n\n if (!content) {\n templateElement.remove()\n return\n }\n\n if (isElement(content)) {\n this._putElementInTemplate(getElement(content), templateElement)\n return\n }\n\n if (this._config.html) {\n templateElement.innerHTML = this._maybeSanitize(content)\n return\n }\n\n templateElement.textContent = content\n }\n\n _maybeSanitize(arg) {\n return this._config.sanitize ? sanitizeHtml(arg, this._config.allowList, this._config.sanitizeFn) : arg\n }\n\n _resolvePossibleFunction(arg) {\n return execute(arg, [this])\n }\n\n _putElementInTemplate(element, templateElement) {\n if (this._config.html) {\n templateElement.innerHTML = ''\n templateElement.append(element)\n return\n }\n\n templateElement.textContent = element.textContent\n }\n}\n\nexport default TemplateFactory\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap tooltip.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport * as Popper from '@popperjs/core'\nimport BaseComponent from './base-component.js'\nimport EventHandler from './dom/event-handler.js'\nimport Manipulator from './dom/manipulator.js'\nimport { defineJQueryPlugin, execute, findShadowRoot, getElement, getUID, isRTL, noop } from './util/index.js'\nimport { DefaultAllowlist } from './util/sanitizer.js'\nimport TemplateFactory from './util/template-factory.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'tooltip'\nconst DISALLOWED_ATTRIBUTES = new Set(['sanitize', 'allowList', 'sanitizeFn'])\n\nconst CLASS_NAME_FADE = 'fade'\nconst CLASS_NAME_MODAL = 'modal'\nconst CLASS_NAME_SHOW = 'show'\n\nconst SELECTOR_TOOLTIP_INNER = '.tooltip-inner'\nconst SELECTOR_MODAL = `.${CLASS_NAME_MODAL}`\n\nconst EVENT_MODAL_HIDE = 'hide.bs.modal'\n\nconst TRIGGER_HOVER = 'hover'\nconst TRIGGER_FOCUS = 'focus'\nconst TRIGGER_CLICK = 'click'\nconst TRIGGER_MANUAL = 'manual'\n\nconst EVENT_HIDE = 'hide'\nconst EVENT_HIDDEN = 'hidden'\nconst EVENT_SHOW = 'show'\nconst EVENT_SHOWN = 'shown'\nconst EVENT_INSERTED = 'inserted'\nconst EVENT_CLICK = 'click'\nconst EVENT_FOCUSIN = 'focusin'\nconst EVENT_FOCUSOUT = 'focusout'\nconst EVENT_MOUSEENTER = 'mouseenter'\nconst EVENT_MOUSELEAVE = 'mouseleave'\n\nconst AttachmentMap = {\n AUTO: 'auto',\n TOP: 'top',\n RIGHT: isRTL() ? 'left' : 'right',\n BOTTOM: 'bottom',\n LEFT: isRTL() ? 'right' : 'left'\n}\n\nconst Default = {\n allowList: DefaultAllowlist,\n animation: true,\n boundary: 'clippingParents',\n container: false,\n customClass: '',\n delay: 0,\n fallbackPlacements: ['top', 'right', 'bottom', 'left'],\n html: false,\n offset: [0, 6],\n placement: 'top',\n popperConfig: null,\n sanitize: true,\n sanitizeFn: null,\n selector: false,\n template: '',\n title: '',\n trigger: 'hover focus'\n}\n\nconst DefaultType = {\n allowList: 'object',\n animation: 'boolean',\n boundary: '(string|element)',\n container: '(string|element|boolean)',\n customClass: '(string|function)',\n delay: '(number|object)',\n fallbackPlacements: 'array',\n html: 'boolean',\n offset: '(array|string|function)',\n placement: '(string|function)',\n popperConfig: '(null|object|function)',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n selector: '(string|boolean)',\n template: 'string',\n title: '(string|element|function)',\n trigger: 'string'\n}\n\n/**\n * Class definition\n */\n\nclass Tooltip extends BaseComponent {\n constructor(element, config) {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s tooltips require Popper (https://popper.js.org)')\n }\n\n super(element, config)\n\n // Private\n this._isEnabled = true\n this._timeout = 0\n this._isHovered = null\n this._activeTrigger = {}\n this._popper = null\n this._templateFactory = null\n this._newContent = null\n\n // Protected\n this.tip = null\n\n this._setListeners()\n\n if (!this._config.selector) {\n this._fixTitle()\n }\n }\n\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Public\n enable() {\n this._isEnabled = true\n }\n\n disable() {\n this._isEnabled = false\n }\n\n toggleEnabled() {\n this._isEnabled = !this._isEnabled\n }\n\n toggle() {\n if (!this._isEnabled) {\n return\n }\n\n this._activeTrigger.click = !this._activeTrigger.click\n if (this._isShown()) {\n this._leave()\n return\n }\n\n this._enter()\n }\n\n dispose() {\n clearTimeout(this._timeout)\n\n EventHandler.off(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler)\n\n if (this._element.getAttribute('data-bs-original-title')) {\n this._element.setAttribute('title', this._element.getAttribute('data-bs-original-title'))\n }\n\n this._disposePopper()\n super.dispose()\n }\n\n show() {\n if (this._element.style.display === 'none') {\n throw new Error('Please use show on visible elements')\n }\n\n if (!(this._isWithContent() && this._isEnabled)) {\n return\n }\n\n const showEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOW))\n const shadowRoot = findShadowRoot(this._element)\n const isInTheDom = (shadowRoot || this._element.ownerDocument.documentElement).contains(this._element)\n\n if (showEvent.defaultPrevented || !isInTheDom) {\n return\n }\n\n // TODO: v6 remove this or make it optional\n this._disposePopper()\n\n const tip = this._getTipElement()\n\n this._element.setAttribute('aria-describedby', tip.getAttribute('id'))\n\n const { container } = this._config\n\n if (!this._element.ownerDocument.documentElement.contains(this.tip)) {\n container.append(tip)\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_INSERTED))\n }\n\n this._popper = this._createPopper(tip)\n\n tip.classList.add(CLASS_NAME_SHOW)\n\n // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop)\n }\n }\n\n const complete = () => {\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOWN))\n\n if (this._isHovered === false) {\n this._leave()\n }\n\n this._isHovered = false\n }\n\n this._queueCallback(complete, this.tip, this._isAnimated())\n }\n\n hide() {\n if (!this._isShown()) {\n return\n }\n\n const hideEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDE))\n if (hideEvent.defaultPrevented) {\n return\n }\n\n const tip = this._getTipElement()\n tip.classList.remove(CLASS_NAME_SHOW)\n\n // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop)\n }\n }\n\n this._activeTrigger[TRIGGER_CLICK] = false\n this._activeTrigger[TRIGGER_FOCUS] = false\n this._activeTrigger[TRIGGER_HOVER] = false\n this._isHovered = null // it is a trick to support manual triggering\n\n const complete = () => {\n if (this._isWithActiveTrigger()) {\n return\n }\n\n if (!this._isHovered) {\n this._disposePopper()\n }\n\n this._element.removeAttribute('aria-describedby')\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDDEN))\n }\n\n this._queueCallback(complete, this.tip, this._isAnimated())\n }\n\n update() {\n if (this._popper) {\n this._popper.update()\n }\n }\n\n // Protected\n _isWithContent() {\n return Boolean(this._getTitle())\n }\n\n _getTipElement() {\n if (!this.tip) {\n this.tip = this._createTipElement(this._newContent || this._getContentForTemplate())\n }\n\n return this.tip\n }\n\n _createTipElement(content) {\n const tip = this._getTemplateFactory(content).toHtml()\n\n // TODO: remove this check in v6\n if (!tip) {\n return null\n }\n\n tip.classList.remove(CLASS_NAME_FADE, CLASS_NAME_SHOW)\n // TODO: v6 the following can be achieved with CSS only\n tip.classList.add(`bs-${this.constructor.NAME}-auto`)\n\n const tipId = getUID(this.constructor.NAME).toString()\n\n tip.setAttribute('id', tipId)\n\n if (this._isAnimated()) {\n tip.classList.add(CLASS_NAME_FADE)\n }\n\n return tip\n }\n\n setContent(content) {\n this._newContent = content\n if (this._isShown()) {\n this._disposePopper()\n this.show()\n }\n }\n\n _getTemplateFactory(content) {\n if (this._templateFactory) {\n this._templateFactory.changeContent(content)\n } else {\n this._templateFactory = new TemplateFactory({\n ...this._config,\n // the `content` var has to be after `this._config`\n // to override config.content in case of popover\n content,\n extraClass: this._resolvePossibleFunction(this._config.customClass)\n })\n }\n\n return this._templateFactory\n }\n\n _getContentForTemplate() {\n return {\n [SELECTOR_TOOLTIP_INNER]: this._getTitle()\n }\n }\n\n _getTitle() {\n return this._resolvePossibleFunction(this._config.title) || this._element.getAttribute('data-bs-original-title')\n }\n\n // Private\n _initializeOnDelegatedTarget(event) {\n return this.constructor.getOrCreateInstance(event.delegateTarget, this._getDelegateConfig())\n }\n\n _isAnimated() {\n return this._config.animation || (this.tip && this.tip.classList.contains(CLASS_NAME_FADE))\n }\n\n _isShown() {\n return this.tip && this.tip.classList.contains(CLASS_NAME_SHOW)\n }\n\n _createPopper(tip) {\n const placement = execute(this._config.placement, [this, tip, this._element])\n const attachment = AttachmentMap[placement.toUpperCase()]\n return Popper.createPopper(this._element, tip, this._getPopperConfig(attachment))\n }\n\n _getOffset() {\n const { offset } = this._config\n\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10))\n }\n\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element)\n }\n\n return offset\n }\n\n _resolvePossibleFunction(arg) {\n return execute(arg, [this._element])\n }\n\n _getPopperConfig(attachment) {\n const defaultBsPopperConfig = {\n placement: attachment,\n modifiers: [\n {\n name: 'flip',\n options: {\n fallbackPlacements: this._config.fallbackPlacements\n }\n },\n {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n },\n {\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n },\n {\n name: 'arrow',\n options: {\n element: `.${this.constructor.NAME}-arrow`\n }\n },\n {\n name: 'preSetPlacement',\n enabled: true,\n phase: 'beforeMain',\n fn: data => {\n // Pre-set Popper's placement attribute in order to read the arrow sizes properly.\n // Otherwise, Popper mixes up the width and height dimensions since the initial arrow style is for top placement\n this._getTipElement().setAttribute('data-popper-placement', data.state.placement)\n }\n }\n ]\n }\n\n return {\n ...defaultBsPopperConfig,\n ...execute(this._config.popperConfig, [defaultBsPopperConfig])\n }\n }\n\n _setListeners() {\n const triggers = this._config.trigger.split(' ')\n\n for (const trigger of triggers) {\n if (trigger === 'click') {\n EventHandler.on(this._element, this.constructor.eventName(EVENT_CLICK), this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event)\n context.toggle()\n })\n } else if (trigger !== TRIGGER_MANUAL) {\n const eventIn = trigger === TRIGGER_HOVER ?\n this.constructor.eventName(EVENT_MOUSEENTER) :\n this.constructor.eventName(EVENT_FOCUSIN)\n const eventOut = trigger === TRIGGER_HOVER ?\n this.constructor.eventName(EVENT_MOUSELEAVE) :\n this.constructor.eventName(EVENT_FOCUSOUT)\n\n EventHandler.on(this._element, eventIn, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event)\n context._activeTrigger[event.type === 'focusin' ? TRIGGER_FOCUS : TRIGGER_HOVER] = true\n context._enter()\n })\n EventHandler.on(this._element, eventOut, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event)\n context._activeTrigger[event.type === 'focusout' ? TRIGGER_FOCUS : TRIGGER_HOVER] =\n context._element.contains(event.relatedTarget)\n\n context._leave()\n })\n }\n }\n\n this._hideModalHandler = () => {\n if (this._element) {\n this.hide()\n }\n }\n\n EventHandler.on(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler)\n }\n\n _fixTitle() {\n const title = this._element.getAttribute('title')\n\n if (!title) {\n return\n }\n\n if (!this._element.getAttribute('aria-label') && !this._element.textContent.trim()) {\n this._element.setAttribute('aria-label', title)\n }\n\n this._element.setAttribute('data-bs-original-title', title) // DO NOT USE IT. Is only for backwards compatibility\n this._element.removeAttribute('title')\n }\n\n _enter() {\n if (this._isShown() || this._isHovered) {\n this._isHovered = true\n return\n }\n\n this._isHovered = true\n\n this._setTimeout(() => {\n if (this._isHovered) {\n this.show()\n }\n }, this._config.delay.show)\n }\n\n _leave() {\n if (this._isWithActiveTrigger()) {\n return\n }\n\n this._isHovered = false\n\n this._setTimeout(() => {\n if (!this._isHovered) {\n this.hide()\n }\n }, this._config.delay.hide)\n }\n\n _setTimeout(handler, timeout) {\n clearTimeout(this._timeout)\n this._timeout = setTimeout(handler, timeout)\n }\n\n _isWithActiveTrigger() {\n return Object.values(this._activeTrigger).includes(true)\n }\n\n _getConfig(config) {\n const dataAttributes = Manipulator.getDataAttributes(this._element)\n\n for (const dataAttribute of Object.keys(dataAttributes)) {\n if (DISALLOWED_ATTRIBUTES.has(dataAttribute)) {\n delete dataAttributes[dataAttribute]\n }\n }\n\n config = {\n ...dataAttributes,\n ...(typeof config === 'object' && config ? config : {})\n }\n config = this._mergeConfigObj(config)\n config = this._configAfterMerge(config)\n this._typeCheckConfig(config)\n return config\n }\n\n _configAfterMerge(config) {\n config.container = config.container === false ? document.body : getElement(config.container)\n\n if (typeof config.delay === 'number') {\n config.delay = {\n show: config.delay,\n hide: config.delay\n }\n }\n\n if (typeof config.title === 'number') {\n config.title = config.title.toString()\n }\n\n if (typeof config.content === 'number') {\n config.content = config.content.toString()\n }\n\n return config\n }\n\n _getDelegateConfig() {\n const config = {}\n\n for (const [key, value] of Object.entries(this._config)) {\n if (this.constructor.Default[key] !== value) {\n config[key] = value\n }\n }\n\n config.selector = false\n config.trigger = 'manual'\n\n // In the future can be replaced with:\n // const keysWithDifferentValues = Object.entries(this._config).filter(entry => this.constructor.Default[entry[0]] !== this._config[entry[0]])\n // `Object.fromEntries(keysWithDifferentValues)`\n return config\n }\n\n _disposePopper() {\n if (this._popper) {\n this._popper.destroy()\n this._popper = null\n }\n\n if (this.tip) {\n this.tip.remove()\n this.tip = null\n }\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Tooltip.getOrCreateInstance(this, config)\n\n if (typeof config !== 'string') {\n return\n }\n\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`)\n }\n\n data[config]()\n })\n }\n}\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Tooltip)\n\nexport default Tooltip\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap popover.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport Tooltip from './tooltip.js'\nimport { defineJQueryPlugin } from './util/index.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'popover'\n\nconst SELECTOR_TITLE = '.popover-header'\nconst SELECTOR_CONTENT = '.popover-body'\n\nconst Default = {\n ...Tooltip.Default,\n content: '',\n offset: [0, 8],\n placement: 'right',\n template: '' +\n '
' +\n '' +\n '
' +\n '
',\n trigger: 'click'\n}\n\nconst DefaultType = {\n ...Tooltip.DefaultType,\n content: '(null|string|element|function)'\n}\n\n/**\n * Class definition\n */\n\nclass Popover extends Tooltip {\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Overrides\n _isWithContent() {\n return this._getTitle() || this._getContent()\n }\n\n // Private\n _getContentForTemplate() {\n return {\n [SELECTOR_TITLE]: this._getTitle(),\n [SELECTOR_CONTENT]: this._getContent()\n }\n }\n\n _getContent() {\n return this._resolvePossibleFunction(this._config.content)\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Popover.getOrCreateInstance(this, config)\n\n if (typeof config !== 'string') {\n return\n }\n\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`)\n }\n\n data[config]()\n })\n }\n}\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Popover)\n\nexport default Popover\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap scrollspy.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport BaseComponent from './base-component.js'\nimport EventHandler from './dom/event-handler.js'\nimport SelectorEngine from './dom/selector-engine.js'\nimport { defineJQueryPlugin, getElement, isDisabled, isVisible } from './util/index.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'scrollspy'\nconst DATA_KEY = 'bs.scrollspy'\nconst EVENT_KEY = `.${DATA_KEY}`\nconst DATA_API_KEY = '.data-api'\n\nconst EVENT_ACTIVATE = `activate${EVENT_KEY}`\nconst EVENT_CLICK = `click${EVENT_KEY}`\nconst EVENT_LOAD_DATA_API = `load${EVENT_KEY}${DATA_API_KEY}`\n\nconst CLASS_NAME_DROPDOWN_ITEM = 'dropdown-item'\nconst CLASS_NAME_ACTIVE = 'active'\n\nconst SELECTOR_DATA_SPY = '[data-bs-spy=\"scroll\"]'\nconst SELECTOR_TARGET_LINKS = '[href]'\nconst SELECTOR_NAV_LIST_GROUP = '.nav, .list-group'\nconst SELECTOR_NAV_LINKS = '.nav-link'\nconst SELECTOR_NAV_ITEMS = '.nav-item'\nconst SELECTOR_LIST_ITEMS = '.list-group-item'\nconst SELECTOR_LINK_ITEMS = `${SELECTOR_NAV_LINKS}, ${SELECTOR_NAV_ITEMS} > ${SELECTOR_NAV_LINKS}, ${SELECTOR_LIST_ITEMS}`\nconst SELECTOR_DROPDOWN = '.dropdown'\nconst SELECTOR_DROPDOWN_TOGGLE = '.dropdown-toggle'\n\nconst Default = {\n offset: null, // TODO: v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: '0px 0px -25%',\n smoothScroll: false,\n target: null,\n threshold: [0.1, 0.5, 1]\n}\n\nconst DefaultType = {\n offset: '(number|null)', // TODO v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: 'string',\n smoothScroll: 'boolean',\n target: 'element',\n threshold: 'array'\n}\n\n/**\n * Class definition\n */\n\nclass ScrollSpy extends BaseComponent {\n constructor(element, config) {\n super(element, config)\n\n // this._element is the observablesContainer and config.target the menu links wrapper\n this._targetLinks = new Map()\n this._observableSections = new Map()\n this._rootElement = getComputedStyle(this._element).overflowY === 'visible' ? null : this._element\n this._activeTarget = null\n this._observer = null\n this._previousScrollData = {\n visibleEntryTop: 0,\n parentScrollTop: 0\n }\n this.refresh() // initialize\n }\n\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Public\n refresh() {\n this._initializeTargetsAndObservables()\n this._maybeEnableSmoothScroll()\n\n if (this._observer) {\n this._observer.disconnect()\n } else {\n this._observer = this._getNewObserver()\n }\n\n for (const section of this._observableSections.values()) {\n this._observer.observe(section)\n }\n }\n\n dispose() {\n this._observer.disconnect()\n super.dispose()\n }\n\n // Private\n _configAfterMerge(config) {\n // TODO: on v6 target should be given explicitly & remove the {target: 'ss-target'} case\n config.target = getElement(config.target) || document.body\n\n // TODO: v6 Only for backwards compatibility reasons. Use rootMargin only\n config.rootMargin = config.offset ? `${config.offset}px 0px -30%` : config.rootMargin\n\n if (typeof config.threshold === 'string') {\n config.threshold = config.threshold.split(',').map(value => Number.parseFloat(value))\n }\n\n return config\n }\n\n _maybeEnableSmoothScroll() {\n if (!this._config.smoothScroll) {\n return\n }\n\n // unregister any previous listeners\n EventHandler.off(this._config.target, EVENT_CLICK)\n\n EventHandler.on(this._config.target, EVENT_CLICK, SELECTOR_TARGET_LINKS, event => {\n const observableSection = this._observableSections.get(event.target.hash)\n if (observableSection) {\n event.preventDefault()\n const root = this._rootElement || window\n const height = observableSection.offsetTop - this._element.offsetTop\n if (root.scrollTo) {\n root.scrollTo({ top: height, behavior: 'smooth' })\n return\n }\n\n // Chrome 60 doesn't support `scrollTo`\n root.scrollTop = height\n }\n })\n }\n\n _getNewObserver() {\n const options = {\n root: this._rootElement,\n threshold: this._config.threshold,\n rootMargin: this._config.rootMargin\n }\n\n return new IntersectionObserver(entries => this._observerCallback(entries), options)\n }\n\n // The logic of selection\n _observerCallback(entries) {\n const targetElement = entry => this._targetLinks.get(`#${entry.target.id}`)\n const activate = entry => {\n this._previousScrollData.visibleEntryTop = entry.target.offsetTop\n this._process(targetElement(entry))\n }\n\n const parentScrollTop = (this._rootElement || document.documentElement).scrollTop\n const userScrollsDown = parentScrollTop >= this._previousScrollData.parentScrollTop\n this._previousScrollData.parentScrollTop = parentScrollTop\n\n for (const entry of entries) {\n if (!entry.isIntersecting) {\n this._activeTarget = null\n this._clearActiveClass(targetElement(entry))\n\n continue\n }\n\n const entryIsLowerThanPrevious = entry.target.offsetTop >= this._previousScrollData.visibleEntryTop\n // if we are scrolling down, pick the bigger offsetTop\n if (userScrollsDown && entryIsLowerThanPrevious) {\n activate(entry)\n // if parent isn't scrolled, let's keep the first visible item, breaking the iteration\n if (!parentScrollTop) {\n return\n }\n\n continue\n }\n\n // if we are scrolling up, pick the smallest offsetTop\n if (!userScrollsDown && !entryIsLowerThanPrevious) {\n activate(entry)\n }\n }\n }\n\n _initializeTargetsAndObservables() {\n this._targetLinks = new Map()\n this._observableSections = new Map()\n\n const targetLinks = SelectorEngine.find(SELECTOR_TARGET_LINKS, this._config.target)\n\n for (const anchor of targetLinks) {\n // ensure that the anchor has an id and is not disabled\n if (!anchor.hash || isDisabled(anchor)) {\n continue\n }\n\n const observableSection = SelectorEngine.findOne(decodeURI(anchor.hash), this._element)\n\n // ensure that the observableSection exists & is visible\n if (isVisible(observableSection)) {\n this._targetLinks.set(decodeURI(anchor.hash), anchor)\n this._observableSections.set(anchor.hash, observableSection)\n }\n }\n }\n\n _process(target) {\n if (this._activeTarget === target) {\n return\n }\n\n this._clearActiveClass(this._config.target)\n this._activeTarget = target\n target.classList.add(CLASS_NAME_ACTIVE)\n this._activateParents(target)\n\n EventHandler.trigger(this._element, EVENT_ACTIVATE, { relatedTarget: target })\n }\n\n _activateParents(target) {\n // Activate dropdown parents\n if (target.classList.contains(CLASS_NAME_DROPDOWN_ITEM)) {\n SelectorEngine.findOne(SELECTOR_DROPDOWN_TOGGLE, target.closest(SELECTOR_DROPDOWN))\n .classList.add(CLASS_NAME_ACTIVE)\n return\n }\n\n for (const listGroup of SelectorEngine.parents(target, SELECTOR_NAV_LIST_GROUP)) {\n // Set triggered links parents as active\n // With both and markup a parent is the previous sibling of any nav ancestor\n for (const item of SelectorEngine.prev(listGroup, SELECTOR_LINK_ITEMS)) {\n item.classList.add(CLASS_NAME_ACTIVE)\n }\n }\n }\n\n _clearActiveClass(parent) {\n parent.classList.remove(CLASS_NAME_ACTIVE)\n\n const activeNodes = SelectorEngine.find(`${SELECTOR_TARGET_LINKS}.${CLASS_NAME_ACTIVE}`, parent)\n for (const node of activeNodes) {\n node.classList.remove(CLASS_NAME_ACTIVE)\n }\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = ScrollSpy.getOrCreateInstance(this, config)\n\n if (typeof config !== 'string') {\n return\n }\n\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`)\n }\n\n data[config]()\n })\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(window, EVENT_LOAD_DATA_API, () => {\n for (const spy of SelectorEngine.find(SELECTOR_DATA_SPY)) {\n ScrollSpy.getOrCreateInstance(spy)\n }\n})\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(ScrollSpy)\n\nexport default ScrollSpy\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap tab.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport BaseComponent from './base-component.js'\nimport EventHandler from './dom/event-handler.js'\nimport SelectorEngine from './dom/selector-engine.js'\nimport { defineJQueryPlugin, getNextActiveElement, isDisabled } from './util/index.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'tab'\nconst DATA_KEY = 'bs.tab'\nconst EVENT_KEY = `.${DATA_KEY}`\n\nconst EVENT_HIDE = `hide${EVENT_KEY}`\nconst EVENT_HIDDEN = `hidden${EVENT_KEY}`\nconst EVENT_SHOW = `show${EVENT_KEY}`\nconst EVENT_SHOWN = `shown${EVENT_KEY}`\nconst EVENT_CLICK_DATA_API = `click${EVENT_KEY}`\nconst EVENT_KEYDOWN = `keydown${EVENT_KEY}`\nconst EVENT_LOAD_DATA_API = `load${EVENT_KEY}`\n\nconst ARROW_LEFT_KEY = 'ArrowLeft'\nconst ARROW_RIGHT_KEY = 'ArrowRight'\nconst ARROW_UP_KEY = 'ArrowUp'\nconst ARROW_DOWN_KEY = 'ArrowDown'\nconst HOME_KEY = 'Home'\nconst END_KEY = 'End'\n\nconst CLASS_NAME_ACTIVE = 'active'\nconst CLASS_NAME_FADE = 'fade'\nconst CLASS_NAME_SHOW = 'show'\nconst CLASS_DROPDOWN = 'dropdown'\n\nconst SELECTOR_DROPDOWN_TOGGLE = '.dropdown-toggle'\nconst SELECTOR_DROPDOWN_MENU = '.dropdown-menu'\nconst NOT_SELECTOR_DROPDOWN_TOGGLE = ':not(.dropdown-toggle)'\n\nconst SELECTOR_TAB_PANEL = '.list-group, .nav, [role=\"tablist\"]'\nconst SELECTOR_OUTER = '.nav-item, .list-group-item'\nconst SELECTOR_INNER = `.nav-link${NOT_SELECTOR_DROPDOWN_TOGGLE}, .list-group-item${NOT_SELECTOR_DROPDOWN_TOGGLE}, [role=\"tab\"]${NOT_SELECTOR_DROPDOWN_TOGGLE}`\nconst SELECTOR_DATA_TOGGLE = '[data-bs-toggle=\"tab\"], [data-bs-toggle=\"pill\"], [data-bs-toggle=\"list\"]' // TODO: could only be `tab` in v6\nconst SELECTOR_INNER_ELEM = `${SELECTOR_INNER}, ${SELECTOR_DATA_TOGGLE}`\n\nconst SELECTOR_DATA_TOGGLE_ACTIVE = `.${CLASS_NAME_ACTIVE}[data-bs-toggle=\"tab\"], .${CLASS_NAME_ACTIVE}[data-bs-toggle=\"pill\"], .${CLASS_NAME_ACTIVE}[data-bs-toggle=\"list\"]`\n\n/**\n * Class definition\n */\n\nclass Tab extends BaseComponent {\n constructor(element) {\n super(element)\n this._parent = this._element.closest(SELECTOR_TAB_PANEL)\n\n if (!this._parent) {\n return\n // TODO: should throw exception in v6\n // throw new TypeError(`${element.outerHTML} has not a valid parent ${SELECTOR_INNER_ELEM}`)\n }\n\n // Set up initial aria attributes\n this._setInitialAttributes(this._parent, this._getChildren())\n\n EventHandler.on(this._element, EVENT_KEYDOWN, event => this._keydown(event))\n }\n\n // Getters\n static get NAME() {\n return NAME\n }\n\n // Public\n show() { // Shows this elem and deactivate the active sibling if exists\n const innerElem = this._element\n if (this._elemIsActive(innerElem)) {\n return\n }\n\n // Search for active tab on same parent to deactivate it\n const active = this._getActiveElem()\n\n const hideEvent = active ?\n EventHandler.trigger(active, EVENT_HIDE, { relatedTarget: innerElem }) :\n null\n\n const showEvent = EventHandler.trigger(innerElem, EVENT_SHOW, { relatedTarget: active })\n\n if (showEvent.defaultPrevented || (hideEvent && hideEvent.defaultPrevented)) {\n return\n }\n\n this._deactivate(active, innerElem)\n this._activate(innerElem, active)\n }\n\n // Private\n _activate(element, relatedElem) {\n if (!element) {\n return\n }\n\n element.classList.add(CLASS_NAME_ACTIVE)\n\n this._activate(SelectorEngine.getElementFromSelector(element)) // Search and activate/show the proper section\n\n const complete = () => {\n if (element.getAttribute('role') !== 'tab') {\n element.classList.add(CLASS_NAME_SHOW)\n return\n }\n\n element.removeAttribute('tabindex')\n element.setAttribute('aria-selected', true)\n this._toggleDropDown(element, true)\n EventHandler.trigger(element, EVENT_SHOWN, {\n relatedTarget: relatedElem\n })\n }\n\n this._queueCallback(complete, element, element.classList.contains(CLASS_NAME_FADE))\n }\n\n _deactivate(element, relatedElem) {\n if (!element) {\n return\n }\n\n element.classList.remove(CLASS_NAME_ACTIVE)\n element.blur()\n\n this._deactivate(SelectorEngine.getElementFromSelector(element)) // Search and deactivate the shown section too\n\n const complete = () => {\n if (element.getAttribute('role') !== 'tab') {\n element.classList.remove(CLASS_NAME_SHOW)\n return\n }\n\n element.setAttribute('aria-selected', false)\n element.setAttribute('tabindex', '-1')\n this._toggleDropDown(element, false)\n EventHandler.trigger(element, EVENT_HIDDEN, { relatedTarget: relatedElem })\n }\n\n this._queueCallback(complete, element, element.classList.contains(CLASS_NAME_FADE))\n }\n\n _keydown(event) {\n if (!([ARROW_LEFT_KEY, ARROW_RIGHT_KEY, ARROW_UP_KEY, ARROW_DOWN_KEY, HOME_KEY, END_KEY].includes(event.key))) {\n return\n }\n\n event.stopPropagation()// stopPropagation/preventDefault both added to support up/down keys without scrolling the page\n event.preventDefault()\n\n const children = this._getChildren().filter(element => !isDisabled(element))\n let nextActiveElement\n\n if ([HOME_KEY, END_KEY].includes(event.key)) {\n nextActiveElement = children[event.key === HOME_KEY ? 0 : children.length - 1]\n } else {\n const isNext = [ARROW_RIGHT_KEY, ARROW_DOWN_KEY].includes(event.key)\n nextActiveElement = getNextActiveElement(children, event.target, isNext, true)\n }\n\n if (nextActiveElement) {\n nextActiveElement.focus({ preventScroll: true })\n Tab.getOrCreateInstance(nextActiveElement).show()\n }\n }\n\n _getChildren() { // collection of inner elements\n return SelectorEngine.find(SELECTOR_INNER_ELEM, this._parent)\n }\n\n _getActiveElem() {\n return this._getChildren().find(child => this._elemIsActive(child)) || null\n }\n\n _setInitialAttributes(parent, children) {\n this._setAttributeIfNotExists(parent, 'role', 'tablist')\n\n for (const child of children) {\n this._setInitialAttributesOnChild(child)\n }\n }\n\n _setInitialAttributesOnChild(child) {\n child = this._getInnerElement(child)\n const isActive = this._elemIsActive(child)\n const outerElem = this._getOuterElement(child)\n child.setAttribute('aria-selected', isActive)\n\n if (outerElem !== child) {\n this._setAttributeIfNotExists(outerElem, 'role', 'presentation')\n }\n\n if (!isActive) {\n child.setAttribute('tabindex', '-1')\n }\n\n this._setAttributeIfNotExists(child, 'role', 'tab')\n\n // set attributes to the related panel too\n this._setInitialAttributesOnTargetPanel(child)\n }\n\n _setInitialAttributesOnTargetPanel(child) {\n const target = SelectorEngine.getElementFromSelector(child)\n\n if (!target) {\n return\n }\n\n this._setAttributeIfNotExists(target, 'role', 'tabpanel')\n\n if (child.id) {\n this._setAttributeIfNotExists(target, 'aria-labelledby', `${child.id}`)\n }\n }\n\n _toggleDropDown(element, open) {\n const outerElem = this._getOuterElement(element)\n if (!outerElem.classList.contains(CLASS_DROPDOWN)) {\n return\n }\n\n const toggle = (selector, className) => {\n const element = SelectorEngine.findOne(selector, outerElem)\n if (element) {\n element.classList.toggle(className, open)\n }\n }\n\n toggle(SELECTOR_DROPDOWN_TOGGLE, CLASS_NAME_ACTIVE)\n toggle(SELECTOR_DROPDOWN_MENU, CLASS_NAME_SHOW)\n outerElem.setAttribute('aria-expanded', open)\n }\n\n _setAttributeIfNotExists(element, attribute, value) {\n if (!element.hasAttribute(attribute)) {\n element.setAttribute(attribute, value)\n }\n }\n\n _elemIsActive(elem) {\n return elem.classList.contains(CLASS_NAME_ACTIVE)\n }\n\n // Try to get the inner element (usually the .nav-link)\n _getInnerElement(elem) {\n return elem.matches(SELECTOR_INNER_ELEM) ? elem : SelectorEngine.findOne(SELECTOR_INNER_ELEM, elem)\n }\n\n // Try to get the outer element (usually the .nav-item)\n _getOuterElement(elem) {\n return elem.closest(SELECTOR_OUTER) || elem\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Tab.getOrCreateInstance(this)\n\n if (typeof config !== 'string') {\n return\n }\n\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`)\n }\n\n data[config]()\n })\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API, SELECTOR_DATA_TOGGLE, function (event) {\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault()\n }\n\n if (isDisabled(this)) {\n return\n }\n\n Tab.getOrCreateInstance(this).show()\n})\n\n/**\n * Initialize on focus\n */\nEventHandler.on(window, EVENT_LOAD_DATA_API, () => {\n for (const element of SelectorEngine.find(SELECTOR_DATA_TOGGLE_ACTIVE)) {\n Tab.getOrCreateInstance(element)\n }\n})\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Tab)\n\nexport default Tab\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap toast.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport BaseComponent from './base-component.js'\nimport EventHandler from './dom/event-handler.js'\nimport { enableDismissTrigger } from './util/component-functions.js'\nimport { defineJQueryPlugin, reflow } from './util/index.js'\n\n/**\n * Constants\n */\n\nconst NAME = 'toast'\nconst DATA_KEY = 'bs.toast'\nconst EVENT_KEY = `.${DATA_KEY}`\n\nconst EVENT_MOUSEOVER = `mouseover${EVENT_KEY}`\nconst EVENT_MOUSEOUT = `mouseout${EVENT_KEY}`\nconst EVENT_FOCUSIN = `focusin${EVENT_KEY}`\nconst EVENT_FOCUSOUT = `focusout${EVENT_KEY}`\nconst EVENT_HIDE = `hide${EVENT_KEY}`\nconst EVENT_HIDDEN = `hidden${EVENT_KEY}`\nconst EVENT_SHOW = `show${EVENT_KEY}`\nconst EVENT_SHOWN = `shown${EVENT_KEY}`\n\nconst CLASS_NAME_FADE = 'fade'\nconst CLASS_NAME_HIDE = 'hide' // @deprecated - kept here only for backwards compatibility\nconst CLASS_NAME_SHOW = 'show'\nconst CLASS_NAME_SHOWING = 'showing'\n\nconst DefaultType = {\n animation: 'boolean',\n autohide: 'boolean',\n delay: 'number'\n}\n\nconst Default = {\n animation: true,\n autohide: true,\n delay: 5000\n}\n\n/**\n * Class definition\n */\n\nclass Toast extends BaseComponent {\n constructor(element, config) {\n super(element, config)\n\n this._timeout = null\n this._hasMouseInteraction = false\n this._hasKeyboardInteraction = false\n this._setListeners()\n }\n\n // Getters\n static get Default() {\n return Default\n }\n\n static get DefaultType() {\n return DefaultType\n }\n\n static get NAME() {\n return NAME\n }\n\n // Public\n show() {\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW)\n\n if (showEvent.defaultPrevented) {\n return\n }\n\n this._clearTimeout()\n\n if (this._config.animation) {\n this._element.classList.add(CLASS_NAME_FADE)\n }\n\n const complete = () => {\n this._element.classList.remove(CLASS_NAME_SHOWING)\n EventHandler.trigger(this._element, EVENT_SHOWN)\n\n this._maybeScheduleHide()\n }\n\n this._element.classList.remove(CLASS_NAME_HIDE) // @deprecated\n reflow(this._element)\n this._element.classList.add(CLASS_NAME_SHOW, CLASS_NAME_SHOWING)\n\n this._queueCallback(complete, this._element, this._config.animation)\n }\n\n hide() {\n if (!this.isShown()) {\n return\n }\n\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE)\n\n if (hideEvent.defaultPrevented) {\n return\n }\n\n const complete = () => {\n this._element.classList.add(CLASS_NAME_HIDE) // @deprecated\n this._element.classList.remove(CLASS_NAME_SHOWING, CLASS_NAME_SHOW)\n EventHandler.trigger(this._element, EVENT_HIDDEN)\n }\n\n this._element.classList.add(CLASS_NAME_SHOWING)\n this._queueCallback(complete, this._element, this._config.animation)\n }\n\n dispose() {\n this._clearTimeout()\n\n if (this.isShown()) {\n this._element.classList.remove(CLASS_NAME_SHOW)\n }\n\n super.dispose()\n }\n\n isShown() {\n return this._element.classList.contains(CLASS_NAME_SHOW)\n }\n\n // Private\n\n _maybeScheduleHide() {\n if (!this._config.autohide) {\n return\n }\n\n if (this._hasMouseInteraction || this._hasKeyboardInteraction) {\n return\n }\n\n this._timeout = setTimeout(() => {\n this.hide()\n }, this._config.delay)\n }\n\n _onInteraction(event, isInteracting) {\n switch (event.type) {\n case 'mouseover':\n case 'mouseout': {\n this._hasMouseInteraction = isInteracting\n break\n }\n\n case 'focusin':\n case 'focusout': {\n this._hasKeyboardInteraction = isInteracting\n break\n }\n\n default: {\n break\n }\n }\n\n if (isInteracting) {\n this._clearTimeout()\n return\n }\n\n const nextElement = event.relatedTarget\n if (this._element === nextElement || this._element.contains(nextElement)) {\n return\n }\n\n this._maybeScheduleHide()\n }\n\n _setListeners() {\n EventHandler.on(this._element, EVENT_MOUSEOVER, event => this._onInteraction(event, true))\n EventHandler.on(this._element, EVENT_MOUSEOUT, event => this._onInteraction(event, false))\n EventHandler.on(this._element, EVENT_FOCUSIN, event => this._onInteraction(event, true))\n EventHandler.on(this._element, EVENT_FOCUSOUT, event => this._onInteraction(event, false))\n }\n\n _clearTimeout() {\n clearTimeout(this._timeout)\n this._timeout = null\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Toast.getOrCreateInstance(this, config)\n\n if (typeof config === 'string') {\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`)\n }\n\n data[config](this)\n }\n })\n }\n}\n\n/**\n * Data API implementation\n */\n\nenableDismissTrigger(Toast)\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Toast)\n\nexport default Toast\n","/**\n * --------------------------------------------------------------------------\n * Bootstrap index.umd.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nimport Alert from './src/alert.js'\nimport Button from './src/button.js'\nimport Carousel from './src/carousel.js'\nimport Collapse from './src/collapse.js'\nimport Dropdown from './src/dropdown.js'\nimport Modal from './src/modal.js'\nimport Offcanvas from './src/offcanvas.js'\nimport Popover from './src/popover.js'\nimport ScrollSpy from './src/scrollspy.js'\nimport Tab from './src/tab.js'\nimport Toast from './src/toast.js'\nimport Tooltip from './src/tooltip.js'\n\nexport default {\n Alert,\n Button,\n Carousel,\n Collapse,\n Dropdown,\n Modal,\n Offcanvas,\n Popover,\n ScrollSpy,\n Tab,\n Toast,\n Tooltip\n}\n"],"mappings":";;;;;0OAWA,MAAMA,EAAa,IAAIC,IAEvBC,EAAe,CACbC,IAAIC,EAASC,EAAKC,GACXN,EAAWO,IAAIH,IAClBJ,EAAWG,IAAIC,EAAS,IAAIH,KAG9B,MAAMO,EAAcR,EAAWS,IAAIL,GAI9BI,EAAYD,IAAIF,IAA6B,IAArBG,EAAYE,KAMzCF,EAAYL,IAAIE,EAAKC,GAJnBK,QAAQC,MAAO,+EAA8EC,MAAMC,KAAKN,EAAYO,QAAQ,M,EAOhIN,IAAGA,CAACL,EAASC,IACPL,EAAWO,IAAIH,IACVJ,EAAWS,IAAIL,GAASK,IAAIJ,IAG9B,KAGTW,OAAOZ,EAASC,GACd,IAAKL,EAAWO,IAAIH,GAClB,OAGF,MAAMI,EAAcR,EAAWS,IAAIL,GAEnCI,EAAYS,OAAOZ,GAGM,IAArBG,EAAYE,MACdV,EAAWiB,OAAOb,EAEtB,GC5CIc,EAAiB,gBAOjBC,EAAgBC,IAChBA,GAAYC,OAAOC,KAAOD,OAAOC,IAAIC,SAEvCH,EAAWA,EAASI,QAAQ,iBAAiB,CAACC,EAAOC,IAAQ,IAAGJ,IAAIC,OAAOG,QAGtEN,GA+CHO,EAAuBvB,IAC3BA,EAAQwB,cAAc,IAAIC,MAAMX,GAAgB,EAG5CY,EAAYC,MACXA,GAA4B,iBAAXA,UAIO,IAAlBA,EAAOC,SAChBD,EAASA,EAAO,SAGgB,IAApBA,EAAOE,UAGjBC,EAAaH,GAEbD,EAAUC,GACLA,EAAOC,OAASD,EAAO,GAAKA,EAGf,iBAAXA,GAAuBA,EAAOI,OAAS,EACzCC,SAASC,cAAclB,EAAcY,IAGvC,KAGHO,EAAYlC,IAChB,IAAK0B,EAAU1B,IAAgD,IAApCA,EAAQmC,iBAAiBJ,OAClD,OAAO,EAGT,MAAMK,EAAgF,YAA7DC,iBAAiBrC,GAASsC,iBAAiB,cAE9DC,EAAgBvC,EAAQwC,QAAQ,uBAEtC,IAAKD,EACH,OAAOH,EAGT,GAAIG,IAAkBvC,EAAS,CAC7B,MAAMyC,EAAUzC,EAAQwC,QAAQ,WAChC,GAAIC,GAAWA,EAAQC,aAAeH,EACpC,OAAO,EAGT,GAAgB,OAAZE,EACF,OAAO,CAEX,CAEA,OAAOL,CAAgB,EAGnBO,EAAa3C,IACZA,GAAWA,EAAQ6B,WAAae,KAAKC,gBAItC7C,EAAQ8C,UAAUC,SAAS,mBAIC,IAArB/C,EAAQgD,SACVhD,EAAQgD,SAGVhD,EAAQiD,aAAa,aAAoD,UAArCjD,EAAQkD,aAAa,aAG5DC,EAAiBnD,IACrB,IAAKgC,SAASoB,gBAAgBC,aAC5B,OAAO,KAIT,GAAmC,mBAAxBrD,EAAQsD,YAA4B,CAC7C,MAAMC,EAAOvD,EAAQsD,cACrB,OAAOC,aAAgBC,WAAaD,EAAO,IAC7C,CAEA,OAAIvD,aAAmBwD,WACdxD,EAIJA,EAAQ0C,WAINS,EAAenD,EAAQ0C,YAHrB,IAGgC,EAGrCe,EAAOA,OAUPC,EAAS1D,IACbA,EAAQ2D,YAAY,EAGhBC,EAAYA,IACZ3C,OAAO4C,SAAW7B,SAAS8B,KAAKb,aAAa,qBACxChC,OAAO4C,OAGT,KAGHE,EAA4B,GAmB5BC,EAAQA,IAAuC,QAAjChC,SAASoB,gBAAgBa,IAEvCC,EAAqBC,IAnBAC,QAoBN,KACjB,MAAMC,EAAIT,IAEV,GAAIS,EAAG,CACL,MAAMC,EAAOH,EAAOI,KACdC,EAAqBH,EAAEI,GAAGH,GAChCD,EAAEI,GAAGH,GAAQH,EAAOO,gBACpBL,EAAEI,GAAGH,GAAMK,YAAcR,EACzBE,EAAEI,GAAGH,GAAMM,WAAa,KACtBP,EAAEI,GAAGH,GAAQE,EACNL,EAAOO,gBAElB,GA/B0B,YAAxB1C,SAAS6C,YAENd,EAA0BhC,QAC7BC,SAAS8C,iBAAiB,oBAAoB,KAC5C,IAAK,MAAMV,KAAYL,EACrBK,GACF,IAIJL,EAA0BgB,KAAKX,IAE/BA,GAoBA,EAGEY,EAAUA,CAACC,EAAkBC,EAAO,GAAIC,EAAeF,IACxB,mBAArBA,EAAkCA,KAAoBC,GAAQC,EAGxEC,EAAyBA,CAAChB,EAAUiB,EAAmBC,GAAoB,KAC/E,IAAKA,EAEH,YADAN,EAAQZ,GAIV,MACMmB,EA7LiCvF,KACvC,IAAKA,EACH,OAAO,EAIT,IAAIwF,mBAAEA,EAAkBC,gBAAEA,GAAoBxE,OAAOoB,iBAAiBrC,GAEtE,MAAM0F,EAA0BC,OAAOC,WAAWJ,GAC5CK,EAAuBF,OAAOC,WAAWH,GAG/C,OAAKC,GAA4BG,GAKjCL,EAAqBA,EAAmBM,MAAM,KAAK,GACnDL,EAAkBA,EAAgBK,MAAM,KAAK,GAxDf,KA0DtBH,OAAOC,WAAWJ,GAAsBG,OAAOC,WAAWH,KAPzD,CAOoG,EAyKpFM,CAAiCV,GADlC,EAGxB,IAAIW,GAAS,EAEb,MAAMC,EAAUA,EAAGC,aACbA,IAAWb,IAIfW,GAAS,EACTX,EAAkBc,oBAAoBrF,EAAgBmF,GACtDjB,EAAQZ,GAAS,EAGnBiB,EAAkBP,iBAAiBhE,EAAgBmF,GACnDG,YAAW,KACJJ,GACHzE,EAAqB8D,EACvB,GACCE,EAAiB,EAYhBc,EAAuBA,CAACC,EAAMC,EAAeC,EAAeC,KAChE,MAAMC,EAAaJ,EAAKvE,OACxB,IAAI4E,EAAQL,EAAKM,QAAQL,GAIzB,OAAe,IAAXI,GACMH,GAAiBC,EAAiBH,EAAKI,EAAa,GAAKJ,EAAK,IAGxEK,GAASH,EAAgB,GAAK,EAE1BC,IACFE,GAASA,EAAQD,GAAcA,GAG1BJ,EAAKO,KAAKC,IAAI,EAAGD,KAAKE,IAAIJ,EAAOD,EAAa,KAAI,EC7QrDM,EAAiB,qBACjBC,EAAiB,OACjBC,EAAgB,SAChBC,EAAgB,GACtB,IAAIC,EAAW,EACf,MAAMC,EAAe,CACnBC,WAAY,YACZC,WAAY,YAGRC,EAAe,IAAIC,IAAI,CAC3B,QACA,WACA,UACA,YACA,cACA,aACA,iBACA,YACA,WACA,YACA,cACA,YACA,UACA,WACA,QACA,oBACA,aACA,YACA,WACA,cACA,cACA,cACA,YACA,eACA,gBACA,eACA,gBACA,aACA,QACA,OACA,SACA,QACA,SACA,SACA,UACA,WACA,OACA,SACA,eACA,SACA,OACA,mBACA,mBACA,QACA,QACA,WAOF,SAASC,EAAa1H,EAAS2H,GAC7B,OAAQA,GAAQ,GAAEA,MAAQP,OAAiBpH,EAAQoH,UAAYA,GACjE,CAEA,SAASQ,EAAiB5H,GACxB,MAAM2H,EAAMD,EAAa1H,GAKzB,OAHAA,EAAQoH,SAAWO,EACnBR,EAAcQ,GAAOR,EAAcQ,IAAQ,GAEpCR,EAAcQ,EACvB,CAoCA,SAASE,EAAYC,EAAQC,EAAUC,EAAqB,MAC1D,OAAOC,OAAOC,OAAOJ,GAClBK,MAAKC,GAASA,EAAML,WAAaA,GAAYK,EAAMJ,qBAAuBA,GAC/E,CAEA,SAASK,EAAoBC,EAAmBrC,EAASsC,GACvD,MAAMC,EAAiC,iBAAZvC,EAErB8B,EAAWS,EAAcD,EAAsBtC,GAAWsC,EAChE,IAAIE,EAAYC,EAAaJ,GAM7B,OAJKd,EAAarH,IAAIsI,KACpBA,EAAYH,GAGP,CAACE,EAAaT,EAAUU,EACjC,CAEA,SAASE,EAAW3I,EAASsI,EAAmBrC,EAASsC,EAAoBK,GAC3E,GAAiC,iBAAtBN,IAAmCtI,EAC5C,OAGF,IAAKwI,EAAaT,EAAUU,GAAaJ,EAAoBC,EAAmBrC,EAASsC,GAIzF,GAAID,KAAqBjB,EAAc,CACrC,MAAMwB,EAAepE,GACZ,SAAU2D,GACf,IAAKA,EAAMU,eAAkBV,EAAMU,gBAAkBV,EAAMW,iBAAmBX,EAAMW,eAAehG,SAASqF,EAAMU,eAChH,OAAOrE,EAAGuE,KAAKC,KAAMb,E,EAK3BL,EAAWc,EAAad,EAC1B,CAEA,MAAMD,EAASF,EAAiB5H,GAC1BkJ,EAAWpB,EAAOW,KAAeX,EAAOW,GAAa,IACrDU,EAAmBtB,EAAYqB,EAAUnB,EAAUS,EAAcvC,EAAU,MAEjF,GAAIkD,EAGF,YAFAA,EAAiBP,OAASO,EAAiBP,QAAUA,GAKvD,MAAMjB,EAAMD,EAAaK,EAAUO,EAAkBlH,QAAQ4F,EAAgB,KACvEvC,EAAK+D,EAxEb,SAAoCxI,EAASgB,EAAUyD,GACrD,OAAO,SAASwB,EAAQmC,GACtB,MAAMgB,EAAcpJ,EAAQqJ,iBAAiBrI,GAE7C,IAAK,IAAIkF,OAAEA,GAAWkC,EAAOlC,GAAUA,IAAW+C,KAAM/C,EAASA,EAAOxD,WACtE,IAAK,MAAM4G,KAAcF,EACvB,GAAIE,IAAepD,EAUnB,OANAqD,EAAWnB,EAAO,CAAEW,eAAgB7C,IAEhCD,EAAQ2C,QACVY,EAAaC,IAAIzJ,EAASoI,EAAMsB,KAAM1I,EAAUyD,GAG3CA,EAAGkF,MAAMzD,EAAQ,CAACkC,G,CAIjC,CAqDIwB,CAA2B5J,EAASiG,EAAS8B,GArFjD,SAA0B/H,EAASyE,GACjC,OAAO,SAASwB,EAAQmC,GAOtB,OANAmB,EAAWnB,EAAO,CAAEW,eAAgB/I,IAEhCiG,EAAQ2C,QACVY,EAAaC,IAAIzJ,EAASoI,EAAMsB,KAAMjF,GAGjCA,EAAGkF,MAAM3J,EAAS,CAACoI,G,CAE9B,CA4EIyB,CAAiB7J,EAAS+H,GAE5BtD,EAAGuD,mBAAqBQ,EAAcvC,EAAU,KAChDxB,EAAGsD,SAAWA,EACdtD,EAAGmE,OAASA,EACZnE,EAAG2C,SAAWO,EACduB,EAASvB,GAAOlD,EAEhBzE,EAAQ8E,iBAAiB2D,EAAWhE,EAAI+D,EAC1C,CAEA,SAASsB,EAAc9J,EAAS8H,EAAQW,EAAWxC,EAAS+B,GAC1D,MAAMvD,EAAKoD,EAAYC,EAAOW,GAAYxC,EAAS+B,GAE9CvD,IAILzE,EAAQmG,oBAAoBsC,EAAWhE,EAAIsF,QAAQ/B,WAC5CF,EAAOW,GAAWhE,EAAG2C,UAC9B,CAEA,SAAS4C,EAAyBhK,EAAS8H,EAAQW,EAAWwB,GAC5D,MAAMC,EAAoBpC,EAAOW,IAAc,GAE/C,IAAK,MAAO0B,EAAY/B,KAAUH,OAAOmC,QAAQF,GAC3CC,EAAWE,SAASJ,IACtBH,EAAc9J,EAAS8H,EAAQW,EAAWL,EAAML,SAAUK,EAAMJ,mBAGtE,CAEA,SAASU,EAAaN,GAGpB,OADAA,EAAQA,EAAMhH,QAAQ6F,EAAgB,IAC/BI,EAAae,IAAUA,CAChC,CAEA,MAAMoB,EAAe,CACnBc,GAAGtK,EAASoI,EAAOnC,EAASsC,GAC1BI,EAAW3I,EAASoI,EAAOnC,EAASsC,GAAoB,E,EAG1DgC,IAAIvK,EAASoI,EAAOnC,EAASsC,GAC3BI,EAAW3I,EAASoI,EAAOnC,EAASsC,GAAoB,E,EAG1DkB,IAAIzJ,EAASsI,EAAmBrC,EAASsC,GACvC,GAAiC,iBAAtBD,IAAmCtI,EAC5C,OAGF,MAAOwI,EAAaT,EAAUU,GAAaJ,EAAoBC,EAAmBrC,EAASsC,GACrFiC,EAAc/B,IAAcH,EAC5BR,EAASF,EAAiB5H,GAC1BkK,EAAoBpC,EAAOW,IAAc,GACzCgC,EAAcnC,EAAkBoC,WAAW,KAEjD,QAAwB,IAAb3C,EAAX,CAUA,GAAI0C,EACF,IAAK,MAAME,KAAgB1C,OAAOtH,KAAKmH,GACrCkC,EAAyBhK,EAAS8H,EAAQ6C,EAAcrC,EAAkBsC,MAAM,IAIpF,IAAK,MAAOC,EAAazC,KAAUH,OAAOmC,QAAQF,GAAoB,CACpE,MAAMC,EAAaU,EAAYzJ,QAAQ8F,EAAe,IAEjDsD,IAAelC,EAAkB+B,SAASF,IAC7CL,EAAc9J,EAAS8H,EAAQW,EAAWL,EAAML,SAAUK,EAAMJ,mBAEpE,CAdA,KARA,CAEE,IAAKC,OAAOtH,KAAKuJ,GAAmBnI,OAClC,OAGF+H,EAAc9J,EAAS8H,EAAQW,EAAWV,EAAUS,EAAcvC,EAAU,KAE9E,C,EAiBF6E,QAAQ9K,EAASoI,EAAOlD,GACtB,GAAqB,iBAAVkD,IAAuBpI,EAChC,OAAO,KAGT,MAAMqE,EAAIT,IAIV,IAAImH,EAAc,KACdC,GAAU,EACVC,GAAiB,EACjBC,GAAmB,EALH9C,IADFM,EAAaN,IAQZ/D,IACjB0G,EAAc1G,EAAE5C,MAAM2G,EAAOlD,GAE7Bb,EAAErE,GAAS8K,QAAQC,GACnBC,GAAWD,EAAYI,uBACvBF,GAAkBF,EAAYK,gCAC9BF,EAAmBH,EAAYM,sBAGjC,MAAMC,EAAM/B,EAAW,IAAI9H,MAAM2G,EAAO,CAAE4C,UAASO,YAAY,IAASrG,GAcxE,OAZIgG,GACFI,EAAIE,iBAGFP,GACFjL,EAAQwB,cAAc8J,GAGpBA,EAAIJ,kBAAoBH,GAC1BA,EAAYS,iBAGPF,CACT,GAGF,SAAS/B,EAAWkC,EAAKC,EAAO,IAC9B,IAAK,MAAOzL,EAAK0L,KAAU1D,OAAOmC,QAAQsB,GACxC,IACED,EAAIxL,GAAO0L,C,CACX,MAAAC,GACA3D,OAAO4D,eAAeJ,EAAKxL,EAAK,CAC9B6L,cAAc,EACdzL,IAAGA,IACMsL,GAGb,CAGF,OAAOF,CACT,CCnTA,SAASM,EAAcJ,GACrB,GAAc,SAAVA,EACF,OAAO,EAGT,GAAc,UAAVA,EACF,OAAO,EAGT,GAAIA,IAAUhG,OAAOgG,GAAOK,WAC1B,OAAOrG,OAAOgG,GAGhB,GAAc,KAAVA,GAA0B,SAAVA,EAClB,OAAO,KAGT,GAAqB,iBAAVA,EACT,OAAOA,EAGT,IACE,OAAOM,KAAKC,MAAMC,mBAAmBR,G,CACrC,MAAAC,GACA,OAAOD,CACT,CACF,CAEA,SAASS,EAAiBnM,GACxB,OAAOA,EAAImB,QAAQ,UAAUiL,GAAQ,IAAGA,EAAIC,iBAC9C,CAEA,MAAMC,EAAc,CAClBC,iBAAiBxM,EAASC,EAAK0L,GAC7B3L,EAAQyM,aAAc,WAAUL,EAAiBnM,KAAQ0L,E,EAG3De,oBAAoB1M,EAASC,GAC3BD,EAAQ2M,gBAAiB,WAAUP,EAAiBnM,K,EAGtD2M,kBAAkB5M,GAChB,IAAKA,EACH,MAAO,GAGT,MAAM6M,EAAa,GACbC,EAAS7E,OAAOtH,KAAKX,EAAQ+M,SAASC,QAAO/M,GAAOA,EAAIyK,WAAW,QAAUzK,EAAIyK,WAAW,cAElG,IAAK,MAAMzK,KAAO6M,EAAQ,CACxB,IAAIG,EAAUhN,EAAImB,QAAQ,MAAO,IACjC6L,EAAUA,EAAQC,OAAO,GAAGZ,cAAgBW,EAAQrC,MAAM,EAAGqC,EAAQlL,QACrE8K,EAAWI,GAAWlB,EAAc/L,EAAQ+M,QAAQ9M,GACtD,CAEA,OAAO4M,C,EAGTM,iBAAgBA,CAACnN,EAASC,IACjB8L,EAAc/L,EAAQkD,aAAc,WAAUkJ,EAAiBnM,QCpD1E,MAAMmN,EAEJ,kBAAWC,GACT,MAAO,EACT,CAEA,sBAAWC,GACT,MAAO,EACT,CAEA,eAAW/I,GACT,MAAM,IAAIgJ,MAAM,sEAClB,CAEAC,WAAWC,GAIT,OAHAA,EAASxE,KAAKyE,gBAAgBD,GAC9BA,EAASxE,KAAK0E,kBAAkBF,GAChCxE,KAAK2E,iBAAiBH,GACfA,CACT,CAEAE,kBAAkBF,GAChB,OAAOA,CACT,CAEAC,gBAAgBD,EAAQzN,GACtB,MAAM6N,EAAanM,EAAU1B,GAAWuM,EAAYY,iBAAiBnN,EAAS,UAAY,GAE1F,MAAO,IACFiJ,KAAK6E,YAAYT,WACM,iBAAfQ,EAA0BA,EAAa,MAC9CnM,EAAU1B,GAAWuM,EAAYK,kBAAkB5M,GAAW,MAC5C,iBAAXyN,EAAsBA,EAAS,GAE9C,CAEAG,iBAAiBH,EAAQM,EAAc9E,KAAK6E,YAAYR,aACtD,IAAK,MAAOU,EAAUC,KAAkBhG,OAAOmC,QAAQ2D,GAAc,CACnE,MAAMpC,EAAQ8B,EAAOO,GACfE,EAAYxM,EAAUiK,GAAS,UH1BrChK,OADSA,EG2B+CgK,GHzBlD,GAAEhK,IAGLsG,OAAOkG,UAAUnC,SAAShD,KAAKrH,GAAQN,MAAM,eAAe,GAAGiL,cGwBlE,IAAK,IAAI8B,OAAOH,GAAeI,KAAKH,GAClC,MAAM,IAAII,UACP,GAAErF,KAAK6E,YAAYvJ,KAAKgK,0BAA0BP,qBAA4BE,yBAAiCD,MAGtH,CHlCWtM,KGmCb,ECvCF,MAAM6M,UAAsBpB,EAC1BU,YAAY9N,EAASyN,GACnBgB,SAEAzO,EAAU8B,EAAW9B,MAKrBiJ,KAAKyF,SAAW1O,EAChBiJ,KAAK0F,QAAU1F,KAAKuE,WAAWC,GAE/B3N,EAAKC,IAAIkJ,KAAKyF,SAAUzF,KAAK6E,YAAYc,SAAU3F,MACrD,CAGA4F,UACE/O,EAAKc,OAAOqI,KAAKyF,SAAUzF,KAAK6E,YAAYc,UAC5CpF,EAAaC,IAAIR,KAAKyF,SAAUzF,KAAK6E,YAAYgB,WAEjD,IAAK,MAAMC,KAAgB9G,OAAO+G,oBAAoB/F,MACpDA,KAAK8F,GAAgB,IAEzB,CAEAE,eAAe7K,EAAUpE,EAASkP,GAAa,GAC7C9J,EAAuBhB,EAAUpE,EAASkP,EAC5C,CAEA1B,WAAWC,GAIT,OAHAA,EAASxE,KAAKyE,gBAAgBD,EAAQxE,KAAKyF,UAC3CjB,EAASxE,KAAK0E,kBAAkBF,GAChCxE,KAAK2E,iBAAiBH,GACfA,CACT,CAGA,kBAAO0B,CAAYnP,GACjB,OAAOF,EAAKO,IAAIyB,EAAW9B,GAAUiJ,KAAK2F,SAC5C,CAEA,0BAAOQ,CAAoBpP,EAASyN,EAAS,IAC3C,OAAOxE,KAAKkG,YAAYnP,IAAY,IAAIiJ,KAAKjJ,EAA2B,iBAAXyN,EAAsBA,EAAS,KAC9F,CAEA,kBAAW4B,GACT,MApDY,OAqDd,CAEA,mBAAWT,GACT,MAAQ,MAAK3F,KAAK1E,MACpB,CAEA,oBAAWuK,GACT,MAAQ,IAAG7F,KAAK2F,UAClB,CAEA,gBAAOU,CAAUhL,GACf,MAAQ,GAAEA,IAAO2E,KAAK6F,WACxB,ECxEF,MAAMS,EAAcvP,IAClB,IAAIgB,EAAWhB,EAAQkD,aAAa,kBAEpC,IAAKlC,GAAyB,MAAbA,EAAkB,CACjC,IAAIwO,EAAgBxP,EAAQkD,aAAa,QAMzC,IAAKsM,IAAmBA,EAAcnF,SAAS,OAASmF,EAAc9E,WAAW,KAC/E,OAAO,KAIL8E,EAAcnF,SAAS,OAASmF,EAAc9E,WAAW,OAC3D8E,EAAiB,IAAGA,EAAc1J,MAAM,KAAK,MAG/C9E,EAAWwO,GAAmC,MAAlBA,EAAwBA,EAAcC,OAAS,IAC7E,CAEA,OAAO1O,EAAcC,EAAS,EAG1B0O,EAAiB,CACrBvH,KAAIA,CAACnH,EAAUhB,EAAUgC,SAASoB,kBACzB,GAAGuM,UAAUC,QAAQzB,UAAU9E,iBAAiBL,KAAKhJ,EAASgB,IAGvE6O,QAAOA,CAAC7O,EAAUhB,EAAUgC,SAASoB,kBAC5BwM,QAAQzB,UAAUlM,cAAc+G,KAAKhJ,EAASgB,GAGvD8O,SAAQA,CAAC9P,EAASgB,IACT,GAAG2O,UAAU3P,EAAQ8P,UAAU9C,QAAO+C,GAASA,EAAMC,QAAQhP,KAGtEiP,QAAQjQ,EAASgB,GACf,MAAMiP,EAAU,GAChB,IAAIC,EAAWlQ,EAAQ0C,WAAWF,QAAQxB,GAE1C,KAAOkP,GACLD,EAAQlL,KAAKmL,GACbA,EAAWA,EAASxN,WAAWF,QAAQxB,GAGzC,OAAOiP,C,EAGTE,KAAKnQ,EAASgB,GACZ,IAAIoP,EAAWpQ,EAAQqQ,uBAEvB,KAAOD,GAAU,CACf,GAAIA,EAASJ,QAAQhP,GACnB,MAAO,CAACoP,GAGVA,EAAWA,EAASC,sBACtB,CAEA,MAAO,E,EAGTC,KAAKtQ,EAASgB,GACZ,IAAIsP,EAAOtQ,EAAQuQ,mBAEnB,KAAOD,GAAM,CACX,GAAIA,EAAKN,QAAQhP,GACf,MAAO,CAACsP,GAGVA,EAAOA,EAAKC,kBACd,CAEA,MAAO,E,EAGTC,kBAAkBxQ,GAChB,MAAMyQ,EAAa,CACjB,IACA,SACA,QACA,WACA,SACA,UACA,aACA,4BACAC,KAAI1P,GAAa,GAAEA,2BAAiC2P,KAAK,KAE3D,OAAO1H,KAAKd,KAAKsI,EAAYzQ,GAASgN,QAAO4D,IAAOjO,EAAWiO,IAAO1O,EAAU0O,I,EAGlFC,uBAAuB7Q,GACrB,MAAMgB,EAAWuO,EAAYvP,GAE7B,OAAIgB,GACK0O,EAAeG,QAAQ7O,GAAYA,EAGrC,I,EAGT8P,uBAAuB9Q,GACrB,MAAMgB,EAAWuO,EAAYvP,GAE7B,OAAOgB,EAAW0O,EAAeG,QAAQ7O,GAAY,I,EAGvD+P,gCAAgC/Q,GAC9B,MAAMgB,EAAWuO,EAAYvP,GAE7B,OAAOgB,EAAW0O,EAAevH,KAAKnH,GAAY,EACpD,GC/GIgQ,EAAuBA,CAACC,EAAWC,EAAS,UAChD,MAAMC,EAAc,gBAAeF,EAAUnC,YACvCxK,EAAO2M,EAAU1M,KAEvBiF,EAAac,GAAGtI,SAAUmP,EAAa,qBAAoB7M,OAAU,SAAU8D,GAK7E,GAJI,CAAC,IAAK,QAAQiC,SAASpB,KAAKmI,UAC9BhJ,EAAMoD,iBAGJ7I,EAAWsG,MACb,OAGF,MAAM/C,EAASwJ,EAAeoB,uBAAuB7H,OAASA,KAAKzG,QAAS,IAAG8B,KAC9D2M,EAAU7B,oBAAoBlJ,GAGtCgL,IACX,GAAE,ECXEpC,EAAa,YAEbuC,EAAe,QAAOvC,IACtBwC,EAAgB,SAAQxC,IAQ9B,MAAMyC,UAAc/C,EAElB,eAAWjK,GACT,MAhBS,OAiBX,CAGAiN,QAGE,GAFmBhI,EAAasB,QAAQ7B,KAAKyF,SAAU2C,GAExCnG,iBACb,OAGFjC,KAAKyF,SAAS5L,UAAUlC,OApBJ,QAsBpB,MAAMsO,EAAajG,KAAKyF,SAAS5L,UAAUC,SAvBvB,QAwBpBkG,KAAKgG,gBAAe,IAAMhG,KAAKwI,mBAAmBxI,KAAKyF,SAAUQ,EACnE,CAGAuC,kBACExI,KAAKyF,SAAS9N,SACd4I,EAAasB,QAAQ7B,KAAKyF,SAAU4C,GACpCrI,KAAK4F,SACP,CAGA,sBAAOnK,CAAgB+I,GACrB,OAAOxE,KAAKyI,MAAK,WACf,MAAMC,EAAOJ,EAAMnC,oBAAoBnG,MAEvC,GAAsB,iBAAXwE,EAAX,CAIA,QAAqBmE,IAAjBD,EAAKlE,IAAyBA,EAAO/C,WAAW,MAAmB,gBAAX+C,EAC1D,MAAM,IAAIa,UAAW,oBAAmBb,MAG1CkE,EAAKlE,GAAQxE,KANb,CAOF,GACF,EAOF+H,EAAqBO,EAAO,SAM5BrN,EAAmBqN,GCrEnB,MAMMM,EAAuB,4BAO7B,MAAMC,UAAetD,EAEnB,eAAWjK,GACT,MAhBS,QAiBX,CAGAwN,SAEE9I,KAAKyF,SAASjC,aAAa,eAAgBxD,KAAKyF,SAAS5L,UAAUiP,OAjB7C,UAkBxB,CAGA,sBAAOrN,CAAgB+I,GACrB,OAAOxE,KAAKyI,MAAK,WACf,MAAMC,EAAOG,EAAO1C,oBAAoBnG,MAEzB,WAAXwE,GACFkE,EAAKlE,IAET,GACF,EAOFjE,EAAac,GAAGtI,SAlCc,2BAkCkB6P,GAAsBzJ,IACpEA,EAAMoD,iBAEN,MAAMwG,EAAS5J,EAAMlC,OAAO1D,QAAQqP,GACvBC,EAAO1C,oBAAoB4C,GAEnCD,QAAQ,IAOf7N,EAAmB4N,GCtDnB,MACMhD,EAAY,YACZmD,EAAoB,aAAYnD,IAChCoD,EAAmB,YAAWpD,IAC9BqD,EAAkB,WAAUrD,IAC5BsD,GAAqB,cAAatD,IAClCuD,GAAmB,YAAWvD,IAM9BzB,GAAU,CACdiF,YAAa,KACbC,aAAc,KACdC,cAAe,MAGXlF,GAAc,CAClBgF,YAAa,kBACbC,aAAc,kBACdC,cAAe,mBAOjB,MAAMC,WAAcrF,EAClBU,YAAY9N,EAASyN,GACnBgB,QACAxF,KAAKyF,SAAW1O,EAEXA,GAAYyS,GAAMC,gBAIvBzJ,KAAK0F,QAAU1F,KAAKuE,WAAWC,GAC/BxE,KAAK0J,QAAU,EACf1J,KAAK2J,sBAAwB7I,QAAQ9I,OAAO4R,cAC5C5J,KAAK6J,cACP,CAGA,kBAAWzF,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,MArDS,OAsDX,CAGAsK,UACErF,EAAaC,IAAIR,KAAKyF,SAAUI,EAClC,CAGAiE,OAAO3K,GACAa,KAAK2J,sBAMN3J,KAAK+J,wBAAwB5K,KAC/Ba,KAAK0J,QAAUvK,EAAM6K,SANrBhK,KAAK0J,QAAUvK,EAAM8K,QAAQ,GAAGD,OAQpC,CAEAE,KAAK/K,GACCa,KAAK+J,wBAAwB5K,KAC/Ba,KAAK0J,QAAUvK,EAAM6K,QAAUhK,KAAK0J,SAGtC1J,KAAKmK,eACLpO,EAAQiE,KAAK0F,QAAQ2D,YACvB,CAEAe,MAAMjL,GACJa,KAAK0J,QAAUvK,EAAM8K,SAAW9K,EAAM8K,QAAQnR,OAAS,EACrD,EACAqG,EAAM8K,QAAQ,GAAGD,QAAUhK,KAAK0J,OACpC,CAEAS,eACE,MAAME,EAAYzM,KAAK0M,IAAItK,KAAK0J,SAEhC,GAAIW,GAlFgB,GAmFlB,OAGF,MAAME,EAAYF,EAAYrK,KAAK0J,QAEnC1J,KAAK0J,QAAU,EAEVa,GAILxO,EAAQwO,EAAY,EAAIvK,KAAK0F,QAAQ6D,cAAgBvJ,KAAK0F,QAAQ4D,aACpE,CAEAO,cACM7J,KAAK2J,uBACPpJ,EAAac,GAAGrB,KAAKyF,SAAU0D,IAAmBhK,GAASa,KAAK8J,OAAO3K,KACvEoB,EAAac,GAAGrB,KAAKyF,SAAU2D,IAAiBjK,GAASa,KAAKkK,KAAK/K,KAEnEa,KAAKyF,SAAS5L,UAAU2Q,IAvGG,mBAyG3BjK,EAAac,GAAGrB,KAAKyF,SAAUuD,GAAkB7J,GAASa,KAAK8J,OAAO3K,KACtEoB,EAAac,GAAGrB,KAAKyF,SAAUwD,GAAiB9J,GAASa,KAAKoK,MAAMjL,KACpEoB,EAAac,GAAGrB,KAAKyF,SAAUyD,GAAgB/J,GAASa,KAAKkK,KAAK/K,KAEtE,CAEA4K,wBAAwB5K,GACtB,OAAOa,KAAK2J,wBAjHS,QAiHiBxK,EAAMsL,aAlHrB,UAkHyDtL,EAAMsL,YACxF,CAGA,kBAAOhB,GACL,MAAO,iBAAkB1Q,SAASoB,iBAAmBuQ,UAAUC,eAAiB,CAClF,ECrHF,MAEM9E,GAAa,eACb+E,GAAe,YAMfC,GAAa,OACbC,GAAa,OACbC,GAAiB,OACjBC,GAAkB,QAElBC,GAAe,QAAOpF,KACtBqF,GAAc,OAAMrF,KACpBsF,GAAiB,UAAStF,KAC1BuF,GAAoB,aAAYvF,KAChCwF,GAAoB,aAAYxF,KAChCyF,GAAoB,YAAWzF,KAC/B0F,GAAuB,OAAM1F,KAAY+E,KACzCY,GAAwB,QAAO3F,KAAY+E,KAE3Ca,GAAsB,WACtBC,GAAoB,SAOpBC,GAAkB,UAClBC,GAAgB,iBAChBC,GAAuBF,GAAkBC,GAMzCE,GAAmB,CACvBC,UAAkBf,GAClBgB,WAAmBjB,IAGf3G,GAAU,CACd6H,SAAU,IACVC,UAAU,EACVC,MAAO,QACPC,MAAM,EACNC,OAAO,EACPC,MAAM,GAGFjI,GAAc,CAClB4H,SAAU,mBACVC,SAAU,UACVC,MAAO,mBACPC,KAAM,mBACNC,MAAO,UACPC,KAAM,WAOR,MAAMC,WAAiBhH,EACrBV,YAAY9N,EAASyN,GACnBgB,MAAMzO,EAASyN,GAEfxE,KAAKwM,UAAY,KACjBxM,KAAKyM,eAAiB,KACtBzM,KAAK0M,YAAa,EAClB1M,KAAK2M,aAAe,KACpB3M,KAAK4M,aAAe,KAEpB5M,KAAK6M,mBAAqBpG,EAAeG,QAzCjB,uBAyC8C5G,KAAKyF,UAC3EzF,KAAK8M,qBAED9M,KAAK0F,QAAQ0G,OAASX,IACxBzL,KAAK+M,OAET,CAGA,kBAAW3I,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,MA9FS,UA+FX,CAGA+L,OACErH,KAAKgN,OAAOnC,GACd,CAEAoC,mBAIOlU,SAASmU,QAAUjU,EAAU+G,KAAKyF,WACrCzF,KAAKqH,MAET,CAEAH,OACElH,KAAKgN,OAAOlC,GACd,CAEAqB,QACMnM,KAAK0M,YACPpU,EAAqB0H,KAAKyF,UAG5BzF,KAAKmN,gBACP,CAEAJ,QACE/M,KAAKmN,iBACLnN,KAAKoN,kBAELpN,KAAKwM,UAAYa,aAAY,IAAMrN,KAAKiN,mBAAmBjN,KAAK0F,QAAQuG,SAC1E,CAEAqB,oBACOtN,KAAK0F,QAAQ0G,OAIdpM,KAAK0M,WACPnM,EAAae,IAAItB,KAAKyF,SAAUyF,IAAY,IAAMlL,KAAK+M,UAIzD/M,KAAK+M,QACP,CAEAQ,GAAG7P,GACD,MAAM8P,EAAQxN,KAAKyN,YACnB,GAAI/P,EAAQ8P,EAAM1U,OAAS,GAAK4E,EAAQ,EACtC,OAGF,GAAIsC,KAAK0M,WAEP,YADAnM,EAAae,IAAItB,KAAKyF,SAAUyF,IAAY,IAAMlL,KAAKuN,GAAG7P,KAI5D,MAAMgQ,EAAc1N,KAAK2N,cAAc3N,KAAK4N,cAC5C,GAAIF,IAAgBhQ,EAClB,OAGF,MAAMmQ,EAAQnQ,EAAQgQ,EAAc7C,GAAaC,GAEjD9K,KAAKgN,OAAOa,EAAOL,EAAM9P,GAC3B,CAEAkI,UACM5F,KAAK4M,cACP5M,KAAK4M,aAAahH,UAGpBJ,MAAMI,SACR,CAGAlB,kBAAkBF,GAEhB,OADAA,EAAOsJ,gBAAkBtJ,EAAOyH,SACzBzH,CACT,CAEAsI,qBACM9M,KAAK0F,QAAQwG,UACf3L,EAAac,GAAGrB,KAAKyF,SAAU0F,IAAehM,GAASa,KAAK+N,SAAS5O,KAG5C,UAAvBa,KAAK0F,QAAQyG,QACf5L,EAAac,GAAGrB,KAAKyF,SAAU2F,IAAkB,IAAMpL,KAAKmM,UAC5D5L,EAAac,GAAGrB,KAAKyF,SAAU4F,IAAkB,IAAMrL,KAAKsN,uBAG1DtN,KAAK0F,QAAQ2G,OAAS7C,GAAMC,eAC9BzJ,KAAKgO,yBAET,CAEAA,0BACE,IAAK,MAAMC,KAAOxH,EAAevH,KAhKX,qBAgKmCc,KAAKyF,UAC5DlF,EAAac,GAAG4M,EAAK3C,IAAkBnM,GAASA,EAAMoD,mBAGxD,MAqBM2L,EAAc,CAClB5E,aAAcA,IAAMtJ,KAAKgN,OAAOhN,KAAKmO,kBAAkBpD,KACvDxB,cAAeA,IAAMvJ,KAAKgN,OAAOhN,KAAKmO,kBAAkBnD,KACxD3B,YAxBkB+E,KACS,UAAvBpO,KAAK0F,QAAQyG,QAYjBnM,KAAKmM,QACDnM,KAAK2M,cACP0B,aAAarO,KAAK2M,cAGpB3M,KAAK2M,aAAexP,YAAW,IAAM6C,KAAKsN,qBAjNjB,IAiN+DtN,KAAK0F,QAAQuG,UAAS,GAShHjM,KAAK4M,aAAe,IAAIpD,GAAMxJ,KAAKyF,SAAUyI,EAC/C,CAEAH,SAAS5O,GACP,GAAI,kBAAkBiG,KAAKjG,EAAMlC,OAAOkL,SACtC,OAGF,MAAMoC,EAAYuB,GAAiB3M,EAAMnI,KACrCuT,IACFpL,EAAMoD,iBACNvC,KAAKgN,OAAOhN,KAAKmO,kBAAkB5D,IAEvC,CAEAoD,cAAc5W,GACZ,OAAOiJ,KAAKyN,YAAY9P,QAAQ5G,EAClC,CAEAuX,2BAA2B5Q,GACzB,IAAKsC,KAAK6M,mBACR,OAGF,MAAM0B,EAAkB9H,EAAeG,QAAQ+E,GAAiB3L,KAAK6M,oBAErE0B,EAAgB1U,UAAUlC,OAAO+T,IACjC6C,EAAgB7K,gBAAgB,gBAEhC,MAAM8K,EAAqB/H,EAAeG,QAAS,sBAAqBlJ,MAAWsC,KAAK6M,oBAEpF2B,IACFA,EAAmB3U,UAAU2Q,IAAIkB,IACjC8C,EAAmBhL,aAAa,eAAgB,QAEpD,CAEA4J,kBACE,MAAMrW,EAAUiJ,KAAKyM,gBAAkBzM,KAAK4N,aAE5C,IAAK7W,EACH,OAGF,MAAM0X,EAAkB/R,OAAOgS,SAAS3X,EAAQkD,aAAa,oBAAqB,IAElF+F,KAAK0F,QAAQuG,SAAWwC,GAAmBzO,KAAK0F,QAAQoI,eAC1D,CAEAd,OAAOa,EAAO9W,EAAU,MACtB,GAAIiJ,KAAK0M,WACP,OAGF,MAAMpP,EAAgB0C,KAAK4N,aACrBe,EAASd,IAAUhD,GACnB+D,EAAc7X,GAAWqG,EAAqB4C,KAAKyN,YAAanQ,EAAeqR,EAAQ3O,KAAK0F,QAAQ4G,MAE1G,GAAIsC,IAAgBtR,EAClB,OAGF,MAAMuR,EAAmB7O,KAAK2N,cAAciB,GAEtCE,EAAezI,GACZ9F,EAAasB,QAAQ7B,KAAKyF,SAAUY,EAAW,CACpDxG,cAAe+O,EACfrE,UAAWvK,KAAK+O,kBAAkBlB,GAClCpW,KAAMuI,KAAK2N,cAAcrQ,GACzBiQ,GAAIsB,IAMR,GAFmBC,EAAa7D,IAEjBhJ,iBACb,OAGF,IAAK3E,IAAkBsR,EAGrB,OAGF,MAAMI,EAAYlO,QAAQd,KAAKwM,WAC/BxM,KAAKmM,QAELnM,KAAK0M,YAAa,EAElB1M,KAAKsO,2BAA2BO,GAChC7O,KAAKyM,eAAiBmC,EAEtB,MAAMK,EAAuBN,EAnSR,sBADF,oBAqSbO,EAAiBP,EAnSH,qBACA,qBAoSpBC,EAAY/U,UAAU2Q,IAAI0E,GAE1BzU,EAAOmU,GAEPtR,EAAczD,UAAU2Q,IAAIyE,GAC5BL,EAAY/U,UAAU2Q,IAAIyE,GAa1BjP,KAAKgG,gBAXoBmJ,KACvBP,EAAY/U,UAAUlC,OAAOsX,EAAsBC,GACnDN,EAAY/U,UAAU2Q,IAAIkB,IAE1BpO,EAAczD,UAAUlC,OAAO+T,GAAmBwD,EAAgBD,GAElEjP,KAAK0M,YAAa,EAElBoC,EAAa5D,GAAW,GAGY5N,EAAe0C,KAAKoP,eAEtDJ,GACFhP,KAAK+M,OAET,CAEAqC,cACE,OAAOpP,KAAKyF,SAAS5L,UAAUC,SAlUV,QAmUvB,CAEA8T,aACE,OAAOnH,EAAeG,QAAQiF,GAAsB7L,KAAKyF,SAC3D,CAEAgI,YACE,OAAOhH,EAAevH,KAAK0M,GAAe5L,KAAKyF,SACjD,CAEA0H,iBACMnN,KAAKwM,YACP6C,cAAcrP,KAAKwM,WACnBxM,KAAKwM,UAAY,KAErB,CAEA2B,kBAAkB5D,GAChB,OAAIxP,IACKwP,IAAcQ,GAAiBD,GAAaD,GAG9CN,IAAcQ,GAAiBF,GAAaC,EACrD,CAEAiE,kBAAkBlB,GAChB,OAAI9S,IACK8S,IAAU/C,GAAaC,GAAiBC,GAG1C6C,IAAU/C,GAAaE,GAAkBD,EAClD,CAGA,sBAAOtP,CAAgB+I,GACrB,OAAOxE,KAAKyI,MAAK,WACf,MAAMC,EAAO6D,GAASpG,oBAAoBnG,KAAMwE,GAEhD,GAAsB,iBAAXA,GAKX,GAAsB,iBAAXA,EAAqB,CAC9B,QAAqBmE,IAAjBD,EAAKlE,IAAyBA,EAAO/C,WAAW,MAAmB,gBAAX+C,EAC1D,MAAM,IAAIa,UAAW,oBAAmBb,MAG1CkE,EAAKlE,IACP,OAVEkE,EAAK6E,GAAG/I,EAWZ,GACF,EAOFjE,EAAac,GAAGtI,SAAUyS,GAlXE,uCAkXyC,SAAUrM,GAC7E,MAAMlC,EAASwJ,EAAeoB,uBAAuB7H,MAErD,IAAK/C,IAAWA,EAAOpD,UAAUC,SAAS2R,IACxC,OAGFtM,EAAMoD,iBAEN,MAAM+M,EAAW/C,GAASpG,oBAAoBlJ,GACxCsS,EAAavP,KAAK/F,aAAa,oBAErC,OAAIsV,GACFD,EAAS/B,GAAGgC,QACZD,EAAShC,qBAIyC,SAAhDhK,EAAYY,iBAAiBlE,KAAM,UACrCsP,EAASjI,YACTiI,EAAShC,sBAIXgC,EAASpI,YACToI,EAAShC,oBACX,IAEA/M,EAAac,GAAGrJ,OAAQuT,IAAqB,KAC3C,MAAMiE,EAAY/I,EAAevH,KA9YR,6BAgZzB,IAAK,MAAMoQ,KAAYE,EACrBjD,GAASpG,oBAAoBmJ,EAC/B,IAOFrU,EAAmBsR,ICncnB,MAEM1G,GAAa,eAGb4J,GAAc,OAAM5J,KACpB6J,GAAe,QAAO7J,KACtB8J,GAAc,OAAM9J,KACpB+J,GAAgB,SAAQ/J,KACxB2F,GAAwB,QAAO3F,cAE/BgK,GAAkB,OAClBC,GAAsB,WACtBC,GAAwB,aAExBC,GAA8B,WAAUF,OAAwBA,KAOhElH,GAAuB,8BAEvBxE,GAAU,CACd6L,OAAQ,KACRnH,QAAQ,GAGJzE,GAAc,CAClB4L,OAAQ,iBACRnH,OAAQ,WAOV,MAAMoH,WAAiB3K,EACrBV,YAAY9N,EAASyN,GACnBgB,MAAMzO,EAASyN,GAEfxE,KAAKmQ,kBAAmB,EACxBnQ,KAAKoQ,cAAgB,GAErB,MAAMC,EAAa5J,EAAevH,KAAK0J,IAEvC,IAAK,MAAM0H,KAAQD,EAAY,CAC7B,MAAMtY,EAAW0O,EAAemB,uBAAuB0I,GACjDC,EAAgB9J,EAAevH,KAAKnH,GACvCgM,QAAOyM,GAAgBA,IAAiBxQ,KAAKyF,WAE/B,OAAb1N,GAAqBwY,EAAczX,QACrCkH,KAAKoQ,cAActU,KAAKwU,EAE5B,CAEAtQ,KAAKyQ,sBAEAzQ,KAAK0F,QAAQuK,QAChBjQ,KAAK0Q,0BAA0B1Q,KAAKoQ,cAAepQ,KAAK2Q,YAGtD3Q,KAAK0F,QAAQoD,QACf9I,KAAK8I,QAET,CAGA,kBAAW1E,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,MA9ES,UA+EX,CAGAwN,SACM9I,KAAK2Q,WACP3Q,KAAK4Q,OAEL5Q,KAAK6Q,MAET,CAEAA,OACE,GAAI7Q,KAAKmQ,kBAAoBnQ,KAAK2Q,WAChC,OAGF,IAAIG,EAAiB,GASrB,GANI9Q,KAAK0F,QAAQuK,SACfa,EAAiB9Q,KAAK+Q,uBA9EH,wCA+EhBhN,QAAOhN,GAAWA,IAAYiJ,KAAKyF,WACnCgC,KAAI1Q,GAAWmZ,GAAS/J,oBAAoBpP,EAAS,CAAE+R,QAAQ,OAGhEgI,EAAehY,QAAUgY,EAAe,GAAGX,iBAC7C,OAIF,GADmB5P,EAAasB,QAAQ7B,KAAKyF,SAAUgK,IACxCxN,iBACb,OAGF,IAAK,MAAM+O,KAAkBF,EAC3BE,EAAeJ,OAGjB,MAAMK,EAAYjR,KAAKkR,gBAEvBlR,KAAKyF,SAAS5L,UAAUlC,OAAOmY,IAC/B9P,KAAKyF,SAAS5L,UAAU2Q,IAAIuF,IAE5B/P,KAAKyF,SAAS0L,MAAMF,GAAa,EAEjCjR,KAAK0Q,0BAA0B1Q,KAAKoQ,eAAe,GACnDpQ,KAAKmQ,kBAAmB,EAExB,MAYMiB,EAAc,SADSH,EAAU,GAAG3L,cAAgB2L,EAAUtP,MAAM,KAG1E3B,KAAKgG,gBAdYqL,KACfrR,KAAKmQ,kBAAmB,EAExBnQ,KAAKyF,SAAS5L,UAAUlC,OAAOoY,IAC/B/P,KAAKyF,SAAS5L,UAAU2Q,IAAIsF,GAAqBD,IAEjD7P,KAAKyF,SAAS0L,MAAMF,GAAa,GAEjC1Q,EAAasB,QAAQ7B,KAAKyF,SAAUiK,GAAY,GAMpB1P,KAAKyF,UAAU,GAC7CzF,KAAKyF,SAAS0L,MAAMF,GAAc,GAAEjR,KAAKyF,SAAS2L,MACpD,CAEAR,OACE,GAAI5Q,KAAKmQ,mBAAqBnQ,KAAK2Q,WACjC,OAIF,GADmBpQ,EAAasB,QAAQ7B,KAAKyF,SAAUkK,IACxC1N,iBACb,OAGF,MAAMgP,EAAYjR,KAAKkR,gBAEvBlR,KAAKyF,SAAS0L,MAAMF,GAAc,GAAEjR,KAAKyF,SAAS6L,wBAAwBL,OAE1ExW,EAAOuF,KAAKyF,UAEZzF,KAAKyF,SAAS5L,UAAU2Q,IAAIuF,IAC5B/P,KAAKyF,SAAS5L,UAAUlC,OAAOmY,GAAqBD,IAEpD,IAAK,MAAMhO,KAAW7B,KAAKoQ,cAAe,CACxC,MAAMrZ,EAAU0P,EAAeoB,uBAAuBhG,GAElD9K,IAAYiJ,KAAK2Q,SAAS5Z,IAC5BiJ,KAAK0Q,0BAA0B,CAAC7O,IAAU,EAE9C,CAEA7B,KAAKmQ,kBAAmB,EASxBnQ,KAAKyF,SAAS0L,MAAMF,GAAa,GAEjCjR,KAAKgG,gBATYqL,KACfrR,KAAKmQ,kBAAmB,EACxBnQ,KAAKyF,SAAS5L,UAAUlC,OAAOoY,IAC/B/P,KAAKyF,SAAS5L,UAAU2Q,IAAIsF,IAC5BvP,EAAasB,QAAQ7B,KAAKyF,SAAUmK,GAAa,GAKrB5P,KAAKyF,UAAU,EAC/C,CAEAkL,SAAS5Z,EAAUiJ,KAAKyF,UACtB,OAAO1O,EAAQ8C,UAAUC,SAAS+V,GACpC,CAGAnL,kBAAkBF,GAGhB,OAFAA,EAAOsE,OAAShI,QAAQ0D,EAAOsE,QAC/BtE,EAAOyL,OAASpX,EAAW2L,EAAOyL,QAC3BzL,CACT,CAEA0M,gBACE,OAAOlR,KAAKyF,SAAS5L,UAAUC,SAtLL,uBAEhB,QACC,QAoLb,CAEA2W,sBACE,IAAKzQ,KAAK0F,QAAQuK,OAChB,OAGF,MAAMpJ,EAAW7G,KAAK+Q,uBAAuBnI,IAE7C,IAAK,MAAM7R,KAAW8P,EAAU,CAC9B,MAAM0K,EAAW9K,EAAeoB,uBAAuB9Q,GAEnDwa,GACFvR,KAAK0Q,0BAA0B,CAAC3Z,GAAUiJ,KAAK2Q,SAASY,GAE5D,CACF,CAEAR,uBAAuBhZ,GACrB,MAAM8O,EAAWJ,EAAevH,KAAK8Q,GAA4BhQ,KAAK0F,QAAQuK,QAE9E,OAAOxJ,EAAevH,KAAKnH,EAAUiI,KAAK0F,QAAQuK,QAAQlM,QAAOhN,IAAY8P,EAASzF,SAASrK,IACjG,CAEA2Z,0BAA0Bc,EAAcC,GACtC,GAAKD,EAAa1Y,OAIlB,IAAK,MAAM/B,KAAWya,EACpBza,EAAQ8C,UAAUiP,OAvNK,aAuNyB2I,GAChD1a,EAAQyM,aAAa,gBAAiBiO,EAE1C,CAGA,sBAAOhW,CAAgB+I,GACrB,MAAMkB,EAAU,GAKhB,MAJsB,iBAAXlB,GAAuB,YAAYY,KAAKZ,KACjDkB,EAAQoD,QAAS,GAGZ9I,KAAKyI,MAAK,WACf,MAAMC,EAAOwH,GAAS/J,oBAAoBnG,KAAM0F,GAEhD,GAAsB,iBAAXlB,EAAqB,CAC9B,QAA4B,IAAjBkE,EAAKlE,GACd,MAAM,IAAIa,UAAW,oBAAmBb,MAG1CkE,EAAKlE,IACP,CACF,GACF,EAOFjE,EAAac,GAAGtI,SAAUyS,GAAsB5C,IAAsB,SAAUzJ,IAEjD,MAAzBA,EAAMlC,OAAOkL,SAAoBhJ,EAAMW,gBAAmD,MAAjCX,EAAMW,eAAeqI,UAChFhJ,EAAMoD,iBAGR,IAAK,MAAMxL,KAAW0P,EAAeqB,gCAAgC9H,MACnEkQ,GAAS/J,oBAAoBpP,EAAS,CAAE+R,QAAQ,IAASA,QAE7D,IAMA7N,EAAmBiV,ICtSZ,IAAIwB,GAAM,MACNC,GAAS,SACTC,GAAQ,QACRC,GAAO,OACPC,GAAO,OACPC,GAAiB,CAACL,GAAKC,GAAQC,GAAOC,IACtCG,GAAQ,QACRC,GAAM,MACNC,GAAkB,kBAClBC,GAAW,WACXC,GAAS,SACTC,GAAY,YACZC,GAAmCP,GAAeQ,QAAO,SAAUC,EAAKC,GACjF,OAAOD,EAAI9L,OAAO,CAAC+L,EAAY,IAAMT,GAAOS,EAAY,IAAMR,IAChE,GAAG,IACQS,GAA0B,GAAGhM,OAAOqL,GAAgB,CAACD,KAAOS,QAAO,SAAUC,EAAKC,GAC3F,OAAOD,EAAI9L,OAAO,CAAC+L,EAAWA,EAAY,IAAMT,GAAOS,EAAY,IAAMR,IAC3E,GAAG,IAEQU,GAAa,aACbC,GAAO,OACPC,GAAY,YAEZC,GAAa,aACbC,GAAO,OACPC,GAAY,YAEZC,GAAc,cACdC,GAAQ,QACRC,GAAa,aACbC,GAAiB,CAACT,GAAYC,GAAMC,GAAWC,GAAYC,GAAMC,GAAWC,GAAaC,GAAOC,IC9B5F,SAASE,GAAYtc,GAClC,OAAOA,GAAWA,EAAQuc,UAAY,IAAIjQ,cAAgB,IAC5D,CCFe,SAASkQ,GAAUC,GAChC,GAAY,MAARA,EACF,OAAOxb,OAGT,GAAwB,oBAApBwb,EAAKzQ,WAAkC,CACzC,IAAI0Q,EAAgBD,EAAKC,cACzB,OAAOA,GAAgBA,EAAcC,aAAwB1b,MACjE,CAEE,OAAOwb,CACT,CCTA,SAAS/a,GAAU+a,GAEjB,OAAOA,aADUD,GAAUC,GAAM7M,SACI6M,aAAgB7M,OACvD,CAEA,SAASgN,GAAcH,GAErB,OAAOA,aADUD,GAAUC,GAAMI,aACIJ,aAAgBI,WACvD,CAEA,SAASC,GAAaL,GAEpB,MAA0B,oBAAfjZ,aAKJiZ,aADUD,GAAUC,GAAMjZ,YACIiZ,aAAgBjZ,WACvD,CCwDA,MAAAuZ,GAAe,CACbzY,KAAM,cACN0Y,SAAS,EACTC,MAAO,QACPxY,GA5EF,SAAqByY,GACnB,IAAIC,EAAQD,EAAKC,MACjBlV,OAAOtH,KAAKwc,EAAMC,UAAUC,SAAQ,SAAU/Y,GAC5C,IAAI8V,EAAQ+C,EAAMG,OAAOhZ,IAAS,GAC9BuI,EAAasQ,EAAMtQ,WAAWvI,IAAS,GACvCtE,EAAUmd,EAAMC,SAAS9Y,GAExBsY,GAAc5c,IAAasc,GAAYtc,KAO5CiI,OAAOsV,OAAOvd,EAAQoa,MAAOA,GAC7BnS,OAAOtH,KAAKkM,GAAYwQ,SAAQ,SAAU/Y,GACxC,IAAIqH,EAAQkB,EAAWvI,IAET,IAAVqH,EACF3L,EAAQ2M,gBAAgBrI,GAExBtE,EAAQyM,aAAanI,GAAgB,IAAVqH,EAAiB,GAAKA,EAEzD,IACA,GACA,EAoDE6R,OAlDF,SAAgBC,GACd,IAAIN,EAAQM,EAAMN,MACdO,EAAgB,CAClBrC,OAAQ,CACNsC,SAAUR,EAAMS,QAAQC,SACxB/C,KAAM,IACNH,IAAK,IACLmD,OAAQ,KAEVC,MAAO,CACLJ,SAAU,YAEZrC,UAAW,IASb,OAPArT,OAAOsV,OAAOJ,EAAMC,SAAS/B,OAAOjB,MAAOsD,EAAcrC,QACzD8B,EAAMG,OAASI,EAEXP,EAAMC,SAASW,OACjB9V,OAAOsV,OAAOJ,EAAMC,SAASW,MAAM3D,MAAOsD,EAAcK,OAGnD,WACL9V,OAAOtH,KAAKwc,EAAMC,UAAUC,SAAQ,SAAU/Y,GAC5C,IAAItE,EAAUmd,EAAMC,SAAS9Y,GACzBuI,EAAasQ,EAAMtQ,WAAWvI,IAAS,GAGvC8V,EAFkBnS,OAAOtH,KAAKwc,EAAMG,OAAOU,eAAe1Z,GAAQ6Y,EAAMG,OAAOhZ,GAAQoZ,EAAcpZ,IAE7EkX,QAAO,SAAUpB,EAAOpM,GAElD,OADAoM,EAAMpM,GAAY,GACXoM,CACf,GAAS,IAEEwC,GAAc5c,IAAasc,GAAYtc,KAI5CiI,OAAOsV,OAAOvd,EAAQoa,MAAOA,GAC7BnS,OAAOtH,KAAKkM,GAAYwQ,SAAQ,SAAUY,GACxCje,EAAQ2M,gBAAgBsR,EAChC,IACA,GACA,CACA,EASEC,SAAU,CAAC,kBCjFE,SAASC,GAAiBzC,GACvC,OAAOA,EAAU5V,MAAM,KAAK,EAC9B,CCHO,IAAIgB,GAAMD,KAAKC,IACXC,GAAMF,KAAKE,IACXqX,GAAQvX,KAAKuX,MCFT,SAASC,KACtB,IAAIC,EAAS3K,UAAU4K,cAEvB,OAAc,MAAVD,GAAkBA,EAAOE,QAAU/d,MAAMge,QAAQH,EAAOE,QACnDF,EAAOE,OAAO9N,KAAI,SAAUgO,GACjC,OAAOA,EAAKC,MAAQ,IAAMD,EAAKE,OACrC,IAAOjO,KAAK,KAGHgD,UAAUkL,SACnB,CCTe,SAASC,KACtB,OAAQ,iCAAiCzQ,KAAKgQ,KAChD,CCCe,SAAS9D,GAAsBva,EAAS+e,EAAcC,QAC9C,IAAjBD,IACFA,GAAe,QAGO,IAApBC,IACFA,GAAkB,GAGpB,IAAIC,EAAajf,EAAQua,wBACrB2E,EAAS,EACTC,EAAS,EAETJ,GAAgBnC,GAAc5c,KAChCkf,EAASlf,EAAQof,YAAc,GAAIhB,GAAMa,EAAWI,OAASrf,EAAQof,aAAmB,EACxFD,EAASnf,EAAQ2D,aAAe,GAAIya,GAAMa,EAAWK,QAAUtf,EAAQ2D,cAAoB,GAG7F,IACI4b,GADO7d,GAAU1B,GAAWwc,GAAUxc,GAAWiB,QAC3Bse,eAEtBC,GAAoBV,MAAsBE,EAC1CS,GAAKR,EAAWnE,MAAQ0E,GAAoBD,EAAiBA,EAAeG,WAAa,IAAMR,EAC/FS,GAAKV,EAAWtE,KAAO6E,GAAoBD,EAAiBA,EAAeK,UAAY,IAAMT,EAC7FE,EAAQJ,EAAWI,MAAQH,EAC3BI,EAASL,EAAWK,OAASH,EACjC,MAAO,CACLE,MAAOA,EACPC,OAAQA,EACR3E,IAAKgF,EACL9E,MAAO4E,EAAIJ,EACXzE,OAAQ+E,EAAIL,EACZxE,KAAM2E,EACNA,EAAGA,EACHE,EAAGA,EAEP,CCrCe,SAASE,GAAc7f,GACpC,IAAIif,EAAa1E,GAAsBva,GAGnCqf,EAAQrf,EAAQof,YAChBE,EAAStf,EAAQ2D,aAUrB,OARIkD,KAAK0M,IAAI0L,EAAWI,MAAQA,IAAU,IACxCA,EAAQJ,EAAWI,OAGjBxY,KAAK0M,IAAI0L,EAAWK,OAASA,IAAW,IAC1CA,EAASL,EAAWK,QAGf,CACLG,EAAGzf,EAAQ0f,WACXC,EAAG3f,EAAQ4f,UACXP,MAAOA,EACPC,OAAQA,EAEZ,CCvBe,SAASvc,GAASmW,EAAQnJ,GACvC,IAAI+P,EAAW/P,EAAMzM,aAAeyM,EAAMzM,cAE1C,GAAI4V,EAAOnW,SAASgN,GAClB,OAAO,EAEJ,GAAI+P,GAAYhD,GAAagD,GAAW,CACzC,IAAIxP,EAAOP,EAEX,EAAG,CACD,GAAIO,GAAQ4I,EAAO6G,WAAWzP,GAC5B,OAAO,EAITA,EAAOA,EAAK5N,YAAc4N,EAAK0P,IACvC,OAAe1P,EACf,CAGE,OAAO,CACT,CCrBe,SAASjO,GAAiBrC,GACvC,OAAOwc,GAAUxc,GAASqC,iBAAiBrC,EAC7C,CCFe,SAASigB,GAAejgB,GACrC,MAAO,CAAC,QAAS,KAAM,MAAM4G,QAAQ0V,GAAYtc,KAAa,CAChE,CCFe,SAASkgB,GAAmBlgB,GAEzC,QAAS0B,GAAU1B,GAAWA,EAAQ0c,cACtC1c,EAAQgC,WAAaf,OAAOe,UAAUoB,eACxC,CCFe,SAAS+c,GAAcngB,GACpC,MAA6B,SAAzBsc,GAAYtc,GACPA,EAMPA,EAAQogB,cACRpgB,EAAQ0C,aACRoa,GAAa9c,GAAWA,EAAQggB,KAAO,OAEvCE,GAAmBlgB,EAGvB,CCVA,SAASqgB,GAAoBrgB,GAC3B,OAAK4c,GAAc5c,IACoB,UAAvCqC,GAAiBrC,GAAS2d,SAInB3d,EAAQsgB,aAHN,IAIX,CAwCe,SAASC,GAAgBvgB,GAItC,IAHA,IAAIiB,EAASub,GAAUxc,GACnBsgB,EAAeD,GAAoBrgB,GAEhCsgB,GAAgBL,GAAeK,IAA6D,WAA5Cje,GAAiBie,GAAc3C,UACpF2C,EAAeD,GAAoBC,GAGrC,OAAIA,IAA+C,SAA9BhE,GAAYgE,IAA0D,SAA9BhE,GAAYgE,IAAwE,WAA5Cje,GAAiBie,GAAc3C,UAC3H1c,EAGFqf,GAhDT,SAA4BtgB,GAC1B,IAAIwgB,EAAY,WAAWnS,KAAKgQ,MAGhC,GAFW,WAAWhQ,KAAKgQ,OAEfzB,GAAc5c,IAII,UAFXqC,GAAiBrC,GAEnB2d,SACb,OAAO,KAIX,IAAI8C,EAAcN,GAAcngB,GAMhC,IAJI8c,GAAa2D,KACfA,EAAcA,EAAYT,MAGrBpD,GAAc6D,IAAgB,CAAC,OAAQ,QAAQ7Z,QAAQ0V,GAAYmE,IAAgB,GAAG,CAC3F,IAAIC,EAAMre,GAAiBoe,GAI3B,GAAsB,SAAlBC,EAAIC,WAA4C,SAApBD,EAAIE,aAA0C,UAAhBF,EAAIG,UAAiF,IAA1D,CAAC,YAAa,eAAeja,QAAQ8Z,EAAII,aAAsBN,GAAgC,WAAnBE,EAAII,YAA2BN,GAAaE,EAAI1T,QAAyB,SAAf0T,EAAI1T,OACjO,OAAOyT,EAEPA,EAAcA,EAAY/d,UAEhC,CAEE,OAAO,IACT,CAgByBqe,CAAmB/gB,IAAYiB,CACxD,CCpEe,SAAS+f,GAAyBtF,GAC/C,MAAO,CAAC,MAAO,UAAU9U,QAAQ8U,IAAc,EAAI,IAAM,GAC3D,CCDO,SAASuF,GAAOla,EAAK4E,EAAO7E,GACjC,OAAOoa,GAAQna,EAAKoa,GAAQxV,EAAO7E,GACrC,CCFe,SAASsa,GAAmBC,GACzC,OAAOpZ,OAAOsV,OAAO,GCDd,CACL5C,IAAK,EACLE,MAAO,EACPD,OAAQ,EACRE,KAAM,GDHuCuG,EACjD,CEHe,SAASC,GAAgB3V,EAAOhL,GAC7C,OAAOA,EAAK6a,QAAO,SAAU+F,EAASthB,GAEpC,OADAshB,EAAQthB,GAAO0L,EACR4V,CACX,GAAK,GACL,CC4EA,MAAAC,GAAe,CACbld,KAAM,QACN0Y,SAAS,EACTC,MAAO,OACPxY,GApEF,SAAeyY,GACb,IAAIuE,EAEAtE,EAAQD,EAAKC,MACb7Y,EAAO4Y,EAAK5Y,KACZsZ,EAAUV,EAAKU,QACf8D,EAAevE,EAAMC,SAASW,MAC9B4D,EAAgBxE,EAAMyE,cAAcD,cACpCE,EAAgB1D,GAAiBhB,EAAMzB,WACvCoG,EAAOd,GAAyBa,GAEhCE,EADa,CAACjH,GAAMD,IAAOjU,QAAQib,IAAkB,EAClC,SAAW,QAElC,GAAKH,GAAiBC,EAAtB,CAIA,IAAIN,EAxBgB,SAAyBW,EAAS7E,GAItD,OAAOiE,GAAsC,iBAH7CY,EAA6B,mBAAZA,EAAyBA,EAAQ/Z,OAAOsV,OAAO,GAAIJ,EAAM8E,MAAO,CAC/EvG,UAAWyB,EAAMzB,aACbsG,GACkDA,EAAUV,GAAgBU,EAAShH,IAC7F,CAmBsBkH,CAAgBtE,EAAQoE,QAAS7E,GACjDgF,EAAYtC,GAAc6B,GAC1BU,EAAmB,MAATN,EAAenH,GAAMG,GAC/BuH,EAAmB,MAATP,EAAelH,GAASC,GAClCyH,EAAUnF,EAAM8E,MAAM3G,UAAUyG,GAAO5E,EAAM8E,MAAM3G,UAAUwG,GAAQH,EAAcG,GAAQ3E,EAAM8E,MAAM5G,OAAO0G,GAC9GQ,EAAYZ,EAAcG,GAAQ3E,EAAM8E,MAAM3G,UAAUwG,GACxDU,EAAoBjC,GAAgBmB,GACpCe,EAAaD,EAA6B,MAATV,EAAeU,EAAkBE,cAAgB,EAAIF,EAAkBG,aAAe,EAAI,EAC3HC,EAAoBN,EAAU,EAAIC,EAAY,EAG9Cxb,EAAMsa,EAAce,GACpBtb,EAAM2b,EAAaN,EAAUJ,GAAOV,EAAcgB,GAClDQ,EAASJ,EAAa,EAAIN,EAAUJ,GAAO,EAAIa,EAC/CE,EAAS7B,GAAOla,EAAK8b,EAAQ/b,GAE7Bic,EAAWjB,EACf3E,EAAMyE,cAActd,KAASmd,EAAwB,IAA0BsB,GAAYD,EAAQrB,EAAsBuB,aAAeF,EAASD,EAAQpB,EAnB3J,CAoBA,EAkCEjE,OAhCF,SAAgBC,GACd,IAAIN,EAAQM,EAAMN,MAEd8F,EADUxF,EAAMG,QACW5d,QAC3B0hB,OAAoC,IAArBuB,EAA8B,sBAAwBA,EAErD,MAAhBvB,IAKwB,iBAAjBA,IACTA,EAAevE,EAAMC,SAAS/B,OAAOpZ,cAAcyf,MAOhD3e,GAASoa,EAAMC,SAAS/B,OAAQqG,KAIrCvE,EAAMC,SAASW,MAAQ2D,EACzB,EASExD,SAAU,CAAC,iBACXgF,iBAAkB,CAAC,oBCxFN,SAASC,GAAazH,GACnC,OAAOA,EAAU5V,MAAM,KAAK,EAC9B,CCOA,IAAIsd,GAAa,CACfzI,IAAK,OACLE,MAAO,OACPD,OAAQ,OACRE,KAAM,QAeD,SAASuI,GAAY5F,GAC1B,IAAI6F,EAEAjI,EAASoC,EAAMpC,OACfkI,EAAa9F,EAAM8F,WACnB7H,EAAY+B,EAAM/B,UAClB8H,EAAY/F,EAAM+F,UAClBC,EAAUhG,EAAMgG,QAChB9F,EAAWF,EAAME,SACjB+F,EAAkBjG,EAAMiG,gBACxBC,EAAWlG,EAAMkG,SACjBC,EAAenG,EAAMmG,aACrBC,EAAUpG,EAAMoG,QAChBC,EAAaL,EAAQhE,EACrBA,OAAmB,IAAfqE,EAAwB,EAAIA,EAChCC,EAAaN,EAAQ9D,EACrBA,OAAmB,IAAfoE,EAAwB,EAAIA,EAEhCC,EAAgC,mBAAjBJ,EAA8BA,EAAa,CAC5DnE,EAAGA,EACHE,EAAGA,IACA,CACHF,EAAGA,EACHE,EAAGA,GAGLF,EAAIuE,EAAMvE,EACVE,EAAIqE,EAAMrE,EACV,IAAIsE,EAAOR,EAAQzF,eAAe,KAC9BkG,EAAOT,EAAQzF,eAAe,KAC9BmG,EAAQrJ,GACRsJ,EAAQzJ,GACR0J,EAAMpjB,OAEV,GAAI0iB,EAAU,CACZ,IAAIrD,EAAeC,GAAgBlF,GAC/BiJ,EAAa,eACbC,EAAY,cAEZjE,IAAiB9D,GAAUnB,IAGmB,WAA5ChZ,GAFJie,EAAeJ,GAAmB7E,IAECsC,UAAsC,aAAbA,IAC1D2G,EAAa,eACbC,EAAY,gBAOZ7I,IAAcf,KAAQe,IAAcZ,IAAQY,IAAcb,KAAU2I,IAActI,MACpFkJ,EAAQxJ,GAGR+E,IAFckE,GAAWvD,IAAiB+D,GAAOA,EAAI9E,eAAiB8E,EAAI9E,eAAeD,OACzFgB,EAAagE,IACEf,EAAWjE,OAC1BK,GAAK+D,EAAkB,GAAK,GAG1BhI,IAAcZ,KAASY,IAAcf,IAAOe,IAAcd,IAAW4I,IAActI,MACrFiJ,EAAQtJ,GAGR4E,IAFcoE,GAAWvD,IAAiB+D,GAAOA,EAAI9E,eAAiB8E,EAAI9E,eAAeF,MACzFiB,EAAaiE,IACEhB,EAAWlE,MAC1BI,GAAKiE,EAAkB,GAAK,EAElC,CAEE,IAgBMc,EAhBFC,EAAexc,OAAOsV,OAAO,CAC/BI,SAAUA,GACTgG,GAAYP,IAEXsB,GAAyB,IAAjBd,EAlFd,SAA2B1G,EAAMmH,GAC/B,IAAI5E,EAAIvC,EAAKuC,EACTE,EAAIzC,EAAKyC,EACTgF,EAAMN,EAAIO,kBAAoB,EAClC,MAAO,CACLnF,EAAGrB,GAAMqB,EAAIkF,GAAOA,GAAO,EAC3BhF,EAAGvB,GAAMuB,EAAIgF,GAAOA,GAAO,EAE/B,CA0EsCE,CAAkB,CACpDpF,EAAGA,EACHE,EAAGA,GACFnD,GAAUnB,IAAW,CACtBoE,EAAGA,EACHE,EAAGA,GAML,OAHAF,EAAIiF,EAAMjF,EACVE,EAAI+E,EAAM/E,EAEN+D,EAGKzb,OAAOsV,OAAO,GAAIkH,IAAeD,EAAiB,IAAmBJ,GAASF,EAAO,IAAM,GAAIM,EAAeL,GAASF,EAAO,IAAM,GAAIO,EAAe7D,WAAa0D,EAAIO,kBAAoB,IAAM,EAAI,aAAenF,EAAI,OAASE,EAAI,MAAQ,eAAiBF,EAAI,OAASE,EAAI,SAAU6E,IAG5Rvc,OAAOsV,OAAO,GAAIkH,IAAenB,EAAkB,IAAoBc,GAASF,EAAOvE,EAAI,KAAO,GAAI2D,EAAgBa,GAASF,EAAOxE,EAAI,KAAO,GAAI6D,EAAgB3C,UAAY,GAAI2C,GAC9L,CA4CA,MAAAwB,GAAe,CACbxgB,KAAM,gBACN0Y,SAAS,EACTC,MAAO,cACPxY,GA9CF,SAAuBsgB,GACrB,IAAI5H,EAAQ4H,EAAM5H,MACdS,EAAUmH,EAAMnH,QAChBoH,EAAwBpH,EAAQ8F,gBAChCA,OAA4C,IAA1BsB,GAA0CA,EAC5DC,EAAoBrH,EAAQ+F,SAC5BA,OAAiC,IAAtBsB,GAAsCA,EACjDC,EAAwBtH,EAAQgG,aAChCA,OAAyC,IAA1BsB,GAA0CA,EACzDT,EAAe,CACjB/I,UAAWyC,GAAiBhB,EAAMzB,WAClC8H,UAAWL,GAAahG,EAAMzB,WAC9BL,OAAQ8B,EAAMC,SAAS/B,OACvBkI,WAAYpG,EAAM8E,MAAM5G,OACxBqI,gBAAiBA,EACjBG,QAAoC,UAA3B1G,EAAMS,QAAQC,UAGgB,MAArCV,EAAMyE,cAAcD,gBACtBxE,EAAMG,OAAOjC,OAASpT,OAAOsV,OAAO,GAAIJ,EAAMG,OAAOjC,OAAQgI,GAAYpb,OAAOsV,OAAO,GAAIkH,EAAc,CACvGhB,QAAStG,EAAMyE,cAAcD,cAC7BhE,SAAUR,EAAMS,QAAQC,SACxB8F,SAAUA,EACVC,aAAcA,OAIe,MAA7BzG,EAAMyE,cAAc7D,QACtBZ,EAAMG,OAAOS,MAAQ9V,OAAOsV,OAAO,GAAIJ,EAAMG,OAAOS,MAAOsF,GAAYpb,OAAOsV,OAAO,GAAIkH,EAAc,CACrGhB,QAAStG,EAAMyE,cAAc7D,MAC7BJ,SAAU,WACVgG,UAAU,EACVC,aAAcA,OAIlBzG,EAAMtQ,WAAWwO,OAASpT,OAAOsV,OAAO,GAAIJ,EAAMtQ,WAAWwO,OAAQ,CACnE,wBAAyB8B,EAAMzB,WAEnC,EAQE/J,KAAM,ICrKR,IAAIwT,GAAU,CACZA,SAAS,GAsCX,MAAAC,GAAe,CACb9gB,KAAM,iBACN0Y,SAAS,EACTC,MAAO,QACPxY,GAAI,WAAc,EAClB+Y,OAxCF,SAAgBN,GACd,IAAIC,EAAQD,EAAKC,MACbjd,EAAWgd,EAAKhd,SAChB0d,EAAUV,EAAKU,QACfyH,EAAkBzH,EAAQ0H,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAkB3H,EAAQ4H,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CtkB,EAASub,GAAUW,EAAMC,SAAS/B,QAClCoK,EAAgB,GAAG9V,OAAOwN,EAAMsI,cAAcnK,UAAW6B,EAAMsI,cAAcpK,QAYjF,OAVIiK,GACFG,EAAcpI,SAAQ,SAAUqI,GAC9BA,EAAa5gB,iBAAiB,SAAU5E,EAASylB,OAAQR,GAC/D,IAGMK,GACFvkB,EAAO6D,iBAAiB,SAAU5E,EAASylB,OAAQR,IAG9C,WACDG,GACFG,EAAcpI,SAAQ,SAAUqI,GAC9BA,EAAavf,oBAAoB,SAAUjG,EAASylB,OAAQR,GACpE,IAGQK,GACFvkB,EAAOkF,oBAAoB,SAAUjG,EAASylB,OAAQR,GAE5D,CACA,EASExT,KAAM,IC/CR,IAAIiU,GAAO,CACT9K,KAAM,QACND,MAAO,OACPD,OAAQ,MACRD,IAAK,UAEQ,SAASkL,GAAqBnK,GAC3C,OAAOA,EAAUta,QAAQ,0BAA0B,SAAU0kB,GAC3D,OAAOF,GAAKE,EAChB,GACA,CCVA,IAAIF,GAAO,CACT3K,MAAO,MACPC,IAAK,SAEQ,SAAS6K,GAA8BrK,GACpD,OAAOA,EAAUta,QAAQ,cAAc,SAAU0kB,GAC/C,OAAOF,GAAKE,EAChB,GACA,CCPe,SAASE,GAAgBvJ,GACtC,IAAI4H,EAAM7H,GAAUC,GAGpB,MAAO,CACLwJ,WAHe5B,EAAI6B,YAInBC,UAHc9B,EAAI+B,YAKtB,CCNe,SAASC,GAAoBrmB,GAQ1C,OAAOua,GAAsB2F,GAAmBlgB,IAAU8a,KAAOkL,GAAgBhmB,GAASimB,UAC5F,CCXe,SAASK,GAAetmB,GAErC,IAAIumB,EAAoBlkB,GAAiBrC,GACrCwmB,EAAWD,EAAkBC,SAC7BC,EAAYF,EAAkBE,UAC9BC,EAAYH,EAAkBG,UAElC,MAAO,6BAA6BrY,KAAKmY,EAAWE,EAAYD,EAClE,CCLe,SAASE,GAAgBlK,GACtC,MAAI,CAAC,OAAQ,OAAQ,aAAa7V,QAAQ0V,GAAYG,KAAU,EAEvDA,EAAKC,cAAc5Y,KAGxB8Y,GAAcH,IAAS6J,GAAe7J,GACjCA,EAGFkK,GAAgBxG,GAAc1D,GACvC,CCJe,SAASmK,GAAkB5mB,EAASsG,GACjD,IAAIugB,OAES,IAATvgB,IACFA,EAAO,IAGT,IAAIof,EAAeiB,GAAgB3mB,GAC/B8mB,EAASpB,KAAqE,OAAlDmB,EAAwB7mB,EAAQ0c,oBAAyB,EAASmK,EAAsB/iB,MACpHugB,EAAM7H,GAAUkJ,GAChBxf,EAAS4gB,EAAS,CAACzC,GAAK1U,OAAO0U,EAAI9E,gBAAkB,GAAI+G,GAAeZ,GAAgBA,EAAe,IAAMA,EAC7GqB,EAAczgB,EAAKqJ,OAAOzJ,GAC9B,OAAO4gB,EAASC,EAChBA,EAAYpX,OAAOiX,GAAkBzG,GAAcja,IACrD,CCzBe,SAAS8gB,GAAiBC,GACvC,OAAOhf,OAAOsV,OAAO,GAAI0J,EAAM,CAC7BnM,KAAMmM,EAAKxH,EACX9E,IAAKsM,EAAKtH,EACV9E,MAAOoM,EAAKxH,EAAIwH,EAAK5H,MACrBzE,OAAQqM,EAAKtH,EAAIsH,EAAK3H,QAE1B,CCqBA,SAAS4H,GAA2BlnB,EAASmnB,EAAgBtJ,GAC3D,OAAOsJ,IAAmB/L,GAAW4L,GCzBxB,SAAyBhnB,EAAS6d,GAC/C,IAAIwG,EAAM7H,GAAUxc,GAChBonB,EAAOlH,GAAmBlgB,GAC1Buf,EAAiB8E,EAAI9E,eACrBF,EAAQ+H,EAAKzE,YACbrD,EAAS8H,EAAK1E,aACdjD,EAAI,EACJE,EAAI,EAER,GAAIJ,EAAgB,CAClBF,EAAQE,EAAeF,MACvBC,EAASC,EAAeD,OACxB,IAAI+H,EAAiBvI,MAEjBuI,IAAmBA,GAA+B,UAAbxJ,KACvC4B,EAAIF,EAAeG,WACnBC,EAAIJ,EAAeK,UAEzB,CAEE,MAAO,CACLP,MAAOA,EACPC,OAAQA,EACRG,EAAGA,EAAI4G,GAAoBrmB,GAC3B2f,EAAGA,EAEP,CDDwD2H,CAAgBtnB,EAAS6d,IAAanc,GAAUylB,GAdxG,SAAoCnnB,EAAS6d,GAC3C,IAAIoJ,EAAO1M,GAAsBva,GAAS,EAAoB,UAAb6d,GASjD,OARAoJ,EAAKtM,IAAMsM,EAAKtM,IAAM3a,EAAQunB,UAC9BN,EAAKnM,KAAOmM,EAAKnM,KAAO9a,EAAQwnB,WAChCP,EAAKrM,OAASqM,EAAKtM,IAAM3a,EAAQ0iB,aACjCuE,EAAKpM,MAAQoM,EAAKnM,KAAO9a,EAAQ2iB,YACjCsE,EAAK5H,MAAQrf,EAAQ2iB,YACrBsE,EAAK3H,OAAStf,EAAQ0iB,aACtBuE,EAAKxH,EAAIwH,EAAKnM,KACdmM,EAAKtH,EAAIsH,EAAKtM,IACPsM,CACT,CAG0HQ,CAA2BN,EAAgBtJ,GAAYmJ,GEtBlK,SAAyBhnB,GACtC,IAAI6mB,EAEAO,EAAOlH,GAAmBlgB,GAC1B0nB,EAAY1B,GAAgBhmB,GAC5B8D,EAA0D,OAAlD+iB,EAAwB7mB,EAAQ0c,oBAAyB,EAASmK,EAAsB/iB,KAChGub,EAAQvY,GAAIsgB,EAAKO,YAAaP,EAAKzE,YAAa7e,EAAOA,EAAK6jB,YAAc,EAAG7jB,EAAOA,EAAK6e,YAAc,GACvGrD,EAASxY,GAAIsgB,EAAKQ,aAAcR,EAAK1E,aAAc5e,EAAOA,EAAK8jB,aAAe,EAAG9jB,EAAOA,EAAK4e,aAAe,GAC5GjD,GAAKiI,EAAUzB,WAAaI,GAAoBrmB,GAChD2f,GAAK+H,EAAUvB,UAMnB,MAJiD,QAA7C9jB,GAAiByB,GAAQsjB,GAAM5T,YACjCiM,GAAK3Y,GAAIsgB,EAAKzE,YAAa7e,EAAOA,EAAK6e,YAAc,GAAKtD,GAGrD,CACLA,MAAOA,EACPC,OAAQA,EACRG,EAAGA,EACHE,EAAGA,EAEP,CFCkMkI,CAAgB3H,GAAmBlgB,IACrO,CG1Be,SAAS8nB,GAAe5K,GACrC,IAOIuG,EAPAnI,EAAY4B,EAAK5B,UACjBtb,EAAUkd,EAAKld,QACf0b,EAAYwB,EAAKxB,UACjBmG,EAAgBnG,EAAYyC,GAAiBzC,GAAa,KAC1D8H,EAAY9H,EAAYyH,GAAazH,GAAa,KAClDqM,EAAUzM,EAAUmE,EAAInE,EAAU+D,MAAQ,EAAIrf,EAAQqf,MAAQ,EAC9D2I,EAAU1M,EAAUqE,EAAIrE,EAAUgE,OAAS,EAAItf,EAAQsf,OAAS,EAGpE,OAAQuC,GACN,KAAKlH,GACH8I,EAAU,CACRhE,EAAGsI,EACHpI,EAAGrE,EAAUqE,EAAI3f,EAAQsf,QAE3B,MAEF,KAAK1E,GACH6I,EAAU,CACRhE,EAAGsI,EACHpI,EAAGrE,EAAUqE,EAAIrE,EAAUgE,QAE7B,MAEF,KAAKzE,GACH4I,EAAU,CACRhE,EAAGnE,EAAUmE,EAAInE,EAAU+D,MAC3BM,EAAGqI,GAEL,MAEF,KAAKlN,GACH2I,EAAU,CACRhE,EAAGnE,EAAUmE,EAAIzf,EAAQqf,MACzBM,EAAGqI,GAEL,MAEF,QACEvE,EAAU,CACRhE,EAAGnE,EAAUmE,EACbE,EAAGrE,EAAUqE,GAInB,IAAIsI,EAAWpG,EAAgBb,GAAyBa,GAAiB,KAEzE,GAAgB,MAAZoG,EAAkB,CACpB,IAAIlG,EAAmB,MAAbkG,EAAmB,SAAW,QAExC,OAAQzE,GACN,KAAKvI,GACHwI,EAAQwE,GAAYxE,EAAQwE,IAAa3M,EAAUyG,GAAO,EAAI/hB,EAAQ+hB,GAAO,GAC7E,MAEF,KAAK7G,GACHuI,EAAQwE,GAAYxE,EAAQwE,IAAa3M,EAAUyG,GAAO,EAAI/hB,EAAQ+hB,GAAO,GAKrF,CAEE,OAAO0B,CACT,CC3De,SAASyE,GAAe/K,EAAOS,QAC5B,IAAZA,IACFA,EAAU,IAGZ,IAAIuK,EAAWvK,EACXwK,EAAqBD,EAASzM,UAC9BA,OAAmC,IAAvB0M,EAAgCjL,EAAMzB,UAAY0M,EAC9DC,EAAoBF,EAAStK,SAC7BA,OAAiC,IAAtBwK,EAA+BlL,EAAMU,SAAWwK,EAC3DC,EAAoBH,EAASI,SAC7BA,OAAiC,IAAtBD,EAA+BnN,GAAkBmN,EAC5DE,EAAwBL,EAASM,aACjCA,OAAyC,IAA1BD,EAAmCpN,GAAWoN,EAC7DE,EAAwBP,EAASQ,eACjCA,OAA2C,IAA1BD,EAAmCrN,GAASqN,EAC7DE,EAAuBT,EAASU,YAChCA,OAAuC,IAAzBD,GAA0CA,EACxDE,EAAmBX,EAASnG,QAC5BA,OAA+B,IAArB8G,EAA8B,EAAIA,EAC5CzH,EAAgBD,GAAsC,iBAAZY,EAAuBA,EAAUV,GAAgBU,EAAShH,KACpG+N,EAAaJ,IAAmBtN,GAASC,GAAYD,GACrDkI,EAAapG,EAAM8E,MAAM5G,OACzBrb,EAAUmd,EAAMC,SAASyL,EAAcE,EAAaJ,GACpDK,EJkBS,SAAyBhpB,EAASuoB,EAAUE,EAAc5K,GACvE,IAAIoL,EAAmC,oBAAbV,EAlB5B,SAA4BvoB,GAC1B,IAAImb,EAAkByL,GAAkBzG,GAAcngB,IAElDkpB,EADoB,CAAC,WAAY,SAAStiB,QAAQvE,GAAiBrC,GAAS2d,WAAa,GACnDf,GAAc5c,GAAWugB,GAAgBvgB,GAAWA,EAE9F,OAAK0B,GAAUwnB,GAKR/N,EAAgBnO,QAAO,SAAUma,GACtC,OAAOzlB,GAAUylB,IAAmBpkB,GAASokB,EAAgB+B,IAAmD,SAAhC5M,GAAY6K,EAChG,IANW,EAOX,CAK6DgC,CAAmBnpB,GAAW,GAAG2P,OAAO4Y,GAC/FpN,EAAkB,GAAGxL,OAAOsZ,EAAqB,CAACR,IAClDW,EAAsBjO,EAAgB,GACtCkO,EAAelO,EAAgBK,QAAO,SAAU8N,EAASnC,GAC3D,IAAIF,EAAOC,GAA2BlnB,EAASmnB,EAAgBtJ,GAK/D,OAJAyL,EAAQ3O,IAAM7T,GAAImgB,EAAKtM,IAAK2O,EAAQ3O,KACpC2O,EAAQzO,MAAQ9T,GAAIkgB,EAAKpM,MAAOyO,EAAQzO,OACxCyO,EAAQ1O,OAAS7T,GAAIkgB,EAAKrM,OAAQ0O,EAAQ1O,QAC1C0O,EAAQxO,KAAOhU,GAAImgB,EAAKnM,KAAMwO,EAAQxO,MAC/BwO,CACX,GAAKpC,GAA2BlnB,EAASopB,EAAqBvL,IAK5D,OAJAwL,EAAahK,MAAQgK,EAAaxO,MAAQwO,EAAavO,KACvDuO,EAAa/J,OAAS+J,EAAazO,OAASyO,EAAa1O,IACzD0O,EAAa5J,EAAI4J,EAAavO,KAC9BuO,EAAa1J,EAAI0J,EAAa1O,IACvB0O,CACT,CInC2BE,CAAgB7nB,GAAU1B,GAAWA,EAAUA,EAAQwpB,gBAAkBtJ,GAAmB/C,EAAMC,SAAS/B,QAASkN,EAAUE,EAAc5K,GACjK4L,EAAsBlP,GAAsB4C,EAAMC,SAAS9B,WAC3DqG,EAAgBmG,GAAe,CACjCxM,UAAWmO,EACXzpB,QAASujB,EACT1F,SAAU,WACVnC,UAAWA,IAETgO,EAAmB1C,GAAiB/e,OAAOsV,OAAO,GAAIgG,EAAY5B,IAClEgI,EAAoBhB,IAAmBtN,GAASqO,EAAmBD,EAGnEG,EAAkB,CACpBjP,IAAKqO,EAAmBrO,IAAMgP,EAAkBhP,IAAM0G,EAAc1G,IACpEC,OAAQ+O,EAAkB/O,OAASoO,EAAmBpO,OAASyG,EAAczG,OAC7EE,KAAMkO,EAAmBlO,KAAO6O,EAAkB7O,KAAOuG,EAAcvG,KACvED,MAAO8O,EAAkB9O,MAAQmO,EAAmBnO,MAAQwG,EAAcxG,OAExEgP,EAAa1M,EAAMyE,cAAckB,OAErC,GAAI6F,IAAmBtN,IAAUwO,EAAY,CAC3C,IAAI/G,EAAS+G,EAAWnO,GACxBzT,OAAOtH,KAAKipB,GAAiBvM,SAAQ,SAAUpd,GAC7C,IAAI6pB,EAAW,CAACjP,GAAOD,IAAQhU,QAAQ3G,IAAQ,EAAI,GAAK,EACpD6hB,EAAO,CAACnH,GAAKC,IAAQhU,QAAQ3G,IAAQ,EAAI,IAAM,IACnD2pB,EAAgB3pB,IAAQ6iB,EAAOhB,GAAQgI,CAC7C,GACA,CAEE,OAAOF,CACT,CC5De,SAASG,GAAqB5M,EAAOS,QAClC,IAAZA,IACFA,EAAU,IAGZ,IAAIuK,EAAWvK,EACXlC,EAAYyM,EAASzM,UACrB6M,EAAWJ,EAASI,SACpBE,EAAeN,EAASM,aACxBzG,EAAUmG,EAASnG,QACnBgI,EAAiB7B,EAAS6B,eAC1BC,EAAwB9B,EAAS+B,sBACjCA,OAAkD,IAA1BD,EAAmCE,GAAgBF,EAC3EzG,EAAYL,GAAazH,GACzBC,EAAa6H,EAAYwG,EAAiBzO,GAAsBA,GAAoBvO,QAAO,SAAU0O,GACvG,OAAOyH,GAAazH,KAAe8H,CACvC,IAAOxI,GACDoP,EAAoBzO,EAAW3O,QAAO,SAAU0O,GAClD,OAAOwO,EAAsBtjB,QAAQ8U,IAAc,CACvD,IAEmC,IAA7B0O,EAAkBroB,SACpBqoB,EAAoBzO,GAItB,IAAI0O,EAAYD,EAAkB5O,QAAO,SAAUC,EAAKC,GAOtD,OANAD,EAAIC,GAAawM,GAAe/K,EAAO,CACrCzB,UAAWA,EACX6M,SAAUA,EACVE,aAAcA,EACdzG,QAASA,IACR7D,GAAiBzC,IACbD,CACX,GAAK,IACH,OAAOxT,OAAOtH,KAAK0pB,GAAWC,MAAK,SAAUC,EAAGC,GAC9C,OAAOH,EAAUE,GAAKF,EAAUG,EACpC,GACA,CC+FA,MAAAC,GAAe,CACbnmB,KAAM,OACN0Y,SAAS,EACTC,MAAO,OACPxY,GA5HF,SAAcyY,GACZ,IAAIC,EAAQD,EAAKC,MACbS,EAAUV,EAAKU,QACftZ,EAAO4Y,EAAK5Y,KAEhB,IAAI6Y,EAAMyE,cAActd,GAAMomB,MAA9B,CAoCA,IAhCA,IAAIC,EAAoB/M,EAAQqK,SAC5B2C,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBjN,EAAQkN,QAC3BC,OAAoC,IAArBF,GAAqCA,EACpDG,EAA8BpN,EAAQqN,mBACtCjJ,EAAUpE,EAAQoE,QAClBuG,EAAW3K,EAAQ2K,SACnBE,EAAe7K,EAAQ6K,aACvBI,EAAcjL,EAAQiL,YACtBqC,EAAwBtN,EAAQoM,eAChCA,OAA2C,IAA1BkB,GAA0CA,EAC3DhB,EAAwBtM,EAAQsM,sBAChCiB,EAAqBhO,EAAMS,QAAQlC,UACnCmG,EAAgB1D,GAAiBgN,GAEjCF,EAAqBD,IADHnJ,IAAkBsJ,GACqCnB,EAjC/E,SAAuCtO,GACrC,GAAIyC,GAAiBzC,KAAeX,GAClC,MAAO,GAGT,IAAIqQ,EAAoBvF,GAAqBnK,GAC7C,MAAO,CAACqK,GAA8BrK,GAAY0P,EAAmBrF,GAA8BqF,GACrG,CA0B6IC,CAA8BF,GAA3E,CAACtF,GAAqBsF,KAChHxP,EAAa,CAACwP,GAAoBxb,OAAOsb,GAAoBzP,QAAO,SAAUC,EAAKC,GACrF,OAAOD,EAAI9L,OAAOwO,GAAiBzC,KAAeX,GAAOgP,GAAqB5M,EAAO,CACnFzB,UAAWA,EACX6M,SAAUA,EACVE,aAAcA,EACdzG,QAASA,EACTgI,eAAgBA,EAChBE,sBAAuBA,IACpBxO,EACT,GAAK,IACC4P,EAAgBnO,EAAM8E,MAAM3G,UAC5BiI,EAAapG,EAAM8E,MAAM5G,OACzBkQ,EAAY,IAAI1rB,IAChB2rB,GAAqB,EACrBC,EAAwB9P,EAAW,GAE9B+P,EAAI,EAAGA,EAAI/P,EAAW5Z,OAAQ2pB,IAAK,CAC1C,IAAIhQ,EAAYC,EAAW+P,GAEvBC,EAAiBxN,GAAiBzC,GAElCkQ,EAAmBzI,GAAazH,KAAeT,GAC/C4Q,EAAa,CAAClR,GAAKC,IAAQhU,QAAQ+kB,IAAmB,EACtD5J,EAAM8J,EAAa,QAAU,SAC7BrF,EAAW0B,GAAe/K,EAAO,CACnCzB,UAAWA,EACX6M,SAAUA,EACVE,aAAcA,EACdI,YAAaA,EACb7G,QAASA,IAEP8J,EAAoBD,EAAaD,EAAmB/Q,GAAQC,GAAO8Q,EAAmBhR,GAASD,GAE/F2Q,EAAcvJ,GAAOwB,EAAWxB,KAClC+J,EAAoBjG,GAAqBiG,IAG3C,IAAIC,EAAmBlG,GAAqBiG,GACxCE,EAAS,GAUb,GARIpB,GACFoB,EAAOjnB,KAAKyhB,EAASmF,IAAmB,GAGtCZ,GACFiB,EAAOjnB,KAAKyhB,EAASsF,IAAsB,EAAGtF,EAASuF,IAAqB,GAG1EC,EAAOC,OAAM,SAAUC,GACzB,OAAOA,CACb,IAAQ,CACFT,EAAwB/P,EACxB8P,GAAqB,EACrB,KACN,CAEID,EAAUxrB,IAAI2b,EAAWsQ,EAC7B,CAEE,GAAIR,EAqBF,IAnBA,IAEIW,EAAQ,SAAeC,GACzB,IAAIC,EAAmB1Q,EAAWxT,MAAK,SAAUuT,GAC/C,IAAIsQ,EAAST,EAAUlrB,IAAIqb,GAE3B,GAAIsQ,EACF,OAAOA,EAAOphB,MAAM,EAAGwhB,GAAIH,OAAM,SAAUC,GACzC,OAAOA,CACnB,GAEA,IAEM,GAAIG,EAEF,OADAZ,EAAwBY,EACjB,OAEf,EAEaD,EAnBYpC,EAAiB,EAAI,EAmBZoC,EAAK,GAGpB,UAFFD,EAAMC,GADmBA,KAOpCjP,EAAMzB,YAAc+P,IACtBtO,EAAMyE,cAActd,GAAMomB,OAAQ,EAClCvN,EAAMzB,UAAY+P,EAClBtO,EAAMmP,OAAQ,EA5GlB,CA8GA,EAQEpJ,iBAAkB,CAAC,UACnBvR,KAAM,CACJ+Y,OAAO,IC7IX,SAAS6B,GAAe/F,EAAUS,EAAMuF,GAQtC,YAPyB,IAArBA,IACFA,EAAmB,CACjB/M,EAAG,EACHE,EAAG,IAIA,CACLhF,IAAK6L,EAAS7L,IAAMsM,EAAK3H,OAASkN,EAAiB7M,EACnD9E,MAAO2L,EAAS3L,MAAQoM,EAAK5H,MAAQmN,EAAiB/M,EACtD7E,OAAQ4L,EAAS5L,OAASqM,EAAK3H,OAASkN,EAAiB7M,EACzD7E,KAAM0L,EAAS1L,KAAOmM,EAAK5H,MAAQmN,EAAiB/M,EAExD,CAEA,SAASgN,GAAsBjG,GAC7B,MAAO,CAAC7L,GAAKE,GAAOD,GAAQE,IAAM4R,MAAK,SAAUC,GAC/C,OAAOnG,EAASmG,IAAS,CAC7B,GACA,CA+BA,MAAAC,GAAe,CACbtoB,KAAM,OACN0Y,SAAS,EACTC,MAAO,OACPiG,iBAAkB,CAAC,mBACnBze,GAlCF,SAAcyY,GACZ,IAAIC,EAAQD,EAAKC,MACb7Y,EAAO4Y,EAAK5Y,KACZgnB,EAAgBnO,EAAM8E,MAAM3G,UAC5BiI,EAAapG,EAAM8E,MAAM5G,OACzBmR,EAAmBrP,EAAMyE,cAAciL,gBACvCC,EAAoB5E,GAAe/K,EAAO,CAC5CwL,eAAgB,cAEdoE,EAAoB7E,GAAe/K,EAAO,CAC5C0L,aAAa,IAEXmE,EAA2BT,GAAeO,EAAmBxB,GAC7D2B,EAAsBV,GAAeQ,EAAmBxJ,EAAYiJ,GACpEU,EAAoBT,GAAsBO,GAC1CG,EAAmBV,GAAsBQ,GAC7C9P,EAAMyE,cAActd,GAAQ,CAC1B0oB,yBAA0BA,EAC1BC,oBAAqBA,EACrBC,kBAAmBA,EACnBC,iBAAkBA,GAEpBhQ,EAAMtQ,WAAWwO,OAASpT,OAAOsV,OAAO,GAAIJ,EAAMtQ,WAAWwO,OAAQ,CACnE,+BAAgC6R,EAChC,sBAAuBC,GAE3B,GCJAC,GAAe,CACb9oB,KAAM,SACN0Y,SAAS,EACTC,MAAO,OACPiB,SAAU,CAAC,iBACXzZ,GA5BF,SAAgBgZ,GACd,IAAIN,EAAQM,EAAMN,MACdS,EAAUH,EAAMG,QAChBtZ,EAAOmZ,EAAMnZ,KACb+oB,EAAkBzP,EAAQkF,OAC1BA,OAA6B,IAApBuK,EAA6B,CAAC,EAAG,GAAKA,EAC/C1b,EAAOgK,GAAWH,QAAO,SAAUC,EAAKC,GAE1C,OADAD,EAAIC,GA5BD,SAAiCA,EAAWuG,EAAOa,GACxD,IAAIjB,EAAgB1D,GAAiBzC,GACjC4R,EAAiB,CAACxS,GAAMH,IAAK/T,QAAQib,IAAkB,GAAK,EAAI,EAEhE3E,EAAyB,mBAAX4F,EAAwBA,EAAO7a,OAAOsV,OAAO,GAAI0E,EAAO,CACxEvG,UAAWA,KACPoH,EACFyK,EAAWrQ,EAAK,GAChBsQ,EAAWtQ,EAAK,GAIpB,OAFAqQ,EAAWA,GAAY,EACvBC,GAAYA,GAAY,GAAKF,EACtB,CAACxS,GAAMD,IAAOjU,QAAQib,IAAkB,EAAI,CACjDpC,EAAG+N,EACH7N,EAAG4N,GACD,CACF9N,EAAG8N,EACH5N,EAAG6N,EAEP,CASqBC,CAAwB/R,EAAWyB,EAAM8E,MAAOa,GAC1DrH,CACX,GAAK,IACCiS,EAAwB/b,EAAKwL,EAAMzB,WACnC+D,EAAIiO,EAAsBjO,EAC1BE,EAAI+N,EAAsB/N,EAEW,MAArCxC,EAAMyE,cAAcD,gBACtBxE,EAAMyE,cAAcD,cAAclC,GAAKA,EACvCtC,EAAMyE,cAAcD,cAAchC,GAAKA,GAGzCxC,EAAMyE,cAActd,GAAQqN,CAC9B,GC1BAgc,GAAe,CACbrpB,KAAM,gBACN0Y,SAAS,EACTC,MAAO,OACPxY,GApBF,SAAuByY,GACrB,IAAIC,EAAQD,EAAKC,MACb7Y,EAAO4Y,EAAK5Y,KAKhB6Y,EAAMyE,cAActd,GAAQwjB,GAAe,CACzCxM,UAAW6B,EAAM8E,MAAM3G,UACvBtb,QAASmd,EAAM8E,MAAM5G,OACrBwC,SAAU,WACVnC,UAAWyB,EAAMzB,WAErB,EAQE/J,KAAM,ICgHRic,GAAe,CACbtpB,KAAM,kBACN0Y,SAAS,EACTC,MAAO,OACPxY,GA/HF,SAAyByY,GACvB,IAAIC,EAAQD,EAAKC,MACbS,EAAUV,EAAKU,QACftZ,EAAO4Y,EAAK5Y,KACZqmB,EAAoB/M,EAAQqK,SAC5B2C,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBjN,EAAQkN,QAC3BC,OAAoC,IAArBF,GAAsCA,EACrDtC,EAAW3K,EAAQ2K,SACnBE,EAAe7K,EAAQ6K,aACvBI,EAAcjL,EAAQiL,YACtB7G,EAAUpE,EAAQoE,QAClB6L,EAAkBjQ,EAAQkQ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAwBnQ,EAAQoQ,aAChCA,OAAyC,IAA1BD,EAAmC,EAAIA,EACtDvH,EAAW0B,GAAe/K,EAAO,CACnCoL,SAAUA,EACVE,aAAcA,EACdzG,QAASA,EACT6G,YAAaA,IAEXhH,EAAgB1D,GAAiBhB,EAAMzB,WACvC8H,EAAYL,GAAahG,EAAMzB,WAC/BuS,GAAmBzK,EACnByE,EAAWjH,GAAyBa,GACpCiJ,ECrCY,MDqCS7C,ECrCH,IAAM,IDsCxBtG,EAAgBxE,EAAMyE,cAAcD,cACpC2J,EAAgBnO,EAAM8E,MAAM3G,UAC5BiI,EAAapG,EAAM8E,MAAM5G,OACzB6S,EAA4C,mBAAjBF,EAA8BA,EAAa/lB,OAAOsV,OAAO,GAAIJ,EAAM8E,MAAO,CACvGvG,UAAWyB,EAAMzB,aACbsS,EACFG,EAA2D,iBAAtBD,EAAiC,CACxEjG,SAAUiG,EACVpD,QAASoD,GACPjmB,OAAOsV,OAAO,CAChB0K,SAAU,EACV6C,QAAS,GACRoD,GACCE,EAAsBjR,EAAMyE,cAAckB,OAAS3F,EAAMyE,cAAckB,OAAO3F,EAAMzB,WAAa,KACjG/J,EAAO,CACT8N,EAAG,EACHE,EAAG,GAGL,GAAKgC,EAAL,CAIA,GAAIiJ,EAAe,CACjB,IAAIyD,EAEAC,EAAwB,MAAbrG,EAAmBtN,GAAMG,GACpCyT,EAAuB,MAAbtG,EAAmBrN,GAASC,GACtCkH,EAAmB,MAAbkG,EAAmB,SAAW,QACpCnF,EAASnB,EAAcsG,GACvBlhB,EAAM+b,EAAS0D,EAAS8H,GACxBxnB,EAAMgc,EAAS0D,EAAS+H,GACxBC,EAAWV,GAAUvK,EAAWxB,GAAO,EAAI,EAC3C0M,EAASjL,IAAcvI,GAAQqQ,EAAcvJ,GAAOwB,EAAWxB,GAC/D2M,EAASlL,IAAcvI,IAASsI,EAAWxB,IAAQuJ,EAAcvJ,GAGjEL,EAAevE,EAAMC,SAASW,MAC9BoE,EAAY2L,GAAUpM,EAAe7B,GAAc6B,GAAgB,CACrErC,MAAO,EACPC,OAAQ,GAENqP,EAAqBxR,EAAMyE,cAAc,oBAAsBzE,EAAMyE,cAAc,oBAAoBI,QxBhFtG,CACLrH,IAAK,EACLE,MAAO,EACPD,OAAQ,EACRE,KAAM,GwB6EF8T,EAAkBD,EAAmBL,GACrCO,EAAkBF,EAAmBJ,GAMrCO,EAAW7N,GAAO,EAAGqK,EAAcvJ,GAAMI,EAAUJ,IACnDgN,EAAYd,EAAkB3C,EAAcvJ,GAAO,EAAIyM,EAAWM,EAAWF,EAAkBT,EAA4BlG,SAAWwG,EAASK,EAAWF,EAAkBT,EAA4BlG,SACxM+G,EAAYf,GAAmB3C,EAAcvJ,GAAO,EAAIyM,EAAWM,EAAWD,EAAkBV,EAA4BlG,SAAWyG,EAASI,EAAWD,EAAkBV,EAA4BlG,SACzMzF,EAAoBrF,EAAMC,SAASW,OAASwC,GAAgBpD,EAAMC,SAASW,OAC3EkR,EAAezM,EAAiC,MAAbyF,EAAmBzF,EAAkB+E,WAAa,EAAI/E,EAAkBgF,YAAc,EAAI,EAC7H0H,EAAwH,OAAjGb,EAA+C,MAAvBD,OAA8B,EAASA,EAAoBnG,IAAqBoG,EAAwB,EAEvJc,EAAYrM,EAASkM,EAAYE,EACjCE,EAAkBnO,GAAO6M,EAAS3M,GAAQpa,EAF9B+b,EAASiM,EAAYG,EAAsBD,GAEKloB,EAAK+b,EAAQgL,EAAS5M,GAAQpa,EAAKqoB,GAAaroB,GAChH6a,EAAcsG,GAAYmH,EAC1Bzd,EAAKsW,GAAYmH,EAAkBtM,CACvC,CAEE,GAAIiI,EAAc,CAChB,IAAIsE,EAEAC,EAAyB,MAAbrH,EAAmBtN,GAAMG,GAErCyU,GAAwB,MAAbtH,EAAmBrN,GAASC,GAEvC2U,GAAU7N,EAAcmJ,GAExB2E,GAAmB,MAAZ3E,EAAkB,SAAW,QAEpC4E,GAAOF,GAAUhJ,EAAS8I,GAE1BK,GAAOH,GAAUhJ,EAAS+I,IAE1BK,IAAuD,IAAxC,CAACjV,GAAKG,IAAMlU,QAAQib,GAEnCgO,GAAyH,OAAjGR,EAAgD,MAAvBjB,OAA8B,EAASA,EAAoBtD,IAAoBuE,EAAyB,EAEzJS,GAAaF,GAAeF,GAAOF,GAAUlE,EAAcmE,IAAQlM,EAAWkM,IAAQI,GAAuB1B,EAA4BrD,QAEzIiF,GAAaH,GAAeJ,GAAUlE,EAAcmE,IAAQlM,EAAWkM,IAAQI,GAAuB1B,EAA4BrD,QAAU6E,GAE5IK,GAAmBlC,GAAU8B,G1BzH9B,SAAwB7oB,EAAK4E,EAAO7E,GACzC,IAAImpB,EAAIhP,GAAOla,EAAK4E,EAAO7E,GAC3B,OAAOmpB,EAAInpB,EAAMA,EAAMmpB,CACzB,C0BsHoDC,CAAeJ,GAAYN,GAASO,IAAc9O,GAAO6M,EAASgC,GAAaJ,GAAMF,GAAS1B,EAASiC,GAAaJ,IAEpKhO,EAAcmJ,GAAWkF,GACzBre,EAAKmZ,GAAWkF,GAAmBR,EACvC,CAEErS,EAAMyE,cAActd,GAAQqN,CAvE9B,CAwEA,EAQEuR,iBAAkB,CAAC,WE1HN,SAASiN,GAAiBC,EAAyB9P,EAAcuD,QAC9D,IAAZA,IACFA,GAAU,GAGZ,ICnBoCpH,ECJOzc,EFuBvCqwB,EAA0BzT,GAAc0D,GACxCgQ,EAAuB1T,GAAc0D,IAf3C,SAAyBtgB,GACvB,IAAIinB,EAAOjnB,EAAQua,wBACf2E,EAASd,GAAM6I,EAAK5H,OAASrf,EAAQof,aAAe,EACpDD,EAASf,GAAM6I,EAAK3H,QAAUtf,EAAQ2D,cAAgB,EAC1D,OAAkB,IAAXub,GAA2B,IAAXC,CACzB,CAU4DoR,CAAgBjQ,GACtEld,EAAkB8c,GAAmBI,GACrC2G,EAAO1M,GAAsB6V,EAAyBE,EAAsBzM,GAC5EyB,EAAS,CACXW,WAAY,EACZE,UAAW,GAET1C,EAAU,CACZhE,EAAG,EACHE,EAAG,GAkBL,OAfI0Q,IAA4BA,IAA4BxM,MACxB,SAA9BvH,GAAYgE,IAChBgG,GAAeljB,MACbkiB,GCnCgC7I,EDmCT6D,KClCd9D,GAAUC,IAAUG,GAAcH,GCJxC,CACLwJ,YAFyCjmB,EDQbyc,GCNRwJ,WACpBE,UAAWnmB,EAAQmmB,WDGZH,GAAgBvJ,IDoCnBG,GAAc0D,KAChBmD,EAAUlJ,GAAsB+F,GAAc,IACtCb,GAAKa,EAAakH,WAC1B/D,EAAQ9D,GAAKW,EAAaiH,WACjBnkB,IACTqgB,EAAQhE,EAAI4G,GAAoBjjB,KAI7B,CACLqc,EAAGwH,EAAKnM,KAAOwK,EAAOW,WAAaxC,EAAQhE,EAC3CE,EAAGsH,EAAKtM,IAAM2K,EAAOa,UAAY1C,EAAQ9D,EACzCN,MAAO4H,EAAK5H,MACZC,OAAQ2H,EAAK3H,OAEjB,CGvDA,SAASxI,GAAM0Z,GACb,IAAI9f,EAAM,IAAI7Q,IACV4wB,EAAU,IAAIhpB,IACdipB,EAAS,GAKb,SAASpG,EAAKqG,GACZF,EAAQhd,IAAIkd,EAASrsB,MACN,GAAGqL,OAAOghB,EAASzS,UAAY,GAAIyS,EAASzN,kBAAoB,IACtE7F,SAAQ,SAAUuT,GACzB,IAAKH,EAAQtwB,IAAIywB,GAAM,CACrB,IAAIC,EAAcngB,EAAIrQ,IAAIuwB,GAEtBC,GACFvG,EAAKuG,EAEf,CACA,IACIH,EAAO3rB,KAAK4rB,EAChB,CAQE,OAzBAH,EAAUnT,SAAQ,SAAUsT,GAC1BjgB,EAAI3Q,IAAI4wB,EAASrsB,KAAMqsB,EAC3B,IAiBEH,EAAUnT,SAAQ,SAAUsT,GACrBF,EAAQtwB,IAAIwwB,EAASrsB,OAExBgmB,EAAKqG,EAEX,IACSD,CACT,CCvBA,IAAII,GAAkB,CACpBpV,UAAW,SACX8U,UAAW,GACX3S,SAAU,YAGZ,SAASkT,KACP,IAAK,IAAItB,EAAOuB,UAAUjvB,OAAQmD,EAAO,IAAIzE,MAAMgvB,GAAOwB,EAAO,EAAGA,EAAOxB,EAAMwB,IAC/E/rB,EAAK+rB,GAAQD,UAAUC,GAGzB,OAAQ/rB,EAAKwnB,MAAK,SAAU1sB,GAC1B,QAASA,GAAoD,mBAAlCA,EAAQua,sBACvC,GACA,CAEO,SAAS2W,GAAgBC,QACL,IAArBA,IACFA,EAAmB,IAGrB,IAAIC,EAAoBD,EACpBE,EAAwBD,EAAkBE,iBAC1CA,OAA6C,IAA1BD,EAAmC,GAAKA,EAC3DE,EAAyBH,EAAkBI,eAC3CA,OAA4C,IAA3BD,EAAoCT,GAAkBS,EAC3E,OAAO,SAAsBjW,EAAWD,EAAQuC,QAC9B,IAAZA,IACFA,EAAU4T,GAGZ,ICxC6B/sB,EAC3BgtB,EDuCEtU,EAAQ,CACVzB,UAAW,SACXgW,iBAAkB,GAClB9T,QAAS3V,OAAOsV,OAAO,GAAIuT,GAAiBU,GAC5C5P,cAAe,GACfxE,SAAU,CACR9B,UAAWA,EACXD,OAAQA,GAEVxO,WAAY,GACZyQ,OAAQ,IAENqU,EAAmB,GACnBC,GAAc,EACd1xB,EAAW,CACbid,MAAOA,EACP0U,WAAY,SAAoBC,GAC9B,IAAIlU,EAAsC,mBAArBkU,EAAkCA,EAAiB3U,EAAMS,SAAWkU,EACzFC,IACA5U,EAAMS,QAAU3V,OAAOsV,OAAO,GAAIiU,EAAgBrU,EAAMS,QAASA,GACjET,EAAMsI,cAAgB,CACpBnK,UAAW5Z,GAAU4Z,GAAasL,GAAkBtL,GAAaA,EAAUkO,eAAiB5C,GAAkBtL,EAAUkO,gBAAkB,GAC1InO,OAAQuL,GAAkBvL,IAI5B,IElE4BmV,EAC9BwB,EFiEMN,EDhCG,SAAwBlB,GAErC,IAAIkB,EAAmB5a,GAAM0Z,GAE7B,OAAOnU,GAAeb,QAAO,SAAUC,EAAKwB,GAC1C,OAAOxB,EAAI9L,OAAO+hB,EAAiB1kB,QAAO,SAAU2jB,GAClD,OAAOA,EAAS1T,QAAUA,CAChC,IACA,GAAK,GACL,CCuB+BgV,EElEKzB,EFkEsB,GAAG7gB,OAAO2hB,EAAkBnU,EAAMS,QAAQ4S,WEjE9FwB,EAASxB,EAAUhV,QAAO,SAAUwW,EAAQE,GAC9C,IAAIC,EAAWH,EAAOE,EAAQ5tB,MAK9B,OAJA0tB,EAAOE,EAAQ5tB,MAAQ6tB,EAAWlqB,OAAOsV,OAAO,GAAI4U,EAAUD,EAAS,CACrEtU,QAAS3V,OAAOsV,OAAO,GAAI4U,EAASvU,QAASsU,EAAQtU,SACrDjM,KAAM1J,OAAOsV,OAAO,GAAI4U,EAASxgB,KAAMugB,EAAQvgB,QAC5CugB,EACEF,CACX,GAAK,IAEI/pB,OAAOtH,KAAKqxB,GAAQthB,KAAI,SAAUzQ,GACvC,OAAO+xB,EAAO/xB,EAClB,MF4DQ,OAJAkd,EAAMuU,iBAAmBA,EAAiB1kB,QAAO,SAAUolB,GACzD,OAAOA,EAAEpV,OACnB,IA+FMG,EAAMuU,iBAAiBrU,SAAQ,SAAUH,GACvC,IAAI5Y,EAAO4Y,EAAK5Y,KACZ+tB,EAAenV,EAAKU,QACpBA,OAA2B,IAAjByU,EAA0B,GAAKA,EACzC7U,EAASN,EAAKM,OAElB,GAAsB,mBAAXA,EAAuB,CAChC,IAAI8U,EAAY9U,EAAO,CACrBL,MAAOA,EACP7Y,KAAMA,EACNpE,SAAUA,EACV0d,QAASA,IAKX+T,EAAiB5sB,KAAKutB,GAFT,WAAkB,EAGzC,CACA,IA/GepyB,EAASylB,QACxB,EAMM4M,YAAa,WACX,IAAIX,EAAJ,CAIA,IAAIY,EAAkBrV,EAAMC,SACxB9B,EAAYkX,EAAgBlX,UAC5BD,EAASmX,EAAgBnX,OAG7B,GAAK0V,GAAiBzV,EAAWD,GAAjC,CAKA8B,EAAM8E,MAAQ,CACZ3G,UAAW6U,GAAiB7U,EAAWiF,GAAgBlF,GAAoC,UAA3B8B,EAAMS,QAAQC,UAC9ExC,OAAQwE,GAAcxE,IAOxB8B,EAAMmP,OAAQ,EACdnP,EAAMzB,UAAYyB,EAAMS,QAAQlC,UAKhCyB,EAAMuU,iBAAiBrU,SAAQ,SAAUsT,GACvC,OAAOxT,EAAMyE,cAAc+O,EAASrsB,MAAQ2D,OAAOsV,OAAO,GAAIoT,EAAShf,KACjF,IAEQ,IAAK,IAAIhL,EAAQ,EAAGA,EAAQwW,EAAMuU,iBAAiB3vB,OAAQ4E,IACzD,IAAoB,IAAhBwW,EAAMmP,MAAV,CAMA,IAAImG,EAAwBtV,EAAMuU,iBAAiB/qB,GAC/ClC,EAAKguB,EAAsBhuB,GAC3BiuB,EAAyBD,EAAsB7U,QAC/CuK,OAAsC,IAA3BuK,EAAoC,GAAKA,EACpDpuB,EAAOmuB,EAAsBnuB,KAEf,mBAAPG,IACT0Y,EAAQ1Y,EAAG,CACT0Y,MAAOA,EACPS,QAASuK,EACT7jB,KAAMA,EACNpE,SAAUA,KACNid,EAdlB,MAHYA,EAAMmP,OAAQ,EACd3lB,GAAS,CAzBrB,CATA,CAqDA,EAGMgf,QC1I2BlhB,ED0IV,WACf,OAAO,IAAIkuB,SAAQ,SAAUC,GAC3B1yB,EAASqyB,cACTK,EAAQzV,EAClB,GACA,EC7IS,WAUL,OATKsU,IACHA,EAAU,IAAIkB,SAAQ,SAAUC,GAC9BD,QAAQC,UAAUC,MAAK,WACrBpB,OAAU7f,EACVghB,EAAQnuB,IAClB,GACA,KAGWgtB,CACX,GDmIMqB,QAAS,WACPf,IACAH,GAAc,CACtB,GAGI,IAAKb,GAAiBzV,EAAWD,GAC/B,OAAOnb,EAmCT,SAAS6xB,IACPJ,EAAiBtU,SAAQ,SAAU5Y,GACjC,OAAOA,GACf,IACMktB,EAAmB,EACzB,CAEI,OAvCAzxB,EAAS2xB,WAAWjU,GAASiV,MAAK,SAAU1V,IACrCyU,GAAehU,EAAQmV,eAC1BnV,EAAQmV,cAAc5V,EAE9B,IAmCWjd,CACX,CACA,CACO,IAAI8yB,GAA4B9B,KG9LnC8B,GAA4B9B,GAAgB,CAC9CI,iBAFqB,CAAClM,GAAgBzD,GAAesR,GAAeC,MCMlEF,GAA4B9B,GAAgB,CAC9CI,iBAFqB,CAAClM,GAAgBzD,GAAesR,GAAeC,GAAapQ,GAAQqQ,GAAMtG,GAAiB9O,GAAOlE,M,+lBCkBnHtV,GAAO,WAEPuK,GAAa,eACb+E,GAAe,YAIfuf,GAAe,UACfC,GAAiB,YAGjBza,GAAc,OAAM9J,KACpB+J,GAAgB,SAAQ/J,KACxB4J,GAAc,OAAM5J,KACpB6J,GAAe,QAAO7J,KACtB2F,GAAwB,QAAO3F,KAAY+E,KAC3Cyf,GAA0B,UAASxkB,KAAY+E,KAC/C0f,GAAwB,QAAOzkB,KAAY+E,KAE3CiF,GAAkB,OAOlBjH,GAAuB,4DACvB2hB,GAA8B,GAAE3hB,MAAwBiH,KACxD2a,GAAgB,iBAKhBC,GAAgB1vB,IAAU,UAAY,YACtC2vB,GAAmB3vB,IAAU,YAAc,UAC3C4vB,GAAmB5vB,IAAU,aAAe,eAC5C6vB,GAAsB7vB,IAAU,eAAiB,aACjD8vB,GAAkB9vB,IAAU,aAAe,cAC3C+vB,GAAiB/vB,IAAU,cAAgB,aAI3CqJ,GAAU,CACd2mB,WAAW,EACXzL,SAAU,kBACV0L,QAAS,UACTnR,OAAQ,CAAC,EAAG,GACZoR,aAAc,KACd5Y,UAAW,UAGPhO,GAAc,CAClB0mB,UAAW,mBACXzL,SAAU,mBACV0L,QAAS,SACTnR,OAAQ,0BACRoR,aAAc,yBACd5Y,UAAW,2BAOb,MAAM6Y,WAAiB3lB,EACrBV,YAAY9N,EAASyN,GACnBgB,MAAMzO,EAASyN,GAEfxE,KAAKmrB,QAAU,KACfnrB,KAAKorB,QAAUprB,KAAKyF,SAAShM,WAE7BuG,KAAKqrB,MAAQ5kB,EAAeY,KAAKrH,KAAKyF,SAAU+kB,IAAe,IAC7D/jB,EAAeS,KAAKlH,KAAKyF,SAAU+kB,IAAe,IAClD/jB,EAAeG,QAAQ4jB,GAAexqB,KAAKorB,SAC7CprB,KAAKsrB,UAAYtrB,KAAKurB,eACxB,CAGA,kBAAWnnB,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,OAAOA,EACT,CAGAwN,SACE,OAAO9I,KAAK2Q,WAAa3Q,KAAK4Q,OAAS5Q,KAAK6Q,MAC9C,CAEAA,OACE,GAAInX,EAAWsG,KAAKyF,WAAazF,KAAK2Q,WACpC,OAGF,MAAM9Q,EAAgB,CACpBA,cAAeG,KAAKyF,UAKtB,IAFkBlF,EAAasB,QAAQ7B,KAAKyF,SAAUgK,GAAY5P,GAEpDoC,iBAAd,CAUA,GANAjC,KAAKwrB,gBAMD,iBAAkBzyB,SAASoB,kBAAoB6F,KAAKorB,QAAQ7xB,QAtFxC,eAuFtB,IAAK,MAAMxC,IAAW,GAAG2P,UAAU3N,SAAS8B,KAAKgM,UAC/CtG,EAAac,GAAGtK,EAAS,YAAayD,GAI1CwF,KAAKyF,SAASgmB,QACdzrB,KAAKyF,SAASjC,aAAa,iBAAiB,GAE5CxD,KAAKqrB,MAAMxxB,UAAU2Q,IAAIqF,IACzB7P,KAAKyF,SAAS5L,UAAU2Q,IAAIqF,IAC5BtP,EAAasB,QAAQ7B,KAAKyF,SAAUiK,GAAa7P,EAnBjD,CAoBF,CAEA+Q,OACE,GAAIlX,EAAWsG,KAAKyF,YAAczF,KAAK2Q,WACrC,OAGF,MAAM9Q,EAAgB,CACpBA,cAAeG,KAAKyF,UAGtBzF,KAAK0rB,cAAc7rB,EACrB,CAEA+F,UACM5F,KAAKmrB,SACPnrB,KAAKmrB,QAAQtB,UAGfrkB,MAAMI,SACR,CAEA8W,SACE1c,KAAKsrB,UAAYtrB,KAAKurB,gBAClBvrB,KAAKmrB,SACPnrB,KAAKmrB,QAAQzO,QAEjB,CAGAgP,cAAc7rB,GAEZ,IADkBU,EAAasB,QAAQ7B,KAAKyF,SAAUkK,GAAY9P,GACpDoC,iBAAd,CAMA,GAAI,iBAAkBlJ,SAASoB,gBAC7B,IAAK,MAAMpD,IAAW,GAAG2P,UAAU3N,SAAS8B,KAAKgM,UAC/CtG,EAAaC,IAAIzJ,EAAS,YAAayD,GAIvCwF,KAAKmrB,SACPnrB,KAAKmrB,QAAQtB,UAGf7pB,KAAKqrB,MAAMxxB,UAAUlC,OAAOkY,IAC5B7P,KAAKyF,SAAS5L,UAAUlC,OAAOkY,IAC/B7P,KAAKyF,SAASjC,aAAa,gBAAiB,SAC5CF,EAAYG,oBAAoBzD,KAAKqrB,MAAO,UAC5C9qB,EAAasB,QAAQ7B,KAAKyF,SAAUmK,GAAc/P,EAlBlD,CAmBF,CAEA0E,WAAWC,GAGT,GAAgC,iBAFhCA,EAASgB,MAAMjB,WAAWC,IAER6N,YAA2B5Z,EAAU+L,EAAO6N,YACV,mBAA3C7N,EAAO6N,UAAUf,sBAGxB,MAAM,IAAIjM,UAAW,GAAE/J,GAAKgK,+GAG9B,OAAOd,CACT,CAEAgnB,gBACE,QAAsB,IAAXG,GACT,MAAM,IAAItmB,UAAU,gEAGtB,IAAIumB,EAAmB5rB,KAAKyF,SAEG,WAA3BzF,KAAK0F,QAAQ2M,UACfuZ,EAAmB5rB,KAAKorB,QACf3yB,EAAUuH,KAAK0F,QAAQ2M,WAChCuZ,EAAmB/yB,EAAWmH,KAAK0F,QAAQ2M,WACA,iBAA3BrS,KAAK0F,QAAQ2M,YAC7BuZ,EAAmB5rB,KAAK0F,QAAQ2M,WAGlC,MAAM4Y,EAAejrB,KAAK6rB,mBAC1B7rB,KAAKmrB,QAAUQ,GAAoBC,EAAkB5rB,KAAKqrB,MAAOJ,EACnE,CAEAta,WACE,OAAO3Q,KAAKqrB,MAAMxxB,UAAUC,SAAS+V,GACvC,CAEAic,gBACE,MAAMC,EAAiB/rB,KAAKorB,QAE5B,GAAIW,EAAelyB,UAAUC,SAzMN,WA0MrB,OAAO+wB,GAGT,GAAIkB,EAAelyB,UAAUC,SA5MJ,aA6MvB,OAAOgxB,GAGT,GAAIiB,EAAelyB,UAAUC,SA/MA,iBAgN3B,MAhMsB,MAmMxB,GAAIiyB,EAAelyB,UAAUC,SAlNE,mBAmN7B,MAnMyB,SAuM3B,MAAMkyB,EAAkF,QAA1E5yB,iBAAiB4G,KAAKqrB,OAAOhyB,iBAAiB,iBAAiBmN,OAE7E,OAAIulB,EAAelyB,UAAUC,SA7NP,UA8NbkyB,EAAQtB,GAAmBD,GAG7BuB,EAAQpB,GAAsBD,EACvC,CAEAY,gBACE,OAAkD,OAA3CvrB,KAAKyF,SAASlM,QA5ND,UA6NtB,CAEA0yB,aACE,MAAMpS,OAAEA,GAAW7Z,KAAK0F,QAExB,MAAsB,iBAAXmU,EACFA,EAAOhd,MAAM,KAAK4K,KAAI/E,GAAShG,OAAOgS,SAAShM,EAAO,MAGzC,mBAAXmX,EACFqS,GAAcrS,EAAOqS,EAAYlsB,KAAKyF,UAGxCoU,CACT,CAEAgS,mBACE,MAAMM,EAAwB,CAC5B1Z,UAAWzS,KAAK8rB,gBAChBvE,UAAW,CAAC,CACVlsB,KAAM,kBACNsZ,QAAS,CACP2K,SAAUtf,KAAK0F,QAAQ4Z,WAG3B,CACEjkB,KAAM,SACNsZ,QAAS,CACPkF,OAAQ7Z,KAAKisB,iBAcnB,OARIjsB,KAAKsrB,WAAsC,WAAzBtrB,KAAK0F,QAAQslB,WACjC1nB,EAAYC,iBAAiBvD,KAAKqrB,MAAO,SAAU,UACnDc,EAAsB5E,UAAY,CAAC,CACjClsB,KAAM,cACN0Y,SAAS,KAIN,IACFoY,KACApwB,EAAQiE,KAAK0F,QAAQulB,aAAc,CAACkB,IAE3C,CAEAC,iBAAgBp1B,IAAEA,EAAGiG,OAAEA,IACrB,MAAMuQ,EAAQ/G,EAAevH,KA5QF,8DA4Q+Bc,KAAKqrB,OAAOtnB,QAAOhN,GAAWkC,EAAUlC,KAE7FyW,EAAM1U,QAMXsE,EAAqBoQ,EAAOvQ,EAAQjG,IAAQozB,IAAiB5c,EAAMpM,SAASnE,IAASwuB,OACvF,CAGA,sBAAOhwB,CAAgB+I,GACrB,OAAOxE,KAAKyI,MAAK,WACf,MAAMC,EAAOwiB,GAAS/kB,oBAAoBnG,KAAMwE,GAEhD,GAAsB,iBAAXA,EAAX,CAIA,QAA4B,IAAjBkE,EAAKlE,GACd,MAAM,IAAIa,UAAW,oBAAmBb,MAG1CkE,EAAKlE,IANL,CAOF,GACF,CAEA,iBAAO6nB,CAAWltB,GAChB,GA/TuB,IA+TnBA,EAAM4J,QAAiD,UAAf5J,EAAMsB,MAlUtC,QAkU0DtB,EAAMnI,IAC1E,OAGF,MAAMs1B,EAAc7lB,EAAevH,KAAKqrB,IAExC,IAAK,MAAMzhB,KAAUwjB,EAAa,CAChC,MAAMC,EAAUrB,GAAShlB,YAAY4C,GACrC,IAAKyjB,IAAyC,IAA9BA,EAAQ7mB,QAAQqlB,UAC9B,SAGF,MAAMyB,EAAertB,EAAMqtB,eACrBC,EAAeD,EAAaprB,SAASmrB,EAAQlB,OACnD,GACEmB,EAAaprB,SAASmrB,EAAQ9mB,WACC,WAA9B8mB,EAAQ7mB,QAAQqlB,YAA2B0B,GACb,YAA9BF,EAAQ7mB,QAAQqlB,WAA2B0B,EAE5C,SAIF,GAAIF,EAAQlB,MAAMvxB,SAASqF,EAAMlC,UAA4B,UAAfkC,EAAMsB,MAzV1C,QAyV8DtB,EAAMnI,KAAoB,qCAAqCoO,KAAKjG,EAAMlC,OAAOkL,UACvJ,SAGF,MAAMtI,EAAgB,CAAEA,cAAe0sB,EAAQ9mB,UAE5B,UAAftG,EAAMsB,OACRZ,EAAcqI,WAAa/I,GAG7BotB,EAAQb,cAAc7rB,EACxB,CACF,CAEA,4BAAO6sB,CAAsBvtB,GAI3B,MAAMwtB,EAAU,kBAAkBvnB,KAAKjG,EAAMlC,OAAOkL,SAC9CykB,EA7WS,WA6WOztB,EAAMnI,IACtB61B,EAAkB,CAAC1C,GAAcC,IAAgBhpB,SAASjC,EAAMnI,KAEtE,IAAK61B,IAAoBD,EACvB,OAGF,GAAID,IAAYC,EACd,OAGFztB,EAAMoD,iBAGN,MAAMuqB,EAAkB9sB,KAAK+G,QAAQ6B,IACnC5I,KACCyG,EAAeS,KAAKlH,KAAM4I,IAAsB,IAC/CnC,EAAeY,KAAKrH,KAAM4I,IAAsB,IAChDnC,EAAeG,QAAQgC,GAAsBzJ,EAAMW,eAAerG,YAEhExC,EAAWi0B,GAAS/kB,oBAAoB2mB,GAE9C,GAAID,EAIF,OAHA1tB,EAAM4tB,kBACN91B,EAAS4Z,YACT5Z,EAASm1B,gBAAgBjtB,GAIvBlI,EAAS0Z,aACXxR,EAAM4tB,kBACN91B,EAAS2Z,OACTkc,EAAgBrB,QAEpB,EAOFlrB,EAAac,GAAGtI,SAAUsxB,GAAwBzhB,GAAsBsiB,GAASwB,uBACjFnsB,EAAac,GAAGtI,SAAUsxB,GAAwBG,GAAeU,GAASwB,uBAC1EnsB,EAAac,GAAGtI,SAAUyS,GAAsB0f,GAASmB,YACzD9rB,EAAac,GAAGtI,SAAUuxB,GAAsBY,GAASmB,YACzD9rB,EAAac,GAAGtI,SAAUyS,GAAsB5C,IAAsB,SAAUzJ,GAC9EA,EAAMoD,iBACN2oB,GAAS/kB,oBAAoBnG,MAAM8I,QACrC,IAMA7N,EAAmBiwB,ICrbnB,MAAM5vB,GAAO,WAEPuU,GAAkB,OAClBmd,GAAmB,gBAAe1xB,KAElC8I,GAAU,CACd6oB,UAAW,iBACXC,cAAe,KACfjnB,YAAY,EACZhN,WAAW,EACXk0B,YAAa,QAGT9oB,GAAc,CAClB4oB,UAAW,SACXC,cAAe,kBACfjnB,WAAY,UACZhN,UAAW,UACXk0B,YAAa,oBAOf,MAAMC,WAAiBjpB,EACrBU,YAAYL,GACVgB,QACAxF,KAAK0F,QAAU1F,KAAKuE,WAAWC,GAC/BxE,KAAKqtB,aAAc,EACnBrtB,KAAKyF,SAAW,IAClB,CAGA,kBAAWrB,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,OAAOA,EACT,CAGAuV,KAAK1V,GACH,IAAK6E,KAAK0F,QAAQzM,UAEhB,YADA8C,EAAQZ,GAIV6E,KAAKstB,UAEL,MAAMv2B,EAAUiJ,KAAKutB,cACjBvtB,KAAK0F,QAAQO,YACfxL,EAAO1D,GAGTA,EAAQ8C,UAAU2Q,IAAIqF,IAEtB7P,KAAKwtB,mBAAkB,KACrBzxB,EAAQZ,EAAS,GAErB,CAEAyV,KAAKzV,GACE6E,KAAK0F,QAAQzM,WAKlB+G,KAAKutB,cAAc1zB,UAAUlC,OAAOkY,IAEpC7P,KAAKwtB,mBAAkB,KACrBxtB,KAAK4F,UACL7J,EAAQZ,EAAS,KARjBY,EAAQZ,EAUZ,CAEAyK,UACO5F,KAAKqtB,cAIV9sB,EAAaC,IAAIR,KAAKyF,SAAUunB,IAEhChtB,KAAKyF,SAAS9N,SACdqI,KAAKqtB,aAAc,EACrB,CAGAE,cACE,IAAKvtB,KAAKyF,SAAU,CAClB,MAAMgoB,EAAW10B,SAAS20B,cAAc,OACxCD,EAASR,UAAYjtB,KAAK0F,QAAQunB,UAC9BjtB,KAAK0F,QAAQO,YACfwnB,EAAS5zB,UAAU2Q,IAjGH,QAoGlBxK,KAAKyF,SAAWgoB,CAClB,CAEA,OAAOztB,KAAKyF,QACd,CAEAf,kBAAkBF,GAGhB,OADAA,EAAO2oB,YAAct0B,EAAW2L,EAAO2oB,aAChC3oB,CACT,CAEA8oB,UACE,GAAIttB,KAAKqtB,YACP,OAGF,MAAMt2B,EAAUiJ,KAAKutB,cACrBvtB,KAAK0F,QAAQynB,YAAYQ,OAAO52B,GAEhCwJ,EAAac,GAAGtK,EAASi2B,IAAiB,KACxCjxB,EAAQiE,KAAK0F,QAAQwnB,cAAc,IAGrCltB,KAAKqtB,aAAc,CACrB,CAEAG,kBAAkBryB,GAChBgB,EAAuBhB,EAAU6E,KAAKutB,cAAevtB,KAAK0F,QAAQO,WACpE,EClIF,MAEMJ,GAAa,gBACb+nB,GAAiB,UAAS/nB,KAC1BgoB,GAAqB,cAAahoB,KAIlCioB,GAAmB,WAEnB1pB,GAAU,CACd2pB,WAAW,EACXC,YAAa,MAGT3pB,GAAc,CAClB0pB,UAAW,UACXC,YAAa,WAOf,MAAMC,WAAkB9pB,EACtBU,YAAYL,GACVgB,QACAxF,KAAK0F,QAAU1F,KAAKuE,WAAWC,GAC/BxE,KAAKkuB,WAAY,EACjBluB,KAAKmuB,qBAAuB,IAC9B,CAGA,kBAAW/pB,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,MA1CS,WA2CX,CAGA8yB,WACMpuB,KAAKkuB,YAILluB,KAAK0F,QAAQqoB,WACf/tB,KAAK0F,QAAQsoB,YAAYvC,QAG3BlrB,EAAaC,IAAIzH,SAAU8M,IAC3BtF,EAAac,GAAGtI,SAAU60B,IAAezuB,GAASa,KAAKquB,eAAelvB,KACtEoB,EAAac,GAAGtI,SAAU80B,IAAmB1uB,GAASa,KAAKsuB,eAAenvB,KAE1Ea,KAAKkuB,WAAY,EACnB,CAEAK,aACOvuB,KAAKkuB,YAIVluB,KAAKkuB,WAAY,EACjB3tB,EAAaC,IAAIzH,SAAU8M,IAC7B,CAGAwoB,eAAelvB,GACb,MAAM6uB,YAAEA,GAAgBhuB,KAAK0F,QAE7B,GAAIvG,EAAMlC,SAAWlE,UAAYoG,EAAMlC,SAAW+wB,GAAeA,EAAYl0B,SAASqF,EAAMlC,QAC1F,OAGF,MAAMkX,EAAW1N,EAAec,kBAAkBymB,GAE1B,IAApB7Z,EAASrb,OACXk1B,EAAYvC,QACHzrB,KAAKmuB,uBAAyBL,GACvC3Z,EAASA,EAASrb,OAAS,GAAG2yB,QAE9BtX,EAAS,GAAGsX,OAEhB,CAEA6C,eAAenvB,GApFD,QAqFRA,EAAMnI,MAIVgJ,KAAKmuB,qBAAuBhvB,EAAMqvB,SAAWV,GAxFzB,UAyFtB,EChGF,MAAMW,GAAyB,oDACzBC,GAA0B,cAC1BC,GAAmB,gBACnBC,GAAkB,eAMxB,MAAMC,GACJhqB,cACE7E,KAAKyF,SAAW1M,SAAS8B,IAC3B,CAGAi0B,WAEE,MAAMC,EAAgBh2B,SAASoB,gBAAgBuf,YAC/C,OAAO9b,KAAK0M,IAAItS,OAAOg3B,WAAaD,EACtC,CAEAne,OACE,MAAMwF,EAAQpW,KAAK8uB,WACnB9uB,KAAKivB,mBAELjvB,KAAKkvB,sBAAsBlvB,KAAKyF,SAAUkpB,IAAkBQ,GAAmBA,EAAkB/Y,IAEjGpW,KAAKkvB,sBAAsBT,GAAwBE,IAAkBQ,GAAmBA,EAAkB/Y,IAC1GpW,KAAKkvB,sBAAsBR,GAAyBE,IAAiBO,GAAmBA,EAAkB/Y,GAC5G,CAEAiN,QACErjB,KAAKovB,wBAAwBpvB,KAAKyF,SAAU,YAC5CzF,KAAKovB,wBAAwBpvB,KAAKyF,SAAUkpB,IAC5C3uB,KAAKovB,wBAAwBX,GAAwBE,IACrD3uB,KAAKovB,wBAAwBV,GAAyBE,GACxD,CAEAS,gBACE,OAAOrvB,KAAK8uB,WAAa,CAC3B,CAGAG,mBACEjvB,KAAKsvB,sBAAsBtvB,KAAKyF,SAAU,YAC1CzF,KAAKyF,SAAS0L,MAAMoM,SAAW,QACjC,CAEA2R,sBAAsBn3B,EAAUw3B,EAAep0B,GAC7C,MAAMq0B,EAAiBxvB,KAAK8uB,WAW5B9uB,KAAKyvB,2BAA2B13B,GAVHhB,IAC3B,GAAIA,IAAYiJ,KAAKyF,UAAYzN,OAAOg3B,WAAaj4B,EAAQ2iB,YAAc8V,EACzE,OAGFxvB,KAAKsvB,sBAAsBv4B,EAASw4B,GACpC,MAAMJ,EAAkBn3B,OAAOoB,iBAAiBrC,GAASsC,iBAAiBk2B,GAC1Ex4B,EAAQoa,MAAMue,YAAYH,EAAgB,GAAEp0B,EAASuB,OAAOC,WAAWwyB,QAAsB,GAIjG,CAEAG,sBAAsBv4B,EAASw4B,GAC7B,MAAMI,EAAc54B,EAAQoa,MAAM9X,iBAAiBk2B,GAC/CI,GACFrsB,EAAYC,iBAAiBxM,EAASw4B,EAAeI,EAEzD,CAEAP,wBAAwBr3B,EAAUw3B,GAahCvvB,KAAKyvB,2BAA2B13B,GAZHhB,IAC3B,MAAM2L,EAAQY,EAAYY,iBAAiBnN,EAASw4B,GAEtC,OAAV7sB,GAKJY,EAAYG,oBAAoB1M,EAASw4B,GACzCx4B,EAAQoa,MAAMue,YAAYH,EAAe7sB,IALvC3L,EAAQoa,MAAMye,eAAeL,EAKgB,GAInD,CAEAE,2BAA2B13B,EAAU83B,GACnC,GAAIp3B,EAAUV,GACZ83B,EAAS93B,QAIX,IAAK,MAAM+3B,KAAOrpB,EAAevH,KAAKnH,EAAUiI,KAAKyF,UACnDoqB,EAASC,EAEb,EC1FF,MAEMjqB,GAAa,YAIb8J,GAAc,OAAM9J,KACpBkqB,GAAwB,gBAAelqB,KACvC+J,GAAgB,SAAQ/J,KACxB4J,GAAc,OAAM5J,KACpB6J,GAAe,QAAO7J,KACtBmqB,GAAgB,SAAQnqB,KACxBoqB,GAAuB,gBAAepqB,KACtCqqB,GAA2B,oBAAmBrqB,KAC9CsqB,GAAyB,kBAAiBtqB,KAC1C2F,GAAwB,QAAO3F,cAE/BuqB,GAAkB,aAElBvgB,GAAkB,OAClBwgB,GAAoB,eAOpBjsB,GAAU,CACdqpB,UAAU,EACVhC,OAAO,EACPvf,UAAU,GAGN7H,GAAc,CAClBopB,SAAU,mBACVhC,MAAO,UACPvf,SAAU,WAOZ,MAAMokB,WAAc/qB,EAClBV,YAAY9N,EAASyN,GACnBgB,MAAMzO,EAASyN,GAEfxE,KAAKuwB,QAAU9pB,EAAeG,QAxBV,gBAwBmC5G,KAAKyF,UAC5DzF,KAAKwwB,UAAYxwB,KAAKywB,sBACtBzwB,KAAK0wB,WAAa1wB,KAAK2wB,uBACvB3wB,KAAK2Q,UAAW,EAChB3Q,KAAKmQ,kBAAmB,EACxBnQ,KAAK4wB,WAAa,IAAI/B,GAEtB7uB,KAAK8M,oBACP,CAGA,kBAAW1I,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,MAnES,OAoEX,CAGAwN,OAAOjJ,GACL,OAAOG,KAAK2Q,SAAW3Q,KAAK4Q,OAAS5Q,KAAK6Q,KAAKhR,EACjD,CAEAgR,KAAKhR,GACCG,KAAK2Q,UAAY3Q,KAAKmQ,kBAIR5P,EAAasB,QAAQ7B,KAAKyF,SAAUgK,GAAY,CAChE5P,kBAGYoC,mBAIdjC,KAAK2Q,UAAW,EAChB3Q,KAAKmQ,kBAAmB,EAExBnQ,KAAK4wB,WAAWhgB,OAEhB7X,SAAS8B,KAAKhB,UAAU2Q,IAAI4lB,IAE5BpwB,KAAK6wB,gBAEL7wB,KAAKwwB,UAAU3f,MAAK,IAAM7Q,KAAK8wB,aAAajxB,KAC9C,CAEA+Q,OACO5Q,KAAK2Q,WAAY3Q,KAAKmQ,mBAIT5P,EAAasB,QAAQ7B,KAAKyF,SAAUkK,IAExC1N,mBAIdjC,KAAK2Q,UAAW,EAChB3Q,KAAKmQ,kBAAmB,EACxBnQ,KAAK0wB,WAAWnC,aAEhBvuB,KAAKyF,SAAS5L,UAAUlC,OAAOkY,IAE/B7P,KAAKgG,gBAAe,IAAMhG,KAAK+wB,cAAc/wB,KAAKyF,SAAUzF,KAAKoP,gBACnE,CAEAxJ,UACErF,EAAaC,IAAIxI,OAAQ6N,IACzBtF,EAAaC,IAAIR,KAAKuwB,QAAS1qB,IAE/B7F,KAAKwwB,UAAU5qB,UACf5F,KAAK0wB,WAAWnC,aAEhB/oB,MAAMI,SACR,CAEAorB,eACEhxB,KAAK6wB,eACP,CAGAJ,sBACE,OAAO,IAAIrD,GAAS,CAClBn0B,UAAW6H,QAAQd,KAAK0F,QAAQ+nB,UAChCxnB,WAAYjG,KAAKoP,eAErB,CAEAuhB,uBACE,OAAO,IAAI1C,GAAU,CACnBD,YAAahuB,KAAKyF,UAEtB,CAEAqrB,aAAajxB,GAEN9G,SAAS8B,KAAKf,SAASkG,KAAKyF,WAC/B1M,SAAS8B,KAAK8yB,OAAO3tB,KAAKyF,UAG5BzF,KAAKyF,SAAS0L,MAAM6Z,QAAU,QAC9BhrB,KAAKyF,SAAS/B,gBAAgB,eAC9B1D,KAAKyF,SAASjC,aAAa,cAAc,GACzCxD,KAAKyF,SAASjC,aAAa,OAAQ,UACnCxD,KAAKyF,SAASyX,UAAY,EAE1B,MAAM+T,EAAYxqB,EAAeG,QAxIT,cAwIsC5G,KAAKuwB,SAC/DU,IACFA,EAAU/T,UAAY,GAGxBziB,EAAOuF,KAAKyF,UAEZzF,KAAKyF,SAAS5L,UAAU2Q,IAAIqF,IAa5B7P,KAAKgG,gBAXsBkrB,KACrBlxB,KAAK0F,QAAQ+lB,OACfzrB,KAAK0wB,WAAWtC,WAGlBpuB,KAAKmQ,kBAAmB,EACxB5P,EAAasB,QAAQ7B,KAAKyF,SAAUiK,GAAa,CAC/C7P,iBACA,GAGoCG,KAAKuwB,QAASvwB,KAAKoP,cAC7D,CAEAtC,qBACEvM,EAAac,GAAGrB,KAAKyF,SAAU0qB,IAAuBhxB,IApLvC,WAqLTA,EAAMnI,MAINgJ,KAAK0F,QAAQwG,SACflM,KAAK4Q,OAIP5Q,KAAKmxB,6BAA4B,IAGnC5wB,EAAac,GAAGrJ,OAAQg4B,IAAc,KAChChwB,KAAK2Q,WAAa3Q,KAAKmQ,kBACzBnQ,KAAK6wB,eACP,IAGFtwB,EAAac,GAAGrB,KAAKyF,SAAUyqB,IAAyB/wB,IAEtDoB,EAAae,IAAItB,KAAKyF,SAAUwqB,IAAqBmB,IAC/CpxB,KAAKyF,WAAatG,EAAMlC,QAAU+C,KAAKyF,WAAa2rB,EAAOn0B,SAIjC,WAA1B+C,KAAK0F,QAAQ+nB,SAKbztB,KAAK0F,QAAQ+nB,UACfztB,KAAK4Q,OALL5Q,KAAKmxB,6BAMP,GACA,GAEN,CAEAJ,aACE/wB,KAAKyF,SAAS0L,MAAM6Z,QAAU,OAC9BhrB,KAAKyF,SAASjC,aAAa,eAAe,GAC1CxD,KAAKyF,SAAS/B,gBAAgB,cAC9B1D,KAAKyF,SAAS/B,gBAAgB,QAC9B1D,KAAKmQ,kBAAmB,EAExBnQ,KAAKwwB,UAAU5f,MAAK,KAClB7X,SAAS8B,KAAKhB,UAAUlC,OAAOy4B,IAC/BpwB,KAAKqxB,oBACLrxB,KAAK4wB,WAAWvN,QAChB9iB,EAAasB,QAAQ7B,KAAKyF,SAAUmK,GAAa,GAErD,CAEAR,cACE,OAAOpP,KAAKyF,SAAS5L,UAAUC,SA5NX,OA6NtB,CAEAq3B,6BAEE,GADkB5wB,EAAasB,QAAQ7B,KAAKyF,SAAUsqB,IACxC9tB,iBACZ,OAGF,MAAMqvB,EAAqBtxB,KAAKyF,SAASkZ,aAAe5lB,SAASoB,gBAAgBsf,aAC3E8X,EAAmBvxB,KAAKyF,SAAS0L,MAAMsM,UAEpB,WAArB8T,GAAiCvxB,KAAKyF,SAAS5L,UAAUC,SAASu2B,MAIjEiB,IACHtxB,KAAKyF,SAAS0L,MAAMsM,UAAY,UAGlCzd,KAAKyF,SAAS5L,UAAU2Q,IAAI6lB,IAC5BrwB,KAAKgG,gBAAe,KAClBhG,KAAKyF,SAAS5L,UAAUlC,OAAO04B,IAC/BrwB,KAAKgG,gBAAe,KAClBhG,KAAKyF,SAAS0L,MAAMsM,UAAY8T,CAAgB,GAC/CvxB,KAAKuwB,QAAQ,GACfvwB,KAAKuwB,SAERvwB,KAAKyF,SAASgmB,QAChB,CAMAoF,gBACE,MAAMS,EAAqBtxB,KAAKyF,SAASkZ,aAAe5lB,SAASoB,gBAAgBsf,aAC3E+V,EAAiBxvB,KAAK4wB,WAAW9B,WACjC0C,EAAoBhC,EAAiB,EAE3C,GAAIgC,IAAsBF,EAAoB,CAC5C,MAAMvsB,EAAWhK,IAAU,cAAgB,eAC3CiF,KAAKyF,SAAS0L,MAAMpM,GAAa,GAAEyqB,KACrC,CAEA,IAAKgC,GAAqBF,EAAoB,CAC5C,MAAMvsB,EAAWhK,IAAU,eAAiB,cAC5CiF,KAAKyF,SAAS0L,MAAMpM,GAAa,GAAEyqB,KACrC,CACF,CAEA6B,oBACErxB,KAAKyF,SAAS0L,MAAMsgB,YAAc,GAClCzxB,KAAKyF,SAAS0L,MAAMugB,aAAe,EACrC,CAGA,sBAAOj2B,CAAgB+I,EAAQ3E,GAC7B,OAAOG,KAAKyI,MAAK,WACf,MAAMC,EAAO4nB,GAAMnqB,oBAAoBnG,KAAMwE,GAE7C,GAAsB,iBAAXA,EAAX,CAIA,QAA4B,IAAjBkE,EAAKlE,GACd,MAAM,IAAIa,UAAW,oBAAmBb,MAG1CkE,EAAKlE,GAAQ3E,EANb,CAOF,GACF,EAOFU,EAAac,GAAGtI,SAAUyS,GAnSG,4BAmSyC,SAAUrM,GAC9E,MAAMlC,EAASwJ,EAAeoB,uBAAuB7H,MAEjD,CAAC,IAAK,QAAQoB,SAASpB,KAAKmI,UAC9BhJ,EAAMoD,iBAGRhC,EAAae,IAAIrE,EAAQwS,IAAYkiB,IAC/BA,EAAU1vB,kBAKd1B,EAAae,IAAIrE,EAAQ2S,IAAc,KACjC3W,EAAU+G,OACZA,KAAKyrB,OACP,GACA,IAIJ,MAAMmG,EAAcnrB,EAAeG,QA3Tf,eA4ThBgrB,GACFtB,GAAMpqB,YAAY0rB,GAAahhB,OAGpB0f,GAAMnqB,oBAAoBlJ,GAElC6L,OAAO9I,KACd,IAEA+H,EAAqBuoB,IAMrBr1B,EAAmBq1B,IC7VnB,MAEMzqB,GAAa,gBACb+E,GAAe,YACfW,GAAuB,OAAM1F,KAAY+E,KAGzCiF,GAAkB,OAClBgiB,GAAqB,UACrBC,GAAoB,SAEpBC,GAAgB,kBAEhBtiB,GAAc,OAAM5J,KACpB6J,GAAe,QAAO7J,KACtB8J,GAAc,OAAM9J,KACpBkqB,GAAwB,gBAAelqB,KACvC+J,GAAgB,SAAQ/J,KACxBmqB,GAAgB,SAAQnqB,KACxB2F,GAAwB,QAAO3F,KAAY+E,KAC3CulB,GAAyB,kBAAiBtqB,KAI1CzB,GAAU,CACdqpB,UAAU,EACVvhB,UAAU,EACVmQ,QAAQ,GAGJhY,GAAc,CAClBopB,SAAU,mBACVvhB,SAAU,UACVmQ,OAAQ,WAOV,MAAM2V,WAAkBzsB,EACtBV,YAAY9N,EAASyN,GACnBgB,MAAMzO,EAASyN,GAEfxE,KAAK2Q,UAAW,EAChB3Q,KAAKwwB,UAAYxwB,KAAKywB,sBACtBzwB,KAAK0wB,WAAa1wB,KAAK2wB,uBACvB3wB,KAAK8M,oBACP,CAGA,kBAAW1I,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,MA5DS,WA6DX,CAGAwN,OAAOjJ,GACL,OAAOG,KAAK2Q,SAAW3Q,KAAK4Q,OAAS5Q,KAAK6Q,KAAKhR,EACjD,CAEAgR,KAAKhR,GACCG,KAAK2Q,UAISpQ,EAAasB,QAAQ7B,KAAKyF,SAAUgK,GAAY,CAAE5P,kBAEtDoC,mBAIdjC,KAAK2Q,UAAW,EAChB3Q,KAAKwwB,UAAU3f,OAEV7Q,KAAK0F,QAAQ2W,SAChB,IAAIwS,IAAkBje,OAGxB5Q,KAAKyF,SAASjC,aAAa,cAAc,GACzCxD,KAAKyF,SAASjC,aAAa,OAAQ,UACnCxD,KAAKyF,SAAS5L,UAAU2Q,IAAIqnB,IAY5B7xB,KAAKgG,gBAVoBmJ,KAClBnP,KAAK0F,QAAQ2W,SAAUrc,KAAK0F,QAAQ+nB,UACvCztB,KAAK0wB,WAAWtC,WAGlBpuB,KAAKyF,SAAS5L,UAAU2Q,IAAIqF,IAC5B7P,KAAKyF,SAAS5L,UAAUlC,OAAOk6B,IAC/BtxB,EAAasB,QAAQ7B,KAAKyF,SAAUiK,GAAa,CAAE7P,iBAAgB,GAG/BG,KAAKyF,UAAU,GACvD,CAEAmL,OACO5Q,KAAK2Q,WAIQpQ,EAAasB,QAAQ7B,KAAKyF,SAAUkK,IAExC1N,mBAIdjC,KAAK0wB,WAAWnC,aAChBvuB,KAAKyF,SAASwsB,OACdjyB,KAAK2Q,UAAW,EAChB3Q,KAAKyF,SAAS5L,UAAU2Q,IAAIsnB,IAC5B9xB,KAAKwwB,UAAU5f,OAcf5Q,KAAKgG,gBAZoBksB,KACvBlyB,KAAKyF,SAAS5L,UAAUlC,OAAOkY,GAAiBiiB,IAChD9xB,KAAKyF,SAAS/B,gBAAgB,cAC9B1D,KAAKyF,SAAS/B,gBAAgB,QAEzB1D,KAAK0F,QAAQ2W,SAChB,IAAIwS,IAAkBxL,QAGxB9iB,EAAasB,QAAQ7B,KAAKyF,SAAUmK,GAAa,GAGb5P,KAAKyF,UAAU,IACvD,CAEAG,UACE5F,KAAKwwB,UAAU5qB,UACf5F,KAAK0wB,WAAWnC,aAChB/oB,MAAMI,SACR,CAGA6qB,sBACE,MAUMx3B,EAAY6H,QAAQd,KAAK0F,QAAQ+nB,UAEvC,OAAO,IAAIL,GAAS,CAClBH,UAlJsB,qBAmJtBh0B,YACAgN,YAAY,EACZknB,YAAantB,KAAKyF,SAAShM,WAC3ByzB,cAAej0B,EAjBKi0B,KACU,WAA1BltB,KAAK0F,QAAQ+nB,SAKjBztB,KAAK4Q,OAJHrQ,EAAasB,QAAQ7B,KAAKyF,SAAUsqB,GAI3B,EAWgC,MAE/C,CAEAY,uBACE,OAAO,IAAI1C,GAAU,CACnBD,YAAahuB,KAAKyF,UAEtB,CAEAqH,qBACEvM,EAAac,GAAGrB,KAAKyF,SAAU0qB,IAAuBhxB,IAtKvC,WAuKTA,EAAMnI,MAINgJ,KAAK0F,QAAQwG,SACflM,KAAK4Q,OAIPrQ,EAAasB,QAAQ7B,KAAKyF,SAAUsqB,IAAqB,GAE7D,CAGA,sBAAOt0B,CAAgB+I,GACrB,OAAOxE,KAAKyI,MAAK,WACf,MAAMC,EAAOspB,GAAU7rB,oBAAoBnG,KAAMwE,GAEjD,GAAsB,iBAAXA,EAAX,CAIA,QAAqBmE,IAAjBD,EAAKlE,IAAyBA,EAAO/C,WAAW,MAAmB,gBAAX+C,EAC1D,MAAM,IAAIa,UAAW,oBAAmBb,MAG1CkE,EAAKlE,GAAQxE,KANb,CAOF,GACF,EAOFO,EAAac,GAAGtI,SAAUyS,GAzLG,gCAyLyC,SAAUrM,GAC9E,MAAMlC,EAASwJ,EAAeoB,uBAAuB7H,MAMrD,GAJI,CAAC,IAAK,QAAQoB,SAASpB,KAAKmI,UAC9BhJ,EAAMoD,iBAGJ7I,EAAWsG,MACb,OAGFO,EAAae,IAAIrE,EAAQ2S,IAAc,KAEjC3W,EAAU+G,OACZA,KAAKyrB,OACP,IAIF,MAAMmG,EAAcnrB,EAAeG,QAAQmrB,IACvCH,GAAeA,IAAgB30B,GACjC+0B,GAAU9rB,YAAY0rB,GAAahhB,OAGxBohB,GAAU7rB,oBAAoBlJ,GACtC6L,OAAO9I,KACd,IAEAO,EAAac,GAAGrJ,OAAQuT,IAAqB,KAC3C,IAAK,MAAMxT,KAAY0O,EAAevH,KAAK6yB,IACzCC,GAAU7rB,oBAAoBpO,GAAU8Y,MAC1C,IAGFtQ,EAAac,GAAGrJ,OAAQg4B,IAAc,KACpC,IAAK,MAAMj5B,KAAW0P,EAAevH,KAAK,gDACG,UAAvC9F,iBAAiBrC,GAAS2d,UAC5Bsd,GAAU7rB,oBAAoBpP,GAAS6Z,MAE3C,IAGF7I,EAAqBiqB,IAMrB/2B,EAAmB+2B,IC/QnB,MAEaG,GAAmB,CAE9B,IAAK,CAAC,QAAS,MAAO,KAAM,OAAQ,OAJP,kBAK7B7Q,EAAG,CAAC,SAAU,OAAQ,QAAS,OAC/B8Q,KAAM,GACN7Q,EAAG,GACH8Q,GAAI,GACJC,IAAK,GACLC,KAAM,GACNC,IAAK,GACLC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJvQ,EAAG,GACHxU,IAAK,CAAC,MAAO,SAAU,MAAO,QAAS,QAAS,UAChDglB,GAAI,GACJC,GAAI,GACJC,EAAG,GACHC,IAAK,GACLC,EAAG,GACHC,MAAO,GACPC,KAAM,GACNC,IAAK,GACLC,IAAK,GACLC,OAAQ,GACRC,EAAG,GACHC,GAAI,IAIAC,GAAgB,IAAIr1B,IAAI,CAC5B,aACA,OACA,OACA,WACA,WACA,SACA,MACA,eAUIs1B,GAAmB,0DAEnBC,GAAmBA,CAAC/e,EAAWgf,KACnC,MAAMC,EAAgBjf,EAAU1B,SAASjQ,cAEzC,OAAI2wB,EAAqB5yB,SAAS6yB,IAC5BJ,GAAc38B,IAAI+8B,IACbnzB,QAAQgzB,GAAiB1uB,KAAK4P,EAAUkf,YAO5CF,EAAqBjwB,QAAOowB,GAAkBA,aAA0BhvB,SAC5Ese,MAAK2Q,GAASA,EAAMhvB,KAAK6uB,IAAe,EC5DvC7vB,GAAU,CACdiwB,UAAWlC,GACXmC,QAAS,GACTC,WAAY,GACZpW,MAAM,EACNqW,UAAU,EACVC,WAAY,KACZC,SAAU,eAGNrwB,GAAc,CAClBgwB,UAAW,SACXC,QAAS,SACTC,WAAY,oBACZpW,KAAM,UACNqW,SAAU,UACVC,WAAY,kBACZC,SAAU,UAGNC,GAAqB,CACzBC,MAAO,iCACP78B,SAAU,oBAOZ,MAAM88B,WAAwB1wB,EAC5BU,YAAYL,GACVgB,QACAxF,KAAK0F,QAAU1F,KAAKuE,WAAWC,EACjC,CAGA,kBAAWJ,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,MA/CS,iBAgDX,CAGAw5B,aACE,OAAO91B,OAAOC,OAAOe,KAAK0F,QAAQ4uB,SAC/B7sB,KAAIjD,GAAUxE,KAAK+0B,yBAAyBvwB,KAC5CT,OAAOjD,QACZ,CAEAk0B,aACE,OAAOh1B,KAAK80B,aAAah8B,OAAS,CACpC,CAEAm8B,cAAcX,GAGZ,OAFAt0B,KAAKk1B,cAAcZ,GACnBt0B,KAAK0F,QAAQ4uB,QAAU,IAAKt0B,KAAK0F,QAAQ4uB,WAAYA,GAC9Ct0B,IACT,CAEAm1B,SACE,MAAMC,EAAkBr8B,SAAS20B,cAAc,OAC/C0H,EAAgBC,UAAYr1B,KAAKs1B,eAAet1B,KAAK0F,QAAQgvB,UAE7D,IAAK,MAAO38B,EAAUw9B,KAASv2B,OAAOmC,QAAQnB,KAAK0F,QAAQ4uB,SACzDt0B,KAAKw1B,YAAYJ,EAAiBG,EAAMx9B,GAG1C,MAAM28B,EAAWU,EAAgBvuB,SAAS,GACpC0tB,EAAav0B,KAAK+0B,yBAAyB/0B,KAAK0F,QAAQ6uB,YAM9D,OAJIA,GACFG,EAAS76B,UAAU2Q,OAAO+pB,EAAW13B,MAAM,MAGtC63B,CACT,CAGA/vB,iBAAiBH,GACfgB,MAAMb,iBAAiBH,GACvBxE,KAAKk1B,cAAc1wB,EAAO8vB,QAC5B,CAEAY,cAAcO,GACZ,IAAK,MAAO19B,EAAUu8B,KAAYt1B,OAAOmC,QAAQs0B,GAC/CjwB,MAAMb,iBAAiB,CAAE5M,WAAU68B,MAAON,GAAWK,GAEzD,CAEAa,YAAYd,EAAUJ,EAASv8B,GAC7B,MAAM29B,EAAkBjvB,EAAeG,QAAQ7O,EAAU28B,GAEpDgB,KAILpB,EAAUt0B,KAAK+0B,yBAAyBT,IAOpC77B,EAAU67B,GACZt0B,KAAK21B,sBAAsB98B,EAAWy7B,GAAUoB,GAI9C11B,KAAK0F,QAAQyY,KACfuX,EAAgBL,UAAYr1B,KAAKs1B,eAAehB,GAIlDoB,EAAgBE,YAActB,EAd5BoB,EAAgB/9B,SAepB,CAEA29B,eAAeG,GACb,OAAOz1B,KAAK0F,QAAQ8uB,SD5DjB,SAAsBqB,EAAYxB,EAAWyB,GAClD,IAAKD,EAAW/8B,OACd,OAAO+8B,EAGT,GAAIC,GAAgD,mBAArBA,EAC7B,OAAOA,EAAiBD,GAG1B,MACME,GADY,IAAI/9B,OAAOg+B,WACKC,gBAAgBJ,EAAY,aACxD1hB,EAAW,GAAGzN,UAAUqvB,EAAgBl7B,KAAKuF,iBAAiB,MAEpE,IAAK,MAAMrJ,KAAWod,EAAU,CAC9B,MAAM+hB,EAAcn/B,EAAQuc,SAASjQ,cAErC,IAAKrE,OAAOtH,KAAK28B,GAAWjzB,SAAS80B,GAAc,CACjDn/B,EAAQY,SACR,QACF,CAEA,MAAMw+B,EAAgB,GAAGzvB,UAAU3P,EAAQ6M,YACrCwyB,EAAoB,GAAG1vB,OAAO2tB,EAAU,MAAQ,GAAIA,EAAU6B,IAAgB,IAEpF,IAAK,MAAMlhB,KAAamhB,EACjBpC,GAAiB/e,EAAWohB,IAC/Br/B,EAAQ2M,gBAAgBsR,EAAU1B,SAGxC,CAEA,OAAOyiB,EAAgBl7B,KAAKw6B,SAC9B,CC4BmCgB,CAAaZ,EAAKz1B,KAAK0F,QAAQ2uB,UAAWr0B,KAAK0F,QAAQ+uB,YAAcgB,CACtG,CAEAV,yBAAyBU,GACvB,OAAO15B,EAAQ05B,EAAK,CAACz1B,MACvB,CAEA21B,sBAAsB5+B,EAAS2+B,GAC7B,GAAI11B,KAAK0F,QAAQyY,KAGf,OAFAuX,EAAgBL,UAAY,QAC5BK,EAAgB/H,OAAO52B,GAIzB2+B,EAAgBE,YAAc7+B,EAAQ6+B,WACxC,ECzIF,MACMU,GAAwB,IAAI93B,IAAI,CAAC,WAAY,YAAa,eAE1D+3B,GAAkB,OAElB1mB,GAAkB,OAGlB2mB,GAAkB,SAElBC,GAAmB,gBAEnBC,GAAgB,QAChBC,GAAgB,QAehBC,GAAgB,CACpBC,KAAM,OACNC,IAAK,MACLC,MAAOh8B,IAAU,OAAS,QAC1Bi8B,OAAQ,SACRC,KAAMl8B,IAAU,QAAU,QAGtBqJ,GAAU,CACdiwB,UAAWlC,GACX+E,WAAW,EACX5X,SAAU,kBACV6X,WAAW,EACXC,YAAa,GACbC,MAAO,EACPrV,mBAAoB,CAAC,MAAO,QAAS,SAAU,QAC/C7D,MAAM,EACNtE,OAAQ,CAAC,EAAG,GACZpH,UAAW,MACXwY,aAAc,KACduJ,UAAU,EACVC,WAAY,KACZ18B,UAAU,EACV28B,SAAU,+GAIV4C,MAAO,GACPz1B,QAAS,eAGLwC,GAAc,CAClBgwB,UAAW,SACX6C,UAAW,UACX5X,SAAU,mBACV6X,UAAW,2BACXC,YAAa,oBACbC,MAAO,kBACPrV,mBAAoB,QACpB7D,KAAM,UACNtE,OAAQ,0BACRpH,UAAW,oBACXwY,aAAc,yBACduJ,SAAU,UACVC,WAAY,kBACZ18B,SAAU,mBACV28B,SAAU,SACV4C,MAAO,4BACPz1B,QAAS,UAOX,MAAM01B,WAAgBhyB,EACpBV,YAAY9N,EAASyN,GACnB,QAAsB,IAAXmnB,GACT,MAAM,IAAItmB,UAAU,+DAGtBG,MAAMzO,EAASyN,GAGfxE,KAAKw3B,YAAa,EAClBx3B,KAAKy3B,SAAW,EAChBz3B,KAAK03B,WAAa,KAClB13B,KAAK23B,eAAiB,GACtB33B,KAAKmrB,QAAU,KACfnrB,KAAK43B,iBAAmB,KACxB53B,KAAK63B,YAAc,KAGnB73B,KAAK83B,IAAM,KAEX93B,KAAK+3B,gBAEA/3B,KAAK0F,QAAQ3N,UAChBiI,KAAKg4B,WAET,CAGA,kBAAW5zB,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,MAxHS,SAyHX,CAGA28B,SACEj4B,KAAKw3B,YAAa,CACpB,CAEAU,UACEl4B,KAAKw3B,YAAa,CACpB,CAEAW,gBACEn4B,KAAKw3B,YAAcx3B,KAAKw3B,UAC1B,CAEA1uB,SACO9I,KAAKw3B,aAIVx3B,KAAK23B,eAAeS,OAASp4B,KAAK23B,eAAeS,MAC7Cp4B,KAAK2Q,WACP3Q,KAAKq4B,SAIPr4B,KAAKs4B,SACP,CAEA1yB,UACEyI,aAAarO,KAAKy3B,UAElBl3B,EAAaC,IAAIR,KAAKyF,SAASlM,QAAQi9B,IAAiBC,GAAkBz2B,KAAKu4B,mBAE3Ev4B,KAAKyF,SAASxL,aAAa,2BAC7B+F,KAAKyF,SAASjC,aAAa,QAASxD,KAAKyF,SAASxL,aAAa,2BAGjE+F,KAAKw4B,iBACLhzB,MAAMI,SACR,CAEAiL,OACE,GAAoC,SAAhC7Q,KAAKyF,SAAS0L,MAAM6Z,QACtB,MAAM,IAAI1mB,MAAM,uCAGlB,IAAMtE,KAAKy4B,mBAAoBz4B,KAAKw3B,WAClC,OAGF,MAAM7F,EAAYpxB,EAAasB,QAAQ7B,KAAKyF,SAAUzF,KAAK6E,YAAYwB,UAzJxD,SA2JTqyB,GADax+B,EAAe8F,KAAKyF,WACLzF,KAAKyF,SAASgO,cAActZ,iBAAiBL,SAASkG,KAAKyF,UAE7F,GAAIksB,EAAU1vB,mBAAqBy2B,EACjC,OAIF14B,KAAKw4B,iBAEL,MAAMV,EAAM93B,KAAK24B,iBAEjB34B,KAAKyF,SAASjC,aAAa,mBAAoBs0B,EAAI79B,aAAa,OAEhE,MAAMk9B,UAAEA,GAAcn3B,KAAK0F,QAe3B,GAbK1F,KAAKyF,SAASgO,cAActZ,gBAAgBL,SAASkG,KAAK83B,OAC7DX,EAAUxJ,OAAOmK,GACjBv3B,EAAasB,QAAQ7B,KAAKyF,SAAUzF,KAAK6E,YAAYwB,UA1KpC,cA6KnBrG,KAAKmrB,QAAUnrB,KAAKwrB,cAAcsM,GAElCA,EAAIj+B,UAAU2Q,IAAIqF,IAMd,iBAAkB9W,SAASoB,gBAC7B,IAAK,MAAMpD,IAAW,GAAG2P,UAAU3N,SAAS8B,KAAKgM,UAC/CtG,EAAac,GAAGtK,EAAS,YAAayD,GAc1CwF,KAAKgG,gBAVYqL,KACf9Q,EAAasB,QAAQ7B,KAAKyF,SAAUzF,KAAK6E,YAAYwB,UA7LvC,WA+LU,IAApBrG,KAAK03B,YACP13B,KAAKq4B,SAGPr4B,KAAK03B,YAAa,CAAK,GAGK13B,KAAK83B,IAAK93B,KAAKoP,cAC/C,CAEAwB,OACE,GAAK5Q,KAAK2Q,aAIQpQ,EAAasB,QAAQ7B,KAAKyF,SAAUzF,KAAK6E,YAAYwB,UAjNxD,SAkNDpE,iBAAd,CASA,GALYjC,KAAK24B,iBACb9+B,UAAUlC,OAAOkY,IAIjB,iBAAkB9W,SAASoB,gBAC7B,IAAK,MAAMpD,IAAW,GAAG2P,UAAU3N,SAAS8B,KAAKgM,UAC/CtG,EAAaC,IAAIzJ,EAAS,YAAayD,GAI3CwF,KAAK23B,eAA4B,OAAI,EACrC33B,KAAK23B,eAAehB,KAAiB,EACrC32B,KAAK23B,eAAejB,KAAiB,EACrC12B,KAAK03B,WAAa,KAelB13B,KAAKgG,gBAbYqL,KACXrR,KAAK44B,yBAIJ54B,KAAK03B,YACR13B,KAAKw4B,iBAGPx4B,KAAKyF,SAAS/B,gBAAgB,oBAC9BnD,EAAasB,QAAQ7B,KAAKyF,SAAUzF,KAAK6E,YAAYwB,UA/OtC,WA+O8D,GAGjDrG,KAAK83B,IAAK93B,KAAKoP,cA/B7C,CAgCF,CAEAsN,SACM1c,KAAKmrB,SACPnrB,KAAKmrB,QAAQzO,QAEjB,CAGA+b,iBACE,OAAO33B,QAAQd,KAAK64B,YACtB,CAEAF,iBAKE,OAJK34B,KAAK83B,MACR93B,KAAK83B,IAAM93B,KAAK84B,kBAAkB94B,KAAK63B,aAAe73B,KAAK+4B,2BAGtD/4B,KAAK83B,GACd,CAEAgB,kBAAkBxE,GAChB,MAAMwD,EAAM93B,KAAKg5B,oBAAoB1E,GAASa,SAG9C,IAAK2C,EACH,OAAO,KAGTA,EAAIj+B,UAAUlC,OAAO4+B,GAAiB1mB,IAEtCioB,EAAIj+B,UAAU2Q,IAAK,MAAKxK,KAAK6E,YAAYvJ,aAEzC,MAAM29B,E3EnRKC,KACb,GACEA,GAAUt7B,KAAKu7B,MAjCH,IAiCSv7B,KAAKw7B,gBACnBrgC,SAASsgC,eAAeH,IAEjC,OAAOA,CAAM,E2E8QGI,CAAOt5B,KAAK6E,YAAYvJ,MAAMyH,WAQ5C,OANA+0B,EAAIt0B,aAAa,KAAMy1B,GAEnBj5B,KAAKoP,eACP0oB,EAAIj+B,UAAU2Q,IAAI+rB,IAGbuB,CACT,CAEAyB,WAAWjF,GACTt0B,KAAK63B,YAAcvD,EACft0B,KAAK2Q,aACP3Q,KAAKw4B,iBACLx4B,KAAK6Q,OAET,CAEAmoB,oBAAoB1E,GAalB,OAZIt0B,KAAK43B,iBACP53B,KAAK43B,iBAAiB3C,cAAcX,GAEpCt0B,KAAK43B,iBAAmB,IAAI/C,GAAgB,IACvC70B,KAAK0F,QAGR4uB,UACAC,WAAYv0B,KAAK+0B,yBAAyB/0B,KAAK0F,QAAQ0xB,eAIpDp3B,KAAK43B,gBACd,CAEAmB,yBACE,MAAO,CACL,iBAA0B/4B,KAAK64B,YAEnC,CAEAA,YACE,OAAO74B,KAAK+0B,yBAAyB/0B,KAAK0F,QAAQ4xB,QAAUt3B,KAAKyF,SAASxL,aAAa,yBACzF,CAGAu/B,6BAA6Br6B,GAC3B,OAAOa,KAAK6E,YAAYsB,oBAAoBhH,EAAMW,eAAgBE,KAAKy5B,qBACzE,CAEArqB,cACE,OAAOpP,KAAK0F,QAAQwxB,WAAcl3B,KAAK83B,KAAO93B,KAAK83B,IAAIj+B,UAAUC,SAASy8B,GAC5E,CAEA5lB,WACE,OAAO3Q,KAAK83B,KAAO93B,KAAK83B,IAAIj+B,UAAUC,SAAS+V,GACjD,CAEA2b,cAAcsM,GACZ,MAAMrlB,EAAY1W,EAAQiE,KAAK0F,QAAQ+M,UAAW,CAACzS,KAAM83B,EAAK93B,KAAKyF,WAC7Di0B,EAAa9C,GAAcnkB,EAAUnN,eAC3C,OAAOqmB,GAAoB3rB,KAAKyF,SAAUqyB,EAAK93B,KAAK6rB,iBAAiB6N,GACvE,CAEAzN,aACE,MAAMpS,OAAEA,GAAW7Z,KAAK0F,QAExB,MAAsB,iBAAXmU,EACFA,EAAOhd,MAAM,KAAK4K,KAAI/E,GAAShG,OAAOgS,SAAShM,EAAO,MAGzC,mBAAXmX,EACFqS,GAAcrS,EAAOqS,EAAYlsB,KAAKyF,UAGxCoU,CACT,CAEAkb,yBAAyBU,GACvB,OAAO15B,EAAQ05B,EAAK,CAACz1B,KAAKyF,UAC5B,CAEAomB,iBAAiB6N,GACf,MAAMvN,EAAwB,CAC5B1Z,UAAWinB,EACXnS,UAAW,CACT,CACElsB,KAAM,OACNsZ,QAAS,CACPqN,mBAAoBhiB,KAAK0F,QAAQsc,qBAGrC,CACE3mB,KAAM,SACNsZ,QAAS,CACPkF,OAAQ7Z,KAAKisB,eAGjB,CACE5wB,KAAM,kBACNsZ,QAAS,CACP2K,SAAUtf,KAAK0F,QAAQ4Z,WAG3B,CACEjkB,KAAM,QACNsZ,QAAS,CACP5d,QAAU,IAAGiJ,KAAK6E,YAAYvJ,eAGlC,CACED,KAAM,kBACN0Y,SAAS,EACTC,MAAO,aACPxY,GAAIkN,IAGF1I,KAAK24B,iBAAiBn1B,aAAa,wBAAyBkF,EAAKwL,MAAMzB,UAAU,KAMzF,MAAO,IACF0Z,KACApwB,EAAQiE,KAAK0F,QAAQulB,aAAc,CAACkB,IAE3C,CAEA4L,gBACE,MAAM4B,EAAW35B,KAAK0F,QAAQ7D,QAAQhF,MAAM,KAE5C,IAAK,MAAMgF,KAAW83B,EACpB,GAAgB,UAAZ93B,EACFtB,EAAac,GAAGrB,KAAKyF,SAAUzF,KAAK6E,YAAYwB,UAtZpC,SAsZ4DrG,KAAK0F,QAAQ3N,UAAUoH,IAC7Ea,KAAKw5B,6BAA6Br6B,GAC1C2J,QAAQ,SAEb,GAjaU,WAiaNjH,EAA4B,CACrC,MAAM+3B,EAAU/3B,IAAY60B,GAC1B12B,KAAK6E,YAAYwB,UAzZF,cA0ZfrG,KAAK6E,YAAYwB,UA5ZL,WA6ZRwzB,EAAWh4B,IAAY60B,GAC3B12B,KAAK6E,YAAYwB,UA3ZF,cA4ZfrG,KAAK6E,YAAYwB,UA9ZJ,YAgaf9F,EAAac,GAAGrB,KAAKyF,SAAUm0B,EAAS55B,KAAK0F,QAAQ3N,UAAUoH,IAC7D,MAAMotB,EAAUvsB,KAAKw5B,6BAA6Br6B,GAClDotB,EAAQoL,eAA8B,YAAfx4B,EAAMsB,KAAqBk2B,GAAgBD,KAAiB,EACnFnK,EAAQ+L,QAAQ,IAElB/3B,EAAac,GAAGrB,KAAKyF,SAAUo0B,EAAU75B,KAAK0F,QAAQ3N,UAAUoH,IAC9D,MAAMotB,EAAUvsB,KAAKw5B,6BAA6Br6B,GAClDotB,EAAQoL,eAA8B,aAAfx4B,EAAMsB,KAAsBk2B,GAAgBD,IACjEnK,EAAQ9mB,SAAS3L,SAASqF,EAAMU,eAElC0sB,EAAQ8L,QAAQ,GAEpB,CAGFr4B,KAAKu4B,kBAAoB,KACnBv4B,KAAKyF,UACPzF,KAAK4Q,MACP,EAGFrQ,EAAac,GAAGrB,KAAKyF,SAASlM,QAAQi9B,IAAiBC,GAAkBz2B,KAAKu4B,kBAChF,CAEAP,YACE,MAAMV,EAAQt3B,KAAKyF,SAASxL,aAAa,SAEpCq9B,IAIAt3B,KAAKyF,SAASxL,aAAa,eAAkB+F,KAAKyF,SAASmwB,YAAYpvB,QAC1ExG,KAAKyF,SAASjC,aAAa,aAAc8zB,GAG3Ct3B,KAAKyF,SAASjC,aAAa,yBAA0B8zB,GACrDt3B,KAAKyF,SAAS/B,gBAAgB,SAChC,CAEA40B,SACMt4B,KAAK2Q,YAAc3Q,KAAK03B,WAC1B13B,KAAK03B,YAAa,GAIpB13B,KAAK03B,YAAa,EAElB13B,KAAK85B,aAAY,KACX95B,KAAK03B,YACP13B,KAAK6Q,MACP,GACC7Q,KAAK0F,QAAQ2xB,MAAMxmB,MACxB,CAEAwnB,SACMr4B,KAAK44B,yBAIT54B,KAAK03B,YAAa,EAElB13B,KAAK85B,aAAY,KACV95B,KAAK03B,YACR13B,KAAK4Q,MACP,GACC5Q,KAAK0F,QAAQ2xB,MAAMzmB,MACxB,CAEAkpB,YAAY98B,EAAS+8B,GACnB1rB,aAAarO,KAAKy3B,UAClBz3B,KAAKy3B,SAAWt6B,WAAWH,EAAS+8B,EACtC,CAEAnB,uBACE,OAAO55B,OAAOC,OAAOe,KAAK23B,gBAAgBv2B,UAAS,EACrD,CAEAmD,WAAWC,GACT,MAAMw1B,EAAiB12B,EAAYK,kBAAkB3D,KAAKyF,UAE1D,IAAK,MAAMw0B,KAAiBj7B,OAAOtH,KAAKsiC,GAClC1D,GAAsBp/B,IAAI+iC,WACrBD,EAAeC,GAW1B,OAPAz1B,EAAS,IACJw1B,KACmB,iBAAXx1B,GAAuBA,EAASA,EAAS,IAEtDA,EAASxE,KAAKyE,gBAAgBD,GAC9BA,EAASxE,KAAK0E,kBAAkBF,GAChCxE,KAAK2E,iBAAiBH,GACfA,CACT,CAEAE,kBAAkBF,GAkBhB,OAjBAA,EAAO2yB,WAAiC,IAArB3yB,EAAO2yB,UAAsBp+B,SAAS8B,KAAOhC,EAAW2L,EAAO2yB,WAEtD,iBAAjB3yB,EAAO6yB,QAChB7yB,EAAO6yB,MAAQ,CACbxmB,KAAMrM,EAAO6yB,MACbzmB,KAAMpM,EAAO6yB,QAIW,iBAAjB7yB,EAAO8yB,QAChB9yB,EAAO8yB,MAAQ9yB,EAAO8yB,MAAMv0B,YAGA,iBAAnByB,EAAO8vB,UAChB9vB,EAAO8vB,QAAU9vB,EAAO8vB,QAAQvxB,YAG3ByB,CACT,CAEAi1B,qBACE,MAAMj1B,EAAS,GAEf,IAAK,MAAOxN,EAAK0L,KAAU1D,OAAOmC,QAAQnB,KAAK0F,SACzC1F,KAAK6E,YAAYT,QAAQpN,KAAS0L,IACpC8B,EAAOxN,GAAO0L,GAUlB,OANA8B,EAAOzM,UAAW,EAClByM,EAAO3C,QAAU,SAKV2C,CACT,CAEAg0B,iBACMx4B,KAAKmrB,UACPnrB,KAAKmrB,QAAQtB,UACb7pB,KAAKmrB,QAAU,MAGbnrB,KAAK83B,MACP93B,KAAK83B,IAAIngC,SACTqI,KAAK83B,IAAM,KAEf,CAGA,sBAAOr8B,CAAgB+I,GACrB,OAAOxE,KAAKyI,MAAK,WACf,MAAMC,EAAO6uB,GAAQpxB,oBAAoBnG,KAAMwE,GAE/C,GAAsB,iBAAXA,EAAX,CAIA,QAA4B,IAAjBkE,EAAKlE,GACd,MAAM,IAAIa,UAAW,oBAAmBb,MAG1CkE,EAAKlE,IANL,CAOF,GACF,EAOFvJ,EAAmBs8B,ICtmBnB,MAKMnzB,GAAU,IACXmzB,GAAQnzB,QACXkwB,QAAS,GACTza,OAAQ,CAAC,EAAG,GACZpH,UAAW,QACXiiB,SAAU,8IAKV7yB,QAAS,SAGLwC,GAAc,IACfkzB,GAAQlzB,YACXiwB,QAAS,kCAOX,MAAM4F,WAAgB3C,GAEpB,kBAAWnzB,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,MAtCS,SAuCX,CAGAm9B,iBACE,OAAOz4B,KAAK64B,aAAe74B,KAAKm6B,aAClC,CAGApB,yBACE,MAAO,CACL,kBAAkB/4B,KAAK64B,YACvB,gBAAoB74B,KAAKm6B,cAE7B,CAEAA,cACE,OAAOn6B,KAAK+0B,yBAAyB/0B,KAAK0F,QAAQ4uB,QACpD,CAGA,sBAAO74B,CAAgB+I,GACrB,OAAOxE,KAAKyI,MAAK,WACf,MAAMC,EAAOwxB,GAAQ/zB,oBAAoBnG,KAAMwE,GAE/C,GAAsB,iBAAXA,EAAX,CAIA,QAA4B,IAAjBkE,EAAKlE,GACd,MAAM,IAAIa,UAAW,oBAAmBb,MAG1CkE,EAAKlE,IANL,CAOF,GACF,EAOFvJ,EAAmBi/B,IC9EnB,MAEMr0B,GAAa,gBAGbu0B,GAAkB,WAAUv0B,KAC5Bw0B,GAAe,QAAOx0B,KACtB0F,GAAuB,OAAM1F,cAG7B6F,GAAoB,SAGpB4uB,GAAwB,SAExBC,GAAqB,YAGrBC,GAAuB,GAAED,mBAA+CA,uBAIxEn2B,GAAU,CACdyV,OAAQ,KACR4gB,WAAY,eACZC,cAAc,EACdz9B,OAAQ,KACR09B,UAAW,CAAC,GAAK,GAAK,IAGlBt2B,GAAc,CAClBwV,OAAQ,gBACR4gB,WAAY,SACZC,aAAc,UACdz9B,OAAQ,UACR09B,UAAW,SAOb,MAAMC,WAAkBr1B,EACtBV,YAAY9N,EAASyN,GACnBgB,MAAMzO,EAASyN,GAGfxE,KAAK66B,aAAe,IAAIjkC,IACxBoJ,KAAK86B,oBAAsB,IAAIlkC,IAC/BoJ,KAAK+6B,aAA6D,YAA9C3hC,iBAAiB4G,KAAKyF,UAAUgY,UAA0B,KAAOzd,KAAKyF,SAC1FzF,KAAKg7B,cAAgB,KACrBh7B,KAAKi7B,UAAY,KACjBj7B,KAAKk7B,oBAAsB,CACzBC,gBAAiB,EACjBC,gBAAiB,GAEnBp7B,KAAKq7B,SACP,CAGA,kBAAWj3B,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,MArES,WAsEX,CAGA+/B,UACEr7B,KAAKs7B,mCACLt7B,KAAKu7B,2BAEDv7B,KAAKi7B,UACPj7B,KAAKi7B,UAAUO,aAEfx7B,KAAKi7B,UAAYj7B,KAAKy7B,kBAGxB,IAAK,MAAMC,KAAW17B,KAAK86B,oBAAoB77B,SAC7Ce,KAAKi7B,UAAUU,QAAQD,EAE3B,CAEA91B,UACE5F,KAAKi7B,UAAUO,aACfh2B,MAAMI,SACR,CAGAlB,kBAAkBF,GAWhB,OATAA,EAAOvH,OAASpE,EAAW2L,EAAOvH,SAAWlE,SAAS8B,KAGtD2J,EAAOi2B,WAAaj2B,EAAOqV,OAAU,GAAErV,EAAOqV,oBAAsBrV,EAAOi2B,WAE3C,iBAArBj2B,EAAOm2B,YAChBn2B,EAAOm2B,UAAYn2B,EAAOm2B,UAAU99B,MAAM,KAAK4K,KAAI/E,GAAShG,OAAOC,WAAW+F,MAGzE8B,CACT,CAEA+2B,2BACOv7B,KAAK0F,QAAQg1B,eAKlBn6B,EAAaC,IAAIR,KAAK0F,QAAQzI,OAAQo9B,IAEtC95B,EAAac,GAAGrB,KAAK0F,QAAQzI,OAAQo9B,GAAaC,IAAuBn7B,IACvE,MAAMy8B,EAAoB57B,KAAK86B,oBAAoB1jC,IAAI+H,EAAMlC,OAAO0f,MACpE,GAAIif,EAAmB,CACrBz8B,EAAMoD,iBACN,MAAMjI,EAAO0F,KAAK+6B,cAAgB/iC,OAC5Bqe,EAASulB,EAAkBjlB,UAAY3W,KAAKyF,SAASkR,UAC3D,GAAIrc,EAAKuhC,SAEP,YADAvhC,EAAKuhC,SAAS,CAAEnqB,IAAK2E,EAAQylB,SAAU,WAKzCxhC,EAAK4iB,UAAY7G,CACnB,KAEJ,CAEAolB,kBACE,MAAM9mB,EAAU,CACdra,KAAM0F,KAAK+6B,aACXJ,UAAW36B,KAAK0F,QAAQi1B,UACxBF,WAAYz6B,KAAK0F,QAAQ+0B,YAG3B,OAAO,IAAIsB,sBAAqB56B,GAAWnB,KAAKg8B,kBAAkB76B,IAAUwT,EAC9E,CAGAqnB,kBAAkB76B,GAChB,MAAM86B,EAAgBrH,GAAS50B,KAAK66B,aAAazjC,IAAK,IAAGw9B,EAAM33B,OAAO5E,MAChE+1B,EAAWwG,IACf50B,KAAKk7B,oBAAoBC,gBAAkBvG,EAAM33B,OAAO0Z,UACxD3W,KAAKk8B,SAASD,EAAcrH,GAAO,EAG/BwG,GAAmBp7B,KAAK+6B,cAAgBhiC,SAASoB,iBAAiB+iB,UAClEif,EAAkBf,GAAmBp7B,KAAKk7B,oBAAoBE,gBACpEp7B,KAAKk7B,oBAAoBE,gBAAkBA,EAE3C,IAAK,MAAMxG,KAASzzB,EAAS,CAC3B,IAAKyzB,EAAMwH,eAAgB,CACzBp8B,KAAKg7B,cAAgB,KACrBh7B,KAAKq8B,kBAAkBJ,EAAcrH,IAErC,QACF,CAEA,MAAM0H,EAA2B1H,EAAM33B,OAAO0Z,WAAa3W,KAAKk7B,oBAAoBC,gBAEpF,GAAIgB,GAAmBG,GAGrB,GAFAlO,EAASwG,IAEJwG,EACH,YAOCe,GAAoBG,GACvBlO,EAASwG,EAEb,CACF,CAEA0G,mCACEt7B,KAAK66B,aAAe,IAAIjkC,IACxBoJ,KAAK86B,oBAAsB,IAAIlkC,IAE/B,MAAM2lC,EAAc91B,EAAevH,KAAKo7B,GAAuBt6B,KAAK0F,QAAQzI,QAE5E,IAAK,MAAMu/B,KAAUD,EAAa,CAEhC,IAAKC,EAAO7f,MAAQjjB,EAAW8iC,GAC7B,SAGF,MAAMZ,EAAoBn1B,EAAeG,QAAQ61B,UAAUD,EAAO7f,MAAO3c,KAAKyF,UAG1ExM,EAAU2iC,KACZ57B,KAAK66B,aAAa/jC,IAAI2lC,UAAUD,EAAO7f,MAAO6f,GAC9Cx8B,KAAK86B,oBAAoBhkC,IAAI0lC,EAAO7f,KAAMif,GAE9C,CACF,CAEAM,SAASj/B,GACH+C,KAAKg7B,gBAAkB/9B,IAI3B+C,KAAKq8B,kBAAkBr8B,KAAK0F,QAAQzI,QACpC+C,KAAKg7B,cAAgB/9B,EACrBA,EAAOpD,UAAU2Q,IAAIkB,IACrB1L,KAAK08B,iBAAiBz/B,GAEtBsD,EAAasB,QAAQ7B,KAAKyF,SAAU20B,GAAgB,CAAEv6B,cAAe5C,IACvE,CAEAy/B,iBAAiBz/B,GAEf,GAAIA,EAAOpD,UAAUC,SAlNQ,iBAmN3B2M,EAAeG,QAxMY,mBAwMsB3J,EAAO1D,QAzMpC,cA0MjBM,UAAU2Q,IAAIkB,SAInB,IAAK,MAAMixB,KAAal2B,EAAeO,QAAQ/J,EAnNnB,qBAsN1B,IAAK,MAAMwY,KAAQhP,EAAeS,KAAKy1B,EAAWnC,IAChD/kB,EAAK5b,UAAU2Q,IAAIkB,GAGzB,CAEA2wB,kBAAkBpsB,GAChBA,EAAOpW,UAAUlC,OAAO+T,IAExB,MAAMkxB,EAAcn2B,EAAevH,KAAM,GAAEo7B,MAAyB5uB,KAAqBuE,GACzF,IAAK,MAAMuD,KAAQopB,EACjBppB,EAAK3Z,UAAUlC,OAAO+T,GAE1B,CAGA,sBAAOjQ,CAAgB+I,GACrB,OAAOxE,KAAKyI,MAAK,WACf,MAAMC,EAAOkyB,GAAUz0B,oBAAoBnG,KAAMwE,GAEjD,GAAsB,iBAAXA,EAAX,CAIA,QAAqBmE,IAAjBD,EAAKlE,IAAyBA,EAAO/C,WAAW,MAAmB,gBAAX+C,EAC1D,MAAM,IAAIa,UAAW,oBAAmBb,MAG1CkE,EAAKlE,IANL,CAOF,GACF,EAOFjE,EAAac,GAAGrJ,OAAQuT,IAAqB,KAC3C,IAAK,MAAMsxB,KAAOp2B,EAAevH,KA9PT,0BA+PtB07B,GAAUz0B,oBAAoB02B,EAChC,IAOF5hC,EAAmB2/B,ICnRnB,MAEM/0B,GAAa,UAEb8J,GAAc,OAAM9J,KACpB+J,GAAgB,SAAQ/J,KACxB4J,GAAc,OAAM5J,KACpB6J,GAAe,QAAO7J,KACtB2F,GAAwB,QAAO3F,KAC/BsF,GAAiB,UAAStF,KAC1B0F,GAAuB,OAAM1F,KAE7Bi3B,GAAiB,YACjBC,GAAkB,aAClB5S,GAAe,UACfC,GAAiB,YACjB4S,GAAW,OACXC,GAAU,MAEVvxB,GAAoB,SACpB6qB,GAAkB,OAClB1mB,GAAkB,OAKlBqtB,GAA+B,yBAK/Bt0B,GAAuB,2EACvBu0B,GAAuB,YAFMD,uBAAiDA,mBAA6CA,OAE/Et0B,KAE5Cw0B,GAA+B,IAAG1xB,8BAA6CA,+BAA8CA,4BAMnI,MAAM2xB,WAAY93B,EAChBV,YAAY9N,GACVyO,MAAMzO,GACNiJ,KAAKorB,QAAUprB,KAAKyF,SAASlM,QAfN,uCAiBlByG,KAAKorB,UAOVprB,KAAKs9B,sBAAsBt9B,KAAKorB,QAASprB,KAAKu9B,gBAE9Ch9B,EAAac,GAAGrB,KAAKyF,SAAU0F,IAAehM,GAASa,KAAK+N,SAAS5O,KACvE,CAGA,eAAW7D,GACT,MA3DS,KA4DX,CAGAuV,OACE,MAAM2sB,EAAYx9B,KAAKyF,SACvB,GAAIzF,KAAKy9B,cAAcD,GACrB,OAIF,MAAME,EAAS19B,KAAK29B,iBAEdC,EAAYF,EAChBn9B,EAAasB,QAAQ67B,EAAQ/tB,GAAY,CAAE9P,cAAe29B,IAC1D,KAEgBj9B,EAAasB,QAAQ27B,EAAW/tB,GAAY,CAAE5P,cAAe69B,IAEjEz7B,kBAAqB27B,GAAaA,EAAU37B,mBAI1DjC,KAAK69B,YAAYH,EAAQF,GACzBx9B,KAAK89B,UAAUN,EAAWE,GAC5B,CAGAI,UAAU/mC,EAASgnC,GACZhnC,IAILA,EAAQ8C,UAAU2Q,IAAIkB,IAEtB1L,KAAK89B,UAAUr3B,EAAeoB,uBAAuB9Q,IAgBrDiJ,KAAKgG,gBAdYqL,KACsB,QAAjCta,EAAQkD,aAAa,SAKzBlD,EAAQ2M,gBAAgB,YACxB3M,EAAQyM,aAAa,iBAAiB,GACtCxD,KAAKg+B,gBAAgBjnC,GAAS,GAC9BwJ,EAAasB,QAAQ9K,EAAS2Y,GAAa,CACzC7P,cAAek+B,KARfhnC,EAAQ8C,UAAU2Q,IAAIqF,GAStB,GAG0B9Y,EAASA,EAAQ8C,UAAUC,SAASy8B,KACpE,CAEAsH,YAAY9mC,EAASgnC,GACdhnC,IAILA,EAAQ8C,UAAUlC,OAAO+T,IACzB3U,EAAQk7B,OAERjyB,KAAK69B,YAAYp3B,EAAeoB,uBAAuB9Q,IAcvDiJ,KAAKgG,gBAZYqL,KACsB,QAAjCta,EAAQkD,aAAa,SAKzBlD,EAAQyM,aAAa,iBAAiB,GACtCzM,EAAQyM,aAAa,WAAY,MACjCxD,KAAKg+B,gBAAgBjnC,GAAS,GAC9BwJ,EAAasB,QAAQ9K,EAAS6Y,GAAc,CAAE/P,cAAek+B,KAP3DhnC,EAAQ8C,UAAUlC,OAAOkY,GAOgD,GAG/C9Y,EAASA,EAAQ8C,UAAUC,SAASy8B,KACpE,CAEAxoB,SAAS5O,GACP,IAAM,CAAC29B,GAAgBC,GAAiB5S,GAAcC,GAAgB4S,GAAUC,IAAS77B,SAASjC,EAAMnI,KACtG,OAGFmI,EAAM4tB,kBACN5tB,EAAMoD,iBAEN,MAAMsE,EAAW7G,KAAKu9B,eAAex5B,QAAOhN,IAAY2C,EAAW3C,KACnE,IAAIknC,EAEJ,GAAI,CAACjB,GAAUC,IAAS77B,SAASjC,EAAMnI,KACrCinC,EAAoBp3B,EAAS1H,EAAMnI,MAAQgmC,GAAW,EAAIn2B,EAAS/N,OAAS,OACvE,CACL,MAAM6V,EAAS,CAACouB,GAAiB3S,IAAgBhpB,SAASjC,EAAMnI,KAChEinC,EAAoB7gC,EAAqByJ,EAAU1H,EAAMlC,OAAQ0R,GAAQ,EAC3E,CAEIsvB,IACFA,EAAkBxS,MAAM,CAAEyS,eAAe,IACzCb,GAAIl3B,oBAAoB83B,GAAmBptB,OAE/C,CAEA0sB,eACE,OAAO92B,EAAevH,KAAKi+B,GAAqBn9B,KAAKorB,QACvD,CAEAuS,iBACE,OAAO39B,KAAKu9B,eAAer+B,MAAK4H,GAAS9G,KAAKy9B,cAAc32B,MAAW,IACzE,CAEAw2B,sBAAsBrtB,EAAQpJ,GAC5B7G,KAAKm+B,yBAAyBluB,EAAQ,OAAQ,WAE9C,IAAK,MAAMnJ,KAASD,EAClB7G,KAAKo+B,6BAA6Bt3B,EAEtC,CAEAs3B,6BAA6Bt3B,GAC3BA,EAAQ9G,KAAKq+B,iBAAiBv3B,GAC9B,MAAMw3B,EAAWt+B,KAAKy9B,cAAc32B,GAC9By3B,EAAYv+B,KAAKw+B,iBAAiB13B,GACxCA,EAAMtD,aAAa,gBAAiB86B,GAEhCC,IAAcz3B,GAChB9G,KAAKm+B,yBAAyBI,EAAW,OAAQ,gBAG9CD,GACHx3B,EAAMtD,aAAa,WAAY,MAGjCxD,KAAKm+B,yBAAyBr3B,EAAO,OAAQ,OAG7C9G,KAAKy+B,mCAAmC33B,EAC1C,CAEA23B,mCAAmC33B,GACjC,MAAM7J,EAASwJ,EAAeoB,uBAAuBf,GAEhD7J,IAIL+C,KAAKm+B,yBAAyBlhC,EAAQ,OAAQ,YAE1C6J,EAAMzO,IACR2H,KAAKm+B,yBAAyBlhC,EAAQ,kBAAoB,GAAE6J,EAAMzO,MAEtE,CAEA2lC,gBAAgBjnC,EAAS2nC,GACvB,MAAMH,EAAYv+B,KAAKw+B,iBAAiBznC,GACxC,IAAKwnC,EAAU1kC,UAAUC,SAhMN,YAiMjB,OAGF,MAAMgP,EAASA,CAAC/Q,EAAUk1B,KACxB,MAAMl2B,EAAU0P,EAAeG,QAAQ7O,EAAUwmC,GAC7CxnC,GACFA,EAAQ8C,UAAUiP,OAAOmkB,EAAWyR,EACtC,EAGF51B,EAzM6B,mBAyMI4C,IACjC5C,EAzM2B,iBAyMI+G,IAC/B0uB,EAAU/6B,aAAa,gBAAiBk7B,EAC1C,CAEAP,yBAAyBpnC,EAASie,EAAWtS,GACtC3L,EAAQiD,aAAagb,IACxBje,EAAQyM,aAAawR,EAAWtS,EAEpC,CAEA+6B,cAAcntB,GACZ,OAAOA,EAAKzW,UAAUC,SAAS4R,GACjC,CAGA2yB,iBAAiB/tB,GACf,OAAOA,EAAKvJ,QAAQo2B,IAAuB7sB,EAAO7J,EAAeG,QAAQu2B,GAAqB7sB,EAChG,CAGAkuB,iBAAiBluB,GACf,OAAOA,EAAK/W,QA1NO,gCA0NoB+W,CACzC,CAGA,sBAAO7U,CAAgB+I,GACrB,OAAOxE,KAAKyI,MAAK,WACf,MAAMC,EAAO20B,GAAIl3B,oBAAoBnG,MAErC,GAAsB,iBAAXwE,EAAX,CAIA,QAAqBmE,IAAjBD,EAAKlE,IAAyBA,EAAO/C,WAAW,MAAmB,gBAAX+C,EAC1D,MAAM,IAAIa,UAAW,oBAAmBb,MAG1CkE,EAAKlE,IANL,CAOF,GACF,EAOFjE,EAAac,GAAGtI,SAAUyS,GAAsB5C,IAAsB,SAAUzJ,GAC1E,CAAC,IAAK,QAAQiC,SAASpB,KAAKmI,UAC9BhJ,EAAMoD,iBAGJ7I,EAAWsG,OAIfq9B,GAAIl3B,oBAAoBnG,MAAM6Q,MAChC,IAKAtQ,EAAac,GAAGrJ,OAAQuT,IAAqB,KAC3C,IAAK,MAAMxU,KAAW0P,EAAevH,KAAKk+B,IACxCC,GAAIl3B,oBAAoBpP,EAC1B,IAMFkE,EAAmBoiC,ICxSnB,MAEMx3B,GAAa,YAEb84B,GAAmB,YAAW94B,KAC9B+4B,GAAkB,WAAU/4B,KAC5B+nB,GAAiB,UAAS/nB,KAC1Bg5B,GAAkB,WAAUh5B,KAC5B8J,GAAc,OAAM9J,KACpB+J,GAAgB,SAAQ/J,KACxB4J,GAAc,OAAM5J,KACpB6J,GAAe,QAAO7J,KAGtBi5B,GAAkB,OAClBjvB,GAAkB,OAClBgiB,GAAqB,UAErBxtB,GAAc,CAClB6yB,UAAW,UACX6H,SAAU,UACV1H,MAAO,UAGHjzB,GAAU,CACd8yB,WAAW,EACX6H,UAAU,EACV1H,MAAO,KAOT,MAAM2H,WAAcz5B,EAClBV,YAAY9N,EAASyN,GACnBgB,MAAMzO,EAASyN,GAEfxE,KAAKy3B,SAAW,KAChBz3B,KAAKi/B,sBAAuB,EAC5Bj/B,KAAKk/B,yBAA0B,EAC/Bl/B,KAAK+3B,eACP,CAGA,kBAAW3zB,GACT,OAAOA,EACT,CAEA,sBAAWC,GACT,OAAOA,EACT,CAEA,eAAW/I,GACT,MAtDS,OAuDX,CAGAuV,OACoBtQ,EAAasB,QAAQ7B,KAAKyF,SAAUgK,IAExCxN,mBAIdjC,KAAKm/B,gBAEDn/B,KAAK0F,QAAQwxB,WACfl3B,KAAKyF,SAAS5L,UAAU2Q,IAvDN,QAiEpBxK,KAAKyF,SAAS5L,UAAUlC,OAAOmnC,IAC/BrkC,EAAOuF,KAAKyF,UACZzF,KAAKyF,SAAS5L,UAAU2Q,IAAIqF,GAAiBgiB,IAE7C7xB,KAAKgG,gBAXYqL,KACfrR,KAAKyF,SAAS5L,UAAUlC,OAAOk6B,IAC/BtxB,EAAasB,QAAQ7B,KAAKyF,SAAUiK,IAEpC1P,KAAKo/B,oBAAoB,GAOGp/B,KAAKyF,SAAUzF,KAAK0F,QAAQwxB,WAC5D,CAEAtmB,OACO5Q,KAAKq/B,YAIQ9+B,EAAasB,QAAQ7B,KAAKyF,SAAUkK,IAExC1N,mBAUdjC,KAAKyF,SAAS5L,UAAU2Q,IAAIqnB,IAC5B7xB,KAAKgG,gBAPYqL,KACfrR,KAAKyF,SAAS5L,UAAU2Q,IAAIs0B,IAC5B9+B,KAAKyF,SAAS5L,UAAUlC,OAAOk6B,GAAoBhiB,IACnDtP,EAAasB,QAAQ7B,KAAKyF,SAAUmK,GAAa,GAIrB5P,KAAKyF,SAAUzF,KAAK0F,QAAQwxB,YAC5D,CAEAtxB,UACE5F,KAAKm/B,gBAEDn/B,KAAKq/B,WACPr/B,KAAKyF,SAAS5L,UAAUlC,OAAOkY,IAGjCrK,MAAMI,SACR,CAEAy5B,UACE,OAAOr/B,KAAKyF,SAAS5L,UAAUC,SAAS+V,GAC1C,CAIAuvB,qBACOp/B,KAAK0F,QAAQq5B,WAId/+B,KAAKi/B,sBAAwBj/B,KAAKk/B,0BAItCl/B,KAAKy3B,SAAWt6B,YAAW,KACzB6C,KAAK4Q,MAAM,GACV5Q,KAAK0F,QAAQ2xB,QAClB,CAEAiI,eAAengC,EAAOogC,GACpB,OAAQpgC,EAAMsB,MACZ,IAAK,YACL,IAAK,WACHT,KAAKi/B,qBAAuBM,EAC5B,MAGF,IAAK,UACL,IAAK,WACHv/B,KAAKk/B,wBAA0BK,EASnC,GAAIA,EAEF,YADAv/B,KAAKm/B,gBAIP,MAAMvwB,EAAczP,EAAMU,cACtBG,KAAKyF,WAAamJ,GAAe5O,KAAKyF,SAAS3L,SAAS8U,IAI5D5O,KAAKo/B,oBACP,CAEArH,gBACEx3B,EAAac,GAAGrB,KAAKyF,SAAUk5B,IAAiBx/B,GAASa,KAAKs/B,eAAengC,GAAO,KACpFoB,EAAac,GAAGrB,KAAKyF,SAAUm5B,IAAgBz/B,GAASa,KAAKs/B,eAAengC,GAAO,KACnFoB,EAAac,GAAGrB,KAAKyF,SAAUmoB,IAAezuB,GAASa,KAAKs/B,eAAengC,GAAO,KAClFoB,EAAac,GAAGrB,KAAKyF,SAAUo5B,IAAgB1/B,GAASa,KAAKs/B,eAAengC,GAAO,IACrF,CAEAggC,gBACE9wB,aAAarO,KAAKy3B,UAClBz3B,KAAKy3B,SAAW,IAClB,CAGA,sBAAOh8B,CAAgB+I,GACrB,OAAOxE,KAAKyI,MAAK,WACf,MAAMC,EAAOs2B,GAAM74B,oBAAoBnG,KAAMwE,GAE7C,GAAsB,iBAAXA,EAAqB,CAC9B,QAA4B,IAAjBkE,EAAKlE,GACd,MAAM,IAAIa,UAAW,oBAAmBb,MAG1CkE,EAAKlE,GAAQxE,KACf,CACF,GACF,E,OAOF+H,EAAqBi3B,IAMrB/jC,EAAmB+jC,IC1MJ,CACb12B,QACAO,SACA0D,YACA2D,YACAgb,YACAoF,SACA0B,aACAkI,WACAU,aACAyC,OACA2B,SACAzH,W"}
\ No newline at end of file
diff --git a/docs/deps/bootstrap-5.3.1/bootstrap.min.css b/docs/deps/bootstrap-5.3.1/bootstrap.min.css
new file mode 100644
index 0000000..3363cb2
--- /dev/null
+++ b/docs/deps/bootstrap-5.3.1/bootstrap.min.css
@@ -0,0 +1,5 @@
+:root{--bslib-bootstrap-version: 5;--bslib-preset-name: ;--bslib-preset-type: }/*!
+ * Bootstrap v5.3.1 (https://getbootstrap.com/)
+ * Copyright 2011-2023 The Bootstrap Authors
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+ */:root,[data-bs-theme="light"]{--bs-blue: #0d6efd;--bs-indigo: #6610f2;--bs-purple: #6f42c1;--bs-pink: #d63384;--bs-red: #dc3545;--bs-orange: #fd7e14;--bs-yellow: #ffc107;--bs-green: #198754;--bs-teal: #20c997;--bs-cyan: #0dcaf0;--bs-black: #000;--bs-white: #fff;--bs-gray: #6c757d;--bs-gray-dark: #343a40;--bs-gray-100: #f8f9fa;--bs-gray-200: #e9ecef;--bs-gray-300: #dee2e6;--bs-gray-400: #ced4da;--bs-gray-500: #adb5bd;--bs-gray-600: #6c757d;--bs-gray-700: #495057;--bs-gray-800: #343a40;--bs-gray-900: #212529;--bs-default: #dee2e6;--bs-primary: #0d6efd;--bs-secondary: #6c757d;--bs-success: #198754;--bs-info: #0dcaf0;--bs-warning: #ffc107;--bs-danger: #dc3545;--bs-light: #f8f9fa;--bs-dark: #212529;--bs-default-rgb: 222,226,230;--bs-primary-rgb: 13,110,253;--bs-secondary-rgb: 108,117,125;--bs-success-rgb: 25,135,84;--bs-info-rgb: 13,202,240;--bs-warning-rgb: 255,193,7;--bs-danger-rgb: 220,53,69;--bs-light-rgb: 248,249,250;--bs-dark-rgb: 33,37,41;--bs-primary-text-emphasis: #052c65;--bs-secondary-text-emphasis: #2b2f32;--bs-success-text-emphasis: #0a3622;--bs-info-text-emphasis: #055160;--bs-warning-text-emphasis: #664d03;--bs-danger-text-emphasis: #58151c;--bs-light-text-emphasis: #495057;--bs-dark-text-emphasis: #495057;--bs-primary-bg-subtle: #cfe2ff;--bs-secondary-bg-subtle: #e2e3e5;--bs-success-bg-subtle: #d1e7dd;--bs-info-bg-subtle: #cff4fc;--bs-warning-bg-subtle: #fff3cd;--bs-danger-bg-subtle: #f8d7da;--bs-light-bg-subtle: #fcfcfd;--bs-dark-bg-subtle: #ced4da;--bs-primary-border-subtle: #9ec5fe;--bs-secondary-border-subtle: #c4c8cb;--bs-success-border-subtle: #a3cfbb;--bs-info-border-subtle: #9eeaf9;--bs-warning-border-subtle: #ffe69c;--bs-danger-border-subtle: #f1aeb5;--bs-light-border-subtle: #e9ecef;--bs-dark-border-subtle: #adb5bd;--bs-white-rgb: 255,255,255;--bs-black-rgb: 0,0,0;--bs-font-sans-serif: system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";--bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;--bs-gradient: linear-gradient(180deg, rgba(255,255,255,0.15), rgba(255,255,255,0));--bs-body-font-family: var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight: 400;--bs-body-line-height: 1.5;--bs-body-color: #212529;--bs-body-color-rgb: 33,37,41;--bs-body-bg: #fff;--bs-body-bg-rgb: 255,255,255;--bs-emphasis-color: #000;--bs-emphasis-color-rgb: 0,0,0;--bs-secondary-color: rgba(33,37,41,0.75);--bs-secondary-color-rgb: 33,37,41;--bs-secondary-bg: #e9ecef;--bs-secondary-bg-rgb: 233,236,239;--bs-tertiary-color: rgba(33,37,41,0.5);--bs-tertiary-color-rgb: 33,37,41;--bs-tertiary-bg: #f8f9fa;--bs-tertiary-bg-rgb: 248,249,250;--bs-heading-color: inherit;--bs-link-color: #0d6efd;--bs-link-color-rgb: 13,110,253;--bs-link-decoration: underline;--bs-link-hover-color: #0a58ca;--bs-link-hover-color-rgb: 10,88,202;--bs-code-color: RGB(var(--bs-emphasis-color-rgb, 0, 0, 0));--bs-highlight-bg: #fff3cd;--bs-border-width: 1px;--bs-border-style: solid;--bs-border-color: #dee2e6;--bs-border-color-translucent: rgba(0,0,0,0.175);--bs-border-radius: .375rem;--bs-border-radius-sm: .25rem;--bs-border-radius-lg: .5rem;--bs-border-radius-xl: 1rem;--bs-border-radius-xxl: 2rem;--bs-border-radius-2xl: var(--bs-border-radius-xxl);--bs-border-radius-pill: 50rem;--bs-box-shadow: 0 0.5rem 1rem rgba(0,0,0,0.15);--bs-box-shadow-sm: 0 0.125rem 0.25rem rgba(0,0,0,0.075);--bs-box-shadow-lg: 0 1rem 3rem rgba(0,0,0,0.175);--bs-box-shadow-inset: inset 0 1px 2px rgba(0,0,0,0.075);--bs-focus-ring-width: .25rem;--bs-focus-ring-opacity: .25;--bs-focus-ring-color: rgba(13,110,253,0.25);--bs-form-valid-color: #198754;--bs-form-valid-border-color: #198754;--bs-form-invalid-color: #dc3545;--bs-form-invalid-border-color: #dc3545}[data-bs-theme="dark"]{color-scheme:dark;--bs-body-color: #dee2e6;--bs-body-color-rgb: 222,226,230;--bs-body-bg: #212529;--bs-body-bg-rgb: 33,37,41;--bs-emphasis-color: #fff;--bs-emphasis-color-rgb: 255,255,255;--bs-secondary-color: rgba(222,226,230,0.75);--bs-secondary-color-rgb: 222,226,230;--bs-secondary-bg: #343a40;--bs-secondary-bg-rgb: 52,58,64;--bs-tertiary-color: rgba(222,226,230,0.5);--bs-tertiary-color-rgb: 222,226,230;--bs-tertiary-bg: #2b3035;--bs-tertiary-bg-rgb: 43,48,53;--bs-primary-text-emphasis: #6ea8fe;--bs-secondary-text-emphasis: #a7acb1;--bs-success-text-emphasis: #75b798;--bs-info-text-emphasis: #6edff6;--bs-warning-text-emphasis: #ffda6a;--bs-danger-text-emphasis: #ea868f;--bs-light-text-emphasis: #f8f9fa;--bs-dark-text-emphasis: #dee2e6;--bs-primary-bg-subtle: #031633;--bs-secondary-bg-subtle: #161719;--bs-success-bg-subtle: #051b11;--bs-info-bg-subtle: #032830;--bs-warning-bg-subtle: #332701;--bs-danger-bg-subtle: #2c0b0e;--bs-light-bg-subtle: #343a40;--bs-dark-bg-subtle: #1a1d20;--bs-primary-border-subtle: #084298;--bs-secondary-border-subtle: #41464b;--bs-success-border-subtle: #0f5132;--bs-info-border-subtle: #087990;--bs-warning-border-subtle: #997404;--bs-danger-border-subtle: #842029;--bs-light-border-subtle: #495057;--bs-dark-border-subtle: #343a40;--bs-heading-color: inherit;--bs-link-color: #6ea8fe;--bs-link-hover-color: #8bb9fe;--bs-link-color-rgb: 110,168,254;--bs-link-hover-color-rgb: 139,185,254;--bs-code-color: RGB(var(--bs-emphasis-color-rgb, 0, 0, 0));--bs-border-color: #495057;--bs-border-color-translucent: rgba(255,255,255,0.15);--bs-form-valid-color: #75b798;--bs-form-valid-border-color: #75b798;--bs-form-invalid-color: #ea868f;--bs-form-invalid-border-color: #ea868f}*,*::before,*::after{box-sizing:border-box}@media (prefers-reduced-motion: no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:rgba(0,0,0,0)}hr{margin:1rem 0;color:inherit;border:0;border-top:var(--bs-border-width) solid;opacity:.25}h6,.h6,h5,.h5,h4,.h4,h3,.h3,h2,.h2,h1,.h1{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2;color:var(--bs-heading-color)}h1,.h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width: 1200px){h1,.h1{font-size:2.5rem}}h2,.h2{font-size:calc(1.325rem + .9vw)}@media (min-width: 1200px){h2,.h2{font-size:2rem}}h3,.h3{font-size:calc(1.3rem + .6vw)}@media (min-width: 1200px){h3,.h3{font-size:1.75rem}}h4,.h4{font-size:calc(1.275rem + .3vw)}@media (min-width: 1200px){h4,.h4{font-size:1.5rem}}h5,.h5{font-size:1.25rem}h6,.h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{text-decoration:underline dotted;-webkit-text-decoration:underline dotted;-moz-text-decoration:underline dotted;-ms-text-decoration:underline dotted;-o-text-decoration:underline dotted;cursor:help;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}ol,ul,dl{margin-top:0;margin-bottom:1rem}ol ol,ul ul,ol ul,ul ol{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem;padding:.625rem 1.25rem;border-left:.25rem solid #e9ecef}blockquote p:last-child,blockquote ul:last-child,blockquote ol:last-child{margin-bottom:0}b,strong{font-weight:bolder}small,.small{font-size:.875em}mark,.mark{padding:.1875em;background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 1));text-decoration:underline;-webkit-text-decoration:underline;-moz-text-decoration:underline;-ms-text-decoration:underline;-o-text-decoration:underline}a:hover{--bs-link-color-rgb: var(--bs-link-hover-color-rgb)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}pre,code,kbd,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em;color:RGB(var(--bs-emphasis-color-rgb, 0, 0, 0));background-color:RGBA(var(--bs-emphasis-color-rgb, 0, 0, 0), 0.04);padding:.5rem;border:1px solid var(--bs-border-color, #dee2e6);border-radius:.375rem}pre code{background-color:transparent;font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);background-color:RGBA(var(--bs-emphasis-color-rgb, 0, 0, 0), 0.04);border-radius:.375rem;padding:.125rem .25rem;word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-secondary-color);text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}thead,tbody,tfoot,tr,td,th{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}input,button,select,optgroup,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role="button"]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type="date"]):not([type="datetime-local"]):not([type="month"]):not([type="week"]):not([type="time"])::-webkit-calendar-picker-indicator{display:none !important}button,[type="button"],[type="reset"],[type="submit"]{-webkit-appearance:button}button:not(:disabled),[type="button"]:not(:disabled),[type="reset"]:not(:disabled),[type="submit"]:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width: 1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-text,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type="search"]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none !important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width: 1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width: 1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width: 1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width: 1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width: 1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width: 1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"\2014\00A0"}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:var(--bs-body-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:var(--bs-secondary-color)}.container,.container-fluid,.container-xxl,.container-xl,.container-lg,.container-md,.container-sm{--bs-gutter-x: 1.5rem;--bs-gutter-y: 0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width: 576px){.container-sm,.container{max-width:540px}}@media (min-width: 768px){.container-md,.container-sm,.container{max-width:720px}}@media (min-width: 992px){.container-lg,.container-md,.container-sm,.container{max-width:960px}}@media (min-width: 1200px){.container-xl,.container-lg,.container-md,.container-sm,.container{max-width:1140px}}@media (min-width: 1400px){.container-xxl,.container-xl,.container-lg,.container-md,.container-sm,.container{max-width:1320px}}:root{--bs-breakpoint-xs: 0;--bs-breakpoint-sm: 576px;--bs-breakpoint-md: 768px;--bs-breakpoint-lg: 992px;--bs-breakpoint-xl: 1200px;--bs-breakpoint-xxl: 1400px}.row{--bs-gutter-x: 1.5rem;--bs-gutter-y: 0;display:flex;display:-webkit-flex;flex-wrap:wrap;-webkit-flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;-webkit-flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.grid{display:grid;grid-template-rows:repeat(var(--bs-rows, 1), 1fr);grid-template-columns:repeat(var(--bs-columns, 12), 1fr);gap:var(--bs-gap, 1.5rem)}.grid .g-col-1{grid-column:auto/span 1}.grid .g-col-2{grid-column:auto/span 2}.grid .g-col-3{grid-column:auto/span 3}.grid .g-col-4{grid-column:auto/span 4}.grid .g-col-5{grid-column:auto/span 5}.grid .g-col-6{grid-column:auto/span 6}.grid .g-col-7{grid-column:auto/span 7}.grid .g-col-8{grid-column:auto/span 8}.grid .g-col-9{grid-column:auto/span 9}.grid .g-col-10{grid-column:auto/span 10}.grid .g-col-11{grid-column:auto/span 11}.grid .g-col-12{grid-column:auto/span 12}.grid .g-start-1{grid-column-start:1}.grid .g-start-2{grid-column-start:2}.grid .g-start-3{grid-column-start:3}.grid .g-start-4{grid-column-start:4}.grid .g-start-5{grid-column-start:5}.grid .g-start-6{grid-column-start:6}.grid .g-start-7{grid-column-start:7}.grid .g-start-8{grid-column-start:8}.grid .g-start-9{grid-column-start:9}.grid .g-start-10{grid-column-start:10}.grid .g-start-11{grid-column-start:11}@media (min-width: 576px){.grid .g-col-sm-1{grid-column:auto/span 1}.grid .g-col-sm-2{grid-column:auto/span 2}.grid .g-col-sm-3{grid-column:auto/span 3}.grid .g-col-sm-4{grid-column:auto/span 4}.grid .g-col-sm-5{grid-column:auto/span 5}.grid .g-col-sm-6{grid-column:auto/span 6}.grid .g-col-sm-7{grid-column:auto/span 7}.grid .g-col-sm-8{grid-column:auto/span 8}.grid .g-col-sm-9{grid-column:auto/span 9}.grid .g-col-sm-10{grid-column:auto/span 10}.grid .g-col-sm-11{grid-column:auto/span 11}.grid .g-col-sm-12{grid-column:auto/span 12}.grid .g-start-sm-1{grid-column-start:1}.grid .g-start-sm-2{grid-column-start:2}.grid .g-start-sm-3{grid-column-start:3}.grid .g-start-sm-4{grid-column-start:4}.grid .g-start-sm-5{grid-column-start:5}.grid .g-start-sm-6{grid-column-start:6}.grid .g-start-sm-7{grid-column-start:7}.grid .g-start-sm-8{grid-column-start:8}.grid .g-start-sm-9{grid-column-start:9}.grid .g-start-sm-10{grid-column-start:10}.grid .g-start-sm-11{grid-column-start:11}}@media (min-width: 768px){.grid .g-col-md-1{grid-column:auto/span 1}.grid .g-col-md-2{grid-column:auto/span 2}.grid .g-col-md-3{grid-column:auto/span 3}.grid .g-col-md-4{grid-column:auto/span 4}.grid .g-col-md-5{grid-column:auto/span 5}.grid .g-col-md-6{grid-column:auto/span 6}.grid .g-col-md-7{grid-column:auto/span 7}.grid .g-col-md-8{grid-column:auto/span 8}.grid .g-col-md-9{grid-column:auto/span 9}.grid .g-col-md-10{grid-column:auto/span 10}.grid .g-col-md-11{grid-column:auto/span 11}.grid .g-col-md-12{grid-column:auto/span 12}.grid .g-start-md-1{grid-column-start:1}.grid .g-start-md-2{grid-column-start:2}.grid .g-start-md-3{grid-column-start:3}.grid .g-start-md-4{grid-column-start:4}.grid .g-start-md-5{grid-column-start:5}.grid .g-start-md-6{grid-column-start:6}.grid .g-start-md-7{grid-column-start:7}.grid .g-start-md-8{grid-column-start:8}.grid .g-start-md-9{grid-column-start:9}.grid .g-start-md-10{grid-column-start:10}.grid .g-start-md-11{grid-column-start:11}}@media (min-width: 992px){.grid .g-col-lg-1{grid-column:auto/span 1}.grid .g-col-lg-2{grid-column:auto/span 2}.grid .g-col-lg-3{grid-column:auto/span 3}.grid .g-col-lg-4{grid-column:auto/span 4}.grid .g-col-lg-5{grid-column:auto/span 5}.grid .g-col-lg-6{grid-column:auto/span 6}.grid .g-col-lg-7{grid-column:auto/span 7}.grid .g-col-lg-8{grid-column:auto/span 8}.grid .g-col-lg-9{grid-column:auto/span 9}.grid .g-col-lg-10{grid-column:auto/span 10}.grid .g-col-lg-11{grid-column:auto/span 11}.grid .g-col-lg-12{grid-column:auto/span 12}.grid .g-start-lg-1{grid-column-start:1}.grid .g-start-lg-2{grid-column-start:2}.grid .g-start-lg-3{grid-column-start:3}.grid .g-start-lg-4{grid-column-start:4}.grid .g-start-lg-5{grid-column-start:5}.grid .g-start-lg-6{grid-column-start:6}.grid .g-start-lg-7{grid-column-start:7}.grid .g-start-lg-8{grid-column-start:8}.grid .g-start-lg-9{grid-column-start:9}.grid .g-start-lg-10{grid-column-start:10}.grid .g-start-lg-11{grid-column-start:11}}@media (min-width: 1200px){.grid .g-col-xl-1{grid-column:auto/span 1}.grid .g-col-xl-2{grid-column:auto/span 2}.grid .g-col-xl-3{grid-column:auto/span 3}.grid .g-col-xl-4{grid-column:auto/span 4}.grid .g-col-xl-5{grid-column:auto/span 5}.grid .g-col-xl-6{grid-column:auto/span 6}.grid .g-col-xl-7{grid-column:auto/span 7}.grid .g-col-xl-8{grid-column:auto/span 8}.grid .g-col-xl-9{grid-column:auto/span 9}.grid .g-col-xl-10{grid-column:auto/span 10}.grid .g-col-xl-11{grid-column:auto/span 11}.grid .g-col-xl-12{grid-column:auto/span 12}.grid .g-start-xl-1{grid-column-start:1}.grid .g-start-xl-2{grid-column-start:2}.grid .g-start-xl-3{grid-column-start:3}.grid .g-start-xl-4{grid-column-start:4}.grid .g-start-xl-5{grid-column-start:5}.grid .g-start-xl-6{grid-column-start:6}.grid .g-start-xl-7{grid-column-start:7}.grid .g-start-xl-8{grid-column-start:8}.grid .g-start-xl-9{grid-column-start:9}.grid .g-start-xl-10{grid-column-start:10}.grid .g-start-xl-11{grid-column-start:11}}@media (min-width: 1400px){.grid .g-col-xxl-1{grid-column:auto/span 1}.grid .g-col-xxl-2{grid-column:auto/span 2}.grid .g-col-xxl-3{grid-column:auto/span 3}.grid .g-col-xxl-4{grid-column:auto/span 4}.grid .g-col-xxl-5{grid-column:auto/span 5}.grid .g-col-xxl-6{grid-column:auto/span 6}.grid .g-col-xxl-7{grid-column:auto/span 7}.grid .g-col-xxl-8{grid-column:auto/span 8}.grid .g-col-xxl-9{grid-column:auto/span 9}.grid .g-col-xxl-10{grid-column:auto/span 10}.grid .g-col-xxl-11{grid-column:auto/span 11}.grid .g-col-xxl-12{grid-column:auto/span 12}.grid .g-start-xxl-1{grid-column-start:1}.grid .g-start-xxl-2{grid-column-start:2}.grid .g-start-xxl-3{grid-column-start:3}.grid .g-start-xxl-4{grid-column-start:4}.grid .g-start-xxl-5{grid-column-start:5}.grid .g-start-xxl-6{grid-column-start:6}.grid .g-start-xxl-7{grid-column-start:7}.grid .g-start-xxl-8{grid-column-start:8}.grid .g-start-xxl-9{grid-column-start:9}.grid .g-start-xxl-10{grid-column-start:10}.grid .g-start-xxl-11{grid-column-start:11}}.col{flex:1 0 0%;-webkit-flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:33.33333%}.row-cols-4>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:16.66667%}.col-auto{flex:0 0 auto;-webkit-flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;-webkit-flex:0 0 auto;width:8.33333%}.col-2{flex:0 0 auto;-webkit-flex:0 0 auto;width:16.66667%}.col-3{flex:0 0 auto;-webkit-flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;-webkit-flex:0 0 auto;width:33.33333%}.col-5{flex:0 0 auto;-webkit-flex:0 0 auto;width:41.66667%}.col-6{flex:0 0 auto;-webkit-flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;-webkit-flex:0 0 auto;width:58.33333%}.col-8{flex:0 0 auto;-webkit-flex:0 0 auto;width:66.66667%}.col-9{flex:0 0 auto;-webkit-flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;-webkit-flex:0 0 auto;width:83.33333%}.col-11{flex:0 0 auto;-webkit-flex:0 0 auto;width:91.66667%}.col-12{flex:0 0 auto;-webkit-flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333%}.offset-2{margin-left:16.66667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333%}.offset-5{margin-left:41.66667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333%}.offset-8{margin-left:66.66667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333%}.offset-11{margin-left:91.66667%}.g-0,.gx-0{--bs-gutter-x: 0}.g-0,.gy-0{--bs-gutter-y: 0}.g-1,.gx-1{--bs-gutter-x: .25rem}.g-1,.gy-1{--bs-gutter-y: .25rem}.g-2,.gx-2{--bs-gutter-x: .5rem}.g-2,.gy-2{--bs-gutter-y: .5rem}.g-3,.gx-3{--bs-gutter-x: 1rem}.g-3,.gy-3{--bs-gutter-y: 1rem}.g-4,.gx-4{--bs-gutter-x: 1.5rem}.g-4,.gy-4{--bs-gutter-y: 1.5rem}.g-5,.gx-5{--bs-gutter-x: 3rem}.g-5,.gy-5{--bs-gutter-y: 3rem}@media (min-width: 576px){.col-sm{flex:1 0 0%;-webkit-flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:33.33333%}.row-cols-sm-4>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:16.66667%}.col-sm-auto{flex:0 0 auto;-webkit-flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;-webkit-flex:0 0 auto;width:8.33333%}.col-sm-2{flex:0 0 auto;-webkit-flex:0 0 auto;width:16.66667%}.col-sm-3{flex:0 0 auto;-webkit-flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;-webkit-flex:0 0 auto;width:33.33333%}.col-sm-5{flex:0 0 auto;-webkit-flex:0 0 auto;width:41.66667%}.col-sm-6{flex:0 0 auto;-webkit-flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;-webkit-flex:0 0 auto;width:58.33333%}.col-sm-8{flex:0 0 auto;-webkit-flex:0 0 auto;width:66.66667%}.col-sm-9{flex:0 0 auto;-webkit-flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;-webkit-flex:0 0 auto;width:83.33333%}.col-sm-11{flex:0 0 auto;-webkit-flex:0 0 auto;width:91.66667%}.col-sm-12{flex:0 0 auto;-webkit-flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333%}.offset-sm-2{margin-left:16.66667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333%}.offset-sm-5{margin-left:41.66667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333%}.offset-sm-8{margin-left:66.66667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333%}.offset-sm-11{margin-left:91.66667%}.g-sm-0,.gx-sm-0{--bs-gutter-x: 0}.g-sm-0,.gy-sm-0{--bs-gutter-y: 0}.g-sm-1,.gx-sm-1{--bs-gutter-x: .25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y: .25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x: .5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y: .5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x: 1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y: 1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x: 1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y: 1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x: 3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y: 3rem}}@media (min-width: 768px){.col-md{flex:1 0 0%;-webkit-flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:33.33333%}.row-cols-md-4>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:16.66667%}.col-md-auto{flex:0 0 auto;-webkit-flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;-webkit-flex:0 0 auto;width:8.33333%}.col-md-2{flex:0 0 auto;-webkit-flex:0 0 auto;width:16.66667%}.col-md-3{flex:0 0 auto;-webkit-flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;-webkit-flex:0 0 auto;width:33.33333%}.col-md-5{flex:0 0 auto;-webkit-flex:0 0 auto;width:41.66667%}.col-md-6{flex:0 0 auto;-webkit-flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;-webkit-flex:0 0 auto;width:58.33333%}.col-md-8{flex:0 0 auto;-webkit-flex:0 0 auto;width:66.66667%}.col-md-9{flex:0 0 auto;-webkit-flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;-webkit-flex:0 0 auto;width:83.33333%}.col-md-11{flex:0 0 auto;-webkit-flex:0 0 auto;width:91.66667%}.col-md-12{flex:0 0 auto;-webkit-flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333%}.offset-md-2{margin-left:16.66667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333%}.offset-md-5{margin-left:41.66667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333%}.offset-md-8{margin-left:66.66667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333%}.offset-md-11{margin-left:91.66667%}.g-md-0,.gx-md-0{--bs-gutter-x: 0}.g-md-0,.gy-md-0{--bs-gutter-y: 0}.g-md-1,.gx-md-1{--bs-gutter-x: .25rem}.g-md-1,.gy-md-1{--bs-gutter-y: .25rem}.g-md-2,.gx-md-2{--bs-gutter-x: .5rem}.g-md-2,.gy-md-2{--bs-gutter-y: .5rem}.g-md-3,.gx-md-3{--bs-gutter-x: 1rem}.g-md-3,.gy-md-3{--bs-gutter-y: 1rem}.g-md-4,.gx-md-4{--bs-gutter-x: 1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y: 1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x: 3rem}.g-md-5,.gy-md-5{--bs-gutter-y: 3rem}}@media (min-width: 992px){.col-lg{flex:1 0 0%;-webkit-flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:33.33333%}.row-cols-lg-4>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:16.66667%}.col-lg-auto{flex:0 0 auto;-webkit-flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;-webkit-flex:0 0 auto;width:8.33333%}.col-lg-2{flex:0 0 auto;-webkit-flex:0 0 auto;width:16.66667%}.col-lg-3{flex:0 0 auto;-webkit-flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;-webkit-flex:0 0 auto;width:33.33333%}.col-lg-5{flex:0 0 auto;-webkit-flex:0 0 auto;width:41.66667%}.col-lg-6{flex:0 0 auto;-webkit-flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;-webkit-flex:0 0 auto;width:58.33333%}.col-lg-8{flex:0 0 auto;-webkit-flex:0 0 auto;width:66.66667%}.col-lg-9{flex:0 0 auto;-webkit-flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;-webkit-flex:0 0 auto;width:83.33333%}.col-lg-11{flex:0 0 auto;-webkit-flex:0 0 auto;width:91.66667%}.col-lg-12{flex:0 0 auto;-webkit-flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333%}.offset-lg-2{margin-left:16.66667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333%}.offset-lg-5{margin-left:41.66667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333%}.offset-lg-8{margin-left:66.66667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333%}.offset-lg-11{margin-left:91.66667%}.g-lg-0,.gx-lg-0{--bs-gutter-x: 0}.g-lg-0,.gy-lg-0{--bs-gutter-y: 0}.g-lg-1,.gx-lg-1{--bs-gutter-x: .25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y: .25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x: .5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y: .5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x: 1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y: 1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x: 1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y: 1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x: 3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y: 3rem}}@media (min-width: 1200px){.col-xl{flex:1 0 0%;-webkit-flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:33.33333%}.row-cols-xl-4>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:16.66667%}.col-xl-auto{flex:0 0 auto;-webkit-flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;-webkit-flex:0 0 auto;width:8.33333%}.col-xl-2{flex:0 0 auto;-webkit-flex:0 0 auto;width:16.66667%}.col-xl-3{flex:0 0 auto;-webkit-flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;-webkit-flex:0 0 auto;width:33.33333%}.col-xl-5{flex:0 0 auto;-webkit-flex:0 0 auto;width:41.66667%}.col-xl-6{flex:0 0 auto;-webkit-flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;-webkit-flex:0 0 auto;width:58.33333%}.col-xl-8{flex:0 0 auto;-webkit-flex:0 0 auto;width:66.66667%}.col-xl-9{flex:0 0 auto;-webkit-flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;-webkit-flex:0 0 auto;width:83.33333%}.col-xl-11{flex:0 0 auto;-webkit-flex:0 0 auto;width:91.66667%}.col-xl-12{flex:0 0 auto;-webkit-flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333%}.offset-xl-2{margin-left:16.66667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333%}.offset-xl-5{margin-left:41.66667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333%}.offset-xl-8{margin-left:66.66667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333%}.offset-xl-11{margin-left:91.66667%}.g-xl-0,.gx-xl-0{--bs-gutter-x: 0}.g-xl-0,.gy-xl-0{--bs-gutter-y: 0}.g-xl-1,.gx-xl-1{--bs-gutter-x: .25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y: .25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x: .5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y: .5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x: 1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y: 1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x: 1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y: 1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x: 3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y: 3rem}}@media (min-width: 1400px){.col-xxl{flex:1 0 0%;-webkit-flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:33.33333%}.row-cols-xxl-4>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;-webkit-flex:0 0 auto;width:16.66667%}.col-xxl-auto{flex:0 0 auto;-webkit-flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;-webkit-flex:0 0 auto;width:8.33333%}.col-xxl-2{flex:0 0 auto;-webkit-flex:0 0 auto;width:16.66667%}.col-xxl-3{flex:0 0 auto;-webkit-flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;-webkit-flex:0 0 auto;width:33.33333%}.col-xxl-5{flex:0 0 auto;-webkit-flex:0 0 auto;width:41.66667%}.col-xxl-6{flex:0 0 auto;-webkit-flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;-webkit-flex:0 0 auto;width:58.33333%}.col-xxl-8{flex:0 0 auto;-webkit-flex:0 0 auto;width:66.66667%}.col-xxl-9{flex:0 0 auto;-webkit-flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;-webkit-flex:0 0 auto;width:83.33333%}.col-xxl-11{flex:0 0 auto;-webkit-flex:0 0 auto;width:91.66667%}.col-xxl-12{flex:0 0 auto;-webkit-flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333%}.offset-xxl-2{margin-left:16.66667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333%}.offset-xxl-5{margin-left:41.66667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333%}.offset-xxl-8{margin-left:66.66667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333%}.offset-xxl-11{margin-left:91.66667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x: 0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y: 0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x: .25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y: .25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x: .5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y: .5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x: 1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y: 1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x: 1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y: 1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x: 3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y: 3rem}}.table{--bs-table-color-type: initial;--bs-table-bg-type: initial;--bs-table-color-state: initial;--bs-table-bg-state: initial;--bs-table-color: var(--bs-body-color);--bs-table-bg: var(--bs-body-bg);--bs-table-border-color: var(--bs-border-color);--bs-table-accent-bg: rgba(0,0,0,0);--bs-table-striped-color: var(--bs-body-color);--bs-table-striped-bg: rgba(0,0,0,0.05);--bs-table-active-color: var(--bs-body-color);--bs-table-active-bg: rgba(0,0,0,0.1);--bs-table-hover-color: var(--bs-body-color);--bs-table-hover-bg: rgba(0,0,0,0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;color:var(--bs-table-color-state, var(--bs-table-color-type, var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:var(--bs-border-width);box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state, var(--bs-table-bg-type, var(--bs-table-accent-bg)))}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:calc(var(--bs-border-width) * 2) solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:var(--bs-border-width) 0}.table-bordered>:not(caption)>*>*{border-width:0 var(--bs-border-width)}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-color-type: var(--bs-table-striped-color);--bs-table-bg-type: var(--bs-table-striped-bg)}.table-striped-columns>:not(caption)>tr>:nth-child(even){--bs-table-color-type: var(--bs-table-striped-color);--bs-table-bg-type: var(--bs-table-striped-bg)}.table-active{--bs-table-color-state: var(--bs-table-active-color);--bs-table-bg-state: var(--bs-table-active-bg)}.table-hover>tbody>tr:hover>*{--bs-table-color-state: var(--bs-table-hover-color);--bs-table-bg-state: var(--bs-table-hover-bg)}.table-primary{--bs-table-color: #000;--bs-table-bg: #cfe2ff;--bs-table-border-color: #bacbe6;--bs-table-striped-bg: #c5d7f2;--bs-table-striped-color: #000;--bs-table-active-bg: #bacbe6;--bs-table-active-color: #000;--bs-table-hover-bg: #bfd1ec;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color: #000;--bs-table-bg: #e2e3e5;--bs-table-border-color: #cbccce;--bs-table-striped-bg: #d7d8da;--bs-table-striped-color: #000;--bs-table-active-bg: #cbccce;--bs-table-active-color: #000;--bs-table-hover-bg: #d1d2d4;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color: #000;--bs-table-bg: #d1e7dd;--bs-table-border-color: #bcd0c7;--bs-table-striped-bg: #c7dbd2;--bs-table-striped-color: #000;--bs-table-active-bg: #bcd0c7;--bs-table-active-color: #000;--bs-table-hover-bg: #c1d6cc;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color: #000;--bs-table-bg: #cff4fc;--bs-table-border-color: #badce3;--bs-table-striped-bg: #c5e8ef;--bs-table-striped-color: #000;--bs-table-active-bg: #badce3;--bs-table-active-color: #000;--bs-table-hover-bg: #bfe2e9;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color: #000;--bs-table-bg: #fff3cd;--bs-table-border-color: #e6dbb9;--bs-table-striped-bg: #f2e7c3;--bs-table-striped-color: #000;--bs-table-active-bg: #e6dbb9;--bs-table-active-color: #000;--bs-table-hover-bg: #ece1be;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color: #000;--bs-table-bg: #f8d7da;--bs-table-border-color: #dfc2c4;--bs-table-striped-bg: #eccccf;--bs-table-striped-color: #000;--bs-table-active-bg: #dfc2c4;--bs-table-active-color: #000;--bs-table-hover-bg: #e5c7ca;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color: #000;--bs-table-bg: #f8f9fa;--bs-table-border-color: #dfe0e1;--bs-table-striped-bg: #ecedee;--bs-table-striped-color: #000;--bs-table-active-bg: #dfe0e1;--bs-table-active-color: #000;--bs-table-hover-bg: #e5e6e7;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color: #fff;--bs-table-bg: #212529;--bs-table-border-color: #373b3e;--bs-table-striped-bg: #2c3034;--bs-table-striped-color: #fff;--bs-table-active-bg: #373b3e;--bs-table-active-color: #fff;--bs-table-hover-bg: #323539;--bs-table-hover-color: #fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width: 575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width: 767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width: 991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width: 1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width: 1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label,.shiny-input-container .control-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + var(--bs-border-width));padding-bottom:calc(.375rem + var(--bs-border-width));margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + var(--bs-border-width));padding-bottom:calc(.5rem + var(--bs-border-width));font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + var(--bs-border-width));padding-bottom:calc(.25rem + var(--bs-border-width));font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:var(--bs-secondary-color)}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);appearance:none;-webkit-appearance:none;-moz-appearance:none;-ms-appearance:none;-o-appearance:none;background-color:var(--bs-body-bg);background-clip:padding-box;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.form-control{transition:none}}.form-control[type="file"]{overflow:hidden}.form-control[type="file"]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:var(--bs-body-color);background-color:var(--bs-body-bg);border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,0.25)}.form-control::-webkit-date-and-time-value{min-width:85px;height:1.5em;margin:0}.form-control::-webkit-datetime-edit{display:block;padding:0}.form-control::placeholder{color:var(--bs-secondary-color);opacity:1}.form-control:disabled{background-color:var(--bs-secondary-bg);opacity:1}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:var(--bs-secondary-bg)}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:var(--bs-body-color);background-color:transparent;border:solid transparent;border-width:var(--bs-border-width) 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-sm,.form-control-plaintext.form-control-lg{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2))}textarea.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}textarea.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-control-color{width:3rem;height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2));padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0 !important;border-radius:var(--bs-border-radius)}.form-control-color::-webkit-color-swatch{border:0 !important;border-radius:var(--bs-border-radius)}.form-control-color.form-control-sm{height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-select{--bs-form-select-bg-img: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);appearance:none;-webkit-appearance:none;-moz-appearance:none;-ms-appearance:none;-o-appearance:none;background-color:var(--bs-body-bg);background-image:var(--bs-form-select-bg-img),var(--bs-form-select-bg-icon, none);background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,0.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:var(--bs-secondary-bg)}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 var(--bs-body-color)}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}[data-bs-theme="dark"] .form-select{--bs-form-select-bg-img: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23dee2e6' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e")}.form-check,.shiny-input-container .checkbox,.shiny-input-container .radio{display:block;min-height:1.5rem;padding-left:0;margin-bottom:.125rem}.form-check .form-check-input,.form-check .shiny-input-container .checkbox input,.form-check .shiny-input-container .radio input,.shiny-input-container .checkbox .form-check-input,.shiny-input-container .checkbox .shiny-input-container .checkbox input,.shiny-input-container .checkbox .shiny-input-container .radio input,.shiny-input-container .radio .form-check-input,.shiny-input-container .radio .shiny-input-container .checkbox input,.shiny-input-container .radio .shiny-input-container .radio input{float:left;margin-left:0}.form-check-reverse{padding-right:0;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:0;margin-left:0}.form-check-input,.shiny-input-container .checkbox input,.shiny-input-container .checkbox-inline input,.shiny-input-container .radio input,.shiny-input-container .radio-inline input{--bs-form-check-bg: var(--bs-body-bg);width:1em;height:1em;margin-top:.25em;vertical-align:top;appearance:none;-webkit-appearance:none;-moz-appearance:none;-ms-appearance:none;-o-appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:var(--bs-border-width) solid var(--bs-border-color);print-color-adjust:exact}.form-check-input[type="checkbox"],.shiny-input-container .checkbox input[type="checkbox"],.shiny-input-container .checkbox-inline input[type="checkbox"],.shiny-input-container .radio input[type="checkbox"],.shiny-input-container .radio-inline input[type="checkbox"]{border-radius:.25em}.form-check-input[type="radio"],.shiny-input-container .checkbox input[type="radio"],.shiny-input-container .checkbox-inline input[type="radio"],.shiny-input-container .radio input[type="radio"],.shiny-input-container .radio-inline input[type="radio"]{border-radius:50%}.form-check-input:active,.shiny-input-container .checkbox input:active,.shiny-input-container .checkbox-inline input:active,.shiny-input-container .radio input:active,.shiny-input-container .radio-inline input:active{filter:brightness(90%)}.form-check-input:focus,.shiny-input-container .checkbox input:focus,.shiny-input-container .checkbox-inline input:focus,.shiny-input-container .radio input:focus,.shiny-input-container .radio-inline input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,0.25)}.form-check-input:checked,.shiny-input-container .checkbox input:checked,.shiny-input-container .checkbox-inline input:checked,.shiny-input-container .radio input:checked,.shiny-input-container .radio-inline input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type="checkbox"],.shiny-input-container .checkbox input:checked[type="checkbox"],.shiny-input-container .checkbox-inline input:checked[type="checkbox"],.shiny-input-container .radio input:checked[type="checkbox"],.shiny-input-container .radio-inline input:checked[type="checkbox"]{--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type="radio"],.shiny-input-container .checkbox input:checked[type="radio"],.shiny-input-container .checkbox-inline input:checked[type="radio"],.shiny-input-container .radio input:checked[type="radio"],.shiny-input-container .radio-inline input:checked[type="radio"]{--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type="checkbox"]:indeterminate,.shiny-input-container .checkbox input[type="checkbox"]:indeterminate,.shiny-input-container .checkbox-inline input[type="checkbox"]:indeterminate,.shiny-input-container .radio input[type="checkbox"]:indeterminate,.shiny-input-container .radio-inline input[type="checkbox"]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled,.shiny-input-container .checkbox input:disabled,.shiny-input-container .checkbox-inline input:disabled,.shiny-input-container .radio input:disabled,.shiny-input-container .radio-inline input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input[disabled]~.form-check-label,.form-check-input[disabled]~span,.form-check-input:disabled~.form-check-label,.form-check-input:disabled~span,.shiny-input-container .checkbox input[disabled]~.form-check-label,.shiny-input-container .checkbox input[disabled]~span,.shiny-input-container .checkbox input:disabled~.form-check-label,.shiny-input-container .checkbox input:disabled~span,.shiny-input-container .checkbox-inline input[disabled]~.form-check-label,.shiny-input-container .checkbox-inline input[disabled]~span,.shiny-input-container .checkbox-inline input:disabled~.form-check-label,.shiny-input-container .checkbox-inline input:disabled~span,.shiny-input-container .radio input[disabled]~.form-check-label,.shiny-input-container .radio input[disabled]~span,.shiny-input-container .radio input:disabled~.form-check-label,.shiny-input-container .radio input:disabled~span,.shiny-input-container .radio-inline input[disabled]~.form-check-label,.shiny-input-container .radio-inline input[disabled]~span,.shiny-input-container .radio-inline input:disabled~.form-check-label,.shiny-input-container .radio-inline input:disabled~span{cursor:default;opacity:.5}.form-check-label,.shiny-input-container .checkbox label,.shiny-input-container .checkbox-inline label,.shiny-input-container .radio label,.shiny-input-container .radio-inline label{cursor:pointer}.form-switch{padding-left:2.5em}.form-switch .form-check-input{--bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280,0,0,0.25%29'/%3e%3c/svg%3e");width:2em;margin-left:-2.5em;background-image:var(--bs-form-switch-bg);background-position:left center;border-radius:2em;transition:background-position 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{--bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;--bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0, 0, 0, 0);pointer-events:none}.btn-check[disabled]+.btn,.btn-check:disabled+.btn{pointer-events:none;filter:none;opacity:.65}[data-bs-theme="dark"] .form-switch .form-check-input:not(:checked):not(:focus){--bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255,255,255,0.25%29'/%3e%3c/svg%3e")}.form-range{width:100%;height:1.5rem;padding:0;appearance:none;-webkit-appearance:none;-moz-appearance:none;-ms-appearance:none;-o-appearance:none;background-color:transparent}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,0.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,0.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;appearance:none;-webkit-appearance:none;-moz-appearance:none;-ms-appearance:none;-o-appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;transition:background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.form-range::-webkit-slider-thumb{transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-tertiary-bg);border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;appearance:none;-webkit-appearance:none;-moz-appearance:none;-ms-appearance:none;-o-appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;transition:background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.form-range::-moz-range-thumb{transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-tertiary-bg);border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:var(--bs-secondary-color)}.form-range:disabled::-moz-range-thumb{background-color:var(--bs-secondary-color)}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + calc(var(--bs-border-width) * 2));min-height:calc(3.5rem + calc(var(--bs-border-width) * 2));line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;z-index:2;height:100%;padding:1rem .75rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:var(--bs-border-width) solid transparent;transform-origin:0 0;transition:opacity 0.1s ease-in-out,transform 0.1s ease-in-out}@media (prefers-reduced-motion: reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control::placeholder,.form-floating>.form-control-plaintext::placeholder{color:transparent}.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown),.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:-webkit-autofill,.form-floating>.form-control-plaintext:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-control-plaintext~label,.form-floating>.form-select~label{color:rgba(var(--bs-body-color-rgb), .65);transform:scale(0.85) translateY(-0.5rem) translateX(0.15rem)}.form-floating>.form-control:focus~label::after,.form-floating>.form-control:not(:placeholder-shown)~label::after,.form-floating>.form-control-plaintext~label::after,.form-floating>.form-select~label::after{position:absolute;inset:1rem .375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control:-webkit-autofill~label{color:rgba(var(--bs-body-color-rgb), .65);transform:scale(0.85) translateY(-0.5rem) translateX(0.15rem)}.form-floating>.form-control-plaintext~label{border-width:var(--bs-border-width) 0}.form-floating>:disabled~label,.form-floating>.form-control:disabled~label{color:#6c757d}.form-floating>:disabled~label::after,.form-floating>.form-control:disabled~label::after{background-color:var(--bs-secondary-bg)}.input-group{position:relative;display:flex;display:-webkit-flex;flex-wrap:wrap;-webkit-flex-wrap:wrap;align-items:stretch;-webkit-align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-select,.input-group>.form-floating{position:relative;flex:1 1 auto;-webkit-flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-select:focus,.input-group>.form-floating:focus-within{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;display:-webkit-flex;align-items:center;-webkit-align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);text-align:center;white-space:nowrap;background-color:var(--bs-tertiary-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius)}.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text,.input-group-lg>.btn{padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text,.input-group-sm>.btn{padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating),.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n + 3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select{border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>:nth-last-child(n + 3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating),.input-group.has-validation>.dropdown-toggle:nth-last-child(n + 4),.input-group.has-validation>.form-floating:nth-last-child(n + 3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n + 3)>.form-select{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:calc(var(--bs-border-width) * -1);border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-valid-color)}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-success);border-radius:var(--bs-border-radius)}.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip,.is-valid~.valid-feedback,.is-valid~.valid-tooltip{display:block}.was-validated .form-control:valid,.form-control.is-valid{border-color:var(--bs-form-valid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.was-validated .form-control:valid:focus,.form-control.is-valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb), 0.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.was-validated .form-select:valid,.form-select.is-valid{border-color:var(--bs-form-valid-border-color)}.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"],.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"]{--bs-form-select-bg-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.was-validated .form-select:valid:focus,.form-select.is-valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb), 0.25)}.was-validated .form-control-color:valid,.form-control-color.is-valid{width:calc(3rem + calc(1.5em + .75rem))}.was-validated .form-check-input:valid,.form-check-input.is-valid{border-color:var(--bs-form-valid-border-color)}.was-validated .form-check-input:valid:checked,.form-check-input.is-valid:checked{background-color:var(--bs-form-valid-color)}.was-validated .form-check-input:valid:focus,.form-check-input.is-valid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb), 0.25)}.was-validated .form-check-input:valid~.form-check-label,.form-check-input.is-valid~.form-check-label{color:var(--bs-form-valid-color)}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.was-validated .input-group>.form-control:not(:focus):valid,.input-group>.form-control:not(:focus).is-valid,.was-validated .input-group>.form-select:not(:focus):valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.input-group>.form-floating:not(:focus-within).is-valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-invalid-color)}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-danger);border-radius:var(--bs-border-radius)}.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip,.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip{display:block}.was-validated .form-control:invalid,.form-control.is-invalid{border-color:var(--bs-form-invalid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.was-validated .form-control:invalid:focus,.form-control.is-invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb), 0.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.was-validated .form-select:invalid,.form-select.is-invalid{border-color:var(--bs-form-invalid-border-color)}.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"],.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"]{--bs-form-select-bg-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.was-validated .form-select:invalid:focus,.form-select.is-invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb), 0.25)}.was-validated .form-control-color:invalid,.form-control-color.is-invalid{width:calc(3rem + calc(1.5em + .75rem))}.was-validated .form-check-input:invalid,.form-check-input.is-invalid{border-color:var(--bs-form-invalid-border-color)}.was-validated .form-check-input:invalid:checked,.form-check-input.is-invalid:checked{background-color:var(--bs-form-invalid-color)}.was-validated .form-check-input:invalid:focus,.form-check-input.is-invalid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb), 0.25)}.was-validated .form-check-input:invalid~.form-check-label,.form-check-input.is-invalid~.form-check-label{color:var(--bs-form-invalid-color)}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.was-validated .input-group>.form-control:not(:focus):invalid,.input-group>.form-control:not(:focus).is-invalid,.was-validated .input-group>.form-select:not(:focus):invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.input-group>.form-floating:not(:focus-within).is-invalid{z-index:4}.btn{--bs-btn-padding-x: .75rem;--bs-btn-padding-y: .375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight: 400;--bs-btn-line-height: 1.5;--bs-btn-color: var(--bs-body-color);--bs-btn-bg: transparent;--bs-btn-border-width: var(--bs-border-width);--bs-btn-border-color: transparent;--bs-btn-border-radius: var(--bs-border-radius);--bs-btn-hover-border-color: transparent;--bs-btn-box-shadow: inset 0 1px 0 rgba(255,255,255,0.15),0 1px 1px rgba(0,0,0,0.075);--bs-btn-disabled-opacity: .65;--bs-btn-focus-box-shadow: 0 0 0 .25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;-webkit-text-decoration:none;-moz-text-decoration:none;-ms-text-decoration:none;-o-text-decoration:none;vertical-align:middle;cursor:pointer;user-select:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;-o-user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check+.btn:hover{color:var(--bs-btn-color);background-color:var(--bs-btn-bg);border-color:var(--bs-btn-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,:not(.btn-check)+.btn:active,.btn:first-child:active,.btn.active,.btn.show{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:checked+.btn:focus-visible,:not(.btn-check)+.btn:active:focus-visible,.btn:first-child:active:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn:disabled,.btn.disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-default{--bs-btn-color: #000;--bs-btn-bg: #dee2e6;--bs-btn-border-color: #dee2e6;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #e3e6ea;--bs-btn-hover-border-color: #e1e5e9;--bs-btn-focus-shadow-rgb: 189,192,196;--bs-btn-active-color: #000;--bs-btn-active-bg: #e5e8eb;--bs-btn-active-border-color: #e1e5e9;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #dee2e6;--bs-btn-disabled-border-color: #dee2e6}.btn-primary{--bs-btn-color: #fff;--bs-btn-bg: #0d6efd;--bs-btn-border-color: #0d6efd;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #0b5ed7;--bs-btn-hover-border-color: #0a58ca;--bs-btn-focus-shadow-rgb: 49,132,253;--bs-btn-active-color: #fff;--bs-btn-active-bg: #0a58ca;--bs-btn-active-border-color: #0a53be;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #0d6efd;--bs-btn-disabled-border-color: #0d6efd}.btn-secondary{--bs-btn-color: #fff;--bs-btn-bg: #6c757d;--bs-btn-border-color: #6c757d;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #5c636a;--bs-btn-hover-border-color: #565e64;--bs-btn-focus-shadow-rgb: 130,138,145;--bs-btn-active-color: #fff;--bs-btn-active-bg: #565e64;--bs-btn-active-border-color: #51585e;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #6c757d;--bs-btn-disabled-border-color: #6c757d}.btn-success{--bs-btn-color: #fff;--bs-btn-bg: #198754;--bs-btn-border-color: #198754;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #157347;--bs-btn-hover-border-color: #146c43;--bs-btn-focus-shadow-rgb: 60,153,110;--bs-btn-active-color: #fff;--bs-btn-active-bg: #146c43;--bs-btn-active-border-color: #13653f;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #198754;--bs-btn-disabled-border-color: #198754}.btn-info{--bs-btn-color: #000;--bs-btn-bg: #0dcaf0;--bs-btn-border-color: #0dcaf0;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #31d2f2;--bs-btn-hover-border-color: #25cff2;--bs-btn-focus-shadow-rgb: 11,172,204;--bs-btn-active-color: #000;--bs-btn-active-bg: #3dd5f3;--bs-btn-active-border-color: #25cff2;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #0dcaf0;--bs-btn-disabled-border-color: #0dcaf0}.btn-warning{--bs-btn-color: #000;--bs-btn-bg: #ffc107;--bs-btn-border-color: #ffc107;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #ffca2c;--bs-btn-hover-border-color: #ffc720;--bs-btn-focus-shadow-rgb: 217,164,6;--bs-btn-active-color: #000;--bs-btn-active-bg: #ffcd39;--bs-btn-active-border-color: #ffc720;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #ffc107;--bs-btn-disabled-border-color: #ffc107}.btn-danger{--bs-btn-color: #fff;--bs-btn-bg: #dc3545;--bs-btn-border-color: #dc3545;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #bb2d3b;--bs-btn-hover-border-color: #b02a37;--bs-btn-focus-shadow-rgb: 225,83,97;--bs-btn-active-color: #fff;--bs-btn-active-bg: #b02a37;--bs-btn-active-border-color: #a52834;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #dc3545;--bs-btn-disabled-border-color: #dc3545}.btn-light{--bs-btn-color: #000;--bs-btn-bg: #f8f9fa;--bs-btn-border-color: #f8f9fa;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #d3d4d5;--bs-btn-hover-border-color: #c6c7c8;--bs-btn-focus-shadow-rgb: 211,212,213;--bs-btn-active-color: #000;--bs-btn-active-bg: #c6c7c8;--bs-btn-active-border-color: #babbbc;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #f8f9fa;--bs-btn-disabled-border-color: #f8f9fa}.btn-dark{--bs-btn-color: #fff;--bs-btn-bg: #212529;--bs-btn-border-color: #212529;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #424649;--bs-btn-hover-border-color: #373b3e;--bs-btn-focus-shadow-rgb: 66,70,73;--bs-btn-active-color: #fff;--bs-btn-active-bg: #4d5154;--bs-btn-active-border-color: #373b3e;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #212529;--bs-btn-disabled-border-color: #212529}.btn-outline-default{--bs-btn-color: #dee2e6;--bs-btn-border-color: #dee2e6;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #dee2e6;--bs-btn-hover-border-color: #dee2e6;--bs-btn-focus-shadow-rgb: 222,226,230;--bs-btn-active-color: #000;--bs-btn-active-bg: #dee2e6;--bs-btn-active-border-color: #dee2e6;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #dee2e6;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #dee2e6;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-primary{--bs-btn-color: #0d6efd;--bs-btn-border-color: #0d6efd;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #0d6efd;--bs-btn-hover-border-color: #0d6efd;--bs-btn-focus-shadow-rgb: 13,110,253;--bs-btn-active-color: #fff;--bs-btn-active-bg: #0d6efd;--bs-btn-active-border-color: #0d6efd;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #0d6efd;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #0d6efd;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-secondary{--bs-btn-color: #6c757d;--bs-btn-border-color: #6c757d;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #6c757d;--bs-btn-hover-border-color: #6c757d;--bs-btn-focus-shadow-rgb: 108,117,125;--bs-btn-active-color: #fff;--bs-btn-active-bg: #6c757d;--bs-btn-active-border-color: #6c757d;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #6c757d;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #6c757d;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-success{--bs-btn-color: #198754;--bs-btn-border-color: #198754;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #198754;--bs-btn-hover-border-color: #198754;--bs-btn-focus-shadow-rgb: 25,135,84;--bs-btn-active-color: #fff;--bs-btn-active-bg: #198754;--bs-btn-active-border-color: #198754;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #198754;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #198754;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-info{--bs-btn-color: #0dcaf0;--bs-btn-border-color: #0dcaf0;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #0dcaf0;--bs-btn-hover-border-color: #0dcaf0;--bs-btn-focus-shadow-rgb: 13,202,240;--bs-btn-active-color: #000;--bs-btn-active-bg: #0dcaf0;--bs-btn-active-border-color: #0dcaf0;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #0dcaf0;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #0dcaf0;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-warning{--bs-btn-color: #ffc107;--bs-btn-border-color: #ffc107;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #ffc107;--bs-btn-hover-border-color: #ffc107;--bs-btn-focus-shadow-rgb: 255,193,7;--bs-btn-active-color: #000;--bs-btn-active-bg: #ffc107;--bs-btn-active-border-color: #ffc107;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #ffc107;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #ffc107;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-danger{--bs-btn-color: #dc3545;--bs-btn-border-color: #dc3545;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #dc3545;--bs-btn-hover-border-color: #dc3545;--bs-btn-focus-shadow-rgb: 220,53,69;--bs-btn-active-color: #fff;--bs-btn-active-bg: #dc3545;--bs-btn-active-border-color: #dc3545;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #dc3545;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #dc3545;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-light{--bs-btn-color: #f8f9fa;--bs-btn-border-color: #f8f9fa;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #f8f9fa;--bs-btn-hover-border-color: #f8f9fa;--bs-btn-focus-shadow-rgb: 248,249,250;--bs-btn-active-color: #000;--bs-btn-active-bg: #f8f9fa;--bs-btn-active-border-color: #f8f9fa;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #f8f9fa;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #f8f9fa;--bs-btn-bg: transparent;--bs-gradient: none}.btn-outline-dark{--bs-btn-color: #212529;--bs-btn-border-color: #212529;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #212529;--bs-btn-hover-border-color: #212529;--bs-btn-focus-shadow-rgb: 33,37,41;--bs-btn-active-color: #fff;--bs-btn-active-bg: #212529;--bs-btn-active-border-color: #212529;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #212529;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #212529;--bs-btn-bg: transparent;--bs-gradient: none}.btn-link{--bs-btn-font-weight: 400;--bs-btn-color: var(--bs-link-color);--bs-btn-bg: transparent;--bs-btn-border-color: transparent;--bs-btn-hover-color: var(--bs-link-hover-color);--bs-btn-hover-border-color: transparent;--bs-btn-active-color: var(--bs-link-hover-color);--bs-btn-active-border-color: transparent;--bs-btn-disabled-color: #6c757d;--bs-btn-disabled-border-color: transparent;--bs-btn-box-shadow: 0 0 0 #000;--bs-btn-focus-shadow-rgb: 49,132,253;text-decoration:underline;-webkit-text-decoration:underline;-moz-text-decoration:underline;-ms-text-decoration:underline;-o-text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-lg,.btn-group-lg>.btn{--bs-btn-padding-y: .5rem;--bs-btn-padding-x: 1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius: var(--bs-border-radius-lg)}.btn-sm,.btn-group-sm>.btn{--bs-btn-padding-y: .25rem;--bs-btn-padding-x: .5rem;--bs-btn-font-size:.875rem;--bs-btn-border-radius: var(--bs-border-radius-sm)}.fade{transition:opacity 0.15s linear}@media (prefers-reduced-motion: reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height 0.35s ease}@media (prefers-reduced-motion: reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width 0.35s ease}@media (prefers-reduced-motion: reduce){.collapsing.collapse-horizontal{transition:none}}.dropup,.dropend,.dropdown,.dropstart,.dropup-center,.dropdown-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex: 1000;--bs-dropdown-min-width: 10rem;--bs-dropdown-padding-x: 0;--bs-dropdown-padding-y: .5rem;--bs-dropdown-spacer: .125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color: var(--bs-body-color);--bs-dropdown-bg: var(--bs-body-bg);--bs-dropdown-border-color: var(--bs-border-color-translucent);--bs-dropdown-border-radius: var(--bs-border-radius);--bs-dropdown-border-width: var(--bs-border-width);--bs-dropdown-inner-border-radius: calc(var(--bs-border-radius) - var(--bs-border-width));--bs-dropdown-divider-bg: var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y: .5rem;--bs-dropdown-box-shadow: 0 0.5rem 1rem rgba(0,0,0,0.15);--bs-dropdown-link-color: var(--bs-body-color);--bs-dropdown-link-hover-color: var(--bs-body-color);--bs-dropdown-link-hover-bg: var(--bs-tertiary-bg);--bs-dropdown-link-active-color: #fff;--bs-dropdown-link-active-bg: #0d6efd;--bs-dropdown-link-disabled-color: var(--bs-tertiary-color);--bs-dropdown-item-padding-x: 1rem;--bs-dropdown-item-padding-y: .25rem;--bs-dropdown-header-color: #6c757d;--bs-dropdown-header-padding-x: 1rem;--bs-dropdown-header-padding-y: .5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position: start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position: end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width: 576px){.dropdown-menu-sm-start{--bs-position: start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position: end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width: 768px){.dropdown-menu-md-start{--bs-position: start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position: end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width: 992px){.dropdown-menu-lg-start{--bs-position: start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position: end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width: 1200px){.dropdown-menu-xl-start{--bs-position: start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position: end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width: 1400px){.dropdown-menu-xxl-start{--bs-position: start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position: end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;-webkit-text-decoration:none;-moz-text-decoration:none;-ms-text-decoration:none;-o-text-decoration:none;white-space:nowrap;background-color:transparent;border:0;border-radius:var(--bs-dropdown-item-border-radius, 0)}.dropdown-item:hover,.dropdown-item:focus{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color: #dee2e6;--bs-dropdown-bg: #343a40;--bs-dropdown-border-color: var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color: #dee2e6;--bs-dropdown-link-hover-color: #fff;--bs-dropdown-divider-bg: var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg: rgba(255,255,255,0.15);--bs-dropdown-link-active-color: #fff;--bs-dropdown-link-active-bg: #0d6efd;--bs-dropdown-link-disabled-color: #adb5bd;--bs-dropdown-header-color: #adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group>.btn,.btn-group-vertical>.btn{position:relative;flex:1 1 auto;-webkit-flex:1 1 auto}.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn:hover,.btn-group>.btn:focus,.btn-group>.btn:active,.btn-group>.btn.active,.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn:hover,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn.active{z-index:1}.btn-toolbar{display:flex;display:-webkit-flex;flex-wrap:wrap;-webkit-flex-wrap:wrap;justify-content:flex-start;-webkit-justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:var(--bs-border-radius)}.btn-group>:not(.btn-check:first-child)+.btn,.btn-group>.btn-group:not(:first-child){margin-left:calc(var(--bs-border-width) * -1)}.btn-group>.btn:not(:last-child):not(.dropdown-toggle),.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn-group:not(:last-child)>.btn{border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn:nth-child(n + 3),.btn-group>:not(.btn-check)+.btn,.btn-group>.btn-group:not(:first-child)>.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-sm+.dropdown-toggle-split,.btn-group-sm>.btn+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-lg+.dropdown-toggle-split,.btn-group-lg>.btn+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;-webkit-flex-direction:column;align-items:flex-start;-webkit-align-items:flex-start;justify-content:center;-webkit-justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn:not(:first-child),.btn-group-vertical>.btn-group:not(:first-child){margin-top:calc(var(--bs-border-width) * -1)}.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle),.btn-group-vertical>.btn-group:not(:last-child)>.btn{border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn~.btn,.btn-group-vertical>.btn-group:not(:first-child)>.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x: 1rem;--bs-nav-link-padding-y: .5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color: var(--bs-link-color);--bs-nav-link-hover-color: var(--bs-link-hover-color);--bs-nav-link-disabled-color: var(--bs-secondary-color);display:flex;display:-webkit-flex;flex-wrap:wrap;-webkit-flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;-webkit-text-decoration:none;-moz-text-decoration:none;-ms-text-decoration:none;-o-text-decoration:none;background:none;border:0;transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.nav-link{transition:none}}.nav-link:hover,.nav-link:focus{color:var(--bs-nav-link-hover-color)}.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,0.25)}.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width: var(--bs-border-width);--bs-nav-tabs-border-color: var(--bs-border-color);--bs-nav-tabs-border-radius: var(--bs-border-radius);--bs-nav-tabs-link-hover-border-color: var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);--bs-nav-tabs-link-active-color: var(--bs-emphasis-color);--bs-nav-tabs-link-active-bg: var(--bs-body-bg);--bs-nav-tabs-link-active-border-color: var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:hover,.nav-tabs .nav-link:focus{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-link.active,.nav-tabs .nav-item.show .nav-link{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1 * var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius: var(--bs-border-radius);--bs-nav-pills-link-active-color: #fff;--bs-nav-pills-link-active-bg: #0d6efd}.nav-pills .nav-link{border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-underline{--bs-nav-underline-gap: 1rem;--bs-nav-underline-border-width: .125rem;--bs-nav-underline-link-active-color: var(--bs-emphasis-color);gap:var(--bs-nav-underline-gap)}.nav-underline .nav-link{padding-right:0;padding-left:0;border-bottom:var(--bs-nav-underline-border-width) solid transparent}.nav-underline .nav-link:hover,.nav-underline .nav-link:focus{border-bottom-color:currentcolor}.nav-underline .nav-link.active,.nav-underline .show>.nav-link{font-weight:700;color:var(--bs-nav-underline-link-active-color);border-bottom-color:currentcolor}.nav-fill>.nav-link,.nav-fill .nav-item{flex:1 1 auto;-webkit-flex:1 1 auto;text-align:center}.nav-justified>.nav-link,.nav-justified .nav-item{flex-basis:0;-webkit-flex-basis:0;flex-grow:1;-webkit-flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar,:where([data-bs-theme="light"]) .navbar{--bs-navbar-padding-x: 0;--bs-navbar-padding-y: .5rem;--bs-navbar-color: rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color: rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color: rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-padding-y: .3125rem;--bs-navbar-brand-margin-end: 1rem;--bs-navbar-brand-font-size: 1.25rem;--bs-navbar-brand-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-nav-link-padding-x: .5rem;--bs-navbar-toggler-padding-y: .25rem;--bs-navbar-toggler-padding-x: .75rem;--bs-navbar-toggler-font-size: 1.25rem;--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833,37,41,0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color: rgba(var(--bs-emphasis-color-rgb), 0.15);--bs-navbar-toggler-border-radius: var(--bs-border-radius);--bs-navbar-toggler-focus-width: .25rem;--bs-navbar-toggler-transition: box-shadow 0.15s ease-in-out}.navbar{position:relative;display:flex;display:-webkit-flex;flex-wrap:wrap;-webkit-flex-wrap:wrap;align-items:center;-webkit-align-items:center;justify-content:space-between;-webkit-justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-sm,.navbar>.container-md,.navbar>.container-lg,.navbar>.container-xl,.navbar>.container-xxl{display:flex;display:-webkit-flex;flex-wrap:inherit;-webkit-flex-wrap:inherit;align-items:center;-webkit-align-items:center;justify-content:space-between;-webkit-justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;-webkit-text-decoration:none;-moz-text-decoration:none;-ms-text-decoration:none;-o-text-decoration:none;white-space:nowrap}.navbar-brand:hover,.navbar-brand:focus{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x: 0;--bs-nav-link-padding-y: .5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color: var(--bs-navbar-color);--bs-nav-link-hover-color: var(--bs-navbar-hover-color);--bs-nav-link-disabled-color: var(--bs-navbar-disabled-color);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:hover,.navbar-text a:focus{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;-webkit-flex-basis:100%;flex-grow:1;-webkit-flex-grow:1;align-items:center;-webkit-align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion: reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height, 75vh);overflow-y:auto}@media (min-width: 576px){.navbar-expand-sm{flex-wrap:nowrap;-webkit-flex-wrap:nowrap;justify-content:flex-start;-webkit-justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row;-webkit-flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex !important;display:-webkit-flex !important;flex-basis:auto;-webkit-flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;-webkit-flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:transparent !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible}}@media (min-width: 768px){.navbar-expand-md{flex-wrap:nowrap;-webkit-flex-wrap:nowrap;justify-content:flex-start;-webkit-justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row;-webkit-flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex !important;display:-webkit-flex !important;flex-basis:auto;-webkit-flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;-webkit-flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:transparent !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible}}@media (min-width: 992px){.navbar-expand-lg{flex-wrap:nowrap;-webkit-flex-wrap:nowrap;justify-content:flex-start;-webkit-justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row;-webkit-flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex !important;display:-webkit-flex !important;flex-basis:auto;-webkit-flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;-webkit-flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:transparent !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible}}@media (min-width: 1200px){.navbar-expand-xl{flex-wrap:nowrap;-webkit-flex-wrap:nowrap;justify-content:flex-start;-webkit-justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row;-webkit-flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex !important;display:-webkit-flex !important;flex-basis:auto;-webkit-flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;-webkit-flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:transparent !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible}}@media (min-width: 1400px){.navbar-expand-xxl{flex-wrap:nowrap;-webkit-flex-wrap:nowrap;justify-content:flex-start;-webkit-justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row;-webkit-flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex !important;display:-webkit-flex !important;flex-basis:auto;-webkit-flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;-webkit-flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:transparent !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;-webkit-flex-wrap:nowrap;justify-content:flex-start;-webkit-justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row;-webkit-flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex !important;display:-webkit-flex !important;flex-basis:auto;-webkit-flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;-webkit-flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:transparent !important;border:0 !important;transform:none !important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible}.navbar-dark,:where([data-bs-theme="dark"]) .navbar,.navbar[data-bs-theme="dark"]{--bs-navbar-color: rgba(var(--bs-emphasis-color-rgb), 0.55);--bs-navbar-hover-color: rgba(var(--bs-emphasis-color-rgb), 0.75);--bs-navbar-disabled-color: rgba(var(--bs-emphasis-color-rgb), 0.25);--bs-navbar-active-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-toggler-border-color: rgba(var(--bs-emphasis-color-rgb), 0.1);--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255,255,255,0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}:where(.navbar[data-bs-theme="dark"] .navbar-toggler-icon){--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255,255,255,0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}[data-bs-theme="dark"] :where(.navbar:not([data-bs-theme="light"]) .navbar-toggler-icon){--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255,255,255,0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.navbar[data-bs-theme="light"]{--bs-navbar-color: rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color: rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color: rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-toggler-border-color: rgba(var(--bs-emphasis-color-rgb), 0.15)}.navbar[data-bs-theme="light"] .navbar-toggler-icon{--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833,37,41,0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y: 1rem;--bs-card-spacer-x: 1rem;--bs-card-title-spacer-y: .5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width: var(--bs-border-width);--bs-card-border-color: var(--bs-border-color-translucent);--bs-card-border-radius: var(--bs-border-radius);--bs-card-box-shadow: ;--bs-card-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-card-cap-padding-y: .5rem;--bs-card-cap-padding-x: 1rem;--bs-card-cap-bg: rgba(var(--bs-body-color-rgb), 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg: var(--bs-body-bg);--bs-card-img-overlay-padding: 1rem;--bs-card-group-margin: .75rem;position:relative;display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;-webkit-flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0;color:var(--bs-card-subtitle-color)}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-top,.card-img-bottom{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width: 576px){.card-group{display:flex;display:-webkit-flex;flex-flow:row wrap;-webkit-flex-flow:row wrap}.card-group>.card{flex:1 0 0%;-webkit-flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-img-top,.card-group>.card:not(:last-child) .card-header{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-img-bottom,.card-group>.card:not(:last-child) .card-footer{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-img-top,.card-group>.card:not(:first-child) .card-header{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-img-bottom,.card-group>.card:not(:first-child) .card-footer{border-bottom-left-radius:0}}.accordion{--bs-accordion-color: var(--bs-body-color);--bs-accordion-bg: var(--bs-body-bg);--bs-accordion-transition: color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color: var(--bs-border-color);--bs-accordion-border-width: var(--bs-border-width);--bs-accordion-border-radius: var(--bs-border-radius);--bs-accordion-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-accordion-btn-padding-x: 1.25rem;--bs-accordion-btn-padding-y: 1rem;--bs-accordion-btn-color: var(--bs-body-color);--bs-accordion-btn-bg: var(--bs-accordion-bg);--bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23212529'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width: 1.25rem;--bs-accordion-btn-icon-transform: rotate(-180deg);--bs-accordion-btn-icon-transition: transform 0.2s ease-in-out;--bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23052c65'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-focus-border-color: #86b7fe;--bs-accordion-btn-focus-box-shadow: 0 0 0 .25rem rgba(13,110,253,0.25);--bs-accordion-body-padding-x: 1.25rem;--bs-accordion-body-padding-y: 1rem;--bs-accordion-active-color: var(--bs-primary-text-emphasis);--bs-accordion-active-bg: var(--bs-primary-bg-subtle)}.accordion-button{position:relative;display:flex;display:-webkit-flex;align-items:center;-webkit-align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion: reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;-webkit-flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion: reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;border-color:var(--bs-accordion-btn-focus-border-color);outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type .accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush .accordion-collapse{border-width:0}.accordion-flush .accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush .accordion-item:first-child{border-top:0}.accordion-flush .accordion-item:last-child{border-bottom:0}.accordion-flush .accordion-item .accordion-button,.accordion-flush .accordion-item .accordion-button.collapsed{border-radius:0}[data-bs-theme="dark"] .accordion-button::after{--bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.breadcrumb{--bs-breadcrumb-padding-x: 0;--bs-breadcrumb-padding-y: 0;--bs-breadcrumb-margin-bottom: 1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color: var(--bs-secondary-color);--bs-breadcrumb-item-padding-x: .5rem;--bs-breadcrumb-item-active-color: var(--bs-secondary-color);display:flex;display:-webkit-flex;flex-wrap:wrap;-webkit-flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/") /* rtl: var(--bs-breadcrumb-divider, "/") */}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x: .75rem;--bs-pagination-padding-y: .375rem;--bs-pagination-font-size:1rem;--bs-pagination-color: var(--bs-link-color);--bs-pagination-bg: var(--bs-body-bg);--bs-pagination-border-width: var(--bs-border-width);--bs-pagination-border-color: var(--bs-border-color);--bs-pagination-border-radius: var(--bs-border-radius);--bs-pagination-hover-color: var(--bs-link-hover-color);--bs-pagination-hover-bg: var(--bs-tertiary-bg);--bs-pagination-hover-border-color: var(--bs-border-color);--bs-pagination-focus-color: var(--bs-link-hover-color);--bs-pagination-focus-bg: var(--bs-secondary-bg);--bs-pagination-focus-box-shadow: 0 0 0 .25rem rgba(13,110,253,0.25);--bs-pagination-active-color: #fff;--bs-pagination-active-bg: #0d6efd;--bs-pagination-active-border-color: #0d6efd;--bs-pagination-disabled-color: var(--bs-secondary-color);--bs-pagination-disabled-bg: var(--bs-secondary-bg);--bs-pagination-disabled-border-color: var(--bs-border-color);display:flex;display:-webkit-flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;-webkit-text-decoration:none;-moz-text-decoration:none;-ms-text-decoration:none;-o-text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.page-link.active,.active>.page-link{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.page-link.disabled,.disabled>.page-link{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:calc(var(--bs-border-width) * -1)}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x: 1.5rem;--bs-pagination-padding-y: .75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius: var(--bs-border-radius-lg)}.pagination-sm{--bs-pagination-padding-x: .5rem;--bs-pagination-padding-y: .25rem;--bs-pagination-font-size:.875rem;--bs-pagination-border-radius: var(--bs-border-radius-sm)}.badge{--bs-badge-padding-x: .65em;--bs-badge-padding-y: .35em;--bs-badge-font-size:.75em;--bs-badge-font-weight: 700;--bs-badge-color: #fff;--bs-badge-border-radius: var(--bs-border-radius);display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg: transparent;--bs-alert-padding-x: 1rem;--bs-alert-padding-y: 1rem;--bs-alert-margin-bottom: 1rem;--bs-alert-color: inherit;--bs-alert-border-color: transparent;--bs-alert-border: var(--bs-border-width) solid var(--bs-alert-border-color);--bs-alert-border-radius: var(--bs-border-radius);--bs-alert-link-color: inherit;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700;color:var(--bs-alert-link-color)}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-default{--bs-alert-color: var(--bs-default-text-emphasis);--bs-alert-bg: var(--bs-default-bg-subtle);--bs-alert-border-color: var(--bs-default-border-subtle);--bs-alert-link-color: var(--bs-default-text-emphasis)}.alert-primary{--bs-alert-color: var(--bs-primary-text-emphasis);--bs-alert-bg: var(--bs-primary-bg-subtle);--bs-alert-border-color: var(--bs-primary-border-subtle);--bs-alert-link-color: var(--bs-primary-text-emphasis)}.alert-secondary{--bs-alert-color: var(--bs-secondary-text-emphasis);--bs-alert-bg: var(--bs-secondary-bg-subtle);--bs-alert-border-color: var(--bs-secondary-border-subtle);--bs-alert-link-color: var(--bs-secondary-text-emphasis)}.alert-success{--bs-alert-color: var(--bs-success-text-emphasis);--bs-alert-bg: var(--bs-success-bg-subtle);--bs-alert-border-color: var(--bs-success-border-subtle);--bs-alert-link-color: var(--bs-success-text-emphasis)}.alert-info{--bs-alert-color: var(--bs-info-text-emphasis);--bs-alert-bg: var(--bs-info-bg-subtle);--bs-alert-border-color: var(--bs-info-border-subtle);--bs-alert-link-color: var(--bs-info-text-emphasis)}.alert-warning{--bs-alert-color: var(--bs-warning-text-emphasis);--bs-alert-bg: var(--bs-warning-bg-subtle);--bs-alert-border-color: var(--bs-warning-border-subtle);--bs-alert-link-color: var(--bs-warning-text-emphasis)}.alert-danger{--bs-alert-color: var(--bs-danger-text-emphasis);--bs-alert-bg: var(--bs-danger-bg-subtle);--bs-alert-border-color: var(--bs-danger-border-subtle);--bs-alert-link-color: var(--bs-danger-text-emphasis)}.alert-light{--bs-alert-color: var(--bs-light-text-emphasis);--bs-alert-bg: var(--bs-light-bg-subtle);--bs-alert-border-color: var(--bs-light-border-subtle);--bs-alert-link-color: var(--bs-light-text-emphasis)}.alert-dark{--bs-alert-color: var(--bs-dark-text-emphasis);--bs-alert-bg: var(--bs-dark-bg-subtle);--bs-alert-border-color: var(--bs-dark-border-subtle);--bs-alert-link-color: var(--bs-dark-text-emphasis)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress,.progress-stacked{--bs-progress-height: 1rem;--bs-progress-font-size:.75rem;--bs-progress-bg: var(--bs-secondary-bg);--bs-progress-border-radius: var(--bs-border-radius);--bs-progress-box-shadow: var(--bs-box-shadow-inset);--bs-progress-bar-color: #fff;--bs-progress-bar-bg: #0d6efd;--bs-progress-bar-transition: width 0.6s ease;display:flex;display:-webkit-flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;justify-content:center;-webkit-justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion: reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg, rgba(255,255,255,0.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,0.15) 50%, rgba(255,255,255,0.15) 75%, transparent 75%, transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-stacked>.progress{overflow:visible}.progress-stacked>.progress>.progress-bar{width:100%}.progress-bar-animated{animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion: reduce){.progress-bar-animated{animation:none}}.list-group{--bs-list-group-color: var(--bs-body-color);--bs-list-group-bg: var(--bs-body-bg);--bs-list-group-border-color: var(--bs-border-color);--bs-list-group-border-width: var(--bs-border-width);--bs-list-group-border-radius: var(--bs-border-radius);--bs-list-group-item-padding-x: 1rem;--bs-list-group-item-padding-y: .5rem;--bs-list-group-action-color: var(--bs-secondary-color);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-tertiary-bg);--bs-list-group-action-active-color: var(--bs-body-color);--bs-list-group-action-active-bg: var(--bs-secondary-bg);--bs-list-group-disabled-color: var(--bs-secondary-color);--bs-list-group-disabled-bg: var(--bs-body-bg);--bs-list-group-active-color: #fff;--bs-list-group-active-bg: #0d6efd;--bs-list-group-active-border-color: #0d6efd;display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:hover,.list-group-item-action:focus{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;-webkit-text-decoration:none;-moz-text-decoration:none;-ms-text-decoration:none;-o-text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1 * var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row;-webkit-flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media (min-width: 576px){.list-group-horizontal-sm{flex-direction:row;-webkit-flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width: 768px){.list-group-horizontal-md{flex-direction:row;-webkit-flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width: 992px){.list-group-horizontal-lg{flex-direction:row;-webkit-flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width: 1200px){.list-group-horizontal-xl{flex-direction:row;-webkit-flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width: 1400px){.list-group-horizontal-xxl{flex-direction:row;-webkit-flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-default{--bs-list-group-color: var(--bs-default-text-emphasis);--bs-list-group-bg: var(--bs-default-bg-subtle);--bs-list-group-border-color: var(--bs-default-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-default-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-default-border-subtle);--bs-list-group-active-color: var(--bs-default-bg-subtle);--bs-list-group-active-bg: var(--bs-default-text-emphasis);--bs-list-group-active-border-color: var(--bs-default-text-emphasis)}.list-group-item-primary{--bs-list-group-color: var(--bs-primary-text-emphasis);--bs-list-group-bg: var(--bs-primary-bg-subtle);--bs-list-group-border-color: var(--bs-primary-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-primary-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-primary-border-subtle);--bs-list-group-active-color: var(--bs-primary-bg-subtle);--bs-list-group-active-bg: var(--bs-primary-text-emphasis);--bs-list-group-active-border-color: var(--bs-primary-text-emphasis)}.list-group-item-secondary{--bs-list-group-color: var(--bs-secondary-text-emphasis);--bs-list-group-bg: var(--bs-secondary-bg-subtle);--bs-list-group-border-color: var(--bs-secondary-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-secondary-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-secondary-border-subtle);--bs-list-group-active-color: var(--bs-secondary-bg-subtle);--bs-list-group-active-bg: var(--bs-secondary-text-emphasis);--bs-list-group-active-border-color: var(--bs-secondary-text-emphasis)}.list-group-item-success{--bs-list-group-color: var(--bs-success-text-emphasis);--bs-list-group-bg: var(--bs-success-bg-subtle);--bs-list-group-border-color: var(--bs-success-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-success-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-success-border-subtle);--bs-list-group-active-color: var(--bs-success-bg-subtle);--bs-list-group-active-bg: var(--bs-success-text-emphasis);--bs-list-group-active-border-color: var(--bs-success-text-emphasis)}.list-group-item-info{--bs-list-group-color: var(--bs-info-text-emphasis);--bs-list-group-bg: var(--bs-info-bg-subtle);--bs-list-group-border-color: var(--bs-info-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-info-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-info-border-subtle);--bs-list-group-active-color: var(--bs-info-bg-subtle);--bs-list-group-active-bg: var(--bs-info-text-emphasis);--bs-list-group-active-border-color: var(--bs-info-text-emphasis)}.list-group-item-warning{--bs-list-group-color: var(--bs-warning-text-emphasis);--bs-list-group-bg: var(--bs-warning-bg-subtle);--bs-list-group-border-color: var(--bs-warning-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-warning-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-warning-border-subtle);--bs-list-group-active-color: var(--bs-warning-bg-subtle);--bs-list-group-active-bg: var(--bs-warning-text-emphasis);--bs-list-group-active-border-color: var(--bs-warning-text-emphasis)}.list-group-item-danger{--bs-list-group-color: var(--bs-danger-text-emphasis);--bs-list-group-bg: var(--bs-danger-bg-subtle);--bs-list-group-border-color: var(--bs-danger-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-danger-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-danger-border-subtle);--bs-list-group-active-color: var(--bs-danger-bg-subtle);--bs-list-group-active-bg: var(--bs-danger-text-emphasis);--bs-list-group-active-border-color: var(--bs-danger-text-emphasis)}.list-group-item-light{--bs-list-group-color: var(--bs-light-text-emphasis);--bs-list-group-bg: var(--bs-light-bg-subtle);--bs-list-group-border-color: var(--bs-light-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-light-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-light-border-subtle);--bs-list-group-active-color: var(--bs-light-bg-subtle);--bs-list-group-active-bg: var(--bs-light-text-emphasis);--bs-list-group-active-border-color: var(--bs-light-text-emphasis)}.list-group-item-dark{--bs-list-group-color: var(--bs-dark-text-emphasis);--bs-list-group-bg: var(--bs-dark-bg-subtle);--bs-list-group-border-color: var(--bs-dark-border-subtle);--bs-list-group-action-hover-color: var(--bs-emphasis-color);--bs-list-group-action-hover-bg: var(--bs-dark-border-subtle);--bs-list-group-action-active-color: var(--bs-emphasis-color);--bs-list-group-action-active-bg: var(--bs-dark-border-subtle);--bs-list-group-active-color: var(--bs-dark-bg-subtle);--bs-list-group-active-bg: var(--bs-dark-text-emphasis);--bs-list-group-active-border-color: var(--bs-dark-text-emphasis)}.btn-close{--bs-btn-close-color: #000;--bs-btn-close-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e");--bs-btn-close-opacity: .5;--bs-btn-close-hover-opacity: .75;--bs-btn-close-focus-shadow: 0 0 0 .25rem rgba(13,110,253,0.25);--bs-btn-close-focus-opacity: 1;--bs-btn-close-disabled-opacity: .25;--bs-btn-close-white-filter: invert(1) grayscale(100%) brightness(200%);box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:var(--bs-btn-close-color);background:transparent var(--bs-btn-close-bg) center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:var(--bs-btn-close-opacity)}.btn-close:hover{color:var(--bs-btn-close-color);text-decoration:none;opacity:var(--bs-btn-close-hover-opacity)}.btn-close:focus{outline:0;box-shadow:var(--bs-btn-close-focus-shadow);opacity:var(--bs-btn-close-focus-opacity)}.btn-close:disabled,.btn-close.disabled{pointer-events:none;user-select:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;-o-user-select:none;opacity:var(--bs-btn-close-disabled-opacity)}.btn-close-white{filter:var(--bs-btn-close-white-filter)}[data-bs-theme="dark"] .btn-close{filter:var(--bs-btn-close-white-filter)}.toast{--bs-toast-zindex: 1090;--bs-toast-padding-x: .75rem;--bs-toast-padding-y: .5rem;--bs-toast-spacing: 1.5rem;--bs-toast-max-width: 350px;--bs-toast-font-size:.875rem;--bs-toast-color: ;--bs-toast-bg: rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-border-width: var(--bs-border-width);--bs-toast-border-color: var(--bs-border-color-translucent);--bs-toast-border-radius: var(--bs-border-radius);--bs-toast-box-shadow: var(--bs-box-shadow);--bs-toast-header-color: var(--bs-secondary-color);--bs-toast-header-bg: rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-header-border-color: var(--bs-border-color-translucent);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{--bs-toast-zindex: 1090;position:absolute;z-index:var(--bs-toast-zindex);width:max-content;width:-webkit-max-content;width:-moz-max-content;width:-ms-max-content;width:-o-max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;display:-webkit-flex;align-items:center;-webkit-align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-.5 * var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex: 1055;--bs-modal-width: 500px;--bs-modal-padding: 1rem;--bs-modal-margin: .5rem;--bs-modal-color: ;--bs-modal-bg: var(--bs-body-bg);--bs-modal-border-color: var(--bs-border-color-translucent);--bs-modal-border-width: var(--bs-border-width);--bs-modal-border-radius: var(--bs-border-radius-lg);--bs-modal-box-shadow: 0 0.125rem 0.25rem rgba(0,0,0,0.075);--bs-modal-inner-border-radius: calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));--bs-modal-header-padding-x: 1rem;--bs-modal-header-padding-y: 1rem;--bs-modal-header-padding: 1rem 1rem;--bs-modal-header-border-color: var(--bs-border-color);--bs-modal-header-border-width: var(--bs-border-width);--bs-modal-title-line-height: 1.5;--bs-modal-footer-gap: .5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color: var(--bs-border-color);--bs-modal-footer-border-width: var(--bs-border-width);position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform 0.3s ease-out;transform:translate(0, -50px)}@media (prefers-reduced-motion: reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;display:-webkit-flex;align-items:center;-webkit-align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex: 1050;--bs-backdrop-bg: #000;--bs-backdrop-opacity: .5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;display:-webkit-flex;flex-shrink:0;-webkit-flex-shrink:0;align-items:center;-webkit-align-items:center;justify-content:space-between;-webkit-justify-content:space-between;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;-webkit-flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;display:-webkit-flex;flex-shrink:0;-webkit-flex-shrink:0;flex-wrap:wrap;-webkit-flex-wrap:wrap;align-items:center;-webkit-align-items:center;justify-content:flex-end;-webkit-justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width: 576px){.modal{--bs-modal-margin: 1.75rem;--bs-modal-box-shadow: 0 0.5rem 1rem rgba(0,0,0,0.15)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width: 300px}}@media (min-width: 992px){.modal-lg,.modal-xl{--bs-modal-width: 800px}}@media (min-width: 1200px){.modal-xl{--bs-modal-width: 1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-header,.modal-fullscreen .modal-footer{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width: 575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-header,.modal-fullscreen-sm-down .modal-footer{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width: 767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-header,.modal-fullscreen-md-down .modal-footer{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width: 991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-header,.modal-fullscreen-lg-down .modal-footer{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width: 1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-header,.modal-fullscreen-xl-down .modal-footer{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width: 1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-header,.modal-fullscreen-xxl-down .modal-footer{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex: 1080;--bs-tooltip-max-width: 200px;--bs-tooltip-padding-x: .5rem;--bs-tooltip-padding-y: .25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:.875rem;--bs-tooltip-color: var(--bs-body-bg);--bs-tooltip-bg: var(--bs-emphasis-color);--bs-tooltip-border-radius: var(--bs-border-radius);--bs-tooltip-opacity: .9;--bs-tooltip-arrow-width: .8rem;--bs-tooltip-arrow-height: .4rem;z-index:var(--bs-tooltip-zindex);display:block;margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-top .tooltip-arrow,.bs-tooltip-auto[data-popper-placement^="top"] .tooltip-arrow{bottom:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-top .tooltip-arrow::before,.bs-tooltip-auto[data-popper-placement^="top"] .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-end .tooltip-arrow,.bs-tooltip-auto[data-popper-placement^="right"] .tooltip-arrow{left:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-end .tooltip-arrow::before,.bs-tooltip-auto[data-popper-placement^="right"] .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-bottom .tooltip-arrow,.bs-tooltip-auto[data-popper-placement^="bottom"] .tooltip-arrow{top:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-bottom .tooltip-arrow::before,.bs-tooltip-auto[data-popper-placement^="bottom"] .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-start .tooltip-arrow,.bs-tooltip-auto[data-popper-placement^="left"] .tooltip-arrow{right:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-start .tooltip-arrow::before,.bs-tooltip-auto[data-popper-placement^="left"] .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex: 1070;--bs-popover-max-width: 276px;--bs-popover-font-size:.875rem;--bs-popover-bg: var(--bs-body-bg);--bs-popover-border-width: var(--bs-border-width);--bs-popover-border-color: var(--bs-border-color-translucent);--bs-popover-border-radius: var(--bs-border-radius-lg);--bs-popover-inner-border-radius: calc(var(--bs-border-radius-lg) - var(--bs-border-width));--bs-popover-box-shadow: 0 0.5rem 1rem rgba(0,0,0,0.15);--bs-popover-header-padding-x: 1rem;--bs-popover-header-padding-y: .5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color: inherit;--bs-popover-header-bg: var(--bs-secondary-bg);--bs-popover-body-padding-x: 1rem;--bs-popover-body-padding-y: 1rem;--bs-popover-body-color: var(--bs-body-color);--bs-popover-arrow-width: 1rem;--bs-popover-arrow-height: .5rem;--bs-popover-arrow-border: var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::before,.popover .popover-arrow::after{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-top>.popover-arrow,.bs-popover-auto[data-popper-placement^="top"]>.popover-arrow{bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-top>.popover-arrow::before,.bs-popover-auto[data-popper-placement^="top"]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-auto[data-popper-placement^="top"]>.popover-arrow::after{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-top>.popover-arrow::before,.bs-popover-auto[data-popper-placement^="top"]>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-top>.popover-arrow::after,.bs-popover-auto[data-popper-placement^="top"]>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-end>.popover-arrow,.bs-popover-auto[data-popper-placement^="right"]>.popover-arrow{left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-end>.popover-arrow::before,.bs-popover-auto[data-popper-placement^="right"]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-auto[data-popper-placement^="right"]>.popover-arrow::after{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-end>.popover-arrow::before,.bs-popover-auto[data-popper-placement^="right"]>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-end>.popover-arrow::after,.bs-popover-auto[data-popper-placement^="right"]>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-bottom>.popover-arrow,.bs-popover-auto[data-popper-placement^="bottom"]>.popover-arrow{top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-bottom>.popover-arrow::before,.bs-popover-auto[data-popper-placement^="bottom"]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-auto[data-popper-placement^="bottom"]>.popover-arrow::after{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-bottom>.popover-arrow::before,.bs-popover-auto[data-popper-placement^="bottom"]>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-bottom>.popover-arrow::after,.bs-popover-auto[data-popper-placement^="bottom"]>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-bottom .popover-header::before,.bs-popover-auto[data-popper-placement^="bottom"] .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-.5 * var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-start>.popover-arrow,.bs-popover-auto[data-popper-placement^="left"]>.popover-arrow{right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-start>.popover-arrow::before,.bs-popover-auto[data-popper-placement^="left"]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-auto[data-popper-placement^="left"]>.popover-arrow::after{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-start>.popover-arrow::before,.bs-popover-auto[data-popper-placement^="left"]>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-start>.popover-arrow::after,.bs-popover-auto[data-popper-placement^="left"]>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y;-webkit-touch-action:pan-y;-moz-touch-action:pan-y;-ms-touch-action:pan-y;-o-touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;backface-visibility:hidden;-webkit-backface-visibility:hidden;-moz-backface-visibility:hidden;-ms-backface-visibility:hidden;-o-backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion: reduce){.carousel-item{transition:none}}.carousel-item.active,.carousel-item-next,.carousel-item-prev{display:block}.carousel-item-next:not(.carousel-item-start),.active.carousel-item-end{transform:translateX(100%)}.carousel-item-prev:not(.carousel-item-end),.active.carousel-item-start{transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item.active,.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end{z-index:1;opacity:1}.carousel-fade .active.carousel-item-start,.carousel-fade .active.carousel-item-end{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion: reduce){.carousel-fade .active.carousel-item-start,.carousel-fade .active.carousel-item-end{transition:none}}.carousel-control-prev,.carousel-control-next{position:absolute;top:0;bottom:0;z-index:1;display:flex;display:-webkit-flex;align-items:center;-webkit-align-items:center;justify-content:center;-webkit-justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:none;border:0;opacity:.5;transition:opacity 0.15s ease}@media (prefers-reduced-motion: reduce){.carousel-control-prev,.carousel-control-next{transition:none}}.carousel-control-prev:hover,.carousel-control-prev:focus,.carousel-control-next:hover,.carousel-control-next:focus{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-prev-icon,.carousel-control-next-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;display:-webkit-flex;justify-content:center;-webkit-justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;-webkit-flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity 0.6s ease}@media (prefers-reduced-motion: reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-prev-icon,.carousel-dark .carousel-control-next-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}[data-bs-theme="dark"] .carousel .carousel-control-prev-icon,[data-bs-theme="dark"] .carousel .carousel-control-next-icon,[data-bs-theme="dark"].carousel .carousel-control-prev-icon,[data-bs-theme="dark"].carousel .carousel-control-next-icon{filter:invert(1) grayscale(100)}[data-bs-theme="dark"] .carousel .carousel-indicators [data-bs-target],[data-bs-theme="dark"].carousel .carousel-indicators [data-bs-target]{background-color:#000}[data-bs-theme="dark"] .carousel .carousel-caption,[data-bs-theme="dark"].carousel .carousel-caption{color:#000}.spinner-grow,.spinner-border{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@keyframes spinner-border{to{transform:rotate(360deg) /* rtl:ignore */}}.spinner-border{--bs-spinner-width: 2rem;--bs-spinner-height: 2rem;--bs-spinner-vertical-align: -.125em;--bs-spinner-border-width: .25em;--bs-spinner-animation-speed: .75s;--bs-spinner-animation-name: spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width: 1rem;--bs-spinner-height: 1rem;--bs-spinner-border-width: .2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width: 2rem;--bs-spinner-height: 2rem;--bs-spinner-vertical-align: -.125em;--bs-spinner-animation-speed: .75s;--bs-spinner-animation-name: spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width: 1rem;--bs-spinner-height: 1rem}@media (prefers-reduced-motion: reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed: 1.5s}}.offcanvas,.offcanvas-xxl,.offcanvas-xl,.offcanvas-lg,.offcanvas-md,.offcanvas-sm{--bs-offcanvas-zindex: 1045;--bs-offcanvas-width: 400px;--bs-offcanvas-height: 30vh;--bs-offcanvas-padding-x: 1rem;--bs-offcanvas-padding-y: 1rem;--bs-offcanvas-color: var(--bs-body-color);--bs-offcanvas-bg: var(--bs-body-bg);--bs-offcanvas-border-width: var(--bs-border-width);--bs-offcanvas-border-color: var(--bs-border-color-translucent);--bs-offcanvas-box-shadow: 0 0.125rem 0.25rem rgba(0,0,0,0.075);--bs-offcanvas-transition: transform .3s ease-in-out;--bs-offcanvas-title-line-height: 1.5}@media (max-width: 575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width: 575.98px) and (prefers-reduced-motion: reduce){.offcanvas-sm{transition:none}}@media (max-width: 575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-sm.showing,.offcanvas-sm.show:not(.hiding){transform:none}.offcanvas-sm.showing,.offcanvas-sm.hiding,.offcanvas-sm.show{visibility:visible}}@media (min-width: 576px){.offcanvas-sm{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:transparent !important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible;background-color:transparent !important}}@media (max-width: 767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width: 767.98px) and (prefers-reduced-motion: reduce){.offcanvas-md{transition:none}}@media (max-width: 767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-md.showing,.offcanvas-md.show:not(.hiding){transform:none}.offcanvas-md.showing,.offcanvas-md.hiding,.offcanvas-md.show{visibility:visible}}@media (min-width: 768px){.offcanvas-md{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:transparent !important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible;background-color:transparent !important}}@media (max-width: 991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width: 991.98px) and (prefers-reduced-motion: reduce){.offcanvas-lg{transition:none}}@media (max-width: 991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-lg.showing,.offcanvas-lg.show:not(.hiding){transform:none}.offcanvas-lg.showing,.offcanvas-lg.hiding,.offcanvas-lg.show{visibility:visible}}@media (min-width: 992px){.offcanvas-lg{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:transparent !important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible;background-color:transparent !important}}@media (max-width: 1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width: 1199.98px) and (prefers-reduced-motion: reduce){.offcanvas-xl{transition:none}}@media (max-width: 1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xl.showing,.offcanvas-xl.show:not(.hiding){transform:none}.offcanvas-xl.showing,.offcanvas-xl.hiding,.offcanvas-xl.show{visibility:visible}}@media (min-width: 1200px){.offcanvas-xl{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:transparent !important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible;background-color:transparent !important}}@media (max-width: 1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width: 1399.98px) and (prefers-reduced-motion: reduce){.offcanvas-xxl{transition:none}}@media (max-width: 1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xxl.showing,.offcanvas-xxl.show:not(.hiding){transform:none}.offcanvas-xxl.showing,.offcanvas-xxl.hiding,.offcanvas-xxl.show{visibility:visible}}@media (min-width: 1400px){.offcanvas-xxl{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:transparent !important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;display:-webkit-flex;flex-grow:0;-webkit-flex-grow:0;padding:0;overflow-y:visible;background-color:transparent !important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;display:-webkit-flex;flex-direction:column;-webkit-flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}@media (prefers-reduced-motion: reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.showing,.offcanvas.show:not(.hiding){transform:none}.offcanvas.showing,.offcanvas.hiding,.offcanvas.show{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;display:-webkit-flex;align-items:center;-webkit-align-items:center;justify-content:space-between;-webkit-justify-content:space-between;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin-top:calc(-.5 * var(--bs-offcanvas-padding-y));margin-right:calc(-.5 * var(--bs-offcanvas-padding-x));margin-bottom:calc(-.5 * var(--bs-offcanvas-padding-y))}.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}.offcanvas-body{flex-grow:1;-webkit-flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{animation:placeholder-glow 2s ease-in-out infinite}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{mask-image:linear-gradient(130deg, #000 55%, rgba(0,0,0,0.8) 75%, #000 95%);-webkit-mask-image:linear-gradient(130deg, #000 55%, rgba(0,0,0,0.8) 75%, #000 95%);mask-size:200% 100%;-webkit-mask-size:200% 100%;animation:placeholder-wave 2s linear infinite}@keyframes placeholder-wave{100%{mask-position:-200% 0%;-webkit-mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-default{color:#000 !important;background-color:RGBA(var(--bs-default-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-primary{color:#fff !important;background-color:RGBA(var(--bs-primary-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-secondary{color:#fff !important;background-color:RGBA(var(--bs-secondary-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-success{color:#fff !important;background-color:RGBA(var(--bs-success-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-info{color:#000 !important;background-color:RGBA(var(--bs-info-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-warning{color:#000 !important;background-color:RGBA(var(--bs-warning-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-danger{color:#fff !important;background-color:RGBA(var(--bs-danger-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-light{color:#000 !important;background-color:RGBA(var(--bs-light-rgb), var(--bs-bg-opacity, 1)) !important}.text-bg-dark{color:#fff !important;background-color:RGBA(var(--bs-dark-rgb), var(--bs-bg-opacity, 1)) !important}.link-default{color:RGBA(var(--bs-default-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-default-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-default:hover,.link-default:focus{color:RGBA(229,232,235, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(229,232,235, var(--bs-link-underline-opacity, 1)) !important}.link-primary{color:RGBA(var(--bs-primary-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-primary-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-primary:hover,.link-primary:focus{color:RGBA(10,88,202, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(10,88,202, var(--bs-link-underline-opacity, 1)) !important}.link-secondary{color:RGBA(var(--bs-secondary-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-secondary-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-secondary:hover,.link-secondary:focus{color:RGBA(86,94,100, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(86,94,100, var(--bs-link-underline-opacity, 1)) !important}.link-success{color:RGBA(var(--bs-success-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-success-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-success:hover,.link-success:focus{color:RGBA(20,108,67, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(20,108,67, var(--bs-link-underline-opacity, 1)) !important}.link-info{color:RGBA(var(--bs-info-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-info-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-info:hover,.link-info:focus{color:RGBA(61,213,243, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(61,213,243, var(--bs-link-underline-opacity, 1)) !important}.link-warning{color:RGBA(var(--bs-warning-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-warning-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-warning:hover,.link-warning:focus{color:RGBA(255,205,57, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(255,205,57, var(--bs-link-underline-opacity, 1)) !important}.link-danger{color:RGBA(var(--bs-danger-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-danger-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-danger:hover,.link-danger:focus{color:RGBA(176,42,55, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(176,42,55, var(--bs-link-underline-opacity, 1)) !important}.link-light{color:RGBA(var(--bs-light-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-light-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-light:hover,.link-light:focus{color:RGBA(249,250,251, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(249,250,251, var(--bs-link-underline-opacity, 1)) !important}.link-dark{color:RGBA(var(--bs-dark-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-dark-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-dark:hover,.link-dark:focus{color:RGBA(26,30,33, var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(26,30,33, var(--bs-link-underline-opacity, 1)) !important}.link-body-emphasis{color:RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 1)) !important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-body-emphasis:hover,.link-body-emphasis:focus{color:RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 0.75)) !important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 0.75)) !important}.focus-ring:focus{outline:0;box-shadow:var(--bs-focus-ring-x, 0) var(--bs-focus-ring-y, 0) var(--bs-focus-ring-blur, 0) var(--bs-focus-ring-width) var(--bs-focus-ring-color)}.icon-link{display:inline-flex;gap:.375rem;align-items:center;-webkit-align-items:center;text-decoration-color:rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 0.5));text-underline-offset:.25em;backface-visibility:hidden;-webkit-backface-visibility:hidden;-moz-backface-visibility:hidden;-ms-backface-visibility:hidden;-o-backface-visibility:hidden}.icon-link>.bi{flex-shrink:0;-webkit-flex-shrink:0;width:1em;height:1em;fill:currentcolor;transition:0.2s ease-in-out transform}@media (prefers-reduced-motion: reduce){.icon-link>.bi{transition:none}}.icon-link-hover:hover>.bi,.icon-link-hover:focus-visible>.bi{transform:var(--bs-icon-link-transform, translate3d(0.25em, 0, 0))}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio: 100%}.ratio-4x3{--bs-aspect-ratio: calc(3 / 4 * 100%)}.ratio-16x9{--bs-aspect-ratio: calc(9 / 16 * 100%)}.ratio-21x9{--bs-aspect-ratio: calc(9 / 21 * 100%)}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:sticky;top:0;z-index:1020}.sticky-bottom{position:sticky;bottom:0;z-index:1020}@media (min-width: 576px){.sticky-sm-top{position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:sticky;bottom:0;z-index:1020}}@media (min-width: 768px){.sticky-md-top{position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:sticky;bottom:0;z-index:1020}}@media (min-width: 992px){.sticky-lg-top{position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:sticky;bottom:0;z-index:1020}}@media (min-width: 1200px){.sticky-xl-top{position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:sticky;bottom:0;z-index:1020}}@media (min-width: 1400px){.sticky-xxl-top{position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;display:-webkit-flex;flex-direction:row;-webkit-flex-direction:row;align-items:center;-webkit-align-items:center;align-self:stretch;-webkit-align-self:stretch}.vstack{display:flex;display:-webkit-flex;flex:1 1 auto;-webkit-flex:1 1 auto;flex-direction:column;-webkit-flex-direction:column;align-self:stretch;-webkit-align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){width:1px !important;height:1px !important;padding:0 !important;margin:-1px !important;overflow:hidden !important;clip:rect(0, 0, 0, 0) !important;white-space:nowrap !important;border:0 !important}.visually-hidden:not(caption),.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption){position:absolute !important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;-webkit-align-self:stretch;width:var(--bs-border-width);min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline !important}.align-top{vertical-align:top !important}.align-middle{vertical-align:middle !important}.align-bottom{vertical-align:bottom !important}.align-text-bottom{vertical-align:text-bottom !important}.align-text-top{vertical-align:text-top !important}.float-start{float:left !important}.float-end{float:right !important}.float-none{float:none !important}.object-fit-contain{object-fit:contain !important}.object-fit-cover{object-fit:cover !important}.object-fit-fill{object-fit:fill !important}.object-fit-scale{object-fit:scale-down !important}.object-fit-none{object-fit:none !important}.opacity-0{opacity:0 !important}.opacity-25{opacity:.25 !important}.opacity-50{opacity:.5 !important}.opacity-75{opacity:.75 !important}.opacity-100{opacity:1 !important}.overflow-auto{overflow:auto !important}.overflow-hidden{overflow:hidden !important}.overflow-visible{overflow:visible !important}.overflow-scroll{overflow:scroll !important}.overflow-x-auto{overflow-x:auto !important}.overflow-x-hidden{overflow-x:hidden !important}.overflow-x-visible{overflow-x:visible !important}.overflow-x-scroll{overflow-x:scroll !important}.overflow-y-auto{overflow-y:auto !important}.overflow-y-hidden{overflow-y:hidden !important}.overflow-y-visible{overflow-y:visible !important}.overflow-y-scroll{overflow-y:scroll !important}.d-inline{display:inline !important}.d-inline-block{display:inline-block !important}.d-block{display:block !important}.d-grid{display:grid !important}.d-inline-grid{display:inline-grid !important}.d-table{display:table !important}.d-table-row{display:table-row !important}.d-table-cell{display:table-cell !important}.d-flex{display:flex !important}.d-inline-flex{display:inline-flex !important}.d-none{display:none !important}.shadow{box-shadow:0 0.5rem 1rem rgba(0,0,0,0.15) !important}.shadow-sm{box-shadow:0 0.125rem 0.25rem rgba(0,0,0,0.075) !important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,0.175) !important}.shadow-none{box-shadow:none !important}.focus-ring-default{--bs-focus-ring-color: rgba(var(--bs-default-rgb), var(--bs-focus-ring-opacity))}.focus-ring-primary{--bs-focus-ring-color: rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-secondary{--bs-focus-ring-color: rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-success{--bs-focus-ring-color: rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity))}.focus-ring-info{--bs-focus-ring-color: rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity))}.focus-ring-warning{--bs-focus-ring-color: rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity))}.focus-ring-danger{--bs-focus-ring-color: rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity))}.focus-ring-light{--bs-focus-ring-color: rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity))}.focus-ring-dark{--bs-focus-ring-color: rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity))}.position-static{position:static !important}.position-relative{position:relative !important}.position-absolute{position:absolute !important}.position-fixed{position:fixed !important}.position-sticky{position:sticky !important}.top-0{top:0 !important}.top-50{top:50% !important}.top-100{top:100% !important}.bottom-0{bottom:0 !important}.bottom-50{bottom:50% !important}.bottom-100{bottom:100% !important}.start-0{left:0 !important}.start-50{left:50% !important}.start-100{left:100% !important}.end-0{right:0 !important}.end-50{right:50% !important}.end-100{right:100% !important}.translate-middle{transform:translate(-50%, -50%) !important}.translate-middle-x{transform:translateX(-50%) !important}.translate-middle-y{transform:translateY(-50%) !important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-0{border:0 !important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-top-0{border-top:0 !important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-end-0{border-right:0 !important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-bottom-0{border-bottom:0 !important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-start-0{border-left:0 !important}.border-default{--bs-border-opacity: 1;border-color:rgba(var(--bs-default-rgb), var(--bs-border-opacity)) !important}.border-primary{--bs-border-opacity: 1;border-color:rgba(var(--bs-primary-rgb), var(--bs-border-opacity)) !important}.border-secondary{--bs-border-opacity: 1;border-color:rgba(var(--bs-secondary-rgb), var(--bs-border-opacity)) !important}.border-success{--bs-border-opacity: 1;border-color:rgba(var(--bs-success-rgb), var(--bs-border-opacity)) !important}.border-info{--bs-border-opacity: 1;border-color:rgba(var(--bs-info-rgb), var(--bs-border-opacity)) !important}.border-warning{--bs-border-opacity: 1;border-color:rgba(var(--bs-warning-rgb), var(--bs-border-opacity)) !important}.border-danger{--bs-border-opacity: 1;border-color:rgba(var(--bs-danger-rgb), var(--bs-border-opacity)) !important}.border-light{--bs-border-opacity: 1;border-color:rgba(var(--bs-light-rgb), var(--bs-border-opacity)) !important}.border-dark{--bs-border-opacity: 1;border-color:rgba(var(--bs-dark-rgb), var(--bs-border-opacity)) !important}.border-black{--bs-border-opacity: 1;border-color:rgba(var(--bs-black-rgb), var(--bs-border-opacity)) !important}.border-white{--bs-border-opacity: 1;border-color:rgba(var(--bs-white-rgb), var(--bs-border-opacity)) !important}.border-primary-subtle{border-color:var(--bs-primary-border-subtle) !important}.border-secondary-subtle{border-color:var(--bs-secondary-border-subtle) !important}.border-success-subtle{border-color:var(--bs-success-border-subtle) !important}.border-info-subtle{border-color:var(--bs-info-border-subtle) !important}.border-warning-subtle{border-color:var(--bs-warning-border-subtle) !important}.border-danger-subtle{border-color:var(--bs-danger-border-subtle) !important}.border-light-subtle{border-color:var(--bs-light-border-subtle) !important}.border-dark-subtle{border-color:var(--bs-dark-border-subtle) !important}.border-1{border-width:1px !important}.border-2{border-width:2px !important}.border-3{border-width:3px !important}.border-4{border-width:4px !important}.border-5{border-width:5px !important}.border-opacity-10{--bs-border-opacity: .1}.border-opacity-25{--bs-border-opacity: .25}.border-opacity-50{--bs-border-opacity: .5}.border-opacity-75{--bs-border-opacity: .75}.border-opacity-100{--bs-border-opacity: 1}.w-25{width:25% !important}.w-50{width:50% !important}.w-75{width:75% !important}.w-100{width:100% !important}.w-auto{width:auto !important}.mw-100{max-width:100% !important}.vw-100{width:100vw !important}.min-vw-100{min-width:100vw !important}.h-25{height:25% !important}.h-50{height:50% !important}.h-75{height:75% !important}.h-100{height:100% !important}.h-auto{height:auto !important}.mh-100{max-height:100% !important}.vh-100{height:100vh !important}.min-vh-100{min-height:100vh !important}.flex-fill{flex:1 1 auto !important}.flex-row{flex-direction:row !important}.flex-column{flex-direction:column !important}.flex-row-reverse{flex-direction:row-reverse !important}.flex-column-reverse{flex-direction:column-reverse !important}.flex-grow-0{flex-grow:0 !important}.flex-grow-1{flex-grow:1 !important}.flex-shrink-0{flex-shrink:0 !important}.flex-shrink-1{flex-shrink:1 !important}.flex-wrap{flex-wrap:wrap !important}.flex-nowrap{flex-wrap:nowrap !important}.flex-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-start{justify-content:flex-start !important}.justify-content-end{justify-content:flex-end !important}.justify-content-center{justify-content:center !important}.justify-content-between{justify-content:space-between !important}.justify-content-around{justify-content:space-around !important}.justify-content-evenly{justify-content:space-evenly !important}.align-items-start{align-items:flex-start !important}.align-items-end{align-items:flex-end !important}.align-items-center{align-items:center !important}.align-items-baseline{align-items:baseline !important}.align-items-stretch{align-items:stretch !important}.align-content-start{align-content:flex-start !important}.align-content-end{align-content:flex-end !important}.align-content-center{align-content:center !important}.align-content-between{align-content:space-between !important}.align-content-around{align-content:space-around !important}.align-content-stretch{align-content:stretch !important}.align-self-auto{align-self:auto !important}.align-self-start{align-self:flex-start !important}.align-self-end{align-self:flex-end !important}.align-self-center{align-self:center !important}.align-self-baseline{align-self:baseline !important}.align-self-stretch{align-self:stretch !important}.order-first{order:-1 !important}.order-0{order:0 !important}.order-1{order:1 !important}.order-2{order:2 !important}.order-3{order:3 !important}.order-4{order:4 !important}.order-5{order:5 !important}.order-last{order:6 !important}.m-0{margin:0 !important}.m-1{margin:.25rem !important}.m-2{margin:.5rem !important}.m-3{margin:1rem !important}.m-4{margin:1.5rem !important}.m-5{margin:3rem !important}.m-auto{margin:auto !important}.mx-0{margin-right:0 !important;margin-left:0 !important}.mx-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-3{margin-right:1rem !important;margin-left:1rem !important}.mx-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-5{margin-right:3rem !important;margin-left:3rem !important}.mx-auto{margin-right:auto !important;margin-left:auto !important}.my-0{margin-top:0 !important;margin-bottom:0 !important}.my-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-0{margin-top:0 !important}.mt-1{margin-top:.25rem !important}.mt-2{margin-top:.5rem !important}.mt-3{margin-top:1rem !important}.mt-4{margin-top:1.5rem !important}.mt-5{margin-top:3rem !important}.mt-auto{margin-top:auto !important}.me-0{margin-right:0 !important}.me-1{margin-right:.25rem !important}.me-2{margin-right:.5rem !important}.me-3{margin-right:1rem !important}.me-4{margin-right:1.5rem !important}.me-5{margin-right:3rem !important}.me-auto{margin-right:auto !important}.mb-0{margin-bottom:0 !important}.mb-1{margin-bottom:.25rem !important}.mb-2{margin-bottom:.5rem !important}.mb-3{margin-bottom:1rem !important}.mb-4{margin-bottom:1.5rem !important}.mb-5{margin-bottom:3rem !important}.mb-auto{margin-bottom:auto !important}.ms-0{margin-left:0 !important}.ms-1{margin-left:.25rem !important}.ms-2{margin-left:.5rem !important}.ms-3{margin-left:1rem !important}.ms-4{margin-left:1.5rem !important}.ms-5{margin-left:3rem !important}.ms-auto{margin-left:auto !important}.p-0{padding:0 !important}.p-1{padding:.25rem !important}.p-2{padding:.5rem !important}.p-3{padding:1rem !important}.p-4{padding:1.5rem !important}.p-5{padding:3rem !important}.px-0{padding-right:0 !important;padding-left:0 !important}.px-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-3{padding-right:1rem !important;padding-left:1rem !important}.px-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-5{padding-right:3rem !important;padding-left:3rem !important}.py-0{padding-top:0 !important;padding-bottom:0 !important}.py-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-0{padding-top:0 !important}.pt-1{padding-top:.25rem !important}.pt-2{padding-top:.5rem !important}.pt-3{padding-top:1rem !important}.pt-4{padding-top:1.5rem !important}.pt-5{padding-top:3rem !important}.pe-0{padding-right:0 !important}.pe-1{padding-right:.25rem !important}.pe-2{padding-right:.5rem !important}.pe-3{padding-right:1rem !important}.pe-4{padding-right:1.5rem !important}.pe-5{padding-right:3rem !important}.pb-0{padding-bottom:0 !important}.pb-1{padding-bottom:.25rem !important}.pb-2{padding-bottom:.5rem !important}.pb-3{padding-bottom:1rem !important}.pb-4{padding-bottom:1.5rem !important}.pb-5{padding-bottom:3rem !important}.ps-0{padding-left:0 !important}.ps-1{padding-left:.25rem !important}.ps-2{padding-left:.5rem !important}.ps-3{padding-left:1rem !important}.ps-4{padding-left:1.5rem !important}.ps-5{padding-left:3rem !important}.gap-0{gap:0 !important}.gap-1{gap:.25rem !important}.gap-2{gap:.5rem !important}.gap-3{gap:1rem !important}.gap-4{gap:1.5rem !important}.gap-5{gap:3rem !important}.row-gap-0{row-gap:0 !important}.row-gap-1{row-gap:.25rem !important}.row-gap-2{row-gap:.5rem !important}.row-gap-3{row-gap:1rem !important}.row-gap-4{row-gap:1.5rem !important}.row-gap-5{row-gap:3rem !important}.column-gap-0{column-gap:0 !important}.column-gap-1{column-gap:.25rem !important}.column-gap-2{column-gap:.5rem !important}.column-gap-3{column-gap:1rem !important}.column-gap-4{column-gap:1.5rem !important}.column-gap-5{column-gap:3rem !important}.font-monospace{font-family:var(--bs-font-monospace) !important}.fs-1{font-size:calc(1.375rem + 1.5vw) !important}.fs-2{font-size:calc(1.325rem + .9vw) !important}.fs-3{font-size:calc(1.3rem + .6vw) !important}.fs-4{font-size:calc(1.275rem + .3vw) !important}.fs-5{font-size:1.25rem !important}.fs-6{font-size:1rem !important}.fst-italic{font-style:italic !important}.fst-normal{font-style:normal !important}.fw-lighter{font-weight:lighter !important}.fw-light{font-weight:300 !important}.fw-normal{font-weight:400 !important}.fw-medium{font-weight:500 !important}.fw-semibold{font-weight:600 !important}.fw-bold{font-weight:700 !important}.fw-bolder{font-weight:bolder !important}.lh-1{line-height:1 !important}.lh-sm{line-height:1.25 !important}.lh-base{line-height:1.5 !important}.lh-lg{line-height:2 !important}.text-start{text-align:left !important}.text-end{text-align:right !important}.text-center{text-align:center !important}.text-decoration-none{text-decoration:none !important}.text-decoration-underline{text-decoration:underline !important}.text-decoration-line-through{text-decoration:line-through !important}.text-lowercase{text-transform:lowercase !important}.text-uppercase{text-transform:uppercase !important}.text-capitalize{text-transform:capitalize !important}.text-wrap{white-space:normal !important}.text-nowrap{white-space:nowrap !important}.text-break{word-wrap:break-word !important;word-break:break-word !important}.text-default{--bs-text-opacity: 1;color:rgba(var(--bs-default-rgb), var(--bs-text-opacity)) !important}.text-primary{--bs-text-opacity: 1;color:rgba(var(--bs-primary-rgb), var(--bs-text-opacity)) !important}.text-secondary{--bs-text-opacity: 1;color:rgba(var(--bs-secondary-rgb), var(--bs-text-opacity)) !important}.text-success{--bs-text-opacity: 1;color:rgba(var(--bs-success-rgb), var(--bs-text-opacity)) !important}.text-info{--bs-text-opacity: 1;color:rgba(var(--bs-info-rgb), var(--bs-text-opacity)) !important}.text-warning{--bs-text-opacity: 1;color:rgba(var(--bs-warning-rgb), var(--bs-text-opacity)) !important}.text-danger{--bs-text-opacity: 1;color:rgba(var(--bs-danger-rgb), var(--bs-text-opacity)) !important}.text-light{--bs-text-opacity: 1;color:rgba(var(--bs-light-rgb), var(--bs-text-opacity)) !important}.text-dark{--bs-text-opacity: 1;color:rgba(var(--bs-dark-rgb), var(--bs-text-opacity)) !important}.text-black{--bs-text-opacity: 1;color:rgba(var(--bs-black-rgb), var(--bs-text-opacity)) !important}.text-white{--bs-text-opacity: 1;color:rgba(var(--bs-white-rgb), var(--bs-text-opacity)) !important}.text-body{--bs-text-opacity: 1;color:rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important}.text-muted{--bs-text-opacity: 1;color:var(--bs-secondary-color) !important}.text-black-50{--bs-text-opacity: 1;color:rgba(0,0,0,0.5) !important}.text-white-50{--bs-text-opacity: 1;color:rgba(255,255,255,0.5) !important}.text-body-secondary{--bs-text-opacity: 1;color:var(--bs-secondary-color) !important}.text-body-tertiary{--bs-text-opacity: 1;color:var(--bs-tertiary-color) !important}.text-body-emphasis{--bs-text-opacity: 1;color:var(--bs-emphasis-color) !important}.text-reset{--bs-text-opacity: 1;color:inherit !important}.text-opacity-25{--bs-text-opacity: .25}.text-opacity-50{--bs-text-opacity: .5}.text-opacity-75{--bs-text-opacity: .75}.text-opacity-100{--bs-text-opacity: 1}.text-primary-emphasis{color:var(--bs-primary-text-emphasis) !important}.text-secondary-emphasis{color:var(--bs-secondary-text-emphasis) !important}.text-success-emphasis{color:var(--bs-success-text-emphasis) !important}.text-info-emphasis{color:var(--bs-info-text-emphasis) !important}.text-warning-emphasis{color:var(--bs-warning-text-emphasis) !important}.text-danger-emphasis{color:var(--bs-danger-text-emphasis) !important}.text-light-emphasis{color:var(--bs-light-text-emphasis) !important}.text-dark-emphasis{color:var(--bs-dark-text-emphasis) !important}.link-opacity-10{--bs-link-opacity: .1}.link-opacity-10-hover:hover{--bs-link-opacity: .1}.link-opacity-25{--bs-link-opacity: .25}.link-opacity-25-hover:hover{--bs-link-opacity: .25}.link-opacity-50{--bs-link-opacity: .5}.link-opacity-50-hover:hover{--bs-link-opacity: .5}.link-opacity-75{--bs-link-opacity: .75}.link-opacity-75-hover:hover{--bs-link-opacity: .75}.link-opacity-100{--bs-link-opacity: 1}.link-opacity-100-hover:hover{--bs-link-opacity: 1}.link-offset-1{text-underline-offset:.125em !important}.link-offset-1-hover:hover{text-underline-offset:.125em !important}.link-offset-2{text-underline-offset:.25em !important}.link-offset-2-hover:hover{text-underline-offset:.25em !important}.link-offset-3{text-underline-offset:.375em !important}.link-offset-3-hover:hover{text-underline-offset:.375em !important}.link-underline-default{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-default-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-primary{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-primary-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-secondary{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-secondary-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-success{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-success-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-info{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-info-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-warning{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-warning-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-danger{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-danger-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-light{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-light-rgb), var(--bs-link-underline-opacity)) !important}.link-underline-dark{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-dark-rgb), var(--bs-link-underline-opacity)) !important}.link-underline{--bs-link-underline-opacity: 1;text-decoration-color:rgba(var(--bs-link-color-rgb), var(--bs-link-underline-opacity, 1)) !important}.link-underline-opacity-0{--bs-link-underline-opacity: 0}.link-underline-opacity-0-hover:hover{--bs-link-underline-opacity: 0}.link-underline-opacity-10{--bs-link-underline-opacity: .1}.link-underline-opacity-10-hover:hover{--bs-link-underline-opacity: .1}.link-underline-opacity-25{--bs-link-underline-opacity: .25}.link-underline-opacity-25-hover:hover{--bs-link-underline-opacity: .25}.link-underline-opacity-50{--bs-link-underline-opacity: .5}.link-underline-opacity-50-hover:hover{--bs-link-underline-opacity: .5}.link-underline-opacity-75{--bs-link-underline-opacity: .75}.link-underline-opacity-75-hover:hover{--bs-link-underline-opacity: .75}.link-underline-opacity-100{--bs-link-underline-opacity: 1}.link-underline-opacity-100-hover:hover{--bs-link-underline-opacity: 1}.bg-default{--bs-bg-opacity: 1;background-color:rgba(var(--bs-default-rgb), var(--bs-bg-opacity)) !important}.bg-primary{--bs-bg-opacity: 1;background-color:rgba(var(--bs-primary-rgb), var(--bs-bg-opacity)) !important}.bg-secondary{--bs-bg-opacity: 1;background-color:rgba(var(--bs-secondary-rgb), var(--bs-bg-opacity)) !important}.bg-success{--bs-bg-opacity: 1;background-color:rgba(var(--bs-success-rgb), var(--bs-bg-opacity)) !important}.bg-info{--bs-bg-opacity: 1;background-color:rgba(var(--bs-info-rgb), var(--bs-bg-opacity)) !important}.bg-warning{--bs-bg-opacity: 1;background-color:rgba(var(--bs-warning-rgb), var(--bs-bg-opacity)) !important}.bg-danger{--bs-bg-opacity: 1;background-color:rgba(var(--bs-danger-rgb), var(--bs-bg-opacity)) !important}.bg-light{--bs-bg-opacity: 1;background-color:rgba(var(--bs-light-rgb), var(--bs-bg-opacity)) !important}.bg-dark{--bs-bg-opacity: 1;background-color:rgba(var(--bs-dark-rgb), var(--bs-bg-opacity)) !important}.bg-black{--bs-bg-opacity: 1;background-color:rgba(var(--bs-black-rgb), var(--bs-bg-opacity)) !important}.bg-white{--bs-bg-opacity: 1;background-color:rgba(var(--bs-white-rgb), var(--bs-bg-opacity)) !important}.bg-body{--bs-bg-opacity: 1;background-color:rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity)) !important}.bg-transparent{--bs-bg-opacity: 1;background-color:rgba(0,0,0,0) !important}.bg-body-secondary{--bs-bg-opacity: 1;background-color:rgba(var(--bs-secondary-bg-rgb), var(--bs-bg-opacity)) !important}.bg-body-tertiary{--bs-bg-opacity: 1;background-color:rgba(var(--bs-tertiary-bg-rgb), var(--bs-bg-opacity)) !important}.bg-opacity-10{--bs-bg-opacity: .1}.bg-opacity-25{--bs-bg-opacity: .25}.bg-opacity-50{--bs-bg-opacity: .5}.bg-opacity-75{--bs-bg-opacity: .75}.bg-opacity-100{--bs-bg-opacity: 1}.bg-primary-subtle{background-color:var(--bs-primary-bg-subtle) !important}.bg-secondary-subtle{background-color:var(--bs-secondary-bg-subtle) !important}.bg-success-subtle{background-color:var(--bs-success-bg-subtle) !important}.bg-info-subtle{background-color:var(--bs-info-bg-subtle) !important}.bg-warning-subtle{background-color:var(--bs-warning-bg-subtle) !important}.bg-danger-subtle{background-color:var(--bs-danger-bg-subtle) !important}.bg-light-subtle{background-color:var(--bs-light-bg-subtle) !important}.bg-dark-subtle{background-color:var(--bs-dark-bg-subtle) !important}.bg-gradient{background-image:var(--bs-gradient) !important}.user-select-all{user-select:all !important}.user-select-auto{user-select:auto !important}.user-select-none{user-select:none !important}.pe-none{pointer-events:none !important}.pe-auto{pointer-events:auto !important}.rounded{border-radius:var(--bs-border-radius) !important}.rounded-0{border-radius:0 !important}.rounded-1{border-radius:var(--bs-border-radius-sm) !important}.rounded-2{border-radius:var(--bs-border-radius) !important}.rounded-3{border-radius:var(--bs-border-radius-lg) !important}.rounded-4{border-radius:var(--bs-border-radius-xl) !important}.rounded-5{border-radius:var(--bs-border-radius-xxl) !important}.rounded-circle{border-radius:50% !important}.rounded-pill{border-radius:var(--bs-border-radius-pill) !important}.rounded-top{border-top-left-radius:var(--bs-border-radius) !important;border-top-right-radius:var(--bs-border-radius) !important}.rounded-top-0{border-top-left-radius:0 !important;border-top-right-radius:0 !important}.rounded-top-1{border-top-left-radius:var(--bs-border-radius-sm) !important;border-top-right-radius:var(--bs-border-radius-sm) !important}.rounded-top-2{border-top-left-radius:var(--bs-border-radius) !important;border-top-right-radius:var(--bs-border-radius) !important}.rounded-top-3{border-top-left-radius:var(--bs-border-radius-lg) !important;border-top-right-radius:var(--bs-border-radius-lg) !important}.rounded-top-4{border-top-left-radius:var(--bs-border-radius-xl) !important;border-top-right-radius:var(--bs-border-radius-xl) !important}.rounded-top-5{border-top-left-radius:var(--bs-border-radius-xxl) !important;border-top-right-radius:var(--bs-border-radius-xxl) !important}.rounded-top-circle{border-top-left-radius:50% !important;border-top-right-radius:50% !important}.rounded-top-pill{border-top-left-radius:var(--bs-border-radius-pill) !important;border-top-right-radius:var(--bs-border-radius-pill) !important}.rounded-end{border-top-right-radius:var(--bs-border-radius) !important;border-bottom-right-radius:var(--bs-border-radius) !important}.rounded-end-0{border-top-right-radius:0 !important;border-bottom-right-radius:0 !important}.rounded-end-1{border-top-right-radius:var(--bs-border-radius-sm) !important;border-bottom-right-radius:var(--bs-border-radius-sm) !important}.rounded-end-2{border-top-right-radius:var(--bs-border-radius) !important;border-bottom-right-radius:var(--bs-border-radius) !important}.rounded-end-3{border-top-right-radius:var(--bs-border-radius-lg) !important;border-bottom-right-radius:var(--bs-border-radius-lg) !important}.rounded-end-4{border-top-right-radius:var(--bs-border-radius-xl) !important;border-bottom-right-radius:var(--bs-border-radius-xl) !important}.rounded-end-5{border-top-right-radius:var(--bs-border-radius-xxl) !important;border-bottom-right-radius:var(--bs-border-radius-xxl) !important}.rounded-end-circle{border-top-right-radius:50% !important;border-bottom-right-radius:50% !important}.rounded-end-pill{border-top-right-radius:var(--bs-border-radius-pill) !important;border-bottom-right-radius:var(--bs-border-radius-pill) !important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius) !important;border-bottom-left-radius:var(--bs-border-radius) !important}.rounded-bottom-0{border-bottom-right-radius:0 !important;border-bottom-left-radius:0 !important}.rounded-bottom-1{border-bottom-right-radius:var(--bs-border-radius-sm) !important;border-bottom-left-radius:var(--bs-border-radius-sm) !important}.rounded-bottom-2{border-bottom-right-radius:var(--bs-border-radius) !important;border-bottom-left-radius:var(--bs-border-radius) !important}.rounded-bottom-3{border-bottom-right-radius:var(--bs-border-radius-lg) !important;border-bottom-left-radius:var(--bs-border-radius-lg) !important}.rounded-bottom-4{border-bottom-right-radius:var(--bs-border-radius-xl) !important;border-bottom-left-radius:var(--bs-border-radius-xl) !important}.rounded-bottom-5{border-bottom-right-radius:var(--bs-border-radius-xxl) !important;border-bottom-left-radius:var(--bs-border-radius-xxl) !important}.rounded-bottom-circle{border-bottom-right-radius:50% !important;border-bottom-left-radius:50% !important}.rounded-bottom-pill{border-bottom-right-radius:var(--bs-border-radius-pill) !important;border-bottom-left-radius:var(--bs-border-radius-pill) !important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius) !important;border-top-left-radius:var(--bs-border-radius) !important}.rounded-start-0{border-bottom-left-radius:0 !important;border-top-left-radius:0 !important}.rounded-start-1{border-bottom-left-radius:var(--bs-border-radius-sm) !important;border-top-left-radius:var(--bs-border-radius-sm) !important}.rounded-start-2{border-bottom-left-radius:var(--bs-border-radius) !important;border-top-left-radius:var(--bs-border-radius) !important}.rounded-start-3{border-bottom-left-radius:var(--bs-border-radius-lg) !important;border-top-left-radius:var(--bs-border-radius-lg) !important}.rounded-start-4{border-bottom-left-radius:var(--bs-border-radius-xl) !important;border-top-left-radius:var(--bs-border-radius-xl) !important}.rounded-start-5{border-bottom-left-radius:var(--bs-border-radius-xxl) !important;border-top-left-radius:var(--bs-border-radius-xxl) !important}.rounded-start-circle{border-bottom-left-radius:50% !important;border-top-left-radius:50% !important}.rounded-start-pill{border-bottom-left-radius:var(--bs-border-radius-pill) !important;border-top-left-radius:var(--bs-border-radius-pill) !important}.visible{visibility:visible !important}.invisible{visibility:hidden !important}.z-n1{z-index:-1 !important}.z-0{z-index:0 !important}.z-1{z-index:1 !important}.z-2{z-index:2 !important}.z-3{z-index:3 !important}@media (min-width: 576px){.float-sm-start{float:left !important}.float-sm-end{float:right !important}.float-sm-none{float:none !important}.object-fit-sm-contain{object-fit:contain !important}.object-fit-sm-cover{object-fit:cover !important}.object-fit-sm-fill{object-fit:fill !important}.object-fit-sm-scale{object-fit:scale-down !important}.object-fit-sm-none{object-fit:none !important}.d-sm-inline{display:inline !important}.d-sm-inline-block{display:inline-block !important}.d-sm-block{display:block !important}.d-sm-grid{display:grid !important}.d-sm-inline-grid{display:inline-grid !important}.d-sm-table{display:table !important}.d-sm-table-row{display:table-row !important}.d-sm-table-cell{display:table-cell !important}.d-sm-flex{display:flex !important}.d-sm-inline-flex{display:inline-flex !important}.d-sm-none{display:none !important}.flex-sm-fill{flex:1 1 auto !important}.flex-sm-row{flex-direction:row !important}.flex-sm-column{flex-direction:column !important}.flex-sm-row-reverse{flex-direction:row-reverse !important}.flex-sm-column-reverse{flex-direction:column-reverse !important}.flex-sm-grow-0{flex-grow:0 !important}.flex-sm-grow-1{flex-grow:1 !important}.flex-sm-shrink-0{flex-shrink:0 !important}.flex-sm-shrink-1{flex-shrink:1 !important}.flex-sm-wrap{flex-wrap:wrap !important}.flex-sm-nowrap{flex-wrap:nowrap !important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-sm-start{justify-content:flex-start !important}.justify-content-sm-end{justify-content:flex-end !important}.justify-content-sm-center{justify-content:center !important}.justify-content-sm-between{justify-content:space-between !important}.justify-content-sm-around{justify-content:space-around !important}.justify-content-sm-evenly{justify-content:space-evenly !important}.align-items-sm-start{align-items:flex-start !important}.align-items-sm-end{align-items:flex-end !important}.align-items-sm-center{align-items:center !important}.align-items-sm-baseline{align-items:baseline !important}.align-items-sm-stretch{align-items:stretch !important}.align-content-sm-start{align-content:flex-start !important}.align-content-sm-end{align-content:flex-end !important}.align-content-sm-center{align-content:center !important}.align-content-sm-between{align-content:space-between !important}.align-content-sm-around{align-content:space-around !important}.align-content-sm-stretch{align-content:stretch !important}.align-self-sm-auto{align-self:auto !important}.align-self-sm-start{align-self:flex-start !important}.align-self-sm-end{align-self:flex-end !important}.align-self-sm-center{align-self:center !important}.align-self-sm-baseline{align-self:baseline !important}.align-self-sm-stretch{align-self:stretch !important}.order-sm-first{order:-1 !important}.order-sm-0{order:0 !important}.order-sm-1{order:1 !important}.order-sm-2{order:2 !important}.order-sm-3{order:3 !important}.order-sm-4{order:4 !important}.order-sm-5{order:5 !important}.order-sm-last{order:6 !important}.m-sm-0{margin:0 !important}.m-sm-1{margin:.25rem !important}.m-sm-2{margin:.5rem !important}.m-sm-3{margin:1rem !important}.m-sm-4{margin:1.5rem !important}.m-sm-5{margin:3rem !important}.m-sm-auto{margin:auto !important}.mx-sm-0{margin-right:0 !important;margin-left:0 !important}.mx-sm-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-sm-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-sm-3{margin-right:1rem !important;margin-left:1rem !important}.mx-sm-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-sm-5{margin-right:3rem !important;margin-left:3rem !important}.mx-sm-auto{margin-right:auto !important;margin-left:auto !important}.my-sm-0{margin-top:0 !important;margin-bottom:0 !important}.my-sm-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-sm-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-sm-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-sm-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-sm-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-sm-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-sm-0{margin-top:0 !important}.mt-sm-1{margin-top:.25rem !important}.mt-sm-2{margin-top:.5rem !important}.mt-sm-3{margin-top:1rem !important}.mt-sm-4{margin-top:1.5rem !important}.mt-sm-5{margin-top:3rem !important}.mt-sm-auto{margin-top:auto !important}.me-sm-0{margin-right:0 !important}.me-sm-1{margin-right:.25rem !important}.me-sm-2{margin-right:.5rem !important}.me-sm-3{margin-right:1rem !important}.me-sm-4{margin-right:1.5rem !important}.me-sm-5{margin-right:3rem !important}.me-sm-auto{margin-right:auto !important}.mb-sm-0{margin-bottom:0 !important}.mb-sm-1{margin-bottom:.25rem !important}.mb-sm-2{margin-bottom:.5rem !important}.mb-sm-3{margin-bottom:1rem !important}.mb-sm-4{margin-bottom:1.5rem !important}.mb-sm-5{margin-bottom:3rem !important}.mb-sm-auto{margin-bottom:auto !important}.ms-sm-0{margin-left:0 !important}.ms-sm-1{margin-left:.25rem !important}.ms-sm-2{margin-left:.5rem !important}.ms-sm-3{margin-left:1rem !important}.ms-sm-4{margin-left:1.5rem !important}.ms-sm-5{margin-left:3rem !important}.ms-sm-auto{margin-left:auto !important}.p-sm-0{padding:0 !important}.p-sm-1{padding:.25rem !important}.p-sm-2{padding:.5rem !important}.p-sm-3{padding:1rem !important}.p-sm-4{padding:1.5rem !important}.p-sm-5{padding:3rem !important}.px-sm-0{padding-right:0 !important;padding-left:0 !important}.px-sm-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-sm-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-sm-3{padding-right:1rem !important;padding-left:1rem !important}.px-sm-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-sm-5{padding-right:3rem !important;padding-left:3rem !important}.py-sm-0{padding-top:0 !important;padding-bottom:0 !important}.py-sm-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-sm-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-sm-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-sm-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-sm-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-sm-0{padding-top:0 !important}.pt-sm-1{padding-top:.25rem !important}.pt-sm-2{padding-top:.5rem !important}.pt-sm-3{padding-top:1rem !important}.pt-sm-4{padding-top:1.5rem !important}.pt-sm-5{padding-top:3rem !important}.pe-sm-0{padding-right:0 !important}.pe-sm-1{padding-right:.25rem !important}.pe-sm-2{padding-right:.5rem !important}.pe-sm-3{padding-right:1rem !important}.pe-sm-4{padding-right:1.5rem !important}.pe-sm-5{padding-right:3rem !important}.pb-sm-0{padding-bottom:0 !important}.pb-sm-1{padding-bottom:.25rem !important}.pb-sm-2{padding-bottom:.5rem !important}.pb-sm-3{padding-bottom:1rem !important}.pb-sm-4{padding-bottom:1.5rem !important}.pb-sm-5{padding-bottom:3rem !important}.ps-sm-0{padding-left:0 !important}.ps-sm-1{padding-left:.25rem !important}.ps-sm-2{padding-left:.5rem !important}.ps-sm-3{padding-left:1rem !important}.ps-sm-4{padding-left:1.5rem !important}.ps-sm-5{padding-left:3rem !important}.gap-sm-0{gap:0 !important}.gap-sm-1{gap:.25rem !important}.gap-sm-2{gap:.5rem !important}.gap-sm-3{gap:1rem !important}.gap-sm-4{gap:1.5rem !important}.gap-sm-5{gap:3rem !important}.row-gap-sm-0{row-gap:0 !important}.row-gap-sm-1{row-gap:.25rem !important}.row-gap-sm-2{row-gap:.5rem !important}.row-gap-sm-3{row-gap:1rem !important}.row-gap-sm-4{row-gap:1.5rem !important}.row-gap-sm-5{row-gap:3rem !important}.column-gap-sm-0{column-gap:0 !important}.column-gap-sm-1{column-gap:.25rem !important}.column-gap-sm-2{column-gap:.5rem !important}.column-gap-sm-3{column-gap:1rem !important}.column-gap-sm-4{column-gap:1.5rem !important}.column-gap-sm-5{column-gap:3rem !important}.text-sm-start{text-align:left !important}.text-sm-end{text-align:right !important}.text-sm-center{text-align:center !important}}@media (min-width: 768px){.float-md-start{float:left !important}.float-md-end{float:right !important}.float-md-none{float:none !important}.object-fit-md-contain{object-fit:contain !important}.object-fit-md-cover{object-fit:cover !important}.object-fit-md-fill{object-fit:fill !important}.object-fit-md-scale{object-fit:scale-down !important}.object-fit-md-none{object-fit:none !important}.d-md-inline{display:inline !important}.d-md-inline-block{display:inline-block !important}.d-md-block{display:block !important}.d-md-grid{display:grid !important}.d-md-inline-grid{display:inline-grid !important}.d-md-table{display:table !important}.d-md-table-row{display:table-row !important}.d-md-table-cell{display:table-cell !important}.d-md-flex{display:flex !important}.d-md-inline-flex{display:inline-flex !important}.d-md-none{display:none !important}.flex-md-fill{flex:1 1 auto !important}.flex-md-row{flex-direction:row !important}.flex-md-column{flex-direction:column !important}.flex-md-row-reverse{flex-direction:row-reverse !important}.flex-md-column-reverse{flex-direction:column-reverse !important}.flex-md-grow-0{flex-grow:0 !important}.flex-md-grow-1{flex-grow:1 !important}.flex-md-shrink-0{flex-shrink:0 !important}.flex-md-shrink-1{flex-shrink:1 !important}.flex-md-wrap{flex-wrap:wrap !important}.flex-md-nowrap{flex-wrap:nowrap !important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-md-start{justify-content:flex-start !important}.justify-content-md-end{justify-content:flex-end !important}.justify-content-md-center{justify-content:center !important}.justify-content-md-between{justify-content:space-between !important}.justify-content-md-around{justify-content:space-around !important}.justify-content-md-evenly{justify-content:space-evenly !important}.align-items-md-start{align-items:flex-start !important}.align-items-md-end{align-items:flex-end !important}.align-items-md-center{align-items:center !important}.align-items-md-baseline{align-items:baseline !important}.align-items-md-stretch{align-items:stretch !important}.align-content-md-start{align-content:flex-start !important}.align-content-md-end{align-content:flex-end !important}.align-content-md-center{align-content:center !important}.align-content-md-between{align-content:space-between !important}.align-content-md-around{align-content:space-around !important}.align-content-md-stretch{align-content:stretch !important}.align-self-md-auto{align-self:auto !important}.align-self-md-start{align-self:flex-start !important}.align-self-md-end{align-self:flex-end !important}.align-self-md-center{align-self:center !important}.align-self-md-baseline{align-self:baseline !important}.align-self-md-stretch{align-self:stretch !important}.order-md-first{order:-1 !important}.order-md-0{order:0 !important}.order-md-1{order:1 !important}.order-md-2{order:2 !important}.order-md-3{order:3 !important}.order-md-4{order:4 !important}.order-md-5{order:5 !important}.order-md-last{order:6 !important}.m-md-0{margin:0 !important}.m-md-1{margin:.25rem !important}.m-md-2{margin:.5rem !important}.m-md-3{margin:1rem !important}.m-md-4{margin:1.5rem !important}.m-md-5{margin:3rem !important}.m-md-auto{margin:auto !important}.mx-md-0{margin-right:0 !important;margin-left:0 !important}.mx-md-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-md-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-md-3{margin-right:1rem !important;margin-left:1rem !important}.mx-md-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-md-5{margin-right:3rem !important;margin-left:3rem !important}.mx-md-auto{margin-right:auto !important;margin-left:auto !important}.my-md-0{margin-top:0 !important;margin-bottom:0 !important}.my-md-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-md-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-md-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-md-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-md-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-md-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-md-0{margin-top:0 !important}.mt-md-1{margin-top:.25rem !important}.mt-md-2{margin-top:.5rem !important}.mt-md-3{margin-top:1rem !important}.mt-md-4{margin-top:1.5rem !important}.mt-md-5{margin-top:3rem !important}.mt-md-auto{margin-top:auto !important}.me-md-0{margin-right:0 !important}.me-md-1{margin-right:.25rem !important}.me-md-2{margin-right:.5rem !important}.me-md-3{margin-right:1rem !important}.me-md-4{margin-right:1.5rem !important}.me-md-5{margin-right:3rem !important}.me-md-auto{margin-right:auto !important}.mb-md-0{margin-bottom:0 !important}.mb-md-1{margin-bottom:.25rem !important}.mb-md-2{margin-bottom:.5rem !important}.mb-md-3{margin-bottom:1rem !important}.mb-md-4{margin-bottom:1.5rem !important}.mb-md-5{margin-bottom:3rem !important}.mb-md-auto{margin-bottom:auto !important}.ms-md-0{margin-left:0 !important}.ms-md-1{margin-left:.25rem !important}.ms-md-2{margin-left:.5rem !important}.ms-md-3{margin-left:1rem !important}.ms-md-4{margin-left:1.5rem !important}.ms-md-5{margin-left:3rem !important}.ms-md-auto{margin-left:auto !important}.p-md-0{padding:0 !important}.p-md-1{padding:.25rem !important}.p-md-2{padding:.5rem !important}.p-md-3{padding:1rem !important}.p-md-4{padding:1.5rem !important}.p-md-5{padding:3rem !important}.px-md-0{padding-right:0 !important;padding-left:0 !important}.px-md-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-md-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-md-3{padding-right:1rem !important;padding-left:1rem !important}.px-md-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-md-5{padding-right:3rem !important;padding-left:3rem !important}.py-md-0{padding-top:0 !important;padding-bottom:0 !important}.py-md-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-md-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-md-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-md-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-md-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-md-0{padding-top:0 !important}.pt-md-1{padding-top:.25rem !important}.pt-md-2{padding-top:.5rem !important}.pt-md-3{padding-top:1rem !important}.pt-md-4{padding-top:1.5rem !important}.pt-md-5{padding-top:3rem !important}.pe-md-0{padding-right:0 !important}.pe-md-1{padding-right:.25rem !important}.pe-md-2{padding-right:.5rem !important}.pe-md-3{padding-right:1rem !important}.pe-md-4{padding-right:1.5rem !important}.pe-md-5{padding-right:3rem !important}.pb-md-0{padding-bottom:0 !important}.pb-md-1{padding-bottom:.25rem !important}.pb-md-2{padding-bottom:.5rem !important}.pb-md-3{padding-bottom:1rem !important}.pb-md-4{padding-bottom:1.5rem !important}.pb-md-5{padding-bottom:3rem !important}.ps-md-0{padding-left:0 !important}.ps-md-1{padding-left:.25rem !important}.ps-md-2{padding-left:.5rem !important}.ps-md-3{padding-left:1rem !important}.ps-md-4{padding-left:1.5rem !important}.ps-md-5{padding-left:3rem !important}.gap-md-0{gap:0 !important}.gap-md-1{gap:.25rem !important}.gap-md-2{gap:.5rem !important}.gap-md-3{gap:1rem !important}.gap-md-4{gap:1.5rem !important}.gap-md-5{gap:3rem !important}.row-gap-md-0{row-gap:0 !important}.row-gap-md-1{row-gap:.25rem !important}.row-gap-md-2{row-gap:.5rem !important}.row-gap-md-3{row-gap:1rem !important}.row-gap-md-4{row-gap:1.5rem !important}.row-gap-md-5{row-gap:3rem !important}.column-gap-md-0{column-gap:0 !important}.column-gap-md-1{column-gap:.25rem !important}.column-gap-md-2{column-gap:.5rem !important}.column-gap-md-3{column-gap:1rem !important}.column-gap-md-4{column-gap:1.5rem !important}.column-gap-md-5{column-gap:3rem !important}.text-md-start{text-align:left !important}.text-md-end{text-align:right !important}.text-md-center{text-align:center !important}}@media (min-width: 992px){.float-lg-start{float:left !important}.float-lg-end{float:right !important}.float-lg-none{float:none !important}.object-fit-lg-contain{object-fit:contain !important}.object-fit-lg-cover{object-fit:cover !important}.object-fit-lg-fill{object-fit:fill !important}.object-fit-lg-scale{object-fit:scale-down !important}.object-fit-lg-none{object-fit:none !important}.d-lg-inline{display:inline !important}.d-lg-inline-block{display:inline-block !important}.d-lg-block{display:block !important}.d-lg-grid{display:grid !important}.d-lg-inline-grid{display:inline-grid !important}.d-lg-table{display:table !important}.d-lg-table-row{display:table-row !important}.d-lg-table-cell{display:table-cell !important}.d-lg-flex{display:flex !important}.d-lg-inline-flex{display:inline-flex !important}.d-lg-none{display:none !important}.flex-lg-fill{flex:1 1 auto !important}.flex-lg-row{flex-direction:row !important}.flex-lg-column{flex-direction:column !important}.flex-lg-row-reverse{flex-direction:row-reverse !important}.flex-lg-column-reverse{flex-direction:column-reverse !important}.flex-lg-grow-0{flex-grow:0 !important}.flex-lg-grow-1{flex-grow:1 !important}.flex-lg-shrink-0{flex-shrink:0 !important}.flex-lg-shrink-1{flex-shrink:1 !important}.flex-lg-wrap{flex-wrap:wrap !important}.flex-lg-nowrap{flex-wrap:nowrap !important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-lg-start{justify-content:flex-start !important}.justify-content-lg-end{justify-content:flex-end !important}.justify-content-lg-center{justify-content:center !important}.justify-content-lg-between{justify-content:space-between !important}.justify-content-lg-around{justify-content:space-around !important}.justify-content-lg-evenly{justify-content:space-evenly !important}.align-items-lg-start{align-items:flex-start !important}.align-items-lg-end{align-items:flex-end !important}.align-items-lg-center{align-items:center !important}.align-items-lg-baseline{align-items:baseline !important}.align-items-lg-stretch{align-items:stretch !important}.align-content-lg-start{align-content:flex-start !important}.align-content-lg-end{align-content:flex-end !important}.align-content-lg-center{align-content:center !important}.align-content-lg-between{align-content:space-between !important}.align-content-lg-around{align-content:space-around !important}.align-content-lg-stretch{align-content:stretch !important}.align-self-lg-auto{align-self:auto !important}.align-self-lg-start{align-self:flex-start !important}.align-self-lg-end{align-self:flex-end !important}.align-self-lg-center{align-self:center !important}.align-self-lg-baseline{align-self:baseline !important}.align-self-lg-stretch{align-self:stretch !important}.order-lg-first{order:-1 !important}.order-lg-0{order:0 !important}.order-lg-1{order:1 !important}.order-lg-2{order:2 !important}.order-lg-3{order:3 !important}.order-lg-4{order:4 !important}.order-lg-5{order:5 !important}.order-lg-last{order:6 !important}.m-lg-0{margin:0 !important}.m-lg-1{margin:.25rem !important}.m-lg-2{margin:.5rem !important}.m-lg-3{margin:1rem !important}.m-lg-4{margin:1.5rem !important}.m-lg-5{margin:3rem !important}.m-lg-auto{margin:auto !important}.mx-lg-0{margin-right:0 !important;margin-left:0 !important}.mx-lg-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-lg-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-lg-3{margin-right:1rem !important;margin-left:1rem !important}.mx-lg-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-lg-5{margin-right:3rem !important;margin-left:3rem !important}.mx-lg-auto{margin-right:auto !important;margin-left:auto !important}.my-lg-0{margin-top:0 !important;margin-bottom:0 !important}.my-lg-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-lg-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-lg-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-lg-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-lg-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-lg-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-lg-0{margin-top:0 !important}.mt-lg-1{margin-top:.25rem !important}.mt-lg-2{margin-top:.5rem !important}.mt-lg-3{margin-top:1rem !important}.mt-lg-4{margin-top:1.5rem !important}.mt-lg-5{margin-top:3rem !important}.mt-lg-auto{margin-top:auto !important}.me-lg-0{margin-right:0 !important}.me-lg-1{margin-right:.25rem !important}.me-lg-2{margin-right:.5rem !important}.me-lg-3{margin-right:1rem !important}.me-lg-4{margin-right:1.5rem !important}.me-lg-5{margin-right:3rem !important}.me-lg-auto{margin-right:auto !important}.mb-lg-0{margin-bottom:0 !important}.mb-lg-1{margin-bottom:.25rem !important}.mb-lg-2{margin-bottom:.5rem !important}.mb-lg-3{margin-bottom:1rem !important}.mb-lg-4{margin-bottom:1.5rem !important}.mb-lg-5{margin-bottom:3rem !important}.mb-lg-auto{margin-bottom:auto !important}.ms-lg-0{margin-left:0 !important}.ms-lg-1{margin-left:.25rem !important}.ms-lg-2{margin-left:.5rem !important}.ms-lg-3{margin-left:1rem !important}.ms-lg-4{margin-left:1.5rem !important}.ms-lg-5{margin-left:3rem !important}.ms-lg-auto{margin-left:auto !important}.p-lg-0{padding:0 !important}.p-lg-1{padding:.25rem !important}.p-lg-2{padding:.5rem !important}.p-lg-3{padding:1rem !important}.p-lg-4{padding:1.5rem !important}.p-lg-5{padding:3rem !important}.px-lg-0{padding-right:0 !important;padding-left:0 !important}.px-lg-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-lg-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-lg-3{padding-right:1rem !important;padding-left:1rem !important}.px-lg-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-lg-5{padding-right:3rem !important;padding-left:3rem !important}.py-lg-0{padding-top:0 !important;padding-bottom:0 !important}.py-lg-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-lg-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-lg-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-lg-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-lg-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-lg-0{padding-top:0 !important}.pt-lg-1{padding-top:.25rem !important}.pt-lg-2{padding-top:.5rem !important}.pt-lg-3{padding-top:1rem !important}.pt-lg-4{padding-top:1.5rem !important}.pt-lg-5{padding-top:3rem !important}.pe-lg-0{padding-right:0 !important}.pe-lg-1{padding-right:.25rem !important}.pe-lg-2{padding-right:.5rem !important}.pe-lg-3{padding-right:1rem !important}.pe-lg-4{padding-right:1.5rem !important}.pe-lg-5{padding-right:3rem !important}.pb-lg-0{padding-bottom:0 !important}.pb-lg-1{padding-bottom:.25rem !important}.pb-lg-2{padding-bottom:.5rem !important}.pb-lg-3{padding-bottom:1rem !important}.pb-lg-4{padding-bottom:1.5rem !important}.pb-lg-5{padding-bottom:3rem !important}.ps-lg-0{padding-left:0 !important}.ps-lg-1{padding-left:.25rem !important}.ps-lg-2{padding-left:.5rem !important}.ps-lg-3{padding-left:1rem !important}.ps-lg-4{padding-left:1.5rem !important}.ps-lg-5{padding-left:3rem !important}.gap-lg-0{gap:0 !important}.gap-lg-1{gap:.25rem !important}.gap-lg-2{gap:.5rem !important}.gap-lg-3{gap:1rem !important}.gap-lg-4{gap:1.5rem !important}.gap-lg-5{gap:3rem !important}.row-gap-lg-0{row-gap:0 !important}.row-gap-lg-1{row-gap:.25rem !important}.row-gap-lg-2{row-gap:.5rem !important}.row-gap-lg-3{row-gap:1rem !important}.row-gap-lg-4{row-gap:1.5rem !important}.row-gap-lg-5{row-gap:3rem !important}.column-gap-lg-0{column-gap:0 !important}.column-gap-lg-1{column-gap:.25rem !important}.column-gap-lg-2{column-gap:.5rem !important}.column-gap-lg-3{column-gap:1rem !important}.column-gap-lg-4{column-gap:1.5rem !important}.column-gap-lg-5{column-gap:3rem !important}.text-lg-start{text-align:left !important}.text-lg-end{text-align:right !important}.text-lg-center{text-align:center !important}}@media (min-width: 1200px){.float-xl-start{float:left !important}.float-xl-end{float:right !important}.float-xl-none{float:none !important}.object-fit-xl-contain{object-fit:contain !important}.object-fit-xl-cover{object-fit:cover !important}.object-fit-xl-fill{object-fit:fill !important}.object-fit-xl-scale{object-fit:scale-down !important}.object-fit-xl-none{object-fit:none !important}.d-xl-inline{display:inline !important}.d-xl-inline-block{display:inline-block !important}.d-xl-block{display:block !important}.d-xl-grid{display:grid !important}.d-xl-inline-grid{display:inline-grid !important}.d-xl-table{display:table !important}.d-xl-table-row{display:table-row !important}.d-xl-table-cell{display:table-cell !important}.d-xl-flex{display:flex !important}.d-xl-inline-flex{display:inline-flex !important}.d-xl-none{display:none !important}.flex-xl-fill{flex:1 1 auto !important}.flex-xl-row{flex-direction:row !important}.flex-xl-column{flex-direction:column !important}.flex-xl-row-reverse{flex-direction:row-reverse !important}.flex-xl-column-reverse{flex-direction:column-reverse !important}.flex-xl-grow-0{flex-grow:0 !important}.flex-xl-grow-1{flex-grow:1 !important}.flex-xl-shrink-0{flex-shrink:0 !important}.flex-xl-shrink-1{flex-shrink:1 !important}.flex-xl-wrap{flex-wrap:wrap !important}.flex-xl-nowrap{flex-wrap:nowrap !important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-xl-start{justify-content:flex-start !important}.justify-content-xl-end{justify-content:flex-end !important}.justify-content-xl-center{justify-content:center !important}.justify-content-xl-between{justify-content:space-between !important}.justify-content-xl-around{justify-content:space-around !important}.justify-content-xl-evenly{justify-content:space-evenly !important}.align-items-xl-start{align-items:flex-start !important}.align-items-xl-end{align-items:flex-end !important}.align-items-xl-center{align-items:center !important}.align-items-xl-baseline{align-items:baseline !important}.align-items-xl-stretch{align-items:stretch !important}.align-content-xl-start{align-content:flex-start !important}.align-content-xl-end{align-content:flex-end !important}.align-content-xl-center{align-content:center !important}.align-content-xl-between{align-content:space-between !important}.align-content-xl-around{align-content:space-around !important}.align-content-xl-stretch{align-content:stretch !important}.align-self-xl-auto{align-self:auto !important}.align-self-xl-start{align-self:flex-start !important}.align-self-xl-end{align-self:flex-end !important}.align-self-xl-center{align-self:center !important}.align-self-xl-baseline{align-self:baseline !important}.align-self-xl-stretch{align-self:stretch !important}.order-xl-first{order:-1 !important}.order-xl-0{order:0 !important}.order-xl-1{order:1 !important}.order-xl-2{order:2 !important}.order-xl-3{order:3 !important}.order-xl-4{order:4 !important}.order-xl-5{order:5 !important}.order-xl-last{order:6 !important}.m-xl-0{margin:0 !important}.m-xl-1{margin:.25rem !important}.m-xl-2{margin:.5rem !important}.m-xl-3{margin:1rem !important}.m-xl-4{margin:1.5rem !important}.m-xl-5{margin:3rem !important}.m-xl-auto{margin:auto !important}.mx-xl-0{margin-right:0 !important;margin-left:0 !important}.mx-xl-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-xl-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-xl-3{margin-right:1rem !important;margin-left:1rem !important}.mx-xl-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-xl-5{margin-right:3rem !important;margin-left:3rem !important}.mx-xl-auto{margin-right:auto !important;margin-left:auto !important}.my-xl-0{margin-top:0 !important;margin-bottom:0 !important}.my-xl-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-xl-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-xl-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-xl-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-xl-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-xl-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-xl-0{margin-top:0 !important}.mt-xl-1{margin-top:.25rem !important}.mt-xl-2{margin-top:.5rem !important}.mt-xl-3{margin-top:1rem !important}.mt-xl-4{margin-top:1.5rem !important}.mt-xl-5{margin-top:3rem !important}.mt-xl-auto{margin-top:auto !important}.me-xl-0{margin-right:0 !important}.me-xl-1{margin-right:.25rem !important}.me-xl-2{margin-right:.5rem !important}.me-xl-3{margin-right:1rem !important}.me-xl-4{margin-right:1.5rem !important}.me-xl-5{margin-right:3rem !important}.me-xl-auto{margin-right:auto !important}.mb-xl-0{margin-bottom:0 !important}.mb-xl-1{margin-bottom:.25rem !important}.mb-xl-2{margin-bottom:.5rem !important}.mb-xl-3{margin-bottom:1rem !important}.mb-xl-4{margin-bottom:1.5rem !important}.mb-xl-5{margin-bottom:3rem !important}.mb-xl-auto{margin-bottom:auto !important}.ms-xl-0{margin-left:0 !important}.ms-xl-1{margin-left:.25rem !important}.ms-xl-2{margin-left:.5rem !important}.ms-xl-3{margin-left:1rem !important}.ms-xl-4{margin-left:1.5rem !important}.ms-xl-5{margin-left:3rem !important}.ms-xl-auto{margin-left:auto !important}.p-xl-0{padding:0 !important}.p-xl-1{padding:.25rem !important}.p-xl-2{padding:.5rem !important}.p-xl-3{padding:1rem !important}.p-xl-4{padding:1.5rem !important}.p-xl-5{padding:3rem !important}.px-xl-0{padding-right:0 !important;padding-left:0 !important}.px-xl-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-xl-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-xl-3{padding-right:1rem !important;padding-left:1rem !important}.px-xl-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-xl-5{padding-right:3rem !important;padding-left:3rem !important}.py-xl-0{padding-top:0 !important;padding-bottom:0 !important}.py-xl-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-xl-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-xl-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-xl-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-xl-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-xl-0{padding-top:0 !important}.pt-xl-1{padding-top:.25rem !important}.pt-xl-2{padding-top:.5rem !important}.pt-xl-3{padding-top:1rem !important}.pt-xl-4{padding-top:1.5rem !important}.pt-xl-5{padding-top:3rem !important}.pe-xl-0{padding-right:0 !important}.pe-xl-1{padding-right:.25rem !important}.pe-xl-2{padding-right:.5rem !important}.pe-xl-3{padding-right:1rem !important}.pe-xl-4{padding-right:1.5rem !important}.pe-xl-5{padding-right:3rem !important}.pb-xl-0{padding-bottom:0 !important}.pb-xl-1{padding-bottom:.25rem !important}.pb-xl-2{padding-bottom:.5rem !important}.pb-xl-3{padding-bottom:1rem !important}.pb-xl-4{padding-bottom:1.5rem !important}.pb-xl-5{padding-bottom:3rem !important}.ps-xl-0{padding-left:0 !important}.ps-xl-1{padding-left:.25rem !important}.ps-xl-2{padding-left:.5rem !important}.ps-xl-3{padding-left:1rem !important}.ps-xl-4{padding-left:1.5rem !important}.ps-xl-5{padding-left:3rem !important}.gap-xl-0{gap:0 !important}.gap-xl-1{gap:.25rem !important}.gap-xl-2{gap:.5rem !important}.gap-xl-3{gap:1rem !important}.gap-xl-4{gap:1.5rem !important}.gap-xl-5{gap:3rem !important}.row-gap-xl-0{row-gap:0 !important}.row-gap-xl-1{row-gap:.25rem !important}.row-gap-xl-2{row-gap:.5rem !important}.row-gap-xl-3{row-gap:1rem !important}.row-gap-xl-4{row-gap:1.5rem !important}.row-gap-xl-5{row-gap:3rem !important}.column-gap-xl-0{column-gap:0 !important}.column-gap-xl-1{column-gap:.25rem !important}.column-gap-xl-2{column-gap:.5rem !important}.column-gap-xl-3{column-gap:1rem !important}.column-gap-xl-4{column-gap:1.5rem !important}.column-gap-xl-5{column-gap:3rem !important}.text-xl-start{text-align:left !important}.text-xl-end{text-align:right !important}.text-xl-center{text-align:center !important}}@media (min-width: 1400px){.float-xxl-start{float:left !important}.float-xxl-end{float:right !important}.float-xxl-none{float:none !important}.object-fit-xxl-contain{object-fit:contain !important}.object-fit-xxl-cover{object-fit:cover !important}.object-fit-xxl-fill{object-fit:fill !important}.object-fit-xxl-scale{object-fit:scale-down !important}.object-fit-xxl-none{object-fit:none !important}.d-xxl-inline{display:inline !important}.d-xxl-inline-block{display:inline-block !important}.d-xxl-block{display:block !important}.d-xxl-grid{display:grid !important}.d-xxl-inline-grid{display:inline-grid !important}.d-xxl-table{display:table !important}.d-xxl-table-row{display:table-row !important}.d-xxl-table-cell{display:table-cell !important}.d-xxl-flex{display:flex !important}.d-xxl-inline-flex{display:inline-flex !important}.d-xxl-none{display:none !important}.flex-xxl-fill{flex:1 1 auto !important}.flex-xxl-row{flex-direction:row !important}.flex-xxl-column{flex-direction:column !important}.flex-xxl-row-reverse{flex-direction:row-reverse !important}.flex-xxl-column-reverse{flex-direction:column-reverse !important}.flex-xxl-grow-0{flex-grow:0 !important}.flex-xxl-grow-1{flex-grow:1 !important}.flex-xxl-shrink-0{flex-shrink:0 !important}.flex-xxl-shrink-1{flex-shrink:1 !important}.flex-xxl-wrap{flex-wrap:wrap !important}.flex-xxl-nowrap{flex-wrap:nowrap !important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-xxl-start{justify-content:flex-start !important}.justify-content-xxl-end{justify-content:flex-end !important}.justify-content-xxl-center{justify-content:center !important}.justify-content-xxl-between{justify-content:space-between !important}.justify-content-xxl-around{justify-content:space-around !important}.justify-content-xxl-evenly{justify-content:space-evenly !important}.align-items-xxl-start{align-items:flex-start !important}.align-items-xxl-end{align-items:flex-end !important}.align-items-xxl-center{align-items:center !important}.align-items-xxl-baseline{align-items:baseline !important}.align-items-xxl-stretch{align-items:stretch !important}.align-content-xxl-start{align-content:flex-start !important}.align-content-xxl-end{align-content:flex-end !important}.align-content-xxl-center{align-content:center !important}.align-content-xxl-between{align-content:space-between !important}.align-content-xxl-around{align-content:space-around !important}.align-content-xxl-stretch{align-content:stretch !important}.align-self-xxl-auto{align-self:auto !important}.align-self-xxl-start{align-self:flex-start !important}.align-self-xxl-end{align-self:flex-end !important}.align-self-xxl-center{align-self:center !important}.align-self-xxl-baseline{align-self:baseline !important}.align-self-xxl-stretch{align-self:stretch !important}.order-xxl-first{order:-1 !important}.order-xxl-0{order:0 !important}.order-xxl-1{order:1 !important}.order-xxl-2{order:2 !important}.order-xxl-3{order:3 !important}.order-xxl-4{order:4 !important}.order-xxl-5{order:5 !important}.order-xxl-last{order:6 !important}.m-xxl-0{margin:0 !important}.m-xxl-1{margin:.25rem !important}.m-xxl-2{margin:.5rem !important}.m-xxl-3{margin:1rem !important}.m-xxl-4{margin:1.5rem !important}.m-xxl-5{margin:3rem !important}.m-xxl-auto{margin:auto !important}.mx-xxl-0{margin-right:0 !important;margin-left:0 !important}.mx-xxl-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-xxl-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-xxl-3{margin-right:1rem !important;margin-left:1rem !important}.mx-xxl-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-xxl-5{margin-right:3rem !important;margin-left:3rem !important}.mx-xxl-auto{margin-right:auto !important;margin-left:auto !important}.my-xxl-0{margin-top:0 !important;margin-bottom:0 !important}.my-xxl-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-xxl-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-xxl-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-xxl-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-xxl-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-xxl-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-xxl-0{margin-top:0 !important}.mt-xxl-1{margin-top:.25rem !important}.mt-xxl-2{margin-top:.5rem !important}.mt-xxl-3{margin-top:1rem !important}.mt-xxl-4{margin-top:1.5rem !important}.mt-xxl-5{margin-top:3rem !important}.mt-xxl-auto{margin-top:auto !important}.me-xxl-0{margin-right:0 !important}.me-xxl-1{margin-right:.25rem !important}.me-xxl-2{margin-right:.5rem !important}.me-xxl-3{margin-right:1rem !important}.me-xxl-4{margin-right:1.5rem !important}.me-xxl-5{margin-right:3rem !important}.me-xxl-auto{margin-right:auto !important}.mb-xxl-0{margin-bottom:0 !important}.mb-xxl-1{margin-bottom:.25rem !important}.mb-xxl-2{margin-bottom:.5rem !important}.mb-xxl-3{margin-bottom:1rem !important}.mb-xxl-4{margin-bottom:1.5rem !important}.mb-xxl-5{margin-bottom:3rem !important}.mb-xxl-auto{margin-bottom:auto !important}.ms-xxl-0{margin-left:0 !important}.ms-xxl-1{margin-left:.25rem !important}.ms-xxl-2{margin-left:.5rem !important}.ms-xxl-3{margin-left:1rem !important}.ms-xxl-4{margin-left:1.5rem !important}.ms-xxl-5{margin-left:3rem !important}.ms-xxl-auto{margin-left:auto !important}.p-xxl-0{padding:0 !important}.p-xxl-1{padding:.25rem !important}.p-xxl-2{padding:.5rem !important}.p-xxl-3{padding:1rem !important}.p-xxl-4{padding:1.5rem !important}.p-xxl-5{padding:3rem !important}.px-xxl-0{padding-right:0 !important;padding-left:0 !important}.px-xxl-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-xxl-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-xxl-3{padding-right:1rem !important;padding-left:1rem !important}.px-xxl-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-xxl-5{padding-right:3rem !important;padding-left:3rem !important}.py-xxl-0{padding-top:0 !important;padding-bottom:0 !important}.py-xxl-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-xxl-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-xxl-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-xxl-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-xxl-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-xxl-0{padding-top:0 !important}.pt-xxl-1{padding-top:.25rem !important}.pt-xxl-2{padding-top:.5rem !important}.pt-xxl-3{padding-top:1rem !important}.pt-xxl-4{padding-top:1.5rem !important}.pt-xxl-5{padding-top:3rem !important}.pe-xxl-0{padding-right:0 !important}.pe-xxl-1{padding-right:.25rem !important}.pe-xxl-2{padding-right:.5rem !important}.pe-xxl-3{padding-right:1rem !important}.pe-xxl-4{padding-right:1.5rem !important}.pe-xxl-5{padding-right:3rem !important}.pb-xxl-0{padding-bottom:0 !important}.pb-xxl-1{padding-bottom:.25rem !important}.pb-xxl-2{padding-bottom:.5rem !important}.pb-xxl-3{padding-bottom:1rem !important}.pb-xxl-4{padding-bottom:1.5rem !important}.pb-xxl-5{padding-bottom:3rem !important}.ps-xxl-0{padding-left:0 !important}.ps-xxl-1{padding-left:.25rem !important}.ps-xxl-2{padding-left:.5rem !important}.ps-xxl-3{padding-left:1rem !important}.ps-xxl-4{padding-left:1.5rem !important}.ps-xxl-5{padding-left:3rem !important}.gap-xxl-0{gap:0 !important}.gap-xxl-1{gap:.25rem !important}.gap-xxl-2{gap:.5rem !important}.gap-xxl-3{gap:1rem !important}.gap-xxl-4{gap:1.5rem !important}.gap-xxl-5{gap:3rem !important}.row-gap-xxl-0{row-gap:0 !important}.row-gap-xxl-1{row-gap:.25rem !important}.row-gap-xxl-2{row-gap:.5rem !important}.row-gap-xxl-3{row-gap:1rem !important}.row-gap-xxl-4{row-gap:1.5rem !important}.row-gap-xxl-5{row-gap:3rem !important}.column-gap-xxl-0{column-gap:0 !important}.column-gap-xxl-1{column-gap:.25rem !important}.column-gap-xxl-2{column-gap:.5rem !important}.column-gap-xxl-3{column-gap:1rem !important}.column-gap-xxl-4{column-gap:1.5rem !important}.column-gap-xxl-5{column-gap:3rem !important}.text-xxl-start{text-align:left !important}.text-xxl-end{text-align:right !important}.text-xxl-center{text-align:center !important}}.bg-default{color:#000}.bg-primary{color:#fff}.bg-secondary{color:#fff}.bg-success{color:#fff}.bg-info{color:#000}.bg-warning{color:#000}.bg-danger{color:#fff}.bg-light{color:#000}.bg-dark{color:#fff}@media (min-width: 1200px){.fs-1{font-size:2.5rem !important}.fs-2{font-size:2rem !important}.fs-3{font-size:1.75rem !important}.fs-4{font-size:1.5rem !important}}@media print{.d-print-inline{display:inline !important}.d-print-inline-block{display:inline-block !important}.d-print-block{display:block !important}.d-print-grid{display:grid !important}.d-print-inline-grid{display:inline-grid !important}.d-print-table{display:table !important}.d-print-table-row{display:table-row !important}.d-print-table-cell{display:table-cell !important}.d-print-flex{display:flex !important}.d-print-inline-flex{display:inline-flex !important}.d-print-none{display:none !important}}.table th[align=left]{text-align:left}.table th[align=right]{text-align:right}.table th[align=center]{text-align:center}:root{--bslib-spacer: 1rem;--bslib-mb-spacer: var(--bslib-spacer, 1rem)}.bslib-mb-spacing{margin-bottom:var(--bslib-mb-spacer)}.bslib-gap-spacing{gap:var(--bslib-mb-spacer)}.bslib-gap-spacing>.bslib-mb-spacing,.bslib-gap-spacing>.form-group,.bslib-gap-spacing>p,.bslib-gap-spacing>pre,.bslib-gap-spacing>.shiny-html-output>.bslib-mb-spacing,.bslib-gap-spacing>.shiny-html-output>.form-group,.bslib-gap-spacing>.shiny-html-output>p,.bslib-gap-spacing>.shiny-html-output>pre,.bslib-gap-spacing>.shiny-panel-conditional>.bslib-mb-spacing,.bslib-gap-spacing>.shiny-panel-conditional>.form-group,.bslib-gap-spacing>.shiny-panel-conditional>p,.bslib-gap-spacing>.shiny-panel-conditional>pre{margin-bottom:0}.html-fill-container>.html-fill-item.bslib-mb-spacing{margin-bottom:0}.tab-content>.tab-pane.html-fill-container{display:none}.tab-content>.active.html-fill-container{display:flex}.tab-content.html-fill-container{padding:0}.bg-blue{--bslib-color-bg: #0d6efd;--bslib-color-fg: #fff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-blue{--bslib-color-fg: #0d6efd;color:var(--bslib-color-fg)}.bg-indigo{--bslib-color-bg: #6610f2;--bslib-color-fg: #fff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-indigo{--bslib-color-fg: #6610f2;color:var(--bslib-color-fg)}.bg-purple{--bslib-color-bg: #6f42c1;--bslib-color-fg: #fff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-purple{--bslib-color-fg: #6f42c1;color:var(--bslib-color-fg)}.bg-pink{--bslib-color-bg: #d63384;--bslib-color-fg: #fff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-pink{--bslib-color-fg: #d63384;color:var(--bslib-color-fg)}.bg-red{--bslib-color-bg: #dc3545;--bslib-color-fg: #fff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-red{--bslib-color-fg: #dc3545;color:var(--bslib-color-fg)}.bg-orange{--bslib-color-bg: #fd7e14;--bslib-color-fg: #000;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-orange{--bslib-color-fg: #fd7e14;color:var(--bslib-color-fg)}.bg-yellow{--bslib-color-bg: #ffc107;--bslib-color-fg: #000;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-yellow{--bslib-color-fg: #ffc107;color:var(--bslib-color-fg)}.bg-green{--bslib-color-bg: #198754;--bslib-color-fg: #fff;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-green{--bslib-color-fg: #198754;color:var(--bslib-color-fg)}.bg-teal{--bslib-color-bg: #20c997;--bslib-color-fg: #000;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-teal{--bslib-color-fg: #20c997;color:var(--bslib-color-fg)}.bg-cyan{--bslib-color-bg: #0dcaf0;--bslib-color-fg: #000;background-color:var(--bslib-color-bg);color:var(--bslib-color-fg)}.text-cyan{--bslib-color-fg: #0dcaf0;color:var(--bslib-color-fg)}.text-default{--bslib-color-fg: #dee2e6}.bg-default{--bslib-color-bg: #dee2e6;--bslib-color-fg: #000}.text-primary{--bslib-color-fg: #0d6efd}.bg-primary{--bslib-color-bg: #0d6efd;--bslib-color-fg: #fff}.text-secondary{--bslib-color-fg: #6c757d}.bg-secondary{--bslib-color-bg: #6c757d;--bslib-color-fg: #fff}.text-success{--bslib-color-fg: #198754}.bg-success{--bslib-color-bg: #198754;--bslib-color-fg: #fff}.text-info{--bslib-color-fg: #0dcaf0}.bg-info{--bslib-color-bg: #0dcaf0;--bslib-color-fg: #000}.text-warning{--bslib-color-fg: #ffc107}.bg-warning{--bslib-color-bg: #ffc107;--bslib-color-fg: #000}.text-danger{--bslib-color-fg: #dc3545}.bg-danger{--bslib-color-bg: #dc3545;--bslib-color-fg: #fff}.text-light{--bslib-color-fg: #f8f9fa}.bg-light{--bslib-color-bg: #f8f9fa;--bslib-color-fg: #000}.text-dark{--bslib-color-fg: #212529}.bg-dark{--bslib-color-bg: #212529;--bslib-color-fg: #fff}.bg-gradient-blue-indigo{--bslib-color-fg: #fff;--bslib-color-bg: #3148f9;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #3148f9;color:#fff}.bg-gradient-blue-purple{--bslib-color-fg: #fff;--bslib-color-bg: #345ce5;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #345ce5;color:#fff}.bg-gradient-blue-pink{--bslib-color-fg: #fff;--bslib-color-bg: #5d56cd;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #5d56cd;color:#fff}.bg-gradient-blue-red{--bslib-color-fg: #fff;--bslib-color-bg: #6057b3;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #6057b3;color:#fff}.bg-gradient-blue-orange{--bslib-color-fg: #fff;--bslib-color-bg: #6d74a0;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #6d74a0;color:#fff}.bg-gradient-blue-yellow{--bslib-color-fg: #000;--bslib-color-bg: #6e8f9b;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #6e8f9b;color:#000}.bg-gradient-blue-green{--bslib-color-fg: #fff;--bslib-color-bg: #1278b9;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #1278b9;color:#fff}.bg-gradient-blue-teal{--bslib-color-fg: #000;--bslib-color-bg: #1592d4;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #1592d4;color:#000}.bg-gradient-blue-cyan{--bslib-color-fg: #000;--bslib-color-bg: #0d93f8;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0d6efd var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #0d93f8;color:#000}.bg-gradient-indigo-blue{--bslib-color-fg: #fff;--bslib-color-bg: #4236f6;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #4236f6;color:#fff}.bg-gradient-indigo-purple{--bslib-color-fg: #fff;--bslib-color-bg: #6a24de;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #6a24de;color:#fff}.bg-gradient-indigo-pink{--bslib-color-fg: #fff;--bslib-color-bg: #931ec6;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #931ec6;color:#fff}.bg-gradient-indigo-red{--bslib-color-fg: #fff;--bslib-color-bg: #951fad;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #951fad;color:#fff}.bg-gradient-indigo-orange{--bslib-color-fg: #fff;--bslib-color-bg: #a23c99;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #a23c99;color:#fff}.bg-gradient-indigo-yellow{--bslib-color-fg: #fff;--bslib-color-bg: #a35794;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #a35794;color:#fff}.bg-gradient-indigo-green{--bslib-color-fg: #fff;--bslib-color-bg: #4740b3;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #4740b3;color:#fff}.bg-gradient-indigo-teal{--bslib-color-fg: #fff;--bslib-color-bg: #4a5ace;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #4a5ace;color:#fff}.bg-gradient-indigo-cyan{--bslib-color-fg: #fff;--bslib-color-bg: #425af1;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6610f2 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #425af1;color:#fff}.bg-gradient-purple-blue{--bslib-color-fg: #fff;--bslib-color-bg: #4854d9;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #4854d9;color:#fff}.bg-gradient-purple-indigo{--bslib-color-fg: #fff;--bslib-color-bg: #6b2ed5;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #6b2ed5;color:#fff}.bg-gradient-purple-pink{--bslib-color-fg: #fff;--bslib-color-bg: #983ca9;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #983ca9;color:#fff}.bg-gradient-purple-red{--bslib-color-fg: #fff;--bslib-color-bg: #9b3d8f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #9b3d8f;color:#fff}.bg-gradient-purple-orange{--bslib-color-fg: #fff;--bslib-color-bg: #a85a7c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #a85a7c;color:#fff}.bg-gradient-purple-yellow{--bslib-color-fg: #000;--bslib-color-bg: #a97577;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #a97577;color:#000}.bg-gradient-purple-green{--bslib-color-fg: #fff;--bslib-color-bg: #4d5e95;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #4d5e95;color:#fff}.bg-gradient-purple-teal{--bslib-color-fg: #fff;--bslib-color-bg: #4f78b0;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #4f78b0;color:#fff}.bg-gradient-purple-cyan{--bslib-color-fg: #000;--bslib-color-bg: #4878d4;background:linear-gradient(var(--bg-gradient-deg, 140deg), #6f42c1 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #4878d4;color:#000}.bg-gradient-pink-blue{--bslib-color-fg: #fff;--bslib-color-bg: #864bb4;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #864bb4;color:#fff}.bg-gradient-pink-indigo{--bslib-color-fg: #fff;--bslib-color-bg: #a925b0;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #a925b0;color:#fff}.bg-gradient-pink-purple{--bslib-color-fg: #fff;--bslib-color-bg: #ad399c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #ad399c;color:#fff}.bg-gradient-pink-red{--bslib-color-fg: #fff;--bslib-color-bg: #d8346b;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #d8346b;color:#fff}.bg-gradient-pink-orange{--bslib-color-fg: #000;--bslib-color-bg: #e65157;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #e65157;color:#000}.bg-gradient-pink-yellow{--bslib-color-fg: #000;--bslib-color-bg: #e66c52;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #e66c52;color:#000}.bg-gradient-pink-green{--bslib-color-fg: #fff;--bslib-color-bg: #8a5571;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #8a5571;color:#fff}.bg-gradient-pink-teal{--bslib-color-fg: #000;--bslib-color-bg: #8d6f8c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #8d6f8c;color:#000}.bg-gradient-pink-cyan{--bslib-color-fg: #000;--bslib-color-bg: #866faf;background:linear-gradient(var(--bg-gradient-deg, 140deg), #d63384 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #866faf;color:#000}.bg-gradient-red-blue{--bslib-color-fg: #fff;--bslib-color-bg: #894c8f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #894c8f;color:#fff}.bg-gradient-red-indigo{--bslib-color-fg: #fff;--bslib-color-bg: #ad268a;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #ad268a;color:#fff}.bg-gradient-red-purple{--bslib-color-fg: #fff;--bslib-color-bg: #b03a77;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #b03a77;color:#fff}.bg-gradient-red-pink{--bslib-color-fg: #fff;--bslib-color-bg: #da345e;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #da345e;color:#fff}.bg-gradient-red-orange{--bslib-color-fg: #000;--bslib-color-bg: #e95231;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #e95231;color:#000}.bg-gradient-red-yellow{--bslib-color-fg: #000;--bslib-color-bg: #ea6d2c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #ea6d2c;color:#000}.bg-gradient-red-green{--bslib-color-fg: #fff;--bslib-color-bg: #8e564b;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #8e564b;color:#fff}.bg-gradient-red-teal{--bslib-color-fg: #000;--bslib-color-bg: #917066;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #917066;color:#000}.bg-gradient-red-cyan{--bslib-color-fg: #000;--bslib-color-bg: #897189;background:linear-gradient(var(--bg-gradient-deg, 140deg), #dc3545 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #897189;color:#000}.bg-gradient-orange-blue{--bslib-color-fg: #000;--bslib-color-bg: #9d7871;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #9d7871;color:#000}.bg-gradient-orange-indigo{--bslib-color-fg: #000;--bslib-color-bg: #c1526d;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #c1526d;color:#000}.bg-gradient-orange-purple{--bslib-color-fg: #000;--bslib-color-bg: #c46659;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #c46659;color:#000}.bg-gradient-orange-pink{--bslib-color-fg: #000;--bslib-color-bg: #ed6041;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #ed6041;color:#000}.bg-gradient-orange-red{--bslib-color-fg: #000;--bslib-color-bg: #f06128;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #f06128;color:#000}.bg-gradient-orange-yellow{--bslib-color-fg: #000;--bslib-color-bg: #fe990f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #fe990f;color:#000}.bg-gradient-orange-green{--bslib-color-fg: #000;--bslib-color-bg: #a2822e;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #a2822e;color:#000}.bg-gradient-orange-teal{--bslib-color-fg: #000;--bslib-color-bg: #a59c48;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #a59c48;color:#000}.bg-gradient-orange-cyan{--bslib-color-fg: #000;--bslib-color-bg: #9d9c6c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #fd7e14 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #9d9c6c;color:#000}.bg-gradient-yellow-blue{--bslib-color-fg: #000;--bslib-color-bg: #9ea069;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #9ea069;color:#000}.bg-gradient-yellow-indigo{--bslib-color-fg: #000;--bslib-color-bg: #c27a65;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #c27a65;color:#000}.bg-gradient-yellow-purple{--bslib-color-fg: #000;--bslib-color-bg: #c58e51;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #c58e51;color:#000}.bg-gradient-yellow-pink{--bslib-color-fg: #000;--bslib-color-bg: #ef8839;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #ef8839;color:#000}.bg-gradient-yellow-red{--bslib-color-fg: #000;--bslib-color-bg: #f18920;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #f18920;color:#000}.bg-gradient-yellow-orange{--bslib-color-fg: #000;--bslib-color-bg: #fea60c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #fea60c;color:#000}.bg-gradient-yellow-green{--bslib-color-fg: #000;--bslib-color-bg: #a3aa26;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #a3aa26;color:#000}.bg-gradient-yellow-teal{--bslib-color-fg: #000;--bslib-color-bg: #a6c441;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #a6c441;color:#000}.bg-gradient-yellow-cyan{--bslib-color-fg: #000;--bslib-color-bg: #9ec564;background:linear-gradient(var(--bg-gradient-deg, 140deg), #ffc107 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #9ec564;color:#000}.bg-gradient-green-blue{--bslib-color-fg: #fff;--bslib-color-bg: #147d98;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #147d98;color:#fff}.bg-gradient-green-indigo{--bslib-color-fg: #fff;--bslib-color-bg: #385793;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #385793;color:#fff}.bg-gradient-green-purple{--bslib-color-fg: #fff;--bslib-color-bg: #3b6b80;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #3b6b80;color:#fff}.bg-gradient-green-pink{--bslib-color-fg: #fff;--bslib-color-bg: #656567;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #656567;color:#fff}.bg-gradient-green-red{--bslib-color-fg: #fff;--bslib-color-bg: #67664e;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #67664e;color:#fff}.bg-gradient-green-orange{--bslib-color-fg: #000;--bslib-color-bg: #74833a;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #74833a;color:#000}.bg-gradient-green-yellow{--bslib-color-fg: #000;--bslib-color-bg: #759e35;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #759e35;color:#000}.bg-gradient-green-teal{--bslib-color-fg: #000;--bslib-color-bg: #1ca16f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #1ca16f;color:#000}.bg-gradient-green-cyan{--bslib-color-fg: #000;--bslib-color-bg: #14a292;background:linear-gradient(var(--bg-gradient-deg, 140deg), #198754 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #14a292;color:#000}.bg-gradient-teal-blue{--bslib-color-fg: #000;--bslib-color-bg: #18a5c0;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #18a5c0;color:#000}.bg-gradient-teal-indigo{--bslib-color-fg: #000;--bslib-color-bg: #3c7fbb;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #3c7fbb;color:#000}.bg-gradient-teal-purple{--bslib-color-fg: #000;--bslib-color-bg: #4093a8;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #4093a8;color:#000}.bg-gradient-teal-pink{--bslib-color-fg: #000;--bslib-color-bg: #698d8f;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #698d8f;color:#000}.bg-gradient-teal-red{--bslib-color-fg: #000;--bslib-color-bg: #6b8e76;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #6b8e76;color:#000}.bg-gradient-teal-orange{--bslib-color-fg: #000;--bslib-color-bg: #78ab63;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #78ab63;color:#000}.bg-gradient-teal-yellow{--bslib-color-fg: #000;--bslib-color-bg: #79c65d;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #79c65d;color:#000}.bg-gradient-teal-green{--bslib-color-fg: #000;--bslib-color-bg: #1daf7c;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #1daf7c;color:#000}.bg-gradient-teal-cyan{--bslib-color-fg: #000;--bslib-color-bg: #18c9bb;background:linear-gradient(var(--bg-gradient-deg, 140deg), #20c997 var(--bg-gradient-start, 36%), #0dcaf0 var(--bg-gradient-end, 180%)) #18c9bb;color:#000}.bg-gradient-cyan-blue{--bslib-color-fg: #000;--bslib-color-bg: #0da5f5;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #0d6efd var(--bg-gradient-end, 180%)) #0da5f5;color:#000}.bg-gradient-cyan-indigo{--bslib-color-fg: #000;--bslib-color-bg: #3180f1;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #6610f2 var(--bg-gradient-end, 180%)) #3180f1;color:#000}.bg-gradient-cyan-purple{--bslib-color-fg: #000;--bslib-color-bg: #3494dd;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #6f42c1 var(--bg-gradient-end, 180%)) #3494dd;color:#000}.bg-gradient-cyan-pink{--bslib-color-fg: #000;--bslib-color-bg: #5d8ec5;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #d63384 var(--bg-gradient-end, 180%)) #5d8ec5;color:#000}.bg-gradient-cyan-red{--bslib-color-fg: #000;--bslib-color-bg: #608eac;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #dc3545 var(--bg-gradient-end, 180%)) #608eac;color:#000}.bg-gradient-cyan-orange{--bslib-color-fg: #000;--bslib-color-bg: #6dac98;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #fd7e14 var(--bg-gradient-end, 180%)) #6dac98;color:#000}.bg-gradient-cyan-yellow{--bslib-color-fg: #000;--bslib-color-bg: #6ec693;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #ffc107 var(--bg-gradient-end, 180%)) #6ec693;color:#000}.bg-gradient-cyan-green{--bslib-color-fg: #000;--bslib-color-bg: #12afb2;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #198754 var(--bg-gradient-end, 180%)) #12afb2;color:#000}.bg-gradient-cyan-teal{--bslib-color-fg: #000;--bslib-color-bg: #15cacc;background:linear-gradient(var(--bg-gradient-deg, 140deg), #0dcaf0 var(--bg-gradient-start, 36%), #20c997 var(--bg-gradient-end, 180%)) #15cacc;color:#000}.row>main{max-width:50rem}@media (max-width: 767.98px){.row>main{overflow-wrap:break-word;hyphens:auto}}@media (min-width: 1200px) and (max-width: 1399.98px){.container .row{justify-content:space-evenly}}@media (min-width: 1400px){body{font-size:18px}.col-md-3{margin-left:5rem}}.navbar{background:RGBA(var(--bs-body-color-rgb), 0.1);background:color-mix(in oklab, color-mix(in oklab, var(--bs-body-bg) 95%, var(--bs-primary)) 95%, var(--bs-body-color));line-height:initial}.nav-item .nav-link{border-radius:.375rem}.nav-item.active .nav-link{background:RGBA(var(--bs-body-color-rgb), 0.1)}.nav-item .nav-link:hover{background:RGBA(var(--bs-primary-rgb), 0.1)}.navbar>.container{align-items:baseline;-webkit-align-items:baseline}input[type="search"]{width:12rem}[aria-labelledby=dropdown-lightswitch] span.fa{opacity:0.5}@media (max-width: 991.98px){.algolia-autocomplete,input[type="search"],#navbar .dropdown-menu{width:100%}#navbar .dropdown-item{white-space:normal}input[type="search"]{margin:0.25rem 0}}.headroom{will-change:transform;transition:transform 400ms ease}.headroom--pinned{transform:translateY(0%)}.headroom--unpinned{transform:translateY(-100%)}.row>main,.row>aside{margin-top:56px}html,body{scroll-padding:56px}@media (min-width: 576px){#toc{position:sticky;top:56px;max-height:calc(100vh - 56px - 1rem);overflow-y:auto}}aside h2,aside .h2{margin-top:1.5rem;font-size:1.25rem}aside .roles{color:RGBA(var(--bs-body-color-rgb), 0.8)}aside .list-unstyled li{margin-bottom:0.5rem}aside .dev-status .list-unstyled li{margin-bottom:0.1rem}@media (max-width: 767.98px){.row>aside{margin:0.5rem;width:calc(100vw - 1rem);background-color:RGBA(var(--bs-body-color-rgb), 0.1);border-color:var(--bs-border-color);border-radius:.375rem}.row>aside h2:first-child,.row>aside .h2:first-child{margin-top:1rem}}body{position:relative}#toc>.nav{margin-bottom:1rem}#toc>.nav a.nav-link{color:inherit;padding:0.25rem 0.5rem;margin-bottom:2px;border-radius:.375rem}#toc>.nav a.nav-link:hover,#toc>.nav a.nav-link:focus{background-color:RGBA(var(--bs-primary-rgb), 0.1)}#toc>.nav a.nav-link.active{background-color:RGBA(var(--bs-body-color-rgb), 0.1)}#toc>.nav .nav a.nav-link{margin-left:0.5rem}#toc>.nav .nav{display:none !important}#toc>.nav a.active+.nav{display:flex !important}footer{margin:1rem 0 1rem 0;padding-top:1rem;font-size:.875em;border-top:1px solid #dee2e6;background:rgba(0,0,0,0);color:RGBA(var(--bs-body-color-rgb), 0.8);display:flex;column-gap:1rem}@media (max-width: 575.98px){footer{flex-direction:column}}@media (min-width: 576px){footer .pkgdown-footer-right{text-align:right}}footer div{flex:1 1 auto}html,body{height:100%}body>.container{min-height:100%;display:flex;flex-direction:column}body>.container .row{flex:1 0 auto}main img{max-width:100%;height:auto}main table{display:block;overflow:auto}body{font-display:fallback}.page-header{border-bottom:1px solid var(--bs-border-color);padding-bottom:0.5rem;margin-bottom:0.5rem;margin-top:1.5rem}dl{margin-bottom:0}dd{padding-left:1.5rem;margin-bottom:0.25rem}h2,.h2{font-size:1.75rem;margin-top:1.5rem}h3,.h3{font-size:1.25rem;margin-top:1rem;font-weight:bold}h4,.h4{font-size:1.1rem;font-weight:bold}h5,.h5{font-size:1rem;font-weight:bold}summary{margin-bottom:0.5rem}details{margin-bottom:1rem}.html-widget{margin-bottom:1rem}a.anchor{display:none;margin-left:2px;vertical-align:top;width:Min(0.9em, 20px);height:Min(0.9em, 20px);background-image:url(../../link.svg);background-repeat:no-repeat;background-size:Min(0.9em, 20px) Min(0.9em, 20px);background-position:center center}h2:hover .anchor,.h2:hover .anchor,h2:target .anchor,.h2:target .anchor,h3:hover .anchor,.h3:hover .anchor,h3:target .anchor,.h3:target .anchor,h4:hover .anchor,.h4:hover .anchor,h4:target .anchor,.h4:target .anchor,h5:hover .anchor,.h5:hover .anchor,h5:target .anchor,.h5:target .anchor,h6:hover .anchor,.h6:hover .anchor,h6:target .anchor,.h6:target .anchor,dt:hover .anchor,dt:target .anchor{display:inline-block}dt:target,dt:target+dd{border-left:0.25rem solid var(--bs-primary);margin-left:-0.75rem}dt:target{padding-left:0.5rem}dt:target+dd{padding-left:2rem}.orcid{color:#A6CE39;margin-right:4px}.ror{height:16px;margin-right:4px}.fab{font-family:"Font Awesome 5 Brands" !important}img.logo{float:right;width:100px;margin-left:30px}.template-home img.logo{width:120px}@media (max-width: 575.98px){img.logo{width:80px}}@media (min-width: 576px){.page-header{min-height:88px}.template-home .page-header{min-height:104px}}.line-block{margin-bottom:1rem}.template-reference-index dt{font-weight:normal}.template-reference-index code{word-wrap:normal}.icon{float:right}.icon img{width:40px}a[href='#main']{position:absolute;margin:4px;padding:0.75rem;background-color:var(--bs-body-bg);text-decoration:none;z-index:2000}.lifecycle{color:var(--bs-secondary-color);background-color:var(--bs-secondary-bg);border-radius:5px}.lifecycle-stable{background-color:#108001;color:var(--bs-white)}.lifecycle-superseded{background-color:#074080;color:var(--bs-white)}.lifecycle-experimental,.lifecycle-deprecated{background-color:#fd8008;color:var(--bs-black)}a.footnote-ref{cursor:pointer}.popover{width:Min(100vw, 32rem);font-size:0.9rem;box-shadow:4px 4px 8px RGBA(var(--bs-body-color-rgb), 0.3)}.popover-body{padding:0.75rem}.popover-body p:last-child{margin-bottom:0}.tab-content{padding:1rem}.tabset-pills .tab-content{border:solid 1px #e5e5e5}.tab-content{display:flex}.tab-content>.tab-pane{display:block;visibility:hidden;margin-right:-100%;width:100%}.tab-content>.active{visibility:visible}div.csl-entry{clear:both}.hanging-indent div.csl-entry{margin-left:2em;text-indent:-2em}div.csl-left-margin{min-width:2em;float:left}div.csl-right-inline{margin-left:2em;padding-left:1em}div.csl-indent{margin-left:2em}pre,pre code{word-wrap:normal}[data-bs-theme="dark"] pre,[data-bs-theme="dark"] code{background-color:RGBA(var(--bs-body-color-rgb), 0.1)}[data-bs-theme="dark"] pre code{background:transparent}code{overflow-wrap:break-word}.hasCopyButton{position:relative}.btn-copy-ex{position:absolute;right:5px;top:5px;visibility:hidden}.hasCopyButton:hover button.btn-copy-ex{visibility:visible}pre{padding:0.75rem}pre div.gt-table{white-space:normal;margin-top:1rem}@media (max-width: 575.98px){div>div>pre{margin-left:calc(var(--bs-gutter-x) * -.5);margin-right:calc(var(--bs-gutter-x) * -.5);border-radius:0;padding-left:1rem;padding-right:1rem}.btn-copy-ex{right:calc(var(--bs-gutter-x) * -.5 + 5px)}}code a:any-link{color:inherit;text-decoration-color:RGBA(var(--bs-body-color-rgb), 0.6)}pre code{padding:0;background:transparent}pre code .error,pre code .warning{font-weight:bolder}pre .img img,pre .r-plt img{margin:5px 0;background-color:#fff}[data-bs-theme="dark"] pre img{opacity:0.66;transition:opacity 250ms ease-in-out}[data-bs-theme="dark"] pre img:hover,[data-bs-theme="dark"] pre img:focus,[data-bs-theme="dark"] pre img:active{opacity:1}@media print{code a:link:after,code a:visited:after{content:""}}a.sourceLine:hover{text-decoration:none}mark,.mark{background:linear-gradient(-100deg, RGBA(var(--bs-info-rgb), 0.2), RGBA(var(--bs-info-rgb), 0.7) 95%, RGBA(var(--bs-info-rgb), 0.1))}.algolia-autocomplete .aa-dropdown-menu{margin-top:0.5rem;padding:0.5rem 0.25rem;width:MAX(100%, 20rem);max-height:50vh;overflow-y:auto;background-color:var(--bs-body-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:.375rem}.algolia-autocomplete .aa-dropdown-menu .aa-suggestion{cursor:pointer;font-size:1rem;padding:0.5rem 0.25rem;line-height:1.3}.algolia-autocomplete .aa-dropdown-menu .aa-suggestion:hover{background-color:var(--bs-tertiary-bg);color:var(--bs-body-color)}.algolia-autocomplete .aa-dropdown-menu .aa-suggestion .search-details{text-decoration:underline;display:inline}span.smallcaps{font-variant:small-caps}ul.task-list{list-style:none}ul.task-list li input[type="checkbox"]{width:0.8em;margin:0 0.8em 0.2em -1em;vertical-align:middle}figure.figure{display:block}.quarto-layout-panel{margin-bottom:1em}.quarto-layout-panel>figure{width:100%}.quarto-layout-panel>figure>figcaption,.quarto-layout-panel>.panel-caption{margin-top:10pt}.quarto-layout-panel>.table-caption{margin-top:0px}.table-caption p{margin-bottom:0.5em}.quarto-layout-row{display:flex;flex-direction:row;align-items:flex-start}.quarto-layout-valign-top{align-items:flex-start}.quarto-layout-valign-bottom{align-items:flex-end}.quarto-layout-valign-center{align-items:center}.quarto-layout-cell{position:relative;margin-right:20px}.quarto-layout-cell:last-child{margin-right:0}.quarto-layout-cell figure,.quarto-layout-cell>p{margin:0.2em}.quarto-layout-cell img{max-width:100%}.quarto-layout-cell .html-widget{width:100% !important}.quarto-layout-cell div figure p{margin:0}.quarto-layout-cell figure{display:block;margin-inline-start:0;margin-inline-end:0}.quarto-layout-cell table{display:inline-table}.quarto-layout-cell-subref figcaption,figure .quarto-layout-row figure figcaption{text-align:center;font-style:italic}.quarto-figure{position:relative;margin-bottom:1em}.quarto-figure>figure{width:100%;margin-bottom:0}.quarto-figure-left>figure>p,.quarto-figure-left>figure>div{text-align:left}.quarto-figure-center>figure>p,.quarto-figure-center>figure>div{text-align:center}.quarto-figure-right>figure>p,.quarto-figure-right>figure>div{text-align:right}.quarto-figure>figure>div.cell-annotation,.quarto-figure>figure>div code{text-align:left}figure>p:empty{display:none}figure>p:first-child{margin-top:0;margin-bottom:0}figure>figcaption.quarto-float-caption-bottom{margin-bottom:0.5em}figure>figcaption.quarto-float-caption-top{margin-top:0.5em}:root{--mermaid-bg-color: transparent;--mermaid-edge-color: var(--bs-secondary);--mermaid-fg-color: var(--bs-body-color);--mermaid-fg-color--lighter: RGBA(var(--bs-body-color-rgb), 0.9);--mermaid-fg-color--lightest: RGBA(var(--bs-body-color-rgb), 0.8);--mermaid-font-family: var(--bs-body-font-family);--mermaid-label-bg-color: var(--bs-primary);--mermaid-label-fg-color: var(--bs-body-color);--mermaid-node-bg-color: RGBA(var(--bs-primary-rgb), 0.1);--mermaid-node-fg-color: var(--bs-primary)}pre{background-color:#f1f3f5}pre code{color:#003B4F}pre code span.al{color:#AD0000}pre code span.an{color:#5E5E5E}pre code span.at{color:#657422}pre code span.bn{color:#AD0000}pre code span.cf{color:#003B4F}pre code span.ch{color:#20794D}pre code span.cn{color:#8f5902}pre code span.co{color:#5E5E5E}pre code span.cv{color:#5E5E5E;font-style:italic}pre code span.do{color:#5E5E5E;font-style:italic}pre code span.dt{color:#AD0000}pre code span.dv{color:#AD0000}pre code span.er{color:#AD0000}pre code span.fl{color:#AD0000}pre code span.fu{color:#4758AB}pre code span.im{color:#00769E}pre code span.in{color:#5E5E5E}pre code span.kw{color:#003B4F}pre code span.op{color:#5E5E5E}pre code span.ot{color:#003B4F}pre code span.pp{color:#AD0000}pre code span.sc{color:#5E5E5E}pre code span.ss{color:#20794D}pre code span.st{color:#20794D}pre code span.va{color:#111111}pre code span.vs{color:#20794D}pre code span.wa{color:#5E5E5E;font-style:italic}
diff --git a/docs/deps/bootstrap-toc-1.0.1/bootstrap-toc.min.js b/docs/deps/bootstrap-toc-1.0.1/bootstrap-toc.min.js
new file mode 100644
index 0000000..c628326
--- /dev/null
+++ b/docs/deps/bootstrap-toc-1.0.1/bootstrap-toc.min.js
@@ -0,0 +1,5 @@
+/*!
+ * Bootstrap Table of Contents v1.0.1 (http://afeld.github.io/bootstrap-toc/)
+ * Copyright 2015 Aidan Feldman
+ * Licensed under MIT (https://github.com/afeld/bootstrap-toc/blob/gh-pages/LICENSE.md) */
+!function(a){"use strict";window.Toc={helpers:{findOrFilter:function(e,t){var n=e.find(t);return e.filter(t).add(n).filter(":not([data-toc-skip])")},generateUniqueIdBase:function(e){return a(e).text().trim().replace(/\'/gi,"").replace(/[& +$,:;=?@"#{}|^~[`%!'<>\]\.\/\(\)\*\\\n\t\b\v]/g,"-").replace(/-{2,}/g,"-").substring(0,64).replace(/^-+|-+$/gm,"").toLowerCase()||e.tagName.toLowerCase()},generateUniqueId:function(e){for(var t=this.generateUniqueIdBase(e),n=0;;n++){var r=t;if(0 ')},createChildNavList:function(e){var t=this.createNavList();return e.append(t),t},generateNavEl:function(e,t){var n=a(' ');n.attr("href","#"+e),n.text(t);var r=a(" ");return r.append(n),r},generateNavItem:function(e){var t=this.generateAnchor(e),n=a(e),r=n.data("toc-text")||n.text();return this.generateNavEl(t,r)},getTopLevel:function(e){for(var t=1;t<=6;t++){if(1
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/deps/font-awesome-6.5.2/css/all.css b/docs/deps/font-awesome-6.5.2/css/all.css
new file mode 100644
index 0000000..151dd57
--- /dev/null
+++ b/docs/deps/font-awesome-6.5.2/css/all.css
@@ -0,0 +1,8028 @@
+/*!
+ * Font Awesome Free 6.5.2 by @fontawesome - https://fontawesome.com
+ * License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License)
+ * Copyright 2024 Fonticons, Inc.
+ */
+.fa {
+ font-family: var(--fa-style-family, "Font Awesome 6 Free");
+ font-weight: var(--fa-style, 900); }
+
+.fa,
+.fa-classic,
+.fa-sharp,
+.fas,
+.fa-solid,
+.far,
+.fa-regular,
+.fab,
+.fa-brands {
+ -moz-osx-font-smoothing: grayscale;
+ -webkit-font-smoothing: antialiased;
+ display: var(--fa-display, inline-block);
+ font-style: normal;
+ font-variant: normal;
+ line-height: 1;
+ text-rendering: auto; }
+
+.fas,
+.fa-classic,
+.fa-solid,
+.far,
+.fa-regular {
+ font-family: 'Font Awesome 6 Free'; }
+
+.fab,
+.fa-brands {
+ font-family: 'Font Awesome 6 Brands'; }
+
+.fa-1x {
+ font-size: 1em; }
+
+.fa-2x {
+ font-size: 2em; }
+
+.fa-3x {
+ font-size: 3em; }
+
+.fa-4x {
+ font-size: 4em; }
+
+.fa-5x {
+ font-size: 5em; }
+
+.fa-6x {
+ font-size: 6em; }
+
+.fa-7x {
+ font-size: 7em; }
+
+.fa-8x {
+ font-size: 8em; }
+
+.fa-9x {
+ font-size: 9em; }
+
+.fa-10x {
+ font-size: 10em; }
+
+.fa-2xs {
+ font-size: 0.625em;
+ line-height: 0.1em;
+ vertical-align: 0.225em; }
+
+.fa-xs {
+ font-size: 0.75em;
+ line-height: 0.08333em;
+ vertical-align: 0.125em; }
+
+.fa-sm {
+ font-size: 0.875em;
+ line-height: 0.07143em;
+ vertical-align: 0.05357em; }
+
+.fa-lg {
+ font-size: 1.25em;
+ line-height: 0.05em;
+ vertical-align: -0.075em; }
+
+.fa-xl {
+ font-size: 1.5em;
+ line-height: 0.04167em;
+ vertical-align: -0.125em; }
+
+.fa-2xl {
+ font-size: 2em;
+ line-height: 0.03125em;
+ vertical-align: -0.1875em; }
+
+.fa-fw {
+ text-align: center;
+ width: 1.25em; }
+
+.fa-ul {
+ list-style-type: none;
+ margin-left: var(--fa-li-margin, 2.5em);
+ padding-left: 0; }
+ .fa-ul > li {
+ position: relative; }
+
+.fa-li {
+ left: calc(var(--fa-li-width, 2em) * -1);
+ position: absolute;
+ text-align: center;
+ width: var(--fa-li-width, 2em);
+ line-height: inherit; }
+
+.fa-border {
+ border-color: var(--fa-border-color, #eee);
+ border-radius: var(--fa-border-radius, 0.1em);
+ border-style: var(--fa-border-style, solid);
+ border-width: var(--fa-border-width, 0.08em);
+ padding: var(--fa-border-padding, 0.2em 0.25em 0.15em); }
+
+.fa-pull-left {
+ float: left;
+ margin-right: var(--fa-pull-margin, 0.3em); }
+
+.fa-pull-right {
+ float: right;
+ margin-left: var(--fa-pull-margin, 0.3em); }
+
+.fa-beat {
+ -webkit-animation-name: fa-beat;
+ animation-name: fa-beat;
+ -webkit-animation-delay: var(--fa-animation-delay, 0s);
+ animation-delay: var(--fa-animation-delay, 0s);
+ -webkit-animation-direction: var(--fa-animation-direction, normal);
+ animation-direction: var(--fa-animation-direction, normal);
+ -webkit-animation-duration: var(--fa-animation-duration, 1s);
+ animation-duration: var(--fa-animation-duration, 1s);
+ -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ -webkit-animation-timing-function: var(--fa-animation-timing, ease-in-out);
+ animation-timing-function: var(--fa-animation-timing, ease-in-out); }
+
+.fa-bounce {
+ -webkit-animation-name: fa-bounce;
+ animation-name: fa-bounce;
+ -webkit-animation-delay: var(--fa-animation-delay, 0s);
+ animation-delay: var(--fa-animation-delay, 0s);
+ -webkit-animation-direction: var(--fa-animation-direction, normal);
+ animation-direction: var(--fa-animation-direction, normal);
+ -webkit-animation-duration: var(--fa-animation-duration, 1s);
+ animation-duration: var(--fa-animation-duration, 1s);
+ -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ -webkit-animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.28, 0.84, 0.42, 1));
+ animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.28, 0.84, 0.42, 1)); }
+
+.fa-fade {
+ -webkit-animation-name: fa-fade;
+ animation-name: fa-fade;
+ -webkit-animation-delay: var(--fa-animation-delay, 0s);
+ animation-delay: var(--fa-animation-delay, 0s);
+ -webkit-animation-direction: var(--fa-animation-direction, normal);
+ animation-direction: var(--fa-animation-direction, normal);
+ -webkit-animation-duration: var(--fa-animation-duration, 1s);
+ animation-duration: var(--fa-animation-duration, 1s);
+ -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ -webkit-animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1));
+ animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1)); }
+
+.fa-beat-fade {
+ -webkit-animation-name: fa-beat-fade;
+ animation-name: fa-beat-fade;
+ -webkit-animation-delay: var(--fa-animation-delay, 0s);
+ animation-delay: var(--fa-animation-delay, 0s);
+ -webkit-animation-direction: var(--fa-animation-direction, normal);
+ animation-direction: var(--fa-animation-direction, normal);
+ -webkit-animation-duration: var(--fa-animation-duration, 1s);
+ animation-duration: var(--fa-animation-duration, 1s);
+ -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ -webkit-animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1));
+ animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1)); }
+
+.fa-flip {
+ -webkit-animation-name: fa-flip;
+ animation-name: fa-flip;
+ -webkit-animation-delay: var(--fa-animation-delay, 0s);
+ animation-delay: var(--fa-animation-delay, 0s);
+ -webkit-animation-direction: var(--fa-animation-direction, normal);
+ animation-direction: var(--fa-animation-direction, normal);
+ -webkit-animation-duration: var(--fa-animation-duration, 1s);
+ animation-duration: var(--fa-animation-duration, 1s);
+ -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ -webkit-animation-timing-function: var(--fa-animation-timing, ease-in-out);
+ animation-timing-function: var(--fa-animation-timing, ease-in-out); }
+
+.fa-shake {
+ -webkit-animation-name: fa-shake;
+ animation-name: fa-shake;
+ -webkit-animation-delay: var(--fa-animation-delay, 0s);
+ animation-delay: var(--fa-animation-delay, 0s);
+ -webkit-animation-direction: var(--fa-animation-direction, normal);
+ animation-direction: var(--fa-animation-direction, normal);
+ -webkit-animation-duration: var(--fa-animation-duration, 1s);
+ animation-duration: var(--fa-animation-duration, 1s);
+ -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ -webkit-animation-timing-function: var(--fa-animation-timing, linear);
+ animation-timing-function: var(--fa-animation-timing, linear); }
+
+.fa-spin {
+ -webkit-animation-name: fa-spin;
+ animation-name: fa-spin;
+ -webkit-animation-delay: var(--fa-animation-delay, 0s);
+ animation-delay: var(--fa-animation-delay, 0s);
+ -webkit-animation-direction: var(--fa-animation-direction, normal);
+ animation-direction: var(--fa-animation-direction, normal);
+ -webkit-animation-duration: var(--fa-animation-duration, 2s);
+ animation-duration: var(--fa-animation-duration, 2s);
+ -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ -webkit-animation-timing-function: var(--fa-animation-timing, linear);
+ animation-timing-function: var(--fa-animation-timing, linear); }
+
+.fa-spin-reverse {
+ --fa-animation-direction: reverse; }
+
+.fa-pulse,
+.fa-spin-pulse {
+ -webkit-animation-name: fa-spin;
+ animation-name: fa-spin;
+ -webkit-animation-direction: var(--fa-animation-direction, normal);
+ animation-direction: var(--fa-animation-direction, normal);
+ -webkit-animation-duration: var(--fa-animation-duration, 1s);
+ animation-duration: var(--fa-animation-duration, 1s);
+ -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ animation-iteration-count: var(--fa-animation-iteration-count, infinite);
+ -webkit-animation-timing-function: var(--fa-animation-timing, steps(8));
+ animation-timing-function: var(--fa-animation-timing, steps(8)); }
+
+@media (prefers-reduced-motion: reduce) {
+ .fa-beat,
+ .fa-bounce,
+ .fa-fade,
+ .fa-beat-fade,
+ .fa-flip,
+ .fa-pulse,
+ .fa-shake,
+ .fa-spin,
+ .fa-spin-pulse {
+ -webkit-animation-delay: -1ms;
+ animation-delay: -1ms;
+ -webkit-animation-duration: 1ms;
+ animation-duration: 1ms;
+ -webkit-animation-iteration-count: 1;
+ animation-iteration-count: 1;
+ -webkit-transition-delay: 0s;
+ transition-delay: 0s;
+ -webkit-transition-duration: 0s;
+ transition-duration: 0s; } }
+
+@-webkit-keyframes fa-beat {
+ 0%, 90% {
+ -webkit-transform: scale(1);
+ transform: scale(1); }
+ 45% {
+ -webkit-transform: scale(var(--fa-beat-scale, 1.25));
+ transform: scale(var(--fa-beat-scale, 1.25)); } }
+
+@keyframes fa-beat {
+ 0%, 90% {
+ -webkit-transform: scale(1);
+ transform: scale(1); }
+ 45% {
+ -webkit-transform: scale(var(--fa-beat-scale, 1.25));
+ transform: scale(var(--fa-beat-scale, 1.25)); } }
+
+@-webkit-keyframes fa-bounce {
+ 0% {
+ -webkit-transform: scale(1, 1) translateY(0);
+ transform: scale(1, 1) translateY(0); }
+ 10% {
+ -webkit-transform: scale(var(--fa-bounce-start-scale-x, 1.1), var(--fa-bounce-start-scale-y, 0.9)) translateY(0);
+ transform: scale(var(--fa-bounce-start-scale-x, 1.1), var(--fa-bounce-start-scale-y, 0.9)) translateY(0); }
+ 30% {
+ -webkit-transform: scale(var(--fa-bounce-jump-scale-x, 0.9), var(--fa-bounce-jump-scale-y, 1.1)) translateY(var(--fa-bounce-height, -0.5em));
+ transform: scale(var(--fa-bounce-jump-scale-x, 0.9), var(--fa-bounce-jump-scale-y, 1.1)) translateY(var(--fa-bounce-height, -0.5em)); }
+ 50% {
+ -webkit-transform: scale(var(--fa-bounce-land-scale-x, 1.05), var(--fa-bounce-land-scale-y, 0.95)) translateY(0);
+ transform: scale(var(--fa-bounce-land-scale-x, 1.05), var(--fa-bounce-land-scale-y, 0.95)) translateY(0); }
+ 57% {
+ -webkit-transform: scale(1, 1) translateY(var(--fa-bounce-rebound, -0.125em));
+ transform: scale(1, 1) translateY(var(--fa-bounce-rebound, -0.125em)); }
+ 64% {
+ -webkit-transform: scale(1, 1) translateY(0);
+ transform: scale(1, 1) translateY(0); }
+ 100% {
+ -webkit-transform: scale(1, 1) translateY(0);
+ transform: scale(1, 1) translateY(0); } }
+
+@keyframes fa-bounce {
+ 0% {
+ -webkit-transform: scale(1, 1) translateY(0);
+ transform: scale(1, 1) translateY(0); }
+ 10% {
+ -webkit-transform: scale(var(--fa-bounce-start-scale-x, 1.1), var(--fa-bounce-start-scale-y, 0.9)) translateY(0);
+ transform: scale(var(--fa-bounce-start-scale-x, 1.1), var(--fa-bounce-start-scale-y, 0.9)) translateY(0); }
+ 30% {
+ -webkit-transform: scale(var(--fa-bounce-jump-scale-x, 0.9), var(--fa-bounce-jump-scale-y, 1.1)) translateY(var(--fa-bounce-height, -0.5em));
+ transform: scale(var(--fa-bounce-jump-scale-x, 0.9), var(--fa-bounce-jump-scale-y, 1.1)) translateY(var(--fa-bounce-height, -0.5em)); }
+ 50% {
+ -webkit-transform: scale(var(--fa-bounce-land-scale-x, 1.05), var(--fa-bounce-land-scale-y, 0.95)) translateY(0);
+ transform: scale(var(--fa-bounce-land-scale-x, 1.05), var(--fa-bounce-land-scale-y, 0.95)) translateY(0); }
+ 57% {
+ -webkit-transform: scale(1, 1) translateY(var(--fa-bounce-rebound, -0.125em));
+ transform: scale(1, 1) translateY(var(--fa-bounce-rebound, -0.125em)); }
+ 64% {
+ -webkit-transform: scale(1, 1) translateY(0);
+ transform: scale(1, 1) translateY(0); }
+ 100% {
+ -webkit-transform: scale(1, 1) translateY(0);
+ transform: scale(1, 1) translateY(0); } }
+
+@-webkit-keyframes fa-fade {
+ 50% {
+ opacity: var(--fa-fade-opacity, 0.4); } }
+
+@keyframes fa-fade {
+ 50% {
+ opacity: var(--fa-fade-opacity, 0.4); } }
+
+@-webkit-keyframes fa-beat-fade {
+ 0%, 100% {
+ opacity: var(--fa-beat-fade-opacity, 0.4);
+ -webkit-transform: scale(1);
+ transform: scale(1); }
+ 50% {
+ opacity: 1;
+ -webkit-transform: scale(var(--fa-beat-fade-scale, 1.125));
+ transform: scale(var(--fa-beat-fade-scale, 1.125)); } }
+
+@keyframes fa-beat-fade {
+ 0%, 100% {
+ opacity: var(--fa-beat-fade-opacity, 0.4);
+ -webkit-transform: scale(1);
+ transform: scale(1); }
+ 50% {
+ opacity: 1;
+ -webkit-transform: scale(var(--fa-beat-fade-scale, 1.125));
+ transform: scale(var(--fa-beat-fade-scale, 1.125)); } }
+
+@-webkit-keyframes fa-flip {
+ 50% {
+ -webkit-transform: rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg));
+ transform: rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg)); } }
+
+@keyframes fa-flip {
+ 50% {
+ -webkit-transform: rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg));
+ transform: rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg)); } }
+
+@-webkit-keyframes fa-shake {
+ 0% {
+ -webkit-transform: rotate(-15deg);
+ transform: rotate(-15deg); }
+ 4% {
+ -webkit-transform: rotate(15deg);
+ transform: rotate(15deg); }
+ 8%, 24% {
+ -webkit-transform: rotate(-18deg);
+ transform: rotate(-18deg); }
+ 12%, 28% {
+ -webkit-transform: rotate(18deg);
+ transform: rotate(18deg); }
+ 16% {
+ -webkit-transform: rotate(-22deg);
+ transform: rotate(-22deg); }
+ 20% {
+ -webkit-transform: rotate(22deg);
+ transform: rotate(22deg); }
+ 32% {
+ -webkit-transform: rotate(-12deg);
+ transform: rotate(-12deg); }
+ 36% {
+ -webkit-transform: rotate(12deg);
+ transform: rotate(12deg); }
+ 40%, 100% {
+ -webkit-transform: rotate(0deg);
+ transform: rotate(0deg); } }
+
+@keyframes fa-shake {
+ 0% {
+ -webkit-transform: rotate(-15deg);
+ transform: rotate(-15deg); }
+ 4% {
+ -webkit-transform: rotate(15deg);
+ transform: rotate(15deg); }
+ 8%, 24% {
+ -webkit-transform: rotate(-18deg);
+ transform: rotate(-18deg); }
+ 12%, 28% {
+ -webkit-transform: rotate(18deg);
+ transform: rotate(18deg); }
+ 16% {
+ -webkit-transform: rotate(-22deg);
+ transform: rotate(-22deg); }
+ 20% {
+ -webkit-transform: rotate(22deg);
+ transform: rotate(22deg); }
+ 32% {
+ -webkit-transform: rotate(-12deg);
+ transform: rotate(-12deg); }
+ 36% {
+ -webkit-transform: rotate(12deg);
+ transform: rotate(12deg); }
+ 40%, 100% {
+ -webkit-transform: rotate(0deg);
+ transform: rotate(0deg); } }
+
+@-webkit-keyframes fa-spin {
+ 0% {
+ -webkit-transform: rotate(0deg);
+ transform: rotate(0deg); }
+ 100% {
+ -webkit-transform: rotate(360deg);
+ transform: rotate(360deg); } }
+
+@keyframes fa-spin {
+ 0% {
+ -webkit-transform: rotate(0deg);
+ transform: rotate(0deg); }
+ 100% {
+ -webkit-transform: rotate(360deg);
+ transform: rotate(360deg); } }
+
+.fa-rotate-90 {
+ -webkit-transform: rotate(90deg);
+ transform: rotate(90deg); }
+
+.fa-rotate-180 {
+ -webkit-transform: rotate(180deg);
+ transform: rotate(180deg); }
+
+.fa-rotate-270 {
+ -webkit-transform: rotate(270deg);
+ transform: rotate(270deg); }
+
+.fa-flip-horizontal {
+ -webkit-transform: scale(-1, 1);
+ transform: scale(-1, 1); }
+
+.fa-flip-vertical {
+ -webkit-transform: scale(1, -1);
+ transform: scale(1, -1); }
+
+.fa-flip-both,
+.fa-flip-horizontal.fa-flip-vertical {
+ -webkit-transform: scale(-1, -1);
+ transform: scale(-1, -1); }
+
+.fa-rotate-by {
+ -webkit-transform: rotate(var(--fa-rotate-angle, 0));
+ transform: rotate(var(--fa-rotate-angle, 0)); }
+
+.fa-stack {
+ display: inline-block;
+ height: 2em;
+ line-height: 2em;
+ position: relative;
+ vertical-align: middle;
+ width: 2.5em; }
+
+.fa-stack-1x,
+.fa-stack-2x {
+ left: 0;
+ position: absolute;
+ text-align: center;
+ width: 100%;
+ z-index: var(--fa-stack-z-index, auto); }
+
+.fa-stack-1x {
+ line-height: inherit; }
+
+.fa-stack-2x {
+ font-size: 2em; }
+
+.fa-inverse {
+ color: var(--fa-inverse, #fff); }
+
+/* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen
+readers do not read off random characters that represent icons */
+
+.fa-0::before {
+ content: "\30"; }
+
+.fa-1::before {
+ content: "\31"; }
+
+.fa-2::before {
+ content: "\32"; }
+
+.fa-3::before {
+ content: "\33"; }
+
+.fa-4::before {
+ content: "\34"; }
+
+.fa-5::before {
+ content: "\35"; }
+
+.fa-6::before {
+ content: "\36"; }
+
+.fa-7::before {
+ content: "\37"; }
+
+.fa-8::before {
+ content: "\38"; }
+
+.fa-9::before {
+ content: "\39"; }
+
+.fa-fill-drip::before {
+ content: "\f576"; }
+
+.fa-arrows-to-circle::before {
+ content: "\e4bd"; }
+
+.fa-circle-chevron-right::before {
+ content: "\f138"; }
+
+.fa-chevron-circle-right::before {
+ content: "\f138"; }
+
+.fa-at::before {
+ content: "\40"; }
+
+.fa-trash-can::before {
+ content: "\f2ed"; }
+
+.fa-trash-alt::before {
+ content: "\f2ed"; }
+
+.fa-text-height::before {
+ content: "\f034"; }
+
+.fa-user-xmark::before {
+ content: "\f235"; }
+
+.fa-user-times::before {
+ content: "\f235"; }
+
+.fa-stethoscope::before {
+ content: "\f0f1"; }
+
+.fa-message::before {
+ content: "\f27a"; }
+
+.fa-comment-alt::before {
+ content: "\f27a"; }
+
+.fa-info::before {
+ content: "\f129"; }
+
+.fa-down-left-and-up-right-to-center::before {
+ content: "\f422"; }
+
+.fa-compress-alt::before {
+ content: "\f422"; }
+
+.fa-explosion::before {
+ content: "\e4e9"; }
+
+.fa-file-lines::before {
+ content: "\f15c"; }
+
+.fa-file-alt::before {
+ content: "\f15c"; }
+
+.fa-file-text::before {
+ content: "\f15c"; }
+
+.fa-wave-square::before {
+ content: "\f83e"; }
+
+.fa-ring::before {
+ content: "\f70b"; }
+
+.fa-building-un::before {
+ content: "\e4d9"; }
+
+.fa-dice-three::before {
+ content: "\f527"; }
+
+.fa-calendar-days::before {
+ content: "\f073"; }
+
+.fa-calendar-alt::before {
+ content: "\f073"; }
+
+.fa-anchor-circle-check::before {
+ content: "\e4aa"; }
+
+.fa-building-circle-arrow-right::before {
+ content: "\e4d1"; }
+
+.fa-volleyball::before {
+ content: "\f45f"; }
+
+.fa-volleyball-ball::before {
+ content: "\f45f"; }
+
+.fa-arrows-up-to-line::before {
+ content: "\e4c2"; }
+
+.fa-sort-down::before {
+ content: "\f0dd"; }
+
+.fa-sort-desc::before {
+ content: "\f0dd"; }
+
+.fa-circle-minus::before {
+ content: "\f056"; }
+
+.fa-minus-circle::before {
+ content: "\f056"; }
+
+.fa-door-open::before {
+ content: "\f52b"; }
+
+.fa-right-from-bracket::before {
+ content: "\f2f5"; }
+
+.fa-sign-out-alt::before {
+ content: "\f2f5"; }
+
+.fa-atom::before {
+ content: "\f5d2"; }
+
+.fa-soap::before {
+ content: "\e06e"; }
+
+.fa-icons::before {
+ content: "\f86d"; }
+
+.fa-heart-music-camera-bolt::before {
+ content: "\f86d"; }
+
+.fa-microphone-lines-slash::before {
+ content: "\f539"; }
+
+.fa-microphone-alt-slash::before {
+ content: "\f539"; }
+
+.fa-bridge-circle-check::before {
+ content: "\e4c9"; }
+
+.fa-pump-medical::before {
+ content: "\e06a"; }
+
+.fa-fingerprint::before {
+ content: "\f577"; }
+
+.fa-hand-point-right::before {
+ content: "\f0a4"; }
+
+.fa-magnifying-glass-location::before {
+ content: "\f689"; }
+
+.fa-search-location::before {
+ content: "\f689"; }
+
+.fa-forward-step::before {
+ content: "\f051"; }
+
+.fa-step-forward::before {
+ content: "\f051"; }
+
+.fa-face-smile-beam::before {
+ content: "\f5b8"; }
+
+.fa-smile-beam::before {
+ content: "\f5b8"; }
+
+.fa-flag-checkered::before {
+ content: "\f11e"; }
+
+.fa-football::before {
+ content: "\f44e"; }
+
+.fa-football-ball::before {
+ content: "\f44e"; }
+
+.fa-school-circle-exclamation::before {
+ content: "\e56c"; }
+
+.fa-crop::before {
+ content: "\f125"; }
+
+.fa-angles-down::before {
+ content: "\f103"; }
+
+.fa-angle-double-down::before {
+ content: "\f103"; }
+
+.fa-users-rectangle::before {
+ content: "\e594"; }
+
+.fa-people-roof::before {
+ content: "\e537"; }
+
+.fa-people-line::before {
+ content: "\e534"; }
+
+.fa-beer-mug-empty::before {
+ content: "\f0fc"; }
+
+.fa-beer::before {
+ content: "\f0fc"; }
+
+.fa-diagram-predecessor::before {
+ content: "\e477"; }
+
+.fa-arrow-up-long::before {
+ content: "\f176"; }
+
+.fa-long-arrow-up::before {
+ content: "\f176"; }
+
+.fa-fire-flame-simple::before {
+ content: "\f46a"; }
+
+.fa-burn::before {
+ content: "\f46a"; }
+
+.fa-person::before {
+ content: "\f183"; }
+
+.fa-male::before {
+ content: "\f183"; }
+
+.fa-laptop::before {
+ content: "\f109"; }
+
+.fa-file-csv::before {
+ content: "\f6dd"; }
+
+.fa-menorah::before {
+ content: "\f676"; }
+
+.fa-truck-plane::before {
+ content: "\e58f"; }
+
+.fa-record-vinyl::before {
+ content: "\f8d9"; }
+
+.fa-face-grin-stars::before {
+ content: "\f587"; }
+
+.fa-grin-stars::before {
+ content: "\f587"; }
+
+.fa-bong::before {
+ content: "\f55c"; }
+
+.fa-spaghetti-monster-flying::before {
+ content: "\f67b"; }
+
+.fa-pastafarianism::before {
+ content: "\f67b"; }
+
+.fa-arrow-down-up-across-line::before {
+ content: "\e4af"; }
+
+.fa-spoon::before {
+ content: "\f2e5"; }
+
+.fa-utensil-spoon::before {
+ content: "\f2e5"; }
+
+.fa-jar-wheat::before {
+ content: "\e517"; }
+
+.fa-envelopes-bulk::before {
+ content: "\f674"; }
+
+.fa-mail-bulk::before {
+ content: "\f674"; }
+
+.fa-file-circle-exclamation::before {
+ content: "\e4eb"; }
+
+.fa-circle-h::before {
+ content: "\f47e"; }
+
+.fa-hospital-symbol::before {
+ content: "\f47e"; }
+
+.fa-pager::before {
+ content: "\f815"; }
+
+.fa-address-book::before {
+ content: "\f2b9"; }
+
+.fa-contact-book::before {
+ content: "\f2b9"; }
+
+.fa-strikethrough::before {
+ content: "\f0cc"; }
+
+.fa-k::before {
+ content: "\4b"; }
+
+.fa-landmark-flag::before {
+ content: "\e51c"; }
+
+.fa-pencil::before {
+ content: "\f303"; }
+
+.fa-pencil-alt::before {
+ content: "\f303"; }
+
+.fa-backward::before {
+ content: "\f04a"; }
+
+.fa-caret-right::before {
+ content: "\f0da"; }
+
+.fa-comments::before {
+ content: "\f086"; }
+
+.fa-paste::before {
+ content: "\f0ea"; }
+
+.fa-file-clipboard::before {
+ content: "\f0ea"; }
+
+.fa-code-pull-request::before {
+ content: "\e13c"; }
+
+.fa-clipboard-list::before {
+ content: "\f46d"; }
+
+.fa-truck-ramp-box::before {
+ content: "\f4de"; }
+
+.fa-truck-loading::before {
+ content: "\f4de"; }
+
+.fa-user-check::before {
+ content: "\f4fc"; }
+
+.fa-vial-virus::before {
+ content: "\e597"; }
+
+.fa-sheet-plastic::before {
+ content: "\e571"; }
+
+.fa-blog::before {
+ content: "\f781"; }
+
+.fa-user-ninja::before {
+ content: "\f504"; }
+
+.fa-person-arrow-up-from-line::before {
+ content: "\e539"; }
+
+.fa-scroll-torah::before {
+ content: "\f6a0"; }
+
+.fa-torah::before {
+ content: "\f6a0"; }
+
+.fa-broom-ball::before {
+ content: "\f458"; }
+
+.fa-quidditch::before {
+ content: "\f458"; }
+
+.fa-quidditch-broom-ball::before {
+ content: "\f458"; }
+
+.fa-toggle-off::before {
+ content: "\f204"; }
+
+.fa-box-archive::before {
+ content: "\f187"; }
+
+.fa-archive::before {
+ content: "\f187"; }
+
+.fa-person-drowning::before {
+ content: "\e545"; }
+
+.fa-arrow-down-9-1::before {
+ content: "\f886"; }
+
+.fa-sort-numeric-desc::before {
+ content: "\f886"; }
+
+.fa-sort-numeric-down-alt::before {
+ content: "\f886"; }
+
+.fa-face-grin-tongue-squint::before {
+ content: "\f58a"; }
+
+.fa-grin-tongue-squint::before {
+ content: "\f58a"; }
+
+.fa-spray-can::before {
+ content: "\f5bd"; }
+
+.fa-truck-monster::before {
+ content: "\f63b"; }
+
+.fa-w::before {
+ content: "\57"; }
+
+.fa-earth-africa::before {
+ content: "\f57c"; }
+
+.fa-globe-africa::before {
+ content: "\f57c"; }
+
+.fa-rainbow::before {
+ content: "\f75b"; }
+
+.fa-circle-notch::before {
+ content: "\f1ce"; }
+
+.fa-tablet-screen-button::before {
+ content: "\f3fa"; }
+
+.fa-tablet-alt::before {
+ content: "\f3fa"; }
+
+.fa-paw::before {
+ content: "\f1b0"; }
+
+.fa-cloud::before {
+ content: "\f0c2"; }
+
+.fa-trowel-bricks::before {
+ content: "\e58a"; }
+
+.fa-face-flushed::before {
+ content: "\f579"; }
+
+.fa-flushed::before {
+ content: "\f579"; }
+
+.fa-hospital-user::before {
+ content: "\f80d"; }
+
+.fa-tent-arrow-left-right::before {
+ content: "\e57f"; }
+
+.fa-gavel::before {
+ content: "\f0e3"; }
+
+.fa-legal::before {
+ content: "\f0e3"; }
+
+.fa-binoculars::before {
+ content: "\f1e5"; }
+
+.fa-microphone-slash::before {
+ content: "\f131"; }
+
+.fa-box-tissue::before {
+ content: "\e05b"; }
+
+.fa-motorcycle::before {
+ content: "\f21c"; }
+
+.fa-bell-concierge::before {
+ content: "\f562"; }
+
+.fa-concierge-bell::before {
+ content: "\f562"; }
+
+.fa-pen-ruler::before {
+ content: "\f5ae"; }
+
+.fa-pencil-ruler::before {
+ content: "\f5ae"; }
+
+.fa-people-arrows::before {
+ content: "\e068"; }
+
+.fa-people-arrows-left-right::before {
+ content: "\e068"; }
+
+.fa-mars-and-venus-burst::before {
+ content: "\e523"; }
+
+.fa-square-caret-right::before {
+ content: "\f152"; }
+
+.fa-caret-square-right::before {
+ content: "\f152"; }
+
+.fa-scissors::before {
+ content: "\f0c4"; }
+
+.fa-cut::before {
+ content: "\f0c4"; }
+
+.fa-sun-plant-wilt::before {
+ content: "\e57a"; }
+
+.fa-toilets-portable::before {
+ content: "\e584"; }
+
+.fa-hockey-puck::before {
+ content: "\f453"; }
+
+.fa-table::before {
+ content: "\f0ce"; }
+
+.fa-magnifying-glass-arrow-right::before {
+ content: "\e521"; }
+
+.fa-tachograph-digital::before {
+ content: "\f566"; }
+
+.fa-digital-tachograph::before {
+ content: "\f566"; }
+
+.fa-users-slash::before {
+ content: "\e073"; }
+
+.fa-clover::before {
+ content: "\e139"; }
+
+.fa-reply::before {
+ content: "\f3e5"; }
+
+.fa-mail-reply::before {
+ content: "\f3e5"; }
+
+.fa-star-and-crescent::before {
+ content: "\f699"; }
+
+.fa-house-fire::before {
+ content: "\e50c"; }
+
+.fa-square-minus::before {
+ content: "\f146"; }
+
+.fa-minus-square::before {
+ content: "\f146"; }
+
+.fa-helicopter::before {
+ content: "\f533"; }
+
+.fa-compass::before {
+ content: "\f14e"; }
+
+.fa-square-caret-down::before {
+ content: "\f150"; }
+
+.fa-caret-square-down::before {
+ content: "\f150"; }
+
+.fa-file-circle-question::before {
+ content: "\e4ef"; }
+
+.fa-laptop-code::before {
+ content: "\f5fc"; }
+
+.fa-swatchbook::before {
+ content: "\f5c3"; }
+
+.fa-prescription-bottle::before {
+ content: "\f485"; }
+
+.fa-bars::before {
+ content: "\f0c9"; }
+
+.fa-navicon::before {
+ content: "\f0c9"; }
+
+.fa-people-group::before {
+ content: "\e533"; }
+
+.fa-hourglass-end::before {
+ content: "\f253"; }
+
+.fa-hourglass-3::before {
+ content: "\f253"; }
+
+.fa-heart-crack::before {
+ content: "\f7a9"; }
+
+.fa-heart-broken::before {
+ content: "\f7a9"; }
+
+.fa-square-up-right::before {
+ content: "\f360"; }
+
+.fa-external-link-square-alt::before {
+ content: "\f360"; }
+
+.fa-face-kiss-beam::before {
+ content: "\f597"; }
+
+.fa-kiss-beam::before {
+ content: "\f597"; }
+
+.fa-film::before {
+ content: "\f008"; }
+
+.fa-ruler-horizontal::before {
+ content: "\f547"; }
+
+.fa-people-robbery::before {
+ content: "\e536"; }
+
+.fa-lightbulb::before {
+ content: "\f0eb"; }
+
+.fa-caret-left::before {
+ content: "\f0d9"; }
+
+.fa-circle-exclamation::before {
+ content: "\f06a"; }
+
+.fa-exclamation-circle::before {
+ content: "\f06a"; }
+
+.fa-school-circle-xmark::before {
+ content: "\e56d"; }
+
+.fa-arrow-right-from-bracket::before {
+ content: "\f08b"; }
+
+.fa-sign-out::before {
+ content: "\f08b"; }
+
+.fa-circle-chevron-down::before {
+ content: "\f13a"; }
+
+.fa-chevron-circle-down::before {
+ content: "\f13a"; }
+
+.fa-unlock-keyhole::before {
+ content: "\f13e"; }
+
+.fa-unlock-alt::before {
+ content: "\f13e"; }
+
+.fa-cloud-showers-heavy::before {
+ content: "\f740"; }
+
+.fa-headphones-simple::before {
+ content: "\f58f"; }
+
+.fa-headphones-alt::before {
+ content: "\f58f"; }
+
+.fa-sitemap::before {
+ content: "\f0e8"; }
+
+.fa-circle-dollar-to-slot::before {
+ content: "\f4b9"; }
+
+.fa-donate::before {
+ content: "\f4b9"; }
+
+.fa-memory::before {
+ content: "\f538"; }
+
+.fa-road-spikes::before {
+ content: "\e568"; }
+
+.fa-fire-burner::before {
+ content: "\e4f1"; }
+
+.fa-flag::before {
+ content: "\f024"; }
+
+.fa-hanukiah::before {
+ content: "\f6e6"; }
+
+.fa-feather::before {
+ content: "\f52d"; }
+
+.fa-volume-low::before {
+ content: "\f027"; }
+
+.fa-volume-down::before {
+ content: "\f027"; }
+
+.fa-comment-slash::before {
+ content: "\f4b3"; }
+
+.fa-cloud-sun-rain::before {
+ content: "\f743"; }
+
+.fa-compress::before {
+ content: "\f066"; }
+
+.fa-wheat-awn::before {
+ content: "\e2cd"; }
+
+.fa-wheat-alt::before {
+ content: "\e2cd"; }
+
+.fa-ankh::before {
+ content: "\f644"; }
+
+.fa-hands-holding-child::before {
+ content: "\e4fa"; }
+
+.fa-asterisk::before {
+ content: "\2a"; }
+
+.fa-square-check::before {
+ content: "\f14a"; }
+
+.fa-check-square::before {
+ content: "\f14a"; }
+
+.fa-peseta-sign::before {
+ content: "\e221"; }
+
+.fa-heading::before {
+ content: "\f1dc"; }
+
+.fa-header::before {
+ content: "\f1dc"; }
+
+.fa-ghost::before {
+ content: "\f6e2"; }
+
+.fa-list::before {
+ content: "\f03a"; }
+
+.fa-list-squares::before {
+ content: "\f03a"; }
+
+.fa-square-phone-flip::before {
+ content: "\f87b"; }
+
+.fa-phone-square-alt::before {
+ content: "\f87b"; }
+
+.fa-cart-plus::before {
+ content: "\f217"; }
+
+.fa-gamepad::before {
+ content: "\f11b"; }
+
+.fa-circle-dot::before {
+ content: "\f192"; }
+
+.fa-dot-circle::before {
+ content: "\f192"; }
+
+.fa-face-dizzy::before {
+ content: "\f567"; }
+
+.fa-dizzy::before {
+ content: "\f567"; }
+
+.fa-egg::before {
+ content: "\f7fb"; }
+
+.fa-house-medical-circle-xmark::before {
+ content: "\e513"; }
+
+.fa-campground::before {
+ content: "\f6bb"; }
+
+.fa-folder-plus::before {
+ content: "\f65e"; }
+
+.fa-futbol::before {
+ content: "\f1e3"; }
+
+.fa-futbol-ball::before {
+ content: "\f1e3"; }
+
+.fa-soccer-ball::before {
+ content: "\f1e3"; }
+
+.fa-paintbrush::before {
+ content: "\f1fc"; }
+
+.fa-paint-brush::before {
+ content: "\f1fc"; }
+
+.fa-lock::before {
+ content: "\f023"; }
+
+.fa-gas-pump::before {
+ content: "\f52f"; }
+
+.fa-hot-tub-person::before {
+ content: "\f593"; }
+
+.fa-hot-tub::before {
+ content: "\f593"; }
+
+.fa-map-location::before {
+ content: "\f59f"; }
+
+.fa-map-marked::before {
+ content: "\f59f"; }
+
+.fa-house-flood-water::before {
+ content: "\e50e"; }
+
+.fa-tree::before {
+ content: "\f1bb"; }
+
+.fa-bridge-lock::before {
+ content: "\e4cc"; }
+
+.fa-sack-dollar::before {
+ content: "\f81d"; }
+
+.fa-pen-to-square::before {
+ content: "\f044"; }
+
+.fa-edit::before {
+ content: "\f044"; }
+
+.fa-car-side::before {
+ content: "\f5e4"; }
+
+.fa-share-nodes::before {
+ content: "\f1e0"; }
+
+.fa-share-alt::before {
+ content: "\f1e0"; }
+
+.fa-heart-circle-minus::before {
+ content: "\e4ff"; }
+
+.fa-hourglass-half::before {
+ content: "\f252"; }
+
+.fa-hourglass-2::before {
+ content: "\f252"; }
+
+.fa-microscope::before {
+ content: "\f610"; }
+
+.fa-sink::before {
+ content: "\e06d"; }
+
+.fa-bag-shopping::before {
+ content: "\f290"; }
+
+.fa-shopping-bag::before {
+ content: "\f290"; }
+
+.fa-arrow-down-z-a::before {
+ content: "\f881"; }
+
+.fa-sort-alpha-desc::before {
+ content: "\f881"; }
+
+.fa-sort-alpha-down-alt::before {
+ content: "\f881"; }
+
+.fa-mitten::before {
+ content: "\f7b5"; }
+
+.fa-person-rays::before {
+ content: "\e54d"; }
+
+.fa-users::before {
+ content: "\f0c0"; }
+
+.fa-eye-slash::before {
+ content: "\f070"; }
+
+.fa-flask-vial::before {
+ content: "\e4f3"; }
+
+.fa-hand::before {
+ content: "\f256"; }
+
+.fa-hand-paper::before {
+ content: "\f256"; }
+
+.fa-om::before {
+ content: "\f679"; }
+
+.fa-worm::before {
+ content: "\e599"; }
+
+.fa-house-circle-xmark::before {
+ content: "\e50b"; }
+
+.fa-plug::before {
+ content: "\f1e6"; }
+
+.fa-chevron-up::before {
+ content: "\f077"; }
+
+.fa-hand-spock::before {
+ content: "\f259"; }
+
+.fa-stopwatch::before {
+ content: "\f2f2"; }
+
+.fa-face-kiss::before {
+ content: "\f596"; }
+
+.fa-kiss::before {
+ content: "\f596"; }
+
+.fa-bridge-circle-xmark::before {
+ content: "\e4cb"; }
+
+.fa-face-grin-tongue::before {
+ content: "\f589"; }
+
+.fa-grin-tongue::before {
+ content: "\f589"; }
+
+.fa-chess-bishop::before {
+ content: "\f43a"; }
+
+.fa-face-grin-wink::before {
+ content: "\f58c"; }
+
+.fa-grin-wink::before {
+ content: "\f58c"; }
+
+.fa-ear-deaf::before {
+ content: "\f2a4"; }
+
+.fa-deaf::before {
+ content: "\f2a4"; }
+
+.fa-deafness::before {
+ content: "\f2a4"; }
+
+.fa-hard-of-hearing::before {
+ content: "\f2a4"; }
+
+.fa-road-circle-check::before {
+ content: "\e564"; }
+
+.fa-dice-five::before {
+ content: "\f523"; }
+
+.fa-square-rss::before {
+ content: "\f143"; }
+
+.fa-rss-square::before {
+ content: "\f143"; }
+
+.fa-land-mine-on::before {
+ content: "\e51b"; }
+
+.fa-i-cursor::before {
+ content: "\f246"; }
+
+.fa-stamp::before {
+ content: "\f5bf"; }
+
+.fa-stairs::before {
+ content: "\e289"; }
+
+.fa-i::before {
+ content: "\49"; }
+
+.fa-hryvnia-sign::before {
+ content: "\f6f2"; }
+
+.fa-hryvnia::before {
+ content: "\f6f2"; }
+
+.fa-pills::before {
+ content: "\f484"; }
+
+.fa-face-grin-wide::before {
+ content: "\f581"; }
+
+.fa-grin-alt::before {
+ content: "\f581"; }
+
+.fa-tooth::before {
+ content: "\f5c9"; }
+
+.fa-v::before {
+ content: "\56"; }
+
+.fa-bangladeshi-taka-sign::before {
+ content: "\e2e6"; }
+
+.fa-bicycle::before {
+ content: "\f206"; }
+
+.fa-staff-snake::before {
+ content: "\e579"; }
+
+.fa-rod-asclepius::before {
+ content: "\e579"; }
+
+.fa-rod-snake::before {
+ content: "\e579"; }
+
+.fa-staff-aesculapius::before {
+ content: "\e579"; }
+
+.fa-head-side-cough-slash::before {
+ content: "\e062"; }
+
+.fa-truck-medical::before {
+ content: "\f0f9"; }
+
+.fa-ambulance::before {
+ content: "\f0f9"; }
+
+.fa-wheat-awn-circle-exclamation::before {
+ content: "\e598"; }
+
+.fa-snowman::before {
+ content: "\f7d0"; }
+
+.fa-mortar-pestle::before {
+ content: "\f5a7"; }
+
+.fa-road-barrier::before {
+ content: "\e562"; }
+
+.fa-school::before {
+ content: "\f549"; }
+
+.fa-igloo::before {
+ content: "\f7ae"; }
+
+.fa-joint::before {
+ content: "\f595"; }
+
+.fa-angle-right::before {
+ content: "\f105"; }
+
+.fa-horse::before {
+ content: "\f6f0"; }
+
+.fa-q::before {
+ content: "\51"; }
+
+.fa-g::before {
+ content: "\47"; }
+
+.fa-notes-medical::before {
+ content: "\f481"; }
+
+.fa-temperature-half::before {
+ content: "\f2c9"; }
+
+.fa-temperature-2::before {
+ content: "\f2c9"; }
+
+.fa-thermometer-2::before {
+ content: "\f2c9"; }
+
+.fa-thermometer-half::before {
+ content: "\f2c9"; }
+
+.fa-dong-sign::before {
+ content: "\e169"; }
+
+.fa-capsules::before {
+ content: "\f46b"; }
+
+.fa-poo-storm::before {
+ content: "\f75a"; }
+
+.fa-poo-bolt::before {
+ content: "\f75a"; }
+
+.fa-face-frown-open::before {
+ content: "\f57a"; }
+
+.fa-frown-open::before {
+ content: "\f57a"; }
+
+.fa-hand-point-up::before {
+ content: "\f0a6"; }
+
+.fa-money-bill::before {
+ content: "\f0d6"; }
+
+.fa-bookmark::before {
+ content: "\f02e"; }
+
+.fa-align-justify::before {
+ content: "\f039"; }
+
+.fa-umbrella-beach::before {
+ content: "\f5ca"; }
+
+.fa-helmet-un::before {
+ content: "\e503"; }
+
+.fa-bullseye::before {
+ content: "\f140"; }
+
+.fa-bacon::before {
+ content: "\f7e5"; }
+
+.fa-hand-point-down::before {
+ content: "\f0a7"; }
+
+.fa-arrow-up-from-bracket::before {
+ content: "\e09a"; }
+
+.fa-folder::before {
+ content: "\f07b"; }
+
+.fa-folder-blank::before {
+ content: "\f07b"; }
+
+.fa-file-waveform::before {
+ content: "\f478"; }
+
+.fa-file-medical-alt::before {
+ content: "\f478"; }
+
+.fa-radiation::before {
+ content: "\f7b9"; }
+
+.fa-chart-simple::before {
+ content: "\e473"; }
+
+.fa-mars-stroke::before {
+ content: "\f229"; }
+
+.fa-vial::before {
+ content: "\f492"; }
+
+.fa-gauge::before {
+ content: "\f624"; }
+
+.fa-dashboard::before {
+ content: "\f624"; }
+
+.fa-gauge-med::before {
+ content: "\f624"; }
+
+.fa-tachometer-alt-average::before {
+ content: "\f624"; }
+
+.fa-wand-magic-sparkles::before {
+ content: "\e2ca"; }
+
+.fa-magic-wand-sparkles::before {
+ content: "\e2ca"; }
+
+.fa-e::before {
+ content: "\45"; }
+
+.fa-pen-clip::before {
+ content: "\f305"; }
+
+.fa-pen-alt::before {
+ content: "\f305"; }
+
+.fa-bridge-circle-exclamation::before {
+ content: "\e4ca"; }
+
+.fa-user::before {
+ content: "\f007"; }
+
+.fa-school-circle-check::before {
+ content: "\e56b"; }
+
+.fa-dumpster::before {
+ content: "\f793"; }
+
+.fa-van-shuttle::before {
+ content: "\f5b6"; }
+
+.fa-shuttle-van::before {
+ content: "\f5b6"; }
+
+.fa-building-user::before {
+ content: "\e4da"; }
+
+.fa-square-caret-left::before {
+ content: "\f191"; }
+
+.fa-caret-square-left::before {
+ content: "\f191"; }
+
+.fa-highlighter::before {
+ content: "\f591"; }
+
+.fa-key::before {
+ content: "\f084"; }
+
+.fa-bullhorn::before {
+ content: "\f0a1"; }
+
+.fa-globe::before {
+ content: "\f0ac"; }
+
+.fa-synagogue::before {
+ content: "\f69b"; }
+
+.fa-person-half-dress::before {
+ content: "\e548"; }
+
+.fa-road-bridge::before {
+ content: "\e563"; }
+
+.fa-location-arrow::before {
+ content: "\f124"; }
+
+.fa-c::before {
+ content: "\43"; }
+
+.fa-tablet-button::before {
+ content: "\f10a"; }
+
+.fa-building-lock::before {
+ content: "\e4d6"; }
+
+.fa-pizza-slice::before {
+ content: "\f818"; }
+
+.fa-money-bill-wave::before {
+ content: "\f53a"; }
+
+.fa-chart-area::before {
+ content: "\f1fe"; }
+
+.fa-area-chart::before {
+ content: "\f1fe"; }
+
+.fa-house-flag::before {
+ content: "\e50d"; }
+
+.fa-person-circle-minus::before {
+ content: "\e540"; }
+
+.fa-ban::before {
+ content: "\f05e"; }
+
+.fa-cancel::before {
+ content: "\f05e"; }
+
+.fa-camera-rotate::before {
+ content: "\e0d8"; }
+
+.fa-spray-can-sparkles::before {
+ content: "\f5d0"; }
+
+.fa-air-freshener::before {
+ content: "\f5d0"; }
+
+.fa-star::before {
+ content: "\f005"; }
+
+.fa-repeat::before {
+ content: "\f363"; }
+
+.fa-cross::before {
+ content: "\f654"; }
+
+.fa-box::before {
+ content: "\f466"; }
+
+.fa-venus-mars::before {
+ content: "\f228"; }
+
+.fa-arrow-pointer::before {
+ content: "\f245"; }
+
+.fa-mouse-pointer::before {
+ content: "\f245"; }
+
+.fa-maximize::before {
+ content: "\f31e"; }
+
+.fa-expand-arrows-alt::before {
+ content: "\f31e"; }
+
+.fa-charging-station::before {
+ content: "\f5e7"; }
+
+.fa-shapes::before {
+ content: "\f61f"; }
+
+.fa-triangle-circle-square::before {
+ content: "\f61f"; }
+
+.fa-shuffle::before {
+ content: "\f074"; }
+
+.fa-random::before {
+ content: "\f074"; }
+
+.fa-person-running::before {
+ content: "\f70c"; }
+
+.fa-running::before {
+ content: "\f70c"; }
+
+.fa-mobile-retro::before {
+ content: "\e527"; }
+
+.fa-grip-lines-vertical::before {
+ content: "\f7a5"; }
+
+.fa-spider::before {
+ content: "\f717"; }
+
+.fa-hands-bound::before {
+ content: "\e4f9"; }
+
+.fa-file-invoice-dollar::before {
+ content: "\f571"; }
+
+.fa-plane-circle-exclamation::before {
+ content: "\e556"; }
+
+.fa-x-ray::before {
+ content: "\f497"; }
+
+.fa-spell-check::before {
+ content: "\f891"; }
+
+.fa-slash::before {
+ content: "\f715"; }
+
+.fa-computer-mouse::before {
+ content: "\f8cc"; }
+
+.fa-mouse::before {
+ content: "\f8cc"; }
+
+.fa-arrow-right-to-bracket::before {
+ content: "\f090"; }
+
+.fa-sign-in::before {
+ content: "\f090"; }
+
+.fa-shop-slash::before {
+ content: "\e070"; }
+
+.fa-store-alt-slash::before {
+ content: "\e070"; }
+
+.fa-server::before {
+ content: "\f233"; }
+
+.fa-virus-covid-slash::before {
+ content: "\e4a9"; }
+
+.fa-shop-lock::before {
+ content: "\e4a5"; }
+
+.fa-hourglass-start::before {
+ content: "\f251"; }
+
+.fa-hourglass-1::before {
+ content: "\f251"; }
+
+.fa-blender-phone::before {
+ content: "\f6b6"; }
+
+.fa-building-wheat::before {
+ content: "\e4db"; }
+
+.fa-person-breastfeeding::before {
+ content: "\e53a"; }
+
+.fa-right-to-bracket::before {
+ content: "\f2f6"; }
+
+.fa-sign-in-alt::before {
+ content: "\f2f6"; }
+
+.fa-venus::before {
+ content: "\f221"; }
+
+.fa-passport::before {
+ content: "\f5ab"; }
+
+.fa-heart-pulse::before {
+ content: "\f21e"; }
+
+.fa-heartbeat::before {
+ content: "\f21e"; }
+
+.fa-people-carry-box::before {
+ content: "\f4ce"; }
+
+.fa-people-carry::before {
+ content: "\f4ce"; }
+
+.fa-temperature-high::before {
+ content: "\f769"; }
+
+.fa-microchip::before {
+ content: "\f2db"; }
+
+.fa-crown::before {
+ content: "\f521"; }
+
+.fa-weight-hanging::before {
+ content: "\f5cd"; }
+
+.fa-xmarks-lines::before {
+ content: "\e59a"; }
+
+.fa-file-prescription::before {
+ content: "\f572"; }
+
+.fa-weight-scale::before {
+ content: "\f496"; }
+
+.fa-weight::before {
+ content: "\f496"; }
+
+.fa-user-group::before {
+ content: "\f500"; }
+
+.fa-user-friends::before {
+ content: "\f500"; }
+
+.fa-arrow-up-a-z::before {
+ content: "\f15e"; }
+
+.fa-sort-alpha-up::before {
+ content: "\f15e"; }
+
+.fa-chess-knight::before {
+ content: "\f441"; }
+
+.fa-face-laugh-squint::before {
+ content: "\f59b"; }
+
+.fa-laugh-squint::before {
+ content: "\f59b"; }
+
+.fa-wheelchair::before {
+ content: "\f193"; }
+
+.fa-circle-arrow-up::before {
+ content: "\f0aa"; }
+
+.fa-arrow-circle-up::before {
+ content: "\f0aa"; }
+
+.fa-toggle-on::before {
+ content: "\f205"; }
+
+.fa-person-walking::before {
+ content: "\f554"; }
+
+.fa-walking::before {
+ content: "\f554"; }
+
+.fa-l::before {
+ content: "\4c"; }
+
+.fa-fire::before {
+ content: "\f06d"; }
+
+.fa-bed-pulse::before {
+ content: "\f487"; }
+
+.fa-procedures::before {
+ content: "\f487"; }
+
+.fa-shuttle-space::before {
+ content: "\f197"; }
+
+.fa-space-shuttle::before {
+ content: "\f197"; }
+
+.fa-face-laugh::before {
+ content: "\f599"; }
+
+.fa-laugh::before {
+ content: "\f599"; }
+
+.fa-folder-open::before {
+ content: "\f07c"; }
+
+.fa-heart-circle-plus::before {
+ content: "\e500"; }
+
+.fa-code-fork::before {
+ content: "\e13b"; }
+
+.fa-city::before {
+ content: "\f64f"; }
+
+.fa-microphone-lines::before {
+ content: "\f3c9"; }
+
+.fa-microphone-alt::before {
+ content: "\f3c9"; }
+
+.fa-pepper-hot::before {
+ content: "\f816"; }
+
+.fa-unlock::before {
+ content: "\f09c"; }
+
+.fa-colon-sign::before {
+ content: "\e140"; }
+
+.fa-headset::before {
+ content: "\f590"; }
+
+.fa-store-slash::before {
+ content: "\e071"; }
+
+.fa-road-circle-xmark::before {
+ content: "\e566"; }
+
+.fa-user-minus::before {
+ content: "\f503"; }
+
+.fa-mars-stroke-up::before {
+ content: "\f22a"; }
+
+.fa-mars-stroke-v::before {
+ content: "\f22a"; }
+
+.fa-champagne-glasses::before {
+ content: "\f79f"; }
+
+.fa-glass-cheers::before {
+ content: "\f79f"; }
+
+.fa-clipboard::before {
+ content: "\f328"; }
+
+.fa-house-circle-exclamation::before {
+ content: "\e50a"; }
+
+.fa-file-arrow-up::before {
+ content: "\f574"; }
+
+.fa-file-upload::before {
+ content: "\f574"; }
+
+.fa-wifi::before {
+ content: "\f1eb"; }
+
+.fa-wifi-3::before {
+ content: "\f1eb"; }
+
+.fa-wifi-strong::before {
+ content: "\f1eb"; }
+
+.fa-bath::before {
+ content: "\f2cd"; }
+
+.fa-bathtub::before {
+ content: "\f2cd"; }
+
+.fa-underline::before {
+ content: "\f0cd"; }
+
+.fa-user-pen::before {
+ content: "\f4ff"; }
+
+.fa-user-edit::before {
+ content: "\f4ff"; }
+
+.fa-signature::before {
+ content: "\f5b7"; }
+
+.fa-stroopwafel::before {
+ content: "\f551"; }
+
+.fa-bold::before {
+ content: "\f032"; }
+
+.fa-anchor-lock::before {
+ content: "\e4ad"; }
+
+.fa-building-ngo::before {
+ content: "\e4d7"; }
+
+.fa-manat-sign::before {
+ content: "\e1d5"; }
+
+.fa-not-equal::before {
+ content: "\f53e"; }
+
+.fa-border-top-left::before {
+ content: "\f853"; }
+
+.fa-border-style::before {
+ content: "\f853"; }
+
+.fa-map-location-dot::before {
+ content: "\f5a0"; }
+
+.fa-map-marked-alt::before {
+ content: "\f5a0"; }
+
+.fa-jedi::before {
+ content: "\f669"; }
+
+.fa-square-poll-vertical::before {
+ content: "\f681"; }
+
+.fa-poll::before {
+ content: "\f681"; }
+
+.fa-mug-hot::before {
+ content: "\f7b6"; }
+
+.fa-car-battery::before {
+ content: "\f5df"; }
+
+.fa-battery-car::before {
+ content: "\f5df"; }
+
+.fa-gift::before {
+ content: "\f06b"; }
+
+.fa-dice-two::before {
+ content: "\f528"; }
+
+.fa-chess-queen::before {
+ content: "\f445"; }
+
+.fa-glasses::before {
+ content: "\f530"; }
+
+.fa-chess-board::before {
+ content: "\f43c"; }
+
+.fa-building-circle-check::before {
+ content: "\e4d2"; }
+
+.fa-person-chalkboard::before {
+ content: "\e53d"; }
+
+.fa-mars-stroke-right::before {
+ content: "\f22b"; }
+
+.fa-mars-stroke-h::before {
+ content: "\f22b"; }
+
+.fa-hand-back-fist::before {
+ content: "\f255"; }
+
+.fa-hand-rock::before {
+ content: "\f255"; }
+
+.fa-square-caret-up::before {
+ content: "\f151"; }
+
+.fa-caret-square-up::before {
+ content: "\f151"; }
+
+.fa-cloud-showers-water::before {
+ content: "\e4e4"; }
+
+.fa-chart-bar::before {
+ content: "\f080"; }
+
+.fa-bar-chart::before {
+ content: "\f080"; }
+
+.fa-hands-bubbles::before {
+ content: "\e05e"; }
+
+.fa-hands-wash::before {
+ content: "\e05e"; }
+
+.fa-less-than-equal::before {
+ content: "\f537"; }
+
+.fa-train::before {
+ content: "\f238"; }
+
+.fa-eye-low-vision::before {
+ content: "\f2a8"; }
+
+.fa-low-vision::before {
+ content: "\f2a8"; }
+
+.fa-crow::before {
+ content: "\f520"; }
+
+.fa-sailboat::before {
+ content: "\e445"; }
+
+.fa-window-restore::before {
+ content: "\f2d2"; }
+
+.fa-square-plus::before {
+ content: "\f0fe"; }
+
+.fa-plus-square::before {
+ content: "\f0fe"; }
+
+.fa-torii-gate::before {
+ content: "\f6a1"; }
+
+.fa-frog::before {
+ content: "\f52e"; }
+
+.fa-bucket::before {
+ content: "\e4cf"; }
+
+.fa-image::before {
+ content: "\f03e"; }
+
+.fa-microphone::before {
+ content: "\f130"; }
+
+.fa-cow::before {
+ content: "\f6c8"; }
+
+.fa-caret-up::before {
+ content: "\f0d8"; }
+
+.fa-screwdriver::before {
+ content: "\f54a"; }
+
+.fa-folder-closed::before {
+ content: "\e185"; }
+
+.fa-house-tsunami::before {
+ content: "\e515"; }
+
+.fa-square-nfi::before {
+ content: "\e576"; }
+
+.fa-arrow-up-from-ground-water::before {
+ content: "\e4b5"; }
+
+.fa-martini-glass::before {
+ content: "\f57b"; }
+
+.fa-glass-martini-alt::before {
+ content: "\f57b"; }
+
+.fa-rotate-left::before {
+ content: "\f2ea"; }
+
+.fa-rotate-back::before {
+ content: "\f2ea"; }
+
+.fa-rotate-backward::before {
+ content: "\f2ea"; }
+
+.fa-undo-alt::before {
+ content: "\f2ea"; }
+
+.fa-table-columns::before {
+ content: "\f0db"; }
+
+.fa-columns::before {
+ content: "\f0db"; }
+
+.fa-lemon::before {
+ content: "\f094"; }
+
+.fa-head-side-mask::before {
+ content: "\e063"; }
+
+.fa-handshake::before {
+ content: "\f2b5"; }
+
+.fa-gem::before {
+ content: "\f3a5"; }
+
+.fa-dolly::before {
+ content: "\f472"; }
+
+.fa-dolly-box::before {
+ content: "\f472"; }
+
+.fa-smoking::before {
+ content: "\f48d"; }
+
+.fa-minimize::before {
+ content: "\f78c"; }
+
+.fa-compress-arrows-alt::before {
+ content: "\f78c"; }
+
+.fa-monument::before {
+ content: "\f5a6"; }
+
+.fa-snowplow::before {
+ content: "\f7d2"; }
+
+.fa-angles-right::before {
+ content: "\f101"; }
+
+.fa-angle-double-right::before {
+ content: "\f101"; }
+
+.fa-cannabis::before {
+ content: "\f55f"; }
+
+.fa-circle-play::before {
+ content: "\f144"; }
+
+.fa-play-circle::before {
+ content: "\f144"; }
+
+.fa-tablets::before {
+ content: "\f490"; }
+
+.fa-ethernet::before {
+ content: "\f796"; }
+
+.fa-euro-sign::before {
+ content: "\f153"; }
+
+.fa-eur::before {
+ content: "\f153"; }
+
+.fa-euro::before {
+ content: "\f153"; }
+
+.fa-chair::before {
+ content: "\f6c0"; }
+
+.fa-circle-check::before {
+ content: "\f058"; }
+
+.fa-check-circle::before {
+ content: "\f058"; }
+
+.fa-circle-stop::before {
+ content: "\f28d"; }
+
+.fa-stop-circle::before {
+ content: "\f28d"; }
+
+.fa-compass-drafting::before {
+ content: "\f568"; }
+
+.fa-drafting-compass::before {
+ content: "\f568"; }
+
+.fa-plate-wheat::before {
+ content: "\e55a"; }
+
+.fa-icicles::before {
+ content: "\f7ad"; }
+
+.fa-person-shelter::before {
+ content: "\e54f"; }
+
+.fa-neuter::before {
+ content: "\f22c"; }
+
+.fa-id-badge::before {
+ content: "\f2c1"; }
+
+.fa-marker::before {
+ content: "\f5a1"; }
+
+.fa-face-laugh-beam::before {
+ content: "\f59a"; }
+
+.fa-laugh-beam::before {
+ content: "\f59a"; }
+
+.fa-helicopter-symbol::before {
+ content: "\e502"; }
+
+.fa-universal-access::before {
+ content: "\f29a"; }
+
+.fa-circle-chevron-up::before {
+ content: "\f139"; }
+
+.fa-chevron-circle-up::before {
+ content: "\f139"; }
+
+.fa-lari-sign::before {
+ content: "\e1c8"; }
+
+.fa-volcano::before {
+ content: "\f770"; }
+
+.fa-person-walking-dashed-line-arrow-right::before {
+ content: "\e553"; }
+
+.fa-sterling-sign::before {
+ content: "\f154"; }
+
+.fa-gbp::before {
+ content: "\f154"; }
+
+.fa-pound-sign::before {
+ content: "\f154"; }
+
+.fa-viruses::before {
+ content: "\e076"; }
+
+.fa-square-person-confined::before {
+ content: "\e577"; }
+
+.fa-user-tie::before {
+ content: "\f508"; }
+
+.fa-arrow-down-long::before {
+ content: "\f175"; }
+
+.fa-long-arrow-down::before {
+ content: "\f175"; }
+
+.fa-tent-arrow-down-to-line::before {
+ content: "\e57e"; }
+
+.fa-certificate::before {
+ content: "\f0a3"; }
+
+.fa-reply-all::before {
+ content: "\f122"; }
+
+.fa-mail-reply-all::before {
+ content: "\f122"; }
+
+.fa-suitcase::before {
+ content: "\f0f2"; }
+
+.fa-person-skating::before {
+ content: "\f7c5"; }
+
+.fa-skating::before {
+ content: "\f7c5"; }
+
+.fa-filter-circle-dollar::before {
+ content: "\f662"; }
+
+.fa-funnel-dollar::before {
+ content: "\f662"; }
+
+.fa-camera-retro::before {
+ content: "\f083"; }
+
+.fa-circle-arrow-down::before {
+ content: "\f0ab"; }
+
+.fa-arrow-circle-down::before {
+ content: "\f0ab"; }
+
+.fa-file-import::before {
+ content: "\f56f"; }
+
+.fa-arrow-right-to-file::before {
+ content: "\f56f"; }
+
+.fa-square-arrow-up-right::before {
+ content: "\f14c"; }
+
+.fa-external-link-square::before {
+ content: "\f14c"; }
+
+.fa-box-open::before {
+ content: "\f49e"; }
+
+.fa-scroll::before {
+ content: "\f70e"; }
+
+.fa-spa::before {
+ content: "\f5bb"; }
+
+.fa-location-pin-lock::before {
+ content: "\e51f"; }
+
+.fa-pause::before {
+ content: "\f04c"; }
+
+.fa-hill-avalanche::before {
+ content: "\e507"; }
+
+.fa-temperature-empty::before {
+ content: "\f2cb"; }
+
+.fa-temperature-0::before {
+ content: "\f2cb"; }
+
+.fa-thermometer-0::before {
+ content: "\f2cb"; }
+
+.fa-thermometer-empty::before {
+ content: "\f2cb"; }
+
+.fa-bomb::before {
+ content: "\f1e2"; }
+
+.fa-registered::before {
+ content: "\f25d"; }
+
+.fa-address-card::before {
+ content: "\f2bb"; }
+
+.fa-contact-card::before {
+ content: "\f2bb"; }
+
+.fa-vcard::before {
+ content: "\f2bb"; }
+
+.fa-scale-unbalanced-flip::before {
+ content: "\f516"; }
+
+.fa-balance-scale-right::before {
+ content: "\f516"; }
+
+.fa-subscript::before {
+ content: "\f12c"; }
+
+.fa-diamond-turn-right::before {
+ content: "\f5eb"; }
+
+.fa-directions::before {
+ content: "\f5eb"; }
+
+.fa-burst::before {
+ content: "\e4dc"; }
+
+.fa-house-laptop::before {
+ content: "\e066"; }
+
+.fa-laptop-house::before {
+ content: "\e066"; }
+
+.fa-face-tired::before {
+ content: "\f5c8"; }
+
+.fa-tired::before {
+ content: "\f5c8"; }
+
+.fa-money-bills::before {
+ content: "\e1f3"; }
+
+.fa-smog::before {
+ content: "\f75f"; }
+
+.fa-crutch::before {
+ content: "\f7f7"; }
+
+.fa-cloud-arrow-up::before {
+ content: "\f0ee"; }
+
+.fa-cloud-upload::before {
+ content: "\f0ee"; }
+
+.fa-cloud-upload-alt::before {
+ content: "\f0ee"; }
+
+.fa-palette::before {
+ content: "\f53f"; }
+
+.fa-arrows-turn-right::before {
+ content: "\e4c0"; }
+
+.fa-vest::before {
+ content: "\e085"; }
+
+.fa-ferry::before {
+ content: "\e4ea"; }
+
+.fa-arrows-down-to-people::before {
+ content: "\e4b9"; }
+
+.fa-seedling::before {
+ content: "\f4d8"; }
+
+.fa-sprout::before {
+ content: "\f4d8"; }
+
+.fa-left-right::before {
+ content: "\f337"; }
+
+.fa-arrows-alt-h::before {
+ content: "\f337"; }
+
+.fa-boxes-packing::before {
+ content: "\e4c7"; }
+
+.fa-circle-arrow-left::before {
+ content: "\f0a8"; }
+
+.fa-arrow-circle-left::before {
+ content: "\f0a8"; }
+
+.fa-group-arrows-rotate::before {
+ content: "\e4f6"; }
+
+.fa-bowl-food::before {
+ content: "\e4c6"; }
+
+.fa-candy-cane::before {
+ content: "\f786"; }
+
+.fa-arrow-down-wide-short::before {
+ content: "\f160"; }
+
+.fa-sort-amount-asc::before {
+ content: "\f160"; }
+
+.fa-sort-amount-down::before {
+ content: "\f160"; }
+
+.fa-cloud-bolt::before {
+ content: "\f76c"; }
+
+.fa-thunderstorm::before {
+ content: "\f76c"; }
+
+.fa-text-slash::before {
+ content: "\f87d"; }
+
+.fa-remove-format::before {
+ content: "\f87d"; }
+
+.fa-face-smile-wink::before {
+ content: "\f4da"; }
+
+.fa-smile-wink::before {
+ content: "\f4da"; }
+
+.fa-file-word::before {
+ content: "\f1c2"; }
+
+.fa-file-powerpoint::before {
+ content: "\f1c4"; }
+
+.fa-arrows-left-right::before {
+ content: "\f07e"; }
+
+.fa-arrows-h::before {
+ content: "\f07e"; }
+
+.fa-house-lock::before {
+ content: "\e510"; }
+
+.fa-cloud-arrow-down::before {
+ content: "\f0ed"; }
+
+.fa-cloud-download::before {
+ content: "\f0ed"; }
+
+.fa-cloud-download-alt::before {
+ content: "\f0ed"; }
+
+.fa-children::before {
+ content: "\e4e1"; }
+
+.fa-chalkboard::before {
+ content: "\f51b"; }
+
+.fa-blackboard::before {
+ content: "\f51b"; }
+
+.fa-user-large-slash::before {
+ content: "\f4fa"; }
+
+.fa-user-alt-slash::before {
+ content: "\f4fa"; }
+
+.fa-envelope-open::before {
+ content: "\f2b6"; }
+
+.fa-handshake-simple-slash::before {
+ content: "\e05f"; }
+
+.fa-handshake-alt-slash::before {
+ content: "\e05f"; }
+
+.fa-mattress-pillow::before {
+ content: "\e525"; }
+
+.fa-guarani-sign::before {
+ content: "\e19a"; }
+
+.fa-arrows-rotate::before {
+ content: "\f021"; }
+
+.fa-refresh::before {
+ content: "\f021"; }
+
+.fa-sync::before {
+ content: "\f021"; }
+
+.fa-fire-extinguisher::before {
+ content: "\f134"; }
+
+.fa-cruzeiro-sign::before {
+ content: "\e152"; }
+
+.fa-greater-than-equal::before {
+ content: "\f532"; }
+
+.fa-shield-halved::before {
+ content: "\f3ed"; }
+
+.fa-shield-alt::before {
+ content: "\f3ed"; }
+
+.fa-book-atlas::before {
+ content: "\f558"; }
+
+.fa-atlas::before {
+ content: "\f558"; }
+
+.fa-virus::before {
+ content: "\e074"; }
+
+.fa-envelope-circle-check::before {
+ content: "\e4e8"; }
+
+.fa-layer-group::before {
+ content: "\f5fd"; }
+
+.fa-arrows-to-dot::before {
+ content: "\e4be"; }
+
+.fa-archway::before {
+ content: "\f557"; }
+
+.fa-heart-circle-check::before {
+ content: "\e4fd"; }
+
+.fa-house-chimney-crack::before {
+ content: "\f6f1"; }
+
+.fa-house-damage::before {
+ content: "\f6f1"; }
+
+.fa-file-zipper::before {
+ content: "\f1c6"; }
+
+.fa-file-archive::before {
+ content: "\f1c6"; }
+
+.fa-square::before {
+ content: "\f0c8"; }
+
+.fa-martini-glass-empty::before {
+ content: "\f000"; }
+
+.fa-glass-martini::before {
+ content: "\f000"; }
+
+.fa-couch::before {
+ content: "\f4b8"; }
+
+.fa-cedi-sign::before {
+ content: "\e0df"; }
+
+.fa-italic::before {
+ content: "\f033"; }
+
+.fa-table-cells-column-lock::before {
+ content: "\e678"; }
+
+.fa-church::before {
+ content: "\f51d"; }
+
+.fa-comments-dollar::before {
+ content: "\f653"; }
+
+.fa-democrat::before {
+ content: "\f747"; }
+
+.fa-z::before {
+ content: "\5a"; }
+
+.fa-person-skiing::before {
+ content: "\f7c9"; }
+
+.fa-skiing::before {
+ content: "\f7c9"; }
+
+.fa-road-lock::before {
+ content: "\e567"; }
+
+.fa-a::before {
+ content: "\41"; }
+
+.fa-temperature-arrow-down::before {
+ content: "\e03f"; }
+
+.fa-temperature-down::before {
+ content: "\e03f"; }
+
+.fa-feather-pointed::before {
+ content: "\f56b"; }
+
+.fa-feather-alt::before {
+ content: "\f56b"; }
+
+.fa-p::before {
+ content: "\50"; }
+
+.fa-snowflake::before {
+ content: "\f2dc"; }
+
+.fa-newspaper::before {
+ content: "\f1ea"; }
+
+.fa-rectangle-ad::before {
+ content: "\f641"; }
+
+.fa-ad::before {
+ content: "\f641"; }
+
+.fa-circle-arrow-right::before {
+ content: "\f0a9"; }
+
+.fa-arrow-circle-right::before {
+ content: "\f0a9"; }
+
+.fa-filter-circle-xmark::before {
+ content: "\e17b"; }
+
+.fa-locust::before {
+ content: "\e520"; }
+
+.fa-sort::before {
+ content: "\f0dc"; }
+
+.fa-unsorted::before {
+ content: "\f0dc"; }
+
+.fa-list-ol::before {
+ content: "\f0cb"; }
+
+.fa-list-1-2::before {
+ content: "\f0cb"; }
+
+.fa-list-numeric::before {
+ content: "\f0cb"; }
+
+.fa-person-dress-burst::before {
+ content: "\e544"; }
+
+.fa-money-check-dollar::before {
+ content: "\f53d"; }
+
+.fa-money-check-alt::before {
+ content: "\f53d"; }
+
+.fa-vector-square::before {
+ content: "\f5cb"; }
+
+.fa-bread-slice::before {
+ content: "\f7ec"; }
+
+.fa-language::before {
+ content: "\f1ab"; }
+
+.fa-face-kiss-wink-heart::before {
+ content: "\f598"; }
+
+.fa-kiss-wink-heart::before {
+ content: "\f598"; }
+
+.fa-filter::before {
+ content: "\f0b0"; }
+
+.fa-question::before {
+ content: "\3f"; }
+
+.fa-file-signature::before {
+ content: "\f573"; }
+
+.fa-up-down-left-right::before {
+ content: "\f0b2"; }
+
+.fa-arrows-alt::before {
+ content: "\f0b2"; }
+
+.fa-house-chimney-user::before {
+ content: "\e065"; }
+
+.fa-hand-holding-heart::before {
+ content: "\f4be"; }
+
+.fa-puzzle-piece::before {
+ content: "\f12e"; }
+
+.fa-money-check::before {
+ content: "\f53c"; }
+
+.fa-star-half-stroke::before {
+ content: "\f5c0"; }
+
+.fa-star-half-alt::before {
+ content: "\f5c0"; }
+
+.fa-code::before {
+ content: "\f121"; }
+
+.fa-whiskey-glass::before {
+ content: "\f7a0"; }
+
+.fa-glass-whiskey::before {
+ content: "\f7a0"; }
+
+.fa-building-circle-exclamation::before {
+ content: "\e4d3"; }
+
+.fa-magnifying-glass-chart::before {
+ content: "\e522"; }
+
+.fa-arrow-up-right-from-square::before {
+ content: "\f08e"; }
+
+.fa-external-link::before {
+ content: "\f08e"; }
+
+.fa-cubes-stacked::before {
+ content: "\e4e6"; }
+
+.fa-won-sign::before {
+ content: "\f159"; }
+
+.fa-krw::before {
+ content: "\f159"; }
+
+.fa-won::before {
+ content: "\f159"; }
+
+.fa-virus-covid::before {
+ content: "\e4a8"; }
+
+.fa-austral-sign::before {
+ content: "\e0a9"; }
+
+.fa-f::before {
+ content: "\46"; }
+
+.fa-leaf::before {
+ content: "\f06c"; }
+
+.fa-road::before {
+ content: "\f018"; }
+
+.fa-taxi::before {
+ content: "\f1ba"; }
+
+.fa-cab::before {
+ content: "\f1ba"; }
+
+.fa-person-circle-plus::before {
+ content: "\e541"; }
+
+.fa-chart-pie::before {
+ content: "\f200"; }
+
+.fa-pie-chart::before {
+ content: "\f200"; }
+
+.fa-bolt-lightning::before {
+ content: "\e0b7"; }
+
+.fa-sack-xmark::before {
+ content: "\e56a"; }
+
+.fa-file-excel::before {
+ content: "\f1c3"; }
+
+.fa-file-contract::before {
+ content: "\f56c"; }
+
+.fa-fish-fins::before {
+ content: "\e4f2"; }
+
+.fa-building-flag::before {
+ content: "\e4d5"; }
+
+.fa-face-grin-beam::before {
+ content: "\f582"; }
+
+.fa-grin-beam::before {
+ content: "\f582"; }
+
+.fa-object-ungroup::before {
+ content: "\f248"; }
+
+.fa-poop::before {
+ content: "\f619"; }
+
+.fa-location-pin::before {
+ content: "\f041"; }
+
+.fa-map-marker::before {
+ content: "\f041"; }
+
+.fa-kaaba::before {
+ content: "\f66b"; }
+
+.fa-toilet-paper::before {
+ content: "\f71e"; }
+
+.fa-helmet-safety::before {
+ content: "\f807"; }
+
+.fa-hard-hat::before {
+ content: "\f807"; }
+
+.fa-hat-hard::before {
+ content: "\f807"; }
+
+.fa-eject::before {
+ content: "\f052"; }
+
+.fa-circle-right::before {
+ content: "\f35a"; }
+
+.fa-arrow-alt-circle-right::before {
+ content: "\f35a"; }
+
+.fa-plane-circle-check::before {
+ content: "\e555"; }
+
+.fa-face-rolling-eyes::before {
+ content: "\f5a5"; }
+
+.fa-meh-rolling-eyes::before {
+ content: "\f5a5"; }
+
+.fa-object-group::before {
+ content: "\f247"; }
+
+.fa-chart-line::before {
+ content: "\f201"; }
+
+.fa-line-chart::before {
+ content: "\f201"; }
+
+.fa-mask-ventilator::before {
+ content: "\e524"; }
+
+.fa-arrow-right::before {
+ content: "\f061"; }
+
+.fa-signs-post::before {
+ content: "\f277"; }
+
+.fa-map-signs::before {
+ content: "\f277"; }
+
+.fa-cash-register::before {
+ content: "\f788"; }
+
+.fa-person-circle-question::before {
+ content: "\e542"; }
+
+.fa-h::before {
+ content: "\48"; }
+
+.fa-tarp::before {
+ content: "\e57b"; }
+
+.fa-screwdriver-wrench::before {
+ content: "\f7d9"; }
+
+.fa-tools::before {
+ content: "\f7d9"; }
+
+.fa-arrows-to-eye::before {
+ content: "\e4bf"; }
+
+.fa-plug-circle-bolt::before {
+ content: "\e55b"; }
+
+.fa-heart::before {
+ content: "\f004"; }
+
+.fa-mars-and-venus::before {
+ content: "\f224"; }
+
+.fa-house-user::before {
+ content: "\e1b0"; }
+
+.fa-home-user::before {
+ content: "\e1b0"; }
+
+.fa-dumpster-fire::before {
+ content: "\f794"; }
+
+.fa-house-crack::before {
+ content: "\e3b1"; }
+
+.fa-martini-glass-citrus::before {
+ content: "\f561"; }
+
+.fa-cocktail::before {
+ content: "\f561"; }
+
+.fa-face-surprise::before {
+ content: "\f5c2"; }
+
+.fa-surprise::before {
+ content: "\f5c2"; }
+
+.fa-bottle-water::before {
+ content: "\e4c5"; }
+
+.fa-circle-pause::before {
+ content: "\f28b"; }
+
+.fa-pause-circle::before {
+ content: "\f28b"; }
+
+.fa-toilet-paper-slash::before {
+ content: "\e072"; }
+
+.fa-apple-whole::before {
+ content: "\f5d1"; }
+
+.fa-apple-alt::before {
+ content: "\f5d1"; }
+
+.fa-kitchen-set::before {
+ content: "\e51a"; }
+
+.fa-r::before {
+ content: "\52"; }
+
+.fa-temperature-quarter::before {
+ content: "\f2ca"; }
+
+.fa-temperature-1::before {
+ content: "\f2ca"; }
+
+.fa-thermometer-1::before {
+ content: "\f2ca"; }
+
+.fa-thermometer-quarter::before {
+ content: "\f2ca"; }
+
+.fa-cube::before {
+ content: "\f1b2"; }
+
+.fa-bitcoin-sign::before {
+ content: "\e0b4"; }
+
+.fa-shield-dog::before {
+ content: "\e573"; }
+
+.fa-solar-panel::before {
+ content: "\f5ba"; }
+
+.fa-lock-open::before {
+ content: "\f3c1"; }
+
+.fa-elevator::before {
+ content: "\e16d"; }
+
+.fa-money-bill-transfer::before {
+ content: "\e528"; }
+
+.fa-money-bill-trend-up::before {
+ content: "\e529"; }
+
+.fa-house-flood-water-circle-arrow-right::before {
+ content: "\e50f"; }
+
+.fa-square-poll-horizontal::before {
+ content: "\f682"; }
+
+.fa-poll-h::before {
+ content: "\f682"; }
+
+.fa-circle::before {
+ content: "\f111"; }
+
+.fa-backward-fast::before {
+ content: "\f049"; }
+
+.fa-fast-backward::before {
+ content: "\f049"; }
+
+.fa-recycle::before {
+ content: "\f1b8"; }
+
+.fa-user-astronaut::before {
+ content: "\f4fb"; }
+
+.fa-plane-slash::before {
+ content: "\e069"; }
+
+.fa-trademark::before {
+ content: "\f25c"; }
+
+.fa-basketball::before {
+ content: "\f434"; }
+
+.fa-basketball-ball::before {
+ content: "\f434"; }
+
+.fa-satellite-dish::before {
+ content: "\f7c0"; }
+
+.fa-circle-up::before {
+ content: "\f35b"; }
+
+.fa-arrow-alt-circle-up::before {
+ content: "\f35b"; }
+
+.fa-mobile-screen-button::before {
+ content: "\f3cd"; }
+
+.fa-mobile-alt::before {
+ content: "\f3cd"; }
+
+.fa-volume-high::before {
+ content: "\f028"; }
+
+.fa-volume-up::before {
+ content: "\f028"; }
+
+.fa-users-rays::before {
+ content: "\e593"; }
+
+.fa-wallet::before {
+ content: "\f555"; }
+
+.fa-clipboard-check::before {
+ content: "\f46c"; }
+
+.fa-file-audio::before {
+ content: "\f1c7"; }
+
+.fa-burger::before {
+ content: "\f805"; }
+
+.fa-hamburger::before {
+ content: "\f805"; }
+
+.fa-wrench::before {
+ content: "\f0ad"; }
+
+.fa-bugs::before {
+ content: "\e4d0"; }
+
+.fa-rupee-sign::before {
+ content: "\f156"; }
+
+.fa-rupee::before {
+ content: "\f156"; }
+
+.fa-file-image::before {
+ content: "\f1c5"; }
+
+.fa-circle-question::before {
+ content: "\f059"; }
+
+.fa-question-circle::before {
+ content: "\f059"; }
+
+.fa-plane-departure::before {
+ content: "\f5b0"; }
+
+.fa-handshake-slash::before {
+ content: "\e060"; }
+
+.fa-book-bookmark::before {
+ content: "\e0bb"; }
+
+.fa-code-branch::before {
+ content: "\f126"; }
+
+.fa-hat-cowboy::before {
+ content: "\f8c0"; }
+
+.fa-bridge::before {
+ content: "\e4c8"; }
+
+.fa-phone-flip::before {
+ content: "\f879"; }
+
+.fa-phone-alt::before {
+ content: "\f879"; }
+
+.fa-truck-front::before {
+ content: "\e2b7"; }
+
+.fa-cat::before {
+ content: "\f6be"; }
+
+.fa-anchor-circle-exclamation::before {
+ content: "\e4ab"; }
+
+.fa-truck-field::before {
+ content: "\e58d"; }
+
+.fa-route::before {
+ content: "\f4d7"; }
+
+.fa-clipboard-question::before {
+ content: "\e4e3"; }
+
+.fa-panorama::before {
+ content: "\e209"; }
+
+.fa-comment-medical::before {
+ content: "\f7f5"; }
+
+.fa-teeth-open::before {
+ content: "\f62f"; }
+
+.fa-file-circle-minus::before {
+ content: "\e4ed"; }
+
+.fa-tags::before {
+ content: "\f02c"; }
+
+.fa-wine-glass::before {
+ content: "\f4e3"; }
+
+.fa-forward-fast::before {
+ content: "\f050"; }
+
+.fa-fast-forward::before {
+ content: "\f050"; }
+
+.fa-face-meh-blank::before {
+ content: "\f5a4"; }
+
+.fa-meh-blank::before {
+ content: "\f5a4"; }
+
+.fa-square-parking::before {
+ content: "\f540"; }
+
+.fa-parking::before {
+ content: "\f540"; }
+
+.fa-house-signal::before {
+ content: "\e012"; }
+
+.fa-bars-progress::before {
+ content: "\f828"; }
+
+.fa-tasks-alt::before {
+ content: "\f828"; }
+
+.fa-faucet-drip::before {
+ content: "\e006"; }
+
+.fa-cart-flatbed::before {
+ content: "\f474"; }
+
+.fa-dolly-flatbed::before {
+ content: "\f474"; }
+
+.fa-ban-smoking::before {
+ content: "\f54d"; }
+
+.fa-smoking-ban::before {
+ content: "\f54d"; }
+
+.fa-terminal::before {
+ content: "\f120"; }
+
+.fa-mobile-button::before {
+ content: "\f10b"; }
+
+.fa-house-medical-flag::before {
+ content: "\e514"; }
+
+.fa-basket-shopping::before {
+ content: "\f291"; }
+
+.fa-shopping-basket::before {
+ content: "\f291"; }
+
+.fa-tape::before {
+ content: "\f4db"; }
+
+.fa-bus-simple::before {
+ content: "\f55e"; }
+
+.fa-bus-alt::before {
+ content: "\f55e"; }
+
+.fa-eye::before {
+ content: "\f06e"; }
+
+.fa-face-sad-cry::before {
+ content: "\f5b3"; }
+
+.fa-sad-cry::before {
+ content: "\f5b3"; }
+
+.fa-audio-description::before {
+ content: "\f29e"; }
+
+.fa-person-military-to-person::before {
+ content: "\e54c"; }
+
+.fa-file-shield::before {
+ content: "\e4f0"; }
+
+.fa-user-slash::before {
+ content: "\f506"; }
+
+.fa-pen::before {
+ content: "\f304"; }
+
+.fa-tower-observation::before {
+ content: "\e586"; }
+
+.fa-file-code::before {
+ content: "\f1c9"; }
+
+.fa-signal::before {
+ content: "\f012"; }
+
+.fa-signal-5::before {
+ content: "\f012"; }
+
+.fa-signal-perfect::before {
+ content: "\f012"; }
+
+.fa-bus::before {
+ content: "\f207"; }
+
+.fa-heart-circle-xmark::before {
+ content: "\e501"; }
+
+.fa-house-chimney::before {
+ content: "\e3af"; }
+
+.fa-home-lg::before {
+ content: "\e3af"; }
+
+.fa-window-maximize::before {
+ content: "\f2d0"; }
+
+.fa-face-frown::before {
+ content: "\f119"; }
+
+.fa-frown::before {
+ content: "\f119"; }
+
+.fa-prescription::before {
+ content: "\f5b1"; }
+
+.fa-shop::before {
+ content: "\f54f"; }
+
+.fa-store-alt::before {
+ content: "\f54f"; }
+
+.fa-floppy-disk::before {
+ content: "\f0c7"; }
+
+.fa-save::before {
+ content: "\f0c7"; }
+
+.fa-vihara::before {
+ content: "\f6a7"; }
+
+.fa-scale-unbalanced::before {
+ content: "\f515"; }
+
+.fa-balance-scale-left::before {
+ content: "\f515"; }
+
+.fa-sort-up::before {
+ content: "\f0de"; }
+
+.fa-sort-asc::before {
+ content: "\f0de"; }
+
+.fa-comment-dots::before {
+ content: "\f4ad"; }
+
+.fa-commenting::before {
+ content: "\f4ad"; }
+
+.fa-plant-wilt::before {
+ content: "\e5aa"; }
+
+.fa-diamond::before {
+ content: "\f219"; }
+
+.fa-face-grin-squint::before {
+ content: "\f585"; }
+
+.fa-grin-squint::before {
+ content: "\f585"; }
+
+.fa-hand-holding-dollar::before {
+ content: "\f4c0"; }
+
+.fa-hand-holding-usd::before {
+ content: "\f4c0"; }
+
+.fa-bacterium::before {
+ content: "\e05a"; }
+
+.fa-hand-pointer::before {
+ content: "\f25a"; }
+
+.fa-drum-steelpan::before {
+ content: "\f56a"; }
+
+.fa-hand-scissors::before {
+ content: "\f257"; }
+
+.fa-hands-praying::before {
+ content: "\f684"; }
+
+.fa-praying-hands::before {
+ content: "\f684"; }
+
+.fa-arrow-rotate-right::before {
+ content: "\f01e"; }
+
+.fa-arrow-right-rotate::before {
+ content: "\f01e"; }
+
+.fa-arrow-rotate-forward::before {
+ content: "\f01e"; }
+
+.fa-redo::before {
+ content: "\f01e"; }
+
+.fa-biohazard::before {
+ content: "\f780"; }
+
+.fa-location-crosshairs::before {
+ content: "\f601"; }
+
+.fa-location::before {
+ content: "\f601"; }
+
+.fa-mars-double::before {
+ content: "\f227"; }
+
+.fa-child-dress::before {
+ content: "\e59c"; }
+
+.fa-users-between-lines::before {
+ content: "\e591"; }
+
+.fa-lungs-virus::before {
+ content: "\e067"; }
+
+.fa-face-grin-tears::before {
+ content: "\f588"; }
+
+.fa-grin-tears::before {
+ content: "\f588"; }
+
+.fa-phone::before {
+ content: "\f095"; }
+
+.fa-calendar-xmark::before {
+ content: "\f273"; }
+
+.fa-calendar-times::before {
+ content: "\f273"; }
+
+.fa-child-reaching::before {
+ content: "\e59d"; }
+
+.fa-head-side-virus::before {
+ content: "\e064"; }
+
+.fa-user-gear::before {
+ content: "\f4fe"; }
+
+.fa-user-cog::before {
+ content: "\f4fe"; }
+
+.fa-arrow-up-1-9::before {
+ content: "\f163"; }
+
+.fa-sort-numeric-up::before {
+ content: "\f163"; }
+
+.fa-door-closed::before {
+ content: "\f52a"; }
+
+.fa-shield-virus::before {
+ content: "\e06c"; }
+
+.fa-dice-six::before {
+ content: "\f526"; }
+
+.fa-mosquito-net::before {
+ content: "\e52c"; }
+
+.fa-bridge-water::before {
+ content: "\e4ce"; }
+
+.fa-person-booth::before {
+ content: "\f756"; }
+
+.fa-text-width::before {
+ content: "\f035"; }
+
+.fa-hat-wizard::before {
+ content: "\f6e8"; }
+
+.fa-pen-fancy::before {
+ content: "\f5ac"; }
+
+.fa-person-digging::before {
+ content: "\f85e"; }
+
+.fa-digging::before {
+ content: "\f85e"; }
+
+.fa-trash::before {
+ content: "\f1f8"; }
+
+.fa-gauge-simple::before {
+ content: "\f629"; }
+
+.fa-gauge-simple-med::before {
+ content: "\f629"; }
+
+.fa-tachometer-average::before {
+ content: "\f629"; }
+
+.fa-book-medical::before {
+ content: "\f7e6"; }
+
+.fa-poo::before {
+ content: "\f2fe"; }
+
+.fa-quote-right::before {
+ content: "\f10e"; }
+
+.fa-quote-right-alt::before {
+ content: "\f10e"; }
+
+.fa-shirt::before {
+ content: "\f553"; }
+
+.fa-t-shirt::before {
+ content: "\f553"; }
+
+.fa-tshirt::before {
+ content: "\f553"; }
+
+.fa-cubes::before {
+ content: "\f1b3"; }
+
+.fa-divide::before {
+ content: "\f529"; }
+
+.fa-tenge-sign::before {
+ content: "\f7d7"; }
+
+.fa-tenge::before {
+ content: "\f7d7"; }
+
+.fa-headphones::before {
+ content: "\f025"; }
+
+.fa-hands-holding::before {
+ content: "\f4c2"; }
+
+.fa-hands-clapping::before {
+ content: "\e1a8"; }
+
+.fa-republican::before {
+ content: "\f75e"; }
+
+.fa-arrow-left::before {
+ content: "\f060"; }
+
+.fa-person-circle-xmark::before {
+ content: "\e543"; }
+
+.fa-ruler::before {
+ content: "\f545"; }
+
+.fa-align-left::before {
+ content: "\f036"; }
+
+.fa-dice-d6::before {
+ content: "\f6d1"; }
+
+.fa-restroom::before {
+ content: "\f7bd"; }
+
+.fa-j::before {
+ content: "\4a"; }
+
+.fa-users-viewfinder::before {
+ content: "\e595"; }
+
+.fa-file-video::before {
+ content: "\f1c8"; }
+
+.fa-up-right-from-square::before {
+ content: "\f35d"; }
+
+.fa-external-link-alt::before {
+ content: "\f35d"; }
+
+.fa-table-cells::before {
+ content: "\f00a"; }
+
+.fa-th::before {
+ content: "\f00a"; }
+
+.fa-file-pdf::before {
+ content: "\f1c1"; }
+
+.fa-book-bible::before {
+ content: "\f647"; }
+
+.fa-bible::before {
+ content: "\f647"; }
+
+.fa-o::before {
+ content: "\4f"; }
+
+.fa-suitcase-medical::before {
+ content: "\f0fa"; }
+
+.fa-medkit::before {
+ content: "\f0fa"; }
+
+.fa-user-secret::before {
+ content: "\f21b"; }
+
+.fa-otter::before {
+ content: "\f700"; }
+
+.fa-person-dress::before {
+ content: "\f182"; }
+
+.fa-female::before {
+ content: "\f182"; }
+
+.fa-comment-dollar::before {
+ content: "\f651"; }
+
+.fa-business-time::before {
+ content: "\f64a"; }
+
+.fa-briefcase-clock::before {
+ content: "\f64a"; }
+
+.fa-table-cells-large::before {
+ content: "\f009"; }
+
+.fa-th-large::before {
+ content: "\f009"; }
+
+.fa-book-tanakh::before {
+ content: "\f827"; }
+
+.fa-tanakh::before {
+ content: "\f827"; }
+
+.fa-phone-volume::before {
+ content: "\f2a0"; }
+
+.fa-volume-control-phone::before {
+ content: "\f2a0"; }
+
+.fa-hat-cowboy-side::before {
+ content: "\f8c1"; }
+
+.fa-clipboard-user::before {
+ content: "\f7f3"; }
+
+.fa-child::before {
+ content: "\f1ae"; }
+
+.fa-lira-sign::before {
+ content: "\f195"; }
+
+.fa-satellite::before {
+ content: "\f7bf"; }
+
+.fa-plane-lock::before {
+ content: "\e558"; }
+
+.fa-tag::before {
+ content: "\f02b"; }
+
+.fa-comment::before {
+ content: "\f075"; }
+
+.fa-cake-candles::before {
+ content: "\f1fd"; }
+
+.fa-birthday-cake::before {
+ content: "\f1fd"; }
+
+.fa-cake::before {
+ content: "\f1fd"; }
+
+.fa-envelope::before {
+ content: "\f0e0"; }
+
+.fa-angles-up::before {
+ content: "\f102"; }
+
+.fa-angle-double-up::before {
+ content: "\f102"; }
+
+.fa-paperclip::before {
+ content: "\f0c6"; }
+
+.fa-arrow-right-to-city::before {
+ content: "\e4b3"; }
+
+.fa-ribbon::before {
+ content: "\f4d6"; }
+
+.fa-lungs::before {
+ content: "\f604"; }
+
+.fa-arrow-up-9-1::before {
+ content: "\f887"; }
+
+.fa-sort-numeric-up-alt::before {
+ content: "\f887"; }
+
+.fa-litecoin-sign::before {
+ content: "\e1d3"; }
+
+.fa-border-none::before {
+ content: "\f850"; }
+
+.fa-circle-nodes::before {
+ content: "\e4e2"; }
+
+.fa-parachute-box::before {
+ content: "\f4cd"; }
+
+.fa-indent::before {
+ content: "\f03c"; }
+
+.fa-truck-field-un::before {
+ content: "\e58e"; }
+
+.fa-hourglass::before {
+ content: "\f254"; }
+
+.fa-hourglass-empty::before {
+ content: "\f254"; }
+
+.fa-mountain::before {
+ content: "\f6fc"; }
+
+.fa-user-doctor::before {
+ content: "\f0f0"; }
+
+.fa-user-md::before {
+ content: "\f0f0"; }
+
+.fa-circle-info::before {
+ content: "\f05a"; }
+
+.fa-info-circle::before {
+ content: "\f05a"; }
+
+.fa-cloud-meatball::before {
+ content: "\f73b"; }
+
+.fa-camera::before {
+ content: "\f030"; }
+
+.fa-camera-alt::before {
+ content: "\f030"; }
+
+.fa-square-virus::before {
+ content: "\e578"; }
+
+.fa-meteor::before {
+ content: "\f753"; }
+
+.fa-car-on::before {
+ content: "\e4dd"; }
+
+.fa-sleigh::before {
+ content: "\f7cc"; }
+
+.fa-arrow-down-1-9::before {
+ content: "\f162"; }
+
+.fa-sort-numeric-asc::before {
+ content: "\f162"; }
+
+.fa-sort-numeric-down::before {
+ content: "\f162"; }
+
+.fa-hand-holding-droplet::before {
+ content: "\f4c1"; }
+
+.fa-hand-holding-water::before {
+ content: "\f4c1"; }
+
+.fa-water::before {
+ content: "\f773"; }
+
+.fa-calendar-check::before {
+ content: "\f274"; }
+
+.fa-braille::before {
+ content: "\f2a1"; }
+
+.fa-prescription-bottle-medical::before {
+ content: "\f486"; }
+
+.fa-prescription-bottle-alt::before {
+ content: "\f486"; }
+
+.fa-landmark::before {
+ content: "\f66f"; }
+
+.fa-truck::before {
+ content: "\f0d1"; }
+
+.fa-crosshairs::before {
+ content: "\f05b"; }
+
+.fa-person-cane::before {
+ content: "\e53c"; }
+
+.fa-tent::before {
+ content: "\e57d"; }
+
+.fa-vest-patches::before {
+ content: "\e086"; }
+
+.fa-check-double::before {
+ content: "\f560"; }
+
+.fa-arrow-down-a-z::before {
+ content: "\f15d"; }
+
+.fa-sort-alpha-asc::before {
+ content: "\f15d"; }
+
+.fa-sort-alpha-down::before {
+ content: "\f15d"; }
+
+.fa-money-bill-wheat::before {
+ content: "\e52a"; }
+
+.fa-cookie::before {
+ content: "\f563"; }
+
+.fa-arrow-rotate-left::before {
+ content: "\f0e2"; }
+
+.fa-arrow-left-rotate::before {
+ content: "\f0e2"; }
+
+.fa-arrow-rotate-back::before {
+ content: "\f0e2"; }
+
+.fa-arrow-rotate-backward::before {
+ content: "\f0e2"; }
+
+.fa-undo::before {
+ content: "\f0e2"; }
+
+.fa-hard-drive::before {
+ content: "\f0a0"; }
+
+.fa-hdd::before {
+ content: "\f0a0"; }
+
+.fa-face-grin-squint-tears::before {
+ content: "\f586"; }
+
+.fa-grin-squint-tears::before {
+ content: "\f586"; }
+
+.fa-dumbbell::before {
+ content: "\f44b"; }
+
+.fa-rectangle-list::before {
+ content: "\f022"; }
+
+.fa-list-alt::before {
+ content: "\f022"; }
+
+.fa-tarp-droplet::before {
+ content: "\e57c"; }
+
+.fa-house-medical-circle-check::before {
+ content: "\e511"; }
+
+.fa-person-skiing-nordic::before {
+ content: "\f7ca"; }
+
+.fa-skiing-nordic::before {
+ content: "\f7ca"; }
+
+.fa-calendar-plus::before {
+ content: "\f271"; }
+
+.fa-plane-arrival::before {
+ content: "\f5af"; }
+
+.fa-circle-left::before {
+ content: "\f359"; }
+
+.fa-arrow-alt-circle-left::before {
+ content: "\f359"; }
+
+.fa-train-subway::before {
+ content: "\f239"; }
+
+.fa-subway::before {
+ content: "\f239"; }
+
+.fa-chart-gantt::before {
+ content: "\e0e4"; }
+
+.fa-indian-rupee-sign::before {
+ content: "\e1bc"; }
+
+.fa-indian-rupee::before {
+ content: "\e1bc"; }
+
+.fa-inr::before {
+ content: "\e1bc"; }
+
+.fa-crop-simple::before {
+ content: "\f565"; }
+
+.fa-crop-alt::before {
+ content: "\f565"; }
+
+.fa-money-bill-1::before {
+ content: "\f3d1"; }
+
+.fa-money-bill-alt::before {
+ content: "\f3d1"; }
+
+.fa-left-long::before {
+ content: "\f30a"; }
+
+.fa-long-arrow-alt-left::before {
+ content: "\f30a"; }
+
+.fa-dna::before {
+ content: "\f471"; }
+
+.fa-virus-slash::before {
+ content: "\e075"; }
+
+.fa-minus::before {
+ content: "\f068"; }
+
+.fa-subtract::before {
+ content: "\f068"; }
+
+.fa-chess::before {
+ content: "\f439"; }
+
+.fa-arrow-left-long::before {
+ content: "\f177"; }
+
+.fa-long-arrow-left::before {
+ content: "\f177"; }
+
+.fa-plug-circle-check::before {
+ content: "\e55c"; }
+
+.fa-street-view::before {
+ content: "\f21d"; }
+
+.fa-franc-sign::before {
+ content: "\e18f"; }
+
+.fa-volume-off::before {
+ content: "\f026"; }
+
+.fa-hands-asl-interpreting::before {
+ content: "\f2a3"; }
+
+.fa-american-sign-language-interpreting::before {
+ content: "\f2a3"; }
+
+.fa-asl-interpreting::before {
+ content: "\f2a3"; }
+
+.fa-hands-american-sign-language-interpreting::before {
+ content: "\f2a3"; }
+
+.fa-gear::before {
+ content: "\f013"; }
+
+.fa-cog::before {
+ content: "\f013"; }
+
+.fa-droplet-slash::before {
+ content: "\f5c7"; }
+
+.fa-tint-slash::before {
+ content: "\f5c7"; }
+
+.fa-mosque::before {
+ content: "\f678"; }
+
+.fa-mosquito::before {
+ content: "\e52b"; }
+
+.fa-star-of-david::before {
+ content: "\f69a"; }
+
+.fa-person-military-rifle::before {
+ content: "\e54b"; }
+
+.fa-cart-shopping::before {
+ content: "\f07a"; }
+
+.fa-shopping-cart::before {
+ content: "\f07a"; }
+
+.fa-vials::before {
+ content: "\f493"; }
+
+.fa-plug-circle-plus::before {
+ content: "\e55f"; }
+
+.fa-place-of-worship::before {
+ content: "\f67f"; }
+
+.fa-grip-vertical::before {
+ content: "\f58e"; }
+
+.fa-arrow-turn-up::before {
+ content: "\f148"; }
+
+.fa-level-up::before {
+ content: "\f148"; }
+
+.fa-u::before {
+ content: "\55"; }
+
+.fa-square-root-variable::before {
+ content: "\f698"; }
+
+.fa-square-root-alt::before {
+ content: "\f698"; }
+
+.fa-clock::before {
+ content: "\f017"; }
+
+.fa-clock-four::before {
+ content: "\f017"; }
+
+.fa-backward-step::before {
+ content: "\f048"; }
+
+.fa-step-backward::before {
+ content: "\f048"; }
+
+.fa-pallet::before {
+ content: "\f482"; }
+
+.fa-faucet::before {
+ content: "\e005"; }
+
+.fa-baseball-bat-ball::before {
+ content: "\f432"; }
+
+.fa-s::before {
+ content: "\53"; }
+
+.fa-timeline::before {
+ content: "\e29c"; }
+
+.fa-keyboard::before {
+ content: "\f11c"; }
+
+.fa-caret-down::before {
+ content: "\f0d7"; }
+
+.fa-house-chimney-medical::before {
+ content: "\f7f2"; }
+
+.fa-clinic-medical::before {
+ content: "\f7f2"; }
+
+.fa-temperature-three-quarters::before {
+ content: "\f2c8"; }
+
+.fa-temperature-3::before {
+ content: "\f2c8"; }
+
+.fa-thermometer-3::before {
+ content: "\f2c8"; }
+
+.fa-thermometer-three-quarters::before {
+ content: "\f2c8"; }
+
+.fa-mobile-screen::before {
+ content: "\f3cf"; }
+
+.fa-mobile-android-alt::before {
+ content: "\f3cf"; }
+
+.fa-plane-up::before {
+ content: "\e22d"; }
+
+.fa-piggy-bank::before {
+ content: "\f4d3"; }
+
+.fa-battery-half::before {
+ content: "\f242"; }
+
+.fa-battery-3::before {
+ content: "\f242"; }
+
+.fa-mountain-city::before {
+ content: "\e52e"; }
+
+.fa-coins::before {
+ content: "\f51e"; }
+
+.fa-khanda::before {
+ content: "\f66d"; }
+
+.fa-sliders::before {
+ content: "\f1de"; }
+
+.fa-sliders-h::before {
+ content: "\f1de"; }
+
+.fa-folder-tree::before {
+ content: "\f802"; }
+
+.fa-network-wired::before {
+ content: "\f6ff"; }
+
+.fa-map-pin::before {
+ content: "\f276"; }
+
+.fa-hamsa::before {
+ content: "\f665"; }
+
+.fa-cent-sign::before {
+ content: "\e3f5"; }
+
+.fa-flask::before {
+ content: "\f0c3"; }
+
+.fa-person-pregnant::before {
+ content: "\e31e"; }
+
+.fa-wand-sparkles::before {
+ content: "\f72b"; }
+
+.fa-ellipsis-vertical::before {
+ content: "\f142"; }
+
+.fa-ellipsis-v::before {
+ content: "\f142"; }
+
+.fa-ticket::before {
+ content: "\f145"; }
+
+.fa-power-off::before {
+ content: "\f011"; }
+
+.fa-right-long::before {
+ content: "\f30b"; }
+
+.fa-long-arrow-alt-right::before {
+ content: "\f30b"; }
+
+.fa-flag-usa::before {
+ content: "\f74d"; }
+
+.fa-laptop-file::before {
+ content: "\e51d"; }
+
+.fa-tty::before {
+ content: "\f1e4"; }
+
+.fa-teletype::before {
+ content: "\f1e4"; }
+
+.fa-diagram-next::before {
+ content: "\e476"; }
+
+.fa-person-rifle::before {
+ content: "\e54e"; }
+
+.fa-house-medical-circle-exclamation::before {
+ content: "\e512"; }
+
+.fa-closed-captioning::before {
+ content: "\f20a"; }
+
+.fa-person-hiking::before {
+ content: "\f6ec"; }
+
+.fa-hiking::before {
+ content: "\f6ec"; }
+
+.fa-venus-double::before {
+ content: "\f226"; }
+
+.fa-images::before {
+ content: "\f302"; }
+
+.fa-calculator::before {
+ content: "\f1ec"; }
+
+.fa-people-pulling::before {
+ content: "\e535"; }
+
+.fa-n::before {
+ content: "\4e"; }
+
+.fa-cable-car::before {
+ content: "\f7da"; }
+
+.fa-tram::before {
+ content: "\f7da"; }
+
+.fa-cloud-rain::before {
+ content: "\f73d"; }
+
+.fa-building-circle-xmark::before {
+ content: "\e4d4"; }
+
+.fa-ship::before {
+ content: "\f21a"; }
+
+.fa-arrows-down-to-line::before {
+ content: "\e4b8"; }
+
+.fa-download::before {
+ content: "\f019"; }
+
+.fa-face-grin::before {
+ content: "\f580"; }
+
+.fa-grin::before {
+ content: "\f580"; }
+
+.fa-delete-left::before {
+ content: "\f55a"; }
+
+.fa-backspace::before {
+ content: "\f55a"; }
+
+.fa-eye-dropper::before {
+ content: "\f1fb"; }
+
+.fa-eye-dropper-empty::before {
+ content: "\f1fb"; }
+
+.fa-eyedropper::before {
+ content: "\f1fb"; }
+
+.fa-file-circle-check::before {
+ content: "\e5a0"; }
+
+.fa-forward::before {
+ content: "\f04e"; }
+
+.fa-mobile::before {
+ content: "\f3ce"; }
+
+.fa-mobile-android::before {
+ content: "\f3ce"; }
+
+.fa-mobile-phone::before {
+ content: "\f3ce"; }
+
+.fa-face-meh::before {
+ content: "\f11a"; }
+
+.fa-meh::before {
+ content: "\f11a"; }
+
+.fa-align-center::before {
+ content: "\f037"; }
+
+.fa-book-skull::before {
+ content: "\f6b7"; }
+
+.fa-book-dead::before {
+ content: "\f6b7"; }
+
+.fa-id-card::before {
+ content: "\f2c2"; }
+
+.fa-drivers-license::before {
+ content: "\f2c2"; }
+
+.fa-outdent::before {
+ content: "\f03b"; }
+
+.fa-dedent::before {
+ content: "\f03b"; }
+
+.fa-heart-circle-exclamation::before {
+ content: "\e4fe"; }
+
+.fa-house::before {
+ content: "\f015"; }
+
+.fa-home::before {
+ content: "\f015"; }
+
+.fa-home-alt::before {
+ content: "\f015"; }
+
+.fa-home-lg-alt::before {
+ content: "\f015"; }
+
+.fa-calendar-week::before {
+ content: "\f784"; }
+
+.fa-laptop-medical::before {
+ content: "\f812"; }
+
+.fa-b::before {
+ content: "\42"; }
+
+.fa-file-medical::before {
+ content: "\f477"; }
+
+.fa-dice-one::before {
+ content: "\f525"; }
+
+.fa-kiwi-bird::before {
+ content: "\f535"; }
+
+.fa-arrow-right-arrow-left::before {
+ content: "\f0ec"; }
+
+.fa-exchange::before {
+ content: "\f0ec"; }
+
+.fa-rotate-right::before {
+ content: "\f2f9"; }
+
+.fa-redo-alt::before {
+ content: "\f2f9"; }
+
+.fa-rotate-forward::before {
+ content: "\f2f9"; }
+
+.fa-utensils::before {
+ content: "\f2e7"; }
+
+.fa-cutlery::before {
+ content: "\f2e7"; }
+
+.fa-arrow-up-wide-short::before {
+ content: "\f161"; }
+
+.fa-sort-amount-up::before {
+ content: "\f161"; }
+
+.fa-mill-sign::before {
+ content: "\e1ed"; }
+
+.fa-bowl-rice::before {
+ content: "\e2eb"; }
+
+.fa-skull::before {
+ content: "\f54c"; }
+
+.fa-tower-broadcast::before {
+ content: "\f519"; }
+
+.fa-broadcast-tower::before {
+ content: "\f519"; }
+
+.fa-truck-pickup::before {
+ content: "\f63c"; }
+
+.fa-up-long::before {
+ content: "\f30c"; }
+
+.fa-long-arrow-alt-up::before {
+ content: "\f30c"; }
+
+.fa-stop::before {
+ content: "\f04d"; }
+
+.fa-code-merge::before {
+ content: "\f387"; }
+
+.fa-upload::before {
+ content: "\f093"; }
+
+.fa-hurricane::before {
+ content: "\f751"; }
+
+.fa-mound::before {
+ content: "\e52d"; }
+
+.fa-toilet-portable::before {
+ content: "\e583"; }
+
+.fa-compact-disc::before {
+ content: "\f51f"; }
+
+.fa-file-arrow-down::before {
+ content: "\f56d"; }
+
+.fa-file-download::before {
+ content: "\f56d"; }
+
+.fa-caravan::before {
+ content: "\f8ff"; }
+
+.fa-shield-cat::before {
+ content: "\e572"; }
+
+.fa-bolt::before {
+ content: "\f0e7"; }
+
+.fa-zap::before {
+ content: "\f0e7"; }
+
+.fa-glass-water::before {
+ content: "\e4f4"; }
+
+.fa-oil-well::before {
+ content: "\e532"; }
+
+.fa-vault::before {
+ content: "\e2c5"; }
+
+.fa-mars::before {
+ content: "\f222"; }
+
+.fa-toilet::before {
+ content: "\f7d8"; }
+
+.fa-plane-circle-xmark::before {
+ content: "\e557"; }
+
+.fa-yen-sign::before {
+ content: "\f157"; }
+
+.fa-cny::before {
+ content: "\f157"; }
+
+.fa-jpy::before {
+ content: "\f157"; }
+
+.fa-rmb::before {
+ content: "\f157"; }
+
+.fa-yen::before {
+ content: "\f157"; }
+
+.fa-ruble-sign::before {
+ content: "\f158"; }
+
+.fa-rouble::before {
+ content: "\f158"; }
+
+.fa-rub::before {
+ content: "\f158"; }
+
+.fa-ruble::before {
+ content: "\f158"; }
+
+.fa-sun::before {
+ content: "\f185"; }
+
+.fa-guitar::before {
+ content: "\f7a6"; }
+
+.fa-face-laugh-wink::before {
+ content: "\f59c"; }
+
+.fa-laugh-wink::before {
+ content: "\f59c"; }
+
+.fa-horse-head::before {
+ content: "\f7ab"; }
+
+.fa-bore-hole::before {
+ content: "\e4c3"; }
+
+.fa-industry::before {
+ content: "\f275"; }
+
+.fa-circle-down::before {
+ content: "\f358"; }
+
+.fa-arrow-alt-circle-down::before {
+ content: "\f358"; }
+
+.fa-arrows-turn-to-dots::before {
+ content: "\e4c1"; }
+
+.fa-florin-sign::before {
+ content: "\e184"; }
+
+.fa-arrow-down-short-wide::before {
+ content: "\f884"; }
+
+.fa-sort-amount-desc::before {
+ content: "\f884"; }
+
+.fa-sort-amount-down-alt::before {
+ content: "\f884"; }
+
+.fa-less-than::before {
+ content: "\3c"; }
+
+.fa-angle-down::before {
+ content: "\f107"; }
+
+.fa-car-tunnel::before {
+ content: "\e4de"; }
+
+.fa-head-side-cough::before {
+ content: "\e061"; }
+
+.fa-grip-lines::before {
+ content: "\f7a4"; }
+
+.fa-thumbs-down::before {
+ content: "\f165"; }
+
+.fa-user-lock::before {
+ content: "\f502"; }
+
+.fa-arrow-right-long::before {
+ content: "\f178"; }
+
+.fa-long-arrow-right::before {
+ content: "\f178"; }
+
+.fa-anchor-circle-xmark::before {
+ content: "\e4ac"; }
+
+.fa-ellipsis::before {
+ content: "\f141"; }
+
+.fa-ellipsis-h::before {
+ content: "\f141"; }
+
+.fa-chess-pawn::before {
+ content: "\f443"; }
+
+.fa-kit-medical::before {
+ content: "\f479"; }
+
+.fa-first-aid::before {
+ content: "\f479"; }
+
+.fa-person-through-window::before {
+ content: "\e5a9"; }
+
+.fa-toolbox::before {
+ content: "\f552"; }
+
+.fa-hands-holding-circle::before {
+ content: "\e4fb"; }
+
+.fa-bug::before {
+ content: "\f188"; }
+
+.fa-credit-card::before {
+ content: "\f09d"; }
+
+.fa-credit-card-alt::before {
+ content: "\f09d"; }
+
+.fa-car::before {
+ content: "\f1b9"; }
+
+.fa-automobile::before {
+ content: "\f1b9"; }
+
+.fa-hand-holding-hand::before {
+ content: "\e4f7"; }
+
+.fa-book-open-reader::before {
+ content: "\f5da"; }
+
+.fa-book-reader::before {
+ content: "\f5da"; }
+
+.fa-mountain-sun::before {
+ content: "\e52f"; }
+
+.fa-arrows-left-right-to-line::before {
+ content: "\e4ba"; }
+
+.fa-dice-d20::before {
+ content: "\f6cf"; }
+
+.fa-truck-droplet::before {
+ content: "\e58c"; }
+
+.fa-file-circle-xmark::before {
+ content: "\e5a1"; }
+
+.fa-temperature-arrow-up::before {
+ content: "\e040"; }
+
+.fa-temperature-up::before {
+ content: "\e040"; }
+
+.fa-medal::before {
+ content: "\f5a2"; }
+
+.fa-bed::before {
+ content: "\f236"; }
+
+.fa-square-h::before {
+ content: "\f0fd"; }
+
+.fa-h-square::before {
+ content: "\f0fd"; }
+
+.fa-podcast::before {
+ content: "\f2ce"; }
+
+.fa-temperature-full::before {
+ content: "\f2c7"; }
+
+.fa-temperature-4::before {
+ content: "\f2c7"; }
+
+.fa-thermometer-4::before {
+ content: "\f2c7"; }
+
+.fa-thermometer-full::before {
+ content: "\f2c7"; }
+
+.fa-bell::before {
+ content: "\f0f3"; }
+
+.fa-superscript::before {
+ content: "\f12b"; }
+
+.fa-plug-circle-xmark::before {
+ content: "\e560"; }
+
+.fa-star-of-life::before {
+ content: "\f621"; }
+
+.fa-phone-slash::before {
+ content: "\f3dd"; }
+
+.fa-paint-roller::before {
+ content: "\f5aa"; }
+
+.fa-handshake-angle::before {
+ content: "\f4c4"; }
+
+.fa-hands-helping::before {
+ content: "\f4c4"; }
+
+.fa-location-dot::before {
+ content: "\f3c5"; }
+
+.fa-map-marker-alt::before {
+ content: "\f3c5"; }
+
+.fa-file::before {
+ content: "\f15b"; }
+
+.fa-greater-than::before {
+ content: "\3e"; }
+
+.fa-person-swimming::before {
+ content: "\f5c4"; }
+
+.fa-swimmer::before {
+ content: "\f5c4"; }
+
+.fa-arrow-down::before {
+ content: "\f063"; }
+
+.fa-droplet::before {
+ content: "\f043"; }
+
+.fa-tint::before {
+ content: "\f043"; }
+
+.fa-eraser::before {
+ content: "\f12d"; }
+
+.fa-earth-americas::before {
+ content: "\f57d"; }
+
+.fa-earth::before {
+ content: "\f57d"; }
+
+.fa-earth-america::before {
+ content: "\f57d"; }
+
+.fa-globe-americas::before {
+ content: "\f57d"; }
+
+.fa-person-burst::before {
+ content: "\e53b"; }
+
+.fa-dove::before {
+ content: "\f4ba"; }
+
+.fa-battery-empty::before {
+ content: "\f244"; }
+
+.fa-battery-0::before {
+ content: "\f244"; }
+
+.fa-socks::before {
+ content: "\f696"; }
+
+.fa-inbox::before {
+ content: "\f01c"; }
+
+.fa-section::before {
+ content: "\e447"; }
+
+.fa-gauge-high::before {
+ content: "\f625"; }
+
+.fa-tachometer-alt::before {
+ content: "\f625"; }
+
+.fa-tachometer-alt-fast::before {
+ content: "\f625"; }
+
+.fa-envelope-open-text::before {
+ content: "\f658"; }
+
+.fa-hospital::before {
+ content: "\f0f8"; }
+
+.fa-hospital-alt::before {
+ content: "\f0f8"; }
+
+.fa-hospital-wide::before {
+ content: "\f0f8"; }
+
+.fa-wine-bottle::before {
+ content: "\f72f"; }
+
+.fa-chess-rook::before {
+ content: "\f447"; }
+
+.fa-bars-staggered::before {
+ content: "\f550"; }
+
+.fa-reorder::before {
+ content: "\f550"; }
+
+.fa-stream::before {
+ content: "\f550"; }
+
+.fa-dharmachakra::before {
+ content: "\f655"; }
+
+.fa-hotdog::before {
+ content: "\f80f"; }
+
+.fa-person-walking-with-cane::before {
+ content: "\f29d"; }
+
+.fa-blind::before {
+ content: "\f29d"; }
+
+.fa-drum::before {
+ content: "\f569"; }
+
+.fa-ice-cream::before {
+ content: "\f810"; }
+
+.fa-heart-circle-bolt::before {
+ content: "\e4fc"; }
+
+.fa-fax::before {
+ content: "\f1ac"; }
+
+.fa-paragraph::before {
+ content: "\f1dd"; }
+
+.fa-check-to-slot::before {
+ content: "\f772"; }
+
+.fa-vote-yea::before {
+ content: "\f772"; }
+
+.fa-star-half::before {
+ content: "\f089"; }
+
+.fa-boxes-stacked::before {
+ content: "\f468"; }
+
+.fa-boxes::before {
+ content: "\f468"; }
+
+.fa-boxes-alt::before {
+ content: "\f468"; }
+
+.fa-link::before {
+ content: "\f0c1"; }
+
+.fa-chain::before {
+ content: "\f0c1"; }
+
+.fa-ear-listen::before {
+ content: "\f2a2"; }
+
+.fa-assistive-listening-systems::before {
+ content: "\f2a2"; }
+
+.fa-tree-city::before {
+ content: "\e587"; }
+
+.fa-play::before {
+ content: "\f04b"; }
+
+.fa-font::before {
+ content: "\f031"; }
+
+.fa-table-cells-row-lock::before {
+ content: "\e67a"; }
+
+.fa-rupiah-sign::before {
+ content: "\e23d"; }
+
+.fa-magnifying-glass::before {
+ content: "\f002"; }
+
+.fa-search::before {
+ content: "\f002"; }
+
+.fa-table-tennis-paddle-ball::before {
+ content: "\f45d"; }
+
+.fa-ping-pong-paddle-ball::before {
+ content: "\f45d"; }
+
+.fa-table-tennis::before {
+ content: "\f45d"; }
+
+.fa-person-dots-from-line::before {
+ content: "\f470"; }
+
+.fa-diagnoses::before {
+ content: "\f470"; }
+
+.fa-trash-can-arrow-up::before {
+ content: "\f82a"; }
+
+.fa-trash-restore-alt::before {
+ content: "\f82a"; }
+
+.fa-naira-sign::before {
+ content: "\e1f6"; }
+
+.fa-cart-arrow-down::before {
+ content: "\f218"; }
+
+.fa-walkie-talkie::before {
+ content: "\f8ef"; }
+
+.fa-file-pen::before {
+ content: "\f31c"; }
+
+.fa-file-edit::before {
+ content: "\f31c"; }
+
+.fa-receipt::before {
+ content: "\f543"; }
+
+.fa-square-pen::before {
+ content: "\f14b"; }
+
+.fa-pen-square::before {
+ content: "\f14b"; }
+
+.fa-pencil-square::before {
+ content: "\f14b"; }
+
+.fa-suitcase-rolling::before {
+ content: "\f5c1"; }
+
+.fa-person-circle-exclamation::before {
+ content: "\e53f"; }
+
+.fa-chevron-down::before {
+ content: "\f078"; }
+
+.fa-battery-full::before {
+ content: "\f240"; }
+
+.fa-battery::before {
+ content: "\f240"; }
+
+.fa-battery-5::before {
+ content: "\f240"; }
+
+.fa-skull-crossbones::before {
+ content: "\f714"; }
+
+.fa-code-compare::before {
+ content: "\e13a"; }
+
+.fa-list-ul::before {
+ content: "\f0ca"; }
+
+.fa-list-dots::before {
+ content: "\f0ca"; }
+
+.fa-school-lock::before {
+ content: "\e56f"; }
+
+.fa-tower-cell::before {
+ content: "\e585"; }
+
+.fa-down-long::before {
+ content: "\f309"; }
+
+.fa-long-arrow-alt-down::before {
+ content: "\f309"; }
+
+.fa-ranking-star::before {
+ content: "\e561"; }
+
+.fa-chess-king::before {
+ content: "\f43f"; }
+
+.fa-person-harassing::before {
+ content: "\e549"; }
+
+.fa-brazilian-real-sign::before {
+ content: "\e46c"; }
+
+.fa-landmark-dome::before {
+ content: "\f752"; }
+
+.fa-landmark-alt::before {
+ content: "\f752"; }
+
+.fa-arrow-up::before {
+ content: "\f062"; }
+
+.fa-tv::before {
+ content: "\f26c"; }
+
+.fa-television::before {
+ content: "\f26c"; }
+
+.fa-tv-alt::before {
+ content: "\f26c"; }
+
+.fa-shrimp::before {
+ content: "\e448"; }
+
+.fa-list-check::before {
+ content: "\f0ae"; }
+
+.fa-tasks::before {
+ content: "\f0ae"; }
+
+.fa-jug-detergent::before {
+ content: "\e519"; }
+
+.fa-circle-user::before {
+ content: "\f2bd"; }
+
+.fa-user-circle::before {
+ content: "\f2bd"; }
+
+.fa-user-shield::before {
+ content: "\f505"; }
+
+.fa-wind::before {
+ content: "\f72e"; }
+
+.fa-car-burst::before {
+ content: "\f5e1"; }
+
+.fa-car-crash::before {
+ content: "\f5e1"; }
+
+.fa-y::before {
+ content: "\59"; }
+
+.fa-person-snowboarding::before {
+ content: "\f7ce"; }
+
+.fa-snowboarding::before {
+ content: "\f7ce"; }
+
+.fa-truck-fast::before {
+ content: "\f48b"; }
+
+.fa-shipping-fast::before {
+ content: "\f48b"; }
+
+.fa-fish::before {
+ content: "\f578"; }
+
+.fa-user-graduate::before {
+ content: "\f501"; }
+
+.fa-circle-half-stroke::before {
+ content: "\f042"; }
+
+.fa-adjust::before {
+ content: "\f042"; }
+
+.fa-clapperboard::before {
+ content: "\e131"; }
+
+.fa-circle-radiation::before {
+ content: "\f7ba"; }
+
+.fa-radiation-alt::before {
+ content: "\f7ba"; }
+
+.fa-baseball::before {
+ content: "\f433"; }
+
+.fa-baseball-ball::before {
+ content: "\f433"; }
+
+.fa-jet-fighter-up::before {
+ content: "\e518"; }
+
+.fa-diagram-project::before {
+ content: "\f542"; }
+
+.fa-project-diagram::before {
+ content: "\f542"; }
+
+.fa-copy::before {
+ content: "\f0c5"; }
+
+.fa-volume-xmark::before {
+ content: "\f6a9"; }
+
+.fa-volume-mute::before {
+ content: "\f6a9"; }
+
+.fa-volume-times::before {
+ content: "\f6a9"; }
+
+.fa-hand-sparkles::before {
+ content: "\e05d"; }
+
+.fa-grip::before {
+ content: "\f58d"; }
+
+.fa-grip-horizontal::before {
+ content: "\f58d"; }
+
+.fa-share-from-square::before {
+ content: "\f14d"; }
+
+.fa-share-square::before {
+ content: "\f14d"; }
+
+.fa-child-combatant::before {
+ content: "\e4e0"; }
+
+.fa-child-rifle::before {
+ content: "\e4e0"; }
+
+.fa-gun::before {
+ content: "\e19b"; }
+
+.fa-square-phone::before {
+ content: "\f098"; }
+
+.fa-phone-square::before {
+ content: "\f098"; }
+
+.fa-plus::before {
+ content: "\2b"; }
+
+.fa-add::before {
+ content: "\2b"; }
+
+.fa-expand::before {
+ content: "\f065"; }
+
+.fa-computer::before {
+ content: "\e4e5"; }
+
+.fa-xmark::before {
+ content: "\f00d"; }
+
+.fa-close::before {
+ content: "\f00d"; }
+
+.fa-multiply::before {
+ content: "\f00d"; }
+
+.fa-remove::before {
+ content: "\f00d"; }
+
+.fa-times::before {
+ content: "\f00d"; }
+
+.fa-arrows-up-down-left-right::before {
+ content: "\f047"; }
+
+.fa-arrows::before {
+ content: "\f047"; }
+
+.fa-chalkboard-user::before {
+ content: "\f51c"; }
+
+.fa-chalkboard-teacher::before {
+ content: "\f51c"; }
+
+.fa-peso-sign::before {
+ content: "\e222"; }
+
+.fa-building-shield::before {
+ content: "\e4d8"; }
+
+.fa-baby::before {
+ content: "\f77c"; }
+
+.fa-users-line::before {
+ content: "\e592"; }
+
+.fa-quote-left::before {
+ content: "\f10d"; }
+
+.fa-quote-left-alt::before {
+ content: "\f10d"; }
+
+.fa-tractor::before {
+ content: "\f722"; }
+
+.fa-trash-arrow-up::before {
+ content: "\f829"; }
+
+.fa-trash-restore::before {
+ content: "\f829"; }
+
+.fa-arrow-down-up-lock::before {
+ content: "\e4b0"; }
+
+.fa-lines-leaning::before {
+ content: "\e51e"; }
+
+.fa-ruler-combined::before {
+ content: "\f546"; }
+
+.fa-copyright::before {
+ content: "\f1f9"; }
+
+.fa-equals::before {
+ content: "\3d"; }
+
+.fa-blender::before {
+ content: "\f517"; }
+
+.fa-teeth::before {
+ content: "\f62e"; }
+
+.fa-shekel-sign::before {
+ content: "\f20b"; }
+
+.fa-ils::before {
+ content: "\f20b"; }
+
+.fa-shekel::before {
+ content: "\f20b"; }
+
+.fa-sheqel::before {
+ content: "\f20b"; }
+
+.fa-sheqel-sign::before {
+ content: "\f20b"; }
+
+.fa-map::before {
+ content: "\f279"; }
+
+.fa-rocket::before {
+ content: "\f135"; }
+
+.fa-photo-film::before {
+ content: "\f87c"; }
+
+.fa-photo-video::before {
+ content: "\f87c"; }
+
+.fa-folder-minus::before {
+ content: "\f65d"; }
+
+.fa-store::before {
+ content: "\f54e"; }
+
+.fa-arrow-trend-up::before {
+ content: "\e098"; }
+
+.fa-plug-circle-minus::before {
+ content: "\e55e"; }
+
+.fa-sign-hanging::before {
+ content: "\f4d9"; }
+
+.fa-sign::before {
+ content: "\f4d9"; }
+
+.fa-bezier-curve::before {
+ content: "\f55b"; }
+
+.fa-bell-slash::before {
+ content: "\f1f6"; }
+
+.fa-tablet::before {
+ content: "\f3fb"; }
+
+.fa-tablet-android::before {
+ content: "\f3fb"; }
+
+.fa-school-flag::before {
+ content: "\e56e"; }
+
+.fa-fill::before {
+ content: "\f575"; }
+
+.fa-angle-up::before {
+ content: "\f106"; }
+
+.fa-drumstick-bite::before {
+ content: "\f6d7"; }
+
+.fa-holly-berry::before {
+ content: "\f7aa"; }
+
+.fa-chevron-left::before {
+ content: "\f053"; }
+
+.fa-bacteria::before {
+ content: "\e059"; }
+
+.fa-hand-lizard::before {
+ content: "\f258"; }
+
+.fa-notdef::before {
+ content: "\e1fe"; }
+
+.fa-disease::before {
+ content: "\f7fa"; }
+
+.fa-briefcase-medical::before {
+ content: "\f469"; }
+
+.fa-genderless::before {
+ content: "\f22d"; }
+
+.fa-chevron-right::before {
+ content: "\f054"; }
+
+.fa-retweet::before {
+ content: "\f079"; }
+
+.fa-car-rear::before {
+ content: "\f5de"; }
+
+.fa-car-alt::before {
+ content: "\f5de"; }
+
+.fa-pump-soap::before {
+ content: "\e06b"; }
+
+.fa-video-slash::before {
+ content: "\f4e2"; }
+
+.fa-battery-quarter::before {
+ content: "\f243"; }
+
+.fa-battery-2::before {
+ content: "\f243"; }
+
+.fa-radio::before {
+ content: "\f8d7"; }
+
+.fa-baby-carriage::before {
+ content: "\f77d"; }
+
+.fa-carriage-baby::before {
+ content: "\f77d"; }
+
+.fa-traffic-light::before {
+ content: "\f637"; }
+
+.fa-thermometer::before {
+ content: "\f491"; }
+
+.fa-vr-cardboard::before {
+ content: "\f729"; }
+
+.fa-hand-middle-finger::before {
+ content: "\f806"; }
+
+.fa-percent::before {
+ content: "\25"; }
+
+.fa-percentage::before {
+ content: "\25"; }
+
+.fa-truck-moving::before {
+ content: "\f4df"; }
+
+.fa-glass-water-droplet::before {
+ content: "\e4f5"; }
+
+.fa-display::before {
+ content: "\e163"; }
+
+.fa-face-smile::before {
+ content: "\f118"; }
+
+.fa-smile::before {
+ content: "\f118"; }
+
+.fa-thumbtack::before {
+ content: "\f08d"; }
+
+.fa-thumb-tack::before {
+ content: "\f08d"; }
+
+.fa-trophy::before {
+ content: "\f091"; }
+
+.fa-person-praying::before {
+ content: "\f683"; }
+
+.fa-pray::before {
+ content: "\f683"; }
+
+.fa-hammer::before {
+ content: "\f6e3"; }
+
+.fa-hand-peace::before {
+ content: "\f25b"; }
+
+.fa-rotate::before {
+ content: "\f2f1"; }
+
+.fa-sync-alt::before {
+ content: "\f2f1"; }
+
+.fa-spinner::before {
+ content: "\f110"; }
+
+.fa-robot::before {
+ content: "\f544"; }
+
+.fa-peace::before {
+ content: "\f67c"; }
+
+.fa-gears::before {
+ content: "\f085"; }
+
+.fa-cogs::before {
+ content: "\f085"; }
+
+.fa-warehouse::before {
+ content: "\f494"; }
+
+.fa-arrow-up-right-dots::before {
+ content: "\e4b7"; }
+
+.fa-splotch::before {
+ content: "\f5bc"; }
+
+.fa-face-grin-hearts::before {
+ content: "\f584"; }
+
+.fa-grin-hearts::before {
+ content: "\f584"; }
+
+.fa-dice-four::before {
+ content: "\f524"; }
+
+.fa-sim-card::before {
+ content: "\f7c4"; }
+
+.fa-transgender::before {
+ content: "\f225"; }
+
+.fa-transgender-alt::before {
+ content: "\f225"; }
+
+.fa-mercury::before {
+ content: "\f223"; }
+
+.fa-arrow-turn-down::before {
+ content: "\f149"; }
+
+.fa-level-down::before {
+ content: "\f149"; }
+
+.fa-person-falling-burst::before {
+ content: "\e547"; }
+
+.fa-award::before {
+ content: "\f559"; }
+
+.fa-ticket-simple::before {
+ content: "\f3ff"; }
+
+.fa-ticket-alt::before {
+ content: "\f3ff"; }
+
+.fa-building::before {
+ content: "\f1ad"; }
+
+.fa-angles-left::before {
+ content: "\f100"; }
+
+.fa-angle-double-left::before {
+ content: "\f100"; }
+
+.fa-qrcode::before {
+ content: "\f029"; }
+
+.fa-clock-rotate-left::before {
+ content: "\f1da"; }
+
+.fa-history::before {
+ content: "\f1da"; }
+
+.fa-face-grin-beam-sweat::before {
+ content: "\f583"; }
+
+.fa-grin-beam-sweat::before {
+ content: "\f583"; }
+
+.fa-file-export::before {
+ content: "\f56e"; }
+
+.fa-arrow-right-from-file::before {
+ content: "\f56e"; }
+
+.fa-shield::before {
+ content: "\f132"; }
+
+.fa-shield-blank::before {
+ content: "\f132"; }
+
+.fa-arrow-up-short-wide::before {
+ content: "\f885"; }
+
+.fa-sort-amount-up-alt::before {
+ content: "\f885"; }
+
+.fa-house-medical::before {
+ content: "\e3b2"; }
+
+.fa-golf-ball-tee::before {
+ content: "\f450"; }
+
+.fa-golf-ball::before {
+ content: "\f450"; }
+
+.fa-circle-chevron-left::before {
+ content: "\f137"; }
+
+.fa-chevron-circle-left::before {
+ content: "\f137"; }
+
+.fa-house-chimney-window::before {
+ content: "\e00d"; }
+
+.fa-pen-nib::before {
+ content: "\f5ad"; }
+
+.fa-tent-arrow-turn-left::before {
+ content: "\e580"; }
+
+.fa-tents::before {
+ content: "\e582"; }
+
+.fa-wand-magic::before {
+ content: "\f0d0"; }
+
+.fa-magic::before {
+ content: "\f0d0"; }
+
+.fa-dog::before {
+ content: "\f6d3"; }
+
+.fa-carrot::before {
+ content: "\f787"; }
+
+.fa-moon::before {
+ content: "\f186"; }
+
+.fa-wine-glass-empty::before {
+ content: "\f5ce"; }
+
+.fa-wine-glass-alt::before {
+ content: "\f5ce"; }
+
+.fa-cheese::before {
+ content: "\f7ef"; }
+
+.fa-yin-yang::before {
+ content: "\f6ad"; }
+
+.fa-music::before {
+ content: "\f001"; }
+
+.fa-code-commit::before {
+ content: "\f386"; }
+
+.fa-temperature-low::before {
+ content: "\f76b"; }
+
+.fa-person-biking::before {
+ content: "\f84a"; }
+
+.fa-biking::before {
+ content: "\f84a"; }
+
+.fa-broom::before {
+ content: "\f51a"; }
+
+.fa-shield-heart::before {
+ content: "\e574"; }
+
+.fa-gopuram::before {
+ content: "\f664"; }
+
+.fa-earth-oceania::before {
+ content: "\e47b"; }
+
+.fa-globe-oceania::before {
+ content: "\e47b"; }
+
+.fa-square-xmark::before {
+ content: "\f2d3"; }
+
+.fa-times-square::before {
+ content: "\f2d3"; }
+
+.fa-xmark-square::before {
+ content: "\f2d3"; }
+
+.fa-hashtag::before {
+ content: "\23"; }
+
+.fa-up-right-and-down-left-from-center::before {
+ content: "\f424"; }
+
+.fa-expand-alt::before {
+ content: "\f424"; }
+
+.fa-oil-can::before {
+ content: "\f613"; }
+
+.fa-t::before {
+ content: "\54"; }
+
+.fa-hippo::before {
+ content: "\f6ed"; }
+
+.fa-chart-column::before {
+ content: "\e0e3"; }
+
+.fa-infinity::before {
+ content: "\f534"; }
+
+.fa-vial-circle-check::before {
+ content: "\e596"; }
+
+.fa-person-arrow-down-to-line::before {
+ content: "\e538"; }
+
+.fa-voicemail::before {
+ content: "\f897"; }
+
+.fa-fan::before {
+ content: "\f863"; }
+
+.fa-person-walking-luggage::before {
+ content: "\e554"; }
+
+.fa-up-down::before {
+ content: "\f338"; }
+
+.fa-arrows-alt-v::before {
+ content: "\f338"; }
+
+.fa-cloud-moon-rain::before {
+ content: "\f73c"; }
+
+.fa-calendar::before {
+ content: "\f133"; }
+
+.fa-trailer::before {
+ content: "\e041"; }
+
+.fa-bahai::before {
+ content: "\f666"; }
+
+.fa-haykal::before {
+ content: "\f666"; }
+
+.fa-sd-card::before {
+ content: "\f7c2"; }
+
+.fa-dragon::before {
+ content: "\f6d5"; }
+
+.fa-shoe-prints::before {
+ content: "\f54b"; }
+
+.fa-circle-plus::before {
+ content: "\f055"; }
+
+.fa-plus-circle::before {
+ content: "\f055"; }
+
+.fa-face-grin-tongue-wink::before {
+ content: "\f58b"; }
+
+.fa-grin-tongue-wink::before {
+ content: "\f58b"; }
+
+.fa-hand-holding::before {
+ content: "\f4bd"; }
+
+.fa-plug-circle-exclamation::before {
+ content: "\e55d"; }
+
+.fa-link-slash::before {
+ content: "\f127"; }
+
+.fa-chain-broken::before {
+ content: "\f127"; }
+
+.fa-chain-slash::before {
+ content: "\f127"; }
+
+.fa-unlink::before {
+ content: "\f127"; }
+
+.fa-clone::before {
+ content: "\f24d"; }
+
+.fa-person-walking-arrow-loop-left::before {
+ content: "\e551"; }
+
+.fa-arrow-up-z-a::before {
+ content: "\f882"; }
+
+.fa-sort-alpha-up-alt::before {
+ content: "\f882"; }
+
+.fa-fire-flame-curved::before {
+ content: "\f7e4"; }
+
+.fa-fire-alt::before {
+ content: "\f7e4"; }
+
+.fa-tornado::before {
+ content: "\f76f"; }
+
+.fa-file-circle-plus::before {
+ content: "\e494"; }
+
+.fa-book-quran::before {
+ content: "\f687"; }
+
+.fa-quran::before {
+ content: "\f687"; }
+
+.fa-anchor::before {
+ content: "\f13d"; }
+
+.fa-border-all::before {
+ content: "\f84c"; }
+
+.fa-face-angry::before {
+ content: "\f556"; }
+
+.fa-angry::before {
+ content: "\f556"; }
+
+.fa-cookie-bite::before {
+ content: "\f564"; }
+
+.fa-arrow-trend-down::before {
+ content: "\e097"; }
+
+.fa-rss::before {
+ content: "\f09e"; }
+
+.fa-feed::before {
+ content: "\f09e"; }
+
+.fa-draw-polygon::before {
+ content: "\f5ee"; }
+
+.fa-scale-balanced::before {
+ content: "\f24e"; }
+
+.fa-balance-scale::before {
+ content: "\f24e"; }
+
+.fa-gauge-simple-high::before {
+ content: "\f62a"; }
+
+.fa-tachometer::before {
+ content: "\f62a"; }
+
+.fa-tachometer-fast::before {
+ content: "\f62a"; }
+
+.fa-shower::before {
+ content: "\f2cc"; }
+
+.fa-desktop::before {
+ content: "\f390"; }
+
+.fa-desktop-alt::before {
+ content: "\f390"; }
+
+.fa-m::before {
+ content: "\4d"; }
+
+.fa-table-list::before {
+ content: "\f00b"; }
+
+.fa-th-list::before {
+ content: "\f00b"; }
+
+.fa-comment-sms::before {
+ content: "\f7cd"; }
+
+.fa-sms::before {
+ content: "\f7cd"; }
+
+.fa-book::before {
+ content: "\f02d"; }
+
+.fa-user-plus::before {
+ content: "\f234"; }
+
+.fa-check::before {
+ content: "\f00c"; }
+
+.fa-battery-three-quarters::before {
+ content: "\f241"; }
+
+.fa-battery-4::before {
+ content: "\f241"; }
+
+.fa-house-circle-check::before {
+ content: "\e509"; }
+
+.fa-angle-left::before {
+ content: "\f104"; }
+
+.fa-diagram-successor::before {
+ content: "\e47a"; }
+
+.fa-truck-arrow-right::before {
+ content: "\e58b"; }
+
+.fa-arrows-split-up-and-left::before {
+ content: "\e4bc"; }
+
+.fa-hand-fist::before {
+ content: "\f6de"; }
+
+.fa-fist-raised::before {
+ content: "\f6de"; }
+
+.fa-cloud-moon::before {
+ content: "\f6c3"; }
+
+.fa-briefcase::before {
+ content: "\f0b1"; }
+
+.fa-person-falling::before {
+ content: "\e546"; }
+
+.fa-image-portrait::before {
+ content: "\f3e0"; }
+
+.fa-portrait::before {
+ content: "\f3e0"; }
+
+.fa-user-tag::before {
+ content: "\f507"; }
+
+.fa-rug::before {
+ content: "\e569"; }
+
+.fa-earth-europe::before {
+ content: "\f7a2"; }
+
+.fa-globe-europe::before {
+ content: "\f7a2"; }
+
+.fa-cart-flatbed-suitcase::before {
+ content: "\f59d"; }
+
+.fa-luggage-cart::before {
+ content: "\f59d"; }
+
+.fa-rectangle-xmark::before {
+ content: "\f410"; }
+
+.fa-rectangle-times::before {
+ content: "\f410"; }
+
+.fa-times-rectangle::before {
+ content: "\f410"; }
+
+.fa-window-close::before {
+ content: "\f410"; }
+
+.fa-baht-sign::before {
+ content: "\e0ac"; }
+
+.fa-book-open::before {
+ content: "\f518"; }
+
+.fa-book-journal-whills::before {
+ content: "\f66a"; }
+
+.fa-journal-whills::before {
+ content: "\f66a"; }
+
+.fa-handcuffs::before {
+ content: "\e4f8"; }
+
+.fa-triangle-exclamation::before {
+ content: "\f071"; }
+
+.fa-exclamation-triangle::before {
+ content: "\f071"; }
+
+.fa-warning::before {
+ content: "\f071"; }
+
+.fa-database::before {
+ content: "\f1c0"; }
+
+.fa-share::before {
+ content: "\f064"; }
+
+.fa-mail-forward::before {
+ content: "\f064"; }
+
+.fa-bottle-droplet::before {
+ content: "\e4c4"; }
+
+.fa-mask-face::before {
+ content: "\e1d7"; }
+
+.fa-hill-rockslide::before {
+ content: "\e508"; }
+
+.fa-right-left::before {
+ content: "\f362"; }
+
+.fa-exchange-alt::before {
+ content: "\f362"; }
+
+.fa-paper-plane::before {
+ content: "\f1d8"; }
+
+.fa-road-circle-exclamation::before {
+ content: "\e565"; }
+
+.fa-dungeon::before {
+ content: "\f6d9"; }
+
+.fa-align-right::before {
+ content: "\f038"; }
+
+.fa-money-bill-1-wave::before {
+ content: "\f53b"; }
+
+.fa-money-bill-wave-alt::before {
+ content: "\f53b"; }
+
+.fa-life-ring::before {
+ content: "\f1cd"; }
+
+.fa-hands::before {
+ content: "\f2a7"; }
+
+.fa-sign-language::before {
+ content: "\f2a7"; }
+
+.fa-signing::before {
+ content: "\f2a7"; }
+
+.fa-calendar-day::before {
+ content: "\f783"; }
+
+.fa-water-ladder::before {
+ content: "\f5c5"; }
+
+.fa-ladder-water::before {
+ content: "\f5c5"; }
+
+.fa-swimming-pool::before {
+ content: "\f5c5"; }
+
+.fa-arrows-up-down::before {
+ content: "\f07d"; }
+
+.fa-arrows-v::before {
+ content: "\f07d"; }
+
+.fa-face-grimace::before {
+ content: "\f57f"; }
+
+.fa-grimace::before {
+ content: "\f57f"; }
+
+.fa-wheelchair-move::before {
+ content: "\e2ce"; }
+
+.fa-wheelchair-alt::before {
+ content: "\e2ce"; }
+
+.fa-turn-down::before {
+ content: "\f3be"; }
+
+.fa-level-down-alt::before {
+ content: "\f3be"; }
+
+.fa-person-walking-arrow-right::before {
+ content: "\e552"; }
+
+.fa-square-envelope::before {
+ content: "\f199"; }
+
+.fa-envelope-square::before {
+ content: "\f199"; }
+
+.fa-dice::before {
+ content: "\f522"; }
+
+.fa-bowling-ball::before {
+ content: "\f436"; }
+
+.fa-brain::before {
+ content: "\f5dc"; }
+
+.fa-bandage::before {
+ content: "\f462"; }
+
+.fa-band-aid::before {
+ content: "\f462"; }
+
+.fa-calendar-minus::before {
+ content: "\f272"; }
+
+.fa-circle-xmark::before {
+ content: "\f057"; }
+
+.fa-times-circle::before {
+ content: "\f057"; }
+
+.fa-xmark-circle::before {
+ content: "\f057"; }
+
+.fa-gifts::before {
+ content: "\f79c"; }
+
+.fa-hotel::before {
+ content: "\f594"; }
+
+.fa-earth-asia::before {
+ content: "\f57e"; }
+
+.fa-globe-asia::before {
+ content: "\f57e"; }
+
+.fa-id-card-clip::before {
+ content: "\f47f"; }
+
+.fa-id-card-alt::before {
+ content: "\f47f"; }
+
+.fa-magnifying-glass-plus::before {
+ content: "\f00e"; }
+
+.fa-search-plus::before {
+ content: "\f00e"; }
+
+.fa-thumbs-up::before {
+ content: "\f164"; }
+
+.fa-user-clock::before {
+ content: "\f4fd"; }
+
+.fa-hand-dots::before {
+ content: "\f461"; }
+
+.fa-allergies::before {
+ content: "\f461"; }
+
+.fa-file-invoice::before {
+ content: "\f570"; }
+
+.fa-window-minimize::before {
+ content: "\f2d1"; }
+
+.fa-mug-saucer::before {
+ content: "\f0f4"; }
+
+.fa-coffee::before {
+ content: "\f0f4"; }
+
+.fa-brush::before {
+ content: "\f55d"; }
+
+.fa-mask::before {
+ content: "\f6fa"; }
+
+.fa-magnifying-glass-minus::before {
+ content: "\f010"; }
+
+.fa-search-minus::before {
+ content: "\f010"; }
+
+.fa-ruler-vertical::before {
+ content: "\f548"; }
+
+.fa-user-large::before {
+ content: "\f406"; }
+
+.fa-user-alt::before {
+ content: "\f406"; }
+
+.fa-train-tram::before {
+ content: "\e5b4"; }
+
+.fa-user-nurse::before {
+ content: "\f82f"; }
+
+.fa-syringe::before {
+ content: "\f48e"; }
+
+.fa-cloud-sun::before {
+ content: "\f6c4"; }
+
+.fa-stopwatch-20::before {
+ content: "\e06f"; }
+
+.fa-square-full::before {
+ content: "\f45c"; }
+
+.fa-magnet::before {
+ content: "\f076"; }
+
+.fa-jar::before {
+ content: "\e516"; }
+
+.fa-note-sticky::before {
+ content: "\f249"; }
+
+.fa-sticky-note::before {
+ content: "\f249"; }
+
+.fa-bug-slash::before {
+ content: "\e490"; }
+
+.fa-arrow-up-from-water-pump::before {
+ content: "\e4b6"; }
+
+.fa-bone::before {
+ content: "\f5d7"; }
+
+.fa-user-injured::before {
+ content: "\f728"; }
+
+.fa-face-sad-tear::before {
+ content: "\f5b4"; }
+
+.fa-sad-tear::before {
+ content: "\f5b4"; }
+
+.fa-plane::before {
+ content: "\f072"; }
+
+.fa-tent-arrows-down::before {
+ content: "\e581"; }
+
+.fa-exclamation::before {
+ content: "\21"; }
+
+.fa-arrows-spin::before {
+ content: "\e4bb"; }
+
+.fa-print::before {
+ content: "\f02f"; }
+
+.fa-turkish-lira-sign::before {
+ content: "\e2bb"; }
+
+.fa-try::before {
+ content: "\e2bb"; }
+
+.fa-turkish-lira::before {
+ content: "\e2bb"; }
+
+.fa-dollar-sign::before {
+ content: "\24"; }
+
+.fa-dollar::before {
+ content: "\24"; }
+
+.fa-usd::before {
+ content: "\24"; }
+
+.fa-x::before {
+ content: "\58"; }
+
+.fa-magnifying-glass-dollar::before {
+ content: "\f688"; }
+
+.fa-search-dollar::before {
+ content: "\f688"; }
+
+.fa-users-gear::before {
+ content: "\f509"; }
+
+.fa-users-cog::before {
+ content: "\f509"; }
+
+.fa-person-military-pointing::before {
+ content: "\e54a"; }
+
+.fa-building-columns::before {
+ content: "\f19c"; }
+
+.fa-bank::before {
+ content: "\f19c"; }
+
+.fa-institution::before {
+ content: "\f19c"; }
+
+.fa-museum::before {
+ content: "\f19c"; }
+
+.fa-university::before {
+ content: "\f19c"; }
+
+.fa-umbrella::before {
+ content: "\f0e9"; }
+
+.fa-trowel::before {
+ content: "\e589"; }
+
+.fa-d::before {
+ content: "\44"; }
+
+.fa-stapler::before {
+ content: "\e5af"; }
+
+.fa-masks-theater::before {
+ content: "\f630"; }
+
+.fa-theater-masks::before {
+ content: "\f630"; }
+
+.fa-kip-sign::before {
+ content: "\e1c4"; }
+
+.fa-hand-point-left::before {
+ content: "\f0a5"; }
+
+.fa-handshake-simple::before {
+ content: "\f4c6"; }
+
+.fa-handshake-alt::before {
+ content: "\f4c6"; }
+
+.fa-jet-fighter::before {
+ content: "\f0fb"; }
+
+.fa-fighter-jet::before {
+ content: "\f0fb"; }
+
+.fa-square-share-nodes::before {
+ content: "\f1e1"; }
+
+.fa-share-alt-square::before {
+ content: "\f1e1"; }
+
+.fa-barcode::before {
+ content: "\f02a"; }
+
+.fa-plus-minus::before {
+ content: "\e43c"; }
+
+.fa-video::before {
+ content: "\f03d"; }
+
+.fa-video-camera::before {
+ content: "\f03d"; }
+
+.fa-graduation-cap::before {
+ content: "\f19d"; }
+
+.fa-mortar-board::before {
+ content: "\f19d"; }
+
+.fa-hand-holding-medical::before {
+ content: "\e05c"; }
+
+.fa-person-circle-check::before {
+ content: "\e53e"; }
+
+.fa-turn-up::before {
+ content: "\f3bf"; }
+
+.fa-level-up-alt::before {
+ content: "\f3bf"; }
+
+.sr-only,
+.fa-sr-only {
+ position: absolute;
+ width: 1px;
+ height: 1px;
+ padding: 0;
+ margin: -1px;
+ overflow: hidden;
+ clip: rect(0, 0, 0, 0);
+ white-space: nowrap;
+ border-width: 0; }
+
+.sr-only-focusable:not(:focus),
+.fa-sr-only-focusable:not(:focus) {
+ position: absolute;
+ width: 1px;
+ height: 1px;
+ padding: 0;
+ margin: -1px;
+ overflow: hidden;
+ clip: rect(0, 0, 0, 0);
+ white-space: nowrap;
+ border-width: 0; }
+:root, :host {
+ --fa-style-family-brands: 'Font Awesome 6 Brands';
+ --fa-font-brands: normal 400 1em/1 'Font Awesome 6 Brands'; }
+
+@font-face {
+ font-family: 'Font Awesome 6 Brands';
+ font-style: normal;
+ font-weight: 400;
+ font-display: block;
+ src: url("../webfonts/fa-brands-400.woff2") format("woff2"), url("../webfonts/fa-brands-400.ttf") format("truetype"); }
+
+.fab,
+.fa-brands {
+ font-weight: 400; }
+
+.fa-monero:before {
+ content: "\f3d0"; }
+
+.fa-hooli:before {
+ content: "\f427"; }
+
+.fa-yelp:before {
+ content: "\f1e9"; }
+
+.fa-cc-visa:before {
+ content: "\f1f0"; }
+
+.fa-lastfm:before {
+ content: "\f202"; }
+
+.fa-shopware:before {
+ content: "\f5b5"; }
+
+.fa-creative-commons-nc:before {
+ content: "\f4e8"; }
+
+.fa-aws:before {
+ content: "\f375"; }
+
+.fa-redhat:before {
+ content: "\f7bc"; }
+
+.fa-yoast:before {
+ content: "\f2b1"; }
+
+.fa-cloudflare:before {
+ content: "\e07d"; }
+
+.fa-ups:before {
+ content: "\f7e0"; }
+
+.fa-pixiv:before {
+ content: "\e640"; }
+
+.fa-wpexplorer:before {
+ content: "\f2de"; }
+
+.fa-dyalog:before {
+ content: "\f399"; }
+
+.fa-bity:before {
+ content: "\f37a"; }
+
+.fa-stackpath:before {
+ content: "\f842"; }
+
+.fa-buysellads:before {
+ content: "\f20d"; }
+
+.fa-first-order:before {
+ content: "\f2b0"; }
+
+.fa-modx:before {
+ content: "\f285"; }
+
+.fa-guilded:before {
+ content: "\e07e"; }
+
+.fa-vnv:before {
+ content: "\f40b"; }
+
+.fa-square-js:before {
+ content: "\f3b9"; }
+
+.fa-js-square:before {
+ content: "\f3b9"; }
+
+.fa-microsoft:before {
+ content: "\f3ca"; }
+
+.fa-qq:before {
+ content: "\f1d6"; }
+
+.fa-orcid:before {
+ content: "\f8d2"; }
+
+.fa-java:before {
+ content: "\f4e4"; }
+
+.fa-invision:before {
+ content: "\f7b0"; }
+
+.fa-creative-commons-pd-alt:before {
+ content: "\f4ed"; }
+
+.fa-centercode:before {
+ content: "\f380"; }
+
+.fa-glide-g:before {
+ content: "\f2a6"; }
+
+.fa-drupal:before {
+ content: "\f1a9"; }
+
+.fa-jxl:before {
+ content: "\e67b"; }
+
+.fa-hire-a-helper:before {
+ content: "\f3b0"; }
+
+.fa-creative-commons-by:before {
+ content: "\f4e7"; }
+
+.fa-unity:before {
+ content: "\e049"; }
+
+.fa-whmcs:before {
+ content: "\f40d"; }
+
+.fa-rocketchat:before {
+ content: "\f3e8"; }
+
+.fa-vk:before {
+ content: "\f189"; }
+
+.fa-untappd:before {
+ content: "\f405"; }
+
+.fa-mailchimp:before {
+ content: "\f59e"; }
+
+.fa-css3-alt:before {
+ content: "\f38b"; }
+
+.fa-square-reddit:before {
+ content: "\f1a2"; }
+
+.fa-reddit-square:before {
+ content: "\f1a2"; }
+
+.fa-vimeo-v:before {
+ content: "\f27d"; }
+
+.fa-contao:before {
+ content: "\f26d"; }
+
+.fa-square-font-awesome:before {
+ content: "\e5ad"; }
+
+.fa-deskpro:before {
+ content: "\f38f"; }
+
+.fa-brave:before {
+ content: "\e63c"; }
+
+.fa-sistrix:before {
+ content: "\f3ee"; }
+
+.fa-square-instagram:before {
+ content: "\e055"; }
+
+.fa-instagram-square:before {
+ content: "\e055"; }
+
+.fa-battle-net:before {
+ content: "\f835"; }
+
+.fa-the-red-yeti:before {
+ content: "\f69d"; }
+
+.fa-square-hacker-news:before {
+ content: "\f3af"; }
+
+.fa-hacker-news-square:before {
+ content: "\f3af"; }
+
+.fa-edge:before {
+ content: "\f282"; }
+
+.fa-threads:before {
+ content: "\e618"; }
+
+.fa-napster:before {
+ content: "\f3d2"; }
+
+.fa-square-snapchat:before {
+ content: "\f2ad"; }
+
+.fa-snapchat-square:before {
+ content: "\f2ad"; }
+
+.fa-google-plus-g:before {
+ content: "\f0d5"; }
+
+.fa-artstation:before {
+ content: "\f77a"; }
+
+.fa-markdown:before {
+ content: "\f60f"; }
+
+.fa-sourcetree:before {
+ content: "\f7d3"; }
+
+.fa-google-plus:before {
+ content: "\f2b3"; }
+
+.fa-diaspora:before {
+ content: "\f791"; }
+
+.fa-foursquare:before {
+ content: "\f180"; }
+
+.fa-stack-overflow:before {
+ content: "\f16c"; }
+
+.fa-github-alt:before {
+ content: "\f113"; }
+
+.fa-phoenix-squadron:before {
+ content: "\f511"; }
+
+.fa-pagelines:before {
+ content: "\f18c"; }
+
+.fa-algolia:before {
+ content: "\f36c"; }
+
+.fa-red-river:before {
+ content: "\f3e3"; }
+
+.fa-creative-commons-sa:before {
+ content: "\f4ef"; }
+
+.fa-safari:before {
+ content: "\f267"; }
+
+.fa-google:before {
+ content: "\f1a0"; }
+
+.fa-square-font-awesome-stroke:before {
+ content: "\f35c"; }
+
+.fa-font-awesome-alt:before {
+ content: "\f35c"; }
+
+.fa-atlassian:before {
+ content: "\f77b"; }
+
+.fa-linkedin-in:before {
+ content: "\f0e1"; }
+
+.fa-digital-ocean:before {
+ content: "\f391"; }
+
+.fa-nimblr:before {
+ content: "\f5a8"; }
+
+.fa-chromecast:before {
+ content: "\f838"; }
+
+.fa-evernote:before {
+ content: "\f839"; }
+
+.fa-hacker-news:before {
+ content: "\f1d4"; }
+
+.fa-creative-commons-sampling:before {
+ content: "\f4f0"; }
+
+.fa-adversal:before {
+ content: "\f36a"; }
+
+.fa-creative-commons:before {
+ content: "\f25e"; }
+
+.fa-watchman-monitoring:before {
+ content: "\e087"; }
+
+.fa-fonticons:before {
+ content: "\f280"; }
+
+.fa-weixin:before {
+ content: "\f1d7"; }
+
+.fa-shirtsinbulk:before {
+ content: "\f214"; }
+
+.fa-codepen:before {
+ content: "\f1cb"; }
+
+.fa-git-alt:before {
+ content: "\f841"; }
+
+.fa-lyft:before {
+ content: "\f3c3"; }
+
+.fa-rev:before {
+ content: "\f5b2"; }
+
+.fa-windows:before {
+ content: "\f17a"; }
+
+.fa-wizards-of-the-coast:before {
+ content: "\f730"; }
+
+.fa-square-viadeo:before {
+ content: "\f2aa"; }
+
+.fa-viadeo-square:before {
+ content: "\f2aa"; }
+
+.fa-meetup:before {
+ content: "\f2e0"; }
+
+.fa-centos:before {
+ content: "\f789"; }
+
+.fa-adn:before {
+ content: "\f170"; }
+
+.fa-cloudsmith:before {
+ content: "\f384"; }
+
+.fa-opensuse:before {
+ content: "\e62b"; }
+
+.fa-pied-piper-alt:before {
+ content: "\f1a8"; }
+
+.fa-square-dribbble:before {
+ content: "\f397"; }
+
+.fa-dribbble-square:before {
+ content: "\f397"; }
+
+.fa-codiepie:before {
+ content: "\f284"; }
+
+.fa-node:before {
+ content: "\f419"; }
+
+.fa-mix:before {
+ content: "\f3cb"; }
+
+.fa-steam:before {
+ content: "\f1b6"; }
+
+.fa-cc-apple-pay:before {
+ content: "\f416"; }
+
+.fa-scribd:before {
+ content: "\f28a"; }
+
+.fa-debian:before {
+ content: "\e60b"; }
+
+.fa-openid:before {
+ content: "\f19b"; }
+
+.fa-instalod:before {
+ content: "\e081"; }
+
+.fa-expeditedssl:before {
+ content: "\f23e"; }
+
+.fa-sellcast:before {
+ content: "\f2da"; }
+
+.fa-square-twitter:before {
+ content: "\f081"; }
+
+.fa-twitter-square:before {
+ content: "\f081"; }
+
+.fa-r-project:before {
+ content: "\f4f7"; }
+
+.fa-delicious:before {
+ content: "\f1a5"; }
+
+.fa-freebsd:before {
+ content: "\f3a4"; }
+
+.fa-vuejs:before {
+ content: "\f41f"; }
+
+.fa-accusoft:before {
+ content: "\f369"; }
+
+.fa-ioxhost:before {
+ content: "\f208"; }
+
+.fa-fonticons-fi:before {
+ content: "\f3a2"; }
+
+.fa-app-store:before {
+ content: "\f36f"; }
+
+.fa-cc-mastercard:before {
+ content: "\f1f1"; }
+
+.fa-itunes-note:before {
+ content: "\f3b5"; }
+
+.fa-golang:before {
+ content: "\e40f"; }
+
+.fa-kickstarter:before {
+ content: "\f3bb"; }
+
+.fa-square-kickstarter:before {
+ content: "\f3bb"; }
+
+.fa-grav:before {
+ content: "\f2d6"; }
+
+.fa-weibo:before {
+ content: "\f18a"; }
+
+.fa-uncharted:before {
+ content: "\e084"; }
+
+.fa-firstdraft:before {
+ content: "\f3a1"; }
+
+.fa-square-youtube:before {
+ content: "\f431"; }
+
+.fa-youtube-square:before {
+ content: "\f431"; }
+
+.fa-wikipedia-w:before {
+ content: "\f266"; }
+
+.fa-wpressr:before {
+ content: "\f3e4"; }
+
+.fa-rendact:before {
+ content: "\f3e4"; }
+
+.fa-angellist:before {
+ content: "\f209"; }
+
+.fa-galactic-republic:before {
+ content: "\f50c"; }
+
+.fa-nfc-directional:before {
+ content: "\e530"; }
+
+.fa-skype:before {
+ content: "\f17e"; }
+
+.fa-joget:before {
+ content: "\f3b7"; }
+
+.fa-fedora:before {
+ content: "\f798"; }
+
+.fa-stripe-s:before {
+ content: "\f42a"; }
+
+.fa-meta:before {
+ content: "\e49b"; }
+
+.fa-laravel:before {
+ content: "\f3bd"; }
+
+.fa-hotjar:before {
+ content: "\f3b1"; }
+
+.fa-bluetooth-b:before {
+ content: "\f294"; }
+
+.fa-square-letterboxd:before {
+ content: "\e62e"; }
+
+.fa-sticker-mule:before {
+ content: "\f3f7"; }
+
+.fa-creative-commons-zero:before {
+ content: "\f4f3"; }
+
+.fa-hips:before {
+ content: "\f452"; }
+
+.fa-behance:before {
+ content: "\f1b4"; }
+
+.fa-reddit:before {
+ content: "\f1a1"; }
+
+.fa-discord:before {
+ content: "\f392"; }
+
+.fa-chrome:before {
+ content: "\f268"; }
+
+.fa-app-store-ios:before {
+ content: "\f370"; }
+
+.fa-cc-discover:before {
+ content: "\f1f2"; }
+
+.fa-wpbeginner:before {
+ content: "\f297"; }
+
+.fa-confluence:before {
+ content: "\f78d"; }
+
+.fa-shoelace:before {
+ content: "\e60c"; }
+
+.fa-mdb:before {
+ content: "\f8ca"; }
+
+.fa-dochub:before {
+ content: "\f394"; }
+
+.fa-accessible-icon:before {
+ content: "\f368"; }
+
+.fa-ebay:before {
+ content: "\f4f4"; }
+
+.fa-amazon:before {
+ content: "\f270"; }
+
+.fa-unsplash:before {
+ content: "\e07c"; }
+
+.fa-yarn:before {
+ content: "\f7e3"; }
+
+.fa-square-steam:before {
+ content: "\f1b7"; }
+
+.fa-steam-square:before {
+ content: "\f1b7"; }
+
+.fa-500px:before {
+ content: "\f26e"; }
+
+.fa-square-vimeo:before {
+ content: "\f194"; }
+
+.fa-vimeo-square:before {
+ content: "\f194"; }
+
+.fa-asymmetrik:before {
+ content: "\f372"; }
+
+.fa-font-awesome:before {
+ content: "\f2b4"; }
+
+.fa-font-awesome-flag:before {
+ content: "\f2b4"; }
+
+.fa-font-awesome-logo-full:before {
+ content: "\f2b4"; }
+
+.fa-gratipay:before {
+ content: "\f184"; }
+
+.fa-apple:before {
+ content: "\f179"; }
+
+.fa-hive:before {
+ content: "\e07f"; }
+
+.fa-gitkraken:before {
+ content: "\f3a6"; }
+
+.fa-keybase:before {
+ content: "\f4f5"; }
+
+.fa-apple-pay:before {
+ content: "\f415"; }
+
+.fa-padlet:before {
+ content: "\e4a0"; }
+
+.fa-amazon-pay:before {
+ content: "\f42c"; }
+
+.fa-square-github:before {
+ content: "\f092"; }
+
+.fa-github-square:before {
+ content: "\f092"; }
+
+.fa-stumbleupon:before {
+ content: "\f1a4"; }
+
+.fa-fedex:before {
+ content: "\f797"; }
+
+.fa-phoenix-framework:before {
+ content: "\f3dc"; }
+
+.fa-shopify:before {
+ content: "\e057"; }
+
+.fa-neos:before {
+ content: "\f612"; }
+
+.fa-square-threads:before {
+ content: "\e619"; }
+
+.fa-hackerrank:before {
+ content: "\f5f7"; }
+
+.fa-researchgate:before {
+ content: "\f4f8"; }
+
+.fa-swift:before {
+ content: "\f8e1"; }
+
+.fa-angular:before {
+ content: "\f420"; }
+
+.fa-speakap:before {
+ content: "\f3f3"; }
+
+.fa-angrycreative:before {
+ content: "\f36e"; }
+
+.fa-y-combinator:before {
+ content: "\f23b"; }
+
+.fa-empire:before {
+ content: "\f1d1"; }
+
+.fa-envira:before {
+ content: "\f299"; }
+
+.fa-google-scholar:before {
+ content: "\e63b"; }
+
+.fa-square-gitlab:before {
+ content: "\e5ae"; }
+
+.fa-gitlab-square:before {
+ content: "\e5ae"; }
+
+.fa-studiovinari:before {
+ content: "\f3f8"; }
+
+.fa-pied-piper:before {
+ content: "\f2ae"; }
+
+.fa-wordpress:before {
+ content: "\f19a"; }
+
+.fa-product-hunt:before {
+ content: "\f288"; }
+
+.fa-firefox:before {
+ content: "\f269"; }
+
+.fa-linode:before {
+ content: "\f2b8"; }
+
+.fa-goodreads:before {
+ content: "\f3a8"; }
+
+.fa-square-odnoklassniki:before {
+ content: "\f264"; }
+
+.fa-odnoklassniki-square:before {
+ content: "\f264"; }
+
+.fa-jsfiddle:before {
+ content: "\f1cc"; }
+
+.fa-sith:before {
+ content: "\f512"; }
+
+.fa-themeisle:before {
+ content: "\f2b2"; }
+
+.fa-page4:before {
+ content: "\f3d7"; }
+
+.fa-hashnode:before {
+ content: "\e499"; }
+
+.fa-react:before {
+ content: "\f41b"; }
+
+.fa-cc-paypal:before {
+ content: "\f1f4"; }
+
+.fa-squarespace:before {
+ content: "\f5be"; }
+
+.fa-cc-stripe:before {
+ content: "\f1f5"; }
+
+.fa-creative-commons-share:before {
+ content: "\f4f2"; }
+
+.fa-bitcoin:before {
+ content: "\f379"; }
+
+.fa-keycdn:before {
+ content: "\f3ba"; }
+
+.fa-opera:before {
+ content: "\f26a"; }
+
+.fa-itch-io:before {
+ content: "\f83a"; }
+
+.fa-umbraco:before {
+ content: "\f8e8"; }
+
+.fa-galactic-senate:before {
+ content: "\f50d"; }
+
+.fa-ubuntu:before {
+ content: "\f7df"; }
+
+.fa-draft2digital:before {
+ content: "\f396"; }
+
+.fa-stripe:before {
+ content: "\f429"; }
+
+.fa-houzz:before {
+ content: "\f27c"; }
+
+.fa-gg:before {
+ content: "\f260"; }
+
+.fa-dhl:before {
+ content: "\f790"; }
+
+.fa-square-pinterest:before {
+ content: "\f0d3"; }
+
+.fa-pinterest-square:before {
+ content: "\f0d3"; }
+
+.fa-xing:before {
+ content: "\f168"; }
+
+.fa-blackberry:before {
+ content: "\f37b"; }
+
+.fa-creative-commons-pd:before {
+ content: "\f4ec"; }
+
+.fa-playstation:before {
+ content: "\f3df"; }
+
+.fa-quinscape:before {
+ content: "\f459"; }
+
+.fa-less:before {
+ content: "\f41d"; }
+
+.fa-blogger-b:before {
+ content: "\f37d"; }
+
+.fa-opencart:before {
+ content: "\f23d"; }
+
+.fa-vine:before {
+ content: "\f1ca"; }
+
+.fa-signal-messenger:before {
+ content: "\e663"; }
+
+.fa-paypal:before {
+ content: "\f1ed"; }
+
+.fa-gitlab:before {
+ content: "\f296"; }
+
+.fa-typo3:before {
+ content: "\f42b"; }
+
+.fa-reddit-alien:before {
+ content: "\f281"; }
+
+.fa-yahoo:before {
+ content: "\f19e"; }
+
+.fa-dailymotion:before {
+ content: "\e052"; }
+
+.fa-affiliatetheme:before {
+ content: "\f36b"; }
+
+.fa-pied-piper-pp:before {
+ content: "\f1a7"; }
+
+.fa-bootstrap:before {
+ content: "\f836"; }
+
+.fa-odnoklassniki:before {
+ content: "\f263"; }
+
+.fa-nfc-symbol:before {
+ content: "\e531"; }
+
+.fa-mintbit:before {
+ content: "\e62f"; }
+
+.fa-ethereum:before {
+ content: "\f42e"; }
+
+.fa-speaker-deck:before {
+ content: "\f83c"; }
+
+.fa-creative-commons-nc-eu:before {
+ content: "\f4e9"; }
+
+.fa-patreon:before {
+ content: "\f3d9"; }
+
+.fa-avianex:before {
+ content: "\f374"; }
+
+.fa-ello:before {
+ content: "\f5f1"; }
+
+.fa-gofore:before {
+ content: "\f3a7"; }
+
+.fa-bimobject:before {
+ content: "\f378"; }
+
+.fa-brave-reverse:before {
+ content: "\e63d"; }
+
+.fa-facebook-f:before {
+ content: "\f39e"; }
+
+.fa-square-google-plus:before {
+ content: "\f0d4"; }
+
+.fa-google-plus-square:before {
+ content: "\f0d4"; }
+
+.fa-web-awesome:before {
+ content: "\e682"; }
+
+.fa-mandalorian:before {
+ content: "\f50f"; }
+
+.fa-first-order-alt:before {
+ content: "\f50a"; }
+
+.fa-osi:before {
+ content: "\f41a"; }
+
+.fa-google-wallet:before {
+ content: "\f1ee"; }
+
+.fa-d-and-d-beyond:before {
+ content: "\f6ca"; }
+
+.fa-periscope:before {
+ content: "\f3da"; }
+
+.fa-fulcrum:before {
+ content: "\f50b"; }
+
+.fa-cloudscale:before {
+ content: "\f383"; }
+
+.fa-forumbee:before {
+ content: "\f211"; }
+
+.fa-mizuni:before {
+ content: "\f3cc"; }
+
+.fa-schlix:before {
+ content: "\f3ea"; }
+
+.fa-square-xing:before {
+ content: "\f169"; }
+
+.fa-xing-square:before {
+ content: "\f169"; }
+
+.fa-bandcamp:before {
+ content: "\f2d5"; }
+
+.fa-wpforms:before {
+ content: "\f298"; }
+
+.fa-cloudversify:before {
+ content: "\f385"; }
+
+.fa-usps:before {
+ content: "\f7e1"; }
+
+.fa-megaport:before {
+ content: "\f5a3"; }
+
+.fa-magento:before {
+ content: "\f3c4"; }
+
+.fa-spotify:before {
+ content: "\f1bc"; }
+
+.fa-optin-monster:before {
+ content: "\f23c"; }
+
+.fa-fly:before {
+ content: "\f417"; }
+
+.fa-aviato:before {
+ content: "\f421"; }
+
+.fa-itunes:before {
+ content: "\f3b4"; }
+
+.fa-cuttlefish:before {
+ content: "\f38c"; }
+
+.fa-blogger:before {
+ content: "\f37c"; }
+
+.fa-flickr:before {
+ content: "\f16e"; }
+
+.fa-viber:before {
+ content: "\f409"; }
+
+.fa-soundcloud:before {
+ content: "\f1be"; }
+
+.fa-digg:before {
+ content: "\f1a6"; }
+
+.fa-tencent-weibo:before {
+ content: "\f1d5"; }
+
+.fa-letterboxd:before {
+ content: "\e62d"; }
+
+.fa-symfony:before {
+ content: "\f83d"; }
+
+.fa-maxcdn:before {
+ content: "\f136"; }
+
+.fa-etsy:before {
+ content: "\f2d7"; }
+
+.fa-facebook-messenger:before {
+ content: "\f39f"; }
+
+.fa-audible:before {
+ content: "\f373"; }
+
+.fa-think-peaks:before {
+ content: "\f731"; }
+
+.fa-bilibili:before {
+ content: "\e3d9"; }
+
+.fa-erlang:before {
+ content: "\f39d"; }
+
+.fa-x-twitter:before {
+ content: "\e61b"; }
+
+.fa-cotton-bureau:before {
+ content: "\f89e"; }
+
+.fa-dashcube:before {
+ content: "\f210"; }
+
+.fa-42-group:before {
+ content: "\e080"; }
+
+.fa-innosoft:before {
+ content: "\e080"; }
+
+.fa-stack-exchange:before {
+ content: "\f18d"; }
+
+.fa-elementor:before {
+ content: "\f430"; }
+
+.fa-square-pied-piper:before {
+ content: "\e01e"; }
+
+.fa-pied-piper-square:before {
+ content: "\e01e"; }
+
+.fa-creative-commons-nd:before {
+ content: "\f4eb"; }
+
+.fa-palfed:before {
+ content: "\f3d8"; }
+
+.fa-superpowers:before {
+ content: "\f2dd"; }
+
+.fa-resolving:before {
+ content: "\f3e7"; }
+
+.fa-xbox:before {
+ content: "\f412"; }
+
+.fa-square-web-awesome-stroke:before {
+ content: "\e684"; }
+
+.fa-searchengin:before {
+ content: "\f3eb"; }
+
+.fa-tiktok:before {
+ content: "\e07b"; }
+
+.fa-square-facebook:before {
+ content: "\f082"; }
+
+.fa-facebook-square:before {
+ content: "\f082"; }
+
+.fa-renren:before {
+ content: "\f18b"; }
+
+.fa-linux:before {
+ content: "\f17c"; }
+
+.fa-glide:before {
+ content: "\f2a5"; }
+
+.fa-linkedin:before {
+ content: "\f08c"; }
+
+.fa-hubspot:before {
+ content: "\f3b2"; }
+
+.fa-deploydog:before {
+ content: "\f38e"; }
+
+.fa-twitch:before {
+ content: "\f1e8"; }
+
+.fa-ravelry:before {
+ content: "\f2d9"; }
+
+.fa-mixer:before {
+ content: "\e056"; }
+
+.fa-square-lastfm:before {
+ content: "\f203"; }
+
+.fa-lastfm-square:before {
+ content: "\f203"; }
+
+.fa-vimeo:before {
+ content: "\f40a"; }
+
+.fa-mendeley:before {
+ content: "\f7b3"; }
+
+.fa-uniregistry:before {
+ content: "\f404"; }
+
+.fa-figma:before {
+ content: "\f799"; }
+
+.fa-creative-commons-remix:before {
+ content: "\f4ee"; }
+
+.fa-cc-amazon-pay:before {
+ content: "\f42d"; }
+
+.fa-dropbox:before {
+ content: "\f16b"; }
+
+.fa-instagram:before {
+ content: "\f16d"; }
+
+.fa-cmplid:before {
+ content: "\e360"; }
+
+.fa-upwork:before {
+ content: "\e641"; }
+
+.fa-facebook:before {
+ content: "\f09a"; }
+
+.fa-gripfire:before {
+ content: "\f3ac"; }
+
+.fa-jedi-order:before {
+ content: "\f50e"; }
+
+.fa-uikit:before {
+ content: "\f403"; }
+
+.fa-fort-awesome-alt:before {
+ content: "\f3a3"; }
+
+.fa-phabricator:before {
+ content: "\f3db"; }
+
+.fa-ussunnah:before {
+ content: "\f407"; }
+
+.fa-earlybirds:before {
+ content: "\f39a"; }
+
+.fa-trade-federation:before {
+ content: "\f513"; }
+
+.fa-autoprefixer:before {
+ content: "\f41c"; }
+
+.fa-whatsapp:before {
+ content: "\f232"; }
+
+.fa-square-upwork:before {
+ content: "\e67c"; }
+
+.fa-slideshare:before {
+ content: "\f1e7"; }
+
+.fa-google-play:before {
+ content: "\f3ab"; }
+
+.fa-viadeo:before {
+ content: "\f2a9"; }
+
+.fa-line:before {
+ content: "\f3c0"; }
+
+.fa-google-drive:before {
+ content: "\f3aa"; }
+
+.fa-servicestack:before {
+ content: "\f3ec"; }
+
+.fa-simplybuilt:before {
+ content: "\f215"; }
+
+.fa-bitbucket:before {
+ content: "\f171"; }
+
+.fa-imdb:before {
+ content: "\f2d8"; }
+
+.fa-deezer:before {
+ content: "\e077"; }
+
+.fa-raspberry-pi:before {
+ content: "\f7bb"; }
+
+.fa-jira:before {
+ content: "\f7b1"; }
+
+.fa-docker:before {
+ content: "\f395"; }
+
+.fa-screenpal:before {
+ content: "\e570"; }
+
+.fa-bluetooth:before {
+ content: "\f293"; }
+
+.fa-gitter:before {
+ content: "\f426"; }
+
+.fa-d-and-d:before {
+ content: "\f38d"; }
+
+.fa-microblog:before {
+ content: "\e01a"; }
+
+.fa-cc-diners-club:before {
+ content: "\f24c"; }
+
+.fa-gg-circle:before {
+ content: "\f261"; }
+
+.fa-pied-piper-hat:before {
+ content: "\f4e5"; }
+
+.fa-kickstarter-k:before {
+ content: "\f3bc"; }
+
+.fa-yandex:before {
+ content: "\f413"; }
+
+.fa-readme:before {
+ content: "\f4d5"; }
+
+.fa-html5:before {
+ content: "\f13b"; }
+
+.fa-sellsy:before {
+ content: "\f213"; }
+
+.fa-square-web-awesome:before {
+ content: "\e683"; }
+
+.fa-sass:before {
+ content: "\f41e"; }
+
+.fa-wirsindhandwerk:before {
+ content: "\e2d0"; }
+
+.fa-wsh:before {
+ content: "\e2d0"; }
+
+.fa-buromobelexperte:before {
+ content: "\f37f"; }
+
+.fa-salesforce:before {
+ content: "\f83b"; }
+
+.fa-octopus-deploy:before {
+ content: "\e082"; }
+
+.fa-medapps:before {
+ content: "\f3c6"; }
+
+.fa-ns8:before {
+ content: "\f3d5"; }
+
+.fa-pinterest-p:before {
+ content: "\f231"; }
+
+.fa-apper:before {
+ content: "\f371"; }
+
+.fa-fort-awesome:before {
+ content: "\f286"; }
+
+.fa-waze:before {
+ content: "\f83f"; }
+
+.fa-bluesky:before {
+ content: "\e671"; }
+
+.fa-cc-jcb:before {
+ content: "\f24b"; }
+
+.fa-snapchat:before {
+ content: "\f2ab"; }
+
+.fa-snapchat-ghost:before {
+ content: "\f2ab"; }
+
+.fa-fantasy-flight-games:before {
+ content: "\f6dc"; }
+
+.fa-rust:before {
+ content: "\e07a"; }
+
+.fa-wix:before {
+ content: "\f5cf"; }
+
+.fa-square-behance:before {
+ content: "\f1b5"; }
+
+.fa-behance-square:before {
+ content: "\f1b5"; }
+
+.fa-supple:before {
+ content: "\f3f9"; }
+
+.fa-webflow:before {
+ content: "\e65c"; }
+
+.fa-rebel:before {
+ content: "\f1d0"; }
+
+.fa-css3:before {
+ content: "\f13c"; }
+
+.fa-staylinked:before {
+ content: "\f3f5"; }
+
+.fa-kaggle:before {
+ content: "\f5fa"; }
+
+.fa-space-awesome:before {
+ content: "\e5ac"; }
+
+.fa-deviantart:before {
+ content: "\f1bd"; }
+
+.fa-cpanel:before {
+ content: "\f388"; }
+
+.fa-goodreads-g:before {
+ content: "\f3a9"; }
+
+.fa-square-git:before {
+ content: "\f1d2"; }
+
+.fa-git-square:before {
+ content: "\f1d2"; }
+
+.fa-square-tumblr:before {
+ content: "\f174"; }
+
+.fa-tumblr-square:before {
+ content: "\f174"; }
+
+.fa-trello:before {
+ content: "\f181"; }
+
+.fa-creative-commons-nc-jp:before {
+ content: "\f4ea"; }
+
+.fa-get-pocket:before {
+ content: "\f265"; }
+
+.fa-perbyte:before {
+ content: "\e083"; }
+
+.fa-grunt:before {
+ content: "\f3ad"; }
+
+.fa-weebly:before {
+ content: "\f5cc"; }
+
+.fa-connectdevelop:before {
+ content: "\f20e"; }
+
+.fa-leanpub:before {
+ content: "\f212"; }
+
+.fa-black-tie:before {
+ content: "\f27e"; }
+
+.fa-themeco:before {
+ content: "\f5c6"; }
+
+.fa-python:before {
+ content: "\f3e2"; }
+
+.fa-android:before {
+ content: "\f17b"; }
+
+.fa-bots:before {
+ content: "\e340"; }
+
+.fa-free-code-camp:before {
+ content: "\f2c5"; }
+
+.fa-hornbill:before {
+ content: "\f592"; }
+
+.fa-js:before {
+ content: "\f3b8"; }
+
+.fa-ideal:before {
+ content: "\e013"; }
+
+.fa-git:before {
+ content: "\f1d3"; }
+
+.fa-dev:before {
+ content: "\f6cc"; }
+
+.fa-sketch:before {
+ content: "\f7c6"; }
+
+.fa-yandex-international:before {
+ content: "\f414"; }
+
+.fa-cc-amex:before {
+ content: "\f1f3"; }
+
+.fa-uber:before {
+ content: "\f402"; }
+
+.fa-github:before {
+ content: "\f09b"; }
+
+.fa-php:before {
+ content: "\f457"; }
+
+.fa-alipay:before {
+ content: "\f642"; }
+
+.fa-youtube:before {
+ content: "\f167"; }
+
+.fa-skyatlas:before {
+ content: "\f216"; }
+
+.fa-firefox-browser:before {
+ content: "\e007"; }
+
+.fa-replyd:before {
+ content: "\f3e6"; }
+
+.fa-suse:before {
+ content: "\f7d6"; }
+
+.fa-jenkins:before {
+ content: "\f3b6"; }
+
+.fa-twitter:before {
+ content: "\f099"; }
+
+.fa-rockrms:before {
+ content: "\f3e9"; }
+
+.fa-pinterest:before {
+ content: "\f0d2"; }
+
+.fa-buffer:before {
+ content: "\f837"; }
+
+.fa-npm:before {
+ content: "\f3d4"; }
+
+.fa-yammer:before {
+ content: "\f840"; }
+
+.fa-btc:before {
+ content: "\f15a"; }
+
+.fa-dribbble:before {
+ content: "\f17d"; }
+
+.fa-stumbleupon-circle:before {
+ content: "\f1a3"; }
+
+.fa-internet-explorer:before {
+ content: "\f26b"; }
+
+.fa-stubber:before {
+ content: "\e5c7"; }
+
+.fa-telegram:before {
+ content: "\f2c6"; }
+
+.fa-telegram-plane:before {
+ content: "\f2c6"; }
+
+.fa-old-republic:before {
+ content: "\f510"; }
+
+.fa-odysee:before {
+ content: "\e5c6"; }
+
+.fa-square-whatsapp:before {
+ content: "\f40c"; }
+
+.fa-whatsapp-square:before {
+ content: "\f40c"; }
+
+.fa-node-js:before {
+ content: "\f3d3"; }
+
+.fa-edge-legacy:before {
+ content: "\e078"; }
+
+.fa-slack:before {
+ content: "\f198"; }
+
+.fa-slack-hash:before {
+ content: "\f198"; }
+
+.fa-medrt:before {
+ content: "\f3c8"; }
+
+.fa-usb:before {
+ content: "\f287"; }
+
+.fa-tumblr:before {
+ content: "\f173"; }
+
+.fa-vaadin:before {
+ content: "\f408"; }
+
+.fa-quora:before {
+ content: "\f2c4"; }
+
+.fa-square-x-twitter:before {
+ content: "\e61a"; }
+
+.fa-reacteurope:before {
+ content: "\f75d"; }
+
+.fa-medium:before {
+ content: "\f23a"; }
+
+.fa-medium-m:before {
+ content: "\f23a"; }
+
+.fa-amilia:before {
+ content: "\f36d"; }
+
+.fa-mixcloud:before {
+ content: "\f289"; }
+
+.fa-flipboard:before {
+ content: "\f44d"; }
+
+.fa-viacoin:before {
+ content: "\f237"; }
+
+.fa-critical-role:before {
+ content: "\f6c9"; }
+
+.fa-sitrox:before {
+ content: "\e44a"; }
+
+.fa-discourse:before {
+ content: "\f393"; }
+
+.fa-joomla:before {
+ content: "\f1aa"; }
+
+.fa-mastodon:before {
+ content: "\f4f6"; }
+
+.fa-airbnb:before {
+ content: "\f834"; }
+
+.fa-wolf-pack-battalion:before {
+ content: "\f514"; }
+
+.fa-buy-n-large:before {
+ content: "\f8a6"; }
+
+.fa-gulp:before {
+ content: "\f3ae"; }
+
+.fa-creative-commons-sampling-plus:before {
+ content: "\f4f1"; }
+
+.fa-strava:before {
+ content: "\f428"; }
+
+.fa-ember:before {
+ content: "\f423"; }
+
+.fa-canadian-maple-leaf:before {
+ content: "\f785"; }
+
+.fa-teamspeak:before {
+ content: "\f4f9"; }
+
+.fa-pushed:before {
+ content: "\f3e1"; }
+
+.fa-wordpress-simple:before {
+ content: "\f411"; }
+
+.fa-nutritionix:before {
+ content: "\f3d6"; }
+
+.fa-wodu:before {
+ content: "\e088"; }
+
+.fa-google-pay:before {
+ content: "\e079"; }
+
+.fa-intercom:before {
+ content: "\f7af"; }
+
+.fa-zhihu:before {
+ content: "\f63f"; }
+
+.fa-korvue:before {
+ content: "\f42f"; }
+
+.fa-pix:before {
+ content: "\e43a"; }
+
+.fa-steam-symbol:before {
+ content: "\f3f6"; }
+:root, :host {
+ --fa-style-family-classic: 'Font Awesome 6 Free';
+ --fa-font-regular: normal 400 1em/1 'Font Awesome 6 Free'; }
+
+@font-face {
+ font-family: 'Font Awesome 6 Free';
+ font-style: normal;
+ font-weight: 400;
+ font-display: block;
+ src: url("../webfonts/fa-regular-400.woff2") format("woff2"), url("../webfonts/fa-regular-400.ttf") format("truetype"); }
+
+.far,
+.fa-regular {
+ font-weight: 400; }
+:root, :host {
+ --fa-style-family-classic: 'Font Awesome 6 Free';
+ --fa-font-solid: normal 900 1em/1 'Font Awesome 6 Free'; }
+
+@font-face {
+ font-family: 'Font Awesome 6 Free';
+ font-style: normal;
+ font-weight: 900;
+ font-display: block;
+ src: url("../webfonts/fa-solid-900.woff2") format("woff2"), url("../webfonts/fa-solid-900.ttf") format("truetype"); }
+
+.fas,
+.fa-solid {
+ font-weight: 900; }
+@font-face {
+ font-family: 'Font Awesome 5 Brands';
+ font-display: block;
+ font-weight: 400;
+ src: url("../webfonts/fa-brands-400.woff2") format("woff2"), url("../webfonts/fa-brands-400.ttf") format("truetype"); }
+
+@font-face {
+ font-family: 'Font Awesome 5 Free';
+ font-display: block;
+ font-weight: 900;
+ src: url("../webfonts/fa-solid-900.woff2") format("woff2"), url("../webfonts/fa-solid-900.ttf") format("truetype"); }
+
+@font-face {
+ font-family: 'Font Awesome 5 Free';
+ font-display: block;
+ font-weight: 400;
+ src: url("../webfonts/fa-regular-400.woff2") format("woff2"), url("../webfonts/fa-regular-400.ttf") format("truetype"); }
+@font-face {
+ font-family: 'FontAwesome';
+ font-display: block;
+ src: url("../webfonts/fa-solid-900.woff2") format("woff2"), url("../webfonts/fa-solid-900.ttf") format("truetype"); }
+
+@font-face {
+ font-family: 'FontAwesome';
+ font-display: block;
+ src: url("../webfonts/fa-brands-400.woff2") format("woff2"), url("../webfonts/fa-brands-400.ttf") format("truetype"); }
+
+@font-face {
+ font-family: 'FontAwesome';
+ font-display: block;
+ src: url("../webfonts/fa-regular-400.woff2") format("woff2"), url("../webfonts/fa-regular-400.ttf") format("truetype"); }
+
+@font-face {
+ font-family: 'FontAwesome';
+ font-display: block;
+ src: url("../webfonts/fa-v4compatibility.woff2") format("woff2"), url("../webfonts/fa-v4compatibility.ttf") format("truetype"); }
diff --git a/docs/deps/font-awesome-6.5.2/css/all.min.css b/docs/deps/font-awesome-6.5.2/css/all.min.css
new file mode 100644
index 0000000..269bcee
--- /dev/null
+++ b/docs/deps/font-awesome-6.5.2/css/all.min.css
@@ -0,0 +1,9 @@
+/*!
+ * Font Awesome Free 6.5.2 by @fontawesome - https://fontawesome.com
+ * License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License)
+ * Copyright 2024 Fonticons, Inc.
+ */
+.fa{font-family:var(--fa-style-family,"Font Awesome 6 Free");font-weight:var(--fa-style,900)}.fa,.fa-brands,.fa-classic,.fa-regular,.fa-sharp,.fa-solid,.fab,.far,.fas{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased;display:var(--fa-display,inline-block);font-style:normal;font-variant:normal;line-height:1;text-rendering:auto}.fa-classic,.fa-regular,.fa-solid,.far,.fas{font-family:"Font Awesome 6 Free"}.fa-brands,.fab{font-family:"Font Awesome 6 Brands"}.fa-1x{font-size:1em}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-6x{font-size:6em}.fa-7x{font-size:7em}.fa-8x{font-size:8em}.fa-9x{font-size:9em}.fa-10x{font-size:10em}.fa-2xs{font-size:.625em;line-height:.1em;vertical-align:.225em}.fa-xs{font-size:.75em;line-height:.08333em;vertical-align:.125em}.fa-sm{font-size:.875em;line-height:.07143em;vertical-align:.05357em}.fa-lg{font-size:1.25em;line-height:.05em;vertical-align:-.075em}.fa-xl{font-size:1.5em;line-height:.04167em;vertical-align:-.125em}.fa-2xl{font-size:2em;line-height:.03125em;vertical-align:-.1875em}.fa-fw{text-align:center;width:1.25em}.fa-ul{list-style-type:none;margin-left:var(--fa-li-margin,2.5em);padding-left:0}.fa-ul>li{position:relative}.fa-li{left:calc(var(--fa-li-width, 2em)*-1);position:absolute;text-align:center;width:var(--fa-li-width,2em);line-height:inherit}.fa-border{border-radius:var(--fa-border-radius,.1em);border:var(--fa-border-width,.08em) var(--fa-border-style,solid) var(--fa-border-color,#eee);padding:var(--fa-border-padding,.2em .25em .15em)}.fa-pull-left{float:left;margin-right:var(--fa-pull-margin,.3em)}.fa-pull-right{float:right;margin-left:var(--fa-pull-margin,.3em)}.fa-beat{-webkit-animation-name:fa-beat;animation-name:fa-beat;-webkit-animation-delay:var(--fa-animation-delay,0s);animation-delay:var(--fa-animation-delay,0s);-webkit-animation-direction:var(--fa-animation-direction,normal);animation-direction:var(--fa-animation-direction,normal);-webkit-animation-duration:var(--fa-animation-duration,1s);animation-duration:var(--fa-animation-duration,1s);-webkit-animation-iteration-count:var(--fa-animation-iteration-count,infinite);animation-iteration-count:var(--fa-animation-iteration-count,infinite);-webkit-animation-timing-function:var(--fa-animation-timing,ease-in-out);animation-timing-function:var(--fa-animation-timing,ease-in-out)}.fa-bounce{-webkit-animation-name:fa-bounce;animation-name:fa-bounce;-webkit-animation-delay:var(--fa-animation-delay,0s);animation-delay:var(--fa-animation-delay,0s);-webkit-animation-direction:var(--fa-animation-direction,normal);animation-direction:var(--fa-animation-direction,normal);-webkit-animation-duration:var(--fa-animation-duration,1s);animation-duration:var(--fa-animation-duration,1s);-webkit-animation-iteration-count:var(--fa-animation-iteration-count,infinite);animation-iteration-count:var(--fa-animation-iteration-count,infinite);-webkit-animation-timing-function:var(--fa-animation-timing,cubic-bezier(.28,.84,.42,1));animation-timing-function:var(--fa-animation-timing,cubic-bezier(.28,.84,.42,1))}.fa-fade{-webkit-animation-name:fa-fade;animation-name:fa-fade;-webkit-animation-iteration-count:var(--fa-animation-iteration-count,infinite);animation-iteration-count:var(--fa-animation-iteration-count,infinite);-webkit-animation-timing-function:var(--fa-animation-timing,cubic-bezier(.4,0,.6,1));animation-timing-function:var(--fa-animation-timing,cubic-bezier(.4,0,.6,1))}.fa-beat-fade,.fa-fade{-webkit-animation-delay:var(--fa-animation-delay,0s);animation-delay:var(--fa-animation-delay,0s);-webkit-animation-direction:var(--fa-animation-direction,normal);animation-direction:var(--fa-animation-direction,normal);-webkit-animation-duration:var(--fa-animation-duration,1s);animation-duration:var(--fa-animation-duration,1s)}.fa-beat-fade{-webkit-animation-name:fa-beat-fade;animation-name:fa-beat-fade;-webkit-animation-iteration-count:var(--fa-animation-iteration-count,infinite);animation-iteration-count:var(--fa-animation-iteration-count,infinite);-webkit-animation-timing-function:var(--fa-animation-timing,cubic-bezier(.4,0,.6,1));animation-timing-function:var(--fa-animation-timing,cubic-bezier(.4,0,.6,1))}.fa-flip{-webkit-animation-name:fa-flip;animation-name:fa-flip;-webkit-animation-delay:var(--fa-animation-delay,0s);animation-delay:var(--fa-animation-delay,0s);-webkit-animation-direction:var(--fa-animation-direction,normal);animation-direction:var(--fa-animation-direction,normal);-webkit-animation-duration:var(--fa-animation-duration,1s);animation-duration:var(--fa-animation-duration,1s);-webkit-animation-iteration-count:var(--fa-animation-iteration-count,infinite);animation-iteration-count:var(--fa-animation-iteration-count,infinite);-webkit-animation-timing-function:var(--fa-animation-timing,ease-in-out);animation-timing-function:var(--fa-animation-timing,ease-in-out)}.fa-shake{-webkit-animation-name:fa-shake;animation-name:fa-shake;-webkit-animation-duration:var(--fa-animation-duration,1s);animation-duration:var(--fa-animation-duration,1s);-webkit-animation-iteration-count:var(--fa-animation-iteration-count,infinite);animation-iteration-count:var(--fa-animation-iteration-count,infinite);-webkit-animation-timing-function:var(--fa-animation-timing,linear);animation-timing-function:var(--fa-animation-timing,linear)}.fa-shake,.fa-spin{-webkit-animation-delay:var(--fa-animation-delay,0s);animation-delay:var(--fa-animation-delay,0s);-webkit-animation-direction:var(--fa-animation-direction,normal);animation-direction:var(--fa-animation-direction,normal)}.fa-spin{-webkit-animation-name:fa-spin;animation-name:fa-spin;-webkit-animation-duration:var(--fa-animation-duration,2s);animation-duration:var(--fa-animation-duration,2s);-webkit-animation-iteration-count:var(--fa-animation-iteration-count,infinite);animation-iteration-count:var(--fa-animation-iteration-count,infinite);-webkit-animation-timing-function:var(--fa-animation-timing,linear);animation-timing-function:var(--fa-animation-timing,linear)}.fa-spin-reverse{--fa-animation-direction:reverse}.fa-pulse,.fa-spin-pulse{-webkit-animation-name:fa-spin;animation-name:fa-spin;-webkit-animation-direction:var(--fa-animation-direction,normal);animation-direction:var(--fa-animation-direction,normal);-webkit-animation-duration:var(--fa-animation-duration,1s);animation-duration:var(--fa-animation-duration,1s);-webkit-animation-iteration-count:var(--fa-animation-iteration-count,infinite);animation-iteration-count:var(--fa-animation-iteration-count,infinite);-webkit-animation-timing-function:var(--fa-animation-timing,steps(8));animation-timing-function:var(--fa-animation-timing,steps(8))}@media (prefers-reduced-motion:reduce){.fa-beat,.fa-beat-fade,.fa-bounce,.fa-fade,.fa-flip,.fa-pulse,.fa-shake,.fa-spin,.fa-spin-pulse{-webkit-animation-delay:-1ms;animation-delay:-1ms;-webkit-animation-duration:1ms;animation-duration:1ms;-webkit-animation-iteration-count:1;animation-iteration-count:1;-webkit-transition-delay:0s;transition-delay:0s;-webkit-transition-duration:0s;transition-duration:0s}}@-webkit-keyframes fa-beat{0%,90%{-webkit-transform:scale(1);transform:scale(1)}45%{-webkit-transform:scale(var(--fa-beat-scale,1.25));transform:scale(var(--fa-beat-scale,1.25))}}@keyframes fa-beat{0%,90%{-webkit-transform:scale(1);transform:scale(1)}45%{-webkit-transform:scale(var(--fa-beat-scale,1.25));transform:scale(var(--fa-beat-scale,1.25))}}@-webkit-keyframes fa-bounce{0%{-webkit-transform:scale(1) translateY(0);transform:scale(1) translateY(0)}10%{-webkit-transform:scale(var(--fa-bounce-start-scale-x,1.1),var(--fa-bounce-start-scale-y,.9)) translateY(0);transform:scale(var(--fa-bounce-start-scale-x,1.1),var(--fa-bounce-start-scale-y,.9)) translateY(0)}30%{-webkit-transform:scale(var(--fa-bounce-jump-scale-x,.9),var(--fa-bounce-jump-scale-y,1.1)) translateY(var(--fa-bounce-height,-.5em));transform:scale(var(--fa-bounce-jump-scale-x,.9),var(--fa-bounce-jump-scale-y,1.1)) translateY(var(--fa-bounce-height,-.5em))}50%{-webkit-transform:scale(var(--fa-bounce-land-scale-x,1.05),var(--fa-bounce-land-scale-y,.95)) translateY(0);transform:scale(var(--fa-bounce-land-scale-x,1.05),var(--fa-bounce-land-scale-y,.95)) translateY(0)}57%{-webkit-transform:scale(1) translateY(var(--fa-bounce-rebound,-.125em));transform:scale(1) translateY(var(--fa-bounce-rebound,-.125em))}64%{-webkit-transform:scale(1) translateY(0);transform:scale(1) translateY(0)}to{-webkit-transform:scale(1) translateY(0);transform:scale(1) translateY(0)}}@keyframes fa-bounce{0%{-webkit-transform:scale(1) translateY(0);transform:scale(1) translateY(0)}10%{-webkit-transform:scale(var(--fa-bounce-start-scale-x,1.1),var(--fa-bounce-start-scale-y,.9)) translateY(0);transform:scale(var(--fa-bounce-start-scale-x,1.1),var(--fa-bounce-start-scale-y,.9)) translateY(0)}30%{-webkit-transform:scale(var(--fa-bounce-jump-scale-x,.9),var(--fa-bounce-jump-scale-y,1.1)) translateY(var(--fa-bounce-height,-.5em));transform:scale(var(--fa-bounce-jump-scale-x,.9),var(--fa-bounce-jump-scale-y,1.1)) translateY(var(--fa-bounce-height,-.5em))}50%{-webkit-transform:scale(var(--fa-bounce-land-scale-x,1.05),var(--fa-bounce-land-scale-y,.95)) translateY(0);transform:scale(var(--fa-bounce-land-scale-x,1.05),var(--fa-bounce-land-scale-y,.95)) translateY(0)}57%{-webkit-transform:scale(1) translateY(var(--fa-bounce-rebound,-.125em));transform:scale(1) translateY(var(--fa-bounce-rebound,-.125em))}64%{-webkit-transform:scale(1) translateY(0);transform:scale(1) translateY(0)}to{-webkit-transform:scale(1) translateY(0);transform:scale(1) translateY(0)}}@-webkit-keyframes fa-fade{50%{opacity:var(--fa-fade-opacity,.4)}}@keyframes fa-fade{50%{opacity:var(--fa-fade-opacity,.4)}}@-webkit-keyframes fa-beat-fade{0%,to{opacity:var(--fa-beat-fade-opacity,.4);-webkit-transform:scale(1);transform:scale(1)}50%{opacity:1;-webkit-transform:scale(var(--fa-beat-fade-scale,1.125));transform:scale(var(--fa-beat-fade-scale,1.125))}}@keyframes fa-beat-fade{0%,to{opacity:var(--fa-beat-fade-opacity,.4);-webkit-transform:scale(1);transform:scale(1)}50%{opacity:1;-webkit-transform:scale(var(--fa-beat-fade-scale,1.125));transform:scale(var(--fa-beat-fade-scale,1.125))}}@-webkit-keyframes fa-flip{50%{-webkit-transform:rotate3d(var(--fa-flip-x,0),var(--fa-flip-y,1),var(--fa-flip-z,0),var(--fa-flip-angle,-180deg));transform:rotate3d(var(--fa-flip-x,0),var(--fa-flip-y,1),var(--fa-flip-z,0),var(--fa-flip-angle,-180deg))}}@keyframes fa-flip{50%{-webkit-transform:rotate3d(var(--fa-flip-x,0),var(--fa-flip-y,1),var(--fa-flip-z,0),var(--fa-flip-angle,-180deg));transform:rotate3d(var(--fa-flip-x,0),var(--fa-flip-y,1),var(--fa-flip-z,0),var(--fa-flip-angle,-180deg))}}@-webkit-keyframes fa-shake{0%{-webkit-transform:rotate(-15deg);transform:rotate(-15deg)}4%{-webkit-transform:rotate(15deg);transform:rotate(15deg)}8%,24%{-webkit-transform:rotate(-18deg);transform:rotate(-18deg)}12%,28%{-webkit-transform:rotate(18deg);transform:rotate(18deg)}16%{-webkit-transform:rotate(-22deg);transform:rotate(-22deg)}20%{-webkit-transform:rotate(22deg);transform:rotate(22deg)}32%{-webkit-transform:rotate(-12deg);transform:rotate(-12deg)}36%{-webkit-transform:rotate(12deg);transform:rotate(12deg)}40%,to{-webkit-transform:rotate(0deg);transform:rotate(0deg)}}@keyframes fa-shake{0%{-webkit-transform:rotate(-15deg);transform:rotate(-15deg)}4%{-webkit-transform:rotate(15deg);transform:rotate(15deg)}8%,24%{-webkit-transform:rotate(-18deg);transform:rotate(-18deg)}12%,28%{-webkit-transform:rotate(18deg);transform:rotate(18deg)}16%{-webkit-transform:rotate(-22deg);transform:rotate(-22deg)}20%{-webkit-transform:rotate(22deg);transform:rotate(22deg)}32%{-webkit-transform:rotate(-12deg);transform:rotate(-12deg)}36%{-webkit-transform:rotate(12deg);transform:rotate(12deg)}40%,to{-webkit-transform:rotate(0deg);transform:rotate(0deg)}}@-webkit-keyframes fa-spin{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}to{-webkit-transform:rotate(1turn);transform:rotate(1turn)}}@keyframes fa-spin{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}to{-webkit-transform:rotate(1turn);transform:rotate(1turn)}}.fa-rotate-90{-webkit-transform:rotate(90deg);transform:rotate(90deg)}.fa-rotate-180{-webkit-transform:rotate(180deg);transform:rotate(180deg)}.fa-rotate-270{-webkit-transform:rotate(270deg);transform:rotate(270deg)}.fa-flip-horizontal{-webkit-transform:scaleX(-1);transform:scaleX(-1)}.fa-flip-vertical{-webkit-transform:scaleY(-1);transform:scaleY(-1)}.fa-flip-both,.fa-flip-horizontal.fa-flip-vertical{-webkit-transform:scale(-1);transform:scale(-1)}.fa-rotate-by{-webkit-transform:rotate(var(--fa-rotate-angle,0));transform:rotate(var(--fa-rotate-angle,0))}.fa-stack{display:inline-block;height:2em;line-height:2em;position:relative;vertical-align:middle;width:2.5em}.fa-stack-1x,.fa-stack-2x{left:0;position:absolute;text-align:center;width:100%;z-index:var(--fa-stack-z-index,auto)}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:var(--fa-inverse,#fff)}
+
+.fa-0:before{content:"\30"}.fa-1:before{content:"\31"}.fa-2:before{content:"\32"}.fa-3:before{content:"\33"}.fa-4:before{content:"\34"}.fa-5:before{content:"\35"}.fa-6:before{content:"\36"}.fa-7:before{content:"\37"}.fa-8:before{content:"\38"}.fa-9:before{content:"\39"}.fa-fill-drip:before{content:"\f576"}.fa-arrows-to-circle:before{content:"\e4bd"}.fa-chevron-circle-right:before,.fa-circle-chevron-right:before{content:"\f138"}.fa-at:before{content:"\40"}.fa-trash-alt:before,.fa-trash-can:before{content:"\f2ed"}.fa-text-height:before{content:"\f034"}.fa-user-times:before,.fa-user-xmark:before{content:"\f235"}.fa-stethoscope:before{content:"\f0f1"}.fa-comment-alt:before,.fa-message:before{content:"\f27a"}.fa-info:before{content:"\f129"}.fa-compress-alt:before,.fa-down-left-and-up-right-to-center:before{content:"\f422"}.fa-explosion:before{content:"\e4e9"}.fa-file-alt:before,.fa-file-lines:before,.fa-file-text:before{content:"\f15c"}.fa-wave-square:before{content:"\f83e"}.fa-ring:before{content:"\f70b"}.fa-building-un:before{content:"\e4d9"}.fa-dice-three:before{content:"\f527"}.fa-calendar-alt:before,.fa-calendar-days:before{content:"\f073"}.fa-anchor-circle-check:before{content:"\e4aa"}.fa-building-circle-arrow-right:before{content:"\e4d1"}.fa-volleyball-ball:before,.fa-volleyball:before{content:"\f45f"}.fa-arrows-up-to-line:before{content:"\e4c2"}.fa-sort-desc:before,.fa-sort-down:before{content:"\f0dd"}.fa-circle-minus:before,.fa-minus-circle:before{content:"\f056"}.fa-door-open:before{content:"\f52b"}.fa-right-from-bracket:before,.fa-sign-out-alt:before{content:"\f2f5"}.fa-atom:before{content:"\f5d2"}.fa-soap:before{content:"\e06e"}.fa-heart-music-camera-bolt:before,.fa-icons:before{content:"\f86d"}.fa-microphone-alt-slash:before,.fa-microphone-lines-slash:before{content:"\f539"}.fa-bridge-circle-check:before{content:"\e4c9"}.fa-pump-medical:before{content:"\e06a"}.fa-fingerprint:before{content:"\f577"}.fa-hand-point-right:before{content:"\f0a4"}.fa-magnifying-glass-location:before,.fa-search-location:before{content:"\f689"}.fa-forward-step:before,.fa-step-forward:before{content:"\f051"}.fa-face-smile-beam:before,.fa-smile-beam:before{content:"\f5b8"}.fa-flag-checkered:before{content:"\f11e"}.fa-football-ball:before,.fa-football:before{content:"\f44e"}.fa-school-circle-exclamation:before{content:"\e56c"}.fa-crop:before{content:"\f125"}.fa-angle-double-down:before,.fa-angles-down:before{content:"\f103"}.fa-users-rectangle:before{content:"\e594"}.fa-people-roof:before{content:"\e537"}.fa-people-line:before{content:"\e534"}.fa-beer-mug-empty:before,.fa-beer:before{content:"\f0fc"}.fa-diagram-predecessor:before{content:"\e477"}.fa-arrow-up-long:before,.fa-long-arrow-up:before{content:"\f176"}.fa-burn:before,.fa-fire-flame-simple:before{content:"\f46a"}.fa-male:before,.fa-person:before{content:"\f183"}.fa-laptop:before{content:"\f109"}.fa-file-csv:before{content:"\f6dd"}.fa-menorah:before{content:"\f676"}.fa-truck-plane:before{content:"\e58f"}.fa-record-vinyl:before{content:"\f8d9"}.fa-face-grin-stars:before,.fa-grin-stars:before{content:"\f587"}.fa-bong:before{content:"\f55c"}.fa-pastafarianism:before,.fa-spaghetti-monster-flying:before{content:"\f67b"}.fa-arrow-down-up-across-line:before{content:"\e4af"}.fa-spoon:before,.fa-utensil-spoon:before{content:"\f2e5"}.fa-jar-wheat:before{content:"\e517"}.fa-envelopes-bulk:before,.fa-mail-bulk:before{content:"\f674"}.fa-file-circle-exclamation:before{content:"\e4eb"}.fa-circle-h:before,.fa-hospital-symbol:before{content:"\f47e"}.fa-pager:before{content:"\f815"}.fa-address-book:before,.fa-contact-book:before{content:"\f2b9"}.fa-strikethrough:before{content:"\f0cc"}.fa-k:before{content:"\4b"}.fa-landmark-flag:before{content:"\e51c"}.fa-pencil-alt:before,.fa-pencil:before{content:"\f303"}.fa-backward:before{content:"\f04a"}.fa-caret-right:before{content:"\f0da"}.fa-comments:before{content:"\f086"}.fa-file-clipboard:before,.fa-paste:before{content:"\f0ea"}.fa-code-pull-request:before{content:"\e13c"}.fa-clipboard-list:before{content:"\f46d"}.fa-truck-loading:before,.fa-truck-ramp-box:before{content:"\f4de"}.fa-user-check:before{content:"\f4fc"}.fa-vial-virus:before{content:"\e597"}.fa-sheet-plastic:before{content:"\e571"}.fa-blog:before{content:"\f781"}.fa-user-ninja:before{content:"\f504"}.fa-person-arrow-up-from-line:before{content:"\e539"}.fa-scroll-torah:before,.fa-torah:before{content:"\f6a0"}.fa-broom-ball:before,.fa-quidditch-broom-ball:before,.fa-quidditch:before{content:"\f458"}.fa-toggle-off:before{content:"\f204"}.fa-archive:before,.fa-box-archive:before{content:"\f187"}.fa-person-drowning:before{content:"\e545"}.fa-arrow-down-9-1:before,.fa-sort-numeric-desc:before,.fa-sort-numeric-down-alt:before{content:"\f886"}.fa-face-grin-tongue-squint:before,.fa-grin-tongue-squint:before{content:"\f58a"}.fa-spray-can:before{content:"\f5bd"}.fa-truck-monster:before{content:"\f63b"}.fa-w:before{content:"\57"}.fa-earth-africa:before,.fa-globe-africa:before{content:"\f57c"}.fa-rainbow:before{content:"\f75b"}.fa-circle-notch:before{content:"\f1ce"}.fa-tablet-alt:before,.fa-tablet-screen-button:before{content:"\f3fa"}.fa-paw:before{content:"\f1b0"}.fa-cloud:before{content:"\f0c2"}.fa-trowel-bricks:before{content:"\e58a"}.fa-face-flushed:before,.fa-flushed:before{content:"\f579"}.fa-hospital-user:before{content:"\f80d"}.fa-tent-arrow-left-right:before{content:"\e57f"}.fa-gavel:before,.fa-legal:before{content:"\f0e3"}.fa-binoculars:before{content:"\f1e5"}.fa-microphone-slash:before{content:"\f131"}.fa-box-tissue:before{content:"\e05b"}.fa-motorcycle:before{content:"\f21c"}.fa-bell-concierge:before,.fa-concierge-bell:before{content:"\f562"}.fa-pen-ruler:before,.fa-pencil-ruler:before{content:"\f5ae"}.fa-people-arrows-left-right:before,.fa-people-arrows:before{content:"\e068"}.fa-mars-and-venus-burst:before{content:"\e523"}.fa-caret-square-right:before,.fa-square-caret-right:before{content:"\f152"}.fa-cut:before,.fa-scissors:before{content:"\f0c4"}.fa-sun-plant-wilt:before{content:"\e57a"}.fa-toilets-portable:before{content:"\e584"}.fa-hockey-puck:before{content:"\f453"}.fa-table:before{content:"\f0ce"}.fa-magnifying-glass-arrow-right:before{content:"\e521"}.fa-digital-tachograph:before,.fa-tachograph-digital:before{content:"\f566"}.fa-users-slash:before{content:"\e073"}.fa-clover:before{content:"\e139"}.fa-mail-reply:before,.fa-reply:before{content:"\f3e5"}.fa-star-and-crescent:before{content:"\f699"}.fa-house-fire:before{content:"\e50c"}.fa-minus-square:before,.fa-square-minus:before{content:"\f146"}.fa-helicopter:before{content:"\f533"}.fa-compass:before{content:"\f14e"}.fa-caret-square-down:before,.fa-square-caret-down:before{content:"\f150"}.fa-file-circle-question:before{content:"\e4ef"}.fa-laptop-code:before{content:"\f5fc"}.fa-swatchbook:before{content:"\f5c3"}.fa-prescription-bottle:before{content:"\f485"}.fa-bars:before,.fa-navicon:before{content:"\f0c9"}.fa-people-group:before{content:"\e533"}.fa-hourglass-3:before,.fa-hourglass-end:before{content:"\f253"}.fa-heart-broken:before,.fa-heart-crack:before{content:"\f7a9"}.fa-external-link-square-alt:before,.fa-square-up-right:before{content:"\f360"}.fa-face-kiss-beam:before,.fa-kiss-beam:before{content:"\f597"}.fa-film:before{content:"\f008"}.fa-ruler-horizontal:before{content:"\f547"}.fa-people-robbery:before{content:"\e536"}.fa-lightbulb:before{content:"\f0eb"}.fa-caret-left:before{content:"\f0d9"}.fa-circle-exclamation:before,.fa-exclamation-circle:before{content:"\f06a"}.fa-school-circle-xmark:before{content:"\e56d"}.fa-arrow-right-from-bracket:before,.fa-sign-out:before{content:"\f08b"}.fa-chevron-circle-down:before,.fa-circle-chevron-down:before{content:"\f13a"}.fa-unlock-alt:before,.fa-unlock-keyhole:before{content:"\f13e"}.fa-cloud-showers-heavy:before{content:"\f740"}.fa-headphones-alt:before,.fa-headphones-simple:before{content:"\f58f"}.fa-sitemap:before{content:"\f0e8"}.fa-circle-dollar-to-slot:before,.fa-donate:before{content:"\f4b9"}.fa-memory:before{content:"\f538"}.fa-road-spikes:before{content:"\e568"}.fa-fire-burner:before{content:"\e4f1"}.fa-flag:before{content:"\f024"}.fa-hanukiah:before{content:"\f6e6"}.fa-feather:before{content:"\f52d"}.fa-volume-down:before,.fa-volume-low:before{content:"\f027"}.fa-comment-slash:before{content:"\f4b3"}.fa-cloud-sun-rain:before{content:"\f743"}.fa-compress:before{content:"\f066"}.fa-wheat-alt:before,.fa-wheat-awn:before{content:"\e2cd"}.fa-ankh:before{content:"\f644"}.fa-hands-holding-child:before{content:"\e4fa"}.fa-asterisk:before{content:"\2a"}.fa-check-square:before,.fa-square-check:before{content:"\f14a"}.fa-peseta-sign:before{content:"\e221"}.fa-header:before,.fa-heading:before{content:"\f1dc"}.fa-ghost:before{content:"\f6e2"}.fa-list-squares:before,.fa-list:before{content:"\f03a"}.fa-phone-square-alt:before,.fa-square-phone-flip:before{content:"\f87b"}.fa-cart-plus:before{content:"\f217"}.fa-gamepad:before{content:"\f11b"}.fa-circle-dot:before,.fa-dot-circle:before{content:"\f192"}.fa-dizzy:before,.fa-face-dizzy:before{content:"\f567"}.fa-egg:before{content:"\f7fb"}.fa-house-medical-circle-xmark:before{content:"\e513"}.fa-campground:before{content:"\f6bb"}.fa-folder-plus:before{content:"\f65e"}.fa-futbol-ball:before,.fa-futbol:before,.fa-soccer-ball:before{content:"\f1e3"}.fa-paint-brush:before,.fa-paintbrush:before{content:"\f1fc"}.fa-lock:before{content:"\f023"}.fa-gas-pump:before{content:"\f52f"}.fa-hot-tub-person:before,.fa-hot-tub:before{content:"\f593"}.fa-map-location:before,.fa-map-marked:before{content:"\f59f"}.fa-house-flood-water:before{content:"\e50e"}.fa-tree:before{content:"\f1bb"}.fa-bridge-lock:before{content:"\e4cc"}.fa-sack-dollar:before{content:"\f81d"}.fa-edit:before,.fa-pen-to-square:before{content:"\f044"}.fa-car-side:before{content:"\f5e4"}.fa-share-alt:before,.fa-share-nodes:before{content:"\f1e0"}.fa-heart-circle-minus:before{content:"\e4ff"}.fa-hourglass-2:before,.fa-hourglass-half:before{content:"\f252"}.fa-microscope:before{content:"\f610"}.fa-sink:before{content:"\e06d"}.fa-bag-shopping:before,.fa-shopping-bag:before{content:"\f290"}.fa-arrow-down-z-a:before,.fa-sort-alpha-desc:before,.fa-sort-alpha-down-alt:before{content:"\f881"}.fa-mitten:before{content:"\f7b5"}.fa-person-rays:before{content:"\e54d"}.fa-users:before{content:"\f0c0"}.fa-eye-slash:before{content:"\f070"}.fa-flask-vial:before{content:"\e4f3"}.fa-hand-paper:before,.fa-hand:before{content:"\f256"}.fa-om:before{content:"\f679"}.fa-worm:before{content:"\e599"}.fa-house-circle-xmark:before{content:"\e50b"}.fa-plug:before{content:"\f1e6"}.fa-chevron-up:before{content:"\f077"}.fa-hand-spock:before{content:"\f259"}.fa-stopwatch:before{content:"\f2f2"}.fa-face-kiss:before,.fa-kiss:before{content:"\f596"}.fa-bridge-circle-xmark:before{content:"\e4cb"}.fa-face-grin-tongue:before,.fa-grin-tongue:before{content:"\f589"}.fa-chess-bishop:before{content:"\f43a"}.fa-face-grin-wink:before,.fa-grin-wink:before{content:"\f58c"}.fa-deaf:before,.fa-deafness:before,.fa-ear-deaf:before,.fa-hard-of-hearing:before{content:"\f2a4"}.fa-road-circle-check:before{content:"\e564"}.fa-dice-five:before{content:"\f523"}.fa-rss-square:before,.fa-square-rss:before{content:"\f143"}.fa-land-mine-on:before{content:"\e51b"}.fa-i-cursor:before{content:"\f246"}.fa-stamp:before{content:"\f5bf"}.fa-stairs:before{content:"\e289"}.fa-i:before{content:"\49"}.fa-hryvnia-sign:before,.fa-hryvnia:before{content:"\f6f2"}.fa-pills:before{content:"\f484"}.fa-face-grin-wide:before,.fa-grin-alt:before{content:"\f581"}.fa-tooth:before{content:"\f5c9"}.fa-v:before{content:"\56"}.fa-bangladeshi-taka-sign:before{content:"\e2e6"}.fa-bicycle:before{content:"\f206"}.fa-rod-asclepius:before,.fa-rod-snake:before,.fa-staff-aesculapius:before,.fa-staff-snake:before{content:"\e579"}.fa-head-side-cough-slash:before{content:"\e062"}.fa-ambulance:before,.fa-truck-medical:before{content:"\f0f9"}.fa-wheat-awn-circle-exclamation:before{content:"\e598"}.fa-snowman:before{content:"\f7d0"}.fa-mortar-pestle:before{content:"\f5a7"}.fa-road-barrier:before{content:"\e562"}.fa-school:before{content:"\f549"}.fa-igloo:before{content:"\f7ae"}.fa-joint:before{content:"\f595"}.fa-angle-right:before{content:"\f105"}.fa-horse:before{content:"\f6f0"}.fa-q:before{content:"\51"}.fa-g:before{content:"\47"}.fa-notes-medical:before{content:"\f481"}.fa-temperature-2:before,.fa-temperature-half:before,.fa-thermometer-2:before,.fa-thermometer-half:before{content:"\f2c9"}.fa-dong-sign:before{content:"\e169"}.fa-capsules:before{content:"\f46b"}.fa-poo-bolt:before,.fa-poo-storm:before{content:"\f75a"}.fa-face-frown-open:before,.fa-frown-open:before{content:"\f57a"}.fa-hand-point-up:before{content:"\f0a6"}.fa-money-bill:before{content:"\f0d6"}.fa-bookmark:before{content:"\f02e"}.fa-align-justify:before{content:"\f039"}.fa-umbrella-beach:before{content:"\f5ca"}.fa-helmet-un:before{content:"\e503"}.fa-bullseye:before{content:"\f140"}.fa-bacon:before{content:"\f7e5"}.fa-hand-point-down:before{content:"\f0a7"}.fa-arrow-up-from-bracket:before{content:"\e09a"}.fa-folder-blank:before,.fa-folder:before{content:"\f07b"}.fa-file-medical-alt:before,.fa-file-waveform:before{content:"\f478"}.fa-radiation:before{content:"\f7b9"}.fa-chart-simple:before{content:"\e473"}.fa-mars-stroke:before{content:"\f229"}.fa-vial:before{content:"\f492"}.fa-dashboard:before,.fa-gauge-med:before,.fa-gauge:before,.fa-tachometer-alt-average:before{content:"\f624"}.fa-magic-wand-sparkles:before,.fa-wand-magic-sparkles:before{content:"\e2ca"}.fa-e:before{content:"\45"}.fa-pen-alt:before,.fa-pen-clip:before{content:"\f305"}.fa-bridge-circle-exclamation:before{content:"\e4ca"}.fa-user:before{content:"\f007"}.fa-school-circle-check:before{content:"\e56b"}.fa-dumpster:before{content:"\f793"}.fa-shuttle-van:before,.fa-van-shuttle:before{content:"\f5b6"}.fa-building-user:before{content:"\e4da"}.fa-caret-square-left:before,.fa-square-caret-left:before{content:"\f191"}.fa-highlighter:before{content:"\f591"}.fa-key:before{content:"\f084"}.fa-bullhorn:before{content:"\f0a1"}.fa-globe:before{content:"\f0ac"}.fa-synagogue:before{content:"\f69b"}.fa-person-half-dress:before{content:"\e548"}.fa-road-bridge:before{content:"\e563"}.fa-location-arrow:before{content:"\f124"}.fa-c:before{content:"\43"}.fa-tablet-button:before{content:"\f10a"}.fa-building-lock:before{content:"\e4d6"}.fa-pizza-slice:before{content:"\f818"}.fa-money-bill-wave:before{content:"\f53a"}.fa-area-chart:before,.fa-chart-area:before{content:"\f1fe"}.fa-house-flag:before{content:"\e50d"}.fa-person-circle-minus:before{content:"\e540"}.fa-ban:before,.fa-cancel:before{content:"\f05e"}.fa-camera-rotate:before{content:"\e0d8"}.fa-air-freshener:before,.fa-spray-can-sparkles:before{content:"\f5d0"}.fa-star:before{content:"\f005"}.fa-repeat:before{content:"\f363"}.fa-cross:before{content:"\f654"}.fa-box:before{content:"\f466"}.fa-venus-mars:before{content:"\f228"}.fa-arrow-pointer:before,.fa-mouse-pointer:before{content:"\f245"}.fa-expand-arrows-alt:before,.fa-maximize:before{content:"\f31e"}.fa-charging-station:before{content:"\f5e7"}.fa-shapes:before,.fa-triangle-circle-square:before{content:"\f61f"}.fa-random:before,.fa-shuffle:before{content:"\f074"}.fa-person-running:before,.fa-running:before{content:"\f70c"}.fa-mobile-retro:before{content:"\e527"}.fa-grip-lines-vertical:before{content:"\f7a5"}.fa-spider:before{content:"\f717"}.fa-hands-bound:before{content:"\e4f9"}.fa-file-invoice-dollar:before{content:"\f571"}.fa-plane-circle-exclamation:before{content:"\e556"}.fa-x-ray:before{content:"\f497"}.fa-spell-check:before{content:"\f891"}.fa-slash:before{content:"\f715"}.fa-computer-mouse:before,.fa-mouse:before{content:"\f8cc"}.fa-arrow-right-to-bracket:before,.fa-sign-in:before{content:"\f090"}.fa-shop-slash:before,.fa-store-alt-slash:before{content:"\e070"}.fa-server:before{content:"\f233"}.fa-virus-covid-slash:before{content:"\e4a9"}.fa-shop-lock:before{content:"\e4a5"}.fa-hourglass-1:before,.fa-hourglass-start:before{content:"\f251"}.fa-blender-phone:before{content:"\f6b6"}.fa-building-wheat:before{content:"\e4db"}.fa-person-breastfeeding:before{content:"\e53a"}.fa-right-to-bracket:before,.fa-sign-in-alt:before{content:"\f2f6"}.fa-venus:before{content:"\f221"}.fa-passport:before{content:"\f5ab"}.fa-heart-pulse:before,.fa-heartbeat:before{content:"\f21e"}.fa-people-carry-box:before,.fa-people-carry:before{content:"\f4ce"}.fa-temperature-high:before{content:"\f769"}.fa-microchip:before{content:"\f2db"}.fa-crown:before{content:"\f521"}.fa-weight-hanging:before{content:"\f5cd"}.fa-xmarks-lines:before{content:"\e59a"}.fa-file-prescription:before{content:"\f572"}.fa-weight-scale:before,.fa-weight:before{content:"\f496"}.fa-user-friends:before,.fa-user-group:before{content:"\f500"}.fa-arrow-up-a-z:before,.fa-sort-alpha-up:before{content:"\f15e"}.fa-chess-knight:before{content:"\f441"}.fa-face-laugh-squint:before,.fa-laugh-squint:before{content:"\f59b"}.fa-wheelchair:before{content:"\f193"}.fa-arrow-circle-up:before,.fa-circle-arrow-up:before{content:"\f0aa"}.fa-toggle-on:before{content:"\f205"}.fa-person-walking:before,.fa-walking:before{content:"\f554"}.fa-l:before{content:"\4c"}.fa-fire:before{content:"\f06d"}.fa-bed-pulse:before,.fa-procedures:before{content:"\f487"}.fa-shuttle-space:before,.fa-space-shuttle:before{content:"\f197"}.fa-face-laugh:before,.fa-laugh:before{content:"\f599"}.fa-folder-open:before{content:"\f07c"}.fa-heart-circle-plus:before{content:"\e500"}.fa-code-fork:before{content:"\e13b"}.fa-city:before{content:"\f64f"}.fa-microphone-alt:before,.fa-microphone-lines:before{content:"\f3c9"}.fa-pepper-hot:before{content:"\f816"}.fa-unlock:before{content:"\f09c"}.fa-colon-sign:before{content:"\e140"}.fa-headset:before{content:"\f590"}.fa-store-slash:before{content:"\e071"}.fa-road-circle-xmark:before{content:"\e566"}.fa-user-minus:before{content:"\f503"}.fa-mars-stroke-up:before,.fa-mars-stroke-v:before{content:"\f22a"}.fa-champagne-glasses:before,.fa-glass-cheers:before{content:"\f79f"}.fa-clipboard:before{content:"\f328"}.fa-house-circle-exclamation:before{content:"\e50a"}.fa-file-arrow-up:before,.fa-file-upload:before{content:"\f574"}.fa-wifi-3:before,.fa-wifi-strong:before,.fa-wifi:before{content:"\f1eb"}.fa-bath:before,.fa-bathtub:before{content:"\f2cd"}.fa-underline:before{content:"\f0cd"}.fa-user-edit:before,.fa-user-pen:before{content:"\f4ff"}.fa-signature:before{content:"\f5b7"}.fa-stroopwafel:before{content:"\f551"}.fa-bold:before{content:"\f032"}.fa-anchor-lock:before{content:"\e4ad"}.fa-building-ngo:before{content:"\e4d7"}.fa-manat-sign:before{content:"\e1d5"}.fa-not-equal:before{content:"\f53e"}.fa-border-style:before,.fa-border-top-left:before{content:"\f853"}.fa-map-location-dot:before,.fa-map-marked-alt:before{content:"\f5a0"}.fa-jedi:before{content:"\f669"}.fa-poll:before,.fa-square-poll-vertical:before{content:"\f681"}.fa-mug-hot:before{content:"\f7b6"}.fa-battery-car:before,.fa-car-battery:before{content:"\f5df"}.fa-gift:before{content:"\f06b"}.fa-dice-two:before{content:"\f528"}.fa-chess-queen:before{content:"\f445"}.fa-glasses:before{content:"\f530"}.fa-chess-board:before{content:"\f43c"}.fa-building-circle-check:before{content:"\e4d2"}.fa-person-chalkboard:before{content:"\e53d"}.fa-mars-stroke-h:before,.fa-mars-stroke-right:before{content:"\f22b"}.fa-hand-back-fist:before,.fa-hand-rock:before{content:"\f255"}.fa-caret-square-up:before,.fa-square-caret-up:before{content:"\f151"}.fa-cloud-showers-water:before{content:"\e4e4"}.fa-bar-chart:before,.fa-chart-bar:before{content:"\f080"}.fa-hands-bubbles:before,.fa-hands-wash:before{content:"\e05e"}.fa-less-than-equal:before{content:"\f537"}.fa-train:before{content:"\f238"}.fa-eye-low-vision:before,.fa-low-vision:before{content:"\f2a8"}.fa-crow:before{content:"\f520"}.fa-sailboat:before{content:"\e445"}.fa-window-restore:before{content:"\f2d2"}.fa-plus-square:before,.fa-square-plus:before{content:"\f0fe"}.fa-torii-gate:before{content:"\f6a1"}.fa-frog:before{content:"\f52e"}.fa-bucket:before{content:"\e4cf"}.fa-image:before{content:"\f03e"}.fa-microphone:before{content:"\f130"}.fa-cow:before{content:"\f6c8"}.fa-caret-up:before{content:"\f0d8"}.fa-screwdriver:before{content:"\f54a"}.fa-folder-closed:before{content:"\e185"}.fa-house-tsunami:before{content:"\e515"}.fa-square-nfi:before{content:"\e576"}.fa-arrow-up-from-ground-water:before{content:"\e4b5"}.fa-glass-martini-alt:before,.fa-martini-glass:before{content:"\f57b"}.fa-rotate-back:before,.fa-rotate-backward:before,.fa-rotate-left:before,.fa-undo-alt:before{content:"\f2ea"}.fa-columns:before,.fa-table-columns:before{content:"\f0db"}.fa-lemon:before{content:"\f094"}.fa-head-side-mask:before{content:"\e063"}.fa-handshake:before{content:"\f2b5"}.fa-gem:before{content:"\f3a5"}.fa-dolly-box:before,.fa-dolly:before{content:"\f472"}.fa-smoking:before{content:"\f48d"}.fa-compress-arrows-alt:before,.fa-minimize:before{content:"\f78c"}.fa-monument:before{content:"\f5a6"}.fa-snowplow:before{content:"\f7d2"}.fa-angle-double-right:before,.fa-angles-right:before{content:"\f101"}.fa-cannabis:before{content:"\f55f"}.fa-circle-play:before,.fa-play-circle:before{content:"\f144"}.fa-tablets:before{content:"\f490"}.fa-ethernet:before{content:"\f796"}.fa-eur:before,.fa-euro-sign:before,.fa-euro:before{content:"\f153"}.fa-chair:before{content:"\f6c0"}.fa-check-circle:before,.fa-circle-check:before{content:"\f058"}.fa-circle-stop:before,.fa-stop-circle:before{content:"\f28d"}.fa-compass-drafting:before,.fa-drafting-compass:before{content:"\f568"}.fa-plate-wheat:before{content:"\e55a"}.fa-icicles:before{content:"\f7ad"}.fa-person-shelter:before{content:"\e54f"}.fa-neuter:before{content:"\f22c"}.fa-id-badge:before{content:"\f2c1"}.fa-marker:before{content:"\f5a1"}.fa-face-laugh-beam:before,.fa-laugh-beam:before{content:"\f59a"}.fa-helicopter-symbol:before{content:"\e502"}.fa-universal-access:before{content:"\f29a"}.fa-chevron-circle-up:before,.fa-circle-chevron-up:before{content:"\f139"}.fa-lari-sign:before{content:"\e1c8"}.fa-volcano:before{content:"\f770"}.fa-person-walking-dashed-line-arrow-right:before{content:"\e553"}.fa-gbp:before,.fa-pound-sign:before,.fa-sterling-sign:before{content:"\f154"}.fa-viruses:before{content:"\e076"}.fa-square-person-confined:before{content:"\e577"}.fa-user-tie:before{content:"\f508"}.fa-arrow-down-long:before,.fa-long-arrow-down:before{content:"\f175"}.fa-tent-arrow-down-to-line:before{content:"\e57e"}.fa-certificate:before{content:"\f0a3"}.fa-mail-reply-all:before,.fa-reply-all:before{content:"\f122"}.fa-suitcase:before{content:"\f0f2"}.fa-person-skating:before,.fa-skating:before{content:"\f7c5"}.fa-filter-circle-dollar:before,.fa-funnel-dollar:before{content:"\f662"}.fa-camera-retro:before{content:"\f083"}.fa-arrow-circle-down:before,.fa-circle-arrow-down:before{content:"\f0ab"}.fa-arrow-right-to-file:before,.fa-file-import:before{content:"\f56f"}.fa-external-link-square:before,.fa-square-arrow-up-right:before{content:"\f14c"}.fa-box-open:before{content:"\f49e"}.fa-scroll:before{content:"\f70e"}.fa-spa:before{content:"\f5bb"}.fa-location-pin-lock:before{content:"\e51f"}.fa-pause:before{content:"\f04c"}.fa-hill-avalanche:before{content:"\e507"}.fa-temperature-0:before,.fa-temperature-empty:before,.fa-thermometer-0:before,.fa-thermometer-empty:before{content:"\f2cb"}.fa-bomb:before{content:"\f1e2"}.fa-registered:before{content:"\f25d"}.fa-address-card:before,.fa-contact-card:before,.fa-vcard:before{content:"\f2bb"}.fa-balance-scale-right:before,.fa-scale-unbalanced-flip:before{content:"\f516"}.fa-subscript:before{content:"\f12c"}.fa-diamond-turn-right:before,.fa-directions:before{content:"\f5eb"}.fa-burst:before{content:"\e4dc"}.fa-house-laptop:before,.fa-laptop-house:before{content:"\e066"}.fa-face-tired:before,.fa-tired:before{content:"\f5c8"}.fa-money-bills:before{content:"\e1f3"}.fa-smog:before{content:"\f75f"}.fa-crutch:before{content:"\f7f7"}.fa-cloud-arrow-up:before,.fa-cloud-upload-alt:before,.fa-cloud-upload:before{content:"\f0ee"}.fa-palette:before{content:"\f53f"}.fa-arrows-turn-right:before{content:"\e4c0"}.fa-vest:before{content:"\e085"}.fa-ferry:before{content:"\e4ea"}.fa-arrows-down-to-people:before{content:"\e4b9"}.fa-seedling:before,.fa-sprout:before{content:"\f4d8"}.fa-arrows-alt-h:before,.fa-left-right:before{content:"\f337"}.fa-boxes-packing:before{content:"\e4c7"}.fa-arrow-circle-left:before,.fa-circle-arrow-left:before{content:"\f0a8"}.fa-group-arrows-rotate:before{content:"\e4f6"}.fa-bowl-food:before{content:"\e4c6"}.fa-candy-cane:before{content:"\f786"}.fa-arrow-down-wide-short:before,.fa-sort-amount-asc:before,.fa-sort-amount-down:before{content:"\f160"}.fa-cloud-bolt:before,.fa-thunderstorm:before{content:"\f76c"}.fa-remove-format:before,.fa-text-slash:before{content:"\f87d"}.fa-face-smile-wink:before,.fa-smile-wink:before{content:"\f4da"}.fa-file-word:before{content:"\f1c2"}.fa-file-powerpoint:before{content:"\f1c4"}.fa-arrows-h:before,.fa-arrows-left-right:before{content:"\f07e"}.fa-house-lock:before{content:"\e510"}.fa-cloud-arrow-down:before,.fa-cloud-download-alt:before,.fa-cloud-download:before{content:"\f0ed"}.fa-children:before{content:"\e4e1"}.fa-blackboard:before,.fa-chalkboard:before{content:"\f51b"}.fa-user-alt-slash:before,.fa-user-large-slash:before{content:"\f4fa"}.fa-envelope-open:before{content:"\f2b6"}.fa-handshake-alt-slash:before,.fa-handshake-simple-slash:before{content:"\e05f"}.fa-mattress-pillow:before{content:"\e525"}.fa-guarani-sign:before{content:"\e19a"}.fa-arrows-rotate:before,.fa-refresh:before,.fa-sync:before{content:"\f021"}.fa-fire-extinguisher:before{content:"\f134"}.fa-cruzeiro-sign:before{content:"\e152"}.fa-greater-than-equal:before{content:"\f532"}.fa-shield-alt:before,.fa-shield-halved:before{content:"\f3ed"}.fa-atlas:before,.fa-book-atlas:before{content:"\f558"}.fa-virus:before{content:"\e074"}.fa-envelope-circle-check:before{content:"\e4e8"}.fa-layer-group:before{content:"\f5fd"}.fa-arrows-to-dot:before{content:"\e4be"}.fa-archway:before{content:"\f557"}.fa-heart-circle-check:before{content:"\e4fd"}.fa-house-chimney-crack:before,.fa-house-damage:before{content:"\f6f1"}.fa-file-archive:before,.fa-file-zipper:before{content:"\f1c6"}.fa-square:before{content:"\f0c8"}.fa-glass-martini:before,.fa-martini-glass-empty:before{content:"\f000"}.fa-couch:before{content:"\f4b8"}.fa-cedi-sign:before{content:"\e0df"}.fa-italic:before{content:"\f033"}.fa-table-cells-column-lock:before{content:"\e678"}.fa-church:before{content:"\f51d"}.fa-comments-dollar:before{content:"\f653"}.fa-democrat:before{content:"\f747"}.fa-z:before{content:"\5a"}.fa-person-skiing:before,.fa-skiing:before{content:"\f7c9"}.fa-road-lock:before{content:"\e567"}.fa-a:before{content:"\41"}.fa-temperature-arrow-down:before,.fa-temperature-down:before{content:"\e03f"}.fa-feather-alt:before,.fa-feather-pointed:before{content:"\f56b"}.fa-p:before{content:"\50"}.fa-snowflake:before{content:"\f2dc"}.fa-newspaper:before{content:"\f1ea"}.fa-ad:before,.fa-rectangle-ad:before{content:"\f641"}.fa-arrow-circle-right:before,.fa-circle-arrow-right:before{content:"\f0a9"}.fa-filter-circle-xmark:before{content:"\e17b"}.fa-locust:before{content:"\e520"}.fa-sort:before,.fa-unsorted:before{content:"\f0dc"}.fa-list-1-2:before,.fa-list-numeric:before,.fa-list-ol:before{content:"\f0cb"}.fa-person-dress-burst:before{content:"\e544"}.fa-money-check-alt:before,.fa-money-check-dollar:before{content:"\f53d"}.fa-vector-square:before{content:"\f5cb"}.fa-bread-slice:before{content:"\f7ec"}.fa-language:before{content:"\f1ab"}.fa-face-kiss-wink-heart:before,.fa-kiss-wink-heart:before{content:"\f598"}.fa-filter:before{content:"\f0b0"}.fa-question:before{content:"\3f"}.fa-file-signature:before{content:"\f573"}.fa-arrows-alt:before,.fa-up-down-left-right:before{content:"\f0b2"}.fa-house-chimney-user:before{content:"\e065"}.fa-hand-holding-heart:before{content:"\f4be"}.fa-puzzle-piece:before{content:"\f12e"}.fa-money-check:before{content:"\f53c"}.fa-star-half-alt:before,.fa-star-half-stroke:before{content:"\f5c0"}.fa-code:before{content:"\f121"}.fa-glass-whiskey:before,.fa-whiskey-glass:before{content:"\f7a0"}.fa-building-circle-exclamation:before{content:"\e4d3"}.fa-magnifying-glass-chart:before{content:"\e522"}.fa-arrow-up-right-from-square:before,.fa-external-link:before{content:"\f08e"}.fa-cubes-stacked:before{content:"\e4e6"}.fa-krw:before,.fa-won-sign:before,.fa-won:before{content:"\f159"}.fa-virus-covid:before{content:"\e4a8"}.fa-austral-sign:before{content:"\e0a9"}.fa-f:before{content:"\46"}.fa-leaf:before{content:"\f06c"}.fa-road:before{content:"\f018"}.fa-cab:before,.fa-taxi:before{content:"\f1ba"}.fa-person-circle-plus:before{content:"\e541"}.fa-chart-pie:before,.fa-pie-chart:before{content:"\f200"}.fa-bolt-lightning:before{content:"\e0b7"}.fa-sack-xmark:before{content:"\e56a"}.fa-file-excel:before{content:"\f1c3"}.fa-file-contract:before{content:"\f56c"}.fa-fish-fins:before{content:"\e4f2"}.fa-building-flag:before{content:"\e4d5"}.fa-face-grin-beam:before,.fa-grin-beam:before{content:"\f582"}.fa-object-ungroup:before{content:"\f248"}.fa-poop:before{content:"\f619"}.fa-location-pin:before,.fa-map-marker:before{content:"\f041"}.fa-kaaba:before{content:"\f66b"}.fa-toilet-paper:before{content:"\f71e"}.fa-hard-hat:before,.fa-hat-hard:before,.fa-helmet-safety:before{content:"\f807"}.fa-eject:before{content:"\f052"}.fa-arrow-alt-circle-right:before,.fa-circle-right:before{content:"\f35a"}.fa-plane-circle-check:before{content:"\e555"}.fa-face-rolling-eyes:before,.fa-meh-rolling-eyes:before{content:"\f5a5"}.fa-object-group:before{content:"\f247"}.fa-chart-line:before,.fa-line-chart:before{content:"\f201"}.fa-mask-ventilator:before{content:"\e524"}.fa-arrow-right:before{content:"\f061"}.fa-map-signs:before,.fa-signs-post:before{content:"\f277"}.fa-cash-register:before{content:"\f788"}.fa-person-circle-question:before{content:"\e542"}.fa-h:before{content:"\48"}.fa-tarp:before{content:"\e57b"}.fa-screwdriver-wrench:before,.fa-tools:before{content:"\f7d9"}.fa-arrows-to-eye:before{content:"\e4bf"}.fa-plug-circle-bolt:before{content:"\e55b"}.fa-heart:before{content:"\f004"}.fa-mars-and-venus:before{content:"\f224"}.fa-home-user:before,.fa-house-user:before{content:"\e1b0"}.fa-dumpster-fire:before{content:"\f794"}.fa-house-crack:before{content:"\e3b1"}.fa-cocktail:before,.fa-martini-glass-citrus:before{content:"\f561"}.fa-face-surprise:before,.fa-surprise:before{content:"\f5c2"}.fa-bottle-water:before{content:"\e4c5"}.fa-circle-pause:before,.fa-pause-circle:before{content:"\f28b"}.fa-toilet-paper-slash:before{content:"\e072"}.fa-apple-alt:before,.fa-apple-whole:before{content:"\f5d1"}.fa-kitchen-set:before{content:"\e51a"}.fa-r:before{content:"\52"}.fa-temperature-1:before,.fa-temperature-quarter:before,.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:"\f2ca"}.fa-cube:before{content:"\f1b2"}.fa-bitcoin-sign:before{content:"\e0b4"}.fa-shield-dog:before{content:"\e573"}.fa-solar-panel:before{content:"\f5ba"}.fa-lock-open:before{content:"\f3c1"}.fa-elevator:before{content:"\e16d"}.fa-money-bill-transfer:before{content:"\e528"}.fa-money-bill-trend-up:before{content:"\e529"}.fa-house-flood-water-circle-arrow-right:before{content:"\e50f"}.fa-poll-h:before,.fa-square-poll-horizontal:before{content:"\f682"}.fa-circle:before{content:"\f111"}.fa-backward-fast:before,.fa-fast-backward:before{content:"\f049"}.fa-recycle:before{content:"\f1b8"}.fa-user-astronaut:before{content:"\f4fb"}.fa-plane-slash:before{content:"\e069"}.fa-trademark:before{content:"\f25c"}.fa-basketball-ball:before,.fa-basketball:before{content:"\f434"}.fa-satellite-dish:before{content:"\f7c0"}.fa-arrow-alt-circle-up:before,.fa-circle-up:before{content:"\f35b"}.fa-mobile-alt:before,.fa-mobile-screen-button:before{content:"\f3cd"}.fa-volume-high:before,.fa-volume-up:before{content:"\f028"}.fa-users-rays:before{content:"\e593"}.fa-wallet:before{content:"\f555"}.fa-clipboard-check:before{content:"\f46c"}.fa-file-audio:before{content:"\f1c7"}.fa-burger:before,.fa-hamburger:before{content:"\f805"}.fa-wrench:before{content:"\f0ad"}.fa-bugs:before{content:"\e4d0"}.fa-rupee-sign:before,.fa-rupee:before{content:"\f156"}.fa-file-image:before{content:"\f1c5"}.fa-circle-question:before,.fa-question-circle:before{content:"\f059"}.fa-plane-departure:before{content:"\f5b0"}.fa-handshake-slash:before{content:"\e060"}.fa-book-bookmark:before{content:"\e0bb"}.fa-code-branch:before{content:"\f126"}.fa-hat-cowboy:before{content:"\f8c0"}.fa-bridge:before{content:"\e4c8"}.fa-phone-alt:before,.fa-phone-flip:before{content:"\f879"}.fa-truck-front:before{content:"\e2b7"}.fa-cat:before{content:"\f6be"}.fa-anchor-circle-exclamation:before{content:"\e4ab"}.fa-truck-field:before{content:"\e58d"}.fa-route:before{content:"\f4d7"}.fa-clipboard-question:before{content:"\e4e3"}.fa-panorama:before{content:"\e209"}.fa-comment-medical:before{content:"\f7f5"}.fa-teeth-open:before{content:"\f62f"}.fa-file-circle-minus:before{content:"\e4ed"}.fa-tags:before{content:"\f02c"}.fa-wine-glass:before{content:"\f4e3"}.fa-fast-forward:before,.fa-forward-fast:before{content:"\f050"}.fa-face-meh-blank:before,.fa-meh-blank:before{content:"\f5a4"}.fa-parking:before,.fa-square-parking:before{content:"\f540"}.fa-house-signal:before{content:"\e012"}.fa-bars-progress:before,.fa-tasks-alt:before{content:"\f828"}.fa-faucet-drip:before{content:"\e006"}.fa-cart-flatbed:before,.fa-dolly-flatbed:before{content:"\f474"}.fa-ban-smoking:before,.fa-smoking-ban:before{content:"\f54d"}.fa-terminal:before{content:"\f120"}.fa-mobile-button:before{content:"\f10b"}.fa-house-medical-flag:before{content:"\e514"}.fa-basket-shopping:before,.fa-shopping-basket:before{content:"\f291"}.fa-tape:before{content:"\f4db"}.fa-bus-alt:before,.fa-bus-simple:before{content:"\f55e"}.fa-eye:before{content:"\f06e"}.fa-face-sad-cry:before,.fa-sad-cry:before{content:"\f5b3"}.fa-audio-description:before{content:"\f29e"}.fa-person-military-to-person:before{content:"\e54c"}.fa-file-shield:before{content:"\e4f0"}.fa-user-slash:before{content:"\f506"}.fa-pen:before{content:"\f304"}.fa-tower-observation:before{content:"\e586"}.fa-file-code:before{content:"\f1c9"}.fa-signal-5:before,.fa-signal-perfect:before,.fa-signal:before{content:"\f012"}.fa-bus:before{content:"\f207"}.fa-heart-circle-xmark:before{content:"\e501"}.fa-home-lg:before,.fa-house-chimney:before{content:"\e3af"}.fa-window-maximize:before{content:"\f2d0"}.fa-face-frown:before,.fa-frown:before{content:"\f119"}.fa-prescription:before{content:"\f5b1"}.fa-shop:before,.fa-store-alt:before{content:"\f54f"}.fa-floppy-disk:before,.fa-save:before{content:"\f0c7"}.fa-vihara:before{content:"\f6a7"}.fa-balance-scale-left:before,.fa-scale-unbalanced:before{content:"\f515"}.fa-sort-asc:before,.fa-sort-up:before{content:"\f0de"}.fa-comment-dots:before,.fa-commenting:before{content:"\f4ad"}.fa-plant-wilt:before{content:"\e5aa"}.fa-diamond:before{content:"\f219"}.fa-face-grin-squint:before,.fa-grin-squint:before{content:"\f585"}.fa-hand-holding-dollar:before,.fa-hand-holding-usd:before{content:"\f4c0"}.fa-bacterium:before{content:"\e05a"}.fa-hand-pointer:before{content:"\f25a"}.fa-drum-steelpan:before{content:"\f56a"}.fa-hand-scissors:before{content:"\f257"}.fa-hands-praying:before,.fa-praying-hands:before{content:"\f684"}.fa-arrow-right-rotate:before,.fa-arrow-rotate-forward:before,.fa-arrow-rotate-right:before,.fa-redo:before{content:"\f01e"}.fa-biohazard:before{content:"\f780"}.fa-location-crosshairs:before,.fa-location:before{content:"\f601"}.fa-mars-double:before{content:"\f227"}.fa-child-dress:before{content:"\e59c"}.fa-users-between-lines:before{content:"\e591"}.fa-lungs-virus:before{content:"\e067"}.fa-face-grin-tears:before,.fa-grin-tears:before{content:"\f588"}.fa-phone:before{content:"\f095"}.fa-calendar-times:before,.fa-calendar-xmark:before{content:"\f273"}.fa-child-reaching:before{content:"\e59d"}.fa-head-side-virus:before{content:"\e064"}.fa-user-cog:before,.fa-user-gear:before{content:"\f4fe"}.fa-arrow-up-1-9:before,.fa-sort-numeric-up:before{content:"\f163"}.fa-door-closed:before{content:"\f52a"}.fa-shield-virus:before{content:"\e06c"}.fa-dice-six:before{content:"\f526"}.fa-mosquito-net:before{content:"\e52c"}.fa-bridge-water:before{content:"\e4ce"}.fa-person-booth:before{content:"\f756"}.fa-text-width:before{content:"\f035"}.fa-hat-wizard:before{content:"\f6e8"}.fa-pen-fancy:before{content:"\f5ac"}.fa-digging:before,.fa-person-digging:before{content:"\f85e"}.fa-trash:before{content:"\f1f8"}.fa-gauge-simple-med:before,.fa-gauge-simple:before,.fa-tachometer-average:before{content:"\f629"}.fa-book-medical:before{content:"\f7e6"}.fa-poo:before{content:"\f2fe"}.fa-quote-right-alt:before,.fa-quote-right:before{content:"\f10e"}.fa-shirt:before,.fa-t-shirt:before,.fa-tshirt:before{content:"\f553"}.fa-cubes:before{content:"\f1b3"}.fa-divide:before{content:"\f529"}.fa-tenge-sign:before,.fa-tenge:before{content:"\f7d7"}.fa-headphones:before{content:"\f025"}.fa-hands-holding:before{content:"\f4c2"}.fa-hands-clapping:before{content:"\e1a8"}.fa-republican:before{content:"\f75e"}.fa-arrow-left:before{content:"\f060"}.fa-person-circle-xmark:before{content:"\e543"}.fa-ruler:before{content:"\f545"}.fa-align-left:before{content:"\f036"}.fa-dice-d6:before{content:"\f6d1"}.fa-restroom:before{content:"\f7bd"}.fa-j:before{content:"\4a"}.fa-users-viewfinder:before{content:"\e595"}.fa-file-video:before{content:"\f1c8"}.fa-external-link-alt:before,.fa-up-right-from-square:before{content:"\f35d"}.fa-table-cells:before,.fa-th:before{content:"\f00a"}.fa-file-pdf:before{content:"\f1c1"}.fa-bible:before,.fa-book-bible:before{content:"\f647"}.fa-o:before{content:"\4f"}.fa-medkit:before,.fa-suitcase-medical:before{content:"\f0fa"}.fa-user-secret:before{content:"\f21b"}.fa-otter:before{content:"\f700"}.fa-female:before,.fa-person-dress:before{content:"\f182"}.fa-comment-dollar:before{content:"\f651"}.fa-briefcase-clock:before,.fa-business-time:before{content:"\f64a"}.fa-table-cells-large:before,.fa-th-large:before{content:"\f009"}.fa-book-tanakh:before,.fa-tanakh:before{content:"\f827"}.fa-phone-volume:before,.fa-volume-control-phone:before{content:"\f2a0"}.fa-hat-cowboy-side:before{content:"\f8c1"}.fa-clipboard-user:before{content:"\f7f3"}.fa-child:before{content:"\f1ae"}.fa-lira-sign:before{content:"\f195"}.fa-satellite:before{content:"\f7bf"}.fa-plane-lock:before{content:"\e558"}.fa-tag:before{content:"\f02b"}.fa-comment:before{content:"\f075"}.fa-birthday-cake:before,.fa-cake-candles:before,.fa-cake:before{content:"\f1fd"}.fa-envelope:before{content:"\f0e0"}.fa-angle-double-up:before,.fa-angles-up:before{content:"\f102"}.fa-paperclip:before{content:"\f0c6"}.fa-arrow-right-to-city:before{content:"\e4b3"}.fa-ribbon:before{content:"\f4d6"}.fa-lungs:before{content:"\f604"}.fa-arrow-up-9-1:before,.fa-sort-numeric-up-alt:before{content:"\f887"}.fa-litecoin-sign:before{content:"\e1d3"}.fa-border-none:before{content:"\f850"}.fa-circle-nodes:before{content:"\e4e2"}.fa-parachute-box:before{content:"\f4cd"}.fa-indent:before{content:"\f03c"}.fa-truck-field-un:before{content:"\e58e"}.fa-hourglass-empty:before,.fa-hourglass:before{content:"\f254"}.fa-mountain:before{content:"\f6fc"}.fa-user-doctor:before,.fa-user-md:before{content:"\f0f0"}.fa-circle-info:before,.fa-info-circle:before{content:"\f05a"}.fa-cloud-meatball:before{content:"\f73b"}.fa-camera-alt:before,.fa-camera:before{content:"\f030"}.fa-square-virus:before{content:"\e578"}.fa-meteor:before{content:"\f753"}.fa-car-on:before{content:"\e4dd"}.fa-sleigh:before{content:"\f7cc"}.fa-arrow-down-1-9:before,.fa-sort-numeric-asc:before,.fa-sort-numeric-down:before{content:"\f162"}.fa-hand-holding-droplet:before,.fa-hand-holding-water:before{content:"\f4c1"}.fa-water:before{content:"\f773"}.fa-calendar-check:before{content:"\f274"}.fa-braille:before{content:"\f2a1"}.fa-prescription-bottle-alt:before,.fa-prescription-bottle-medical:before{content:"\f486"}.fa-landmark:before{content:"\f66f"}.fa-truck:before{content:"\f0d1"}.fa-crosshairs:before{content:"\f05b"}.fa-person-cane:before{content:"\e53c"}.fa-tent:before{content:"\e57d"}.fa-vest-patches:before{content:"\e086"}.fa-check-double:before{content:"\f560"}.fa-arrow-down-a-z:before,.fa-sort-alpha-asc:before,.fa-sort-alpha-down:before{content:"\f15d"}.fa-money-bill-wheat:before{content:"\e52a"}.fa-cookie:before{content:"\f563"}.fa-arrow-left-rotate:before,.fa-arrow-rotate-back:before,.fa-arrow-rotate-backward:before,.fa-arrow-rotate-left:before,.fa-undo:before{content:"\f0e2"}.fa-hard-drive:before,.fa-hdd:before{content:"\f0a0"}.fa-face-grin-squint-tears:before,.fa-grin-squint-tears:before{content:"\f586"}.fa-dumbbell:before{content:"\f44b"}.fa-list-alt:before,.fa-rectangle-list:before{content:"\f022"}.fa-tarp-droplet:before{content:"\e57c"}.fa-house-medical-circle-check:before{content:"\e511"}.fa-person-skiing-nordic:before,.fa-skiing-nordic:before{content:"\f7ca"}.fa-calendar-plus:before{content:"\f271"}.fa-plane-arrival:before{content:"\f5af"}.fa-arrow-alt-circle-left:before,.fa-circle-left:before{content:"\f359"}.fa-subway:before,.fa-train-subway:before{content:"\f239"}.fa-chart-gantt:before{content:"\e0e4"}.fa-indian-rupee-sign:before,.fa-indian-rupee:before,.fa-inr:before{content:"\e1bc"}.fa-crop-alt:before,.fa-crop-simple:before{content:"\f565"}.fa-money-bill-1:before,.fa-money-bill-alt:before{content:"\f3d1"}.fa-left-long:before,.fa-long-arrow-alt-left:before{content:"\f30a"}.fa-dna:before{content:"\f471"}.fa-virus-slash:before{content:"\e075"}.fa-minus:before,.fa-subtract:before{content:"\f068"}.fa-chess:before{content:"\f439"}.fa-arrow-left-long:before,.fa-long-arrow-left:before{content:"\f177"}.fa-plug-circle-check:before{content:"\e55c"}.fa-street-view:before{content:"\f21d"}.fa-franc-sign:before{content:"\e18f"}.fa-volume-off:before{content:"\f026"}.fa-american-sign-language-interpreting:before,.fa-asl-interpreting:before,.fa-hands-american-sign-language-interpreting:before,.fa-hands-asl-interpreting:before{content:"\f2a3"}.fa-cog:before,.fa-gear:before{content:"\f013"}.fa-droplet-slash:before,.fa-tint-slash:before{content:"\f5c7"}.fa-mosque:before{content:"\f678"}.fa-mosquito:before{content:"\e52b"}.fa-star-of-david:before{content:"\f69a"}.fa-person-military-rifle:before{content:"\e54b"}.fa-cart-shopping:before,.fa-shopping-cart:before{content:"\f07a"}.fa-vials:before{content:"\f493"}.fa-plug-circle-plus:before{content:"\e55f"}.fa-place-of-worship:before{content:"\f67f"}.fa-grip-vertical:before{content:"\f58e"}.fa-arrow-turn-up:before,.fa-level-up:before{content:"\f148"}.fa-u:before{content:"\55"}.fa-square-root-alt:before,.fa-square-root-variable:before{content:"\f698"}.fa-clock-four:before,.fa-clock:before{content:"\f017"}.fa-backward-step:before,.fa-step-backward:before{content:"\f048"}.fa-pallet:before{content:"\f482"}.fa-faucet:before{content:"\e005"}.fa-baseball-bat-ball:before{content:"\f432"}.fa-s:before{content:"\53"}.fa-timeline:before{content:"\e29c"}.fa-keyboard:before{content:"\f11c"}.fa-caret-down:before{content:"\f0d7"}.fa-clinic-medical:before,.fa-house-chimney-medical:before{content:"\f7f2"}.fa-temperature-3:before,.fa-temperature-three-quarters:before,.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:"\f2c8"}.fa-mobile-android-alt:before,.fa-mobile-screen:before{content:"\f3cf"}.fa-plane-up:before{content:"\e22d"}.fa-piggy-bank:before{content:"\f4d3"}.fa-battery-3:before,.fa-battery-half:before{content:"\f242"}.fa-mountain-city:before{content:"\e52e"}.fa-coins:before{content:"\f51e"}.fa-khanda:before{content:"\f66d"}.fa-sliders-h:before,.fa-sliders:before{content:"\f1de"}.fa-folder-tree:before{content:"\f802"}.fa-network-wired:before{content:"\f6ff"}.fa-map-pin:before{content:"\f276"}.fa-hamsa:before{content:"\f665"}.fa-cent-sign:before{content:"\e3f5"}.fa-flask:before{content:"\f0c3"}.fa-person-pregnant:before{content:"\e31e"}.fa-wand-sparkles:before{content:"\f72b"}.fa-ellipsis-v:before,.fa-ellipsis-vertical:before{content:"\f142"}.fa-ticket:before{content:"\f145"}.fa-power-off:before{content:"\f011"}.fa-long-arrow-alt-right:before,.fa-right-long:before{content:"\f30b"}.fa-flag-usa:before{content:"\f74d"}.fa-laptop-file:before{content:"\e51d"}.fa-teletype:before,.fa-tty:before{content:"\f1e4"}.fa-diagram-next:before{content:"\e476"}.fa-person-rifle:before{content:"\e54e"}.fa-house-medical-circle-exclamation:before{content:"\e512"}.fa-closed-captioning:before{content:"\f20a"}.fa-hiking:before,.fa-person-hiking:before{content:"\f6ec"}.fa-venus-double:before{content:"\f226"}.fa-images:before{content:"\f302"}.fa-calculator:before{content:"\f1ec"}.fa-people-pulling:before{content:"\e535"}.fa-n:before{content:"\4e"}.fa-cable-car:before,.fa-tram:before{content:"\f7da"}.fa-cloud-rain:before{content:"\f73d"}.fa-building-circle-xmark:before{content:"\e4d4"}.fa-ship:before{content:"\f21a"}.fa-arrows-down-to-line:before{content:"\e4b8"}.fa-download:before{content:"\f019"}.fa-face-grin:before,.fa-grin:before{content:"\f580"}.fa-backspace:before,.fa-delete-left:before{content:"\f55a"}.fa-eye-dropper-empty:before,.fa-eye-dropper:before,.fa-eyedropper:before{content:"\f1fb"}.fa-file-circle-check:before{content:"\e5a0"}.fa-forward:before{content:"\f04e"}.fa-mobile-android:before,.fa-mobile-phone:before,.fa-mobile:before{content:"\f3ce"}.fa-face-meh:before,.fa-meh:before{content:"\f11a"}.fa-align-center:before{content:"\f037"}.fa-book-dead:before,.fa-book-skull:before{content:"\f6b7"}.fa-drivers-license:before,.fa-id-card:before{content:"\f2c2"}.fa-dedent:before,.fa-outdent:before{content:"\f03b"}.fa-heart-circle-exclamation:before{content:"\e4fe"}.fa-home-alt:before,.fa-home-lg-alt:before,.fa-home:before,.fa-house:before{content:"\f015"}.fa-calendar-week:before{content:"\f784"}.fa-laptop-medical:before{content:"\f812"}.fa-b:before{content:"\42"}.fa-file-medical:before{content:"\f477"}.fa-dice-one:before{content:"\f525"}.fa-kiwi-bird:before{content:"\f535"}.fa-arrow-right-arrow-left:before,.fa-exchange:before{content:"\f0ec"}.fa-redo-alt:before,.fa-rotate-forward:before,.fa-rotate-right:before{content:"\f2f9"}.fa-cutlery:before,.fa-utensils:before{content:"\f2e7"}.fa-arrow-up-wide-short:before,.fa-sort-amount-up:before{content:"\f161"}.fa-mill-sign:before{content:"\e1ed"}.fa-bowl-rice:before{content:"\e2eb"}.fa-skull:before{content:"\f54c"}.fa-broadcast-tower:before,.fa-tower-broadcast:before{content:"\f519"}.fa-truck-pickup:before{content:"\f63c"}.fa-long-arrow-alt-up:before,.fa-up-long:before{content:"\f30c"}.fa-stop:before{content:"\f04d"}.fa-code-merge:before{content:"\f387"}.fa-upload:before{content:"\f093"}.fa-hurricane:before{content:"\f751"}.fa-mound:before{content:"\e52d"}.fa-toilet-portable:before{content:"\e583"}.fa-compact-disc:before{content:"\f51f"}.fa-file-arrow-down:before,.fa-file-download:before{content:"\f56d"}.fa-caravan:before{content:"\f8ff"}.fa-shield-cat:before{content:"\e572"}.fa-bolt:before,.fa-zap:before{content:"\f0e7"}.fa-glass-water:before{content:"\e4f4"}.fa-oil-well:before{content:"\e532"}.fa-vault:before{content:"\e2c5"}.fa-mars:before{content:"\f222"}.fa-toilet:before{content:"\f7d8"}.fa-plane-circle-xmark:before{content:"\e557"}.fa-cny:before,.fa-jpy:before,.fa-rmb:before,.fa-yen-sign:before,.fa-yen:before{content:"\f157"}.fa-rouble:before,.fa-rub:before,.fa-ruble-sign:before,.fa-ruble:before{content:"\f158"}.fa-sun:before{content:"\f185"}.fa-guitar:before{content:"\f7a6"}.fa-face-laugh-wink:before,.fa-laugh-wink:before{content:"\f59c"}.fa-horse-head:before{content:"\f7ab"}.fa-bore-hole:before{content:"\e4c3"}.fa-industry:before{content:"\f275"}.fa-arrow-alt-circle-down:before,.fa-circle-down:before{content:"\f358"}.fa-arrows-turn-to-dots:before{content:"\e4c1"}.fa-florin-sign:before{content:"\e184"}.fa-arrow-down-short-wide:before,.fa-sort-amount-desc:before,.fa-sort-amount-down-alt:before{content:"\f884"}.fa-less-than:before{content:"\3c"}.fa-angle-down:before{content:"\f107"}.fa-car-tunnel:before{content:"\e4de"}.fa-head-side-cough:before{content:"\e061"}.fa-grip-lines:before{content:"\f7a4"}.fa-thumbs-down:before{content:"\f165"}.fa-user-lock:before{content:"\f502"}.fa-arrow-right-long:before,.fa-long-arrow-right:before{content:"\f178"}.fa-anchor-circle-xmark:before{content:"\e4ac"}.fa-ellipsis-h:before,.fa-ellipsis:before{content:"\f141"}.fa-chess-pawn:before{content:"\f443"}.fa-first-aid:before,.fa-kit-medical:before{content:"\f479"}.fa-person-through-window:before{content:"\e5a9"}.fa-toolbox:before{content:"\f552"}.fa-hands-holding-circle:before{content:"\e4fb"}.fa-bug:before{content:"\f188"}.fa-credit-card-alt:before,.fa-credit-card:before{content:"\f09d"}.fa-automobile:before,.fa-car:before{content:"\f1b9"}.fa-hand-holding-hand:before{content:"\e4f7"}.fa-book-open-reader:before,.fa-book-reader:before{content:"\f5da"}.fa-mountain-sun:before{content:"\e52f"}.fa-arrows-left-right-to-line:before{content:"\e4ba"}.fa-dice-d20:before{content:"\f6cf"}.fa-truck-droplet:before{content:"\e58c"}.fa-file-circle-xmark:before{content:"\e5a1"}.fa-temperature-arrow-up:before,.fa-temperature-up:before{content:"\e040"}.fa-medal:before{content:"\f5a2"}.fa-bed:before{content:"\f236"}.fa-h-square:before,.fa-square-h:before{content:"\f0fd"}.fa-podcast:before{content:"\f2ce"}.fa-temperature-4:before,.fa-temperature-full:before,.fa-thermometer-4:before,.fa-thermometer-full:before{content:"\f2c7"}.fa-bell:before{content:"\f0f3"}.fa-superscript:before{content:"\f12b"}.fa-plug-circle-xmark:before{content:"\e560"}.fa-star-of-life:before{content:"\f621"}.fa-phone-slash:before{content:"\f3dd"}.fa-paint-roller:before{content:"\f5aa"}.fa-hands-helping:before,.fa-handshake-angle:before{content:"\f4c4"}.fa-location-dot:before,.fa-map-marker-alt:before{content:"\f3c5"}.fa-file:before{content:"\f15b"}.fa-greater-than:before{content:"\3e"}.fa-person-swimming:before,.fa-swimmer:before{content:"\f5c4"}.fa-arrow-down:before{content:"\f063"}.fa-droplet:before,.fa-tint:before{content:"\f043"}.fa-eraser:before{content:"\f12d"}.fa-earth-america:before,.fa-earth-americas:before,.fa-earth:before,.fa-globe-americas:before{content:"\f57d"}.fa-person-burst:before{content:"\e53b"}.fa-dove:before{content:"\f4ba"}.fa-battery-0:before,.fa-battery-empty:before{content:"\f244"}.fa-socks:before{content:"\f696"}.fa-inbox:before{content:"\f01c"}.fa-section:before{content:"\e447"}.fa-gauge-high:before,.fa-tachometer-alt-fast:before,.fa-tachometer-alt:before{content:"\f625"}.fa-envelope-open-text:before{content:"\f658"}.fa-hospital-alt:before,.fa-hospital-wide:before,.fa-hospital:before{content:"\f0f8"}.fa-wine-bottle:before{content:"\f72f"}.fa-chess-rook:before{content:"\f447"}.fa-bars-staggered:before,.fa-reorder:before,.fa-stream:before{content:"\f550"}.fa-dharmachakra:before{content:"\f655"}.fa-hotdog:before{content:"\f80f"}.fa-blind:before,.fa-person-walking-with-cane:before{content:"\f29d"}.fa-drum:before{content:"\f569"}.fa-ice-cream:before{content:"\f810"}.fa-heart-circle-bolt:before{content:"\e4fc"}.fa-fax:before{content:"\f1ac"}.fa-paragraph:before{content:"\f1dd"}.fa-check-to-slot:before,.fa-vote-yea:before{content:"\f772"}.fa-star-half:before{content:"\f089"}.fa-boxes-alt:before,.fa-boxes-stacked:before,.fa-boxes:before{content:"\f468"}.fa-chain:before,.fa-link:before{content:"\f0c1"}.fa-assistive-listening-systems:before,.fa-ear-listen:before{content:"\f2a2"}.fa-tree-city:before{content:"\e587"}.fa-play:before{content:"\f04b"}.fa-font:before{content:"\f031"}.fa-table-cells-row-lock:before{content:"\e67a"}.fa-rupiah-sign:before{content:"\e23d"}.fa-magnifying-glass:before,.fa-search:before{content:"\f002"}.fa-ping-pong-paddle-ball:before,.fa-table-tennis-paddle-ball:before,.fa-table-tennis:before{content:"\f45d"}.fa-diagnoses:before,.fa-person-dots-from-line:before{content:"\f470"}.fa-trash-can-arrow-up:before,.fa-trash-restore-alt:before{content:"\f82a"}.fa-naira-sign:before{content:"\e1f6"}.fa-cart-arrow-down:before{content:"\f218"}.fa-walkie-talkie:before{content:"\f8ef"}.fa-file-edit:before,.fa-file-pen:before{content:"\f31c"}.fa-receipt:before{content:"\f543"}.fa-pen-square:before,.fa-pencil-square:before,.fa-square-pen:before{content:"\f14b"}.fa-suitcase-rolling:before{content:"\f5c1"}.fa-person-circle-exclamation:before{content:"\e53f"}.fa-chevron-down:before{content:"\f078"}.fa-battery-5:before,.fa-battery-full:before,.fa-battery:before{content:"\f240"}.fa-skull-crossbones:before{content:"\f714"}.fa-code-compare:before{content:"\e13a"}.fa-list-dots:before,.fa-list-ul:before{content:"\f0ca"}.fa-school-lock:before{content:"\e56f"}.fa-tower-cell:before{content:"\e585"}.fa-down-long:before,.fa-long-arrow-alt-down:before{content:"\f309"}.fa-ranking-star:before{content:"\e561"}.fa-chess-king:before{content:"\f43f"}.fa-person-harassing:before{content:"\e549"}.fa-brazilian-real-sign:before{content:"\e46c"}.fa-landmark-alt:before,.fa-landmark-dome:before{content:"\f752"}.fa-arrow-up:before{content:"\f062"}.fa-television:before,.fa-tv-alt:before,.fa-tv:before{content:"\f26c"}.fa-shrimp:before{content:"\e448"}.fa-list-check:before,.fa-tasks:before{content:"\f0ae"}.fa-jug-detergent:before{content:"\e519"}.fa-circle-user:before,.fa-user-circle:before{content:"\f2bd"}.fa-user-shield:before{content:"\f505"}.fa-wind:before{content:"\f72e"}.fa-car-burst:before,.fa-car-crash:before{content:"\f5e1"}.fa-y:before{content:"\59"}.fa-person-snowboarding:before,.fa-snowboarding:before{content:"\f7ce"}.fa-shipping-fast:before,.fa-truck-fast:before{content:"\f48b"}.fa-fish:before{content:"\f578"}.fa-user-graduate:before{content:"\f501"}.fa-adjust:before,.fa-circle-half-stroke:before{content:"\f042"}.fa-clapperboard:before{content:"\e131"}.fa-circle-radiation:before,.fa-radiation-alt:before{content:"\f7ba"}.fa-baseball-ball:before,.fa-baseball:before{content:"\f433"}.fa-jet-fighter-up:before{content:"\e518"}.fa-diagram-project:before,.fa-project-diagram:before{content:"\f542"}.fa-copy:before{content:"\f0c5"}.fa-volume-mute:before,.fa-volume-times:before,.fa-volume-xmark:before{content:"\f6a9"}.fa-hand-sparkles:before{content:"\e05d"}.fa-grip-horizontal:before,.fa-grip:before{content:"\f58d"}.fa-share-from-square:before,.fa-share-square:before{content:"\f14d"}.fa-child-combatant:before,.fa-child-rifle:before{content:"\e4e0"}.fa-gun:before{content:"\e19b"}.fa-phone-square:before,.fa-square-phone:before{content:"\f098"}.fa-add:before,.fa-plus:before{content:"\2b"}.fa-expand:before{content:"\f065"}.fa-computer:before{content:"\e4e5"}.fa-close:before,.fa-multiply:before,.fa-remove:before,.fa-times:before,.fa-xmark:before{content:"\f00d"}.fa-arrows-up-down-left-right:before,.fa-arrows:before{content:"\f047"}.fa-chalkboard-teacher:before,.fa-chalkboard-user:before{content:"\f51c"}.fa-peso-sign:before{content:"\e222"}.fa-building-shield:before{content:"\e4d8"}.fa-baby:before{content:"\f77c"}.fa-users-line:before{content:"\e592"}.fa-quote-left-alt:before,.fa-quote-left:before{content:"\f10d"}.fa-tractor:before{content:"\f722"}.fa-trash-arrow-up:before,.fa-trash-restore:before{content:"\f829"}.fa-arrow-down-up-lock:before{content:"\e4b0"}.fa-lines-leaning:before{content:"\e51e"}.fa-ruler-combined:before{content:"\f546"}.fa-copyright:before{content:"\f1f9"}.fa-equals:before{content:"\3d"}.fa-blender:before{content:"\f517"}.fa-teeth:before{content:"\f62e"}.fa-ils:before,.fa-shekel-sign:before,.fa-shekel:before,.fa-sheqel-sign:before,.fa-sheqel:before{content:"\f20b"}.fa-map:before{content:"\f279"}.fa-rocket:before{content:"\f135"}.fa-photo-film:before,.fa-photo-video:before{content:"\f87c"}.fa-folder-minus:before{content:"\f65d"}.fa-store:before{content:"\f54e"}.fa-arrow-trend-up:before{content:"\e098"}.fa-plug-circle-minus:before{content:"\e55e"}.fa-sign-hanging:before,.fa-sign:before{content:"\f4d9"}.fa-bezier-curve:before{content:"\f55b"}.fa-bell-slash:before{content:"\f1f6"}.fa-tablet-android:before,.fa-tablet:before{content:"\f3fb"}.fa-school-flag:before{content:"\e56e"}.fa-fill:before{content:"\f575"}.fa-angle-up:before{content:"\f106"}.fa-drumstick-bite:before{content:"\f6d7"}.fa-holly-berry:before{content:"\f7aa"}.fa-chevron-left:before{content:"\f053"}.fa-bacteria:before{content:"\e059"}.fa-hand-lizard:before{content:"\f258"}.fa-notdef:before{content:"\e1fe"}.fa-disease:before{content:"\f7fa"}.fa-briefcase-medical:before{content:"\f469"}.fa-genderless:before{content:"\f22d"}.fa-chevron-right:before{content:"\f054"}.fa-retweet:before{content:"\f079"}.fa-car-alt:before,.fa-car-rear:before{content:"\f5de"}.fa-pump-soap:before{content:"\e06b"}.fa-video-slash:before{content:"\f4e2"}.fa-battery-2:before,.fa-battery-quarter:before{content:"\f243"}.fa-radio:before{content:"\f8d7"}.fa-baby-carriage:before,.fa-carriage-baby:before{content:"\f77d"}.fa-traffic-light:before{content:"\f637"}.fa-thermometer:before{content:"\f491"}.fa-vr-cardboard:before{content:"\f729"}.fa-hand-middle-finger:before{content:"\f806"}.fa-percent:before,.fa-percentage:before{content:"\25"}.fa-truck-moving:before{content:"\f4df"}.fa-glass-water-droplet:before{content:"\e4f5"}.fa-display:before{content:"\e163"}.fa-face-smile:before,.fa-smile:before{content:"\f118"}.fa-thumb-tack:before,.fa-thumbtack:before{content:"\f08d"}.fa-trophy:before{content:"\f091"}.fa-person-praying:before,.fa-pray:before{content:"\f683"}.fa-hammer:before{content:"\f6e3"}.fa-hand-peace:before{content:"\f25b"}.fa-rotate:before,.fa-sync-alt:before{content:"\f2f1"}.fa-spinner:before{content:"\f110"}.fa-robot:before{content:"\f544"}.fa-peace:before{content:"\f67c"}.fa-cogs:before,.fa-gears:before{content:"\f085"}.fa-warehouse:before{content:"\f494"}.fa-arrow-up-right-dots:before{content:"\e4b7"}.fa-splotch:before{content:"\f5bc"}.fa-face-grin-hearts:before,.fa-grin-hearts:before{content:"\f584"}.fa-dice-four:before{content:"\f524"}.fa-sim-card:before{content:"\f7c4"}.fa-transgender-alt:before,.fa-transgender:before{content:"\f225"}.fa-mercury:before{content:"\f223"}.fa-arrow-turn-down:before,.fa-level-down:before{content:"\f149"}.fa-person-falling-burst:before{content:"\e547"}.fa-award:before{content:"\f559"}.fa-ticket-alt:before,.fa-ticket-simple:before{content:"\f3ff"}.fa-building:before{content:"\f1ad"}.fa-angle-double-left:before,.fa-angles-left:before{content:"\f100"}.fa-qrcode:before{content:"\f029"}.fa-clock-rotate-left:before,.fa-history:before{content:"\f1da"}.fa-face-grin-beam-sweat:before,.fa-grin-beam-sweat:before{content:"\f583"}.fa-arrow-right-from-file:before,.fa-file-export:before{content:"\f56e"}.fa-shield-blank:before,.fa-shield:before{content:"\f132"}.fa-arrow-up-short-wide:before,.fa-sort-amount-up-alt:before{content:"\f885"}.fa-house-medical:before{content:"\e3b2"}.fa-golf-ball-tee:before,.fa-golf-ball:before{content:"\f450"}.fa-chevron-circle-left:before,.fa-circle-chevron-left:before{content:"\f137"}.fa-house-chimney-window:before{content:"\e00d"}.fa-pen-nib:before{content:"\f5ad"}.fa-tent-arrow-turn-left:before{content:"\e580"}.fa-tents:before{content:"\e582"}.fa-magic:before,.fa-wand-magic:before{content:"\f0d0"}.fa-dog:before{content:"\f6d3"}.fa-carrot:before{content:"\f787"}.fa-moon:before{content:"\f186"}.fa-wine-glass-alt:before,.fa-wine-glass-empty:before{content:"\f5ce"}.fa-cheese:before{content:"\f7ef"}.fa-yin-yang:before{content:"\f6ad"}.fa-music:before{content:"\f001"}.fa-code-commit:before{content:"\f386"}.fa-temperature-low:before{content:"\f76b"}.fa-biking:before,.fa-person-biking:before{content:"\f84a"}.fa-broom:before{content:"\f51a"}.fa-shield-heart:before{content:"\e574"}.fa-gopuram:before{content:"\f664"}.fa-earth-oceania:before,.fa-globe-oceania:before{content:"\e47b"}.fa-square-xmark:before,.fa-times-square:before,.fa-xmark-square:before{content:"\f2d3"}.fa-hashtag:before{content:"\23"}.fa-expand-alt:before,.fa-up-right-and-down-left-from-center:before{content:"\f424"}.fa-oil-can:before{content:"\f613"}.fa-t:before{content:"\54"}.fa-hippo:before{content:"\f6ed"}.fa-chart-column:before{content:"\e0e3"}.fa-infinity:before{content:"\f534"}.fa-vial-circle-check:before{content:"\e596"}.fa-person-arrow-down-to-line:before{content:"\e538"}.fa-voicemail:before{content:"\f897"}.fa-fan:before{content:"\f863"}.fa-person-walking-luggage:before{content:"\e554"}.fa-arrows-alt-v:before,.fa-up-down:before{content:"\f338"}.fa-cloud-moon-rain:before{content:"\f73c"}.fa-calendar:before{content:"\f133"}.fa-trailer:before{content:"\e041"}.fa-bahai:before,.fa-haykal:before{content:"\f666"}.fa-sd-card:before{content:"\f7c2"}.fa-dragon:before{content:"\f6d5"}.fa-shoe-prints:before{content:"\f54b"}.fa-circle-plus:before,.fa-plus-circle:before{content:"\f055"}.fa-face-grin-tongue-wink:before,.fa-grin-tongue-wink:before{content:"\f58b"}.fa-hand-holding:before{content:"\f4bd"}.fa-plug-circle-exclamation:before{content:"\e55d"}.fa-chain-broken:before,.fa-chain-slash:before,.fa-link-slash:before,.fa-unlink:before{content:"\f127"}.fa-clone:before{content:"\f24d"}.fa-person-walking-arrow-loop-left:before{content:"\e551"}.fa-arrow-up-z-a:before,.fa-sort-alpha-up-alt:before{content:"\f882"}.fa-fire-alt:before,.fa-fire-flame-curved:before{content:"\f7e4"}.fa-tornado:before{content:"\f76f"}.fa-file-circle-plus:before{content:"\e494"}.fa-book-quran:before,.fa-quran:before{content:"\f687"}.fa-anchor:before{content:"\f13d"}.fa-border-all:before{content:"\f84c"}.fa-angry:before,.fa-face-angry:before{content:"\f556"}.fa-cookie-bite:before{content:"\f564"}.fa-arrow-trend-down:before{content:"\e097"}.fa-feed:before,.fa-rss:before{content:"\f09e"}.fa-draw-polygon:before{content:"\f5ee"}.fa-balance-scale:before,.fa-scale-balanced:before{content:"\f24e"}.fa-gauge-simple-high:before,.fa-tachometer-fast:before,.fa-tachometer:before{content:"\f62a"}.fa-shower:before{content:"\f2cc"}.fa-desktop-alt:before,.fa-desktop:before{content:"\f390"}.fa-m:before{content:"\4d"}.fa-table-list:before,.fa-th-list:before{content:"\f00b"}.fa-comment-sms:before,.fa-sms:before{content:"\f7cd"}.fa-book:before{content:"\f02d"}.fa-user-plus:before{content:"\f234"}.fa-check:before{content:"\f00c"}.fa-battery-4:before,.fa-battery-three-quarters:before{content:"\f241"}.fa-house-circle-check:before{content:"\e509"}.fa-angle-left:before{content:"\f104"}.fa-diagram-successor:before{content:"\e47a"}.fa-truck-arrow-right:before{content:"\e58b"}.fa-arrows-split-up-and-left:before{content:"\e4bc"}.fa-fist-raised:before,.fa-hand-fist:before{content:"\f6de"}.fa-cloud-moon:before{content:"\f6c3"}.fa-briefcase:before{content:"\f0b1"}.fa-person-falling:before{content:"\e546"}.fa-image-portrait:before,.fa-portrait:before{content:"\f3e0"}.fa-user-tag:before{content:"\f507"}.fa-rug:before{content:"\e569"}.fa-earth-europe:before,.fa-globe-europe:before{content:"\f7a2"}.fa-cart-flatbed-suitcase:before,.fa-luggage-cart:before{content:"\f59d"}.fa-rectangle-times:before,.fa-rectangle-xmark:before,.fa-times-rectangle:before,.fa-window-close:before{content:"\f410"}.fa-baht-sign:before{content:"\e0ac"}.fa-book-open:before{content:"\f518"}.fa-book-journal-whills:before,.fa-journal-whills:before{content:"\f66a"}.fa-handcuffs:before{content:"\e4f8"}.fa-exclamation-triangle:before,.fa-triangle-exclamation:before,.fa-warning:before{content:"\f071"}.fa-database:before{content:"\f1c0"}.fa-mail-forward:before,.fa-share:before{content:"\f064"}.fa-bottle-droplet:before{content:"\e4c4"}.fa-mask-face:before{content:"\e1d7"}.fa-hill-rockslide:before{content:"\e508"}.fa-exchange-alt:before,.fa-right-left:before{content:"\f362"}.fa-paper-plane:before{content:"\f1d8"}.fa-road-circle-exclamation:before{content:"\e565"}.fa-dungeon:before{content:"\f6d9"}.fa-align-right:before{content:"\f038"}.fa-money-bill-1-wave:before,.fa-money-bill-wave-alt:before{content:"\f53b"}.fa-life-ring:before{content:"\f1cd"}.fa-hands:before,.fa-sign-language:before,.fa-signing:before{content:"\f2a7"}.fa-calendar-day:before{content:"\f783"}.fa-ladder-water:before,.fa-swimming-pool:before,.fa-water-ladder:before{content:"\f5c5"}.fa-arrows-up-down:before,.fa-arrows-v:before{content:"\f07d"}.fa-face-grimace:before,.fa-grimace:before{content:"\f57f"}.fa-wheelchair-alt:before,.fa-wheelchair-move:before{content:"\e2ce"}.fa-level-down-alt:before,.fa-turn-down:before{content:"\f3be"}.fa-person-walking-arrow-right:before{content:"\e552"}.fa-envelope-square:before,.fa-square-envelope:before{content:"\f199"}.fa-dice:before{content:"\f522"}.fa-bowling-ball:before{content:"\f436"}.fa-brain:before{content:"\f5dc"}.fa-band-aid:before,.fa-bandage:before{content:"\f462"}.fa-calendar-minus:before{content:"\f272"}.fa-circle-xmark:before,.fa-times-circle:before,.fa-xmark-circle:before{content:"\f057"}.fa-gifts:before{content:"\f79c"}.fa-hotel:before{content:"\f594"}.fa-earth-asia:before,.fa-globe-asia:before{content:"\f57e"}.fa-id-card-alt:before,.fa-id-card-clip:before{content:"\f47f"}.fa-magnifying-glass-plus:before,.fa-search-plus:before{content:"\f00e"}.fa-thumbs-up:before{content:"\f164"}.fa-user-clock:before{content:"\f4fd"}.fa-allergies:before,.fa-hand-dots:before{content:"\f461"}.fa-file-invoice:before{content:"\f570"}.fa-window-minimize:before{content:"\f2d1"}.fa-coffee:before,.fa-mug-saucer:before{content:"\f0f4"}.fa-brush:before{content:"\f55d"}.fa-mask:before{content:"\f6fa"}.fa-magnifying-glass-minus:before,.fa-search-minus:before{content:"\f010"}.fa-ruler-vertical:before{content:"\f548"}.fa-user-alt:before,.fa-user-large:before{content:"\f406"}.fa-train-tram:before{content:"\e5b4"}.fa-user-nurse:before{content:"\f82f"}.fa-syringe:before{content:"\f48e"}.fa-cloud-sun:before{content:"\f6c4"}.fa-stopwatch-20:before{content:"\e06f"}.fa-square-full:before{content:"\f45c"}.fa-magnet:before{content:"\f076"}.fa-jar:before{content:"\e516"}.fa-note-sticky:before,.fa-sticky-note:before{content:"\f249"}.fa-bug-slash:before{content:"\e490"}.fa-arrow-up-from-water-pump:before{content:"\e4b6"}.fa-bone:before{content:"\f5d7"}.fa-user-injured:before{content:"\f728"}.fa-face-sad-tear:before,.fa-sad-tear:before{content:"\f5b4"}.fa-plane:before{content:"\f072"}.fa-tent-arrows-down:before{content:"\e581"}.fa-exclamation:before{content:"\21"}.fa-arrows-spin:before{content:"\e4bb"}.fa-print:before{content:"\f02f"}.fa-try:before,.fa-turkish-lira-sign:before,.fa-turkish-lira:before{content:"\e2bb"}.fa-dollar-sign:before,.fa-dollar:before,.fa-usd:before{content:"\24"}.fa-x:before{content:"\58"}.fa-magnifying-glass-dollar:before,.fa-search-dollar:before{content:"\f688"}.fa-users-cog:before,.fa-users-gear:before{content:"\f509"}.fa-person-military-pointing:before{content:"\e54a"}.fa-bank:before,.fa-building-columns:before,.fa-institution:before,.fa-museum:before,.fa-university:before{content:"\f19c"}.fa-umbrella:before{content:"\f0e9"}.fa-trowel:before{content:"\e589"}.fa-d:before{content:"\44"}.fa-stapler:before{content:"\e5af"}.fa-masks-theater:before,.fa-theater-masks:before{content:"\f630"}.fa-kip-sign:before{content:"\e1c4"}.fa-hand-point-left:before{content:"\f0a5"}.fa-handshake-alt:before,.fa-handshake-simple:before{content:"\f4c6"}.fa-fighter-jet:before,.fa-jet-fighter:before{content:"\f0fb"}.fa-share-alt-square:before,.fa-square-share-nodes:before{content:"\f1e1"}.fa-barcode:before{content:"\f02a"}.fa-plus-minus:before{content:"\e43c"}.fa-video-camera:before,.fa-video:before{content:"\f03d"}.fa-graduation-cap:before,.fa-mortar-board:before{content:"\f19d"}.fa-hand-holding-medical:before{content:"\e05c"}.fa-person-circle-check:before{content:"\e53e"}.fa-level-up-alt:before,.fa-turn-up:before{content:"\f3bf"}
+.fa-sr-only,.fa-sr-only-focusable:not(:focus),.sr-only,.sr-only-focusable:not(:focus){position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;border-width:0}:host,:root{--fa-style-family-brands:"Font Awesome 6 Brands";--fa-font-brands:normal 400 1em/1 "Font Awesome 6 Brands"}@font-face{font-family:"Font Awesome 6 Brands";font-style:normal;font-weight:400;font-display:block;src: url("../webfonts/fa-brands-400.woff2") format("woff2"), url("../webfonts/fa-brands-400.ttf") format("truetype"); }.fa-brands,.fab{font-weight:400}.fa-monero:before{content:"\f3d0"}.fa-hooli:before{content:"\f427"}.fa-yelp:before{content:"\f1e9"}.fa-cc-visa:before{content:"\f1f0"}.fa-lastfm:before{content:"\f202"}.fa-shopware:before{content:"\f5b5"}.fa-creative-commons-nc:before{content:"\f4e8"}.fa-aws:before{content:"\f375"}.fa-redhat:before{content:"\f7bc"}.fa-yoast:before{content:"\f2b1"}.fa-cloudflare:before{content:"\e07d"}.fa-ups:before{content:"\f7e0"}.fa-pixiv:before{content:"\e640"}.fa-wpexplorer:before{content:"\f2de"}.fa-dyalog:before{content:"\f399"}.fa-bity:before{content:"\f37a"}.fa-stackpath:before{content:"\f842"}.fa-buysellads:before{content:"\f20d"}.fa-first-order:before{content:"\f2b0"}.fa-modx:before{content:"\f285"}.fa-guilded:before{content:"\e07e"}.fa-vnv:before{content:"\f40b"}.fa-js-square:before,.fa-square-js:before{content:"\f3b9"}.fa-microsoft:before{content:"\f3ca"}.fa-qq:before{content:"\f1d6"}.fa-orcid:before{content:"\f8d2"}.fa-java:before{content:"\f4e4"}.fa-invision:before{content:"\f7b0"}.fa-creative-commons-pd-alt:before{content:"\f4ed"}.fa-centercode:before{content:"\f380"}.fa-glide-g:before{content:"\f2a6"}.fa-drupal:before{content:"\f1a9"}.fa-jxl:before{content:"\e67b"}.fa-hire-a-helper:before{content:"\f3b0"}.fa-creative-commons-by:before{content:"\f4e7"}.fa-unity:before{content:"\e049"}.fa-whmcs:before{content:"\f40d"}.fa-rocketchat:before{content:"\f3e8"}.fa-vk:before{content:"\f189"}.fa-untappd:before{content:"\f405"}.fa-mailchimp:before{content:"\f59e"}.fa-css3-alt:before{content:"\f38b"}.fa-reddit-square:before,.fa-square-reddit:before{content:"\f1a2"}.fa-vimeo-v:before{content:"\f27d"}.fa-contao:before{content:"\f26d"}.fa-square-font-awesome:before{content:"\e5ad"}.fa-deskpro:before{content:"\f38f"}.fa-brave:before{content:"\e63c"}.fa-sistrix:before{content:"\f3ee"}.fa-instagram-square:before,.fa-square-instagram:before{content:"\e055"}.fa-battle-net:before{content:"\f835"}.fa-the-red-yeti:before{content:"\f69d"}.fa-hacker-news-square:before,.fa-square-hacker-news:before{content:"\f3af"}.fa-edge:before{content:"\f282"}.fa-threads:before{content:"\e618"}.fa-napster:before{content:"\f3d2"}.fa-snapchat-square:before,.fa-square-snapchat:before{content:"\f2ad"}.fa-google-plus-g:before{content:"\f0d5"}.fa-artstation:before{content:"\f77a"}.fa-markdown:before{content:"\f60f"}.fa-sourcetree:before{content:"\f7d3"}.fa-google-plus:before{content:"\f2b3"}.fa-diaspora:before{content:"\f791"}.fa-foursquare:before{content:"\f180"}.fa-stack-overflow:before{content:"\f16c"}.fa-github-alt:before{content:"\f113"}.fa-phoenix-squadron:before{content:"\f511"}.fa-pagelines:before{content:"\f18c"}.fa-algolia:before{content:"\f36c"}.fa-red-river:before{content:"\f3e3"}.fa-creative-commons-sa:before{content:"\f4ef"}.fa-safari:before{content:"\f267"}.fa-google:before{content:"\f1a0"}.fa-font-awesome-alt:before,.fa-square-font-awesome-stroke:before{content:"\f35c"}.fa-atlassian:before{content:"\f77b"}.fa-linkedin-in:before{content:"\f0e1"}.fa-digital-ocean:before{content:"\f391"}.fa-nimblr:before{content:"\f5a8"}.fa-chromecast:before{content:"\f838"}.fa-evernote:before{content:"\f839"}.fa-hacker-news:before{content:"\f1d4"}.fa-creative-commons-sampling:before{content:"\f4f0"}.fa-adversal:before{content:"\f36a"}.fa-creative-commons:before{content:"\f25e"}.fa-watchman-monitoring:before{content:"\e087"}.fa-fonticons:before{content:"\f280"}.fa-weixin:before{content:"\f1d7"}.fa-shirtsinbulk:before{content:"\f214"}.fa-codepen:before{content:"\f1cb"}.fa-git-alt:before{content:"\f841"}.fa-lyft:before{content:"\f3c3"}.fa-rev:before{content:"\f5b2"}.fa-windows:before{content:"\f17a"}.fa-wizards-of-the-coast:before{content:"\f730"}.fa-square-viadeo:before,.fa-viadeo-square:before{content:"\f2aa"}.fa-meetup:before{content:"\f2e0"}.fa-centos:before{content:"\f789"}.fa-adn:before{content:"\f170"}.fa-cloudsmith:before{content:"\f384"}.fa-opensuse:before{content:"\e62b"}.fa-pied-piper-alt:before{content:"\f1a8"}.fa-dribbble-square:before,.fa-square-dribbble:before{content:"\f397"}.fa-codiepie:before{content:"\f284"}.fa-node:before{content:"\f419"}.fa-mix:before{content:"\f3cb"}.fa-steam:before{content:"\f1b6"}.fa-cc-apple-pay:before{content:"\f416"}.fa-scribd:before{content:"\f28a"}.fa-debian:before{content:"\e60b"}.fa-openid:before{content:"\f19b"}.fa-instalod:before{content:"\e081"}.fa-expeditedssl:before{content:"\f23e"}.fa-sellcast:before{content:"\f2da"}.fa-square-twitter:before,.fa-twitter-square:before{content:"\f081"}.fa-r-project:before{content:"\f4f7"}.fa-delicious:before{content:"\f1a5"}.fa-freebsd:before{content:"\f3a4"}.fa-vuejs:before{content:"\f41f"}.fa-accusoft:before{content:"\f369"}.fa-ioxhost:before{content:"\f208"}.fa-fonticons-fi:before{content:"\f3a2"}.fa-app-store:before{content:"\f36f"}.fa-cc-mastercard:before{content:"\f1f1"}.fa-itunes-note:before{content:"\f3b5"}.fa-golang:before{content:"\e40f"}.fa-kickstarter:before,.fa-square-kickstarter:before{content:"\f3bb"}.fa-grav:before{content:"\f2d6"}.fa-weibo:before{content:"\f18a"}.fa-uncharted:before{content:"\e084"}.fa-firstdraft:before{content:"\f3a1"}.fa-square-youtube:before,.fa-youtube-square:before{content:"\f431"}.fa-wikipedia-w:before{content:"\f266"}.fa-rendact:before,.fa-wpressr:before{content:"\f3e4"}.fa-angellist:before{content:"\f209"}.fa-galactic-republic:before{content:"\f50c"}.fa-nfc-directional:before{content:"\e530"}.fa-skype:before{content:"\f17e"}.fa-joget:before{content:"\f3b7"}.fa-fedora:before{content:"\f798"}.fa-stripe-s:before{content:"\f42a"}.fa-meta:before{content:"\e49b"}.fa-laravel:before{content:"\f3bd"}.fa-hotjar:before{content:"\f3b1"}.fa-bluetooth-b:before{content:"\f294"}.fa-square-letterboxd:before{content:"\e62e"}.fa-sticker-mule:before{content:"\f3f7"}.fa-creative-commons-zero:before{content:"\f4f3"}.fa-hips:before{content:"\f452"}.fa-behance:before{content:"\f1b4"}.fa-reddit:before{content:"\f1a1"}.fa-discord:before{content:"\f392"}.fa-chrome:before{content:"\f268"}.fa-app-store-ios:before{content:"\f370"}.fa-cc-discover:before{content:"\f1f2"}.fa-wpbeginner:before{content:"\f297"}.fa-confluence:before{content:"\f78d"}.fa-shoelace:before{content:"\e60c"}.fa-mdb:before{content:"\f8ca"}.fa-dochub:before{content:"\f394"}.fa-accessible-icon:before{content:"\f368"}.fa-ebay:before{content:"\f4f4"}.fa-amazon:before{content:"\f270"}.fa-unsplash:before{content:"\e07c"}.fa-yarn:before{content:"\f7e3"}.fa-square-steam:before,.fa-steam-square:before{content:"\f1b7"}.fa-500px:before{content:"\f26e"}.fa-square-vimeo:before,.fa-vimeo-square:before{content:"\f194"}.fa-asymmetrik:before{content:"\f372"}.fa-font-awesome-flag:before,.fa-font-awesome-logo-full:before,.fa-font-awesome:before{content:"\f2b4"}.fa-gratipay:before{content:"\f184"}.fa-apple:before{content:"\f179"}.fa-hive:before{content:"\e07f"}.fa-gitkraken:before{content:"\f3a6"}.fa-keybase:before{content:"\f4f5"}.fa-apple-pay:before{content:"\f415"}.fa-padlet:before{content:"\e4a0"}.fa-amazon-pay:before{content:"\f42c"}.fa-github-square:before,.fa-square-github:before{content:"\f092"}.fa-stumbleupon:before{content:"\f1a4"}.fa-fedex:before{content:"\f797"}.fa-phoenix-framework:before{content:"\f3dc"}.fa-shopify:before{content:"\e057"}.fa-neos:before{content:"\f612"}.fa-square-threads:before{content:"\e619"}.fa-hackerrank:before{content:"\f5f7"}.fa-researchgate:before{content:"\f4f8"}.fa-swift:before{content:"\f8e1"}.fa-angular:before{content:"\f420"}.fa-speakap:before{content:"\f3f3"}.fa-angrycreative:before{content:"\f36e"}.fa-y-combinator:before{content:"\f23b"}.fa-empire:before{content:"\f1d1"}.fa-envira:before{content:"\f299"}.fa-google-scholar:before{content:"\e63b"}.fa-gitlab-square:before,.fa-square-gitlab:before{content:"\e5ae"}.fa-studiovinari:before{content:"\f3f8"}.fa-pied-piper:before{content:"\f2ae"}.fa-wordpress:before{content:"\f19a"}.fa-product-hunt:before{content:"\f288"}.fa-firefox:before{content:"\f269"}.fa-linode:before{content:"\f2b8"}.fa-goodreads:before{content:"\f3a8"}.fa-odnoklassniki-square:before,.fa-square-odnoklassniki:before{content:"\f264"}.fa-jsfiddle:before{content:"\f1cc"}.fa-sith:before{content:"\f512"}.fa-themeisle:before{content:"\f2b2"}.fa-page4:before{content:"\f3d7"}.fa-hashnode:before{content:"\e499"}.fa-react:before{content:"\f41b"}.fa-cc-paypal:before{content:"\f1f4"}.fa-squarespace:before{content:"\f5be"}.fa-cc-stripe:before{content:"\f1f5"}.fa-creative-commons-share:before{content:"\f4f2"}.fa-bitcoin:before{content:"\f379"}.fa-keycdn:before{content:"\f3ba"}.fa-opera:before{content:"\f26a"}.fa-itch-io:before{content:"\f83a"}.fa-umbraco:before{content:"\f8e8"}.fa-galactic-senate:before{content:"\f50d"}.fa-ubuntu:before{content:"\f7df"}.fa-draft2digital:before{content:"\f396"}.fa-stripe:before{content:"\f429"}.fa-houzz:before{content:"\f27c"}.fa-gg:before{content:"\f260"}.fa-dhl:before{content:"\f790"}.fa-pinterest-square:before,.fa-square-pinterest:before{content:"\f0d3"}.fa-xing:before{content:"\f168"}.fa-blackberry:before{content:"\f37b"}.fa-creative-commons-pd:before{content:"\f4ec"}.fa-playstation:before{content:"\f3df"}.fa-quinscape:before{content:"\f459"}.fa-less:before{content:"\f41d"}.fa-blogger-b:before{content:"\f37d"}.fa-opencart:before{content:"\f23d"}.fa-vine:before{content:"\f1ca"}.fa-signal-messenger:before{content:"\e663"}.fa-paypal:before{content:"\f1ed"}.fa-gitlab:before{content:"\f296"}.fa-typo3:before{content:"\f42b"}.fa-reddit-alien:before{content:"\f281"}.fa-yahoo:before{content:"\f19e"}.fa-dailymotion:before{content:"\e052"}.fa-affiliatetheme:before{content:"\f36b"}.fa-pied-piper-pp:before{content:"\f1a7"}.fa-bootstrap:before{content:"\f836"}.fa-odnoklassniki:before{content:"\f263"}.fa-nfc-symbol:before{content:"\e531"}.fa-mintbit:before{content:"\e62f"}.fa-ethereum:before{content:"\f42e"}.fa-speaker-deck:before{content:"\f83c"}.fa-creative-commons-nc-eu:before{content:"\f4e9"}.fa-patreon:before{content:"\f3d9"}.fa-avianex:before{content:"\f374"}.fa-ello:before{content:"\f5f1"}.fa-gofore:before{content:"\f3a7"}.fa-bimobject:before{content:"\f378"}.fa-brave-reverse:before{content:"\e63d"}.fa-facebook-f:before{content:"\f39e"}.fa-google-plus-square:before,.fa-square-google-plus:before{content:"\f0d4"}.fa-web-awesome:before{content:"\e682"}.fa-mandalorian:before{content:"\f50f"}.fa-first-order-alt:before{content:"\f50a"}.fa-osi:before{content:"\f41a"}.fa-google-wallet:before{content:"\f1ee"}.fa-d-and-d-beyond:before{content:"\f6ca"}.fa-periscope:before{content:"\f3da"}.fa-fulcrum:before{content:"\f50b"}.fa-cloudscale:before{content:"\f383"}.fa-forumbee:before{content:"\f211"}.fa-mizuni:before{content:"\f3cc"}.fa-schlix:before{content:"\f3ea"}.fa-square-xing:before,.fa-xing-square:before{content:"\f169"}.fa-bandcamp:before{content:"\f2d5"}.fa-wpforms:before{content:"\f298"}.fa-cloudversify:before{content:"\f385"}.fa-usps:before{content:"\f7e1"}.fa-megaport:before{content:"\f5a3"}.fa-magento:before{content:"\f3c4"}.fa-spotify:before{content:"\f1bc"}.fa-optin-monster:before{content:"\f23c"}.fa-fly:before{content:"\f417"}.fa-aviato:before{content:"\f421"}.fa-itunes:before{content:"\f3b4"}.fa-cuttlefish:before{content:"\f38c"}.fa-blogger:before{content:"\f37c"}.fa-flickr:before{content:"\f16e"}.fa-viber:before{content:"\f409"}.fa-soundcloud:before{content:"\f1be"}.fa-digg:before{content:"\f1a6"}.fa-tencent-weibo:before{content:"\f1d5"}.fa-letterboxd:before{content:"\e62d"}.fa-symfony:before{content:"\f83d"}.fa-maxcdn:before{content:"\f136"}.fa-etsy:before{content:"\f2d7"}.fa-facebook-messenger:before{content:"\f39f"}.fa-audible:before{content:"\f373"}.fa-think-peaks:before{content:"\f731"}.fa-bilibili:before{content:"\e3d9"}.fa-erlang:before{content:"\f39d"}.fa-x-twitter:before{content:"\e61b"}.fa-cotton-bureau:before{content:"\f89e"}.fa-dashcube:before{content:"\f210"}.fa-42-group:before,.fa-innosoft:before{content:"\e080"}.fa-stack-exchange:before{content:"\f18d"}.fa-elementor:before{content:"\f430"}.fa-pied-piper-square:before,.fa-square-pied-piper:before{content:"\e01e"}.fa-creative-commons-nd:before{content:"\f4eb"}.fa-palfed:before{content:"\f3d8"}.fa-superpowers:before{content:"\f2dd"}.fa-resolving:before{content:"\f3e7"}.fa-xbox:before{content:"\f412"}.fa-square-web-awesome-stroke:before{content:"\e684"}.fa-searchengin:before{content:"\f3eb"}.fa-tiktok:before{content:"\e07b"}.fa-facebook-square:before,.fa-square-facebook:before{content:"\f082"}.fa-renren:before{content:"\f18b"}.fa-linux:before{content:"\f17c"}.fa-glide:before{content:"\f2a5"}.fa-linkedin:before{content:"\f08c"}.fa-hubspot:before{content:"\f3b2"}.fa-deploydog:before{content:"\f38e"}.fa-twitch:before{content:"\f1e8"}.fa-ravelry:before{content:"\f2d9"}.fa-mixer:before{content:"\e056"}.fa-lastfm-square:before,.fa-square-lastfm:before{content:"\f203"}.fa-vimeo:before{content:"\f40a"}.fa-mendeley:before{content:"\f7b3"}.fa-uniregistry:before{content:"\f404"}.fa-figma:before{content:"\f799"}.fa-creative-commons-remix:before{content:"\f4ee"}.fa-cc-amazon-pay:before{content:"\f42d"}.fa-dropbox:before{content:"\f16b"}.fa-instagram:before{content:"\f16d"}.fa-cmplid:before{content:"\e360"}.fa-upwork:before{content:"\e641"}.fa-facebook:before{content:"\f09a"}.fa-gripfire:before{content:"\f3ac"}.fa-jedi-order:before{content:"\f50e"}.fa-uikit:before{content:"\f403"}.fa-fort-awesome-alt:before{content:"\f3a3"}.fa-phabricator:before{content:"\f3db"}.fa-ussunnah:before{content:"\f407"}.fa-earlybirds:before{content:"\f39a"}.fa-trade-federation:before{content:"\f513"}.fa-autoprefixer:before{content:"\f41c"}.fa-whatsapp:before{content:"\f232"}.fa-square-upwork:before{content:"\e67c"}.fa-slideshare:before{content:"\f1e7"}.fa-google-play:before{content:"\f3ab"}.fa-viadeo:before{content:"\f2a9"}.fa-line:before{content:"\f3c0"}.fa-google-drive:before{content:"\f3aa"}.fa-servicestack:before{content:"\f3ec"}.fa-simplybuilt:before{content:"\f215"}.fa-bitbucket:before{content:"\f171"}.fa-imdb:before{content:"\f2d8"}.fa-deezer:before{content:"\e077"}.fa-raspberry-pi:before{content:"\f7bb"}.fa-jira:before{content:"\f7b1"}.fa-docker:before{content:"\f395"}.fa-screenpal:before{content:"\e570"}.fa-bluetooth:before{content:"\f293"}.fa-gitter:before{content:"\f426"}.fa-d-and-d:before{content:"\f38d"}.fa-microblog:before{content:"\e01a"}.fa-cc-diners-club:before{content:"\f24c"}.fa-gg-circle:before{content:"\f261"}.fa-pied-piper-hat:before{content:"\f4e5"}.fa-kickstarter-k:before{content:"\f3bc"}.fa-yandex:before{content:"\f413"}.fa-readme:before{content:"\f4d5"}.fa-html5:before{content:"\f13b"}.fa-sellsy:before{content:"\f213"}.fa-square-web-awesome:before{content:"\e683"}.fa-sass:before{content:"\f41e"}.fa-wirsindhandwerk:before,.fa-wsh:before{content:"\e2d0"}.fa-buromobelexperte:before{content:"\f37f"}.fa-salesforce:before{content:"\f83b"}.fa-octopus-deploy:before{content:"\e082"}.fa-medapps:before{content:"\f3c6"}.fa-ns8:before{content:"\f3d5"}.fa-pinterest-p:before{content:"\f231"}.fa-apper:before{content:"\f371"}.fa-fort-awesome:before{content:"\f286"}.fa-waze:before{content:"\f83f"}.fa-bluesky:before{content:"\e671"}.fa-cc-jcb:before{content:"\f24b"}.fa-snapchat-ghost:before,.fa-snapchat:before{content:"\f2ab"}.fa-fantasy-flight-games:before{content:"\f6dc"}.fa-rust:before{content:"\e07a"}.fa-wix:before{content:"\f5cf"}.fa-behance-square:before,.fa-square-behance:before{content:"\f1b5"}.fa-supple:before{content:"\f3f9"}.fa-webflow:before{content:"\e65c"}.fa-rebel:before{content:"\f1d0"}.fa-css3:before{content:"\f13c"}.fa-staylinked:before{content:"\f3f5"}.fa-kaggle:before{content:"\f5fa"}.fa-space-awesome:before{content:"\e5ac"}.fa-deviantart:before{content:"\f1bd"}.fa-cpanel:before{content:"\f388"}.fa-goodreads-g:before{content:"\f3a9"}.fa-git-square:before,.fa-square-git:before{content:"\f1d2"}.fa-square-tumblr:before,.fa-tumblr-square:before{content:"\f174"}.fa-trello:before{content:"\f181"}.fa-creative-commons-nc-jp:before{content:"\f4ea"}.fa-get-pocket:before{content:"\f265"}.fa-perbyte:before{content:"\e083"}.fa-grunt:before{content:"\f3ad"}.fa-weebly:before{content:"\f5cc"}.fa-connectdevelop:before{content:"\f20e"}.fa-leanpub:before{content:"\f212"}.fa-black-tie:before{content:"\f27e"}.fa-themeco:before{content:"\f5c6"}.fa-python:before{content:"\f3e2"}.fa-android:before{content:"\f17b"}.fa-bots:before{content:"\e340"}.fa-free-code-camp:before{content:"\f2c5"}.fa-hornbill:before{content:"\f592"}.fa-js:before{content:"\f3b8"}.fa-ideal:before{content:"\e013"}.fa-git:before{content:"\f1d3"}.fa-dev:before{content:"\f6cc"}.fa-sketch:before{content:"\f7c6"}.fa-yandex-international:before{content:"\f414"}.fa-cc-amex:before{content:"\f1f3"}.fa-uber:before{content:"\f402"}.fa-github:before{content:"\f09b"}.fa-php:before{content:"\f457"}.fa-alipay:before{content:"\f642"}.fa-youtube:before{content:"\f167"}.fa-skyatlas:before{content:"\f216"}.fa-firefox-browser:before{content:"\e007"}.fa-replyd:before{content:"\f3e6"}.fa-suse:before{content:"\f7d6"}.fa-jenkins:before{content:"\f3b6"}.fa-twitter:before{content:"\f099"}.fa-rockrms:before{content:"\f3e9"}.fa-pinterest:before{content:"\f0d2"}.fa-buffer:before{content:"\f837"}.fa-npm:before{content:"\f3d4"}.fa-yammer:before{content:"\f840"}.fa-btc:before{content:"\f15a"}.fa-dribbble:before{content:"\f17d"}.fa-stumbleupon-circle:before{content:"\f1a3"}.fa-internet-explorer:before{content:"\f26b"}.fa-stubber:before{content:"\e5c7"}.fa-telegram-plane:before,.fa-telegram:before{content:"\f2c6"}.fa-old-republic:before{content:"\f510"}.fa-odysee:before{content:"\e5c6"}.fa-square-whatsapp:before,.fa-whatsapp-square:before{content:"\f40c"}.fa-node-js:before{content:"\f3d3"}.fa-edge-legacy:before{content:"\e078"}.fa-slack-hash:before,.fa-slack:before{content:"\f198"}.fa-medrt:before{content:"\f3c8"}.fa-usb:before{content:"\f287"}.fa-tumblr:before{content:"\f173"}.fa-vaadin:before{content:"\f408"}.fa-quora:before{content:"\f2c4"}.fa-square-x-twitter:before{content:"\e61a"}.fa-reacteurope:before{content:"\f75d"}.fa-medium-m:before,.fa-medium:before{content:"\f23a"}.fa-amilia:before{content:"\f36d"}.fa-mixcloud:before{content:"\f289"}.fa-flipboard:before{content:"\f44d"}.fa-viacoin:before{content:"\f237"}.fa-critical-role:before{content:"\f6c9"}.fa-sitrox:before{content:"\e44a"}.fa-discourse:before{content:"\f393"}.fa-joomla:before{content:"\f1aa"}.fa-mastodon:before{content:"\f4f6"}.fa-airbnb:before{content:"\f834"}.fa-wolf-pack-battalion:before{content:"\f514"}.fa-buy-n-large:before{content:"\f8a6"}.fa-gulp:before{content:"\f3ae"}.fa-creative-commons-sampling-plus:before{content:"\f4f1"}.fa-strava:before{content:"\f428"}.fa-ember:before{content:"\f423"}.fa-canadian-maple-leaf:before{content:"\f785"}.fa-teamspeak:before{content:"\f4f9"}.fa-pushed:before{content:"\f3e1"}.fa-wordpress-simple:before{content:"\f411"}.fa-nutritionix:before{content:"\f3d6"}.fa-wodu:before{content:"\e088"}.fa-google-pay:before{content:"\e079"}.fa-intercom:before{content:"\f7af"}.fa-zhihu:before{content:"\f63f"}.fa-korvue:before{content:"\f42f"}.fa-pix:before{content:"\e43a"}.fa-steam-symbol:before{content:"\f3f6"}:host,:root{--fa-font-regular:normal 400 1em/1 "Font Awesome 6 Free"}@font-face{font-family:"Font Awesome 6 Free";font-style:normal;font-weight:400;font-display:block;src: url("../webfonts/fa-regular-400.woff2") format("woff2"), url("../webfonts/fa-regular-400.ttf") format("truetype"); }.fa-regular,.far{font-weight:400}:host,:root{--fa-style-family-classic:"Font Awesome 6 Free";--fa-font-solid:normal 900 1em/1 "Font Awesome 6 Free"}@font-face{font-family:"Font Awesome 6 Free";font-style:normal;font-weight:900;font-display:block;src: url("../webfonts/fa-solid-900.woff2") format("woff2"), url("../webfonts/fa-solid-900.ttf") format("truetype"); }.fa-solid,.fas{font-weight:900}@font-face{font-family:"Font Awesome 5 Brands";font-display:block;font-weight:400;src: url("../webfonts/fa-brands-400.woff2") format("woff2"), url("../webfonts/fa-brands-400.ttf") format("truetype"); }@font-face{font-family:"Font Awesome 5 Free";font-display:block;font-weight:900;src: url("../webfonts/fa-solid-900.woff2") format("woff2"), url("../webfonts/fa-solid-900.ttf") format("truetype"); }@font-face{font-family:"Font Awesome 5 Free";font-display:block;font-weight:400;src: url("../webfonts/fa-regular-400.woff2") format("woff2"), url("../webfonts/fa-regular-400.ttf") format("truetype"); }@font-face{font-family:"FontAwesome";font-display:block;src: url("../webfonts/fa-solid-900.woff2") format("woff2"), url("../webfonts/fa-solid-900.ttf") format("truetype"); }@font-face{font-family:"FontAwesome";font-display:block;src: url("../webfonts/fa-brands-400.woff2") format("woff2"), url("../webfonts/fa-brands-400.ttf") format("truetype"); }@font-face{font-family:"FontAwesome";font-display:block;src: url("../webfonts/fa-regular-400.woff2") format("woff2"), url("../webfonts/fa-regular-400.ttf") format("truetype"); }@font-face{font-family:"FontAwesome";font-display:block;src: url("../webfonts/fa-v4compatibility.woff2") format("woff2"), url("../webfonts/fa-v4compatibility.ttf") format("truetype"); }
\ No newline at end of file
diff --git a/docs/deps/font-awesome-6.5.2/css/v4-shims.css b/docs/deps/font-awesome-6.5.2/css/v4-shims.css
new file mode 100644
index 0000000..ea60ea4
--- /dev/null
+++ b/docs/deps/font-awesome-6.5.2/css/v4-shims.css
@@ -0,0 +1,2194 @@
+/*!
+ * Font Awesome Free 6.5.2 by @fontawesome - https://fontawesome.com
+ * License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License)
+ * Copyright 2024 Fonticons, Inc.
+ */
+.fa.fa-glass:before {
+ content: "\f000"; }
+
+.fa.fa-envelope-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-envelope-o:before {
+ content: "\f0e0"; }
+
+.fa.fa-star-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-star-o:before {
+ content: "\f005"; }
+
+.fa.fa-remove:before {
+ content: "\f00d"; }
+
+.fa.fa-close:before {
+ content: "\f00d"; }
+
+.fa.fa-gear:before {
+ content: "\f013"; }
+
+.fa.fa-trash-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-trash-o:before {
+ content: "\f2ed"; }
+
+.fa.fa-home:before {
+ content: "\f015"; }
+
+.fa.fa-file-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-o:before {
+ content: "\f15b"; }
+
+.fa.fa-clock-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-clock-o:before {
+ content: "\f017"; }
+
+.fa.fa-arrow-circle-o-down {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-arrow-circle-o-down:before {
+ content: "\f358"; }
+
+.fa.fa-arrow-circle-o-up {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-arrow-circle-o-up:before {
+ content: "\f35b"; }
+
+.fa.fa-play-circle-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-play-circle-o:before {
+ content: "\f144"; }
+
+.fa.fa-repeat:before {
+ content: "\f01e"; }
+
+.fa.fa-rotate-right:before {
+ content: "\f01e"; }
+
+.fa.fa-refresh:before {
+ content: "\f021"; }
+
+.fa.fa-list-alt {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-list-alt:before {
+ content: "\f022"; }
+
+.fa.fa-dedent:before {
+ content: "\f03b"; }
+
+.fa.fa-video-camera:before {
+ content: "\f03d"; }
+
+.fa.fa-picture-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-picture-o:before {
+ content: "\f03e"; }
+
+.fa.fa-photo {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-photo:before {
+ content: "\f03e"; }
+
+.fa.fa-image {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-image:before {
+ content: "\f03e"; }
+
+.fa.fa-map-marker:before {
+ content: "\f3c5"; }
+
+.fa.fa-pencil-square-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-pencil-square-o:before {
+ content: "\f044"; }
+
+.fa.fa-edit {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-edit:before {
+ content: "\f044"; }
+
+.fa.fa-share-square-o:before {
+ content: "\f14d"; }
+
+.fa.fa-check-square-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-check-square-o:before {
+ content: "\f14a"; }
+
+.fa.fa-arrows:before {
+ content: "\f0b2"; }
+
+.fa.fa-times-circle-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-times-circle-o:before {
+ content: "\f057"; }
+
+.fa.fa-check-circle-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-check-circle-o:before {
+ content: "\f058"; }
+
+.fa.fa-mail-forward:before {
+ content: "\f064"; }
+
+.fa.fa-expand:before {
+ content: "\f424"; }
+
+.fa.fa-compress:before {
+ content: "\f422"; }
+
+.fa.fa-eye {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-eye-slash {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-warning:before {
+ content: "\f071"; }
+
+.fa.fa-calendar:before {
+ content: "\f073"; }
+
+.fa.fa-arrows-v:before {
+ content: "\f338"; }
+
+.fa.fa-arrows-h:before {
+ content: "\f337"; }
+
+.fa.fa-bar-chart:before {
+ content: "\e0e3"; }
+
+.fa.fa-bar-chart-o:before {
+ content: "\e0e3"; }
+
+.fa.fa-twitter-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-twitter-square:before {
+ content: "\f081"; }
+
+.fa.fa-facebook-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-facebook-square:before {
+ content: "\f082"; }
+
+.fa.fa-gears:before {
+ content: "\f085"; }
+
+.fa.fa-thumbs-o-up {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-thumbs-o-up:before {
+ content: "\f164"; }
+
+.fa.fa-thumbs-o-down {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-thumbs-o-down:before {
+ content: "\f165"; }
+
+.fa.fa-heart-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-heart-o:before {
+ content: "\f004"; }
+
+.fa.fa-sign-out:before {
+ content: "\f2f5"; }
+
+.fa.fa-linkedin-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-linkedin-square:before {
+ content: "\f08c"; }
+
+.fa.fa-thumb-tack:before {
+ content: "\f08d"; }
+
+.fa.fa-external-link:before {
+ content: "\f35d"; }
+
+.fa.fa-sign-in:before {
+ content: "\f2f6"; }
+
+.fa.fa-github-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-github-square:before {
+ content: "\f092"; }
+
+.fa.fa-lemon-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-lemon-o:before {
+ content: "\f094"; }
+
+.fa.fa-square-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-square-o:before {
+ content: "\f0c8"; }
+
+.fa.fa-bookmark-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-bookmark-o:before {
+ content: "\f02e"; }
+
+.fa.fa-twitter {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-facebook {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-facebook:before {
+ content: "\f39e"; }
+
+.fa.fa-facebook-f {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-facebook-f:before {
+ content: "\f39e"; }
+
+.fa.fa-github {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-credit-card {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-feed:before {
+ content: "\f09e"; }
+
+.fa.fa-hdd-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hdd-o:before {
+ content: "\f0a0"; }
+
+.fa.fa-hand-o-right {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-o-right:before {
+ content: "\f0a4"; }
+
+.fa.fa-hand-o-left {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-o-left:before {
+ content: "\f0a5"; }
+
+.fa.fa-hand-o-up {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-o-up:before {
+ content: "\f0a6"; }
+
+.fa.fa-hand-o-down {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-o-down:before {
+ content: "\f0a7"; }
+
+.fa.fa-globe:before {
+ content: "\f57d"; }
+
+.fa.fa-tasks:before {
+ content: "\f828"; }
+
+.fa.fa-arrows-alt:before {
+ content: "\f31e"; }
+
+.fa.fa-group:before {
+ content: "\f0c0"; }
+
+.fa.fa-chain:before {
+ content: "\f0c1"; }
+
+.fa.fa-cut:before {
+ content: "\f0c4"; }
+
+.fa.fa-files-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-files-o:before {
+ content: "\f0c5"; }
+
+.fa.fa-floppy-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-floppy-o:before {
+ content: "\f0c7"; }
+
+.fa.fa-save {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-save:before {
+ content: "\f0c7"; }
+
+.fa.fa-navicon:before {
+ content: "\f0c9"; }
+
+.fa.fa-reorder:before {
+ content: "\f0c9"; }
+
+.fa.fa-magic:before {
+ content: "\e2ca"; }
+
+.fa.fa-pinterest {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-pinterest-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-pinterest-square:before {
+ content: "\f0d3"; }
+
+.fa.fa-google-plus-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-google-plus-square:before {
+ content: "\f0d4"; }
+
+.fa.fa-google-plus {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-google-plus:before {
+ content: "\f0d5"; }
+
+.fa.fa-money:before {
+ content: "\f3d1"; }
+
+.fa.fa-unsorted:before {
+ content: "\f0dc"; }
+
+.fa.fa-sort-desc:before {
+ content: "\f0dd"; }
+
+.fa.fa-sort-asc:before {
+ content: "\f0de"; }
+
+.fa.fa-linkedin {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-linkedin:before {
+ content: "\f0e1"; }
+
+.fa.fa-rotate-left:before {
+ content: "\f0e2"; }
+
+.fa.fa-legal:before {
+ content: "\f0e3"; }
+
+.fa.fa-tachometer:before {
+ content: "\f625"; }
+
+.fa.fa-dashboard:before {
+ content: "\f625"; }
+
+.fa.fa-comment-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-comment-o:before {
+ content: "\f075"; }
+
+.fa.fa-comments-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-comments-o:before {
+ content: "\f086"; }
+
+.fa.fa-flash:before {
+ content: "\f0e7"; }
+
+.fa.fa-clipboard:before {
+ content: "\f0ea"; }
+
+.fa.fa-lightbulb-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-lightbulb-o:before {
+ content: "\f0eb"; }
+
+.fa.fa-exchange:before {
+ content: "\f362"; }
+
+.fa.fa-cloud-download:before {
+ content: "\f0ed"; }
+
+.fa.fa-cloud-upload:before {
+ content: "\f0ee"; }
+
+.fa.fa-bell-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-bell-o:before {
+ content: "\f0f3"; }
+
+.fa.fa-cutlery:before {
+ content: "\f2e7"; }
+
+.fa.fa-file-text-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-text-o:before {
+ content: "\f15c"; }
+
+.fa.fa-building-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-building-o:before {
+ content: "\f1ad"; }
+
+.fa.fa-hospital-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hospital-o:before {
+ content: "\f0f8"; }
+
+.fa.fa-tablet:before {
+ content: "\f3fa"; }
+
+.fa.fa-mobile:before {
+ content: "\f3cd"; }
+
+.fa.fa-mobile-phone:before {
+ content: "\f3cd"; }
+
+.fa.fa-circle-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-circle-o:before {
+ content: "\f111"; }
+
+.fa.fa-mail-reply:before {
+ content: "\f3e5"; }
+
+.fa.fa-github-alt {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-folder-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-folder-o:before {
+ content: "\f07b"; }
+
+.fa.fa-folder-open-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-folder-open-o:before {
+ content: "\f07c"; }
+
+.fa.fa-smile-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-smile-o:before {
+ content: "\f118"; }
+
+.fa.fa-frown-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-frown-o:before {
+ content: "\f119"; }
+
+.fa.fa-meh-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-meh-o:before {
+ content: "\f11a"; }
+
+.fa.fa-keyboard-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-keyboard-o:before {
+ content: "\f11c"; }
+
+.fa.fa-flag-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-flag-o:before {
+ content: "\f024"; }
+
+.fa.fa-mail-reply-all:before {
+ content: "\f122"; }
+
+.fa.fa-star-half-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-star-half-o:before {
+ content: "\f5c0"; }
+
+.fa.fa-star-half-empty {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-star-half-empty:before {
+ content: "\f5c0"; }
+
+.fa.fa-star-half-full {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-star-half-full:before {
+ content: "\f5c0"; }
+
+.fa.fa-code-fork:before {
+ content: "\f126"; }
+
+.fa.fa-chain-broken:before {
+ content: "\f127"; }
+
+.fa.fa-unlink:before {
+ content: "\f127"; }
+
+.fa.fa-calendar-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-calendar-o:before {
+ content: "\f133"; }
+
+.fa.fa-maxcdn {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-html5 {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-css3 {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-unlock-alt:before {
+ content: "\f09c"; }
+
+.fa.fa-minus-square-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-minus-square-o:before {
+ content: "\f146"; }
+
+.fa.fa-level-up:before {
+ content: "\f3bf"; }
+
+.fa.fa-level-down:before {
+ content: "\f3be"; }
+
+.fa.fa-pencil-square:before {
+ content: "\f14b"; }
+
+.fa.fa-external-link-square:before {
+ content: "\f360"; }
+
+.fa.fa-compass {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-caret-square-o-down {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-caret-square-o-down:before {
+ content: "\f150"; }
+
+.fa.fa-toggle-down {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-toggle-down:before {
+ content: "\f150"; }
+
+.fa.fa-caret-square-o-up {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-caret-square-o-up:before {
+ content: "\f151"; }
+
+.fa.fa-toggle-up {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-toggle-up:before {
+ content: "\f151"; }
+
+.fa.fa-caret-square-o-right {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-caret-square-o-right:before {
+ content: "\f152"; }
+
+.fa.fa-toggle-right {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-toggle-right:before {
+ content: "\f152"; }
+
+.fa.fa-eur:before {
+ content: "\f153"; }
+
+.fa.fa-euro:before {
+ content: "\f153"; }
+
+.fa.fa-gbp:before {
+ content: "\f154"; }
+
+.fa.fa-usd:before {
+ content: "\24"; }
+
+.fa.fa-dollar:before {
+ content: "\24"; }
+
+.fa.fa-inr:before {
+ content: "\e1bc"; }
+
+.fa.fa-rupee:before {
+ content: "\e1bc"; }
+
+.fa.fa-jpy:before {
+ content: "\f157"; }
+
+.fa.fa-cny:before {
+ content: "\f157"; }
+
+.fa.fa-rmb:before {
+ content: "\f157"; }
+
+.fa.fa-yen:before {
+ content: "\f157"; }
+
+.fa.fa-rub:before {
+ content: "\f158"; }
+
+.fa.fa-ruble:before {
+ content: "\f158"; }
+
+.fa.fa-rouble:before {
+ content: "\f158"; }
+
+.fa.fa-krw:before {
+ content: "\f159"; }
+
+.fa.fa-won:before {
+ content: "\f159"; }
+
+.fa.fa-btc {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-bitcoin {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-bitcoin:before {
+ content: "\f15a"; }
+
+.fa.fa-file-text:before {
+ content: "\f15c"; }
+
+.fa.fa-sort-alpha-asc:before {
+ content: "\f15d"; }
+
+.fa.fa-sort-alpha-desc:before {
+ content: "\f881"; }
+
+.fa.fa-sort-amount-asc:before {
+ content: "\f884"; }
+
+.fa.fa-sort-amount-desc:before {
+ content: "\f160"; }
+
+.fa.fa-sort-numeric-asc:before {
+ content: "\f162"; }
+
+.fa.fa-sort-numeric-desc:before {
+ content: "\f886"; }
+
+.fa.fa-youtube-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-youtube-square:before {
+ content: "\f431"; }
+
+.fa.fa-youtube {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-xing {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-xing-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-xing-square:before {
+ content: "\f169"; }
+
+.fa.fa-youtube-play {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-youtube-play:before {
+ content: "\f167"; }
+
+.fa.fa-dropbox {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-stack-overflow {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-instagram {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-flickr {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-adn {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-bitbucket {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-bitbucket-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-bitbucket-square:before {
+ content: "\f171"; }
+
+.fa.fa-tumblr {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-tumblr-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-tumblr-square:before {
+ content: "\f174"; }
+
+.fa.fa-long-arrow-down:before {
+ content: "\f309"; }
+
+.fa.fa-long-arrow-up:before {
+ content: "\f30c"; }
+
+.fa.fa-long-arrow-left:before {
+ content: "\f30a"; }
+
+.fa.fa-long-arrow-right:before {
+ content: "\f30b"; }
+
+.fa.fa-apple {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-windows {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-android {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-linux {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-dribbble {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-skype {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-foursquare {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-trello {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-gratipay {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-gittip {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-gittip:before {
+ content: "\f184"; }
+
+.fa.fa-sun-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-sun-o:before {
+ content: "\f185"; }
+
+.fa.fa-moon-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-moon-o:before {
+ content: "\f186"; }
+
+.fa.fa-vk {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-weibo {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-renren {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-pagelines {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-stack-exchange {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-arrow-circle-o-right {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-arrow-circle-o-right:before {
+ content: "\f35a"; }
+
+.fa.fa-arrow-circle-o-left {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-arrow-circle-o-left:before {
+ content: "\f359"; }
+
+.fa.fa-caret-square-o-left {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-caret-square-o-left:before {
+ content: "\f191"; }
+
+.fa.fa-toggle-left {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-toggle-left:before {
+ content: "\f191"; }
+
+.fa.fa-dot-circle-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-dot-circle-o:before {
+ content: "\f192"; }
+
+.fa.fa-vimeo-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-vimeo-square:before {
+ content: "\f194"; }
+
+.fa.fa-try:before {
+ content: "\e2bb"; }
+
+.fa.fa-turkish-lira:before {
+ content: "\e2bb"; }
+
+.fa.fa-plus-square-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-plus-square-o:before {
+ content: "\f0fe"; }
+
+.fa.fa-slack {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-wordpress {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-openid {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-institution:before {
+ content: "\f19c"; }
+
+.fa.fa-bank:before {
+ content: "\f19c"; }
+
+.fa.fa-mortar-board:before {
+ content: "\f19d"; }
+
+.fa.fa-yahoo {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-google {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-reddit {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-reddit-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-reddit-square:before {
+ content: "\f1a2"; }
+
+.fa.fa-stumbleupon-circle {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-stumbleupon {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-delicious {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-digg {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-pied-piper-pp {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-pied-piper-alt {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-drupal {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-joomla {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-behance {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-behance-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-behance-square:before {
+ content: "\f1b5"; }
+
+.fa.fa-steam {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-steam-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-steam-square:before {
+ content: "\f1b7"; }
+
+.fa.fa-automobile:before {
+ content: "\f1b9"; }
+
+.fa.fa-cab:before {
+ content: "\f1ba"; }
+
+.fa.fa-spotify {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-deviantart {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-soundcloud {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-file-pdf-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-pdf-o:before {
+ content: "\f1c1"; }
+
+.fa.fa-file-word-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-word-o:before {
+ content: "\f1c2"; }
+
+.fa.fa-file-excel-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-excel-o:before {
+ content: "\f1c3"; }
+
+.fa.fa-file-powerpoint-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-powerpoint-o:before {
+ content: "\f1c4"; }
+
+.fa.fa-file-image-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-image-o:before {
+ content: "\f1c5"; }
+
+.fa.fa-file-photo-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-photo-o:before {
+ content: "\f1c5"; }
+
+.fa.fa-file-picture-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-picture-o:before {
+ content: "\f1c5"; }
+
+.fa.fa-file-archive-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-archive-o:before {
+ content: "\f1c6"; }
+
+.fa.fa-file-zip-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-zip-o:before {
+ content: "\f1c6"; }
+
+.fa.fa-file-audio-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-audio-o:before {
+ content: "\f1c7"; }
+
+.fa.fa-file-sound-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-sound-o:before {
+ content: "\f1c7"; }
+
+.fa.fa-file-video-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-video-o:before {
+ content: "\f1c8"; }
+
+.fa.fa-file-movie-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-movie-o:before {
+ content: "\f1c8"; }
+
+.fa.fa-file-code-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-file-code-o:before {
+ content: "\f1c9"; }
+
+.fa.fa-vine {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-codepen {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-jsfiddle {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-life-bouy:before {
+ content: "\f1cd"; }
+
+.fa.fa-life-buoy:before {
+ content: "\f1cd"; }
+
+.fa.fa-life-saver:before {
+ content: "\f1cd"; }
+
+.fa.fa-support:before {
+ content: "\f1cd"; }
+
+.fa.fa-circle-o-notch:before {
+ content: "\f1ce"; }
+
+.fa.fa-rebel {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-ra {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-ra:before {
+ content: "\f1d0"; }
+
+.fa.fa-resistance {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-resistance:before {
+ content: "\f1d0"; }
+
+.fa.fa-empire {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-ge {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-ge:before {
+ content: "\f1d1"; }
+
+.fa.fa-git-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-git-square:before {
+ content: "\f1d2"; }
+
+.fa.fa-git {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-hacker-news {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-y-combinator-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-y-combinator-square:before {
+ content: "\f1d4"; }
+
+.fa.fa-yc-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-yc-square:before {
+ content: "\f1d4"; }
+
+.fa.fa-tencent-weibo {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-qq {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-weixin {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-wechat {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-wechat:before {
+ content: "\f1d7"; }
+
+.fa.fa-send:before {
+ content: "\f1d8"; }
+
+.fa.fa-paper-plane-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-paper-plane-o:before {
+ content: "\f1d8"; }
+
+.fa.fa-send-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-send-o:before {
+ content: "\f1d8"; }
+
+.fa.fa-circle-thin {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-circle-thin:before {
+ content: "\f111"; }
+
+.fa.fa-header:before {
+ content: "\f1dc"; }
+
+.fa.fa-futbol-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-futbol-o:before {
+ content: "\f1e3"; }
+
+.fa.fa-soccer-ball-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-soccer-ball-o:before {
+ content: "\f1e3"; }
+
+.fa.fa-slideshare {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-twitch {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-yelp {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-newspaper-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-newspaper-o:before {
+ content: "\f1ea"; }
+
+.fa.fa-paypal {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-google-wallet {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-cc-visa {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-cc-mastercard {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-cc-discover {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-cc-amex {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-cc-paypal {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-cc-stripe {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-bell-slash-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-bell-slash-o:before {
+ content: "\f1f6"; }
+
+.fa.fa-trash:before {
+ content: "\f2ed"; }
+
+.fa.fa-copyright {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-eyedropper:before {
+ content: "\f1fb"; }
+
+.fa.fa-area-chart:before {
+ content: "\f1fe"; }
+
+.fa.fa-pie-chart:before {
+ content: "\f200"; }
+
+.fa.fa-line-chart:before {
+ content: "\f201"; }
+
+.fa.fa-lastfm {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-lastfm-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-lastfm-square:before {
+ content: "\f203"; }
+
+.fa.fa-ioxhost {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-angellist {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-cc {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-cc:before {
+ content: "\f20a"; }
+
+.fa.fa-ils:before {
+ content: "\f20b"; }
+
+.fa.fa-shekel:before {
+ content: "\f20b"; }
+
+.fa.fa-sheqel:before {
+ content: "\f20b"; }
+
+.fa.fa-buysellads {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-connectdevelop {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-dashcube {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-forumbee {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-leanpub {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-sellsy {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-shirtsinbulk {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-simplybuilt {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-skyatlas {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-diamond {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-diamond:before {
+ content: "\f3a5"; }
+
+.fa.fa-transgender:before {
+ content: "\f224"; }
+
+.fa.fa-intersex:before {
+ content: "\f224"; }
+
+.fa.fa-transgender-alt:before {
+ content: "\f225"; }
+
+.fa.fa-facebook-official {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-facebook-official:before {
+ content: "\f09a"; }
+
+.fa.fa-pinterest-p {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-whatsapp {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-hotel:before {
+ content: "\f236"; }
+
+.fa.fa-viacoin {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-medium {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-y-combinator {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-yc {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-yc:before {
+ content: "\f23b"; }
+
+.fa.fa-optin-monster {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-opencart {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-expeditedssl {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-battery-4:before {
+ content: "\f240"; }
+
+.fa.fa-battery:before {
+ content: "\f240"; }
+
+.fa.fa-battery-3:before {
+ content: "\f241"; }
+
+.fa.fa-battery-2:before {
+ content: "\f242"; }
+
+.fa.fa-battery-1:before {
+ content: "\f243"; }
+
+.fa.fa-battery-0:before {
+ content: "\f244"; }
+
+.fa.fa-object-group {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-object-ungroup {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-sticky-note-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-sticky-note-o:before {
+ content: "\f249"; }
+
+.fa.fa-cc-jcb {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-cc-diners-club {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-clone {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hourglass-o:before {
+ content: "\f254"; }
+
+.fa.fa-hourglass-1:before {
+ content: "\f251"; }
+
+.fa.fa-hourglass-2:before {
+ content: "\f252"; }
+
+.fa.fa-hourglass-3:before {
+ content: "\f253"; }
+
+.fa.fa-hand-rock-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-rock-o:before {
+ content: "\f255"; }
+
+.fa.fa-hand-grab-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-grab-o:before {
+ content: "\f255"; }
+
+.fa.fa-hand-paper-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-paper-o:before {
+ content: "\f256"; }
+
+.fa.fa-hand-stop-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-stop-o:before {
+ content: "\f256"; }
+
+.fa.fa-hand-scissors-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-scissors-o:before {
+ content: "\f257"; }
+
+.fa.fa-hand-lizard-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-lizard-o:before {
+ content: "\f258"; }
+
+.fa.fa-hand-spock-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-spock-o:before {
+ content: "\f259"; }
+
+.fa.fa-hand-pointer-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-pointer-o:before {
+ content: "\f25a"; }
+
+.fa.fa-hand-peace-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-hand-peace-o:before {
+ content: "\f25b"; }
+
+.fa.fa-registered {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-creative-commons {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-gg {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-gg-circle {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-odnoklassniki {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-odnoklassniki-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-odnoklassniki-square:before {
+ content: "\f264"; }
+
+.fa.fa-get-pocket {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-wikipedia-w {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-safari {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-chrome {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-firefox {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-opera {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-internet-explorer {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-television:before {
+ content: "\f26c"; }
+
+.fa.fa-contao {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-500px {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-amazon {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-calendar-plus-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-calendar-plus-o:before {
+ content: "\f271"; }
+
+.fa.fa-calendar-minus-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-calendar-minus-o:before {
+ content: "\f272"; }
+
+.fa.fa-calendar-times-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-calendar-times-o:before {
+ content: "\f273"; }
+
+.fa.fa-calendar-check-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-calendar-check-o:before {
+ content: "\f274"; }
+
+.fa.fa-map-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-map-o:before {
+ content: "\f279"; }
+
+.fa.fa-commenting:before {
+ content: "\f4ad"; }
+
+.fa.fa-commenting-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-commenting-o:before {
+ content: "\f4ad"; }
+
+.fa.fa-houzz {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-vimeo {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-vimeo:before {
+ content: "\f27d"; }
+
+.fa.fa-black-tie {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-fonticons {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-reddit-alien {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-edge {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-credit-card-alt:before {
+ content: "\f09d"; }
+
+.fa.fa-codiepie {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-modx {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-fort-awesome {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-usb {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-product-hunt {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-mixcloud {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-scribd {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-pause-circle-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-pause-circle-o:before {
+ content: "\f28b"; }
+
+.fa.fa-stop-circle-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-stop-circle-o:before {
+ content: "\f28d"; }
+
+.fa.fa-bluetooth {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-bluetooth-b {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-gitlab {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-wpbeginner {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-wpforms {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-envira {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-wheelchair-alt {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-wheelchair-alt:before {
+ content: "\f368"; }
+
+.fa.fa-question-circle-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-question-circle-o:before {
+ content: "\f059"; }
+
+.fa.fa-volume-control-phone:before {
+ content: "\f2a0"; }
+
+.fa.fa-asl-interpreting:before {
+ content: "\f2a3"; }
+
+.fa.fa-deafness:before {
+ content: "\f2a4"; }
+
+.fa.fa-hard-of-hearing:before {
+ content: "\f2a4"; }
+
+.fa.fa-glide {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-glide-g {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-signing:before {
+ content: "\f2a7"; }
+
+.fa.fa-viadeo {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-viadeo-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-viadeo-square:before {
+ content: "\f2aa"; }
+
+.fa.fa-snapchat {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-snapchat-ghost {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-snapchat-ghost:before {
+ content: "\f2ab"; }
+
+.fa.fa-snapchat-square {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-snapchat-square:before {
+ content: "\f2ad"; }
+
+.fa.fa-pied-piper {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-first-order {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-yoast {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-themeisle {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-google-plus-official {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-google-plus-official:before {
+ content: "\f2b3"; }
+
+.fa.fa-google-plus-circle {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-google-plus-circle:before {
+ content: "\f2b3"; }
+
+.fa.fa-font-awesome {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-fa {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-fa:before {
+ content: "\f2b4"; }
+
+.fa.fa-handshake-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-handshake-o:before {
+ content: "\f2b5"; }
+
+.fa.fa-envelope-open-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-envelope-open-o:before {
+ content: "\f2b6"; }
+
+.fa.fa-linode {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-address-book-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-address-book-o:before {
+ content: "\f2b9"; }
+
+.fa.fa-vcard:before {
+ content: "\f2bb"; }
+
+.fa.fa-address-card-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-address-card-o:before {
+ content: "\f2bb"; }
+
+.fa.fa-vcard-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-vcard-o:before {
+ content: "\f2bb"; }
+
+.fa.fa-user-circle-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-user-circle-o:before {
+ content: "\f2bd"; }
+
+.fa.fa-user-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-user-o:before {
+ content: "\f007"; }
+
+.fa.fa-id-badge {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-drivers-license:before {
+ content: "\f2c2"; }
+
+.fa.fa-id-card-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-id-card-o:before {
+ content: "\f2c2"; }
+
+.fa.fa-drivers-license-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-drivers-license-o:before {
+ content: "\f2c2"; }
+
+.fa.fa-quora {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-free-code-camp {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-telegram {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-thermometer-4:before {
+ content: "\f2c7"; }
+
+.fa.fa-thermometer:before {
+ content: "\f2c7"; }
+
+.fa.fa-thermometer-3:before {
+ content: "\f2c8"; }
+
+.fa.fa-thermometer-2:before {
+ content: "\f2c9"; }
+
+.fa.fa-thermometer-1:before {
+ content: "\f2ca"; }
+
+.fa.fa-thermometer-0:before {
+ content: "\f2cb"; }
+
+.fa.fa-bathtub:before {
+ content: "\f2cd"; }
+
+.fa.fa-s15:before {
+ content: "\f2cd"; }
+
+.fa.fa-window-maximize {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-window-restore {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-times-rectangle:before {
+ content: "\f410"; }
+
+.fa.fa-window-close-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-window-close-o:before {
+ content: "\f410"; }
+
+.fa.fa-times-rectangle-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-times-rectangle-o:before {
+ content: "\f410"; }
+
+.fa.fa-bandcamp {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-grav {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-etsy {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-imdb {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-ravelry {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-eercast {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-eercast:before {
+ content: "\f2da"; }
+
+.fa.fa-snowflake-o {
+ font-family: 'Font Awesome 6 Free';
+ font-weight: 400; }
+
+.fa.fa-snowflake-o:before {
+ content: "\f2dc"; }
+
+.fa.fa-superpowers {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-wpexplorer {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
+
+.fa.fa-meetup {
+ font-family: 'Font Awesome 6 Brands';
+ font-weight: 400; }
diff --git a/docs/deps/font-awesome-6.5.2/css/v4-shims.min.css b/docs/deps/font-awesome-6.5.2/css/v4-shims.min.css
new file mode 100644
index 0000000..09baf5f
--- /dev/null
+++ b/docs/deps/font-awesome-6.5.2/css/v4-shims.min.css
@@ -0,0 +1,6 @@
+/*!
+ * Font Awesome Free 6.5.2 by @fontawesome - https://fontawesome.com
+ * License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License)
+ * Copyright 2024 Fonticons, Inc.
+ */
+.fa.fa-glass:before{content:"\f000"}.fa.fa-envelope-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-envelope-o:before{content:"\f0e0"}.fa.fa-star-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-star-o:before{content:"\f005"}.fa.fa-close:before,.fa.fa-remove:before{content:"\f00d"}.fa.fa-gear:before{content:"\f013"}.fa.fa-trash-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-trash-o:before{content:"\f2ed"}.fa.fa-home:before{content:"\f015"}.fa.fa-file-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-o:before{content:"\f15b"}.fa.fa-clock-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-clock-o:before{content:"\f017"}.fa.fa-arrow-circle-o-down{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-arrow-circle-o-down:before{content:"\f358"}.fa.fa-arrow-circle-o-up{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-arrow-circle-o-up:before{content:"\f35b"}.fa.fa-play-circle-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-play-circle-o:before{content:"\f144"}.fa.fa-repeat:before,.fa.fa-rotate-right:before{content:"\f01e"}.fa.fa-refresh:before{content:"\f021"}.fa.fa-list-alt{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-list-alt:before{content:"\f022"}.fa.fa-dedent:before{content:"\f03b"}.fa.fa-video-camera:before{content:"\f03d"}.fa.fa-picture-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-picture-o:before{content:"\f03e"}.fa.fa-photo{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-photo:before{content:"\f03e"}.fa.fa-image{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-image:before{content:"\f03e"}.fa.fa-map-marker:before{content:"\f3c5"}.fa.fa-pencil-square-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-pencil-square-o:before{content:"\f044"}.fa.fa-edit{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-edit:before{content:"\f044"}.fa.fa-share-square-o:before{content:"\f14d"}.fa.fa-check-square-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-check-square-o:before{content:"\f14a"}.fa.fa-arrows:before{content:"\f0b2"}.fa.fa-times-circle-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-times-circle-o:before{content:"\f057"}.fa.fa-check-circle-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-check-circle-o:before{content:"\f058"}.fa.fa-mail-forward:before{content:"\f064"}.fa.fa-expand:before{content:"\f424"}.fa.fa-compress:before{content:"\f422"}.fa.fa-eye,.fa.fa-eye-slash{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-warning:before{content:"\f071"}.fa.fa-calendar:before{content:"\f073"}.fa.fa-arrows-v:before{content:"\f338"}.fa.fa-arrows-h:before{content:"\f337"}.fa.fa-bar-chart-o:before,.fa.fa-bar-chart:before{content:"\e0e3"}.fa.fa-twitter-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-twitter-square:before{content:"\f081"}.fa.fa-facebook-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-facebook-square:before{content:"\f082"}.fa.fa-gears:before{content:"\f085"}.fa.fa-thumbs-o-up{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-thumbs-o-up:before{content:"\f164"}.fa.fa-thumbs-o-down{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-thumbs-o-down:before{content:"\f165"}.fa.fa-heart-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-heart-o:before{content:"\f004"}.fa.fa-sign-out:before{content:"\f2f5"}.fa.fa-linkedin-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-linkedin-square:before{content:"\f08c"}.fa.fa-thumb-tack:before{content:"\f08d"}.fa.fa-external-link:before{content:"\f35d"}.fa.fa-sign-in:before{content:"\f2f6"}.fa.fa-github-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-github-square:before{content:"\f092"}.fa.fa-lemon-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-lemon-o:before{content:"\f094"}.fa.fa-square-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-square-o:before{content:"\f0c8"}.fa.fa-bookmark-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-bookmark-o:before{content:"\f02e"}.fa.fa-facebook,.fa.fa-twitter{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-facebook:before{content:"\f39e"}.fa.fa-facebook-f{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-facebook-f:before{content:"\f39e"}.fa.fa-github{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-credit-card{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-feed:before{content:"\f09e"}.fa.fa-hdd-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hdd-o:before{content:"\f0a0"}.fa.fa-hand-o-right{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-o-right:before{content:"\f0a4"}.fa.fa-hand-o-left{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-o-left:before{content:"\f0a5"}.fa.fa-hand-o-up{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-o-up:before{content:"\f0a6"}.fa.fa-hand-o-down{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-o-down:before{content:"\f0a7"}.fa.fa-globe:before{content:"\f57d"}.fa.fa-tasks:before{content:"\f828"}.fa.fa-arrows-alt:before{content:"\f31e"}.fa.fa-group:before{content:"\f0c0"}.fa.fa-chain:before{content:"\f0c1"}.fa.fa-cut:before{content:"\f0c4"}.fa.fa-files-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-files-o:before{content:"\f0c5"}.fa.fa-floppy-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-floppy-o:before{content:"\f0c7"}.fa.fa-save{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-save:before{content:"\f0c7"}.fa.fa-navicon:before,.fa.fa-reorder:before{content:"\f0c9"}.fa.fa-magic:before{content:"\e2ca"}.fa.fa-pinterest,.fa.fa-pinterest-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-pinterest-square:before{content:"\f0d3"}.fa.fa-google-plus-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-google-plus-square:before{content:"\f0d4"}.fa.fa-google-plus{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-google-plus:before{content:"\f0d5"}.fa.fa-money:before{content:"\f3d1"}.fa.fa-unsorted:before{content:"\f0dc"}.fa.fa-sort-desc:before{content:"\f0dd"}.fa.fa-sort-asc:before{content:"\f0de"}.fa.fa-linkedin{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-linkedin:before{content:"\f0e1"}.fa.fa-rotate-left:before{content:"\f0e2"}.fa.fa-legal:before{content:"\f0e3"}.fa.fa-dashboard:before,.fa.fa-tachometer:before{content:"\f625"}.fa.fa-comment-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-comment-o:before{content:"\f075"}.fa.fa-comments-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-comments-o:before{content:"\f086"}.fa.fa-flash:before{content:"\f0e7"}.fa.fa-clipboard:before{content:"\f0ea"}.fa.fa-lightbulb-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-lightbulb-o:before{content:"\f0eb"}.fa.fa-exchange:before{content:"\f362"}.fa.fa-cloud-download:before{content:"\f0ed"}.fa.fa-cloud-upload:before{content:"\f0ee"}.fa.fa-bell-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-bell-o:before{content:"\f0f3"}.fa.fa-cutlery:before{content:"\f2e7"}.fa.fa-file-text-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-text-o:before{content:"\f15c"}.fa.fa-building-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-building-o:before{content:"\f1ad"}.fa.fa-hospital-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hospital-o:before{content:"\f0f8"}.fa.fa-tablet:before{content:"\f3fa"}.fa.fa-mobile-phone:before,.fa.fa-mobile:before{content:"\f3cd"}.fa.fa-circle-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-circle-o:before{content:"\f111"}.fa.fa-mail-reply:before{content:"\f3e5"}.fa.fa-github-alt{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-folder-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-folder-o:before{content:"\f07b"}.fa.fa-folder-open-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-folder-open-o:before{content:"\f07c"}.fa.fa-smile-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-smile-o:before{content:"\f118"}.fa.fa-frown-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-frown-o:before{content:"\f119"}.fa.fa-meh-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-meh-o:before{content:"\f11a"}.fa.fa-keyboard-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-keyboard-o:before{content:"\f11c"}.fa.fa-flag-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-flag-o:before{content:"\f024"}.fa.fa-mail-reply-all:before{content:"\f122"}.fa.fa-star-half-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-star-half-o:before{content:"\f5c0"}.fa.fa-star-half-empty{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-star-half-empty:before{content:"\f5c0"}.fa.fa-star-half-full{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-star-half-full:before{content:"\f5c0"}.fa.fa-code-fork:before{content:"\f126"}.fa.fa-chain-broken:before,.fa.fa-unlink:before{content:"\f127"}.fa.fa-calendar-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-calendar-o:before{content:"\f133"}.fa.fa-css3,.fa.fa-html5,.fa.fa-maxcdn{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-unlock-alt:before{content:"\f09c"}.fa.fa-minus-square-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-minus-square-o:before{content:"\f146"}.fa.fa-level-up:before{content:"\f3bf"}.fa.fa-level-down:before{content:"\f3be"}.fa.fa-pencil-square:before{content:"\f14b"}.fa.fa-external-link-square:before{content:"\f360"}.fa.fa-compass{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-caret-square-o-down{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-caret-square-o-down:before{content:"\f150"}.fa.fa-toggle-down{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-toggle-down:before{content:"\f150"}.fa.fa-caret-square-o-up{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-caret-square-o-up:before{content:"\f151"}.fa.fa-toggle-up{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-toggle-up:before{content:"\f151"}.fa.fa-caret-square-o-right{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-caret-square-o-right:before{content:"\f152"}.fa.fa-toggle-right{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-toggle-right:before{content:"\f152"}.fa.fa-eur:before,.fa.fa-euro:before{content:"\f153"}.fa.fa-gbp:before{content:"\f154"}.fa.fa-dollar:before,.fa.fa-usd:before{content:"\24"}.fa.fa-inr:before,.fa.fa-rupee:before{content:"\e1bc"}.fa.fa-cny:before,.fa.fa-jpy:before,.fa.fa-rmb:before,.fa.fa-yen:before{content:"\f157"}.fa.fa-rouble:before,.fa.fa-rub:before,.fa.fa-ruble:before{content:"\f158"}.fa.fa-krw:before,.fa.fa-won:before{content:"\f159"}.fa.fa-bitcoin,.fa.fa-btc{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-bitcoin:before{content:"\f15a"}.fa.fa-file-text:before{content:"\f15c"}.fa.fa-sort-alpha-asc:before{content:"\f15d"}.fa.fa-sort-alpha-desc:before{content:"\f881"}.fa.fa-sort-amount-asc:before{content:"\f884"}.fa.fa-sort-amount-desc:before{content:"\f160"}.fa.fa-sort-numeric-asc:before{content:"\f162"}.fa.fa-sort-numeric-desc:before{content:"\f886"}.fa.fa-youtube-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-youtube-square:before{content:"\f431"}.fa.fa-xing,.fa.fa-xing-square,.fa.fa-youtube{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-xing-square:before{content:"\f169"}.fa.fa-youtube-play{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-youtube-play:before{content:"\f167"}.fa.fa-adn,.fa.fa-bitbucket,.fa.fa-bitbucket-square,.fa.fa-dropbox,.fa.fa-flickr,.fa.fa-instagram,.fa.fa-stack-overflow{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-bitbucket-square:before{content:"\f171"}.fa.fa-tumblr,.fa.fa-tumblr-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-tumblr-square:before{content:"\f174"}.fa.fa-long-arrow-down:before{content:"\f309"}.fa.fa-long-arrow-up:before{content:"\f30c"}.fa.fa-long-arrow-left:before{content:"\f30a"}.fa.fa-long-arrow-right:before{content:"\f30b"}.fa.fa-android,.fa.fa-apple,.fa.fa-dribbble,.fa.fa-foursquare,.fa.fa-gittip,.fa.fa-gratipay,.fa.fa-linux,.fa.fa-skype,.fa.fa-trello,.fa.fa-windows{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-gittip:before{content:"\f184"}.fa.fa-sun-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-sun-o:before{content:"\f185"}.fa.fa-moon-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-moon-o:before{content:"\f186"}.fa.fa-pagelines,.fa.fa-renren,.fa.fa-stack-exchange,.fa.fa-vk,.fa.fa-weibo{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-arrow-circle-o-right{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-arrow-circle-o-right:before{content:"\f35a"}.fa.fa-arrow-circle-o-left{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-arrow-circle-o-left:before{content:"\f359"}.fa.fa-caret-square-o-left{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-caret-square-o-left:before{content:"\f191"}.fa.fa-toggle-left{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-toggle-left:before{content:"\f191"}.fa.fa-dot-circle-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-dot-circle-o:before{content:"\f192"}.fa.fa-vimeo-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-vimeo-square:before{content:"\f194"}.fa.fa-try:before,.fa.fa-turkish-lira:before{content:"\e2bb"}.fa.fa-plus-square-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-plus-square-o:before{content:"\f0fe"}.fa.fa-openid,.fa.fa-slack,.fa.fa-wordpress{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-bank:before,.fa.fa-institution:before{content:"\f19c"}.fa.fa-mortar-board:before{content:"\f19d"}.fa.fa-google,.fa.fa-reddit,.fa.fa-reddit-square,.fa.fa-yahoo{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-reddit-square:before{content:"\f1a2"}.fa.fa-behance,.fa.fa-behance-square,.fa.fa-delicious,.fa.fa-digg,.fa.fa-drupal,.fa.fa-joomla,.fa.fa-pied-piper-alt,.fa.fa-pied-piper-pp,.fa.fa-stumbleupon,.fa.fa-stumbleupon-circle{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-behance-square:before{content:"\f1b5"}.fa.fa-steam,.fa.fa-steam-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-steam-square:before{content:"\f1b7"}.fa.fa-automobile:before{content:"\f1b9"}.fa.fa-cab:before{content:"\f1ba"}.fa.fa-deviantart,.fa.fa-soundcloud,.fa.fa-spotify{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-file-pdf-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-pdf-o:before{content:"\f1c1"}.fa.fa-file-word-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-word-o:before{content:"\f1c2"}.fa.fa-file-excel-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-excel-o:before{content:"\f1c3"}.fa.fa-file-powerpoint-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-powerpoint-o:before{content:"\f1c4"}.fa.fa-file-image-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-image-o:before{content:"\f1c5"}.fa.fa-file-photo-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-photo-o:before{content:"\f1c5"}.fa.fa-file-picture-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-picture-o:before{content:"\f1c5"}.fa.fa-file-archive-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-archive-o:before{content:"\f1c6"}.fa.fa-file-zip-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-zip-o:before{content:"\f1c6"}.fa.fa-file-audio-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-audio-o:before{content:"\f1c7"}.fa.fa-file-sound-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-sound-o:before{content:"\f1c7"}.fa.fa-file-video-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-video-o:before{content:"\f1c8"}.fa.fa-file-movie-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-movie-o:before{content:"\f1c8"}.fa.fa-file-code-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-file-code-o:before{content:"\f1c9"}.fa.fa-codepen,.fa.fa-jsfiddle,.fa.fa-vine{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-life-bouy:before,.fa.fa-life-buoy:before,.fa.fa-life-saver:before,.fa.fa-support:before{content:"\f1cd"}.fa.fa-circle-o-notch:before{content:"\f1ce"}.fa.fa-ra,.fa.fa-rebel{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-ra:before{content:"\f1d0"}.fa.fa-resistance{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-resistance:before{content:"\f1d0"}.fa.fa-empire,.fa.fa-ge{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-ge:before{content:"\f1d1"}.fa.fa-git-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-git-square:before{content:"\f1d2"}.fa.fa-git,.fa.fa-hacker-news,.fa.fa-y-combinator-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-y-combinator-square:before{content:"\f1d4"}.fa.fa-yc-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-yc-square:before{content:"\f1d4"}.fa.fa-qq,.fa.fa-tencent-weibo,.fa.fa-wechat,.fa.fa-weixin{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-wechat:before{content:"\f1d7"}.fa.fa-send:before{content:"\f1d8"}.fa.fa-paper-plane-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-paper-plane-o:before{content:"\f1d8"}.fa.fa-send-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-send-o:before{content:"\f1d8"}.fa.fa-circle-thin{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-circle-thin:before{content:"\f111"}.fa.fa-header:before{content:"\f1dc"}.fa.fa-futbol-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-futbol-o:before{content:"\f1e3"}.fa.fa-soccer-ball-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-soccer-ball-o:before{content:"\f1e3"}.fa.fa-slideshare,.fa.fa-twitch,.fa.fa-yelp{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-newspaper-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-newspaper-o:before{content:"\f1ea"}.fa.fa-cc-amex,.fa.fa-cc-discover,.fa.fa-cc-mastercard,.fa.fa-cc-paypal,.fa.fa-cc-stripe,.fa.fa-cc-visa,.fa.fa-google-wallet,.fa.fa-paypal{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-bell-slash-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-bell-slash-o:before{content:"\f1f6"}.fa.fa-trash:before{content:"\f2ed"}.fa.fa-copyright{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-eyedropper:before{content:"\f1fb"}.fa.fa-area-chart:before{content:"\f1fe"}.fa.fa-pie-chart:before{content:"\f200"}.fa.fa-line-chart:before{content:"\f201"}.fa.fa-lastfm,.fa.fa-lastfm-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-lastfm-square:before{content:"\f203"}.fa.fa-angellist,.fa.fa-ioxhost{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-cc{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-cc:before{content:"\f20a"}.fa.fa-ils:before,.fa.fa-shekel:before,.fa.fa-sheqel:before{content:"\f20b"}.fa.fa-buysellads,.fa.fa-connectdevelop,.fa.fa-dashcube,.fa.fa-forumbee,.fa.fa-leanpub,.fa.fa-sellsy,.fa.fa-shirtsinbulk,.fa.fa-simplybuilt,.fa.fa-skyatlas{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-diamond{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-diamond:before{content:"\f3a5"}.fa.fa-intersex:before,.fa.fa-transgender:before{content:"\f224"}.fa.fa-transgender-alt:before{content:"\f225"}.fa.fa-facebook-official{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-facebook-official:before{content:"\f09a"}.fa.fa-pinterest-p,.fa.fa-whatsapp{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-hotel:before{content:"\f236"}.fa.fa-medium,.fa.fa-viacoin,.fa.fa-y-combinator,.fa.fa-yc{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-yc:before{content:"\f23b"}.fa.fa-expeditedssl,.fa.fa-opencart,.fa.fa-optin-monster{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-battery-4:before,.fa.fa-battery:before{content:"\f240"}.fa.fa-battery-3:before{content:"\f241"}.fa.fa-battery-2:before{content:"\f242"}.fa.fa-battery-1:before{content:"\f243"}.fa.fa-battery-0:before{content:"\f244"}.fa.fa-object-group,.fa.fa-object-ungroup,.fa.fa-sticky-note-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-sticky-note-o:before{content:"\f249"}.fa.fa-cc-diners-club,.fa.fa-cc-jcb{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-clone{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hourglass-o:before{content:"\f254"}.fa.fa-hourglass-1:before{content:"\f251"}.fa.fa-hourglass-2:before{content:"\f252"}.fa.fa-hourglass-3:before{content:"\f253"}.fa.fa-hand-rock-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-rock-o:before{content:"\f255"}.fa.fa-hand-grab-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-grab-o:before{content:"\f255"}.fa.fa-hand-paper-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-paper-o:before{content:"\f256"}.fa.fa-hand-stop-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-stop-o:before{content:"\f256"}.fa.fa-hand-scissors-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-scissors-o:before{content:"\f257"}.fa.fa-hand-lizard-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-lizard-o:before{content:"\f258"}.fa.fa-hand-spock-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-spock-o:before{content:"\f259"}.fa.fa-hand-pointer-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-pointer-o:before{content:"\f25a"}.fa.fa-hand-peace-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-hand-peace-o:before{content:"\f25b"}.fa.fa-registered{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-creative-commons,.fa.fa-gg,.fa.fa-gg-circle,.fa.fa-odnoklassniki,.fa.fa-odnoklassniki-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-odnoklassniki-square:before{content:"\f264"}.fa.fa-chrome,.fa.fa-firefox,.fa.fa-get-pocket,.fa.fa-internet-explorer,.fa.fa-opera,.fa.fa-safari,.fa.fa-wikipedia-w{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-television:before{content:"\f26c"}.fa.fa-500px,.fa.fa-amazon,.fa.fa-contao{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-calendar-plus-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-calendar-plus-o:before{content:"\f271"}.fa.fa-calendar-minus-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-calendar-minus-o:before{content:"\f272"}.fa.fa-calendar-times-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-calendar-times-o:before{content:"\f273"}.fa.fa-calendar-check-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-calendar-check-o:before{content:"\f274"}.fa.fa-map-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-map-o:before{content:"\f279"}.fa.fa-commenting:before{content:"\f4ad"}.fa.fa-commenting-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-commenting-o:before{content:"\f4ad"}.fa.fa-houzz,.fa.fa-vimeo{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-vimeo:before{content:"\f27d"}.fa.fa-black-tie,.fa.fa-edge,.fa.fa-fonticons,.fa.fa-reddit-alien{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-credit-card-alt:before{content:"\f09d"}.fa.fa-codiepie,.fa.fa-fort-awesome,.fa.fa-mixcloud,.fa.fa-modx,.fa.fa-product-hunt,.fa.fa-scribd,.fa.fa-usb{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-pause-circle-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-pause-circle-o:before{content:"\f28b"}.fa.fa-stop-circle-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-stop-circle-o:before{content:"\f28d"}.fa.fa-bluetooth,.fa.fa-bluetooth-b,.fa.fa-envira,.fa.fa-gitlab,.fa.fa-wheelchair-alt,.fa.fa-wpbeginner,.fa.fa-wpforms{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-wheelchair-alt:before{content:"\f368"}.fa.fa-question-circle-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-question-circle-o:before{content:"\f059"}.fa.fa-volume-control-phone:before{content:"\f2a0"}.fa.fa-asl-interpreting:before{content:"\f2a3"}.fa.fa-deafness:before,.fa.fa-hard-of-hearing:before{content:"\f2a4"}.fa.fa-glide,.fa.fa-glide-g{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-signing:before{content:"\f2a7"}.fa.fa-viadeo,.fa.fa-viadeo-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-viadeo-square:before{content:"\f2aa"}.fa.fa-snapchat,.fa.fa-snapchat-ghost{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-snapchat-ghost:before{content:"\f2ab"}.fa.fa-snapchat-square{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-snapchat-square:before{content:"\f2ad"}.fa.fa-first-order,.fa.fa-google-plus-official,.fa.fa-pied-piper,.fa.fa-themeisle,.fa.fa-yoast{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-google-plus-official:before{content:"\f2b3"}.fa.fa-google-plus-circle{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-google-plus-circle:before{content:"\f2b3"}.fa.fa-fa,.fa.fa-font-awesome{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-fa:before{content:"\f2b4"}.fa.fa-handshake-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-handshake-o:before{content:"\f2b5"}.fa.fa-envelope-open-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-envelope-open-o:before{content:"\f2b6"}.fa.fa-linode{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-address-book-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-address-book-o:before{content:"\f2b9"}.fa.fa-vcard:before{content:"\f2bb"}.fa.fa-address-card-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-address-card-o:before{content:"\f2bb"}.fa.fa-vcard-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-vcard-o:before{content:"\f2bb"}.fa.fa-user-circle-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-user-circle-o:before{content:"\f2bd"}.fa.fa-user-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-user-o:before{content:"\f007"}.fa.fa-id-badge{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-drivers-license:before{content:"\f2c2"}.fa.fa-id-card-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-id-card-o:before{content:"\f2c2"}.fa.fa-drivers-license-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-drivers-license-o:before{content:"\f2c2"}.fa.fa-free-code-camp,.fa.fa-quora,.fa.fa-telegram{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-thermometer-4:before,.fa.fa-thermometer:before{content:"\f2c7"}.fa.fa-thermometer-3:before{content:"\f2c8"}.fa.fa-thermometer-2:before{content:"\f2c9"}.fa.fa-thermometer-1:before{content:"\f2ca"}.fa.fa-thermometer-0:before{content:"\f2cb"}.fa.fa-bathtub:before,.fa.fa-s15:before{content:"\f2cd"}.fa.fa-window-maximize,.fa.fa-window-restore{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-times-rectangle:before{content:"\f410"}.fa.fa-window-close-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-window-close-o:before{content:"\f410"}.fa.fa-times-rectangle-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-times-rectangle-o:before{content:"\f410"}.fa.fa-bandcamp,.fa.fa-eercast,.fa.fa-etsy,.fa.fa-grav,.fa.fa-imdb,.fa.fa-ravelry{font-family:"Font Awesome 6 Brands";font-weight:400}.fa.fa-eercast:before{content:"\f2da"}.fa.fa-snowflake-o{font-family:"Font Awesome 6 Free";font-weight:400}.fa.fa-snowflake-o:before{content:"\f2dc"}.fa.fa-meetup,.fa.fa-superpowers,.fa.fa-wpexplorer{font-family:"Font Awesome 6 Brands";font-weight:400}
\ No newline at end of file
diff --git a/docs/deps/font-awesome-6.5.2/webfonts/fa-brands-400.ttf b/docs/deps/font-awesome-6.5.2/webfonts/fa-brands-400.ttf
new file mode 100644
index 0000000..1fbb1f7
Binary files /dev/null and b/docs/deps/font-awesome-6.5.2/webfonts/fa-brands-400.ttf differ
diff --git a/docs/deps/font-awesome-6.5.2/webfonts/fa-brands-400.woff2 b/docs/deps/font-awesome-6.5.2/webfonts/fa-brands-400.woff2
new file mode 100644
index 0000000..5d28021
Binary files /dev/null and b/docs/deps/font-awesome-6.5.2/webfonts/fa-brands-400.woff2 differ
diff --git a/docs/deps/font-awesome-6.5.2/webfonts/fa-regular-400.ttf b/docs/deps/font-awesome-6.5.2/webfonts/fa-regular-400.ttf
new file mode 100644
index 0000000..549d68d
Binary files /dev/null and b/docs/deps/font-awesome-6.5.2/webfonts/fa-regular-400.ttf differ
diff --git a/docs/deps/font-awesome-6.5.2/webfonts/fa-regular-400.woff2 b/docs/deps/font-awesome-6.5.2/webfonts/fa-regular-400.woff2
new file mode 100644
index 0000000..18400d7
Binary files /dev/null and b/docs/deps/font-awesome-6.5.2/webfonts/fa-regular-400.woff2 differ
diff --git a/docs/deps/font-awesome-6.5.2/webfonts/fa-solid-900.ttf b/docs/deps/font-awesome-6.5.2/webfonts/fa-solid-900.ttf
new file mode 100644
index 0000000..bb2a869
Binary files /dev/null and b/docs/deps/font-awesome-6.5.2/webfonts/fa-solid-900.ttf differ
diff --git a/docs/deps/font-awesome-6.5.2/webfonts/fa-solid-900.woff2 b/docs/deps/font-awesome-6.5.2/webfonts/fa-solid-900.woff2
new file mode 100644
index 0000000..758dd4f
Binary files /dev/null and b/docs/deps/font-awesome-6.5.2/webfonts/fa-solid-900.woff2 differ
diff --git a/docs/deps/font-awesome-6.5.2/webfonts/fa-v4compatibility.ttf b/docs/deps/font-awesome-6.5.2/webfonts/fa-v4compatibility.ttf
new file mode 100644
index 0000000..8c5864c
Binary files /dev/null and b/docs/deps/font-awesome-6.5.2/webfonts/fa-v4compatibility.ttf differ
diff --git a/docs/deps/font-awesome-6.5.2/webfonts/fa-v4compatibility.woff2 b/docs/deps/font-awesome-6.5.2/webfonts/fa-v4compatibility.woff2
new file mode 100644
index 0000000..f94bec2
Binary files /dev/null and b/docs/deps/font-awesome-6.5.2/webfonts/fa-v4compatibility.woff2 differ
diff --git a/docs/deps/headroom-0.11.0/headroom.min.js b/docs/deps/headroom-0.11.0/headroom.min.js
new file mode 100644
index 0000000..433069f
--- /dev/null
+++ b/docs/deps/headroom-0.11.0/headroom.min.js
@@ -0,0 +1,7 @@
+/*!
+ * headroom.js v0.11.0 - Give your page some headroom. Hide your header until you need it
+ * Copyright (c) 2020 Nick Williams - http://wicky.nillia.ms/headroom.js
+ * License: MIT
+ */
+
+!function(t,n){"object"==typeof exports&&"undefined"!=typeof module?module.exports=n():"function"==typeof define&&define.amd?define(n):(t=t||self).Headroom=n()}(this,function(){"use strict";function t(){return"undefined"!=typeof window}function d(t){return function(t){return t&&t.document&&function(t){return 9===t.nodeType}(t.document)}(t)?function(t){var n=t.document,o=n.body,s=n.documentElement;return{scrollHeight:function(){return Math.max(o.scrollHeight,s.scrollHeight,o.offsetHeight,s.offsetHeight,o.clientHeight,s.clientHeight)},height:function(){return t.innerHeight||s.clientHeight||o.clientHeight},scrollY:function(){return void 0!==t.pageYOffset?t.pageYOffset:(s||o.parentNode||o).scrollTop}}}(t):function(t){return{scrollHeight:function(){return Math.max(t.scrollHeight,t.offsetHeight,t.clientHeight)},height:function(){return Math.max(t.offsetHeight,t.clientHeight)},scrollY:function(){return t.scrollTop}}}(t)}function n(t,s,e){var n,o=function(){var n=!1;try{var t={get passive(){n=!0}};window.addEventListener("test",t,t),window.removeEventListener("test",t,t)}catch(t){n=!1}return n}(),i=!1,r=d(t),l=r.scrollY(),a={};function c(){var t=Math.round(r.scrollY()),n=r.height(),o=r.scrollHeight();a.scrollY=t,a.lastScrollY=l,a.direction=ls.tolerance[a.direction],e(a),l=t,i=!1}function h(){i||(i=!0,n=requestAnimationFrame(c))}var u=!!o&&{passive:!0,capture:!1};return t.addEventListener("scroll",h,u),c(),{destroy:function(){cancelAnimationFrame(n),t.removeEventListener("scroll",h,u)}}}function o(t,n){n=n||{},Object.assign(this,o.options,n),this.classes=Object.assign({},o.options.classes,n.classes),this.elem=t,this.tolerance=function(t){return t===Object(t)?t:{down:t,up:t}}(this.tolerance),this.initialised=!1,this.frozen=!1}return o.prototype={constructor:o,init:function(){return o.cutsTheMustard&&!this.initialised&&(this.addClass("initial"),this.initialised=!0,setTimeout(function(t){t.scrollTracker=n(t.scroller,{offset:t.offset,tolerance:t.tolerance},t.update.bind(t))},100,this)),this},destroy:function(){this.initialised=!1,Object.keys(this.classes).forEach(this.removeClass,this),this.scrollTracker.destroy()},unpin:function(){!this.hasClass("pinned")&&this.hasClass("unpinned")||(this.addClass("unpinned"),this.removeClass("pinned"),this.onUnpin&&this.onUnpin.call(this))},pin:function(){this.hasClass("unpinned")&&(this.addClass("pinned"),this.removeClass("unpinned"),this.onPin&&this.onPin.call(this))},freeze:function(){this.frozen=!0,this.addClass("frozen")},unfreeze:function(){this.frozen=!1,this.removeClass("frozen")},top:function(){this.hasClass("top")||(this.addClass("top"),this.removeClass("notTop"),this.onTop&&this.onTop.call(this))},notTop:function(){this.hasClass("notTop")||(this.addClass("notTop"),this.removeClass("top"),this.onNotTop&&this.onNotTop.call(this))},bottom:function(){this.hasClass("bottom")||(this.addClass("bottom"),this.removeClass("notBottom"),this.onBottom&&this.onBottom.call(this))},notBottom:function(){this.hasClass("notBottom")||(this.addClass("notBottom"),this.removeClass("bottom"),this.onNotBottom&&this.onNotBottom.call(this))},shouldUnpin:function(t){return"down"===t.direction&&!t.top&&t.toleranceExceeded},shouldPin:function(t){return"up"===t.direction&&t.toleranceExceeded||t.top},addClass:function(t){this.elem.classList.add.apply(this.elem.classList,this.classes[t].split(" "))},removeClass:function(t){this.elem.classList.remove.apply(this.elem.classList,this.classes[t].split(" "))},hasClass:function(t){return this.classes[t].split(" ").every(function(t){return this.classList.contains(t)},this.elem)},update:function(t){t.isOutOfBounds||!0!==this.frozen&&(t.top?this.top():this.notTop(),t.bottom?this.bottom():this.notBottom(),this.shouldUnpin(t)?this.unpin():this.shouldPin(t)&&this.pin())}},o.options={tolerance:{up:0,down:0},offset:0,scroller:t()?window:null,classes:{frozen:"headroom--frozen",pinned:"headroom--pinned",unpinned:"headroom--unpinned",top:"headroom--top",notTop:"headroom--not-top",bottom:"headroom--bottom",notBottom:"headroom--not-bottom",initial:"headroom"}},o.cutsTheMustard=!!(t()&&function(){}.bind&&"classList"in document.documentElement&&Object.assign&&Object.keys&&requestAnimationFrame),o});
\ No newline at end of file
diff --git a/docs/deps/headroom-0.11.0/jQuery.headroom.min.js b/docs/deps/headroom-0.11.0/jQuery.headroom.min.js
new file mode 100644
index 0000000..17f70c9
--- /dev/null
+++ b/docs/deps/headroom-0.11.0/jQuery.headroom.min.js
@@ -0,0 +1,7 @@
+/*!
+ * headroom.js v0.9.4 - Give your page some headroom. Hide your header until you need it
+ * Copyright (c) 2017 Nick Williams - http://wicky.nillia.ms/headroom.js
+ * License: MIT
+ */
+
+!function(a){a&&(a.fn.headroom=function(b){return this.each(function(){var c=a(this),d=c.data("headroom"),e="object"==typeof b&&b;e=a.extend(!0,{},Headroom.options,e),d||(d=new Headroom(this,e),d.init(),c.data("headroom",d)),"string"==typeof b&&(d[b](),"destroy"===b&&c.removeData("headroom"))})},a("[data-headroom]").each(function(){var b=a(this);b.headroom(b.data())}))}(window.Zepto||window.jQuery);
\ No newline at end of file
diff --git a/docs/deps/jquery-3.6.0/jquery-3.6.0.js b/docs/deps/jquery-3.6.0/jquery-3.6.0.js
new file mode 100644
index 0000000..fc6c299
--- /dev/null
+++ b/docs/deps/jquery-3.6.0/jquery-3.6.0.js
@@ -0,0 +1,10881 @@
+/*!
+ * jQuery JavaScript Library v3.6.0
+ * https://jquery.com/
+ *
+ * Includes Sizzle.js
+ * https://sizzlejs.com/
+ *
+ * Copyright OpenJS Foundation and other contributors
+ * Released under the MIT license
+ * https://jquery.org/license
+ *
+ * Date: 2021-03-02T17:08Z
+ */
+( function( global, factory ) {
+
+ "use strict";
+
+ if ( typeof module === "object" && typeof module.exports === "object" ) {
+
+ // For CommonJS and CommonJS-like environments where a proper `window`
+ // is present, execute the factory and get jQuery.
+ // For environments that do not have a `window` with a `document`
+ // (such as Node.js), expose a factory as module.exports.
+ // This accentuates the need for the creation of a real `window`.
+ // e.g. var jQuery = require("jquery")(window);
+ // See ticket #14549 for more info.
+ module.exports = global.document ?
+ factory( global, true ) :
+ function( w ) {
+ if ( !w.document ) {
+ throw new Error( "jQuery requires a window with a document" );
+ }
+ return factory( w );
+ };
+ } else {
+ factory( global );
+ }
+
+// Pass this if window is not defined yet
+} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) {
+
+// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1
+// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode
+// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common
+// enough that all such attempts are guarded in a try block.
+"use strict";
+
+var arr = [];
+
+var getProto = Object.getPrototypeOf;
+
+var slice = arr.slice;
+
+var flat = arr.flat ? function( array ) {
+ return arr.flat.call( array );
+} : function( array ) {
+ return arr.concat.apply( [], array );
+};
+
+
+var push = arr.push;
+
+var indexOf = arr.indexOf;
+
+var class2type = {};
+
+var toString = class2type.toString;
+
+var hasOwn = class2type.hasOwnProperty;
+
+var fnToString = hasOwn.toString;
+
+var ObjectFunctionString = fnToString.call( Object );
+
+var support = {};
+
+var isFunction = function isFunction( obj ) {
+
+ // Support: Chrome <=57, Firefox <=52
+ // In some browsers, typeof returns "function" for HTML elements
+ // (i.e., `typeof document.createElement( "object" ) === "function"`).
+ // We don't want to classify *any* DOM node as a function.
+ // Support: QtWeb <=3.8.5, WebKit <=534.34, wkhtmltopdf tool <=0.12.5
+ // Plus for old WebKit, typeof returns "function" for HTML collections
+ // (e.g., `typeof document.getElementsByTagName("div") === "function"`). (gh-4756)
+ return typeof obj === "function" && typeof obj.nodeType !== "number" &&
+ typeof obj.item !== "function";
+ };
+
+
+var isWindow = function isWindow( obj ) {
+ return obj != null && obj === obj.window;
+ };
+
+
+var document = window.document;
+
+
+
+ var preservedScriptAttributes = {
+ type: true,
+ src: true,
+ nonce: true,
+ noModule: true
+ };
+
+ function DOMEval( code, node, doc ) {
+ doc = doc || document;
+
+ var i, val,
+ script = doc.createElement( "script" );
+
+ script.text = code;
+ if ( node ) {
+ for ( i in preservedScriptAttributes ) {
+
+ // Support: Firefox 64+, Edge 18+
+ // Some browsers don't support the "nonce" property on scripts.
+ // On the other hand, just using `getAttribute` is not enough as
+ // the `nonce` attribute is reset to an empty string whenever it
+ // becomes browsing-context connected.
+ // See https://github.com/whatwg/html/issues/2369
+ // See https://html.spec.whatwg.org/#nonce-attributes
+ // The `node.getAttribute` check was added for the sake of
+ // `jQuery.globalEval` so that it can fake a nonce-containing node
+ // via an object.
+ val = node[ i ] || node.getAttribute && node.getAttribute( i );
+ if ( val ) {
+ script.setAttribute( i, val );
+ }
+ }
+ }
+ doc.head.appendChild( script ).parentNode.removeChild( script );
+ }
+
+
+function toType( obj ) {
+ if ( obj == null ) {
+ return obj + "";
+ }
+
+ // Support: Android <=2.3 only (functionish RegExp)
+ return typeof obj === "object" || typeof obj === "function" ?
+ class2type[ toString.call( obj ) ] || "object" :
+ typeof obj;
+}
+/* global Symbol */
+// Defining this global in .eslintrc.json would create a danger of using the global
+// unguarded in another place, it seems safer to define global only for this module
+
+
+
+var
+ version = "3.6.0",
+
+ // Define a local copy of jQuery
+ jQuery = function( selector, context ) {
+
+ // The jQuery object is actually just the init constructor 'enhanced'
+ // Need init if jQuery is called (just allow error to be thrown if not included)
+ return new jQuery.fn.init( selector, context );
+ };
+
+jQuery.fn = jQuery.prototype = {
+
+ // The current version of jQuery being used
+ jquery: version,
+
+ constructor: jQuery,
+
+ // The default length of a jQuery object is 0
+ length: 0,
+
+ toArray: function() {
+ return slice.call( this );
+ },
+
+ // Get the Nth element in the matched element set OR
+ // Get the whole matched element set as a clean array
+ get: function( num ) {
+
+ // Return all the elements in a clean array
+ if ( num == null ) {
+ return slice.call( this );
+ }
+
+ // Return just the one element from the set
+ return num < 0 ? this[ num + this.length ] : this[ num ];
+ },
+
+ // Take an array of elements and push it onto the stack
+ // (returning the new matched element set)
+ pushStack: function( elems ) {
+
+ // Build a new jQuery matched element set
+ var ret = jQuery.merge( this.constructor(), elems );
+
+ // Add the old object onto the stack (as a reference)
+ ret.prevObject = this;
+
+ // Return the newly-formed element set
+ return ret;
+ },
+
+ // Execute a callback for every element in the matched set.
+ each: function( callback ) {
+ return jQuery.each( this, callback );
+ },
+
+ map: function( callback ) {
+ return this.pushStack( jQuery.map( this, function( elem, i ) {
+ return callback.call( elem, i, elem );
+ } ) );
+ },
+
+ slice: function() {
+ return this.pushStack( slice.apply( this, arguments ) );
+ },
+
+ first: function() {
+ return this.eq( 0 );
+ },
+
+ last: function() {
+ return this.eq( -1 );
+ },
+
+ even: function() {
+ return this.pushStack( jQuery.grep( this, function( _elem, i ) {
+ return ( i + 1 ) % 2;
+ } ) );
+ },
+
+ odd: function() {
+ return this.pushStack( jQuery.grep( this, function( _elem, i ) {
+ return i % 2;
+ } ) );
+ },
+
+ eq: function( i ) {
+ var len = this.length,
+ j = +i + ( i < 0 ? len : 0 );
+ return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] );
+ },
+
+ end: function() {
+ return this.prevObject || this.constructor();
+ },
+
+ // For internal use only.
+ // Behaves like an Array's method, not like a jQuery method.
+ push: push,
+ sort: arr.sort,
+ splice: arr.splice
+};
+
+jQuery.extend = jQuery.fn.extend = function() {
+ var options, name, src, copy, copyIsArray, clone,
+ target = arguments[ 0 ] || {},
+ i = 1,
+ length = arguments.length,
+ deep = false;
+
+ // Handle a deep copy situation
+ if ( typeof target === "boolean" ) {
+ deep = target;
+
+ // Skip the boolean and the target
+ target = arguments[ i ] || {};
+ i++;
+ }
+
+ // Handle case when target is a string or something (possible in deep copy)
+ if ( typeof target !== "object" && !isFunction( target ) ) {
+ target = {};
+ }
+
+ // Extend jQuery itself if only one argument is passed
+ if ( i === length ) {
+ target = this;
+ i--;
+ }
+
+ for ( ; i < length; i++ ) {
+
+ // Only deal with non-null/undefined values
+ if ( ( options = arguments[ i ] ) != null ) {
+
+ // Extend the base object
+ for ( name in options ) {
+ copy = options[ name ];
+
+ // Prevent Object.prototype pollution
+ // Prevent never-ending loop
+ if ( name === "__proto__" || target === copy ) {
+ continue;
+ }
+
+ // Recurse if we're merging plain objects or arrays
+ if ( deep && copy && ( jQuery.isPlainObject( copy ) ||
+ ( copyIsArray = Array.isArray( copy ) ) ) ) {
+ src = target[ name ];
+
+ // Ensure proper type for the source value
+ if ( copyIsArray && !Array.isArray( src ) ) {
+ clone = [];
+ } else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) {
+ clone = {};
+ } else {
+ clone = src;
+ }
+ copyIsArray = false;
+
+ // Never move original objects, clone them
+ target[ name ] = jQuery.extend( deep, clone, copy );
+
+ // Don't bring in undefined values
+ } else if ( copy !== undefined ) {
+ target[ name ] = copy;
+ }
+ }
+ }
+ }
+
+ // Return the modified object
+ return target;
+};
+
+jQuery.extend( {
+
+ // Unique for each copy of jQuery on the page
+ expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ),
+
+ // Assume jQuery is ready without the ready module
+ isReady: true,
+
+ error: function( msg ) {
+ throw new Error( msg );
+ },
+
+ noop: function() {},
+
+ isPlainObject: function( obj ) {
+ var proto, Ctor;
+
+ // Detect obvious negatives
+ // Use toString instead of jQuery.type to catch host objects
+ if ( !obj || toString.call( obj ) !== "[object Object]" ) {
+ return false;
+ }
+
+ proto = getProto( obj );
+
+ // Objects with no prototype (e.g., `Object.create( null )`) are plain
+ if ( !proto ) {
+ return true;
+ }
+
+ // Objects with prototype are plain iff they were constructed by a global Object function
+ Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor;
+ return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString;
+ },
+
+ isEmptyObject: function( obj ) {
+ var name;
+
+ for ( name in obj ) {
+ return false;
+ }
+ return true;
+ },
+
+ // Evaluates a script in a provided context; falls back to the global one
+ // if not specified.
+ globalEval: function( code, options, doc ) {
+ DOMEval( code, { nonce: options && options.nonce }, doc );
+ },
+
+ each: function( obj, callback ) {
+ var length, i = 0;
+
+ if ( isArrayLike( obj ) ) {
+ length = obj.length;
+ for ( ; i < length; i++ ) {
+ if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
+ break;
+ }
+ }
+ } else {
+ for ( i in obj ) {
+ if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
+ break;
+ }
+ }
+ }
+
+ return obj;
+ },
+
+ // results is for internal usage only
+ makeArray: function( arr, results ) {
+ var ret = results || [];
+
+ if ( arr != null ) {
+ if ( isArrayLike( Object( arr ) ) ) {
+ jQuery.merge( ret,
+ typeof arr === "string" ?
+ [ arr ] : arr
+ );
+ } else {
+ push.call( ret, arr );
+ }
+ }
+
+ return ret;
+ },
+
+ inArray: function( elem, arr, i ) {
+ return arr == null ? -1 : indexOf.call( arr, elem, i );
+ },
+
+ // Support: Android <=4.0 only, PhantomJS 1 only
+ // push.apply(_, arraylike) throws on ancient WebKit
+ merge: function( first, second ) {
+ var len = +second.length,
+ j = 0,
+ i = first.length;
+
+ for ( ; j < len; j++ ) {
+ first[ i++ ] = second[ j ];
+ }
+
+ first.length = i;
+
+ return first;
+ },
+
+ grep: function( elems, callback, invert ) {
+ var callbackInverse,
+ matches = [],
+ i = 0,
+ length = elems.length,
+ callbackExpect = !invert;
+
+ // Go through the array, only saving the items
+ // that pass the validator function
+ for ( ; i < length; i++ ) {
+ callbackInverse = !callback( elems[ i ], i );
+ if ( callbackInverse !== callbackExpect ) {
+ matches.push( elems[ i ] );
+ }
+ }
+
+ return matches;
+ },
+
+ // arg is for internal usage only
+ map: function( elems, callback, arg ) {
+ var length, value,
+ i = 0,
+ ret = [];
+
+ // Go through the array, translating each of the items to their new values
+ if ( isArrayLike( elems ) ) {
+ length = elems.length;
+ for ( ; i < length; i++ ) {
+ value = callback( elems[ i ], i, arg );
+
+ if ( value != null ) {
+ ret.push( value );
+ }
+ }
+
+ // Go through every key on the object,
+ } else {
+ for ( i in elems ) {
+ value = callback( elems[ i ], i, arg );
+
+ if ( value != null ) {
+ ret.push( value );
+ }
+ }
+ }
+
+ // Flatten any nested arrays
+ return flat( ret );
+ },
+
+ // A global GUID counter for objects
+ guid: 1,
+
+ // jQuery.support is not used in Core but other projects attach their
+ // properties to it so it needs to exist.
+ support: support
+} );
+
+if ( typeof Symbol === "function" ) {
+ jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ];
+}
+
+// Populate the class2type map
+jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ),
+ function( _i, name ) {
+ class2type[ "[object " + name + "]" ] = name.toLowerCase();
+ } );
+
+function isArrayLike( obj ) {
+
+ // Support: real iOS 8.2 only (not reproducible in simulator)
+ // `in` check used to prevent JIT error (gh-2145)
+ // hasOwn isn't used here due to false negatives
+ // regarding Nodelist length in IE
+ var length = !!obj && "length" in obj && obj.length,
+ type = toType( obj );
+
+ if ( isFunction( obj ) || isWindow( obj ) ) {
+ return false;
+ }
+
+ return type === "array" || length === 0 ||
+ typeof length === "number" && length > 0 && ( length - 1 ) in obj;
+}
+var Sizzle =
+/*!
+ * Sizzle CSS Selector Engine v2.3.6
+ * https://sizzlejs.com/
+ *
+ * Copyright JS Foundation and other contributors
+ * Released under the MIT license
+ * https://js.foundation/
+ *
+ * Date: 2021-02-16
+ */
+( function( window ) {
+var i,
+ support,
+ Expr,
+ getText,
+ isXML,
+ tokenize,
+ compile,
+ select,
+ outermostContext,
+ sortInput,
+ hasDuplicate,
+
+ // Local document vars
+ setDocument,
+ document,
+ docElem,
+ documentIsHTML,
+ rbuggyQSA,
+ rbuggyMatches,
+ matches,
+ contains,
+
+ // Instance-specific data
+ expando = "sizzle" + 1 * new Date(),
+ preferredDoc = window.document,
+ dirruns = 0,
+ done = 0,
+ classCache = createCache(),
+ tokenCache = createCache(),
+ compilerCache = createCache(),
+ nonnativeSelectorCache = createCache(),
+ sortOrder = function( a, b ) {
+ if ( a === b ) {
+ hasDuplicate = true;
+ }
+ return 0;
+ },
+
+ // Instance methods
+ hasOwn = ( {} ).hasOwnProperty,
+ arr = [],
+ pop = arr.pop,
+ pushNative = arr.push,
+ push = arr.push,
+ slice = arr.slice,
+
+ // Use a stripped-down indexOf as it's faster than native
+ // https://jsperf.com/thor-indexof-vs-for/5
+ indexOf = function( list, elem ) {
+ var i = 0,
+ len = list.length;
+ for ( ; i < len; i++ ) {
+ if ( list[ i ] === elem ) {
+ return i;
+ }
+ }
+ return -1;
+ },
+
+ booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|" +
+ "ismap|loop|multiple|open|readonly|required|scoped",
+
+ // Regular expressions
+
+ // http://www.w3.org/TR/css3-selectors/#whitespace
+ whitespace = "[\\x20\\t\\r\\n\\f]",
+
+ // https://www.w3.org/TR/css-syntax-3/#ident-token-diagram
+ identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace +
+ "?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+",
+
+ // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors
+ attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace +
+
+ // Operator (capture 2)
+ "*([*^$|!~]?=)" + whitespace +
+
+ // "Attribute values must be CSS identifiers [capture 5]
+ // or strings [capture 3 or capture 4]"
+ "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" +
+ whitespace + "*\\]",
+
+ pseudos = ":(" + identifier + ")(?:\\((" +
+
+ // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:
+ // 1. quoted (capture 3; capture 4 or capture 5)
+ "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" +
+
+ // 2. simple (capture 6)
+ "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" +
+
+ // 3. anything else (capture 2)
+ ".*" +
+ ")\\)|)",
+
+ // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
+ rwhitespace = new RegExp( whitespace + "+", "g" ),
+ rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" +
+ whitespace + "+$", "g" ),
+
+ rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ),
+ rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace +
+ "*" ),
+ rdescend = new RegExp( whitespace + "|>" ),
+
+ rpseudo = new RegExp( pseudos ),
+ ridentifier = new RegExp( "^" + identifier + "$" ),
+
+ matchExpr = {
+ "ID": new RegExp( "^#(" + identifier + ")" ),
+ "CLASS": new RegExp( "^\\.(" + identifier + ")" ),
+ "TAG": new RegExp( "^(" + identifier + "|[*])" ),
+ "ATTR": new RegExp( "^" + attributes ),
+ "PSEUDO": new RegExp( "^" + pseudos ),
+ "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" +
+ whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" +
+ whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
+ "bool": new RegExp( "^(?:" + booleans + ")$", "i" ),
+
+ // For use in libraries implementing .is()
+ // We use this for POS matching in `select`
+ "needsContext": new RegExp( "^" + whitespace +
+ "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace +
+ "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" )
+ },
+
+ rhtml = /HTML$/i,
+ rinputs = /^(?:input|select|textarea|button)$/i,
+ rheader = /^h\d$/i,
+
+ rnative = /^[^{]+\{\s*\[native \w/,
+
+ // Easily-parseable/retrievable ID or TAG or CLASS selectors
+ rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
+
+ rsibling = /[+~]/,
+
+ // CSS escapes
+ // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
+ runescape = new RegExp( "\\\\[\\da-fA-F]{1,6}" + whitespace + "?|\\\\([^\\r\\n\\f])", "g" ),
+ funescape = function( escape, nonHex ) {
+ var high = "0x" + escape.slice( 1 ) - 0x10000;
+
+ return nonHex ?
+
+ // Strip the backslash prefix from a non-hex escape sequence
+ nonHex :
+
+ // Replace a hexadecimal escape sequence with the encoded Unicode code point
+ // Support: IE <=11+
+ // For values outside the Basic Multilingual Plane (BMP), manually construct a
+ // surrogate pair
+ high < 0 ?
+ String.fromCharCode( high + 0x10000 ) :
+ String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );
+ },
+
+ // CSS string/identifier serialization
+ // https://drafts.csswg.org/cssom/#common-serializing-idioms
+ rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,
+ fcssescape = function( ch, asCodePoint ) {
+ if ( asCodePoint ) {
+
+ // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
+ if ( ch === "\0" ) {
+ return "\uFFFD";
+ }
+
+ // Control characters and (dependent upon position) numbers get escaped as code points
+ return ch.slice( 0, -1 ) + "\\" +
+ ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " ";
+ }
+
+ // Other potentially-special ASCII characters get backslash-escaped
+ return "\\" + ch;
+ },
+
+ // Used for iframes
+ // See setDocument()
+ // Removing the function wrapper causes a "Permission Denied"
+ // error in IE
+ unloadHandler = function() {
+ setDocument();
+ },
+
+ inDisabledFieldset = addCombinator(
+ function( elem ) {
+ return elem.disabled === true && elem.nodeName.toLowerCase() === "fieldset";
+ },
+ { dir: "parentNode", next: "legend" }
+ );
+
+// Optimize for push.apply( _, NodeList )
+try {
+ push.apply(
+ ( arr = slice.call( preferredDoc.childNodes ) ),
+ preferredDoc.childNodes
+ );
+
+ // Support: Android<4.0
+ // Detect silently failing push.apply
+ // eslint-disable-next-line no-unused-expressions
+ arr[ preferredDoc.childNodes.length ].nodeType;
+} catch ( e ) {
+ push = { apply: arr.length ?
+
+ // Leverage slice if possible
+ function( target, els ) {
+ pushNative.apply( target, slice.call( els ) );
+ } :
+
+ // Support: IE<9
+ // Otherwise append directly
+ function( target, els ) {
+ var j = target.length,
+ i = 0;
+
+ // Can't trust NodeList.length
+ while ( ( target[ j++ ] = els[ i++ ] ) ) {}
+ target.length = j - 1;
+ }
+ };
+}
+
+function Sizzle( selector, context, results, seed ) {
+ var m, i, elem, nid, match, groups, newSelector,
+ newContext = context && context.ownerDocument,
+
+ // nodeType defaults to 9, since context defaults to document
+ nodeType = context ? context.nodeType : 9;
+
+ results = results || [];
+
+ // Return early from calls with invalid selector or context
+ if ( typeof selector !== "string" || !selector ||
+ nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) {
+
+ return results;
+ }
+
+ // Try to shortcut find operations (as opposed to filters) in HTML documents
+ if ( !seed ) {
+ setDocument( context );
+ context = context || document;
+
+ if ( documentIsHTML ) {
+
+ // If the selector is sufficiently simple, try using a "get*By*" DOM method
+ // (excepting DocumentFragment context, where the methods don't exist)
+ if ( nodeType !== 11 && ( match = rquickExpr.exec( selector ) ) ) {
+
+ // ID selector
+ if ( ( m = match[ 1 ] ) ) {
+
+ // Document context
+ if ( nodeType === 9 ) {
+ if ( ( elem = context.getElementById( m ) ) ) {
+
+ // Support: IE, Opera, Webkit
+ // TODO: identify versions
+ // getElementById can match elements by name instead of ID
+ if ( elem.id === m ) {
+ results.push( elem );
+ return results;
+ }
+ } else {
+ return results;
+ }
+
+ // Element context
+ } else {
+
+ // Support: IE, Opera, Webkit
+ // TODO: identify versions
+ // getElementById can match elements by name instead of ID
+ if ( newContext && ( elem = newContext.getElementById( m ) ) &&
+ contains( context, elem ) &&
+ elem.id === m ) {
+
+ results.push( elem );
+ return results;
+ }
+ }
+
+ // Type selector
+ } else if ( match[ 2 ] ) {
+ push.apply( results, context.getElementsByTagName( selector ) );
+ return results;
+
+ // Class selector
+ } else if ( ( m = match[ 3 ] ) && support.getElementsByClassName &&
+ context.getElementsByClassName ) {
+
+ push.apply( results, context.getElementsByClassName( m ) );
+ return results;
+ }
+ }
+
+ // Take advantage of querySelectorAll
+ if ( support.qsa &&
+ !nonnativeSelectorCache[ selector + " " ] &&
+ ( !rbuggyQSA || !rbuggyQSA.test( selector ) ) &&
+
+ // Support: IE 8 only
+ // Exclude object elements
+ ( nodeType !== 1 || context.nodeName.toLowerCase() !== "object" ) ) {
+
+ newSelector = selector;
+ newContext = context;
+
+ // qSA considers elements outside a scoping root when evaluating child or
+ // descendant combinators, which is not what we want.
+ // In such cases, we work around the behavior by prefixing every selector in the
+ // list with an ID selector referencing the scope context.
+ // The technique has to be used as well when a leading combinator is used
+ // as such selectors are not recognized by querySelectorAll.
+ // Thanks to Andrew Dupont for this technique.
+ if ( nodeType === 1 &&
+ ( rdescend.test( selector ) || rcombinators.test( selector ) ) ) {
+
+ // Expand context for sibling selectors
+ newContext = rsibling.test( selector ) && testContext( context.parentNode ) ||
+ context;
+
+ // We can use :scope instead of the ID hack if the browser
+ // supports it & if we're not changing the context.
+ if ( newContext !== context || !support.scope ) {
+
+ // Capture the context ID, setting it first if necessary
+ if ( ( nid = context.getAttribute( "id" ) ) ) {
+ nid = nid.replace( rcssescape, fcssescape );
+ } else {
+ context.setAttribute( "id", ( nid = expando ) );
+ }
+ }
+
+ // Prefix every selector in the list
+ groups = tokenize( selector );
+ i = groups.length;
+ while ( i-- ) {
+ groups[ i ] = ( nid ? "#" + nid : ":scope" ) + " " +
+ toSelector( groups[ i ] );
+ }
+ newSelector = groups.join( "," );
+ }
+
+ try {
+ push.apply( results,
+ newContext.querySelectorAll( newSelector )
+ );
+ return results;
+ } catch ( qsaError ) {
+ nonnativeSelectorCache( selector, true );
+ } finally {
+ if ( nid === expando ) {
+ context.removeAttribute( "id" );
+ }
+ }
+ }
+ }
+ }
+
+ // All others
+ return select( selector.replace( rtrim, "$1" ), context, results, seed );
+}
+
+/**
+ * Create key-value caches of limited size
+ * @returns {function(string, object)} Returns the Object data after storing it on itself with
+ * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
+ * deleting the oldest entry
+ */
+function createCache() {
+ var keys = [];
+
+ function cache( key, value ) {
+
+ // Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
+ if ( keys.push( key + " " ) > Expr.cacheLength ) {
+
+ // Only keep the most recent entries
+ delete cache[ keys.shift() ];
+ }
+ return ( cache[ key + " " ] = value );
+ }
+ return cache;
+}
+
+/**
+ * Mark a function for special use by Sizzle
+ * @param {Function} fn The function to mark
+ */
+function markFunction( fn ) {
+ fn[ expando ] = true;
+ return fn;
+}
+
+/**
+ * Support testing using an element
+ * @param {Function} fn Passed the created element and returns a boolean result
+ */
+function assert( fn ) {
+ var el = document.createElement( "fieldset" );
+
+ try {
+ return !!fn( el );
+ } catch ( e ) {
+ return false;
+ } finally {
+
+ // Remove from its parent by default
+ if ( el.parentNode ) {
+ el.parentNode.removeChild( el );
+ }
+
+ // release memory in IE
+ el = null;
+ }
+}
+
+/**
+ * Adds the same handler for all of the specified attrs
+ * @param {String} attrs Pipe-separated list of attributes
+ * @param {Function} handler The method that will be applied
+ */
+function addHandle( attrs, handler ) {
+ var arr = attrs.split( "|" ),
+ i = arr.length;
+
+ while ( i-- ) {
+ Expr.attrHandle[ arr[ i ] ] = handler;
+ }
+}
+
+/**
+ * Checks document order of two siblings
+ * @param {Element} a
+ * @param {Element} b
+ * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b
+ */
+function siblingCheck( a, b ) {
+ var cur = b && a,
+ diff = cur && a.nodeType === 1 && b.nodeType === 1 &&
+ a.sourceIndex - b.sourceIndex;
+
+ // Use IE sourceIndex if available on both nodes
+ if ( diff ) {
+ return diff;
+ }
+
+ // Check if b follows a
+ if ( cur ) {
+ while ( ( cur = cur.nextSibling ) ) {
+ if ( cur === b ) {
+ return -1;
+ }
+ }
+ }
+
+ return a ? 1 : -1;
+}
+
+/**
+ * Returns a function to use in pseudos for input types
+ * @param {String} type
+ */
+function createInputPseudo( type ) {
+ return function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === type;
+ };
+}
+
+/**
+ * Returns a function to use in pseudos for buttons
+ * @param {String} type
+ */
+function createButtonPseudo( type ) {
+ return function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return ( name === "input" || name === "button" ) && elem.type === type;
+ };
+}
+
+/**
+ * Returns a function to use in pseudos for :enabled/:disabled
+ * @param {Boolean} disabled true for :disabled; false for :enabled
+ */
+function createDisabledPseudo( disabled ) {
+
+ // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable
+ return function( elem ) {
+
+ // Only certain elements can match :enabled or :disabled
+ // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled
+ // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled
+ if ( "form" in elem ) {
+
+ // Check for inherited disabledness on relevant non-disabled elements:
+ // * listed form-associated elements in a disabled fieldset
+ // https://html.spec.whatwg.org/multipage/forms.html#category-listed
+ // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled
+ // * option elements in a disabled optgroup
+ // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled
+ // All such elements have a "form" property.
+ if ( elem.parentNode && elem.disabled === false ) {
+
+ // Option elements defer to a parent optgroup if present
+ if ( "label" in elem ) {
+ if ( "label" in elem.parentNode ) {
+ return elem.parentNode.disabled === disabled;
+ } else {
+ return elem.disabled === disabled;
+ }
+ }
+
+ // Support: IE 6 - 11
+ // Use the isDisabled shortcut property to check for disabled fieldset ancestors
+ return elem.isDisabled === disabled ||
+
+ // Where there is no isDisabled, check manually
+ /* jshint -W018 */
+ elem.isDisabled !== !disabled &&
+ inDisabledFieldset( elem ) === disabled;
+ }
+
+ return elem.disabled === disabled;
+
+ // Try to winnow out elements that can't be disabled before trusting the disabled property.
+ // Some victims get caught in our net (label, legend, menu, track), but it shouldn't
+ // even exist on them, let alone have a boolean value.
+ } else if ( "label" in elem ) {
+ return elem.disabled === disabled;
+ }
+
+ // Remaining elements are neither :enabled nor :disabled
+ return false;
+ };
+}
+
+/**
+ * Returns a function to use in pseudos for positionals
+ * @param {Function} fn
+ */
+function createPositionalPseudo( fn ) {
+ return markFunction( function( argument ) {
+ argument = +argument;
+ return markFunction( function( seed, matches ) {
+ var j,
+ matchIndexes = fn( [], seed.length, argument ),
+ i = matchIndexes.length;
+
+ // Match elements found at the specified indexes
+ while ( i-- ) {
+ if ( seed[ ( j = matchIndexes[ i ] ) ] ) {
+ seed[ j ] = !( matches[ j ] = seed[ j ] );
+ }
+ }
+ } );
+ } );
+}
+
+/**
+ * Checks a node for validity as a Sizzle context
+ * @param {Element|Object=} context
+ * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value
+ */
+function testContext( context ) {
+ return context && typeof context.getElementsByTagName !== "undefined" && context;
+}
+
+// Expose support vars for convenience
+support = Sizzle.support = {};
+
+/**
+ * Detects XML nodes
+ * @param {Element|Object} elem An element or a document
+ * @returns {Boolean} True iff elem is a non-HTML XML node
+ */
+isXML = Sizzle.isXML = function( elem ) {
+ var namespace = elem && elem.namespaceURI,
+ docElem = elem && ( elem.ownerDocument || elem ).documentElement;
+
+ // Support: IE <=8
+ // Assume HTML when documentElement doesn't yet exist, such as inside loading iframes
+ // https://bugs.jquery.com/ticket/4833
+ return !rhtml.test( namespace || docElem && docElem.nodeName || "HTML" );
+};
+
+/**
+ * Sets document-related variables once based on the current document
+ * @param {Element|Object} [doc] An element or document object to use to set the document
+ * @returns {Object} Returns the current document
+ */
+setDocument = Sizzle.setDocument = function( node ) {
+ var hasCompare, subWindow,
+ doc = node ? node.ownerDocument || node : preferredDoc;
+
+ // Return early if doc is invalid or already selected
+ // Support: IE 11+, Edge 17 - 18+
+ // IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+ // two documents; shallow comparisons work.
+ // eslint-disable-next-line eqeqeq
+ if ( doc == document || doc.nodeType !== 9 || !doc.documentElement ) {
+ return document;
+ }
+
+ // Update global variables
+ document = doc;
+ docElem = document.documentElement;
+ documentIsHTML = !isXML( document );
+
+ // Support: IE 9 - 11+, Edge 12 - 18+
+ // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936)
+ // Support: IE 11+, Edge 17 - 18+
+ // IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+ // two documents; shallow comparisons work.
+ // eslint-disable-next-line eqeqeq
+ if ( preferredDoc != document &&
+ ( subWindow = document.defaultView ) && subWindow.top !== subWindow ) {
+
+ // Support: IE 11, Edge
+ if ( subWindow.addEventListener ) {
+ subWindow.addEventListener( "unload", unloadHandler, false );
+
+ // Support: IE 9 - 10 only
+ } else if ( subWindow.attachEvent ) {
+ subWindow.attachEvent( "onunload", unloadHandler );
+ }
+ }
+
+ // Support: IE 8 - 11+, Edge 12 - 18+, Chrome <=16 - 25 only, Firefox <=3.6 - 31 only,
+ // Safari 4 - 5 only, Opera <=11.6 - 12.x only
+ // IE/Edge & older browsers don't support the :scope pseudo-class.
+ // Support: Safari 6.0 only
+ // Safari 6.0 supports :scope but it's an alias of :root there.
+ support.scope = assert( function( el ) {
+ docElem.appendChild( el ).appendChild( document.createElement( "div" ) );
+ return typeof el.querySelectorAll !== "undefined" &&
+ !el.querySelectorAll( ":scope fieldset div" ).length;
+ } );
+
+ /* Attributes
+ ---------------------------------------------------------------------- */
+
+ // Support: IE<8
+ // Verify that getAttribute really returns attributes and not properties
+ // (excepting IE8 booleans)
+ support.attributes = assert( function( el ) {
+ el.className = "i";
+ return !el.getAttribute( "className" );
+ } );
+
+ /* getElement(s)By*
+ ---------------------------------------------------------------------- */
+
+ // Check if getElementsByTagName("*") returns only elements
+ support.getElementsByTagName = assert( function( el ) {
+ el.appendChild( document.createComment( "" ) );
+ return !el.getElementsByTagName( "*" ).length;
+ } );
+
+ // Support: IE<9
+ support.getElementsByClassName = rnative.test( document.getElementsByClassName );
+
+ // Support: IE<10
+ // Check if getElementById returns elements by name
+ // The broken getElementById methods don't pick up programmatically-set names,
+ // so use a roundabout getElementsByName test
+ support.getById = assert( function( el ) {
+ docElem.appendChild( el ).id = expando;
+ return !document.getElementsByName || !document.getElementsByName( expando ).length;
+ } );
+
+ // ID filter and find
+ if ( support.getById ) {
+ Expr.filter[ "ID" ] = function( id ) {
+ var attrId = id.replace( runescape, funescape );
+ return function( elem ) {
+ return elem.getAttribute( "id" ) === attrId;
+ };
+ };
+ Expr.find[ "ID" ] = function( id, context ) {
+ if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
+ var elem = context.getElementById( id );
+ return elem ? [ elem ] : [];
+ }
+ };
+ } else {
+ Expr.filter[ "ID" ] = function( id ) {
+ var attrId = id.replace( runescape, funescape );
+ return function( elem ) {
+ var node = typeof elem.getAttributeNode !== "undefined" &&
+ elem.getAttributeNode( "id" );
+ return node && node.value === attrId;
+ };
+ };
+
+ // Support: IE 6 - 7 only
+ // getElementById is not reliable as a find shortcut
+ Expr.find[ "ID" ] = function( id, context ) {
+ if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
+ var node, i, elems,
+ elem = context.getElementById( id );
+
+ if ( elem ) {
+
+ // Verify the id attribute
+ node = elem.getAttributeNode( "id" );
+ if ( node && node.value === id ) {
+ return [ elem ];
+ }
+
+ // Fall back on getElementsByName
+ elems = context.getElementsByName( id );
+ i = 0;
+ while ( ( elem = elems[ i++ ] ) ) {
+ node = elem.getAttributeNode( "id" );
+ if ( node && node.value === id ) {
+ return [ elem ];
+ }
+ }
+ }
+
+ return [];
+ }
+ };
+ }
+
+ // Tag
+ Expr.find[ "TAG" ] = support.getElementsByTagName ?
+ function( tag, context ) {
+ if ( typeof context.getElementsByTagName !== "undefined" ) {
+ return context.getElementsByTagName( tag );
+
+ // DocumentFragment nodes don't have gEBTN
+ } else if ( support.qsa ) {
+ return context.querySelectorAll( tag );
+ }
+ } :
+
+ function( tag, context ) {
+ var elem,
+ tmp = [],
+ i = 0,
+
+ // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too
+ results = context.getElementsByTagName( tag );
+
+ // Filter out possible comments
+ if ( tag === "*" ) {
+ while ( ( elem = results[ i++ ] ) ) {
+ if ( elem.nodeType === 1 ) {
+ tmp.push( elem );
+ }
+ }
+
+ return tmp;
+ }
+ return results;
+ };
+
+ // Class
+ Expr.find[ "CLASS" ] = support.getElementsByClassName && function( className, context ) {
+ if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) {
+ return context.getElementsByClassName( className );
+ }
+ };
+
+ /* QSA/matchesSelector
+ ---------------------------------------------------------------------- */
+
+ // QSA and matchesSelector support
+
+ // matchesSelector(:active) reports false when true (IE9/Opera 11.5)
+ rbuggyMatches = [];
+
+ // qSa(:focus) reports false when true (Chrome 21)
+ // We allow this because of a bug in IE8/9 that throws an error
+ // whenever `document.activeElement` is accessed on an iframe
+ // So, we allow :focus to pass through QSA all the time to avoid the IE error
+ // See https://bugs.jquery.com/ticket/13378
+ rbuggyQSA = [];
+
+ if ( ( support.qsa = rnative.test( document.querySelectorAll ) ) ) {
+
+ // Build QSA regex
+ // Regex strategy adopted from Diego Perini
+ assert( function( el ) {
+
+ var input;
+
+ // Select is set to empty string on purpose
+ // This is to test IE's treatment of not explicitly
+ // setting a boolean content attribute,
+ // since its presence should be enough
+ // https://bugs.jquery.com/ticket/12359
+ docElem.appendChild( el ).innerHTML = " " +
+ "" +
+ " ";
+
+ // Support: IE8, Opera 11-12.16
+ // Nothing should be selected when empty strings follow ^= or $= or *=
+ // The test attribute must be unknown in Opera but "safe" for WinRT
+ // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section
+ if ( el.querySelectorAll( "[msallowcapture^='']" ).length ) {
+ rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" );
+ }
+
+ // Support: IE8
+ // Boolean attributes and "value" are not treated correctly
+ if ( !el.querySelectorAll( "[selected]" ).length ) {
+ rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" );
+ }
+
+ // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+
+ if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) {
+ rbuggyQSA.push( "~=" );
+ }
+
+ // Support: IE 11+, Edge 15 - 18+
+ // IE 11/Edge don't find elements on a `[name='']` query in some cases.
+ // Adding a temporary attribute to the document before the selection works
+ // around the issue.
+ // Interestingly, IE 10 & older don't seem to have the issue.
+ input = document.createElement( "input" );
+ input.setAttribute( "name", "" );
+ el.appendChild( input );
+ if ( !el.querySelectorAll( "[name='']" ).length ) {
+ rbuggyQSA.push( "\\[" + whitespace + "*name" + whitespace + "*=" +
+ whitespace + "*(?:''|\"\")" );
+ }
+
+ // Webkit/Opera - :checked should return selected option elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ // IE8 throws error here and will not see later tests
+ if ( !el.querySelectorAll( ":checked" ).length ) {
+ rbuggyQSA.push( ":checked" );
+ }
+
+ // Support: Safari 8+, iOS 8+
+ // https://bugs.webkit.org/show_bug.cgi?id=136851
+ // In-page `selector#id sibling-combinator selector` fails
+ if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) {
+ rbuggyQSA.push( ".#.+[+~]" );
+ }
+
+ // Support: Firefox <=3.6 - 5 only
+ // Old Firefox doesn't throw on a badly-escaped identifier.
+ el.querySelectorAll( "\\\f" );
+ rbuggyQSA.push( "[\\r\\n\\f]" );
+ } );
+
+ assert( function( el ) {
+ el.innerHTML = " " +
+ " ";
+
+ // Support: Windows 8 Native Apps
+ // The type and name attributes are restricted during .innerHTML assignment
+ var input = document.createElement( "input" );
+ input.setAttribute( "type", "hidden" );
+ el.appendChild( input ).setAttribute( "name", "D" );
+
+ // Support: IE8
+ // Enforce case-sensitivity of name attribute
+ if ( el.querySelectorAll( "[name=d]" ).length ) {
+ rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" );
+ }
+
+ // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
+ // IE8 throws error here and will not see later tests
+ if ( el.querySelectorAll( ":enabled" ).length !== 2 ) {
+ rbuggyQSA.push( ":enabled", ":disabled" );
+ }
+
+ // Support: IE9-11+
+ // IE's :disabled selector does not pick up the children of disabled fieldsets
+ docElem.appendChild( el ).disabled = true;
+ if ( el.querySelectorAll( ":disabled" ).length !== 2 ) {
+ rbuggyQSA.push( ":enabled", ":disabled" );
+ }
+
+ // Support: Opera 10 - 11 only
+ // Opera 10-11 does not throw on post-comma invalid pseudos
+ el.querySelectorAll( "*,:x" );
+ rbuggyQSA.push( ",.*:" );
+ } );
+ }
+
+ if ( ( support.matchesSelector = rnative.test( ( matches = docElem.matches ||
+ docElem.webkitMatchesSelector ||
+ docElem.mozMatchesSelector ||
+ docElem.oMatchesSelector ||
+ docElem.msMatchesSelector ) ) ) ) {
+
+ assert( function( el ) {
+
+ // Check to see if it's possible to do matchesSelector
+ // on a disconnected node (IE 9)
+ support.disconnectedMatch = matches.call( el, "*" );
+
+ // This should fail with an exception
+ // Gecko does not error, returns false instead
+ matches.call( el, "[s!='']:x" );
+ rbuggyMatches.push( "!=", pseudos );
+ } );
+ }
+
+ rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join( "|" ) );
+ rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join( "|" ) );
+
+ /* Contains
+ ---------------------------------------------------------------------- */
+ hasCompare = rnative.test( docElem.compareDocumentPosition );
+
+ // Element contains another
+ // Purposefully self-exclusive
+ // As in, an element does not contain itself
+ contains = hasCompare || rnative.test( docElem.contains ) ?
+ function( a, b ) {
+ var adown = a.nodeType === 9 ? a.documentElement : a,
+ bup = b && b.parentNode;
+ return a === bup || !!( bup && bup.nodeType === 1 && (
+ adown.contains ?
+ adown.contains( bup ) :
+ a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16
+ ) );
+ } :
+ function( a, b ) {
+ if ( b ) {
+ while ( ( b = b.parentNode ) ) {
+ if ( b === a ) {
+ return true;
+ }
+ }
+ }
+ return false;
+ };
+
+ /* Sorting
+ ---------------------------------------------------------------------- */
+
+ // Document order sorting
+ sortOrder = hasCompare ?
+ function( a, b ) {
+
+ // Flag for duplicate removal
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+ }
+
+ // Sort on method existence if only one input has compareDocumentPosition
+ var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
+ if ( compare ) {
+ return compare;
+ }
+
+ // Calculate position if both inputs belong to the same document
+ // Support: IE 11+, Edge 17 - 18+
+ // IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+ // two documents; shallow comparisons work.
+ // eslint-disable-next-line eqeqeq
+ compare = ( a.ownerDocument || a ) == ( b.ownerDocument || b ) ?
+ a.compareDocumentPosition( b ) :
+
+ // Otherwise we know they are disconnected
+ 1;
+
+ // Disconnected nodes
+ if ( compare & 1 ||
+ ( !support.sortDetached && b.compareDocumentPosition( a ) === compare ) ) {
+
+ // Choose the first element that is related to our preferred document
+ // Support: IE 11+, Edge 17 - 18+
+ // IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+ // two documents; shallow comparisons work.
+ // eslint-disable-next-line eqeqeq
+ if ( a == document || a.ownerDocument == preferredDoc &&
+ contains( preferredDoc, a ) ) {
+ return -1;
+ }
+
+ // Support: IE 11+, Edge 17 - 18+
+ // IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+ // two documents; shallow comparisons work.
+ // eslint-disable-next-line eqeqeq
+ if ( b == document || b.ownerDocument == preferredDoc &&
+ contains( preferredDoc, b ) ) {
+ return 1;
+ }
+
+ // Maintain original order
+ return sortInput ?
+ ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
+ 0;
+ }
+
+ return compare & 4 ? -1 : 1;
+ } :
+ function( a, b ) {
+
+ // Exit early if the nodes are identical
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+ }
+
+ var cur,
+ i = 0,
+ aup = a.parentNode,
+ bup = b.parentNode,
+ ap = [ a ],
+ bp = [ b ];
+
+ // Parentless nodes are either documents or disconnected
+ if ( !aup || !bup ) {
+
+ // Support: IE 11+, Edge 17 - 18+
+ // IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+ // two documents; shallow comparisons work.
+ /* eslint-disable eqeqeq */
+ return a == document ? -1 :
+ b == document ? 1 :
+ /* eslint-enable eqeqeq */
+ aup ? -1 :
+ bup ? 1 :
+ sortInput ?
+ ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
+ 0;
+
+ // If the nodes are siblings, we can do a quick check
+ } else if ( aup === bup ) {
+ return siblingCheck( a, b );
+ }
+
+ // Otherwise we need full lists of their ancestors for comparison
+ cur = a;
+ while ( ( cur = cur.parentNode ) ) {
+ ap.unshift( cur );
+ }
+ cur = b;
+ while ( ( cur = cur.parentNode ) ) {
+ bp.unshift( cur );
+ }
+
+ // Walk down the tree looking for a discrepancy
+ while ( ap[ i ] === bp[ i ] ) {
+ i++;
+ }
+
+ return i ?
+
+ // Do a sibling check if the nodes have a common ancestor
+ siblingCheck( ap[ i ], bp[ i ] ) :
+
+ // Otherwise nodes in our document sort first
+ // Support: IE 11+, Edge 17 - 18+
+ // IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+ // two documents; shallow comparisons work.
+ /* eslint-disable eqeqeq */
+ ap[ i ] == preferredDoc ? -1 :
+ bp[ i ] == preferredDoc ? 1 :
+ /* eslint-enable eqeqeq */
+ 0;
+ };
+
+ return document;
+};
+
+Sizzle.matches = function( expr, elements ) {
+ return Sizzle( expr, null, null, elements );
+};
+
+Sizzle.matchesSelector = function( elem, expr ) {
+ setDocument( elem );
+
+ if ( support.matchesSelector && documentIsHTML &&
+ !nonnativeSelectorCache[ expr + " " ] &&
+ ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) &&
+ ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) {
+
+ try {
+ var ret = matches.call( elem, expr );
+
+ // IE 9's matchesSelector returns false on disconnected nodes
+ if ( ret || support.disconnectedMatch ||
+
+ // As well, disconnected nodes are said to be in a document
+ // fragment in IE 9
+ elem.document && elem.document.nodeType !== 11 ) {
+ return ret;
+ }
+ } catch ( e ) {
+ nonnativeSelectorCache( expr, true );
+ }
+ }
+
+ return Sizzle( expr, document, null, [ elem ] ).length > 0;
+};
+
+Sizzle.contains = function( context, elem ) {
+
+ // Set document vars if needed
+ // Support: IE 11+, Edge 17 - 18+
+ // IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+ // two documents; shallow comparisons work.
+ // eslint-disable-next-line eqeqeq
+ if ( ( context.ownerDocument || context ) != document ) {
+ setDocument( context );
+ }
+ return contains( context, elem );
+};
+
+Sizzle.attr = function( elem, name ) {
+
+ // Set document vars if needed
+ // Support: IE 11+, Edge 17 - 18+
+ // IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+ // two documents; shallow comparisons work.
+ // eslint-disable-next-line eqeqeq
+ if ( ( elem.ownerDocument || elem ) != document ) {
+ setDocument( elem );
+ }
+
+ var fn = Expr.attrHandle[ name.toLowerCase() ],
+
+ // Don't get fooled by Object.prototype properties (jQuery #13807)
+ val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?
+ fn( elem, name, !documentIsHTML ) :
+ undefined;
+
+ return val !== undefined ?
+ val :
+ support.attributes || !documentIsHTML ?
+ elem.getAttribute( name ) :
+ ( val = elem.getAttributeNode( name ) ) && val.specified ?
+ val.value :
+ null;
+};
+
+Sizzle.escape = function( sel ) {
+ return ( sel + "" ).replace( rcssescape, fcssescape );
+};
+
+Sizzle.error = function( msg ) {
+ throw new Error( "Syntax error, unrecognized expression: " + msg );
+};
+
+/**
+ * Document sorting and removing duplicates
+ * @param {ArrayLike} results
+ */
+Sizzle.uniqueSort = function( results ) {
+ var elem,
+ duplicates = [],
+ j = 0,
+ i = 0;
+
+ // Unless we *know* we can detect duplicates, assume their presence
+ hasDuplicate = !support.detectDuplicates;
+ sortInput = !support.sortStable && results.slice( 0 );
+ results.sort( sortOrder );
+
+ if ( hasDuplicate ) {
+ while ( ( elem = results[ i++ ] ) ) {
+ if ( elem === results[ i ] ) {
+ j = duplicates.push( i );
+ }
+ }
+ while ( j-- ) {
+ results.splice( duplicates[ j ], 1 );
+ }
+ }
+
+ // Clear input after sorting to release objects
+ // See https://github.com/jquery/sizzle/pull/225
+ sortInput = null;
+
+ return results;
+};
+
+/**
+ * Utility function for retrieving the text value of an array of DOM nodes
+ * @param {Array|Element} elem
+ */
+getText = Sizzle.getText = function( elem ) {
+ var node,
+ ret = "",
+ i = 0,
+ nodeType = elem.nodeType;
+
+ if ( !nodeType ) {
+
+ // If no nodeType, this is expected to be an array
+ while ( ( node = elem[ i++ ] ) ) {
+
+ // Do not traverse comment nodes
+ ret += getText( node );
+ }
+ } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {
+
+ // Use textContent for elements
+ // innerText usage removed for consistency of new lines (jQuery #11153)
+ if ( typeof elem.textContent === "string" ) {
+ return elem.textContent;
+ } else {
+
+ // Traverse its children
+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+ ret += getText( elem );
+ }
+ }
+ } else if ( nodeType === 3 || nodeType === 4 ) {
+ return elem.nodeValue;
+ }
+
+ // Do not include comment or processing instruction nodes
+
+ return ret;
+};
+
+Expr = Sizzle.selectors = {
+
+ // Can be adjusted by the user
+ cacheLength: 50,
+
+ createPseudo: markFunction,
+
+ match: matchExpr,
+
+ attrHandle: {},
+
+ find: {},
+
+ relative: {
+ ">": { dir: "parentNode", first: true },
+ " ": { dir: "parentNode" },
+ "+": { dir: "previousSibling", first: true },
+ "~": { dir: "previousSibling" }
+ },
+
+ preFilter: {
+ "ATTR": function( match ) {
+ match[ 1 ] = match[ 1 ].replace( runescape, funescape );
+
+ // Move the given value to match[3] whether quoted or unquoted
+ match[ 3 ] = ( match[ 3 ] || match[ 4 ] ||
+ match[ 5 ] || "" ).replace( runescape, funescape );
+
+ if ( match[ 2 ] === "~=" ) {
+ match[ 3 ] = " " + match[ 3 ] + " ";
+ }
+
+ return match.slice( 0, 4 );
+ },
+
+ "CHILD": function( match ) {
+
+ /* matches from matchExpr["CHILD"]
+ 1 type (only|nth|...)
+ 2 what (child|of-type)
+ 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
+ 4 xn-component of xn+y argument ([+-]?\d*n|)
+ 5 sign of xn-component
+ 6 x of xn-component
+ 7 sign of y-component
+ 8 y of y-component
+ */
+ match[ 1 ] = match[ 1 ].toLowerCase();
+
+ if ( match[ 1 ].slice( 0, 3 ) === "nth" ) {
+
+ // nth-* requires argument
+ if ( !match[ 3 ] ) {
+ Sizzle.error( match[ 0 ] );
+ }
+
+ // numeric x and y parameters for Expr.filter.CHILD
+ // remember that false/true cast respectively to 0/1
+ match[ 4 ] = +( match[ 4 ] ?
+ match[ 5 ] + ( match[ 6 ] || 1 ) :
+ 2 * ( match[ 3 ] === "even" || match[ 3 ] === "odd" ) );
+ match[ 5 ] = +( ( match[ 7 ] + match[ 8 ] ) || match[ 3 ] === "odd" );
+
+ // other types prohibit arguments
+ } else if ( match[ 3 ] ) {
+ Sizzle.error( match[ 0 ] );
+ }
+
+ return match;
+ },
+
+ "PSEUDO": function( match ) {
+ var excess,
+ unquoted = !match[ 6 ] && match[ 2 ];
+
+ if ( matchExpr[ "CHILD" ].test( match[ 0 ] ) ) {
+ return null;
+ }
+
+ // Accept quoted arguments as-is
+ if ( match[ 3 ] ) {
+ match[ 2 ] = match[ 4 ] || match[ 5 ] || "";
+
+ // Strip excess characters from unquoted arguments
+ } else if ( unquoted && rpseudo.test( unquoted ) &&
+
+ // Get excess from tokenize (recursively)
+ ( excess = tokenize( unquoted, true ) ) &&
+
+ // advance to the next closing parenthesis
+ ( excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length ) ) {
+
+ // excess is a negative index
+ match[ 0 ] = match[ 0 ].slice( 0, excess );
+ match[ 2 ] = unquoted.slice( 0, excess );
+ }
+
+ // Return only captures needed by the pseudo filter method (type and argument)
+ return match.slice( 0, 3 );
+ }
+ },
+
+ filter: {
+
+ "TAG": function( nodeNameSelector ) {
+ var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();
+ return nodeNameSelector === "*" ?
+ function() {
+ return true;
+ } :
+ function( elem ) {
+ return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
+ };
+ },
+
+ "CLASS": function( className ) {
+ var pattern = classCache[ className + " " ];
+
+ return pattern ||
+ ( pattern = new RegExp( "(^|" + whitespace +
+ ")" + className + "(" + whitespace + "|$)" ) ) && classCache(
+ className, function( elem ) {
+ return pattern.test(
+ typeof elem.className === "string" && elem.className ||
+ typeof elem.getAttribute !== "undefined" &&
+ elem.getAttribute( "class" ) ||
+ ""
+ );
+ } );
+ },
+
+ "ATTR": function( name, operator, check ) {
+ return function( elem ) {
+ var result = Sizzle.attr( elem, name );
+
+ if ( result == null ) {
+ return operator === "!=";
+ }
+ if ( !operator ) {
+ return true;
+ }
+
+ result += "";
+
+ /* eslint-disable max-len */
+
+ return operator === "=" ? result === check :
+ operator === "!=" ? result !== check :
+ operator === "^=" ? check && result.indexOf( check ) === 0 :
+ operator === "*=" ? check && result.indexOf( check ) > -1 :
+ operator === "$=" ? check && result.slice( -check.length ) === check :
+ operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 :
+ operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" :
+ false;
+ /* eslint-enable max-len */
+
+ };
+ },
+
+ "CHILD": function( type, what, _argument, first, last ) {
+ var simple = type.slice( 0, 3 ) !== "nth",
+ forward = type.slice( -4 ) !== "last",
+ ofType = what === "of-type";
+
+ return first === 1 && last === 0 ?
+
+ // Shortcut for :nth-*(n)
+ function( elem ) {
+ return !!elem.parentNode;
+ } :
+
+ function( elem, _context, xml ) {
+ var cache, uniqueCache, outerCache, node, nodeIndex, start,
+ dir = simple !== forward ? "nextSibling" : "previousSibling",
+ parent = elem.parentNode,
+ name = ofType && elem.nodeName.toLowerCase(),
+ useCache = !xml && !ofType,
+ diff = false;
+
+ if ( parent ) {
+
+ // :(first|last|only)-(child|of-type)
+ if ( simple ) {
+ while ( dir ) {
+ node = elem;
+ while ( ( node = node[ dir ] ) ) {
+ if ( ofType ?
+ node.nodeName.toLowerCase() === name :
+ node.nodeType === 1 ) {
+
+ return false;
+ }
+ }
+
+ // Reverse direction for :only-* (if we haven't yet done so)
+ start = dir = type === "only" && !start && "nextSibling";
+ }
+ return true;
+ }
+
+ start = [ forward ? parent.firstChild : parent.lastChild ];
+
+ // non-xml :nth-child(...) stores cache data on `parent`
+ if ( forward && useCache ) {
+
+ // Seek `elem` from a previously-cached index
+
+ // ...in a gzip-friendly way
+ node = parent;
+ outerCache = node[ expando ] || ( node[ expando ] = {} );
+
+ // Support: IE <9 only
+ // Defend against cloned attroperties (jQuery gh-1709)
+ uniqueCache = outerCache[ node.uniqueID ] ||
+ ( outerCache[ node.uniqueID ] = {} );
+
+ cache = uniqueCache[ type ] || [];
+ nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
+ diff = nodeIndex && cache[ 2 ];
+ node = nodeIndex && parent.childNodes[ nodeIndex ];
+
+ while ( ( node = ++nodeIndex && node && node[ dir ] ||
+
+ // Fallback to seeking `elem` from the start
+ ( diff = nodeIndex = 0 ) || start.pop() ) ) {
+
+ // When found, cache indexes on `parent` and break
+ if ( node.nodeType === 1 && ++diff && node === elem ) {
+ uniqueCache[ type ] = [ dirruns, nodeIndex, diff ];
+ break;
+ }
+ }
+
+ } else {
+
+ // Use previously-cached element index if available
+ if ( useCache ) {
+
+ // ...in a gzip-friendly way
+ node = elem;
+ outerCache = node[ expando ] || ( node[ expando ] = {} );
+
+ // Support: IE <9 only
+ // Defend against cloned attroperties (jQuery gh-1709)
+ uniqueCache = outerCache[ node.uniqueID ] ||
+ ( outerCache[ node.uniqueID ] = {} );
+
+ cache = uniqueCache[ type ] || [];
+ nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
+ diff = nodeIndex;
+ }
+
+ // xml :nth-child(...)
+ // or :nth-last-child(...) or :nth(-last)?-of-type(...)
+ if ( diff === false ) {
+
+ // Use the same loop as above to seek `elem` from the start
+ while ( ( node = ++nodeIndex && node && node[ dir ] ||
+ ( diff = nodeIndex = 0 ) || start.pop() ) ) {
+
+ if ( ( ofType ?
+ node.nodeName.toLowerCase() === name :
+ node.nodeType === 1 ) &&
+ ++diff ) {
+
+ // Cache the index of each encountered element
+ if ( useCache ) {
+ outerCache = node[ expando ] ||
+ ( node[ expando ] = {} );
+
+ // Support: IE <9 only
+ // Defend against cloned attroperties (jQuery gh-1709)
+ uniqueCache = outerCache[ node.uniqueID ] ||
+ ( outerCache[ node.uniqueID ] = {} );
+
+ uniqueCache[ type ] = [ dirruns, diff ];
+ }
+
+ if ( node === elem ) {
+ break;
+ }
+ }
+ }
+ }
+ }
+
+ // Incorporate the offset, then check against cycle size
+ diff -= last;
+ return diff === first || ( diff % first === 0 && diff / first >= 0 );
+ }
+ };
+ },
+
+ "PSEUDO": function( pseudo, argument ) {
+
+ // pseudo-class names are case-insensitive
+ // http://www.w3.org/TR/selectors/#pseudo-classes
+ // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
+ // Remember that setFilters inherits from pseudos
+ var args,
+ fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||
+ Sizzle.error( "unsupported pseudo: " + pseudo );
+
+ // The user may use createPseudo to indicate that
+ // arguments are needed to create the filter function
+ // just as Sizzle does
+ if ( fn[ expando ] ) {
+ return fn( argument );
+ }
+
+ // But maintain support for old signatures
+ if ( fn.length > 1 ) {
+ args = [ pseudo, pseudo, "", argument ];
+ return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?
+ markFunction( function( seed, matches ) {
+ var idx,
+ matched = fn( seed, argument ),
+ i = matched.length;
+ while ( i-- ) {
+ idx = indexOf( seed, matched[ i ] );
+ seed[ idx ] = !( matches[ idx ] = matched[ i ] );
+ }
+ } ) :
+ function( elem ) {
+ return fn( elem, 0, args );
+ };
+ }
+
+ return fn;
+ }
+ },
+
+ pseudos: {
+
+ // Potentially complex pseudos
+ "not": markFunction( function( selector ) {
+
+ // Trim the selector passed to compile
+ // to avoid treating leading and trailing
+ // spaces as combinators
+ var input = [],
+ results = [],
+ matcher = compile( selector.replace( rtrim, "$1" ) );
+
+ return matcher[ expando ] ?
+ markFunction( function( seed, matches, _context, xml ) {
+ var elem,
+ unmatched = matcher( seed, null, xml, [] ),
+ i = seed.length;
+
+ // Match elements unmatched by `matcher`
+ while ( i-- ) {
+ if ( ( elem = unmatched[ i ] ) ) {
+ seed[ i ] = !( matches[ i ] = elem );
+ }
+ }
+ } ) :
+ function( elem, _context, xml ) {
+ input[ 0 ] = elem;
+ matcher( input, null, xml, results );
+
+ // Don't keep the element (issue #299)
+ input[ 0 ] = null;
+ return !results.pop();
+ };
+ } ),
+
+ "has": markFunction( function( selector ) {
+ return function( elem ) {
+ return Sizzle( selector, elem ).length > 0;
+ };
+ } ),
+
+ "contains": markFunction( function( text ) {
+ text = text.replace( runescape, funescape );
+ return function( elem ) {
+ return ( elem.textContent || getText( elem ) ).indexOf( text ) > -1;
+ };
+ } ),
+
+ // "Whether an element is represented by a :lang() selector
+ // is based solely on the element's language value
+ // being equal to the identifier C,
+ // or beginning with the identifier C immediately followed by "-".
+ // The matching of C against the element's language value is performed case-insensitively.
+ // The identifier C does not have to be a valid language name."
+ // http://www.w3.org/TR/selectors/#lang-pseudo
+ "lang": markFunction( function( lang ) {
+
+ // lang value must be a valid identifier
+ if ( !ridentifier.test( lang || "" ) ) {
+ Sizzle.error( "unsupported lang: " + lang );
+ }
+ lang = lang.replace( runescape, funescape ).toLowerCase();
+ return function( elem ) {
+ var elemLang;
+ do {
+ if ( ( elemLang = documentIsHTML ?
+ elem.lang :
+ elem.getAttribute( "xml:lang" ) || elem.getAttribute( "lang" ) ) ) {
+
+ elemLang = elemLang.toLowerCase();
+ return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0;
+ }
+ } while ( ( elem = elem.parentNode ) && elem.nodeType === 1 );
+ return false;
+ };
+ } ),
+
+ // Miscellaneous
+ "target": function( elem ) {
+ var hash = window.location && window.location.hash;
+ return hash && hash.slice( 1 ) === elem.id;
+ },
+
+ "root": function( elem ) {
+ return elem === docElem;
+ },
+
+ "focus": function( elem ) {
+ return elem === document.activeElement &&
+ ( !document.hasFocus || document.hasFocus() ) &&
+ !!( elem.type || elem.href || ~elem.tabIndex );
+ },
+
+ // Boolean properties
+ "enabled": createDisabledPseudo( false ),
+ "disabled": createDisabledPseudo( true ),
+
+ "checked": function( elem ) {
+
+ // In CSS3, :checked should return both checked and selected elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ var nodeName = elem.nodeName.toLowerCase();
+ return ( nodeName === "input" && !!elem.checked ) ||
+ ( nodeName === "option" && !!elem.selected );
+ },
+
+ "selected": function( elem ) {
+
+ // Accessing this property makes selected-by-default
+ // options in Safari work properly
+ if ( elem.parentNode ) {
+ // eslint-disable-next-line no-unused-expressions
+ elem.parentNode.selectedIndex;
+ }
+
+ return elem.selected === true;
+ },
+
+ // Contents
+ "empty": function( elem ) {
+
+ // http://www.w3.org/TR/selectors/#empty-pseudo
+ // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),
+ // but not by others (comment: 8; processing instruction: 7; etc.)
+ // nodeType < 6 works because attributes (2) do not appear as children
+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+ if ( elem.nodeType < 6 ) {
+ return false;
+ }
+ }
+ return true;
+ },
+
+ "parent": function( elem ) {
+ return !Expr.pseudos[ "empty" ]( elem );
+ },
+
+ // Element/input types
+ "header": function( elem ) {
+ return rheader.test( elem.nodeName );
+ },
+
+ "input": function( elem ) {
+ return rinputs.test( elem.nodeName );
+ },
+
+ "button": function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === "button" || name === "button";
+ },
+
+ "text": function( elem ) {
+ var attr;
+ return elem.nodeName.toLowerCase() === "input" &&
+ elem.type === "text" &&
+
+ // Support: IE<8
+ // New HTML5 attribute values (e.g., "search") appear with elem.type === "text"
+ ( ( attr = elem.getAttribute( "type" ) ) == null ||
+ attr.toLowerCase() === "text" );
+ },
+
+ // Position-in-collection
+ "first": createPositionalPseudo( function() {
+ return [ 0 ];
+ } ),
+
+ "last": createPositionalPseudo( function( _matchIndexes, length ) {
+ return [ length - 1 ];
+ } ),
+
+ "eq": createPositionalPseudo( function( _matchIndexes, length, argument ) {
+ return [ argument < 0 ? argument + length : argument ];
+ } ),
+
+ "even": createPositionalPseudo( function( matchIndexes, length ) {
+ var i = 0;
+ for ( ; i < length; i += 2 ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ } ),
+
+ "odd": createPositionalPseudo( function( matchIndexes, length ) {
+ var i = 1;
+ for ( ; i < length; i += 2 ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ } ),
+
+ "lt": createPositionalPseudo( function( matchIndexes, length, argument ) {
+ var i = argument < 0 ?
+ argument + length :
+ argument > length ?
+ length :
+ argument;
+ for ( ; --i >= 0; ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ } ),
+
+ "gt": createPositionalPseudo( function( matchIndexes, length, argument ) {
+ var i = argument < 0 ? argument + length : argument;
+ for ( ; ++i < length; ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ } )
+ }
+};
+
+Expr.pseudos[ "nth" ] = Expr.pseudos[ "eq" ];
+
+// Add button/input type pseudos
+for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {
+ Expr.pseudos[ i ] = createInputPseudo( i );
+}
+for ( i in { submit: true, reset: true } ) {
+ Expr.pseudos[ i ] = createButtonPseudo( i );
+}
+
+// Easy API for creating new setFilters
+function setFilters() {}
+setFilters.prototype = Expr.filters = Expr.pseudos;
+Expr.setFilters = new setFilters();
+
+tokenize = Sizzle.tokenize = function( selector, parseOnly ) {
+ var matched, match, tokens, type,
+ soFar, groups, preFilters,
+ cached = tokenCache[ selector + " " ];
+
+ if ( cached ) {
+ return parseOnly ? 0 : cached.slice( 0 );
+ }
+
+ soFar = selector;
+ groups = [];
+ preFilters = Expr.preFilter;
+
+ while ( soFar ) {
+
+ // Comma and first run
+ if ( !matched || ( match = rcomma.exec( soFar ) ) ) {
+ if ( match ) {
+
+ // Don't consume trailing commas as valid
+ soFar = soFar.slice( match[ 0 ].length ) || soFar;
+ }
+ groups.push( ( tokens = [] ) );
+ }
+
+ matched = false;
+
+ // Combinators
+ if ( ( match = rcombinators.exec( soFar ) ) ) {
+ matched = match.shift();
+ tokens.push( {
+ value: matched,
+
+ // Cast descendant combinators to space
+ type: match[ 0 ].replace( rtrim, " " )
+ } );
+ soFar = soFar.slice( matched.length );
+ }
+
+ // Filters
+ for ( type in Expr.filter ) {
+ if ( ( match = matchExpr[ type ].exec( soFar ) ) && ( !preFilters[ type ] ||
+ ( match = preFilters[ type ]( match ) ) ) ) {
+ matched = match.shift();
+ tokens.push( {
+ value: matched,
+ type: type,
+ matches: match
+ } );
+ soFar = soFar.slice( matched.length );
+ }
+ }
+
+ if ( !matched ) {
+ break;
+ }
+ }
+
+ // Return the length of the invalid excess
+ // if we're just parsing
+ // Otherwise, throw an error or return tokens
+ return parseOnly ?
+ soFar.length :
+ soFar ?
+ Sizzle.error( selector ) :
+
+ // Cache the tokens
+ tokenCache( selector, groups ).slice( 0 );
+};
+
+function toSelector( tokens ) {
+ var i = 0,
+ len = tokens.length,
+ selector = "";
+ for ( ; i < len; i++ ) {
+ selector += tokens[ i ].value;
+ }
+ return selector;
+}
+
+function addCombinator( matcher, combinator, base ) {
+ var dir = combinator.dir,
+ skip = combinator.next,
+ key = skip || dir,
+ checkNonElements = base && key === "parentNode",
+ doneName = done++;
+
+ return combinator.first ?
+
+ // Check against closest ancestor/preceding element
+ function( elem, context, xml ) {
+ while ( ( elem = elem[ dir ] ) ) {
+ if ( elem.nodeType === 1 || checkNonElements ) {
+ return matcher( elem, context, xml );
+ }
+ }
+ return false;
+ } :
+
+ // Check against all ancestor/preceding elements
+ function( elem, context, xml ) {
+ var oldCache, uniqueCache, outerCache,
+ newCache = [ dirruns, doneName ];
+
+ // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching
+ if ( xml ) {
+ while ( ( elem = elem[ dir ] ) ) {
+ if ( elem.nodeType === 1 || checkNonElements ) {
+ if ( matcher( elem, context, xml ) ) {
+ return true;
+ }
+ }
+ }
+ } else {
+ while ( ( elem = elem[ dir ] ) ) {
+ if ( elem.nodeType === 1 || checkNonElements ) {
+ outerCache = elem[ expando ] || ( elem[ expando ] = {} );
+
+ // Support: IE <9 only
+ // Defend against cloned attroperties (jQuery gh-1709)
+ uniqueCache = outerCache[ elem.uniqueID ] ||
+ ( outerCache[ elem.uniqueID ] = {} );
+
+ if ( skip && skip === elem.nodeName.toLowerCase() ) {
+ elem = elem[ dir ] || elem;
+ } else if ( ( oldCache = uniqueCache[ key ] ) &&
+ oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {
+
+ // Assign to newCache so results back-propagate to previous elements
+ return ( newCache[ 2 ] = oldCache[ 2 ] );
+ } else {
+
+ // Reuse newcache so results back-propagate to previous elements
+ uniqueCache[ key ] = newCache;
+
+ // A match means we're done; a fail means we have to keep checking
+ if ( ( newCache[ 2 ] = matcher( elem, context, xml ) ) ) {
+ return true;
+ }
+ }
+ }
+ }
+ }
+ return false;
+ };
+}
+
+function elementMatcher( matchers ) {
+ return matchers.length > 1 ?
+ function( elem, context, xml ) {
+ var i = matchers.length;
+ while ( i-- ) {
+ if ( !matchers[ i ]( elem, context, xml ) ) {
+ return false;
+ }
+ }
+ return true;
+ } :
+ matchers[ 0 ];
+}
+
+function multipleContexts( selector, contexts, results ) {
+ var i = 0,
+ len = contexts.length;
+ for ( ; i < len; i++ ) {
+ Sizzle( selector, contexts[ i ], results );
+ }
+ return results;
+}
+
+function condense( unmatched, map, filter, context, xml ) {
+ var elem,
+ newUnmatched = [],
+ i = 0,
+ len = unmatched.length,
+ mapped = map != null;
+
+ for ( ; i < len; i++ ) {
+ if ( ( elem = unmatched[ i ] ) ) {
+ if ( !filter || filter( elem, context, xml ) ) {
+ newUnmatched.push( elem );
+ if ( mapped ) {
+ map.push( i );
+ }
+ }
+ }
+ }
+
+ return newUnmatched;
+}
+
+function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {
+ if ( postFilter && !postFilter[ expando ] ) {
+ postFilter = setMatcher( postFilter );
+ }
+ if ( postFinder && !postFinder[ expando ] ) {
+ postFinder = setMatcher( postFinder, postSelector );
+ }
+ return markFunction( function( seed, results, context, xml ) {
+ var temp, i, elem,
+ preMap = [],
+ postMap = [],
+ preexisting = results.length,
+
+ // Get initial elements from seed or context
+ elems = seed || multipleContexts(
+ selector || "*",
+ context.nodeType ? [ context ] : context,
+ []
+ ),
+
+ // Prefilter to get matcher input, preserving a map for seed-results synchronization
+ matcherIn = preFilter && ( seed || !selector ) ?
+ condense( elems, preMap, preFilter, context, xml ) :
+ elems,
+
+ matcherOut = matcher ?
+
+ // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
+ postFinder || ( seed ? preFilter : preexisting || postFilter ) ?
+
+ // ...intermediate processing is necessary
+ [] :
+
+ // ...otherwise use results directly
+ results :
+ matcherIn;
+
+ // Find primary matches
+ if ( matcher ) {
+ matcher( matcherIn, matcherOut, context, xml );
+ }
+
+ // Apply postFilter
+ if ( postFilter ) {
+ temp = condense( matcherOut, postMap );
+ postFilter( temp, [], context, xml );
+
+ // Un-match failing elements by moving them back to matcherIn
+ i = temp.length;
+ while ( i-- ) {
+ if ( ( elem = temp[ i ] ) ) {
+ matcherOut[ postMap[ i ] ] = !( matcherIn[ postMap[ i ] ] = elem );
+ }
+ }
+ }
+
+ if ( seed ) {
+ if ( postFinder || preFilter ) {
+ if ( postFinder ) {
+
+ // Get the final matcherOut by condensing this intermediate into postFinder contexts
+ temp = [];
+ i = matcherOut.length;
+ while ( i-- ) {
+ if ( ( elem = matcherOut[ i ] ) ) {
+
+ // Restore matcherIn since elem is not yet a final match
+ temp.push( ( matcherIn[ i ] = elem ) );
+ }
+ }
+ postFinder( null, ( matcherOut = [] ), temp, xml );
+ }
+
+ // Move matched elements from seed to results to keep them synchronized
+ i = matcherOut.length;
+ while ( i-- ) {
+ if ( ( elem = matcherOut[ i ] ) &&
+ ( temp = postFinder ? indexOf( seed, elem ) : preMap[ i ] ) > -1 ) {
+
+ seed[ temp ] = !( results[ temp ] = elem );
+ }
+ }
+ }
+
+ // Add elements to results, through postFinder if defined
+ } else {
+ matcherOut = condense(
+ matcherOut === results ?
+ matcherOut.splice( preexisting, matcherOut.length ) :
+ matcherOut
+ );
+ if ( postFinder ) {
+ postFinder( null, results, matcherOut, xml );
+ } else {
+ push.apply( results, matcherOut );
+ }
+ }
+ } );
+}
+
+function matcherFromTokens( tokens ) {
+ var checkContext, matcher, j,
+ len = tokens.length,
+ leadingRelative = Expr.relative[ tokens[ 0 ].type ],
+ implicitRelative = leadingRelative || Expr.relative[ " " ],
+ i = leadingRelative ? 1 : 0,
+
+ // The foundational matcher ensures that elements are reachable from top-level context(s)
+ matchContext = addCombinator( function( elem ) {
+ return elem === checkContext;
+ }, implicitRelative, true ),
+ matchAnyContext = addCombinator( function( elem ) {
+ return indexOf( checkContext, elem ) > -1;
+ }, implicitRelative, true ),
+ matchers = [ function( elem, context, xml ) {
+ var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || (
+ ( checkContext = context ).nodeType ?
+ matchContext( elem, context, xml ) :
+ matchAnyContext( elem, context, xml ) );
+
+ // Avoid hanging onto element (issue #299)
+ checkContext = null;
+ return ret;
+ } ];
+
+ for ( ; i < len; i++ ) {
+ if ( ( matcher = Expr.relative[ tokens[ i ].type ] ) ) {
+ matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ];
+ } else {
+ matcher = Expr.filter[ tokens[ i ].type ].apply( null, tokens[ i ].matches );
+
+ // Return special upon seeing a positional matcher
+ if ( matcher[ expando ] ) {
+
+ // Find the next relative operator (if any) for proper handling
+ j = ++i;
+ for ( ; j < len; j++ ) {
+ if ( Expr.relative[ tokens[ j ].type ] ) {
+ break;
+ }
+ }
+ return setMatcher(
+ i > 1 && elementMatcher( matchers ),
+ i > 1 && toSelector(
+
+ // If the preceding token was a descendant combinator, insert an implicit any-element `*`
+ tokens
+ .slice( 0, i - 1 )
+ .concat( { value: tokens[ i - 2 ].type === " " ? "*" : "" } )
+ ).replace( rtrim, "$1" ),
+ matcher,
+ i < j && matcherFromTokens( tokens.slice( i, j ) ),
+ j < len && matcherFromTokens( ( tokens = tokens.slice( j ) ) ),
+ j < len && toSelector( tokens )
+ );
+ }
+ matchers.push( matcher );
+ }
+ }
+
+ return elementMatcher( matchers );
+}
+
+function matcherFromGroupMatchers( elementMatchers, setMatchers ) {
+ var bySet = setMatchers.length > 0,
+ byElement = elementMatchers.length > 0,
+ superMatcher = function( seed, context, xml, results, outermost ) {
+ var elem, j, matcher,
+ matchedCount = 0,
+ i = "0",
+ unmatched = seed && [],
+ setMatched = [],
+ contextBackup = outermostContext,
+
+ // We must always have either seed elements or outermost context
+ elems = seed || byElement && Expr.find[ "TAG" ]( "*", outermost ),
+
+ // Use integer dirruns iff this is the outermost matcher
+ dirrunsUnique = ( dirruns += contextBackup == null ? 1 : Math.random() || 0.1 ),
+ len = elems.length;
+
+ if ( outermost ) {
+
+ // Support: IE 11+, Edge 17 - 18+
+ // IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+ // two documents; shallow comparisons work.
+ // eslint-disable-next-line eqeqeq
+ outermostContext = context == document || context || outermost;
+ }
+
+ // Add elements passing elementMatchers directly to results
+ // Support: IE<9, Safari
+ // Tolerate NodeList properties (IE: "length"; Safari: ) matching elements by id
+ for ( ; i !== len && ( elem = elems[ i ] ) != null; i++ ) {
+ if ( byElement && elem ) {
+ j = 0;
+
+ // Support: IE 11+, Edge 17 - 18+
+ // IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+ // two documents; shallow comparisons work.
+ // eslint-disable-next-line eqeqeq
+ if ( !context && elem.ownerDocument != document ) {
+ setDocument( elem );
+ xml = !documentIsHTML;
+ }
+ while ( ( matcher = elementMatchers[ j++ ] ) ) {
+ if ( matcher( elem, context || document, xml ) ) {
+ results.push( elem );
+ break;
+ }
+ }
+ if ( outermost ) {
+ dirruns = dirrunsUnique;
+ }
+ }
+
+ // Track unmatched elements for set filters
+ if ( bySet ) {
+
+ // They will have gone through all possible matchers
+ if ( ( elem = !matcher && elem ) ) {
+ matchedCount--;
+ }
+
+ // Lengthen the array for every element, matched or not
+ if ( seed ) {
+ unmatched.push( elem );
+ }
+ }
+ }
+
+ // `i` is now the count of elements visited above, and adding it to `matchedCount`
+ // makes the latter nonnegative.
+ matchedCount += i;
+
+ // Apply set filters to unmatched elements
+ // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount`
+ // equals `i`), unless we didn't visit _any_ elements in the above loop because we have
+ // no element matchers and no seed.
+ // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that
+ // case, which will result in a "00" `matchedCount` that differs from `i` but is also
+ // numerically zero.
+ if ( bySet && i !== matchedCount ) {
+ j = 0;
+ while ( ( matcher = setMatchers[ j++ ] ) ) {
+ matcher( unmatched, setMatched, context, xml );
+ }
+
+ if ( seed ) {
+
+ // Reintegrate element matches to eliminate the need for sorting
+ if ( matchedCount > 0 ) {
+ while ( i-- ) {
+ if ( !( unmatched[ i ] || setMatched[ i ] ) ) {
+ setMatched[ i ] = pop.call( results );
+ }
+ }
+ }
+
+ // Discard index placeholder values to get only actual matches
+ setMatched = condense( setMatched );
+ }
+
+ // Add matches to results
+ push.apply( results, setMatched );
+
+ // Seedless set matches succeeding multiple successful matchers stipulate sorting
+ if ( outermost && !seed && setMatched.length > 0 &&
+ ( matchedCount + setMatchers.length ) > 1 ) {
+
+ Sizzle.uniqueSort( results );
+ }
+ }
+
+ // Override manipulation of globals by nested matchers
+ if ( outermost ) {
+ dirruns = dirrunsUnique;
+ outermostContext = contextBackup;
+ }
+
+ return unmatched;
+ };
+
+ return bySet ?
+ markFunction( superMatcher ) :
+ superMatcher;
+}
+
+compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) {
+ var i,
+ setMatchers = [],
+ elementMatchers = [],
+ cached = compilerCache[ selector + " " ];
+
+ if ( !cached ) {
+
+ // Generate a function of recursive functions that can be used to check each element
+ if ( !match ) {
+ match = tokenize( selector );
+ }
+ i = match.length;
+ while ( i-- ) {
+ cached = matcherFromTokens( match[ i ] );
+ if ( cached[ expando ] ) {
+ setMatchers.push( cached );
+ } else {
+ elementMatchers.push( cached );
+ }
+ }
+
+ // Cache the compiled function
+ cached = compilerCache(
+ selector,
+ matcherFromGroupMatchers( elementMatchers, setMatchers )
+ );
+
+ // Save selector and tokenization
+ cached.selector = selector;
+ }
+ return cached;
+};
+
+/**
+ * A low-level selection function that works with Sizzle's compiled
+ * selector functions
+ * @param {String|Function} selector A selector or a pre-compiled
+ * selector function built with Sizzle.compile
+ * @param {Element} context
+ * @param {Array} [results]
+ * @param {Array} [seed] A set of elements to match against
+ */
+select = Sizzle.select = function( selector, context, results, seed ) {
+ var i, tokens, token, type, find,
+ compiled = typeof selector === "function" && selector,
+ match = !seed && tokenize( ( selector = compiled.selector || selector ) );
+
+ results = results || [];
+
+ // Try to minimize operations if there is only one selector in the list and no seed
+ // (the latter of which guarantees us context)
+ if ( match.length === 1 ) {
+
+ // Reduce context if the leading compound selector is an ID
+ tokens = match[ 0 ] = match[ 0 ].slice( 0 );
+ if ( tokens.length > 2 && ( token = tokens[ 0 ] ).type === "ID" &&
+ context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[ 1 ].type ] ) {
+
+ context = ( Expr.find[ "ID" ]( token.matches[ 0 ]
+ .replace( runescape, funescape ), context ) || [] )[ 0 ];
+ if ( !context ) {
+ return results;
+
+ // Precompiled matchers will still verify ancestry, so step up a level
+ } else if ( compiled ) {
+ context = context.parentNode;
+ }
+
+ selector = selector.slice( tokens.shift().value.length );
+ }
+
+ // Fetch a seed set for right-to-left matching
+ i = matchExpr[ "needsContext" ].test( selector ) ? 0 : tokens.length;
+ while ( i-- ) {
+ token = tokens[ i ];
+
+ // Abort if we hit a combinator
+ if ( Expr.relative[ ( type = token.type ) ] ) {
+ break;
+ }
+ if ( ( find = Expr.find[ type ] ) ) {
+
+ // Search, expanding context for leading sibling combinators
+ if ( ( seed = find(
+ token.matches[ 0 ].replace( runescape, funescape ),
+ rsibling.test( tokens[ 0 ].type ) && testContext( context.parentNode ) ||
+ context
+ ) ) ) {
+
+ // If seed is empty or no tokens remain, we can return early
+ tokens.splice( i, 1 );
+ selector = seed.length && toSelector( tokens );
+ if ( !selector ) {
+ push.apply( results, seed );
+ return results;
+ }
+
+ break;
+ }
+ }
+ }
+ }
+
+ // Compile and execute a filtering function if one is not provided
+ // Provide `match` to avoid retokenization if we modified the selector above
+ ( compiled || compile( selector, match ) )(
+ seed,
+ context,
+ !documentIsHTML,
+ results,
+ !context || rsibling.test( selector ) && testContext( context.parentNode ) || context
+ );
+ return results;
+};
+
+// One-time assignments
+
+// Sort stability
+support.sortStable = expando.split( "" ).sort( sortOrder ).join( "" ) === expando;
+
+// Support: Chrome 14-35+
+// Always assume duplicates if they aren't passed to the comparison function
+support.detectDuplicates = !!hasDuplicate;
+
+// Initialize against the default document
+setDocument();
+
+// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)
+// Detached nodes confoundingly follow *each other*
+support.sortDetached = assert( function( el ) {
+
+ // Should return 1, but returns 4 (following)
+ return el.compareDocumentPosition( document.createElement( "fieldset" ) ) & 1;
+} );
+
+// Support: IE<8
+// Prevent attribute/property "interpolation"
+// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
+if ( !assert( function( el ) {
+ el.innerHTML = " ";
+ return el.firstChild.getAttribute( "href" ) === "#";
+} ) ) {
+ addHandle( "type|href|height|width", function( elem, name, isXML ) {
+ if ( !isXML ) {
+ return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 );
+ }
+ } );
+}
+
+// Support: IE<9
+// Use defaultValue in place of getAttribute("value")
+if ( !support.attributes || !assert( function( el ) {
+ el.innerHTML = " ";
+ el.firstChild.setAttribute( "value", "" );
+ return el.firstChild.getAttribute( "value" ) === "";
+} ) ) {
+ addHandle( "value", function( elem, _name, isXML ) {
+ if ( !isXML && elem.nodeName.toLowerCase() === "input" ) {
+ return elem.defaultValue;
+ }
+ } );
+}
+
+// Support: IE<9
+// Use getAttributeNode to fetch booleans when getAttribute lies
+if ( !assert( function( el ) {
+ return el.getAttribute( "disabled" ) == null;
+} ) ) {
+ addHandle( booleans, function( elem, name, isXML ) {
+ var val;
+ if ( !isXML ) {
+ return elem[ name ] === true ? name.toLowerCase() :
+ ( val = elem.getAttributeNode( name ) ) && val.specified ?
+ val.value :
+ null;
+ }
+ } );
+}
+
+return Sizzle;
+
+} )( window );
+
+
+
+jQuery.find = Sizzle;
+jQuery.expr = Sizzle.selectors;
+
+// Deprecated
+jQuery.expr[ ":" ] = jQuery.expr.pseudos;
+jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = Sizzle.getText;
+jQuery.isXMLDoc = Sizzle.isXML;
+jQuery.contains = Sizzle.contains;
+jQuery.escapeSelector = Sizzle.escape;
+
+
+
+
+var dir = function( elem, dir, until ) {
+ var matched = [],
+ truncate = until !== undefined;
+
+ while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) {
+ if ( elem.nodeType === 1 ) {
+ if ( truncate && jQuery( elem ).is( until ) ) {
+ break;
+ }
+ matched.push( elem );
+ }
+ }
+ return matched;
+};
+
+
+var siblings = function( n, elem ) {
+ var matched = [];
+
+ for ( ; n; n = n.nextSibling ) {
+ if ( n.nodeType === 1 && n !== elem ) {
+ matched.push( n );
+ }
+ }
+
+ return matched;
+};
+
+
+var rneedsContext = jQuery.expr.match.needsContext;
+
+
+
+function nodeName( elem, name ) {
+
+ return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
+
+}
+var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i );
+
+
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, not ) {
+ if ( isFunction( qualifier ) ) {
+ return jQuery.grep( elements, function( elem, i ) {
+ return !!qualifier.call( elem, i, elem ) !== not;
+ } );
+ }
+
+ // Single element
+ if ( qualifier.nodeType ) {
+ return jQuery.grep( elements, function( elem ) {
+ return ( elem === qualifier ) !== not;
+ } );
+ }
+
+ // Arraylike of elements (jQuery, arguments, Array)
+ if ( typeof qualifier !== "string" ) {
+ return jQuery.grep( elements, function( elem ) {
+ return ( indexOf.call( qualifier, elem ) > -1 ) !== not;
+ } );
+ }
+
+ // Filtered directly for both simple and complex selectors
+ return jQuery.filter( qualifier, elements, not );
+}
+
+jQuery.filter = function( expr, elems, not ) {
+ var elem = elems[ 0 ];
+
+ if ( not ) {
+ expr = ":not(" + expr + ")";
+ }
+
+ if ( elems.length === 1 && elem.nodeType === 1 ) {
+ return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [];
+ }
+
+ return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {
+ return elem.nodeType === 1;
+ } ) );
+};
+
+jQuery.fn.extend( {
+ find: function( selector ) {
+ var i, ret,
+ len = this.length,
+ self = this;
+
+ if ( typeof selector !== "string" ) {
+ return this.pushStack( jQuery( selector ).filter( function() {
+ for ( i = 0; i < len; i++ ) {
+ if ( jQuery.contains( self[ i ], this ) ) {
+ return true;
+ }
+ }
+ } ) );
+ }
+
+ ret = this.pushStack( [] );
+
+ for ( i = 0; i < len; i++ ) {
+ jQuery.find( selector, self[ i ], ret );
+ }
+
+ return len > 1 ? jQuery.uniqueSort( ret ) : ret;
+ },
+ filter: function( selector ) {
+ return this.pushStack( winnow( this, selector || [], false ) );
+ },
+ not: function( selector ) {
+ return this.pushStack( winnow( this, selector || [], true ) );
+ },
+ is: function( selector ) {
+ return !!winnow(
+ this,
+
+ // If this is a positional/relative selector, check membership in the returned set
+ // so $("p:first").is("p:last") won't return true for a doc with two "p".
+ typeof selector === "string" && rneedsContext.test( selector ) ?
+ jQuery( selector ) :
+ selector || [],
+ false
+ ).length;
+ }
+} );
+
+
+// Initialize a jQuery object
+
+
+// A central reference to the root jQuery(document)
+var rootjQuery,
+
+ // A simple way to check for HTML strings
+ // Prioritize #id over to avoid XSS via location.hash (#9521)
+ // Strict HTML recognition (#11290: must start with <)
+ // Shortcut simple #id case for speed
+ rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,
+
+ init = jQuery.fn.init = function( selector, context, root ) {
+ var match, elem;
+
+ // HANDLE: $(""), $(null), $(undefined), $(false)
+ if ( !selector ) {
+ return this;
+ }
+
+ // Method init() accepts an alternate rootjQuery
+ // so migrate can support jQuery.sub (gh-2101)
+ root = root || rootjQuery;
+
+ // Handle HTML strings
+ if ( typeof selector === "string" ) {
+ if ( selector[ 0 ] === "<" &&
+ selector[ selector.length - 1 ] === ">" &&
+ selector.length >= 3 ) {
+
+ // Assume that strings that start and end with <> are HTML and skip the regex check
+ match = [ null, selector, null ];
+
+ } else {
+ match = rquickExpr.exec( selector );
+ }
+
+ // Match html or make sure no context is specified for #id
+ if ( match && ( match[ 1 ] || !context ) ) {
+
+ // HANDLE: $(html) -> $(array)
+ if ( match[ 1 ] ) {
+ context = context instanceof jQuery ? context[ 0 ] : context;
+
+ // Option to run scripts is true for back-compat
+ // Intentionally let the error be thrown if parseHTML is not present
+ jQuery.merge( this, jQuery.parseHTML(
+ match[ 1 ],
+ context && context.nodeType ? context.ownerDocument || context : document,
+ true
+ ) );
+
+ // HANDLE: $(html, props)
+ if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) {
+ for ( match in context ) {
+
+ // Properties of context are called as methods if possible
+ if ( isFunction( this[ match ] ) ) {
+ this[ match ]( context[ match ] );
+
+ // ...and otherwise set as attributes
+ } else {
+ this.attr( match, context[ match ] );
+ }
+ }
+ }
+
+ return this;
+
+ // HANDLE: $(#id)
+ } else {
+ elem = document.getElementById( match[ 2 ] );
+
+ if ( elem ) {
+
+ // Inject the element directly into the jQuery object
+ this[ 0 ] = elem;
+ this.length = 1;
+ }
+ return this;
+ }
+
+ // HANDLE: $(expr, $(...))
+ } else if ( !context || context.jquery ) {
+ return ( context || root ).find( selector );
+
+ // HANDLE: $(expr, context)
+ // (which is just equivalent to: $(context).find(expr)
+ } else {
+ return this.constructor( context ).find( selector );
+ }
+
+ // HANDLE: $(DOMElement)
+ } else if ( selector.nodeType ) {
+ this[ 0 ] = selector;
+ this.length = 1;
+ return this;
+
+ // HANDLE: $(function)
+ // Shortcut for document ready
+ } else if ( isFunction( selector ) ) {
+ return root.ready !== undefined ?
+ root.ready( selector ) :
+
+ // Execute immediately if ready is not present
+ selector( jQuery );
+ }
+
+ return jQuery.makeArray( selector, this );
+ };
+
+// Give the init function the jQuery prototype for later instantiation
+init.prototype = jQuery.fn;
+
+// Initialize central reference
+rootjQuery = jQuery( document );
+
+
+var rparentsprev = /^(?:parents|prev(?:Until|All))/,
+
+ // Methods guaranteed to produce a unique set when starting from a unique set
+ guaranteedUnique = {
+ children: true,
+ contents: true,
+ next: true,
+ prev: true
+ };
+
+jQuery.fn.extend( {
+ has: function( target ) {
+ var targets = jQuery( target, this ),
+ l = targets.length;
+
+ return this.filter( function() {
+ var i = 0;
+ for ( ; i < l; i++ ) {
+ if ( jQuery.contains( this, targets[ i ] ) ) {
+ return true;
+ }
+ }
+ } );
+ },
+
+ closest: function( selectors, context ) {
+ var cur,
+ i = 0,
+ l = this.length,
+ matched = [],
+ targets = typeof selectors !== "string" && jQuery( selectors );
+
+ // Positional selectors never match, since there's no _selection_ context
+ if ( !rneedsContext.test( selectors ) ) {
+ for ( ; i < l; i++ ) {
+ for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) {
+
+ // Always skip document fragments
+ if ( cur.nodeType < 11 && ( targets ?
+ targets.index( cur ) > -1 :
+
+ // Don't pass non-elements to Sizzle
+ cur.nodeType === 1 &&
+ jQuery.find.matchesSelector( cur, selectors ) ) ) {
+
+ matched.push( cur );
+ break;
+ }
+ }
+ }
+ }
+
+ return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched );
+ },
+
+ // Determine the position of an element within the set
+ index: function( elem ) {
+
+ // No argument, return index in parent
+ if ( !elem ) {
+ return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1;
+ }
+
+ // Index in selector
+ if ( typeof elem === "string" ) {
+ return indexOf.call( jQuery( elem ), this[ 0 ] );
+ }
+
+ // Locate the position of the desired element
+ return indexOf.call( this,
+
+ // If it receives a jQuery object, the first element is used
+ elem.jquery ? elem[ 0 ] : elem
+ );
+ },
+
+ add: function( selector, context ) {
+ return this.pushStack(
+ jQuery.uniqueSort(
+ jQuery.merge( this.get(), jQuery( selector, context ) )
+ )
+ );
+ },
+
+ addBack: function( selector ) {
+ return this.add( selector == null ?
+ this.prevObject : this.prevObject.filter( selector )
+ );
+ }
+} );
+
+function sibling( cur, dir ) {
+ while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {}
+ return cur;
+}
+
+jQuery.each( {
+ parent: function( elem ) {
+ var parent = elem.parentNode;
+ return parent && parent.nodeType !== 11 ? parent : null;
+ },
+ parents: function( elem ) {
+ return dir( elem, "parentNode" );
+ },
+ parentsUntil: function( elem, _i, until ) {
+ return dir( elem, "parentNode", until );
+ },
+ next: function( elem ) {
+ return sibling( elem, "nextSibling" );
+ },
+ prev: function( elem ) {
+ return sibling( elem, "previousSibling" );
+ },
+ nextAll: function( elem ) {
+ return dir( elem, "nextSibling" );
+ },
+ prevAll: function( elem ) {
+ return dir( elem, "previousSibling" );
+ },
+ nextUntil: function( elem, _i, until ) {
+ return dir( elem, "nextSibling", until );
+ },
+ prevUntil: function( elem, _i, until ) {
+ return dir( elem, "previousSibling", until );
+ },
+ siblings: function( elem ) {
+ return siblings( ( elem.parentNode || {} ).firstChild, elem );
+ },
+ children: function( elem ) {
+ return siblings( elem.firstChild );
+ },
+ contents: function( elem ) {
+ if ( elem.contentDocument != null &&
+
+ // Support: IE 11+
+ // elements with no `data` attribute has an object
+ // `contentDocument` with a `null` prototype.
+ getProto( elem.contentDocument ) ) {
+
+ return elem.contentDocument;
+ }
+
+ // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only
+ // Treat the template element as a regular one in browsers that
+ // don't support it.
+ if ( nodeName( elem, "template" ) ) {
+ elem = elem.content || elem;
+ }
+
+ return jQuery.merge( [], elem.childNodes );
+ }
+}, function( name, fn ) {
+ jQuery.fn[ name ] = function( until, selector ) {
+ var matched = jQuery.map( this, fn, until );
+
+ if ( name.slice( -5 ) !== "Until" ) {
+ selector = until;
+ }
+
+ if ( selector && typeof selector === "string" ) {
+ matched = jQuery.filter( selector, matched );
+ }
+
+ if ( this.length > 1 ) {
+
+ // Remove duplicates
+ if ( !guaranteedUnique[ name ] ) {
+ jQuery.uniqueSort( matched );
+ }
+
+ // Reverse order for parents* and prev-derivatives
+ if ( rparentsprev.test( name ) ) {
+ matched.reverse();
+ }
+ }
+
+ return this.pushStack( matched );
+ };
+} );
+var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g );
+
+
+
+// Convert String-formatted options into Object-formatted ones
+function createOptions( options ) {
+ var object = {};
+ jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) {
+ object[ flag ] = true;
+ } );
+ return object;
+}
+
+/*
+ * Create a callback list using the following parameters:
+ *
+ * options: an optional list of space-separated options that will change how
+ * the callback list behaves or a more traditional option object
+ *
+ * By default a callback list will act like an event callback list and can be
+ * "fired" multiple times.
+ *
+ * Possible options:
+ *
+ * once: will ensure the callback list can only be fired once (like a Deferred)
+ *
+ * memory: will keep track of previous values and will call any callback added
+ * after the list has been fired right away with the latest "memorized"
+ * values (like a Deferred)
+ *
+ * unique: will ensure a callback can only be added once (no duplicate in the list)
+ *
+ * stopOnFalse: interrupt callings when a callback returns false
+ *
+ */
+jQuery.Callbacks = function( options ) {
+
+ // Convert options from String-formatted to Object-formatted if needed
+ // (we check in cache first)
+ options = typeof options === "string" ?
+ createOptions( options ) :
+ jQuery.extend( {}, options );
+
+ var // Flag to know if list is currently firing
+ firing,
+
+ // Last fire value for non-forgettable lists
+ memory,
+
+ // Flag to know if list was already fired
+ fired,
+
+ // Flag to prevent firing
+ locked,
+
+ // Actual callback list
+ list = [],
+
+ // Queue of execution data for repeatable lists
+ queue = [],
+
+ // Index of currently firing callback (modified by add/remove as needed)
+ firingIndex = -1,
+
+ // Fire callbacks
+ fire = function() {
+
+ // Enforce single-firing
+ locked = locked || options.once;
+
+ // Execute callbacks for all pending executions,
+ // respecting firingIndex overrides and runtime changes
+ fired = firing = true;
+ for ( ; queue.length; firingIndex = -1 ) {
+ memory = queue.shift();
+ while ( ++firingIndex < list.length ) {
+
+ // Run callback and check for early termination
+ if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false &&
+ options.stopOnFalse ) {
+
+ // Jump to end and forget the data so .add doesn't re-fire
+ firingIndex = list.length;
+ memory = false;
+ }
+ }
+ }
+
+ // Forget the data if we're done with it
+ if ( !options.memory ) {
+ memory = false;
+ }
+
+ firing = false;
+
+ // Clean up if we're done firing for good
+ if ( locked ) {
+
+ // Keep an empty list if we have data for future add calls
+ if ( memory ) {
+ list = [];
+
+ // Otherwise, this object is spent
+ } else {
+ list = "";
+ }
+ }
+ },
+
+ // Actual Callbacks object
+ self = {
+
+ // Add a callback or a collection of callbacks to the list
+ add: function() {
+ if ( list ) {
+
+ // If we have memory from a past run, we should fire after adding
+ if ( memory && !firing ) {
+ firingIndex = list.length - 1;
+ queue.push( memory );
+ }
+
+ ( function add( args ) {
+ jQuery.each( args, function( _, arg ) {
+ if ( isFunction( arg ) ) {
+ if ( !options.unique || !self.has( arg ) ) {
+ list.push( arg );
+ }
+ } else if ( arg && arg.length && toType( arg ) !== "string" ) {
+
+ // Inspect recursively
+ add( arg );
+ }
+ } );
+ } )( arguments );
+
+ if ( memory && !firing ) {
+ fire();
+ }
+ }
+ return this;
+ },
+
+ // Remove a callback from the list
+ remove: function() {
+ jQuery.each( arguments, function( _, arg ) {
+ var index;
+ while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
+ list.splice( index, 1 );
+
+ // Handle firing indexes
+ if ( index <= firingIndex ) {
+ firingIndex--;
+ }
+ }
+ } );
+ return this;
+ },
+
+ // Check if a given callback is in the list.
+ // If no argument is given, return whether or not list has callbacks attached.
+ has: function( fn ) {
+ return fn ?
+ jQuery.inArray( fn, list ) > -1 :
+ list.length > 0;
+ },
+
+ // Remove all callbacks from the list
+ empty: function() {
+ if ( list ) {
+ list = [];
+ }
+ return this;
+ },
+
+ // Disable .fire and .add
+ // Abort any current/pending executions
+ // Clear all callbacks and values
+ disable: function() {
+ locked = queue = [];
+ list = memory = "";
+ return this;
+ },
+ disabled: function() {
+ return !list;
+ },
+
+ // Disable .fire
+ // Also disable .add unless we have memory (since it would have no effect)
+ // Abort any pending executions
+ lock: function() {
+ locked = queue = [];
+ if ( !memory && !firing ) {
+ list = memory = "";
+ }
+ return this;
+ },
+ locked: function() {
+ return !!locked;
+ },
+
+ // Call all callbacks with the given context and arguments
+ fireWith: function( context, args ) {
+ if ( !locked ) {
+ args = args || [];
+ args = [ context, args.slice ? args.slice() : args ];
+ queue.push( args );
+ if ( !firing ) {
+ fire();
+ }
+ }
+ return this;
+ },
+
+ // Call all the callbacks with the given arguments
+ fire: function() {
+ self.fireWith( this, arguments );
+ return this;
+ },
+
+ // To know if the callbacks have already been called at least once
+ fired: function() {
+ return !!fired;
+ }
+ };
+
+ return self;
+};
+
+
+function Identity( v ) {
+ return v;
+}
+function Thrower( ex ) {
+ throw ex;
+}
+
+function adoptValue( value, resolve, reject, noValue ) {
+ var method;
+
+ try {
+
+ // Check for promise aspect first to privilege synchronous behavior
+ if ( value && isFunction( ( method = value.promise ) ) ) {
+ method.call( value ).done( resolve ).fail( reject );
+
+ // Other thenables
+ } else if ( value && isFunction( ( method = value.then ) ) ) {
+ method.call( value, resolve, reject );
+
+ // Other non-thenables
+ } else {
+
+ // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer:
+ // * false: [ value ].slice( 0 ) => resolve( value )
+ // * true: [ value ].slice( 1 ) => resolve()
+ resolve.apply( undefined, [ value ].slice( noValue ) );
+ }
+
+ // For Promises/A+, convert exceptions into rejections
+ // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in
+ // Deferred#then to conditionally suppress rejection.
+ } catch ( value ) {
+
+ // Support: Android 4.0 only
+ // Strict mode functions invoked without .call/.apply get global-object context
+ reject.apply( undefined, [ value ] );
+ }
+}
+
+jQuery.extend( {
+
+ Deferred: function( func ) {
+ var tuples = [
+
+ // action, add listener, callbacks,
+ // ... .then handlers, argument index, [final state]
+ [ "notify", "progress", jQuery.Callbacks( "memory" ),
+ jQuery.Callbacks( "memory" ), 2 ],
+ [ "resolve", "done", jQuery.Callbacks( "once memory" ),
+ jQuery.Callbacks( "once memory" ), 0, "resolved" ],
+ [ "reject", "fail", jQuery.Callbacks( "once memory" ),
+ jQuery.Callbacks( "once memory" ), 1, "rejected" ]
+ ],
+ state = "pending",
+ promise = {
+ state: function() {
+ return state;
+ },
+ always: function() {
+ deferred.done( arguments ).fail( arguments );
+ return this;
+ },
+ "catch": function( fn ) {
+ return promise.then( null, fn );
+ },
+
+ // Keep pipe for back-compat
+ pipe: function( /* fnDone, fnFail, fnProgress */ ) {
+ var fns = arguments;
+
+ return jQuery.Deferred( function( newDefer ) {
+ jQuery.each( tuples, function( _i, tuple ) {
+
+ // Map tuples (progress, done, fail) to arguments (done, fail, progress)
+ var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ];
+
+ // deferred.progress(function() { bind to newDefer or newDefer.notify })
+ // deferred.done(function() { bind to newDefer or newDefer.resolve })
+ // deferred.fail(function() { bind to newDefer or newDefer.reject })
+ deferred[ tuple[ 1 ] ]( function() {
+ var returned = fn && fn.apply( this, arguments );
+ if ( returned && isFunction( returned.promise ) ) {
+ returned.promise()
+ .progress( newDefer.notify )
+ .done( newDefer.resolve )
+ .fail( newDefer.reject );
+ } else {
+ newDefer[ tuple[ 0 ] + "With" ](
+ this,
+ fn ? [ returned ] : arguments
+ );
+ }
+ } );
+ } );
+ fns = null;
+ } ).promise();
+ },
+ then: function( onFulfilled, onRejected, onProgress ) {
+ var maxDepth = 0;
+ function resolve( depth, deferred, handler, special ) {
+ return function() {
+ var that = this,
+ args = arguments,
+ mightThrow = function() {
+ var returned, then;
+
+ // Support: Promises/A+ section 2.3.3.3.3
+ // https://promisesaplus.com/#point-59
+ // Ignore double-resolution attempts
+ if ( depth < maxDepth ) {
+ return;
+ }
+
+ returned = handler.apply( that, args );
+
+ // Support: Promises/A+ section 2.3.1
+ // https://promisesaplus.com/#point-48
+ if ( returned === deferred.promise() ) {
+ throw new TypeError( "Thenable self-resolution" );
+ }
+
+ // Support: Promises/A+ sections 2.3.3.1, 3.5
+ // https://promisesaplus.com/#point-54
+ // https://promisesaplus.com/#point-75
+ // Retrieve `then` only once
+ then = returned &&
+
+ // Support: Promises/A+ section 2.3.4
+ // https://promisesaplus.com/#point-64
+ // Only check objects and functions for thenability
+ ( typeof returned === "object" ||
+ typeof returned === "function" ) &&
+ returned.then;
+
+ // Handle a returned thenable
+ if ( isFunction( then ) ) {
+
+ // Special processors (notify) just wait for resolution
+ if ( special ) {
+ then.call(
+ returned,
+ resolve( maxDepth, deferred, Identity, special ),
+ resolve( maxDepth, deferred, Thrower, special )
+ );
+
+ // Normal processors (resolve) also hook into progress
+ } else {
+
+ // ...and disregard older resolution values
+ maxDepth++;
+
+ then.call(
+ returned,
+ resolve( maxDepth, deferred, Identity, special ),
+ resolve( maxDepth, deferred, Thrower, special ),
+ resolve( maxDepth, deferred, Identity,
+ deferred.notifyWith )
+ );
+ }
+
+ // Handle all other returned values
+ } else {
+
+ // Only substitute handlers pass on context
+ // and multiple values (non-spec behavior)
+ if ( handler !== Identity ) {
+ that = undefined;
+ args = [ returned ];
+ }
+
+ // Process the value(s)
+ // Default process is resolve
+ ( special || deferred.resolveWith )( that, args );
+ }
+ },
+
+ // Only normal processors (resolve) catch and reject exceptions
+ process = special ?
+ mightThrow :
+ function() {
+ try {
+ mightThrow();
+ } catch ( e ) {
+
+ if ( jQuery.Deferred.exceptionHook ) {
+ jQuery.Deferred.exceptionHook( e,
+ process.stackTrace );
+ }
+
+ // Support: Promises/A+ section 2.3.3.3.4.1
+ // https://promisesaplus.com/#point-61
+ // Ignore post-resolution exceptions
+ if ( depth + 1 >= maxDepth ) {
+
+ // Only substitute handlers pass on context
+ // and multiple values (non-spec behavior)
+ if ( handler !== Thrower ) {
+ that = undefined;
+ args = [ e ];
+ }
+
+ deferred.rejectWith( that, args );
+ }
+ }
+ };
+
+ // Support: Promises/A+ section 2.3.3.3.1
+ // https://promisesaplus.com/#point-57
+ // Re-resolve promises immediately to dodge false rejection from
+ // subsequent errors
+ if ( depth ) {
+ process();
+ } else {
+
+ // Call an optional hook to record the stack, in case of exception
+ // since it's otherwise lost when execution goes async
+ if ( jQuery.Deferred.getStackHook ) {
+ process.stackTrace = jQuery.Deferred.getStackHook();
+ }
+ window.setTimeout( process );
+ }
+ };
+ }
+
+ return jQuery.Deferred( function( newDefer ) {
+
+ // progress_handlers.add( ... )
+ tuples[ 0 ][ 3 ].add(
+ resolve(
+ 0,
+ newDefer,
+ isFunction( onProgress ) ?
+ onProgress :
+ Identity,
+ newDefer.notifyWith
+ )
+ );
+
+ // fulfilled_handlers.add( ... )
+ tuples[ 1 ][ 3 ].add(
+ resolve(
+ 0,
+ newDefer,
+ isFunction( onFulfilled ) ?
+ onFulfilled :
+ Identity
+ )
+ );
+
+ // rejected_handlers.add( ... )
+ tuples[ 2 ][ 3 ].add(
+ resolve(
+ 0,
+ newDefer,
+ isFunction( onRejected ) ?
+ onRejected :
+ Thrower
+ )
+ );
+ } ).promise();
+ },
+
+ // Get a promise for this deferred
+ // If obj is provided, the promise aspect is added to the object
+ promise: function( obj ) {
+ return obj != null ? jQuery.extend( obj, promise ) : promise;
+ }
+ },
+ deferred = {};
+
+ // Add list-specific methods
+ jQuery.each( tuples, function( i, tuple ) {
+ var list = tuple[ 2 ],
+ stateString = tuple[ 5 ];
+
+ // promise.progress = list.add
+ // promise.done = list.add
+ // promise.fail = list.add
+ promise[ tuple[ 1 ] ] = list.add;
+
+ // Handle state
+ if ( stateString ) {
+ list.add(
+ function() {
+
+ // state = "resolved" (i.e., fulfilled)
+ // state = "rejected"
+ state = stateString;
+ },
+
+ // rejected_callbacks.disable
+ // fulfilled_callbacks.disable
+ tuples[ 3 - i ][ 2 ].disable,
+
+ // rejected_handlers.disable
+ // fulfilled_handlers.disable
+ tuples[ 3 - i ][ 3 ].disable,
+
+ // progress_callbacks.lock
+ tuples[ 0 ][ 2 ].lock,
+
+ // progress_handlers.lock
+ tuples[ 0 ][ 3 ].lock
+ );
+ }
+
+ // progress_handlers.fire
+ // fulfilled_handlers.fire
+ // rejected_handlers.fire
+ list.add( tuple[ 3 ].fire );
+
+ // deferred.notify = function() { deferred.notifyWith(...) }
+ // deferred.resolve = function() { deferred.resolveWith(...) }
+ // deferred.reject = function() { deferred.rejectWith(...) }
+ deferred[ tuple[ 0 ] ] = function() {
+ deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments );
+ return this;
+ };
+
+ // deferred.notifyWith = list.fireWith
+ // deferred.resolveWith = list.fireWith
+ // deferred.rejectWith = list.fireWith
+ deferred[ tuple[ 0 ] + "With" ] = list.fireWith;
+ } );
+
+ // Make the deferred a promise
+ promise.promise( deferred );
+
+ // Call given func if any
+ if ( func ) {
+ func.call( deferred, deferred );
+ }
+
+ // All done!
+ return deferred;
+ },
+
+ // Deferred helper
+ when: function( singleValue ) {
+ var
+
+ // count of uncompleted subordinates
+ remaining = arguments.length,
+
+ // count of unprocessed arguments
+ i = remaining,
+
+ // subordinate fulfillment data
+ resolveContexts = Array( i ),
+ resolveValues = slice.call( arguments ),
+
+ // the primary Deferred
+ primary = jQuery.Deferred(),
+
+ // subordinate callback factory
+ updateFunc = function( i ) {
+ return function( value ) {
+ resolveContexts[ i ] = this;
+ resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;
+ if ( !( --remaining ) ) {
+ primary.resolveWith( resolveContexts, resolveValues );
+ }
+ };
+ };
+
+ // Single- and empty arguments are adopted like Promise.resolve
+ if ( remaining <= 1 ) {
+ adoptValue( singleValue, primary.done( updateFunc( i ) ).resolve, primary.reject,
+ !remaining );
+
+ // Use .then() to unwrap secondary thenables (cf. gh-3000)
+ if ( primary.state() === "pending" ||
+ isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) {
+
+ return primary.then();
+ }
+ }
+
+ // Multiple arguments are aggregated like Promise.all array elements
+ while ( i-- ) {
+ adoptValue( resolveValues[ i ], updateFunc( i ), primary.reject );
+ }
+
+ return primary.promise();
+ }
+} );
+
+
+// These usually indicate a programmer mistake during development,
+// warn about them ASAP rather than swallowing them by default.
+var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;
+
+jQuery.Deferred.exceptionHook = function( error, stack ) {
+
+ // Support: IE 8 - 9 only
+ // Console exists when dev tools are open, which can happen at any time
+ if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) {
+ window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack );
+ }
+};
+
+
+
+
+jQuery.readyException = function( error ) {
+ window.setTimeout( function() {
+ throw error;
+ } );
+};
+
+
+
+
+// The deferred used on DOM ready
+var readyList = jQuery.Deferred();
+
+jQuery.fn.ready = function( fn ) {
+
+ readyList
+ .then( fn )
+
+ // Wrap jQuery.readyException in a function so that the lookup
+ // happens at the time of error handling instead of callback
+ // registration.
+ .catch( function( error ) {
+ jQuery.readyException( error );
+ } );
+
+ return this;
+};
+
+jQuery.extend( {
+
+ // Is the DOM ready to be used? Set to true once it occurs.
+ isReady: false,
+
+ // A counter to track how many items to wait for before
+ // the ready event fires. See #6781
+ readyWait: 1,
+
+ // Handle when the DOM is ready
+ ready: function( wait ) {
+
+ // Abort if there are pending holds or we're already ready
+ if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
+ return;
+ }
+
+ // Remember that the DOM is ready
+ jQuery.isReady = true;
+
+ // If a normal DOM Ready event fired, decrement, and wait if need be
+ if ( wait !== true && --jQuery.readyWait > 0 ) {
+ return;
+ }
+
+ // If there are functions bound, to execute
+ readyList.resolveWith( document, [ jQuery ] );
+ }
+} );
+
+jQuery.ready.then = readyList.then;
+
+// The ready event handler and self cleanup method
+function completed() {
+ document.removeEventListener( "DOMContentLoaded", completed );
+ window.removeEventListener( "load", completed );
+ jQuery.ready();
+}
+
+// Catch cases where $(document).ready() is called
+// after the browser event has already occurred.
+// Support: IE <=9 - 10 only
+// Older IE sometimes signals "interactive" too soon
+if ( document.readyState === "complete" ||
+ ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) {
+
+ // Handle it asynchronously to allow scripts the opportunity to delay ready
+ window.setTimeout( jQuery.ready );
+
+} else {
+
+ // Use the handy event callback
+ document.addEventListener( "DOMContentLoaded", completed );
+
+ // A fallback to window.onload, that will always work
+ window.addEventListener( "load", completed );
+}
+
+
+
+
+// Multifunctional method to get and set values of a collection
+// The value/s can optionally be executed if it's a function
+var access = function( elems, fn, key, value, chainable, emptyGet, raw ) {
+ var i = 0,
+ len = elems.length,
+ bulk = key == null;
+
+ // Sets many values
+ if ( toType( key ) === "object" ) {
+ chainable = true;
+ for ( i in key ) {
+ access( elems, fn, i, key[ i ], true, emptyGet, raw );
+ }
+
+ // Sets one value
+ } else if ( value !== undefined ) {
+ chainable = true;
+
+ if ( !isFunction( value ) ) {
+ raw = true;
+ }
+
+ if ( bulk ) {
+
+ // Bulk operations run against the entire set
+ if ( raw ) {
+ fn.call( elems, value );
+ fn = null;
+
+ // ...except when executing function values
+ } else {
+ bulk = fn;
+ fn = function( elem, _key, value ) {
+ return bulk.call( jQuery( elem ), value );
+ };
+ }
+ }
+
+ if ( fn ) {
+ for ( ; i < len; i++ ) {
+ fn(
+ elems[ i ], key, raw ?
+ value :
+ value.call( elems[ i ], i, fn( elems[ i ], key ) )
+ );
+ }
+ }
+ }
+
+ if ( chainable ) {
+ return elems;
+ }
+
+ // Gets
+ if ( bulk ) {
+ return fn.call( elems );
+ }
+
+ return len ? fn( elems[ 0 ], key ) : emptyGet;
+};
+
+
+// Matches dashed string for camelizing
+var rmsPrefix = /^-ms-/,
+ rdashAlpha = /-([a-z])/g;
+
+// Used by camelCase as callback to replace()
+function fcamelCase( _all, letter ) {
+ return letter.toUpperCase();
+}
+
+// Convert dashed to camelCase; used by the css and data modules
+// Support: IE <=9 - 11, Edge 12 - 15
+// Microsoft forgot to hump their vendor prefix (#9572)
+function camelCase( string ) {
+ return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
+}
+var acceptData = function( owner ) {
+
+ // Accepts only:
+ // - Node
+ // - Node.ELEMENT_NODE
+ // - Node.DOCUMENT_NODE
+ // - Object
+ // - Any
+ return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType );
+};
+
+
+
+
+function Data() {
+ this.expando = jQuery.expando + Data.uid++;
+}
+
+Data.uid = 1;
+
+Data.prototype = {
+
+ cache: function( owner ) {
+
+ // Check if the owner object already has a cache
+ var value = owner[ this.expando ];
+
+ // If not, create one
+ if ( !value ) {
+ value = {};
+
+ // We can accept data for non-element nodes in modern browsers,
+ // but we should not, see #8335.
+ // Always return an empty object.
+ if ( acceptData( owner ) ) {
+
+ // If it is a node unlikely to be stringify-ed or looped over
+ // use plain assignment
+ if ( owner.nodeType ) {
+ owner[ this.expando ] = value;
+
+ // Otherwise secure it in a non-enumerable property
+ // configurable must be true to allow the property to be
+ // deleted when data is removed
+ } else {
+ Object.defineProperty( owner, this.expando, {
+ value: value,
+ configurable: true
+ } );
+ }
+ }
+ }
+
+ return value;
+ },
+ set: function( owner, data, value ) {
+ var prop,
+ cache = this.cache( owner );
+
+ // Handle: [ owner, key, value ] args
+ // Always use camelCase key (gh-2257)
+ if ( typeof data === "string" ) {
+ cache[ camelCase( data ) ] = value;
+
+ // Handle: [ owner, { properties } ] args
+ } else {
+
+ // Copy the properties one-by-one to the cache object
+ for ( prop in data ) {
+ cache[ camelCase( prop ) ] = data[ prop ];
+ }
+ }
+ return cache;
+ },
+ get: function( owner, key ) {
+ return key === undefined ?
+ this.cache( owner ) :
+
+ // Always use camelCase key (gh-2257)
+ owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ];
+ },
+ access: function( owner, key, value ) {
+
+ // In cases where either:
+ //
+ // 1. No key was specified
+ // 2. A string key was specified, but no value provided
+ //
+ // Take the "read" path and allow the get method to determine
+ // which value to return, respectively either:
+ //
+ // 1. The entire cache object
+ // 2. The data stored at the key
+ //
+ if ( key === undefined ||
+ ( ( key && typeof key === "string" ) && value === undefined ) ) {
+
+ return this.get( owner, key );
+ }
+
+ // When the key is not a string, or both a key and value
+ // are specified, set or extend (existing objects) with either:
+ //
+ // 1. An object of properties
+ // 2. A key and value
+ //
+ this.set( owner, key, value );
+
+ // Since the "set" path can have two possible entry points
+ // return the expected data based on which path was taken[*]
+ return value !== undefined ? value : key;
+ },
+ remove: function( owner, key ) {
+ var i,
+ cache = owner[ this.expando ];
+
+ if ( cache === undefined ) {
+ return;
+ }
+
+ if ( key !== undefined ) {
+
+ // Support array or space separated string of keys
+ if ( Array.isArray( key ) ) {
+
+ // If key is an array of keys...
+ // We always set camelCase keys, so remove that.
+ key = key.map( camelCase );
+ } else {
+ key = camelCase( key );
+
+ // If a key with the spaces exists, use it.
+ // Otherwise, create an array by matching non-whitespace
+ key = key in cache ?
+ [ key ] :
+ ( key.match( rnothtmlwhite ) || [] );
+ }
+
+ i = key.length;
+
+ while ( i-- ) {
+ delete cache[ key[ i ] ];
+ }
+ }
+
+ // Remove the expando if there's no more data
+ if ( key === undefined || jQuery.isEmptyObject( cache ) ) {
+
+ // Support: Chrome <=35 - 45
+ // Webkit & Blink performance suffers when deleting properties
+ // from DOM nodes, so set to undefined instead
+ // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted)
+ if ( owner.nodeType ) {
+ owner[ this.expando ] = undefined;
+ } else {
+ delete owner[ this.expando ];
+ }
+ }
+ },
+ hasData: function( owner ) {
+ var cache = owner[ this.expando ];
+ return cache !== undefined && !jQuery.isEmptyObject( cache );
+ }
+};
+var dataPriv = new Data();
+
+var dataUser = new Data();
+
+
+
+// Implementation Summary
+//
+// 1. Enforce API surface and semantic compatibility with 1.9.x branch
+// 2. Improve the module's maintainability by reducing the storage
+// paths to a single mechanism.
+// 3. Use the same single mechanism to support "private" and "user" data.
+// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData)
+// 5. Avoid exposing implementation details on user objects (eg. expando properties)
+// 6. Provide a clear path for implementation upgrade to WeakMap in 2014
+
+var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,
+ rmultiDash = /[A-Z]/g;
+
+function getData( data ) {
+ if ( data === "true" ) {
+ return true;
+ }
+
+ if ( data === "false" ) {
+ return false;
+ }
+
+ if ( data === "null" ) {
+ return null;
+ }
+
+ // Only convert to a number if it doesn't change the string
+ if ( data === +data + "" ) {
+ return +data;
+ }
+
+ if ( rbrace.test( data ) ) {
+ return JSON.parse( data );
+ }
+
+ return data;
+}
+
+function dataAttr( elem, key, data ) {
+ var name;
+
+ // If nothing was found internally, try to fetch any
+ // data from the HTML5 data-* attribute
+ if ( data === undefined && elem.nodeType === 1 ) {
+ name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase();
+ data = elem.getAttribute( name );
+
+ if ( typeof data === "string" ) {
+ try {
+ data = getData( data );
+ } catch ( e ) {}
+
+ // Make sure we set the data so it isn't changed later
+ dataUser.set( elem, key, data );
+ } else {
+ data = undefined;
+ }
+ }
+ return data;
+}
+
+jQuery.extend( {
+ hasData: function( elem ) {
+ return dataUser.hasData( elem ) || dataPriv.hasData( elem );
+ },
+
+ data: function( elem, name, data ) {
+ return dataUser.access( elem, name, data );
+ },
+
+ removeData: function( elem, name ) {
+ dataUser.remove( elem, name );
+ },
+
+ // TODO: Now that all calls to _data and _removeData have been replaced
+ // with direct calls to dataPriv methods, these can be deprecated.
+ _data: function( elem, name, data ) {
+ return dataPriv.access( elem, name, data );
+ },
+
+ _removeData: function( elem, name ) {
+ dataPriv.remove( elem, name );
+ }
+} );
+
+jQuery.fn.extend( {
+ data: function( key, value ) {
+ var i, name, data,
+ elem = this[ 0 ],
+ attrs = elem && elem.attributes;
+
+ // Gets all values
+ if ( key === undefined ) {
+ if ( this.length ) {
+ data = dataUser.get( elem );
+
+ if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) {
+ i = attrs.length;
+ while ( i-- ) {
+
+ // Support: IE 11 only
+ // The attrs elements can be null (#14894)
+ if ( attrs[ i ] ) {
+ name = attrs[ i ].name;
+ if ( name.indexOf( "data-" ) === 0 ) {
+ name = camelCase( name.slice( 5 ) );
+ dataAttr( elem, name, data[ name ] );
+ }
+ }
+ }
+ dataPriv.set( elem, "hasDataAttrs", true );
+ }
+ }
+
+ return data;
+ }
+
+ // Sets multiple values
+ if ( typeof key === "object" ) {
+ return this.each( function() {
+ dataUser.set( this, key );
+ } );
+ }
+
+ return access( this, function( value ) {
+ var data;
+
+ // The calling jQuery object (element matches) is not empty
+ // (and therefore has an element appears at this[ 0 ]) and the
+ // `value` parameter was not undefined. An empty jQuery object
+ // will result in `undefined` for elem = this[ 0 ] which will
+ // throw an exception if an attempt to read a data cache is made.
+ if ( elem && value === undefined ) {
+
+ // Attempt to get data from the cache
+ // The key will always be camelCased in Data
+ data = dataUser.get( elem, key );
+ if ( data !== undefined ) {
+ return data;
+ }
+
+ // Attempt to "discover" the data in
+ // HTML5 custom data-* attrs
+ data = dataAttr( elem, key );
+ if ( data !== undefined ) {
+ return data;
+ }
+
+ // We tried really hard, but the data doesn't exist.
+ return;
+ }
+
+ // Set the data...
+ this.each( function() {
+
+ // We always store the camelCased key
+ dataUser.set( this, key, value );
+ } );
+ }, null, value, arguments.length > 1, null, true );
+ },
+
+ removeData: function( key ) {
+ return this.each( function() {
+ dataUser.remove( this, key );
+ } );
+ }
+} );
+
+
+jQuery.extend( {
+ queue: function( elem, type, data ) {
+ var queue;
+
+ if ( elem ) {
+ type = ( type || "fx" ) + "queue";
+ queue = dataPriv.get( elem, type );
+
+ // Speed up dequeue by getting out quickly if this is just a lookup
+ if ( data ) {
+ if ( !queue || Array.isArray( data ) ) {
+ queue = dataPriv.access( elem, type, jQuery.makeArray( data ) );
+ } else {
+ queue.push( data );
+ }
+ }
+ return queue || [];
+ }
+ },
+
+ dequeue: function( elem, type ) {
+ type = type || "fx";
+
+ var queue = jQuery.queue( elem, type ),
+ startLength = queue.length,
+ fn = queue.shift(),
+ hooks = jQuery._queueHooks( elem, type ),
+ next = function() {
+ jQuery.dequeue( elem, type );
+ };
+
+ // If the fx queue is dequeued, always remove the progress sentinel
+ if ( fn === "inprogress" ) {
+ fn = queue.shift();
+ startLength--;
+ }
+
+ if ( fn ) {
+
+ // Add a progress sentinel to prevent the fx queue from being
+ // automatically dequeued
+ if ( type === "fx" ) {
+ queue.unshift( "inprogress" );
+ }
+
+ // Clear up the last queue stop function
+ delete hooks.stop;
+ fn.call( elem, next, hooks );
+ }
+
+ if ( !startLength && hooks ) {
+ hooks.empty.fire();
+ }
+ },
+
+ // Not public - generate a queueHooks object, or return the current one
+ _queueHooks: function( elem, type ) {
+ var key = type + "queueHooks";
+ return dataPriv.get( elem, key ) || dataPriv.access( elem, key, {
+ empty: jQuery.Callbacks( "once memory" ).add( function() {
+ dataPriv.remove( elem, [ type + "queue", key ] );
+ } )
+ } );
+ }
+} );
+
+jQuery.fn.extend( {
+ queue: function( type, data ) {
+ var setter = 2;
+
+ if ( typeof type !== "string" ) {
+ data = type;
+ type = "fx";
+ setter--;
+ }
+
+ if ( arguments.length < setter ) {
+ return jQuery.queue( this[ 0 ], type );
+ }
+
+ return data === undefined ?
+ this :
+ this.each( function() {
+ var queue = jQuery.queue( this, type, data );
+
+ // Ensure a hooks for this queue
+ jQuery._queueHooks( this, type );
+
+ if ( type === "fx" && queue[ 0 ] !== "inprogress" ) {
+ jQuery.dequeue( this, type );
+ }
+ } );
+ },
+ dequeue: function( type ) {
+ return this.each( function() {
+ jQuery.dequeue( this, type );
+ } );
+ },
+ clearQueue: function( type ) {
+ return this.queue( type || "fx", [] );
+ },
+
+ // Get a promise resolved when queues of a certain type
+ // are emptied (fx is the type by default)
+ promise: function( type, obj ) {
+ var tmp,
+ count = 1,
+ defer = jQuery.Deferred(),
+ elements = this,
+ i = this.length,
+ resolve = function() {
+ if ( !( --count ) ) {
+ defer.resolveWith( elements, [ elements ] );
+ }
+ };
+
+ if ( typeof type !== "string" ) {
+ obj = type;
+ type = undefined;
+ }
+ type = type || "fx";
+
+ while ( i-- ) {
+ tmp = dataPriv.get( elements[ i ], type + "queueHooks" );
+ if ( tmp && tmp.empty ) {
+ count++;
+ tmp.empty.add( resolve );
+ }
+ }
+ resolve();
+ return defer.promise( obj );
+ }
+} );
+var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source;
+
+var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" );
+
+
+var cssExpand = [ "Top", "Right", "Bottom", "Left" ];
+
+var documentElement = document.documentElement;
+
+
+
+ var isAttached = function( elem ) {
+ return jQuery.contains( elem.ownerDocument, elem );
+ },
+ composed = { composed: true };
+
+ // Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only
+ // Check attachment across shadow DOM boundaries when possible (gh-3504)
+ // Support: iOS 10.0-10.2 only
+ // Early iOS 10 versions support `attachShadow` but not `getRootNode`,
+ // leading to errors. We need to check for `getRootNode`.
+ if ( documentElement.getRootNode ) {
+ isAttached = function( elem ) {
+ return jQuery.contains( elem.ownerDocument, elem ) ||
+ elem.getRootNode( composed ) === elem.ownerDocument;
+ };
+ }
+var isHiddenWithinTree = function( elem, el ) {
+
+ // isHiddenWithinTree might be called from jQuery#filter function;
+ // in that case, element will be second argument
+ elem = el || elem;
+
+ // Inline style trumps all
+ return elem.style.display === "none" ||
+ elem.style.display === "" &&
+
+ // Otherwise, check computed style
+ // Support: Firefox <=43 - 45
+ // Disconnected elements can have computed display: none, so first confirm that elem is
+ // in the document.
+ isAttached( elem ) &&
+
+ jQuery.css( elem, "display" ) === "none";
+ };
+
+
+
+function adjustCSS( elem, prop, valueParts, tween ) {
+ var adjusted, scale,
+ maxIterations = 20,
+ currentValue = tween ?
+ function() {
+ return tween.cur();
+ } :
+ function() {
+ return jQuery.css( elem, prop, "" );
+ },
+ initial = currentValue(),
+ unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ),
+
+ // Starting value computation is required for potential unit mismatches
+ initialInUnit = elem.nodeType &&
+ ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) &&
+ rcssNum.exec( jQuery.css( elem, prop ) );
+
+ if ( initialInUnit && initialInUnit[ 3 ] !== unit ) {
+
+ // Support: Firefox <=54
+ // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144)
+ initial = initial / 2;
+
+ // Trust units reported by jQuery.css
+ unit = unit || initialInUnit[ 3 ];
+
+ // Iteratively approximate from a nonzero starting point
+ initialInUnit = +initial || 1;
+
+ while ( maxIterations-- ) {
+
+ // Evaluate and update our best guess (doubling guesses that zero out).
+ // Finish if the scale equals or crosses 1 (making the old*new product non-positive).
+ jQuery.style( elem, prop, initialInUnit + unit );
+ if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) {
+ maxIterations = 0;
+ }
+ initialInUnit = initialInUnit / scale;
+
+ }
+
+ initialInUnit = initialInUnit * 2;
+ jQuery.style( elem, prop, initialInUnit + unit );
+
+ // Make sure we update the tween properties later on
+ valueParts = valueParts || [];
+ }
+
+ if ( valueParts ) {
+ initialInUnit = +initialInUnit || +initial || 0;
+
+ // Apply relative offset (+=/-=) if specified
+ adjusted = valueParts[ 1 ] ?
+ initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] :
+ +valueParts[ 2 ];
+ if ( tween ) {
+ tween.unit = unit;
+ tween.start = initialInUnit;
+ tween.end = adjusted;
+ }
+ }
+ return adjusted;
+}
+
+
+var defaultDisplayMap = {};
+
+function getDefaultDisplay( elem ) {
+ var temp,
+ doc = elem.ownerDocument,
+ nodeName = elem.nodeName,
+ display = defaultDisplayMap[ nodeName ];
+
+ if ( display ) {
+ return display;
+ }
+
+ temp = doc.body.appendChild( doc.createElement( nodeName ) );
+ display = jQuery.css( temp, "display" );
+
+ temp.parentNode.removeChild( temp );
+
+ if ( display === "none" ) {
+ display = "block";
+ }
+ defaultDisplayMap[ nodeName ] = display;
+
+ return display;
+}
+
+function showHide( elements, show ) {
+ var display, elem,
+ values = [],
+ index = 0,
+ length = elements.length;
+
+ // Determine new display value for elements that need to change
+ for ( ; index < length; index++ ) {
+ elem = elements[ index ];
+ if ( !elem.style ) {
+ continue;
+ }
+
+ display = elem.style.display;
+ if ( show ) {
+
+ // Since we force visibility upon cascade-hidden elements, an immediate (and slow)
+ // check is required in this first loop unless we have a nonempty display value (either
+ // inline or about-to-be-restored)
+ if ( display === "none" ) {
+ values[ index ] = dataPriv.get( elem, "display" ) || null;
+ if ( !values[ index ] ) {
+ elem.style.display = "";
+ }
+ }
+ if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) {
+ values[ index ] = getDefaultDisplay( elem );
+ }
+ } else {
+ if ( display !== "none" ) {
+ values[ index ] = "none";
+
+ // Remember what we're overwriting
+ dataPriv.set( elem, "display", display );
+ }
+ }
+ }
+
+ // Set the display of the elements in a second loop to avoid constant reflow
+ for ( index = 0; index < length; index++ ) {
+ if ( values[ index ] != null ) {
+ elements[ index ].style.display = values[ index ];
+ }
+ }
+
+ return elements;
+}
+
+jQuery.fn.extend( {
+ show: function() {
+ return showHide( this, true );
+ },
+ hide: function() {
+ return showHide( this );
+ },
+ toggle: function( state ) {
+ if ( typeof state === "boolean" ) {
+ return state ? this.show() : this.hide();
+ }
+
+ return this.each( function() {
+ if ( isHiddenWithinTree( this ) ) {
+ jQuery( this ).show();
+ } else {
+ jQuery( this ).hide();
+ }
+ } );
+ }
+} );
+var rcheckableType = ( /^(?:checkbox|radio)$/i );
+
+var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i );
+
+var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i );
+
+
+
+( function() {
+ var fragment = document.createDocumentFragment(),
+ div = fragment.appendChild( document.createElement( "div" ) ),
+ input = document.createElement( "input" );
+
+ // Support: Android 4.0 - 4.3 only
+ // Check state lost if the name is set (#11217)
+ // Support: Windows Web Apps (WWA)
+ // `name` and `type` must use .setAttribute for WWA (#14901)
+ input.setAttribute( "type", "radio" );
+ input.setAttribute( "checked", "checked" );
+ input.setAttribute( "name", "t" );
+
+ div.appendChild( input );
+
+ // Support: Android <=4.1 only
+ // Older WebKit doesn't clone checked state correctly in fragments
+ support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;
+
+ // Support: IE <=11 only
+ // Make sure textarea (and checkbox) defaultValue is properly cloned
+ div.innerHTML = "";
+ support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;
+
+ // Support: IE <=9 only
+ // IE <=9 replaces tags with their contents when inserted outside of
+ // the select element.
+ div.innerHTML = " ";
+ support.option = !!div.lastChild;
+} )();
+
+
+// We have to close these tags to support XHTML (#13200)
+var wrapMap = {
+
+ // XHTML parsers do not magically insert elements in the
+ // same way that tag soup parsers do. So we cannot shorten
+ // this by omitting or other required elements.
+ thead: [ 1, "" ],
+ col: [ 2, "" ],
+ tr: [ 2, "" ],
+ td: [ 3, "" ],
+
+ _default: [ 0, "", "" ]
+};
+
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+// Support: IE <=9 only
+if ( !support.option ) {
+ wrapMap.optgroup = wrapMap.option = [ 1, "", " " ];
+}
+
+
+function getAll( context, tag ) {
+
+ // Support: IE <=9 - 11 only
+ // Use typeof to avoid zero-argument method invocation on host objects (#15151)
+ var ret;
+
+ if ( typeof context.getElementsByTagName !== "undefined" ) {
+ ret = context.getElementsByTagName( tag || "*" );
+
+ } else if ( typeof context.querySelectorAll !== "undefined" ) {
+ ret = context.querySelectorAll( tag || "*" );
+
+ } else {
+ ret = [];
+ }
+
+ if ( tag === undefined || tag && nodeName( context, tag ) ) {
+ return jQuery.merge( [ context ], ret );
+ }
+
+ return ret;
+}
+
+
+// Mark scripts as having already been evaluated
+function setGlobalEval( elems, refElements ) {
+ var i = 0,
+ l = elems.length;
+
+ for ( ; i < l; i++ ) {
+ dataPriv.set(
+ elems[ i ],
+ "globalEval",
+ !refElements || dataPriv.get( refElements[ i ], "globalEval" )
+ );
+ }
+}
+
+
+var rhtml = /<|?\w+;/;
+
+function buildFragment( elems, context, scripts, selection, ignored ) {
+ var elem, tmp, tag, wrap, attached, j,
+ fragment = context.createDocumentFragment(),
+ nodes = [],
+ i = 0,
+ l = elems.length;
+
+ for ( ; i < l; i++ ) {
+ elem = elems[ i ];
+
+ if ( elem || elem === 0 ) {
+
+ // Add nodes directly
+ if ( toType( elem ) === "object" ) {
+
+ // Support: Android <=4.0 only, PhantomJS 1 only
+ // push.apply(_, arraylike) throws on ancient WebKit
+ jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );
+
+ // Convert non-html into a text node
+ } else if ( !rhtml.test( elem ) ) {
+ nodes.push( context.createTextNode( elem ) );
+
+ // Convert html into DOM nodes
+ } else {
+ tmp = tmp || fragment.appendChild( context.createElement( "div" ) );
+
+ // Deserialize a standard representation
+ tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase();
+ wrap = wrapMap[ tag ] || wrapMap._default;
+ tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ];
+
+ // Descend through wrappers to the right content
+ j = wrap[ 0 ];
+ while ( j-- ) {
+ tmp = tmp.lastChild;
+ }
+
+ // Support: Android <=4.0 only, PhantomJS 1 only
+ // push.apply(_, arraylike) throws on ancient WebKit
+ jQuery.merge( nodes, tmp.childNodes );
+
+ // Remember the top-level container
+ tmp = fragment.firstChild;
+
+ // Ensure the created nodes are orphaned (#12392)
+ tmp.textContent = "";
+ }
+ }
+ }
+
+ // Remove wrapper from fragment
+ fragment.textContent = "";
+
+ i = 0;
+ while ( ( elem = nodes[ i++ ] ) ) {
+
+ // Skip elements already in the context collection (trac-4087)
+ if ( selection && jQuery.inArray( elem, selection ) > -1 ) {
+ if ( ignored ) {
+ ignored.push( elem );
+ }
+ continue;
+ }
+
+ attached = isAttached( elem );
+
+ // Append to fragment
+ tmp = getAll( fragment.appendChild( elem ), "script" );
+
+ // Preserve script evaluation history
+ if ( attached ) {
+ setGlobalEval( tmp );
+ }
+
+ // Capture executables
+ if ( scripts ) {
+ j = 0;
+ while ( ( elem = tmp[ j++ ] ) ) {
+ if ( rscriptType.test( elem.type || "" ) ) {
+ scripts.push( elem );
+ }
+ }
+ }
+ }
+
+ return fragment;
+}
+
+
+var rtypenamespace = /^([^.]*)(?:\.(.+)|)/;
+
+function returnTrue() {
+ return true;
+}
+
+function returnFalse() {
+ return false;
+}
+
+// Support: IE <=9 - 11+
+// focus() and blur() are asynchronous, except when they are no-op.
+// So expect focus to be synchronous when the element is already active,
+// and blur to be synchronous when the element is not already active.
+// (focus and blur are always synchronous in other supported browsers,
+// this just defines when we can count on it).
+function expectSync( elem, type ) {
+ return ( elem === safeActiveElement() ) === ( type === "focus" );
+}
+
+// Support: IE <=9 only
+// Accessing document.activeElement can throw unexpectedly
+// https://bugs.jquery.com/ticket/13393
+function safeActiveElement() {
+ try {
+ return document.activeElement;
+ } catch ( err ) { }
+}
+
+function on( elem, types, selector, data, fn, one ) {
+ var origFn, type;
+
+ // Types can be a map of types/handlers
+ if ( typeof types === "object" ) {
+
+ // ( types-Object, selector, data )
+ if ( typeof selector !== "string" ) {
+
+ // ( types-Object, data )
+ data = data || selector;
+ selector = undefined;
+ }
+ for ( type in types ) {
+ on( elem, type, selector, data, types[ type ], one );
+ }
+ return elem;
+ }
+
+ if ( data == null && fn == null ) {
+
+ // ( types, fn )
+ fn = selector;
+ data = selector = undefined;
+ } else if ( fn == null ) {
+ if ( typeof selector === "string" ) {
+
+ // ( types, selector, fn )
+ fn = data;
+ data = undefined;
+ } else {
+
+ // ( types, data, fn )
+ fn = data;
+ data = selector;
+ selector = undefined;
+ }
+ }
+ if ( fn === false ) {
+ fn = returnFalse;
+ } else if ( !fn ) {
+ return elem;
+ }
+
+ if ( one === 1 ) {
+ origFn = fn;
+ fn = function( event ) {
+
+ // Can use an empty set, since event contains the info
+ jQuery().off( event );
+ return origFn.apply( this, arguments );
+ };
+
+ // Use same guid so caller can remove using origFn
+ fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
+ }
+ return elem.each( function() {
+ jQuery.event.add( this, types, fn, data, selector );
+ } );
+}
+
+/*
+ * Helper functions for managing events -- not part of the public interface.
+ * Props to Dean Edwards' addEvent library for many of the ideas.
+ */
+jQuery.event = {
+
+ global: {},
+
+ add: function( elem, types, handler, data, selector ) {
+
+ var handleObjIn, eventHandle, tmp,
+ events, t, handleObj,
+ special, handlers, type, namespaces, origType,
+ elemData = dataPriv.get( elem );
+
+ // Only attach events to objects that accept data
+ if ( !acceptData( elem ) ) {
+ return;
+ }
+
+ // Caller can pass in an object of custom data in lieu of the handler
+ if ( handler.handler ) {
+ handleObjIn = handler;
+ handler = handleObjIn.handler;
+ selector = handleObjIn.selector;
+ }
+
+ // Ensure that invalid selectors throw exceptions at attach time
+ // Evaluate against documentElement in case elem is a non-element node (e.g., document)
+ if ( selector ) {
+ jQuery.find.matchesSelector( documentElement, selector );
+ }
+
+ // Make sure that the handler has a unique ID, used to find/remove it later
+ if ( !handler.guid ) {
+ handler.guid = jQuery.guid++;
+ }
+
+ // Init the element's event structure and main handler, if this is the first
+ if ( !( events = elemData.events ) ) {
+ events = elemData.events = Object.create( null );
+ }
+ if ( !( eventHandle = elemData.handle ) ) {
+ eventHandle = elemData.handle = function( e ) {
+
+ // Discard the second event of a jQuery.event.trigger() and
+ // when an event is called after a page has unloaded
+ return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ?
+ jQuery.event.dispatch.apply( elem, arguments ) : undefined;
+ };
+ }
+
+ // Handle multiple events separated by a space
+ types = ( types || "" ).match( rnothtmlwhite ) || [ "" ];
+ t = types.length;
+ while ( t-- ) {
+ tmp = rtypenamespace.exec( types[ t ] ) || [];
+ type = origType = tmp[ 1 ];
+ namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
+
+ // There *must* be a type, no attaching namespace-only handlers
+ if ( !type ) {
+ continue;
+ }
+
+ // If event changes its type, use the special event handlers for the changed type
+ special = jQuery.event.special[ type ] || {};
+
+ // If selector defined, determine special event api type, otherwise given type
+ type = ( selector ? special.delegateType : special.bindType ) || type;
+
+ // Update special based on newly reset type
+ special = jQuery.event.special[ type ] || {};
+
+ // handleObj is passed to all event handlers
+ handleObj = jQuery.extend( {
+ type: type,
+ origType: origType,
+ data: data,
+ handler: handler,
+ guid: handler.guid,
+ selector: selector,
+ needsContext: selector && jQuery.expr.match.needsContext.test( selector ),
+ namespace: namespaces.join( "." )
+ }, handleObjIn );
+
+ // Init the event handler queue if we're the first
+ if ( !( handlers = events[ type ] ) ) {
+ handlers = events[ type ] = [];
+ handlers.delegateCount = 0;
+
+ // Only use addEventListener if the special events handler returns false
+ if ( !special.setup ||
+ special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+
+ if ( elem.addEventListener ) {
+ elem.addEventListener( type, eventHandle );
+ }
+ }
+ }
+
+ if ( special.add ) {
+ special.add.call( elem, handleObj );
+
+ if ( !handleObj.handler.guid ) {
+ handleObj.handler.guid = handler.guid;
+ }
+ }
+
+ // Add to the element's handler list, delegates in front
+ if ( selector ) {
+ handlers.splice( handlers.delegateCount++, 0, handleObj );
+ } else {
+ handlers.push( handleObj );
+ }
+
+ // Keep track of which events have ever been used, for event optimization
+ jQuery.event.global[ type ] = true;
+ }
+
+ },
+
+ // Detach an event or set of events from an element
+ remove: function( elem, types, handler, selector, mappedTypes ) {
+
+ var j, origCount, tmp,
+ events, t, handleObj,
+ special, handlers, type, namespaces, origType,
+ elemData = dataPriv.hasData( elem ) && dataPriv.get( elem );
+
+ if ( !elemData || !( events = elemData.events ) ) {
+ return;
+ }
+
+ // Once for each type.namespace in types; type may be omitted
+ types = ( types || "" ).match( rnothtmlwhite ) || [ "" ];
+ t = types.length;
+ while ( t-- ) {
+ tmp = rtypenamespace.exec( types[ t ] ) || [];
+ type = origType = tmp[ 1 ];
+ namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
+
+ // Unbind all events (on this namespace, if provided) for the element
+ if ( !type ) {
+ for ( type in events ) {
+ jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
+ }
+ continue;
+ }
+
+ special = jQuery.event.special[ type ] || {};
+ type = ( selector ? special.delegateType : special.bindType ) || type;
+ handlers = events[ type ] || [];
+ tmp = tmp[ 2 ] &&
+ new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" );
+
+ // Remove matching events
+ origCount = j = handlers.length;
+ while ( j-- ) {
+ handleObj = handlers[ j ];
+
+ if ( ( mappedTypes || origType === handleObj.origType ) &&
+ ( !handler || handler.guid === handleObj.guid ) &&
+ ( !tmp || tmp.test( handleObj.namespace ) ) &&
+ ( !selector || selector === handleObj.selector ||
+ selector === "**" && handleObj.selector ) ) {
+ handlers.splice( j, 1 );
+
+ if ( handleObj.selector ) {
+ handlers.delegateCount--;
+ }
+ if ( special.remove ) {
+ special.remove.call( elem, handleObj );
+ }
+ }
+ }
+
+ // Remove generic event handler if we removed something and no more handlers exist
+ // (avoids potential for endless recursion during removal of special event handlers)
+ if ( origCount && !handlers.length ) {
+ if ( !special.teardown ||
+ special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
+
+ jQuery.removeEvent( elem, type, elemData.handle );
+ }
+
+ delete events[ type ];
+ }
+ }
+
+ // Remove data and the expando if it's no longer used
+ if ( jQuery.isEmptyObject( events ) ) {
+ dataPriv.remove( elem, "handle events" );
+ }
+ },
+
+ dispatch: function( nativeEvent ) {
+
+ var i, j, ret, matched, handleObj, handlerQueue,
+ args = new Array( arguments.length ),
+
+ // Make a writable jQuery.Event from the native event object
+ event = jQuery.event.fix( nativeEvent ),
+
+ handlers = (
+ dataPriv.get( this, "events" ) || Object.create( null )
+ )[ event.type ] || [],
+ special = jQuery.event.special[ event.type ] || {};
+
+ // Use the fix-ed jQuery.Event rather than the (read-only) native event
+ args[ 0 ] = event;
+
+ for ( i = 1; i < arguments.length; i++ ) {
+ args[ i ] = arguments[ i ];
+ }
+
+ event.delegateTarget = this;
+
+ // Call the preDispatch hook for the mapped type, and let it bail if desired
+ if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {
+ return;
+ }
+
+ // Determine handlers
+ handlerQueue = jQuery.event.handlers.call( this, event, handlers );
+
+ // Run delegates first; they may want to stop propagation beneath us
+ i = 0;
+ while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) {
+ event.currentTarget = matched.elem;
+
+ j = 0;
+ while ( ( handleObj = matched.handlers[ j++ ] ) &&
+ !event.isImmediatePropagationStopped() ) {
+
+ // If the event is namespaced, then each handler is only invoked if it is
+ // specially universal or its namespaces are a superset of the event's.
+ if ( !event.rnamespace || handleObj.namespace === false ||
+ event.rnamespace.test( handleObj.namespace ) ) {
+
+ event.handleObj = handleObj;
+ event.data = handleObj.data;
+
+ ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle ||
+ handleObj.handler ).apply( matched.elem, args );
+
+ if ( ret !== undefined ) {
+ if ( ( event.result = ret ) === false ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ }
+ }
+ }
+ }
+
+ // Call the postDispatch hook for the mapped type
+ if ( special.postDispatch ) {
+ special.postDispatch.call( this, event );
+ }
+
+ return event.result;
+ },
+
+ handlers: function( event, handlers ) {
+ var i, handleObj, sel, matchedHandlers, matchedSelectors,
+ handlerQueue = [],
+ delegateCount = handlers.delegateCount,
+ cur = event.target;
+
+ // Find delegate handlers
+ if ( delegateCount &&
+
+ // Support: IE <=9
+ // Black-hole SVG instance trees (trac-13180)
+ cur.nodeType &&
+
+ // Support: Firefox <=42
+ // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861)
+ // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click
+ // Support: IE 11 only
+ // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343)
+ !( event.type === "click" && event.button >= 1 ) ) {
+
+ for ( ; cur !== this; cur = cur.parentNode || this ) {
+
+ // Don't check non-elements (#13208)
+ // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
+ if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) {
+ matchedHandlers = [];
+ matchedSelectors = {};
+ for ( i = 0; i < delegateCount; i++ ) {
+ handleObj = handlers[ i ];
+
+ // Don't conflict with Object.prototype properties (#13203)
+ sel = handleObj.selector + " ";
+
+ if ( matchedSelectors[ sel ] === undefined ) {
+ matchedSelectors[ sel ] = handleObj.needsContext ?
+ jQuery( sel, this ).index( cur ) > -1 :
+ jQuery.find( sel, this, null, [ cur ] ).length;
+ }
+ if ( matchedSelectors[ sel ] ) {
+ matchedHandlers.push( handleObj );
+ }
+ }
+ if ( matchedHandlers.length ) {
+ handlerQueue.push( { elem: cur, handlers: matchedHandlers } );
+ }
+ }
+ }
+ }
+
+ // Add the remaining (directly-bound) handlers
+ cur = this;
+ if ( delegateCount < handlers.length ) {
+ handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } );
+ }
+
+ return handlerQueue;
+ },
+
+ addProp: function( name, hook ) {
+ Object.defineProperty( jQuery.Event.prototype, name, {
+ enumerable: true,
+ configurable: true,
+
+ get: isFunction( hook ) ?
+ function() {
+ if ( this.originalEvent ) {
+ return hook( this.originalEvent );
+ }
+ } :
+ function() {
+ if ( this.originalEvent ) {
+ return this.originalEvent[ name ];
+ }
+ },
+
+ set: function( value ) {
+ Object.defineProperty( this, name, {
+ enumerable: true,
+ configurable: true,
+ writable: true,
+ value: value
+ } );
+ }
+ } );
+ },
+
+ fix: function( originalEvent ) {
+ return originalEvent[ jQuery.expando ] ?
+ originalEvent :
+ new jQuery.Event( originalEvent );
+ },
+
+ special: {
+ load: {
+
+ // Prevent triggered image.load events from bubbling to window.load
+ noBubble: true
+ },
+ click: {
+
+ // Utilize native event to ensure correct state for checkable inputs
+ setup: function( data ) {
+
+ // For mutual compressibility with _default, replace `this` access with a local var.
+ // `|| data` is dead code meant only to preserve the variable through minification.
+ var el = this || data;
+
+ // Claim the first handler
+ if ( rcheckableType.test( el.type ) &&
+ el.click && nodeName( el, "input" ) ) {
+
+ // dataPriv.set( el, "click", ... )
+ leverageNative( el, "click", returnTrue );
+ }
+
+ // Return false to allow normal processing in the caller
+ return false;
+ },
+ trigger: function( data ) {
+
+ // For mutual compressibility with _default, replace `this` access with a local var.
+ // `|| data` is dead code meant only to preserve the variable through minification.
+ var el = this || data;
+
+ // Force setup before triggering a click
+ if ( rcheckableType.test( el.type ) &&
+ el.click && nodeName( el, "input" ) ) {
+
+ leverageNative( el, "click" );
+ }
+
+ // Return non-false to allow normal event-path propagation
+ return true;
+ },
+
+ // For cross-browser consistency, suppress native .click() on links
+ // Also prevent it if we're currently inside a leveraged native-event stack
+ _default: function( event ) {
+ var target = event.target;
+ return rcheckableType.test( target.type ) &&
+ target.click && nodeName( target, "input" ) &&
+ dataPriv.get( target, "click" ) ||
+ nodeName( target, "a" );
+ }
+ },
+
+ beforeunload: {
+ postDispatch: function( event ) {
+
+ // Support: Firefox 20+
+ // Firefox doesn't alert if the returnValue field is not set.
+ if ( event.result !== undefined && event.originalEvent ) {
+ event.originalEvent.returnValue = event.result;
+ }
+ }
+ }
+ }
+};
+
+// Ensure the presence of an event listener that handles manually-triggered
+// synthetic events by interrupting progress until reinvoked in response to
+// *native* events that it fires directly, ensuring that state changes have
+// already occurred before other listeners are invoked.
+function leverageNative( el, type, expectSync ) {
+
+ // Missing expectSync indicates a trigger call, which must force setup through jQuery.event.add
+ if ( !expectSync ) {
+ if ( dataPriv.get( el, type ) === undefined ) {
+ jQuery.event.add( el, type, returnTrue );
+ }
+ return;
+ }
+
+ // Register the controller as a special universal handler for all event namespaces
+ dataPriv.set( el, type, false );
+ jQuery.event.add( el, type, {
+ namespace: false,
+ handler: function( event ) {
+ var notAsync, result,
+ saved = dataPriv.get( this, type );
+
+ if ( ( event.isTrigger & 1 ) && this[ type ] ) {
+
+ // Interrupt processing of the outer synthetic .trigger()ed event
+ // Saved data should be false in such cases, but might be a leftover capture object
+ // from an async native handler (gh-4350)
+ if ( !saved.length ) {
+
+ // Store arguments for use when handling the inner native event
+ // There will always be at least one argument (an event object), so this array
+ // will not be confused with a leftover capture object.
+ saved = slice.call( arguments );
+ dataPriv.set( this, type, saved );
+
+ // Trigger the native event and capture its result
+ // Support: IE <=9 - 11+
+ // focus() and blur() are asynchronous
+ notAsync = expectSync( this, type );
+ this[ type ]();
+ result = dataPriv.get( this, type );
+ if ( saved !== result || notAsync ) {
+ dataPriv.set( this, type, false );
+ } else {
+ result = {};
+ }
+ if ( saved !== result ) {
+
+ // Cancel the outer synthetic event
+ event.stopImmediatePropagation();
+ event.preventDefault();
+
+ // Support: Chrome 86+
+ // In Chrome, if an element having a focusout handler is blurred by
+ // clicking outside of it, it invokes the handler synchronously. If
+ // that handler calls `.remove()` on the element, the data is cleared,
+ // leaving `result` undefined. We need to guard against this.
+ return result && result.value;
+ }
+
+ // If this is an inner synthetic event for an event with a bubbling surrogate
+ // (focus or blur), assume that the surrogate already propagated from triggering the
+ // native event and prevent that from happening again here.
+ // This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the
+ // bubbling surrogate propagates *after* the non-bubbling base), but that seems
+ // less bad than duplication.
+ } else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) {
+ event.stopPropagation();
+ }
+
+ // If this is a native event triggered above, everything is now in order
+ // Fire an inner synthetic event with the original arguments
+ } else if ( saved.length ) {
+
+ // ...and capture the result
+ dataPriv.set( this, type, {
+ value: jQuery.event.trigger(
+
+ // Support: IE <=9 - 11+
+ // Extend with the prototype to reset the above stopImmediatePropagation()
+ jQuery.extend( saved[ 0 ], jQuery.Event.prototype ),
+ saved.slice( 1 ),
+ this
+ )
+ } );
+
+ // Abort handling of the native event
+ event.stopImmediatePropagation();
+ }
+ }
+ } );
+}
+
+jQuery.removeEvent = function( elem, type, handle ) {
+
+ // This "if" is needed for plain objects
+ if ( elem.removeEventListener ) {
+ elem.removeEventListener( type, handle );
+ }
+};
+
+jQuery.Event = function( src, props ) {
+
+ // Allow instantiation without the 'new' keyword
+ if ( !( this instanceof jQuery.Event ) ) {
+ return new jQuery.Event( src, props );
+ }
+
+ // Event object
+ if ( src && src.type ) {
+ this.originalEvent = src;
+ this.type = src.type;
+
+ // Events bubbling up the document may have been marked as prevented
+ // by a handler lower down the tree; reflect the correct value.
+ this.isDefaultPrevented = src.defaultPrevented ||
+ src.defaultPrevented === undefined &&
+
+ // Support: Android <=2.3 only
+ src.returnValue === false ?
+ returnTrue :
+ returnFalse;
+
+ // Create target properties
+ // Support: Safari <=6 - 7 only
+ // Target should not be a text node (#504, #13143)
+ this.target = ( src.target && src.target.nodeType === 3 ) ?
+ src.target.parentNode :
+ src.target;
+
+ this.currentTarget = src.currentTarget;
+ this.relatedTarget = src.relatedTarget;
+
+ // Event type
+ } else {
+ this.type = src;
+ }
+
+ // Put explicitly provided properties onto the event object
+ if ( props ) {
+ jQuery.extend( this, props );
+ }
+
+ // Create a timestamp if incoming event doesn't have one
+ this.timeStamp = src && src.timeStamp || Date.now();
+
+ // Mark it as fixed
+ this[ jQuery.expando ] = true;
+};
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+ constructor: jQuery.Event,
+ isDefaultPrevented: returnFalse,
+ isPropagationStopped: returnFalse,
+ isImmediatePropagationStopped: returnFalse,
+ isSimulated: false,
+
+ preventDefault: function() {
+ var e = this.originalEvent;
+
+ this.isDefaultPrevented = returnTrue;
+
+ if ( e && !this.isSimulated ) {
+ e.preventDefault();
+ }
+ },
+ stopPropagation: function() {
+ var e = this.originalEvent;
+
+ this.isPropagationStopped = returnTrue;
+
+ if ( e && !this.isSimulated ) {
+ e.stopPropagation();
+ }
+ },
+ stopImmediatePropagation: function() {
+ var e = this.originalEvent;
+
+ this.isImmediatePropagationStopped = returnTrue;
+
+ if ( e && !this.isSimulated ) {
+ e.stopImmediatePropagation();
+ }
+
+ this.stopPropagation();
+ }
+};
+
+// Includes all common event props including KeyEvent and MouseEvent specific props
+jQuery.each( {
+ altKey: true,
+ bubbles: true,
+ cancelable: true,
+ changedTouches: true,
+ ctrlKey: true,
+ detail: true,
+ eventPhase: true,
+ metaKey: true,
+ pageX: true,
+ pageY: true,
+ shiftKey: true,
+ view: true,
+ "char": true,
+ code: true,
+ charCode: true,
+ key: true,
+ keyCode: true,
+ button: true,
+ buttons: true,
+ clientX: true,
+ clientY: true,
+ offsetX: true,
+ offsetY: true,
+ pointerId: true,
+ pointerType: true,
+ screenX: true,
+ screenY: true,
+ targetTouches: true,
+ toElement: true,
+ touches: true,
+ which: true
+}, jQuery.event.addProp );
+
+jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) {
+ jQuery.event.special[ type ] = {
+
+ // Utilize native event if possible so blur/focus sequence is correct
+ setup: function() {
+
+ // Claim the first handler
+ // dataPriv.set( this, "focus", ... )
+ // dataPriv.set( this, "blur", ... )
+ leverageNative( this, type, expectSync );
+
+ // Return false to allow normal processing in the caller
+ return false;
+ },
+ trigger: function() {
+
+ // Force setup before trigger
+ leverageNative( this, type );
+
+ // Return non-false to allow normal event-path propagation
+ return true;
+ },
+
+ // Suppress native focus or blur as it's already being fired
+ // in leverageNative.
+ _default: function() {
+ return true;
+ },
+
+ delegateType: delegateType
+ };
+} );
+
+// Create mouseenter/leave events using mouseover/out and event-time checks
+// so that event delegation works in jQuery.
+// Do the same for pointerenter/pointerleave and pointerover/pointerout
+//
+// Support: Safari 7 only
+// Safari sends mouseenter too often; see:
+// https://bugs.chromium.org/p/chromium/issues/detail?id=470258
+// for the description of the bug (it existed in older Chrome versions as well).
+jQuery.each( {
+ mouseenter: "mouseover",
+ mouseleave: "mouseout",
+ pointerenter: "pointerover",
+ pointerleave: "pointerout"
+}, function( orig, fix ) {
+ jQuery.event.special[ orig ] = {
+ delegateType: fix,
+ bindType: fix,
+
+ handle: function( event ) {
+ var ret,
+ target = this,
+ related = event.relatedTarget,
+ handleObj = event.handleObj;
+
+ // For mouseenter/leave call the handler if related is outside the target.
+ // NB: No relatedTarget if the mouse left/entered the browser window
+ if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) {
+ event.type = handleObj.origType;
+ ret = handleObj.handler.apply( this, arguments );
+ event.type = fix;
+ }
+ return ret;
+ }
+ };
+} );
+
+jQuery.fn.extend( {
+
+ on: function( types, selector, data, fn ) {
+ return on( this, types, selector, data, fn );
+ },
+ one: function( types, selector, data, fn ) {
+ return on( this, types, selector, data, fn, 1 );
+ },
+ off: function( types, selector, fn ) {
+ var handleObj, type;
+ if ( types && types.preventDefault && types.handleObj ) {
+
+ // ( event ) dispatched jQuery.Event
+ handleObj = types.handleObj;
+ jQuery( types.delegateTarget ).off(
+ handleObj.namespace ?
+ handleObj.origType + "." + handleObj.namespace :
+ handleObj.origType,
+ handleObj.selector,
+ handleObj.handler
+ );
+ return this;
+ }
+ if ( typeof types === "object" ) {
+
+ // ( types-object [, selector] )
+ for ( type in types ) {
+ this.off( type, selector, types[ type ] );
+ }
+ return this;
+ }
+ if ( selector === false || typeof selector === "function" ) {
+
+ // ( types [, fn] )
+ fn = selector;
+ selector = undefined;
+ }
+ if ( fn === false ) {
+ fn = returnFalse;
+ }
+ return this.each( function() {
+ jQuery.event.remove( this, types, fn, selector );
+ } );
+ }
+} );
+
+
+var
+
+ // Support: IE <=10 - 11, Edge 12 - 13 only
+ // In IE/Edge using regex groups here causes severe slowdowns.
+ // See https://connect.microsoft.com/IE/feedback/details/1736512/
+ rnoInnerhtml = /
+
+
+
+
+
+
+
+
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Jorge Garcia Molinos et al. 18 July 2019
+
This package is now in release version (v 1.0.0). Please contact me for questions or feed-back.
+
+
Installation
+
+
You can install the development version of VoCC from GitHub with:
+
+# install.packages("devtools")
+devtools :: install_github ( "JorGarMol/VoCC" )
+
+
+
+
Citation
+
+
To cite the package itself please use:
+
+García Molinos, J., Schoeman, D. S., Brown, C. J. and Burrows, M. T. (2019). VoCC: The Velocity of Climate Change and related climatic metrics. R package version 1.0.0. https://doi.org/10.5281/zenodo.3382092
+
+
The following paper explains the package functionality and provides the examples covered by the code in the package vignette
+
+García Molinos, J., Schoeman, D. S., Brown, C. J. and Burrows, M. T. (2019), VoCC: An R package for calculating the velocity of climate change and related climatic metrics. Methods Ecol Evol. doi:10.1111/2041-210X.13295
+
+
+
+
+
+
+
+
+
+
+
+
Developers
+
+Jorge Garcia Molinos Author, maintainer
+David S. Schoeman Author
+Christopher J. Brown Author
+Michael T. Burrows Author
+More about authors...
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/katex-auto.js b/docs/katex-auto.js
new file mode 100644
index 0000000..20651d9
--- /dev/null
+++ b/docs/katex-auto.js
@@ -0,0 +1,14 @@
+// https://github.com/jgm/pandoc/blob/29fa97ab96b8e2d62d48326e1b949a71dc41f47a/src/Text/Pandoc/Writers/HTML.hs#L332-L345
+document.addEventListener("DOMContentLoaded", function () {
+ var mathElements = document.getElementsByClassName("math");
+ var macros = [];
+ for (var i = 0; i < mathElements.length; i++) {
+ var texText = mathElements[i].firstChild;
+ if (mathElements[i].tagName == "SPAN") {
+ katex.render(texText.data, mathElements[i], {
+ displayMode: mathElements[i].classList.contains("display"),
+ throwOnError: false,
+ macros: macros,
+ fleqn: false
+ });
+ }}});
diff --git a/docs/lightswitch.js b/docs/lightswitch.js
new file mode 100644
index 0000000..9467125
--- /dev/null
+++ b/docs/lightswitch.js
@@ -0,0 +1,85 @@
+
+/*!
+ * Color mode toggler for Bootstrap's docs (https://getbootstrap.com/)
+ * Copyright 2011-2023 The Bootstrap Authors
+ * Licensed under the Creative Commons Attribution 3.0 Unported License.
+ * Updates for {pkgdown} by the {bslib} authors, also licensed under CC-BY-3.0.
+ */
+
+const getStoredTheme = () => localStorage.getItem('theme')
+const setStoredTheme = theme => localStorage.setItem('theme', theme)
+
+const getPreferredTheme = () => {
+ const storedTheme = getStoredTheme()
+ if (storedTheme) {
+ return storedTheme
+ }
+
+ return window.matchMedia('(prefers-color-scheme: dark)').matches ? 'dark' : 'light'
+}
+
+const setTheme = theme => {
+ if (theme === 'auto') {
+ document.documentElement.setAttribute('data-bs-theme', (window.matchMedia('(prefers-color-scheme: dark)').matches ? 'dark' : 'light'))
+ } else {
+ document.documentElement.setAttribute('data-bs-theme', theme)
+ }
+}
+
+function bsSetupThemeToggle () {
+ 'use strict'
+
+ const showActiveTheme = (theme, focus = false) => {
+ var activeLabel, activeIcon;
+
+ document.querySelectorAll('[data-bs-theme-value]').forEach(element => {
+ const buttonTheme = element.getAttribute('data-bs-theme-value')
+ const isActive = buttonTheme == theme
+
+ element.classList.toggle('active', isActive)
+ element.setAttribute('aria-pressed', isActive)
+
+ if (isActive) {
+ activeLabel = element.textContent;
+ activeIcon = element.querySelector('span').classList.value;
+ }
+ })
+
+ const themeSwitcher = document.querySelector('#dropdown-lightswitch')
+ if (!themeSwitcher) {
+ return
+ }
+
+ themeSwitcher.setAttribute('aria-label', activeLabel)
+ themeSwitcher.querySelector('span').classList.value = activeIcon;
+
+ if (focus) {
+ themeSwitcher.focus()
+ }
+ }
+
+ window.matchMedia('(prefers-color-scheme: dark)').addEventListener('change', () => {
+ const storedTheme = getStoredTheme()
+ if (storedTheme !== 'light' && storedTheme !== 'dark') {
+ setTheme(getPreferredTheme())
+ }
+ })
+
+ window.addEventListener('DOMContentLoaded', () => {
+ showActiveTheme(getPreferredTheme())
+
+ document
+ .querySelectorAll('[data-bs-theme-value]')
+ .forEach(toggle => {
+ toggle.addEventListener('click', () => {
+ const theme = toggle.getAttribute('data-bs-theme-value')
+ setTheme(theme)
+ setStoredTheme(theme)
+ showActiveTheme(theme, true)
+ })
+ })
+ })
+}
+
+setTheme(getPreferredTheme());
+bsSetupThemeToggle();
diff --git a/docs/link.svg b/docs/link.svg
new file mode 100644
index 0000000..88ad827
--- /dev/null
+++ b/docs/link.svg
@@ -0,0 +1,12 @@
+
+
+
+
+
+
diff --git a/docs/pkgdown.js b/docs/pkgdown.js
new file mode 100644
index 0000000..1a99c65
--- /dev/null
+++ b/docs/pkgdown.js
@@ -0,0 +1,162 @@
+/* http://gregfranko.com/blog/jquery-best-practices/ */
+(function($) {
+ $(function() {
+
+ $('nav.navbar').headroom();
+
+ Toc.init({
+ $nav: $("#toc"),
+ $scope: $("main h2, main h3, main h4, main h5, main h6")
+ });
+
+ if ($('#toc').length) {
+ $('body').scrollspy({
+ target: '#toc',
+ offset: $("nav.navbar").outerHeight() + 1
+ });
+ }
+
+ // Activate popovers
+ $('[data-bs-toggle="popover"]').popover({
+ container: 'body',
+ html: true,
+ trigger: 'focus',
+ placement: "top",
+ sanitize: false,
+ });
+
+ $('[data-bs-toggle="tooltip"]').tooltip();
+
+ /* Clipboard --------------------------*/
+
+ function changeTooltipMessage(element, msg) {
+ var tooltipOriginalTitle=element.getAttribute('data-bs-original-title');
+ element.setAttribute('data-bs-original-title', msg);
+ $(element).tooltip('show');
+ element.setAttribute('data-bs-original-title', tooltipOriginalTitle);
+ }
+
+ if(ClipboardJS.isSupported()) {
+ $(document).ready(function() {
+ var copyButton = " ";
+
+ $("div.sourceCode").addClass("hasCopyButton");
+
+ // Insert copy buttons:
+ $(copyButton).prependTo(".hasCopyButton");
+
+ // Initialize tooltips:
+ $('.btn-copy-ex').tooltip({container: 'body'});
+
+ // Initialize clipboard:
+ var clipboard = new ClipboardJS('[data-clipboard-copy]', {
+ text: function(trigger) {
+ return trigger.parentNode.textContent.replace(/\n#>[^\n]*/g, "");
+ }
+ });
+
+ clipboard.on('success', function(e) {
+ changeTooltipMessage(e.trigger, 'Copied!');
+ e.clearSelection();
+ });
+
+ clipboard.on('error', function(e) {
+ changeTooltipMessage(e.trigger,'Press Ctrl+C or Command+C to copy');
+ });
+
+ });
+ }
+
+ /* Search marking --------------------------*/
+ var url = new URL(window.location.href);
+ var toMark = url.searchParams.get("q");
+ var mark = new Mark("main#main");
+ if (toMark) {
+ mark.mark(toMark, {
+ accuracy: {
+ value: "complementary",
+ limiters: [",", ".", ":", "/"],
+ }
+ });
+ }
+
+ /* Search --------------------------*/
+ /* Adapted from https://github.com/rstudio/bookdown/blob/2d692ba4b61f1e466c92e78fd712b0ab08c11d31/inst/resources/bs4_book/bs4_book.js#L25 */
+ // Initialise search index on focus
+ var fuse;
+ $("#search-input").focus(async function(e) {
+ if (fuse) {
+ return;
+ }
+
+ $(e.target).addClass("loading");
+ var response = await fetch($("#search-input").data("search-index"));
+ var data = await response.json();
+
+ var options = {
+ keys: ["what", "text", "code"],
+ ignoreLocation: true,
+ threshold: 0.1,
+ includeMatches: true,
+ includeScore: true,
+ };
+ fuse = new Fuse(data, options);
+
+ $(e.target).removeClass("loading");
+ });
+
+ // Use algolia autocomplete
+ var options = {
+ autoselect: true,
+ debug: true,
+ hint: false,
+ minLength: 2,
+ };
+ var q;
+async function searchFuse(query, callback) {
+ await fuse;
+
+ var items;
+ if (!fuse) {
+ items = [];
+ } else {
+ q = query;
+ var results = fuse.search(query, { limit: 20 });
+ items = results
+ .filter((x) => x.score <= 0.75)
+ .map((x) => x.item);
+ if (items.length === 0) {
+ items = [{dir:"Sorry 😿",previous_headings:"",title:"No results found.",what:"No results found.",path:window.location.href}];
+ }
+ }
+ callback(items);
+}
+ $("#search-input").autocomplete(options, [
+ {
+ name: "content",
+ source: searchFuse,
+ templates: {
+ suggestion: (s) => {
+ if (s.title == s.what) {
+ return `${s.dir} > ${s.title}
`;
+ } else if (s.previous_headings == "") {
+ return `${s.dir} > ${s.title}
> ${s.what}`;
+ } else {
+ return `${s.dir} > ${s.title}
> ${s.previous_headings} > ${s.what}`;
+ }
+ },
+ },
+ },
+ ]).on('autocomplete:selected', function(event, s) {
+ window.location.href = s.path + "?q=" + q + "#" + s.id;
+ });
+ });
+})(window.jQuery || window.$)
+
+document.addEventListener('keydown', function(event) {
+ // Check if the pressed key is '/'
+ if (event.key === '/') {
+ event.preventDefault(); // Prevent any default action associated with the '/' key
+ document.getElementById('search-input').focus(); // Set focus to the search input
+ }
+});
diff --git a/docs/pkgdown.yml b/docs/pkgdown.yml
new file mode 100644
index 0000000..ca99e68
--- /dev/null
+++ b/docs/pkgdown.yml
@@ -0,0 +1,6 @@
+pandoc: 3.7.0.2
+pkgdown: 2.1.3
+pkgdown_sha: ~
+articles:
+ VoCC: VoCC.html
+last_built: 2025-09-02T04:58Z
diff --git a/docs/reference/EEZ.html b/docs/reference/EEZ.html
new file mode 100644
index 0000000..246a1c2
--- /dev/null
+++ b/docs/reference/EEZ.html
@@ -0,0 +1,71 @@
+
+Icelandic Exclusive Economic Zone (EEZ) — EEZ • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Icelandic Exclusive Economic Zone (v10).
+
+
+
+
+
+
A spatial polygon data frame containing the Icenalndic EEZ
+(200 NM).
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/HSST.html b/docs/reference/HSST.html
new file mode 100644
index 0000000..629da4a
--- /dev/null
+++ b/docs/reference/HSST.html
@@ -0,0 +1,75 @@
+
+Monthly mean sea surface temperatures (SST) around Iceland for 1955-2010 — HSST • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Monthly mean sea surface temperatures (SST) around Iceland for 1955-2010
+
+
+
+
+
+
A raster stack with 672 layers containing mean monthly SSTs (C)
+at 1-deg resolution for the period Jan 1955 to Dec 2010 for the Atlantic waters surrounding Iceland.
+
+
+
Source
+
Hadley Centre data set HadISST 1.1 (data accessed May 2018).
+
+
+
References
+
Rayner et al. 2003 . Global analyses of sea
+surface temperature, sea ice, and night marine air temperature since the late nineteenth century. J. Geophys. Res.Vol. 108: 4407.
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/JapTC.html b/docs/reference/JapTC.html
new file mode 100644
index 0000000..3df538c
--- /dev/null
+++ b/docs/reference/JapTC.html
@@ -0,0 +1,85 @@
+
+Multivariate Terraclimate data for Japan — JapTC • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Historical (1960-1969) and present (2008-2017) multivariate 1/24
+Terraclimate data set (Abatzoglou et al. 2018), extracted for the Japanese
+archipelago and including 3 variables: mean annual monthly precipitation (mm),
+maximum and minimum temperatures (C).
+
+
+
+
+
+
A raster stack with 9 layers for the historical (1960-1969) and current (2008-2017)
+average (AnMn) and standard deviation (AnMnSD) of the mean annual (AnMn) precipitation (Ppr),
+maximum (Tmax) and minimum (Tmin) temperature.
+
+
+
+
References
+
Abatzoglou et al. 2018 . Terraclimate, a high-resolution global
+dataset of monthly climate and climatic water balance from 1958-2015, Scientific Data, 5: 170191
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/angulo.html b/docs/reference/angulo.html
new file mode 100644
index 0000000..09ef4f3
--- /dev/null
+++ b/docs/reference/angulo.html
@@ -0,0 +1,82 @@
+
+Internal. Angle associated to the spatial gradient — angulo • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Internal. Angle associated to the spatial gradient
+
+
+
+
+
+
Arguments
+
+
+
dx
+numeric giving the longitudinal gradient component
+
+
+dy
+numeric giving the latitudinal gradient component
+
+
+
+
Author
+
Jorge Garcia Molinos and David S. Schoeman
+angulo()
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/climPCA.html b/docs/reference/climPCA.html
new file mode 100644
index 0000000..784357b
--- /dev/null
+++ b/docs/reference/climPCA.html
@@ -0,0 +1,133 @@
+
+Reduce dimensionality of climate predictors via Principal Component Analysis — climPCA • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Function to extract the first n principal components explaining a predefined total amount of variance among climatic variables.
+These components can subsequently be used as synthetic climatic variables to reduce dimensionality in climate-analogue methods.
+
+
+
+
Usage
+
climPCA (
+ climp ,
+ climf ,
+ trans = function ( x ) log ( x ) ,
+ cen = TRUE ,
+ sc = TRUE ,
+ th = 0.8
+)
+
+
+
+
Arguments
+
+
+
climp
+raster.stack with one layer for each climatic variable with the values for present or baseline conditions.
+
+
+climf
+raster.stack with one layer for each climatic variable with the values for future conditions.
+
+
+trans
+function specifying the type of transformation to be applied prior to the PCA.
+Specify NA where no transformation is required (default log(x)).
+
+
+cen
+logical should the variables be centered prior to the PCA? (default TRUE).
+
+
+sc
+logical should the variables be scaled prior to the PCA? (default TRUE).
+
+
+th
+numeric threshold giving the minimum amount of total variance that should be explained by the principal components extracted.
+
+
+
+
Value
+
a list containing (i) the output from the PCA (call to 'prcomp'), and
+(ii) a table with the present/future cell values for the principal components accounting
+for the specified percentage of total variance (th).
+
+
+
+
Author
+
Jorge Garcia Molinos
+
+
+
+
Examples
+
if ( FALSE ) { # \dontrun{
+JapTC <- VoCC_get_data ( "JapTC.tif" )
+
+comp <- climPCA ( JapTC [[ c ( 1 , 3 , 5 ) ] ] , JapTC [[ c ( 2 , 4 , 6 ) ] ] ,
+ trans = NA , cen = TRUE , sc = TRUE , th = 0.85 )
+summary ( comp [[ 1 ] ] ) # first two components explain >90% of variance
+# Create a data frame with the necessary variables in the required order (see climAna? for details)
+clim <- comp [[ 2 ] ] [ , c ( 2 , 4 , 3 , 5 , 1 ) ]
+clim [ , c ( "x" , "y" ) ] <- terra :: xyFromCell ( JapTC [[ 1 ] ] , clim $ cid )
+} # }
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/climPlot.html b/docs/reference/climPlot.html
new file mode 100644
index 0000000..c560e8d
--- /dev/null
+++ b/docs/reference/climPlot.html
@@ -0,0 +1,128 @@
+
+Binned scatter plot for 2-dimensional climate space — climPlot • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Function to create a binned scatter plot of two climate variables.
+
+
+
+
Usage
+
climPlot ( xy , x.binSize , y.binSize , x.name = "V1" , y.name = "V2" )
+
+
+
+
Arguments
+
+
+
xy
+data.frame with cells as rows and 4 columns representing the present and future local values for the two variables (V1p, V1f, V2p, V2f).
+
+
+x.binSize
+numeric the bin size for the first variable.
+
+
+y.binSize
+numeric the bin size for the second variable.
+
+
+x.name
+character the variable name for the first variable. Used to label the plot.
+
+
+y.name
+character the variable name for the second variable. Used to label the plot.
+
+
+
+
Value
+
A series of plot objects displaying the (i) present and (ii) future
+cell frequency for each combination of local climates,
+and (iii) the location of remnant, novel and disappearing climates between both periods.
+
+
+
+
Author
+
Jorge Garcia Molinos and Naoki H. Kumagai
+
+
+
+
Examples
+
if ( FALSE ) { # \dontrun{
+JapTC <- VoCC_get_data ( "JapTC.tif" )
+
+# Plot climate space for the two first variables(annual precipitation and maximum temperature)
+xy <- stats :: na.omit ( data.frame (
+ terra :: values ( JapTC [[ 1 ] ] ) ,
+ terra :: values ( JapTC [[ 2 ] ] ) ,
+ terra :: values ( JapTC [[ 3 ] ] ) , terra :: values ( JapTC [[ 4 ] ] )
+) )
+
+out <- climPlot ( xy ,
+ x.binSize = 5 , y.binSize = 0.2 , x.name = "Precipitation (mm)" ,
+ y.name = "Temperature max (°C)"
+)
+
+# output plots can be saved as:
+ggplot2 :: ggsave (
+ plot = out , filename = file.path ( getwd ( ) , "example_plot.pdf" ) ,
+ width = 17 , height = 17 , unit = "cm"
+)
+} # }
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/dVoCC.html b/docs/reference/dVoCC.html
new file mode 100644
index 0000000..469d8c6
--- /dev/null
+++ b/docs/reference/dVoCC.html
@@ -0,0 +1,194 @@
+
+Distance-based velocity based on geographically closest climate analogue — dVoCC • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Function to calculate the geographically closest climate analogues and related distance-based velocity. Cell analogues
+are identified by comparing the baseline climatic conditions at each focal cell with those existing for all
+other (target) cells in the future by reference to a specified climatic threshold. The function allows for the
+specification of search distances and incorporates both least-cost path and Great Circle (as-the-crow-flies) distances.
+
+
+
+
Usage
+
dVoCC (
+ clim ,
+ n ,
+ tdiff ,
+ method = "Single" ,
+ climTol ,
+ geoTol ,
+ distfun = "GreatCircle" ,
+ trans = NA ,
+ lonlat = TRUE
+)
+
+
+
+
Arguments
+
+
+
clim
+data.frame with the value for the climatic parameters (columns) by cell (rows), arranged as follows (see examples below):
+The first 2n columns must contain the present and future values for each of the n climatic variables (V1p, V1f, V2p, V2f,...).
+Where cell-specific analogue thresholds (see "variable" in "method" below) are to be calculated, the next (2n+1:3n) columns
+should contain the standard deviation (or any other measure of climatic variability) of each variable for the baseline period.
+These columns are not required if using the "Single" method. The last three columns of the table should contain an identifyier and centroid coordinates of each cell.
+
+
+n
+integer defining the number of climatic variables.
+
+
+tdiff
+integer defining the number of years (or other temporal unit) between periods.
+
+
+method
+character string specifying the analogue method to be used. 'Single': a constant, single analogue threshold
+for each climate variable is applied to all cells (Ohlemuller et al. 2006, Hamann et al. 2015); climate analogy corresponds to target cells
+with values below the specified threshold for each climatic variable. 'Variable': a cell-specific climate threshold is used for each climatic variable
+to determine the climate analogues associated with each cell by reference to its baseline climatic variability (Garcia Molinos et al. 2017).
+
+
+climTol
+numeric a vector of length n giving the tolerance threshold defining climate analogue conditions for each climatic variable.
+If a cell-specific threshold is being used, this function parameter should be passed as NA.
+
+
+geoTol
+integer impose a geographical distance threshold (in km for lat/lon or map units if projected).
+If used, the pool of potential climate analogues will be limited to cells within that distance from the focal cell.
+
+
+distfun
+character string specifying the function to be used for estimating distances
+between focal and target cells. Either 'Euclidean', 'GreatCircle' (Great Circle Distances).
+'LeastCost' (Least Cost Path Distances) is NOT CURRENTLY IMPLEMENTED. LeastCost requires a transition matrix supplied to the function via de 'trans' argument.
+
+
+trans
+TransitionLayer NOT CURRENTLY IMPLEMENTED gdistance object to be used for the analogue search if distfun = 'LeastCost'.
+
+
+lonlat
+logical is the analysis to be done in unprojected (lon/lat) coordinates?
+
+
+
+
Value
+
A data.frame containing the cell id of the future analogue for each focal cell (NA = no analogue available),
+together with the climatic ("climDis") and geographical ("geoDis") distances in input units,
+the bearing ("ang", degrees North), and resulting climate velocity ("vel", km/yr). Mean climatic distances are returned for multivariate analogues.
+
+
+
References
+
Ohlemuller et al. 2006 . Towards European climate risk surfaces: the extent and distribution of analogous and non-analogous climates 1931-2100. Global Ecology and Biogeography, 15, 395-405. Hamann et al. 2015 . Velocity of climate change algorithms for guiding conservation and management. Global Change Biology, 21, 997-1004. Garcia Molinos et al. 2017 . Improving the interpretability of climate landscape metrics: An ecological risk analysis of Japan's Marine Protected Areas. Global Change Biology, 23, 4440-4452.
+
+
+
+
Author
+
Jorge Garcia Molinos
+
+
+
+
Examples
+
if ( FALSE ) { # \dontrun{
+JapTC <- VoCC_get_data ( "JapTC.tif" )
+
+# Create a data frame with the necessary variables in the required order
+clim <- stats :: na.omit ( data.frame ( terra :: values ( JapTC ) , cid = 1 : terra :: ncell ( JapTC ) ) )
+clim [ , c ( "x" , "y" ) ] <- terra :: xyFromCell ( JapTC , clim $ cid )
+
+# Constant threshold, distance-restricted velocity based on geographical distances
+avocc1 <- dVoCC ( clim ,
+ n = 3 , tdiff = 40 , method = "Single" , climTol = c ( 10 , 0.1 , 0.1 ) ,
+ geoTol = 160 , distfun = "GreatCircle" , trans = NA , lonlat = TRUE
+)
+
+r1 <- JapTC [[ 1 ] ]
+r1 [ avocc1 $ focal ] <- avocc1 $ vel
+terra :: plot ( r1 )
+
+# Cell-specific, distance-unrestricted climate analogue velocity based on least-cost path distances
+# First, create the conductance matrix (all land cells considered to have conductance of 1)
+r <- JapTC [[ 1 ] ]
+r [ ! is.na ( JapTC [[ 1 ] ] ) ] <- 1
+h8 <- gdistance :: transition ( r , transitionFunction = mean , directions = 8 )
+h8 <- gdistance :: geoCorrection ( h8 , type = "c" )
+
+# Now calculate the analogue velocity using the baseline SD for each variable as analogue threshold
+avocc2 <- dVoCC ( clim ,
+ n = 3 , tdiff = 40 , method = "Variable" , climTol = NA , geoTol = Inf ,
+ distfun = "LeastCost" , trans = h8 , lonlat = TRUE
+)
+
+# Plot results
+r1 <- r2 <- JapTC [[ 1 ] ]
+r1 [ avocc1 $ focal ] <- avocc1 $ vel
+r2 [ avocc2 $ focal ] <- avocc2 $ vel
+terra :: plot ( c ( r1 , r2 ) )
+} # }
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/gVoCC.html b/docs/reference/gVoCC.html
new file mode 100644
index 0000000..e68ae7a
--- /dev/null
+++ b/docs/reference/gVoCC.html
@@ -0,0 +1,118 @@
+
+Gradient-based climate velocity — gVoCC • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Function to calculate the velocity of climate change after Burrows et al. (2011)
+based on local climatic temporal trends and spatial gradients.
+
+
+
+
Usage
+
gVoCC ( tempTrend , spatGrad )
+
+
+
+
Arguments
+
+
+
tempTrend
+The output from the tempTrend function containing the long-term linear climatic trends.
+
+
+spatGrad
+The output from the spatGrad function containing the magnitudes and angles for the spatial climatic gradient.
+
+
+
+
Value
+
A RasterStack containing the climate velocity magnitude ("voccMag",
+km/yr for unprojected rasters and spatial unit/year for projected rasters) and angle("voccAng" in
+degrees north: 0N, 90E, 180S and 270W).
+
+
+
References
+
Burrows et al. 2011 . The pace of shifting climate
+in marine and terrestrial ecosystems. Science, 334, 652-655.
+
+
+
+
Author
+
Jorge Garcia Molinos
+
+
+
+
Examples
+
if ( FALSE ) { # \dontrun{
+HSST <- VoCC_get_data ( "HSST.tif" )
+yrSST <- sumSeries ( HSST ,
+ p = "1960-01/2009-12" , yr0 = "1955-01-01" , l = terra :: nlyr ( HSST ) ,
+ fun = function ( x ) colMeans ( x , na.rm = TRUE ) , freqin = "months" , freqout = "years"
+)
+tr <- tempTrend ( yrSST , th = 10 )
+sg <- spatGrad ( yrSST , th = 0.0001 , projected = FALSE )
+
+# Magnitude and angle of the climate velocity (km/yr) 1960-2009
+
+v <- gVoCC ( tr , sg )
+terra :: plot ( v )
+} # }
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/index.html b/docs/reference/index.html
new file mode 100644
index 0000000..34e0d7c
--- /dev/null
+++ b/docs/reference/index.html
@@ -0,0 +1,166 @@
+
+Package index • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
All functions
+
+
+
+
+
+
+
+
+
+
+
+ EEZ
+
+
+ Icelandic Exclusive Economic Zone (EEZ)
+
+
+ HSST
+
+
+ Monthly mean sea surface temperatures (SST) around Iceland for 1955-2010
+
+
+ JapTC
+
+
+ Multivariate Terraclimate data for Japan
+
+
+ angulo()
+
+
+ Internal. Angle associated to the spatial gradient
+
+
+ climPCA()
+
+
+ Reduce dimensionality of climate predictors via Principal Component Analysis
+
+
+ climPlot()
+
+
+ Binned scatter plot for 2-dimensional climate space
+
+
+ dVoCC()
+
+
+ Distance-based velocity based on geographically closest climate analogue
+
+
+ gVoCC()
+
+
+ Gradient-based climate velocity
+
+
+ resTime()
+
+
+ Climatic residence time of a polygon
+
+
+ shiftTime()
+
+
+ Shift in timing of seasonal climatology
+
+
+ spatGrad()
+
+
+ Local spatial climatic gradients
+
+
+ splitLine()
+
+
+ Internal. Split a line segment defined by points A-B into n parts
+
+
+ sumSeries()
+
+
+ Summarize climatic series to higher temporal resolution
+
+
+ tempTrend()
+
+
+ Long-term local climatic trends
+
+
+ trajClas()
+
+
+ Climate velocity trajectory classification
+
+
+ trajLine()
+
+
+ Climate velocity trajectory spatial lines
+
+
+ voccTraj()
+
+
+ Climate velocity trajectories
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/pipe.html b/docs/reference/pipe.html
new file mode 100644
index 0000000..4f5c6e7
--- /dev/null
+++ b/docs/reference/pipe.html
@@ -0,0 +1,81 @@
+
+Pipe operator — %>% • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
See magrittr::%>% for details.
+
+
+
+
+
+
Arguments
+
+
+
lhs
+A value or the magrittr placeholder.
+
+
+rhs
+A function call using the magrittr semantics.
+
+
+
+
Value
+
The result of calling `rhs(lhs)`.
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/resTime.html b/docs/reference/resTime.html
new file mode 100644
index 0000000..bc5372d
--- /dev/null
+++ b/docs/reference/resTime.html
@@ -0,0 +1,138 @@
+
+Climatic residence time of a polygon — resTime • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Function to calculate VoCC-based residence time of isotherms within a polygon after Loaire et al. (2009)
+
+
+
+
Usage
+
resTime ( pg , vel , areapg = NA )
+
+
+
+
Arguments
+
+
+
pg
+sf object or terra::vect object containing the polygons for which
+the residence time is to be calculated. The polygons must be on the same coordinate system as vel.
+
+
+vel
+raster with climate velocity (km/year) for the period of interest.
+
+
+areapg
+vector with the area (in km2) of the polygons. Use NA (default) to calculate internally if field not avilable.
+
+
+
+
Value
+
a data.frame containing for each polygon its ID, mean velocity (km/yr),
+diameter of the equivalent circle (km), and residence time (years) as the ratio D/vel.
+
+
+
References
+
Loarie et al. 2009 . The velocity of climate change. Nature, 462, 1052-1055.
+
+
+
+
Author
+
Jorge Garcia Molinos
+
+
+
+
Examples
+
+# Load example Exclusive Economic Zone polygon
+if ( FALSE ) { # \dontrun{
+EEZ <- VoCC_get_data ( "EEZ.gpkg" )
+HSST <- VoCC_get_data ( "HSST.tif" )
+
+yrSST <- sumSeries ( HSST ,
+ p = "1969-01/2009-12" , yr0 = "1955-01-01" , l = terra :: nlyr ( HSST ) ,
+ fun = function ( x ) colMeans ( x , na.rm = TRUE ) ,
+ freqin = "months" , freqout = "years"
+)
+tr <- tempTrend ( yrSST , th = 10 )
+sg <- spatGrad ( yrSST , th = 0.0001 , projected = FALSE )
+v <- gVoCC ( tr , sg )
+vel <- v [[ 1 ] ]
+
+# Calculating area internally
+a1 <- resTime ( EEZ , vel , areapg = NA )
+a1
+
+# Using the area field from the polygon data table
+a2 <- resTime ( EEZ , vel , areapg = as.numeric ( as.numeric ( levels ( EEZ $ Area_km2 ) ) [ EEZ $ Area_km2 ] ) )
+a2
+
+# Using a user defined polygon
+x_coord <- c ( - 28 , - 20 , - 20.3 , - 25.5 )
+y_coord <- c ( 60 , 61 , 63 , 62 )
+coords <- matrix ( c ( x_coord , y_coord ) , ncol = 2 )
+poly_sf <- sf :: st_sf ( geometry = sf :: st_sfc ( sf :: st_polygon ( list ( coords ) ) ) )
+a3 <- resTime ( poly_sf , vel , areapg = NA )
+
+terra :: plot ( vel )
+plot ( sf :: st_geometry ( EEZ ) , add = TRUE )
+plot ( sf :: st_geometry ( poly_sf ) , add = TRUE )
+} # }
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/shiftTime.html b/docs/reference/shiftTime.html
new file mode 100644
index 0000000..4dfe166
--- /dev/null
+++ b/docs/reference/shiftTime.html
@@ -0,0 +1,122 @@
+
+Shift in timing of seasonal climatology — shiftTime • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Function to calculate the seasonal shift in the arriving of typical seasonal climates
+for a given period of interest as per Burrows et al. (2011).
+
+
+
+
Usage
+
shiftTime ( r , yr1 , yr2 , yr0 , th , m )
+
+
+
+
Arguments
+
+
+
r
+stack with monthly values of the climatic
+variable for the period of interest.
+
+
+yr1
+integer specifying the initial year for the period of interest.
+
+
+yr2
+integer specifying the end year for the period of interest.
+
+
+yr0
+integer specifying the first year in the series.
+
+
+th
+integer minimum number of non NAs in the series needed to
+calculate the trend (default 3).
+
+
+m
+integer number (1-12) of the month for which the shift is to be calculated
+
+
+
+
Value
+
a stack with the long-term monthly trend (C/year for temperature in degrees; "mTrend"),
+seasonal rate of change (C/month; "seaRate"), and seasonal shift (day/decade; "seaShift").
+
+
+
References
+
Burrows et al. 2011 . The pace of
+shifting climate in marine and terrestrial ecosystems. Science, 334, 652-655.
+
+
+
Author
+
Jorge Garcia Molinos and Michael T. Burrows
+
+
+
+
Examples
+
if ( FALSE ) { # \dontrun{
+HSST <- VoCC_get_data ( "HSST.tif" )
+Apr <- shiftTime ( HSST , yr1 = 1960 , yr2 = 2009 , yr0 = 1955 , th = 10 , m = 4 )
+
+terra :: plot ( Apr )
+} # }
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/spatGrad.html b/docs/reference/spatGrad.html
new file mode 100644
index 0000000..bc1001d
--- /dev/null
+++ b/docs/reference/spatGrad.html
@@ -0,0 +1,128 @@
+
+Local spatial climatic gradients — spatGrad • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Function to calculate the magnitude and direction of the spatial gradient
+associated to a climatic variable after Burrows et al. (2011). This trend is
+to be used for the calculation of the gradient-based climate velocity using gVoCC.
+
+
+
+
Usage
+
spatGrad ( r , th = - Inf , projected = FALSE )
+
+
+
+
Arguments
+
+
+
r
+RasterStack with the annual climatic values for the period of interest.
+Alternatively, a raster with the annual climatic values averaged
+over the period of interest.
+
+
+th
+Integer indicating a lower threshold to truncate the spatial
+gradient with. Use -Inf (default) if no threshold required.
+
+
+projected
+Logical is the source raster in a projected coordinate system?
+If FALSE (default) a correction will be made to account for latitudinal distortion.
+
+
+
+
Value
+
A RasterStack with the magnitude of the spatial gradient
+(Grad in C per km for unprojected rasters and C per spatial unit for projected rasters),
+and the associated angle (Ang in degrees).
+
+
+
References
+
Burrows et al. 2011 . The pace of shifting climate in marine and terrestrial ecosystems. Science, 334, 652-655.
+
+
+
+
Author
+
Jorge Garcia Molinos, David S. Schoeman, and Michael T. Burrows
+
+
+
+
Examples
+
if ( FALSE ) { # \dontrun{
+HSST <- VoCC_get_data ( "HSST.tif" )
+
+yrSST <- sumSeries ( HSST ,
+ p = "1969-01/2009-12" , yr0 = "1955-01-01" , l = terra :: nlyr ( HSST ) ,
+ fun = function ( x ) colMeans ( x , na.rm = TRUE ) , freqin = "months" , freqout = "years"
+)
+
+# Spatial gradient (magnitude and angle) for the average mean annual SST.
+
+sg <- spatGrad ( yrSST , th = 0.0001 , projected = FALSE )
+
+terra :: plot ( sg )
+} # }
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/splitLine.html b/docs/reference/splitLine.html
new file mode 100644
index 0000000..0b93646
--- /dev/null
+++ b/docs/reference/splitLine.html
@@ -0,0 +1,85 @@
+
+Internal. Split a line segment defined by points A-B into n parts — splitLine • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Internal. Split a line segment defined by points A-B into n parts
+
+
+
+
+
+
Arguments
+
+
+
A
+numeric giving coordinates of first point
+
+
+B
+numeric giving coordinates of second point
+
+
+n
+numeric number of segments to divide the distance between points with
+
+
+
+
Author
+
Jorge Garcia Molinos
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/sumSeries.html b/docs/reference/sumSeries.html
new file mode 100644
index 0000000..c373233
--- /dev/null
+++ b/docs/reference/sumSeries.html
@@ -0,0 +1,179 @@
+
+Summarize climatic series to higher temporal resolution — sumSeries • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Function to convert climatic series (provided as RasterStack) into a
+coarser time frequency series for a period of interest. This function transforms the RasterStack
+into an xts time series object to extract the values for the period of interest and
+apply some summary function. It is mainly a wrapper from the apply. function family
+in the package xts (Ryan and Ulrich 2017).
+
+
+
+
Usage
+
sumSeries (
+ r ,
+ p ,
+ yr0 ,
+ l = terra :: nlyr ( r ) ,
+ fun = function ( x ) colMeans ( x , na.rm = TRUE ) ,
+ freqin = "months" ,
+ freqout = "years"
+)
+
+
+
+
Arguments
+
+
+
r
+RasterStack containing the time series of the climatic variable.
+
+
+p
+character string defining the period to extract for the calculation
+of the series (see examples).
+
+
+yr0
+character string specifying the first (yr0) year in the series (see examples).
+
+
+l
+integer length of the input time series.
+
+
+fun
+logical summary function to be computed. Summary functions need to be applied by cell (columns)
+so should have the structure 'function(x) apply(x, 2, function(y))'. For convenience, sumSeries imports
+colMaxs, and colMins from package ‘matrixStats’ (Bengtsson 2018) so they can be called in directly.
+
+
+freqin
+character string specifying the original time frequency of the series.
+
+
+freqout
+character string specifying the desired time frequency of the new series.
+Must be one of the following: "weeks", "months", "quarters", "years", "other". Argument "other"
+allows for user-defined functions to be applied on the 'xts' time series object over the period of interest (see examples).
+
+
+
+
Value
+
A RasterStack with the new series.
+
+
+
References
+
Ray and Ulrich. 2017 . xts: eXtensible Time Series. R package version 0.10-1. Bengtsson 2018 . matrixStats: Functions that Apply to Rows and Columns
+of Matrices (and to Vectors). R package version 0.53.1.
+
+
+
Author
+
Jorge Garcia Molinos
+
+
+
+
Examples
+
if ( FALSE ) { # \dontrun{
+# Monthly mean SST (HadISST) data for Europe Jan-1950 to Dec-2010
+
+HSST <- VoCC_get_data ( "HSST.tif" )
+
+# Calculate mean annual monthly SST
+
+yrSST <- sumSeries ( HSST ,
+ p = "1969-01/2009-12" , yr0 = "1955-01-01" , l = terra :: nlyr ( HSST ) ,
+ fun = function ( x ) colMeans ( x , na.rm = TRUE ) , freqin = "months" , freqout = "years"
+)
+
+# Extract Jul Aug mean SST each year (xts months are indexed from 0 to 11)
+
+myf <- function ( x , m = c ( 7 , 8 ) ) {
+ x [ xts :: .indexmon ( x ) %in% ( m - 1 ) ]
+}
+
+JlAugSST <- sumSeries ( HSST ,
+ p = "1969-01/2009-12" , yr0 = "1950-01-01" , l = terra :: nlyr ( HSST ) ,
+ fun = myf , freqin = "months" , freqout = "other"
+)
+
+# Same but calculating the annual variance of the two months
+
+myf <- function ( x , m = c ( 7 , 8 ) ) {
+ x1 <- x [ xts :: .indexmon ( x ) %in% ( m - 1 ) ]
+ xts :: apply.yearly ( x1 , function ( y ) {
+ apply ( y , 2 , function ( y ) {
+ var ( y , na.rm = TRUE )
+ } )
+ } )
+}
+
+meanJASST <- sumSeries ( HSST ,
+ p = "1969-01/2009-12" , yr0 = "1950-01-01" , l = terra :: nlyr ( HSST ) ,
+ fun = myf , freqin = "months" , freqout = "other"
+)
+} # }
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/tempTrend.html b/docs/reference/tempTrend.html
new file mode 100644
index 0000000..6877a02
--- /dev/null
+++ b/docs/reference/tempTrend.html
@@ -0,0 +1,118 @@
+
+Long-term local climatic trends — tempTrend • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Function to calculate temporal trend from a raster series
+of a climatic variable. This trend is to be used for the calculation of the
+gradient-based climate velocity using gVoCC.
+
+
+
+
+
+
Arguments
+
+
+
r
+RasterStack containing a time series of (annual, seasonal, monthly...) values of
+the climatic variable for the period of interest.
+
+
+th
+Integer minimum number of observations in the series needed to
+calculate the trend at each cell.
+
+
+
+
Value
+
A RasterStack containing the cell-specific temporal trends
+extracted from simple linear regressions of the climatic variable against time
+("slpTrends" in degree Celsius per year), together with their standard
+errors ("seTrends") and statistical significance ("sigTrends").
+
+
+
+
Author
+
Jorge Garcia Molinos and Christopher J. Brown
+
+
+
+
Examples
+
if ( FALSE ) { # \dontrun{
+HSST <- VoCC_get_data ( "HSST.tif" )
+
+yrSST <- sumSeries ( HSST ,
+ p = "1969-01/2009-12" , yr0 = "1955-01-01" , l = terra :: nlyr ( HSST ) ,
+ fun = function ( x ) colMeans ( x , na.rm = TRUE ) , freqin = "months" , freqout = "years"
+)
+
+# Mean annual SST trend (minimum threshold of 10 years of data), with SE and p-values.
+
+tr <- tempTrend ( yrSST , th = 10 )
+
+terra :: plot ( tr )
+} # }
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/trajClas.html b/docs/reference/trajClas.html
new file mode 100644
index 0000000..57ec9eb
--- /dev/null
+++ b/docs/reference/trajClas.html
@@ -0,0 +1,248 @@
+
+Climate velocity trajectory classification — trajClas • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Function for the spatial classification of cells based on VoCC trajectories after Burrows et al. (2014). The function performs
+a hierarchical sequential classification based on length of trajectories, geographical features, and the relative abundance of
+trajectories ending in, starting from and flowing through each cell. Essentially, cells are first classified as non-moving,
+slow-moving and fast-moving relative to the distance a trajectory will cover over the projection period based on local climate velocities.
+Two types of climate sinks are then identified among the fast-moving cells: (i) boundary (e.g., coastal) cells disconnected from cooler (warmer)
+neighbouring cells under a locally warming (cooling) climate, and (ii) locations with endorheic spatial gradients where the velocity angles of
+neighbouring cells converge towards their central point of intersection. Finally, the remaining cells are classified by reference to the total
+number of trajectories per cell based on the proportions of the number of trajectories starting from (Nst), ending in (Nend), and flowing
+through (NFT) a cell over the period. Based on these proportions, cells are classified into five classes: (1) climate sources, when no
+trajectories end in a cell (Nend = 0); (2) relative climate sinks, when the relative number of trajectories ending in a cell is high and the
+proportion of starting trajectories is low; (3) corridors as cells with a high proportion of trajectories passing through; and (4) divergence
+and (5) convergence cells identified from the remaining cells as those where fewer/more trajectories ended than started in that
+cell, respectively.
+
+
+
+
Usage
+
trajClas (
+ traj ,
+ vel ,
+ ang ,
+ mn ,
+ trajSt ,
+ tyr ,
+ nmL ,
+ smL ,
+ Nend ,
+ Nst ,
+ NFT ,
+ DateLine = FALSE
+)
+
+
+
+
Arguments
+
+
+
traj
+data.frame as retuned by voccTraj containing the coordinates
+and identification number for each trajectory.
+
+
+vel
+SpatRaster with the magnitude of gradient-based climate velocity.
+
+
+ang
+SpatRaster with velocity angles.
+
+
+mn
+SpatRaster with mean climatic values for the study period.
+
+
+trajSt
+integer number of trajectories starting from each cell or spatial unit.
+
+
+tyr
+integer number of years comprising the projected period.
+
+
+nmL
+numeric upper threshold (distance units as per vel object) up to which
+a trajectory is considered to have traveled a negligible distance over the study period (non-moving).
+
+
+smL
+numeric upper threshold up to which a trajectory is considered to have traveled a small
+distance over the study period (slow-moving).
+
+
+Nend
+numeric the percentage of trajectories ending to be used as threshold in the classification.
+
+
+Nst
+numeric the percentage of trajectories starting to be used as threshold in the classification.
+
+
+NFT
+numeric the percentage of trajectories flowing through to be used as threshold in the classification.
+
+
+DateLine
+logical does the raster extent cross the international date line? (default "FALSE").
+
+
+
+
Value
+
A SpatRaster containing the trajectory classification ("TrajClas"),
+as well as those based on trajectory length ("ClassL"; 1 non-moving, 2 slow-moving, 3 fast-moving cells),
+boundrary ("BounS") and internal sinks ("IntS"), and the proportion of trajectories ending("PropEnd"),
+flowing through ("PropFT") and starting ("PropSt"). The trajectory classes ("TrajClas") are (1) non-moving,
+(2) slow-moving, (3) internal sinks, (4) boundary sinks, (5) sources, (6) relative sinks, (7) corridors,
+(8) divergence and (9) convergence.
+
+
+
References
+
Burrows et al. 2014 . Geographical limits to species-range shifts are suggested by climate velocity. Nature, 507, 492-495.
+
+
+
+
Author
+
Jorge Garcia Molinos
+
+
+
+
Examples
+
if ( FALSE ) { # \dontrun{
+HSST <- VoCC_get_data ( "HSST.tif" )
+
+# input raster layers
+yrSST <- sumSeries ( HSST ,
+ p = "1960-01/2009-12" , yr0 = "1955-01-01" , l = terra :: nlyr ( HSST ) ,
+ fun = function ( x ) colMeans ( x , na.rm = TRUE ) , freqin = "months" , freqout = "years"
+)
+
+mn <- terra :: mean ( yrSST , na.rm = TRUE )
+tr <- tempTrend ( yrSST , th = 10 )
+sg <- spatGrad ( yrSST , th = 0.0001 , projected = FALSE )
+v <- gVoCC ( tr , sg )
+vel <- v [[ 1 ] ]
+ang <- v [[ 2 ] ]
+
+# Get the set of starting cells for the trajectories and calculate trajectories
+# at 1/4-deg resolution (16 trajectories per 1-deg cell)
+mnd <- terra :: disagg ( mn , 4 )
+veld <- terra :: disagg ( vel , 4 )
+angd <- terra :: disagg ( ang , 4 )
+lonlat <- stats :: na.omit ( data.frame (
+ terra :: xyFromCell ( veld , 1 : terra :: ncell ( veld ) ) ,
+ terra :: values ( veld ) , terra :: values ( angd ) , terra :: values ( mnd )
+) ) [ , 1 : 2 ]
+
+traj <- voccTraj ( lonlat , vel , ang , mn , tyr = 50 , correct = TRUE )
+
+# Generate the trajectory-based classification
+clas <- trajClas ( traj , vel , ang , mn ,
+ trajSt = 16 , tyr = 50 , nmL = 20 , smL = 100 ,
+ Nend = 45 , Nst = 15 , NFT = 70 , DateLine = FALSE
+)
+
+# Define first the colour palette for the full set of categories
+my_col <- c (
+ "gainsboro" , "darkseagreen1" , "coral4" , "firebrick2" , "mediumblue" , "darkorange1" ,
+ "magenta1" , "cadetblue1" , "yellow1"
+)
+# Keep only the categories present in our raster
+my_col <- my_col [ sort ( unique ( terra :: values ( clas [[ 7 ] ] ) ) ) ]
+
+# Classify raster / build attribute table
+clasr <- terra :: as.factor ( clas [[ 7 ] ] )
+rat_r <- data.frame ( ID = sort ( unique ( terra :: values ( clas [[ 7 ] ] ) ) ) ,
+ trajcat = c ( "N-M" , "S-M" , "IS" , "BS" , "Srce" ,
+ "RS" , "Cor" , "Div" , "Con" ) [ sort ( unique ( terra :: values ( clas [[ 7 ] ] ) ) ) ] )
+terra :: cats ( clasr ) <- rat_r
+# Produce the plot using the rasterVis levelplot function
+rasterVis :: levelplot ( clasr ,
+ col.regions = my_col ,
+ xlab = NULL , ylab = NULL , scales = list ( draw = FALSE )
+)
+} # }
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/trajLine.html b/docs/reference/trajLine.html
new file mode 100644
index 0000000..23dd357
--- /dev/null
+++ b/docs/reference/trajLine.html
@@ -0,0 +1,132 @@
+
+Climate velocity trajectory spatial lines — trajLine • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Create a spatial line data frame object from trajectory points.
+
+
+
+
Usage
+
trajLine ( x , projx = "EPSG:4326" )
+
+
+
+
Arguments
+
+
+
x
+data.frame containing the coordinates (x, y) of the constituent
+points and identification number (trajIDs) for each trajectory as returned by VoCCTraj.
+
+
+projx
+CRS detailing the coordinate reference system of the input data
+(default geographic CRS).
+
+
+
+
Value
+
A SpatialLinesDataFrame with one line per trajectory as specified in x.
+To avoid artifacts, trajectories crossing the date line need to be split into two segments.
+Where the trajectory on one side of the date line is only composed of a single point,
+the trajectory won't be displayed (no line object created). The function assumes
+a -180 to 180 longitudinal arrangement.
+
+
+
+
Author
+
Jorge Garcia Molinos
+
+
+
+
Examples
+
if ( FALSE ) { # \dontrun{
+HSST <- VoCC_get_data ( "HSST.tif" )
+
+yrSST <- sumSeries ( HSST ,
+ p = "1969-01/2009-12" , yr0 = "1955-01-01" , l = terra :: nlyr ( HSST ) ,
+ fun = function ( x ) colMeans ( x , na.rm = TRUE ) , freqin = "months" , freqout = "years"
+)
+tr <- tempTrend ( yrSST , th = 10 )
+sg <- spatGrad ( yrSST , th = 0.0001 , projected = FALSE )
+v <- gVoCC ( tr , sg )
+vel <- v [[ 1 ] ]
+ang <- v [[ 2 ] ]
+
+# calculate the annual SST mean over the period
+mn <- terra :: mean ( yrSST , na.rm = TRUE )
+
+# get the set of starting cells for the trajectories
+lonlat <- stats :: na.omit ( data.frame (
+ terra :: xyFromCell ( vel , 1 : terra :: ncell ( vel ) ) ,
+ vel [ ] , ang [ ] , mn [ ]
+) ) [ , 1 : 2 ]
+
+# Calculate trajectories.
+traj <- voccTraj ( lonlat , vel , ang , mn , tyr = 50 , correct = TRUE )
+
+# create a spatial line data frame from traj
+lns <- trajLine ( x = traj )
+terra :: plot ( mn )
+terra :: plot ( lns , add = TRUE )
+
+# Export as ESRI shape file
+terra :: writeVector ( lns , filename = "velTraj" , filetype = "ESRI Shapefile" )
+} # }
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/reference/voccTraj.html b/docs/reference/voccTraj.html
new file mode 100644
index 0000000..177a874
--- /dev/null
+++ b/docs/reference/voccTraj.html
@@ -0,0 +1,158 @@
+
+Climate velocity trajectories — voccTraj • VoCC
+ Skip to contents
+
+
+
+
+
VoCC
+
+
0.0.1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Function to calculate vocc trajectories after Burrows et al (2014). Trajectories
+are calculated by propagating climatic isopleths using the magnitude and direction of
+local (cell) velocities. This is a slightly modified version of the original
+Burrows et al. (2014) approach in that iterations of a trajectory are based on
+cumulative time traveled instead of using fixed time steps.
+
+
+
+
Usage
+
voccTraj ( lonlat , vel , ang , mn , tstep , tyr = 50 )
+
+
+
+
Arguments
+
+
+
lonlat
+data.frame with the longitude and latitude (in decimal degrees)
+of the points to project.
+
+
+vel
+raster with the magnitude of gradient-based climate velocity.
+
+
+ang
+raster with velocity angles in degrees.
+
+
+mn
+raster with the overall mean climatic value over the period of interest.
+
+
+tyr
+integer temporal length of the period of interest.
+
+
+
+
Value
+
a data.frame containing the coordinates ("x", "y") of the constituent
+points and identification number ("trajIDs") for each trajectory.
+
+
+
References
+
Burrows et al. 2014 . Geographical limits to species-range shifts are suggested by climate velocity. Nature, 507, 492-495.
+
+
+
+
Author
+
Jorge Garcia Molinos, David S. Schoeman and Michael T. Burrows
+
+
+
+
Examples
+
if ( FALSE ) { # \dontrun{
+yrSST <- sumSeries ( HSST ,
+ p = "1960-01/2009-12" , yr0 = "1955-01-01" , l = terra :: nlyr ( HSST ) ,
+ fun = function ( x ) colMeans ( x , na.rm = TRUE ) ,
+ freqin = "months" , freqout = "years"
+)
+
+# Long-term local climatic trends
+tr <- tempTrend ( yrSST , th = 10 )
+
+# Local spatial climatic gradients
+sg <- spatGrad ( yrSST , th = 0.0001 , projected = FALSE )
+
+# Gradient-based climate velocity
+v <- gVoCC ( tr , sg )
+vel <- v [[ 1 ] ]
+ang <- v [[ 2 ] ]
+
+# Calculate the annual SST mean over the period
+mn <- terra :: mean ( yrSST , na.rm = TRUE )
+
+# Get the set of starting cells for the trajectories
+lonlat <- stats :: na.omit ( data.frame (
+ terra :: xyFromCell ( vel , 1 : terra :: ncell ( vel ) ) ,
+ vel [ ] , ang [ ] , mn [ ]
+) ) [ , 1 : 2 ]
+
+# Calculate trajectories
+# The following throws an error due to the trajectories moving beyond the raster extent
+traj <- voccTraj ( lonlat , vel , ang , mn , tyr = 50 )
+
+# This accounts for the extent issue
+traj <- voccTraj ( lonlat , vel , ang , mn , tyr = 50 , correct = TRUE )
+} # }
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/docs/search.json b/docs/search.json
new file mode 100644
index 0000000..98f4fc1
--- /dev/null
+++ b/docs/search.json
@@ -0,0 +1 @@
+[{"path":"/LICENSE.html","id":null,"dir":"","previous_headings":"","what":"GNU Affero General Public License","title":"GNU Affero General Public License","text":"Version 3, 19 November 2007 Copyright (C) 2007 Free Software Foundation, Inc. Everyone permitted copy distribute verbatim copies license document, changing allowed.","code":""},{"path":"/LICENSE.html","id":"preamble","dir":"","previous_headings":"","what":"Preamble","title":"GNU Affero General Public License","text":"GNU Affero General Public License free, copyleft license software kinds works, specifically designed ensure cooperation community case network server software. licenses software practical works designed take away freedom share change works. contrast, General Public Licenses intended guarantee freedom share change versions program–make sure remains free software users. speak free software, referring freedom, price. General Public Licenses designed make sure freedom distribute copies free software (charge wish), receive source code can get want , can change software use pieces new free programs, know can things. Developers use General Public Licenses protect rights two steps: (1) assert copyright software, (2) offer License gives legal permission copy, distribute /modify software. secondary benefit defending users’ freedom improvements made alternate versions program, receive widespread use, become available developers incorporate. Many developers free software heartened encouraged resulting cooperation. However, case software used network servers, result may fail come . GNU General Public License permits making modified version letting public access server without ever releasing source code public. GNU Affero General Public License designed specifically ensure , cases, modified source code becomes available community. requires operator network server provide source code modified version running users server. Therefore, public use modified version, publicly accessible server, gives public access source code modified version. older license, called Affero General Public License published Affero, designed accomplish similar goals. different license, version Affero GPL, Affero released new version Affero GPL permits relicensing license. precise terms conditions copying, distribution modification follow.","code":""},{"path":[]},{"path":"/LICENSE.html","id":"id_0-definitions","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"0. Definitions.","title":"GNU Affero General Public License","text":"“License” refers version 3 GNU Affero General Public License. “Copyright” also means copyright-like laws apply kinds works, semiconductor masks. “Program” refers copyrightable work licensed License. licensee addressed “”. “Licensees” “recipients” may individuals organizations. “modify” work means copy adapt part work fashion requiring copyright permission, making exact copy. resulting work called “modified version” earlier work work “based ” earlier work. “covered work” means either unmodified Program work based Program. “propagate” work means anything , without permission, make directly secondarily liable infringement applicable copyright law, except executing computer modifying private copy. Propagation includes copying, distribution (without modification), making available public, countries activities well. “convey” work means kind propagation enables parties make receive copies. Mere interaction user computer network, transfer copy, conveying. interactive user interface displays “Appropriate Legal Notices” extent includes convenient prominently visible feature (1) displays appropriate copyright notice, (2) tells user warranty work (except extent warranties provided), licensees may convey work License, view copy License. interface presents list user commands options, menu, prominent item list meets criterion.","code":""},{"path":"/LICENSE.html","id":"id_1-source-code","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"1. Source Code.","title":"GNU Affero General Public License","text":"“source code” work means preferred form work making modifications . “Object code” means non-source form work. “Standard Interface” means interface either official standard defined recognized standards body, , case interfaces specified particular programming language, one widely used among developers working language. “System Libraries” executable work include anything, work whole, () included normal form packaging Major Component, part Major Component, (b) serves enable use work Major Component, implement Standard Interface implementation available public source code form. “Major Component”, context, means major essential component (kernel, window system, ) specific operating system () executable work runs, compiler used produce work, object code interpreter used run . “Corresponding Source” work object code form means source code needed generate, install, (executable work) run object code modify work, including scripts control activities. However, include work’s System Libraries, general-purpose tools generally available free programs used unmodified performing activities part work. example, Corresponding Source includes interface definition files associated source files work, source code shared libraries dynamically linked subprograms work specifically designed require, intimate data communication control flow subprograms parts work. Corresponding Source need include anything users can regenerate automatically parts Corresponding Source. Corresponding Source work source code form work.","code":""},{"path":"/LICENSE.html","id":"id_2-basic-permissions","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"2. Basic Permissions.","title":"GNU Affero General Public License","text":"rights granted License granted term copyright Program, irrevocable provided stated conditions met. License explicitly affirms unlimited permission run unmodified Program. output running covered work covered License output, given content, constitutes covered work. License acknowledges rights fair use equivalent, provided copyright law. may make, run propagate covered works convey, without conditions long license otherwise remains force. may convey covered works others sole purpose make modifications exclusively , provide facilities running works, provided comply terms License conveying material control copyright. thus making running covered works must exclusively behalf, direction control, terms prohibit making copies copyrighted material outside relationship . Conveying circumstances permitted solely conditions stated . Sublicensing allowed; section 10 makes unnecessary.","code":""},{"path":"/LICENSE.html","id":"id_3-protecting-users-legal-rights-from-anti-circumvention-law","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"3. Protecting Users’ Legal Rights From Anti-Circumvention Law.","title":"GNU Affero General Public License","text":"covered work shall deemed part effective technological measure applicable law fulfilling obligations article 11 WIPO copyright treaty adopted 20 December 1996, similar laws prohibiting restricting circumvention measures. convey covered work, waive legal power forbid circumvention technological measures extent circumvention effected exercising rights License respect covered work, disclaim intention limit operation modification work means enforcing, work’s users, third parties’ legal rights forbid circumvention technological measures.","code":""},{"path":"/LICENSE.html","id":"id_4-conveying-verbatim-copies","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"4. Conveying Verbatim Copies.","title":"GNU Affero General Public License","text":"may convey verbatim copies Program’s source code receive , medium, provided conspicuously appropriately publish copy appropriate copyright notice; keep intact notices stating License non-permissive terms added accord section 7 apply code; keep intact notices absence warranty; give recipients copy License along Program. may charge price price copy convey, may offer support warranty protection fee.","code":""},{"path":"/LICENSE.html","id":"id_5-conveying-modified-source-versions","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"5. Conveying Modified Source Versions.","title":"GNU Affero General Public License","text":"may convey work based Program, modifications produce Program, form source code terms section 4, provided also meet conditions: work must carry prominent notices stating modified , giving relevant date. work must carry prominent notices stating released License conditions added section 7. requirement modifies requirement section 4 “keep intact notices”. must license entire work, whole, License anyone comes possession copy. License therefore apply, along applicable section 7 additional terms, whole work, parts, regardless packaged. License gives permission license work way, invalidate permission separately received . work interactive user interfaces, must display Appropriate Legal Notices; however, Program interactive interfaces display Appropriate Legal Notices, work need make . compilation covered work separate independent works, nature extensions covered work, combined form larger program, volume storage distribution medium, called “aggregate” compilation resulting copyright used limit access legal rights compilation’s users beyond individual works permit. Inclusion covered work aggregate cause License apply parts aggregate.","code":""},{"path":"/LICENSE.html","id":"id_6-conveying-non-source-forms","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"6. Conveying Non-Source Forms.","title":"GNU Affero General Public License","text":"may convey covered work object code form terms sections 4 5, provided also convey machine-readable Corresponding Source terms License, one ways: Convey object code , embodied , physical product (including physical distribution medium), accompanied Corresponding Source fixed durable physical medium customarily used software interchange. Convey object code , embodied , physical product (including physical distribution medium), accompanied written offer, valid least three years valid long offer spare parts customer support product model, give anyone possesses object code either (1) copy Corresponding Source software product covered License, durable physical medium customarily used software interchange, price reasonable cost physically performing conveying source, (2) access copy Corresponding Source network server charge. Convey individual copies object code copy written offer provide Corresponding Source. alternative allowed occasionally noncommercially, received object code offer, accord subsection 6b. Convey object code offering access designated place (gratis charge), offer equivalent access Corresponding Source way place charge. need require recipients copy Corresponding Source along object code. place copy object code network server, Corresponding Source may different server (operated third party) supports equivalent copying facilities, provided maintain clear directions next object code saying find Corresponding Source. Regardless server hosts Corresponding Source, remain obligated ensure available long needed satisfy requirements. Convey object code using peer--peer transmission, provided inform peers object code Corresponding Source work offered general public charge subsection 6d. separable portion object code, whose source code excluded Corresponding Source System Library, need included conveying object code work. “User Product” either (1) “consumer product”, means tangible personal property normally used personal, family, household purposes, (2) anything designed sold incorporation dwelling. determining whether product consumer product, doubtful cases shall resolved favor coverage. particular product received particular user, “normally used” refers typical common use class product, regardless status particular user way particular user actually uses, expects expected use, product. product consumer product regardless whether product substantial commercial, industrial non-consumer uses, unless uses represent significant mode use product. “Installation Information” User Product means methods, procedures, authorization keys, information required install execute modified versions covered work User Product modified version Corresponding Source. information must suffice ensure continued functioning modified object code case prevented interfered solely modification made. convey object code work section , , specifically use , User Product, conveying occurs part transaction right possession use User Product transferred recipient perpetuity fixed term (regardless transaction characterized), Corresponding Source conveyed section must accompanied Installation Information. requirement apply neither third party retains ability install modified object code User Product (example, work installed ROM). requirement provide Installation Information include requirement continue provide support service, warranty, updates work modified installed recipient, User Product modified installed. Access network may denied modification materially adversely affects operation network violates rules protocols communication across network. Corresponding Source conveyed, Installation Information provided, accord section must format publicly documented (implementation available public source code form), must require special password key unpacking, reading copying.","code":""},{"path":"/LICENSE.html","id":"id_7-additional-terms","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"7. Additional Terms.","title":"GNU Affero General Public License","text":"“Additional permissions” terms supplement terms License making exceptions one conditions. Additional permissions applicable entire Program shall treated though included License, extent valid applicable law. additional permissions apply part Program, part may used separately permissions, entire Program remains governed License without regard additional permissions. convey copy covered work, may option remove additional permissions copy, part . (Additional permissions may written require removal certain cases modify work.) may place additional permissions material, added covered work, can give appropriate copyright permission. Notwithstanding provision License, material add covered work, may (authorized copyright holders material) supplement terms License terms: Disclaiming warranty limiting liability differently terms sections 15 16 License; Requiring preservation specified reasonable legal notices author attributions material Appropriate Legal Notices displayed works containing ; Prohibiting misrepresentation origin material, requiring modified versions material marked reasonable ways different original version; Limiting use publicity purposes names licensors authors material; Declining grant rights trademark law use trade names, trademarks, service marks; Requiring indemnification licensors authors material anyone conveys material (modified versions ) contractual assumptions liability recipient, liability contractual assumptions directly impose licensors authors. non-permissive additional terms considered “restrictions” within meaning section 10. Program received , part , contains notice stating governed License along term restriction, may remove term. license document contains restriction permits relicensing conveying License, may add covered work material governed terms license document, provided restriction survive relicensing conveying. add terms covered work accord section, must place, relevant source files, statement additional terms apply files, notice indicating find applicable terms. Additional terms, permissive non-permissive, may stated form separately written license, stated exceptions; requirements apply either way.","code":""},{"path":"/LICENSE.html","id":"id_8-termination","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"8. Termination.","title":"GNU Affero General Public License","text":"may propagate modify covered work except expressly provided License. attempt otherwise propagate modify void, automatically terminate rights License (including patent licenses granted third paragraph section 11). However, cease violation License, license particular copyright holder reinstated () provisionally, unless copyright holder explicitly finally terminates license, (b) permanently, copyright holder fails notify violation reasonable means prior 60 days cessation. Moreover, license particular copyright holder reinstated permanently copyright holder notifies violation reasonable means, first time received notice violation License (work) copyright holder, cure violation prior 30 days receipt notice. Termination rights section terminate licenses parties received copies rights License. rights terminated permanently reinstated, qualify receive new licenses material section 10.","code":""},{"path":"/LICENSE.html","id":"id_9-acceptance-not-required-for-having-copies","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"9. Acceptance Not Required for Having Copies.","title":"GNU Affero General Public License","text":"required accept License order receive run copy Program. Ancillary propagation covered work occurring solely consequence using peer--peer transmission receive copy likewise require acceptance. However, nothing License grants permission propagate modify covered work. actions infringe copyright accept License. Therefore, modifying propagating covered work, indicate acceptance License .","code":""},{"path":"/LICENSE.html","id":"id_10-automatic-licensing-of-downstream-recipients","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"10. Automatic Licensing of Downstream Recipients.","title":"GNU Affero General Public License","text":"time convey covered work, recipient automatically receives license original licensors, run, modify propagate work, subject License. responsible enforcing compliance third parties License. “entity transaction” transaction transferring control organization, substantially assets one, subdividing organization, merging organizations. propagation covered work results entity transaction, party transaction receives copy work also receives whatever licenses work party’s predecessor interest give previous paragraph, plus right possession Corresponding Source work predecessor interest, predecessor can get reasonable efforts. may impose restrictions exercise rights granted affirmed License. example, may impose license fee, royalty, charge exercise rights granted License, may initiate litigation (including cross-claim counterclaim lawsuit) alleging patent claim infringed making, using, selling, offering sale, importing Program portion .","code":""},{"path":"/LICENSE.html","id":"id_11-patents","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"11. Patents.","title":"GNU Affero General Public License","text":"“contributor” copyright holder authorizes use License Program work Program based. work thus licensed called contributor’s “contributor version”. contributor’s “essential patent claims” patent claims owned controlled contributor, whether already acquired hereafter acquired, infringed manner, permitted License, making, using, selling contributor version, include claims infringed consequence modification contributor version. purposes definition, “control” includes right grant patent sublicenses manner consistent requirements License. contributor grants non-exclusive, worldwide, royalty-free patent license contributor’s essential patent claims, make, use, sell, offer sale, import otherwise run, modify propagate contents contributor version. following three paragraphs, “patent license” express agreement commitment, however denominated, enforce patent (express permission practice patent covenant sue patent infringement). “grant” patent license party means make agreement commitment enforce patent party. convey covered work, knowingly relying patent license, Corresponding Source work available anyone copy, free charge terms License, publicly available network server readily accessible means, must either (1) cause Corresponding Source available, (2) arrange deprive benefit patent license particular work, (3) arrange, manner consistent requirements License, extend patent license downstream recipients. “Knowingly relying” means actual knowledge , patent license, conveying covered work country, recipient’s use covered work country, infringe one identifiable patents country reason believe valid. , pursuant connection single transaction arrangement, convey, propagate procuring conveyance , covered work, grant patent license parties receiving covered work authorizing use, propagate, modify convey specific copy covered work, patent license grant automatically extended recipients covered work works based . patent license “discriminatory” include within scope coverage, prohibits exercise , conditioned non-exercise one rights specifically granted License. may convey covered work party arrangement third party business distributing software, make payment third party based extent activity conveying work, third party grants, parties receive covered work , discriminatory patent license () connection copies covered work conveyed (copies made copies), (b) primarily connection specific products compilations contain covered work, unless entered arrangement, patent license granted, prior 28 March 2007. Nothing License shall construed excluding limiting implied license defenses infringement may otherwise available applicable patent law.","code":""},{"path":"/LICENSE.html","id":"id_12-no-surrender-of-others-freedom","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"12. No Surrender of Others’ Freedom.","title":"GNU Affero General Public License","text":"conditions imposed (whether court order, agreement otherwise) contradict conditions License, excuse conditions License. convey covered work satisfy simultaneously obligations License pertinent obligations, consequence may convey . example, agree terms obligate collect royalty conveying convey Program, way satisfy terms License refrain entirely conveying Program.","code":""},{"path":"/LICENSE.html","id":"id_13-remote-network-interaction-use-with-the-gnu-general-public-license","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"13. Remote Network Interaction; Use with the GNU General Public License.","title":"GNU Affero General Public License","text":"Notwithstanding provision License, modify Program, modified version must prominently offer users interacting remotely computer network (version supports interaction) opportunity receive Corresponding Source version providing access Corresponding Source network server charge, standard customary means facilitating copying software. Corresponding Source shall include Corresponding Source work covered version 3 GNU General Public License incorporated pursuant following paragraph. Notwithstanding provision License, permission link combine covered work work licensed version 3 GNU General Public License single combined work, convey resulting work. terms License continue apply part covered work, work combined remain governed version 3 GNU General Public License.","code":""},{"path":"/LICENSE.html","id":"id_14-revised-versions-of-this-license","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"14. Revised Versions of this License.","title":"GNU Affero General Public License","text":"Free Software Foundation may publish revised /new versions GNU Affero General Public License time time. new versions similar spirit present version, may differ detail address new problems concerns. version given distinguishing version number. Program specifies certain numbered version GNU Affero General Public License “later version” applies , option following terms conditions either numbered version later version published Free Software Foundation. Program specify version number GNU Affero General Public License, may choose version ever published Free Software Foundation. Program specifies proxy can decide future versions GNU Affero General Public License can used, proxy’s public statement acceptance version permanently authorizes choose version Program. Later license versions may give additional different permissions. However, additional obligations imposed author copyright holder result choosing follow later version.","code":""},{"path":"/LICENSE.html","id":"id_15-disclaimer-of-warranty","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"15. Disclaimer of Warranty.","title":"GNU Affero General Public License","text":"WARRANTY PROGRAM, EXTENT PERMITTED APPLICABLE LAW. EXCEPT OTHERWISE STATED WRITING COPYRIGHT HOLDERS /PARTIES PROVIDE PROGRAM “” WITHOUT WARRANTY KIND, EITHER EXPRESSED IMPLIED, INCLUDING, LIMITED , IMPLIED WARRANTIES MERCHANTABILITY FITNESS PARTICULAR PURPOSE. ENTIRE RISK QUALITY PERFORMANCE PROGRAM . PROGRAM PROVE DEFECTIVE, ASSUME COST NECESSARY SERVICING, REPAIR CORRECTION.","code":""},{"path":"/LICENSE.html","id":"id_16-limitation-of-liability","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"16. Limitation of Liability.","title":"GNU Affero General Public License","text":"EVENT UNLESS REQUIRED APPLICABLE LAW AGREED WRITING COPYRIGHT HOLDER, PARTY MODIFIES /CONVEYS PROGRAM PERMITTED , LIABLE DAMAGES, INCLUDING GENERAL, SPECIAL, INCIDENTAL CONSEQUENTIAL DAMAGES ARISING USE INABILITY USE PROGRAM (INCLUDING LIMITED LOSS DATA DATA RENDERED INACCURATE LOSSES SUSTAINED THIRD PARTIES FAILURE PROGRAM OPERATE PROGRAMS), EVEN HOLDER PARTY ADVISED POSSIBILITY DAMAGES.","code":""},{"path":"/LICENSE.html","id":"id_17-interpretation-of-sections-15-and-16","dir":"","previous_headings":"TERMS AND CONDITIONS","what":"17. Interpretation of Sections 15 and 16.","title":"GNU Affero General Public License","text":"disclaimer warranty limitation liability provided given local legal effect according terms, reviewing courts shall apply local law closely approximates absolute waiver civil liability connection Program, unless warranty assumption liability accompanies copy Program return fee. END TERMS CONDITIONS","code":""},{"path":"/LICENSE.html","id":"how-to-apply-these-terms-to-your-new-programs","dir":"","previous_headings":"","what":"How to Apply These Terms to Your New Programs","title":"GNU Affero General Public License","text":"develop new program, want greatest possible use public, best way achieve make free software everyone can redistribute change terms. , attach following notices program. safest attach start source file effectively state exclusion warranty; file least “copyright” line pointer full notice found. Also add information contact electronic paper mail. software can interact users remotely computer network, also make sure provides way users get source. example, program web application, interface display “Source” link leads users archive code. many ways offer source, different solutions better different programs; see section 13 specific requirements. also get employer (work programmer) school, , sign “copyright disclaimer” program, necessary. information , apply follow GNU AGPL, see https://www.gnu.org/licenses/.","code":" Copyright (C) This program is free software: you can redistribute it and/or modify it under the terms of the GNU Affero General Public License as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU Affero General Public License for more details. You should have received a copy of the GNU Affero General Public License along with this program. If not, see ."},{"path":"/articles/VoCC.html","id":"example-1-prediction-of-biogeographical-shifts","dir":"Articles","previous_headings":"","what":"Example 1: Prediction of biogeographical shifts","title":"VoCC","text":"look first “marshift” global data set containing reported range shifts marine species corresponding given periods time. Next, calculate gradient- distance-based velocities (1960-2009), using HadiSST data set, later extract corresponding values observed shift. Next, extract mean velocity estimates reported shift taking average grid cell values within circle radius equal reported range-shift distance. used fit simple linear regression models observed range shifts climate velocity. Distance-based velocities strictly positive definition, compare like like change first sign negative present local climates warmer future analogues. Produce observed vs predicted scatterplots regression lines (Fig. 2 Garcia Molinos et al. 2019).","code":"str(marshift) #> 'data.frame': 343 obs. of 6 variables: #> $ lat : num 49.7 53.8 53.8 40 43 ... #> $ long : num -4.33 5 5 1 -9.3 -1.4 -9.3 -71.7 -71.7 -71.7 ... #> $ timespan : int 30 40 40 55 35 35 84 39 26 54 ... #> $ years_data: int 23 40 40 15 4 2 5 2 2 2 ... #> $ taxa : Factor w/ 12 levels \"Benthic algae\",..: 6 6 6 6 3 3 4 5 5 5 ... #> $ Shift : num 536.1 65.6 95.9 40 10 ... HadiSST <- terra::rast(system.file(\"extdata\", \"HadiSST.tif\", package = \"VoCCdata\")) # monthly to annual averages r <- sumSeries(HadiSST, p = \"1960-01/2009-12\", yr0 = \"1955-01-01\", l = terra::nlyr(HadiSST), fun = function(x) colMeans(x, na.rm = TRUE), freqin = \"months\", freqout = \"years\") vt <- tempTrend(r, th = 10) # temporal trend vg <- spatGrad(r, th = 0.0001, projected = FALSE) # spatial gradient gv <- gVoCC(vt, vg) # climate velocity # Now the distance-based velocities # Take 1960-1970 as base period against 2000-2009 r2 <- c(terra::mean(r[[1:10]], na.rm = TRUE), terra::mean(r[[41:50]], na.rm = TRUE)) # prepare the data frame with the necessary variables clim <- na.omit(data.frame(terra::values(r2), cid = 1:terra::ncell(r))) clim[, c(\"x\", \"y\")] <- terra::xyFromCell(r, clim$cid) # 1965-2004 (40 yr), 500 km search radius v <- dVoCC(clim, n = 1, tdiff = 40, method = \"Single\", climTol = 0.1, geoTol = 500, distfun = \"GreatCircle\", trans = NA, lonlat = TRUE) # Change sign as needed and create the distance-based velocity raster # Change sign as needed - terra approach for value comparison focal_vals <- terra::values(r2[[1]])[v$focal] target_vals <- terra::values(r2[[2]])[v$target] ind <- which(focal_vals > target_vals) v$velBis <- v$vel v$velBis[ind] <- v$vel[ind] * -1 # put output in raster format - create single layer empty template like raster(gv) dv <- terra::rast(terra::ext(gv), resolution = terra::res(gv), crs = terra::crs(gv)) dv[v$focal] <- v$velBis # Create point geometries and buffer them coords <- terra::vect(cbind(marshift$long, marshift$lat), crs = \"EPSG:4326\") buffer_size <- marshift$Shift * (marshift$timespan / 10) * 1000 # Get the mean velocity within the buffer for each data point. # Match old raster::extract approach exactly marshift$GV <- terra::extract(abs(gv[[1]]), coords, buffer = buffer_size, fun = mean, na.rm = TRUE, weights = TRUE, exact = FALSE)[,2] marshift$DV <- terra::extract(abs(dv), coords, buffer = buffer_size, fun = mean, na.rm = TRUE, weights = TRUE, exact = FALSE)[,2] # For points that didn't get values (NA), find nearest valid cells missing_points <- coords[is.na(marshift$GV)] # Identify NAs if(!is.empty(missing_points)){ marine_cells <- terra::as.points(gv[[1]]) # vector of all valid marine cell locations. nearest_indices <- terra::nearest(missing_points, marine_cells) # Find the nearest marine cell nearest_values <- terra::extract(gv[[1]], marine_cells[nearest_indices]) # get the values from the nearest marine cells. marshift$GV[is.na(marshift$GV)] <- nearest_values[, 2] # Replace the NA values in `marshift$GV` } missing_points <- coords[is.na(marshift$DV)] # Identify NAs if(!is.empty(missing_points)){ marine_cells <- terra::as.points(dv[[1]]) # vector of all valid marine cell locations. nearest_cells <- terra::nearest(missing_points, marine_cells) # Find the nearest marine cell nearest_values <- terra::extract(dv[[1]], nearest_cells) # get the values from the nearest marine cells. marshift$DV[is.na(marshift$DV)] <- nearest_values[, 2] # Replace the NA values in `marshift$GV` } # fit the regression models Mgv <- lm(Shift^(1 / 4) ~ I((GV * 10)^(1 / 4)), data = marshift, weights = years_data) summary(Mgv) #> #> Call: #> lm(formula = Shift^(1/4) ~ I((GV * 10)^(1/4)), data = marshift, #> weights = years_data) #> #> Weighted Residuals: #> Min 1Q Median 3Q Max #> -8.7627 -2.3540 -0.5463 1.5966 14.8297 #> #> Coefficients: #> Estimate Std. Error t value Pr(>|t|) #> (Intercept) 1.20025 0.23469 5.114 5.28e-07 *** #> I((GV * 10)^(1/4)) 0.50348 0.09599 5.245 2.75e-07 *** #> --- #> Signif. codes: 0 '***' 0.001 '**' 0.01 '*' 0.05 '.' 0.1 ' ' 1 #> #> Residual standard error: 3.865 on 340 degrees of freedom #> (1 observation deleted due to missingness) #> Multiple R-squared: 0.07486, Adjusted R-squared: 0.07214 #> F-statistic: 27.51 on 1 and 340 DF, p-value: 2.75e-07 Mdv <- lm(Shift^(1 / 4) ~ I((DV * 10)^(1 / 4)), data = marshift, weights = years_data) summary(Mdv) #> #> Call: #> lm(formula = Shift^(1/4) ~ I((DV * 10)^(1/4)), data = marshift, #> weights = years_data) #> #> Weighted Residuals: #> Min 1Q Median 3Q Max #> -9.1097 -2.3602 -0.7524 1.6379 15.2653 #> #> Coefficients: #> Estimate Std. Error t value Pr(>|t|) #> (Intercept) 0.8565 0.3371 2.541 0.0115 * #> I((DV * 10)^(1/4)) 0.6192 0.1335 4.636 5.07e-06 *** #> --- #> Signif. codes: 0 '***' 0.001 '**' 0.01 '*' 0.05 '.' 0.1 ' ' 1 #> #> Residual standard error: 3.904 on 338 degrees of freedom #> (3 observations deleted due to missingness) #> Multiple R-squared: 0.05979, Adjusted R-squared: 0.05701 #> F-statistic: 21.5 on 1 and 338 DF, p-value: 5.074e-06 # first compare both velocities p1 <- ggplot() + geom_spatraster(data = gv[[1]]) + scale_fill_distiller(palette = \"RdBu\", direction = -1, limits = c(-50, 50)) + ggtitle(\"Gradient-based vocc\") + scale_x_continuous(expand = c(0,0)) + scale_y_continuous(expand = c(0,0)) p2 <- ggplot() + geom_spatraster(data = dv[[1]]) + scale_fill_distiller(palette = \"RdBu\", direction = -1, limits = c(-20, 20)) + ggtitle(\"Distance-based vocc\") + scale_x_continuous(expand = c(0,0)) + scale_y_continuous(expand = c(0,0)) wrap_plots(p1, p2, ncol = 1) # scatter plots with the resulting regression line p1 <- ggplot(na.omit(marshift), aes(x = (GV * 10)^(1 / 4), y = Shift^(1 / 4))) + geom_point(color = \"grey\") + geom_smooth(method = lm, se = FALSE) + theme_classic() + scale_color_brewer(palette = \"Accent\") + labs(x = \"Predicted shift (x^1/4; km/yr)\", y = \"Observed shift (y^1/4; km/yr)\") p2 <- ggplot(na.omit(marshift), aes(x = (DV * 10)^(1 / 4), y = Shift^(1 / 4))) + geom_point(color = \"grey\") + geom_smooth(method = lm, se = FALSE) + theme_classic() + scale_color_brewer(palette = \"Accent\") + labs(x = \"Predicted shift (x^1/4; km/yr)\", y = \"Observed shift (y^1/4; km/yr)\") wrap_plots(p1, p2, nrow = 1) #> `geom_smooth()` using formula = 'y ~ x' #> `geom_smooth()` using formula = 'y ~ x' #> Warning: Removed 2 rows containing non-finite outside the scale range #> (`stat_smooth()`). #> Warning: Removed 2 rows containing missing values or values outside the scale range #> (`geom_point()`)."},{"path":"/articles/VoCC.html","id":"example-2-analysis-of-climate-exposure-and-connectivity-in-the-western-pacific-ocean","dir":"Articles","previous_headings":"","what":"Example 2: Analysis of climate exposure and connectivity in the Western Pacific Ocean","title":"VoCC","text":"example use climate velocity trajectories (based 1960-2009 mean annual SST) analyse climate connectivity Western Pacific region calculate residence time corresponding exclusive economic zones region index climatic exposure. First, arrange raster layers analysis. can now populate data frame cell centroid coordinates trajectories. Let’s calculate trajectories parallel processing demonstrate can used speed things (especially useful dealing fine resolutions large extents). Plot climate velocities EEZ polygons EEZs data set (Fig. 3a Garcia Molinos et al. 2019) now calculate trajectory classes residence times EEZ using traj25 data set. Finally let’s plot category proportions pie charts top EEZ, size chart proportional respective residence time (Fig. 3b Garcia Molinos et al. 2019).","code":"# prepare raster layers vel <- gv[[1]] ang <- gv[[2]] mn <- app(r, mean, na.rm = T) # generate a velocity layer centered and cropped to study region to extract the initial coordinates for the trajectories from x1 <- crop(gv[[1]], ext(-180, 0, -90, 90)) x2 <- crop(gv[[1]], ext(0, 180, -90, 90)) ext(x1) <- c(180, 360, -90, 90) velc <- merge(x1, x2) # crop to the desired extent # display restricted to +180 longitude to avoid plotting issues with date line crossing velc <- crop(velc, c(90, 180, -32, 33)) lonlat <- data.frame(terra::xyFromCell(velc, 1:ncell(velc))) lonlat$vel <- terra::extract(vel, lonlat, ID = FALSE) lonlat$ang <- terra::extract(ang, lonlat[, 1:2], ID = FALSE) lonlat$mn <- terra::extract(mn, lonlat[, 1:2], ID = FALSE) lonlat$lineID <- 1:nrow(lonlat) lonlat <- drop_na(lonlat) traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50, tstep = 1/12) # create the spatial object with the trajectories and plot them together with the EEZ polygons lns <- map(traj %>% group_split(cellIDs), trajLine) %>% purrr::list_rbind() %>% sf::st_sf() # Load and simplify polygons to speed plotting up EEZs <- sf::st_read(system.file(\"extdata\", \"EEZs.gpkg\", package = \"VoCCdata\")) %>% sf::st_break_antimeridian() %>% sf::st_simplify(preserveTopology = TRUE, dTolerance = 500) %>% sf::st_crop(xmin = 75, xmax = 180, ymin = -35, ymax = 35) #> Reading layer `EEZs' from data source #> `/Library/Frameworks/R.framework/Versions/4.5-arm64/Resources/library/VoCCdata/extdata/EEZs.gpkg' #> using driver `GPKG' #> Simple feature collection with 35 features and 22 fields #> Geometry type: MULTIPOLYGON #> Dimension: XY #> Bounding box: xmin: -179.9999 ymin: -31.24447 xmax: 179.9999 ymax: 31.79787 #> Geodetic CRS: +proj=longlat +datum=WGS84 +no_defs ggplot() + geom_spatraster(data = velc, aes(fill = voccMag)) + scale_fill_viridis_c(option = \"inferno\", name = \"Velocity\") + geom_sf(data = lns %>% sf::st_shift_longitude(), colour = \"grey70\", linewidth = 0.1) + geom_sf(data = EEZs %>% sf::st_shift_longitude(), colour = \"white\", fill = NA, linewidth = 0.3) + scale_x_continuous(expand = c(0, 0)) + scale_y_continuous(expand = c(0, 0)) # classify trajectories (16 trajectories starting from each 1-deg cell cell) clas <- trajClas(traj25, vel, ang, mn, trajSt = 16, tyr = 50, nmL = 20, smL = 100, Nend = 45, Nst = 15, NFT = 70) #> Warning: [readValues] raster has no values # Extract proportions by categories for each EEZ v <- data.table(terra::extract(clas[[7]], EEZs, df = TRUE)) v[, TrajClas := as.character(TrajClas)] v[, ID := as.ordered(ID)] # proportions by class d <- prop.table(table(v), 1) # residence times by EEZ EEZa <- resTime(EEZs, vel, areapg = NA) D <- data.table(d) # put data in long format D[, name := as.character(EEZs$Territory1)[as.numeric(ID)]] # add EEZ names for reference D[, RT := as.character(EEZa$resTim)[as.numeric(ID)]] # prepare data frame to plot the pie charts with dt <- as.data.frame.matrix(d) dt$country <- as.character(EEZs$Territory1) coords <- sf::st_coordinates(sf::st_centroid(EEZs)) dt[, c(\"x\", \"y\")] <- coords[, c(\"X\", \"Y\")] dt$RT <- EEZa$resTim # # generate the plot plot(velc) plot(eez_simp, add = TRUE) mycol <- c(scales::alpha(rgb(192, 192, 192, maxColorValue = 255), 0.5), scales::alpha(rgb(204, 255, 204, maxColorValue = 255), 0.5), scales::alpha(rgb(255, 153, 51, maxColorValue = 255), 0.5), scales::alpha(rgb(255, 51, 51, maxColorValue = 255), 0.5), scales::alpha(rgb(51, 51, 255, maxColorValue = 255), 0.5), scales::alpha(rgb(204, 102, 0, maxColorValue = 255), 0.5), scales::alpha(rgb(204, 0, 204, maxColorValue = 255), 0.5), scales::alpha(rgb(255, 255, 51, maxColorValue = 255), 0.5), scales::alpha(rgb(153, 204, 255, maxColorValue = 255), 0.5)) # mylab = c(\"Non-moving\", \"Slow-moving\", \"Internal Sink\", \"Boundary sink\", # \"Source\", \"Internal sink\",\"Corridor\", \"Divergence\", \"Convergence\") for (i in 1:35) { add.pie(z = as.numeric(dt[i, 1:5]), x = dt[i, \"x\"], y = dt[i, \"y\"], radius = log(dt[i, \"RT\"]), col = mycol, labels = \"\") }"},{"path":"/articles/VoCC.html","id":"references","dir":"Articles","previous_headings":"","what":"References","title":"VoCC","text":"García Molinos, J., Schoeman, D. S., Brown, C. J. Burrows, M. T. (2019), VoCC: R package calculating velocity climate change related climatic metrics. Methods Ecol Evol. doi:10.1111/2041-210X.13295","code":""},{"path":"/authors.html","id":null,"dir":"","previous_headings":"","what":"Authors","title":"Authors and Citation","text":"Jorge Garcia Molinos. Author, maintainer. David S. Schoeman. Author. Christopher J. Brown. Author. Michael T. Burrows. Author. Naoki H. Kumagai. Contributor.","code":""},{"path":"/authors.html","id":"citation","dir":"","previous_headings":"","what":"Citation","title":"Authors and Citation","text":"Garcia Molinos J, S. Schoeman D, J. Brown C, T. Burrows M (2025). VoCC: Velocity Climate Change related climatic metrics. R package version 0.0.1, https://mathmarecol.github.io/VoCC/.","code":"@Manual{, title = {VoCC: The Velocity of Climate Change and related climatic metrics}, author = {Jorge {Garcia Molinos} and David {S. Schoeman} and Christopher {J. Brown} and Michael {T. Burrows}}, year = {2025}, note = {R package version 0.0.1}, url = {https://mathmarecol.github.io/VoCC/}, }"},{"path":"/index.html","id":"vocc-the-velocity-of-climate-change-and-related-climatic-metrics","dir":"","previous_headings":"","what":"The Velocity of Climate Change and related climatic metrics","title":"The Velocity of Climate Change and related climatic metrics","text":"Jorge Garcia Molinos et al. 18 July 2019 package now release version (v 1.0.0). Please contact questions feed-back.","code":""},{"path":"/index.html","id":"installation","dir":"","previous_headings":"","what":"Installation","title":"The Velocity of Climate Change and related climatic metrics","text":"can install development version VoCC GitHub :","code":"# install.packages(\"devtools\") devtools::install_github(\"JorGarMol/VoCC\")"},{"path":[]},{"path":"/index.html","id":"citation","dir":"","previous_headings":"","what":"Citation","title":"The Velocity of Climate Change and related climatic metrics","text":"cite package please use: García Molinos, J., Schoeman, D. S., Brown, C. J. Burrows, M. T. (2019). VoCC: Velocity Climate Change related climatic metrics. R package version 1.0.0. https://doi.org/10.5281/zenodo.3382092 following paper explains package functionality provides examples covered code package vignette García Molinos, J., Schoeman, D. S., Brown, C. J. Burrows, M. T. (2019), VoCC: R package calculating velocity climate change related climatic metrics. Methods Ecol Evol. doi:10.1111/2041-210X.13295","code":""},{"path":"/reference/EEZ.html","id":null,"dir":"Reference","previous_headings":"","what":"Icelandic Exclusive Economic Zone (EEZ) — EEZ","title":"Icelandic Exclusive Economic Zone (EEZ) — EEZ","text":"Icelandic Exclusive Economic Zone (v10).","code":""},{"path":"/reference/EEZ.html","id":"format","dir":"Reference","previous_headings":"","what":"Format","title":"Icelandic Exclusive Economic Zone (EEZ) — EEZ","text":"spatial polygon data frame containing Icenalndic EEZ (200 NM).","code":""},{"path":"/reference/EEZ.html","id":"source","dir":"Reference","previous_headings":"","what":"Source","title":"Icelandic Exclusive Economic Zone (EEZ) — EEZ","text":"Marineregions.org http://www.marineregions.org/downloads.php","code":""},{"path":"/reference/HSST.html","id":null,"dir":"Reference","previous_headings":"","what":"Monthly mean sea surface temperatures (SST) around Iceland for 1955-2010 — HSST","title":"Monthly mean sea surface temperatures (SST) around Iceland for 1955-2010 — HSST","text":"Monthly mean sea surface temperatures (SST) around Iceland 1955-2010","code":""},{"path":"/reference/HSST.html","id":"format","dir":"Reference","previous_headings":"","what":"Format","title":"Monthly mean sea surface temperatures (SST) around Iceland for 1955-2010 — HSST","text":"raster stack 672 layers containing mean monthly SSTs (C) 1-deg resolution period Jan 1955 Dec 2010 Atlantic waters surrounding Iceland.","code":""},{"path":"/reference/HSST.html","id":"source","dir":"Reference","previous_headings":"","what":"Source","title":"Monthly mean sea surface temperatures (SST) around Iceland for 1955-2010 — HSST","text":"Hadley Centre data set HadISST 1.1 (data accessed May 2018).","code":""},{"path":"/reference/HSST.html","id":"references","dir":"Reference","previous_headings":"","what":"References","title":"Monthly mean sea surface temperatures (SST) around Iceland for 1955-2010 — HSST","text":"Rayner et al. 2003. Global analyses sea surface temperature, sea ice, night marine air temperature since late nineteenth century. J. Geophys. Res.Vol. 108: 4407.","code":""},{"path":"/reference/JapTC.html","id":null,"dir":"Reference","previous_headings":"","what":"Multivariate Terraclimate data for Japan — JapTC","title":"Multivariate Terraclimate data for Japan — JapTC","text":"Historical (1960-1969) present (2008-2017) multivariate 1/24 Terraclimate data set (Abatzoglou et al. 2018), extracted Japanese archipelago including 3 variables: mean annual monthly precipitation (mm), maximum minimum temperatures (C).","code":""},{"path":"/reference/JapTC.html","id":"format","dir":"Reference","previous_headings":"","what":"Format","title":"Multivariate Terraclimate data for Japan — JapTC","text":"raster stack 9 layers historical (1960-1969) current (2008-2017) average (AnMn) standard deviation (AnMnSD) mean annual (AnMn) precipitation (Ppr), maximum (Tmax) minimum (Tmin) temperature.","code":""},{"path":"/reference/JapTC.html","id":"source","dir":"Reference","previous_headings":"","what":"Source","title":"Multivariate Terraclimate data for Japan — JapTC","text":"Terraclimate data set.","code":""},{"path":"/reference/JapTC.html","id":"references","dir":"Reference","previous_headings":"","what":"References","title":"Multivariate Terraclimate data for Japan — JapTC","text":"Abatzoglou et al. 2018. Terraclimate, high-resolution global dataset monthly climate climatic water balance 1958-2015, Scientific Data, 5: 170191","code":""},{"path":"/reference/angulo.html","id":null,"dir":"Reference","previous_headings":"","what":"Internal. Angle associated to the spatial gradient — angulo","title":"Internal. Angle associated to the spatial gradient — angulo","text":"Internal. Angle associated spatial gradient","code":""},{"path":"/reference/angulo.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Internal. Angle associated to the spatial gradient — angulo","text":"","code":"angulo(dx, dy)"},{"path":"/reference/angulo.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Internal. Angle associated to the spatial gradient — angulo","text":"dx numeric giving longitudinal gradient component dy numeric giving latitudinal gradient component","code":""},{"path":"/reference/angulo.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Internal. Angle associated to the spatial gradient — angulo","text":"Jorge Garcia Molinos David S. Schoeman angulo()","code":""},{"path":"/reference/climPCA.html","id":null,"dir":"Reference","previous_headings":"","what":"Reduce dimensionality of climate predictors via Principal Component Analysis — climPCA","title":"Reduce dimensionality of climate predictors via Principal Component Analysis — climPCA","text":"Function extract first n principal components explaining predefined total amount variance among climatic variables. components can subsequently used synthetic climatic variables reduce dimensionality climate-analogue methods.","code":""},{"path":"/reference/climPCA.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Reduce dimensionality of climate predictors via Principal Component Analysis — climPCA","text":"","code":"climPCA( climp, climf, trans = function(x) log(x), cen = TRUE, sc = TRUE, th = 0.8 )"},{"path":"/reference/climPCA.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Reduce dimensionality of climate predictors via Principal Component Analysis — climPCA","text":"climp raster.stack one layer climatic variable values present baseline conditions. climf raster.stack one layer climatic variable values future conditions. trans function specifying type transformation applied prior PCA. Specify NA transformation required (default log(x)). cen logical variables centered prior PCA? (default TRUE). sc logical variables scaled prior PCA? (default TRUE). th numeric threshold giving minimum amount total variance explained principal components extracted.","code":""},{"path":"/reference/climPCA.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Reduce dimensionality of climate predictors via Principal Component Analysis — climPCA","text":"list containing () output PCA (call 'prcomp'), (ii) table present/future cell values principal components accounting specified percentage total variance (th).","code":""},{"path":[]},{"path":"/reference/climPCA.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Reduce dimensionality of climate predictors via Principal Component Analysis — climPCA","text":"Jorge Garcia Molinos","code":""},{"path":"/reference/climPCA.html","id":"ref-examples","dir":"Reference","previous_headings":"","what":"Examples","title":"Reduce dimensionality of climate predictors via Principal Component Analysis — climPCA","text":"","code":"if (FALSE) { # \\dontrun{ JapTC <- VoCC_get_data(\"JapTC.tif\") comp <- climPCA(JapTC[[c(1, 3, 5)]], JapTC[[c(2, 4, 6)]], trans = NA, cen = TRUE, sc = TRUE, th = 0.85) summary(comp[[1]]) # first two components explain >90% of variance # Create a data frame with the necessary variables in the required order (see climAna? for details) clim <- comp[[2]][, c(2, 4, 3, 5, 1)] clim[, c(\"x\", \"y\")] <- terra::xyFromCell(JapTC[[1]], clim$cid) } # }"},{"path":"/reference/climPlot.html","id":null,"dir":"Reference","previous_headings":"","what":"Binned scatter plot for 2-dimensional climate space — climPlot","title":"Binned scatter plot for 2-dimensional climate space — climPlot","text":"Function create binned scatter plot two climate variables.","code":""},{"path":"/reference/climPlot.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Binned scatter plot for 2-dimensional climate space — climPlot","text":"","code":"climPlot(xy, x.binSize, y.binSize, x.name = \"V1\", y.name = \"V2\")"},{"path":"/reference/climPlot.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Binned scatter plot for 2-dimensional climate space — climPlot","text":"xy data.frame cells rows 4 columns representing present future local values two variables (V1p, V1f, V2p, V2f). x.binSize numeric bin size first variable. y.binSize numeric bin size second variable. x.name character variable name first variable. Used label plot. y.name character variable name second variable. Used label plot.","code":""},{"path":"/reference/climPlot.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Binned scatter plot for 2-dimensional climate space — climPlot","text":"series plot objects displaying () present (ii) future cell frequency combination local climates, (iii) location remnant, novel disappearing climates periods.","code":""},{"path":[]},{"path":"/reference/climPlot.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Binned scatter plot for 2-dimensional climate space — climPlot","text":"Jorge Garcia Molinos Naoki H. Kumagai","code":""},{"path":"/reference/climPlot.html","id":"ref-examples","dir":"Reference","previous_headings":"","what":"Examples","title":"Binned scatter plot for 2-dimensional climate space — climPlot","text":"","code":"if (FALSE) { # \\dontrun{ JapTC <- VoCC_get_data(\"JapTC.tif\") # Plot climate space for the two first variables(annual precipitation and maximum temperature) xy <- stats::na.omit(data.frame( terra::values(JapTC[[1]]), terra::values(JapTC[[2]]), terra::values(JapTC[[3]]), terra::values(JapTC[[4]]) )) out <- climPlot(xy, x.binSize = 5, y.binSize = 0.2, x.name = \"Precipitation (mm)\", y.name = \"Temperature max (°C)\" ) # output plots can be saved as: ggplot2::ggsave( plot = out, filename = file.path(getwd(), \"example_plot.pdf\"), width = 17, height = 17, unit = \"cm\" ) } # }"},{"path":"/reference/dVoCC.html","id":null,"dir":"Reference","previous_headings":"","what":"Distance-based velocity based on geographically closest climate analogue — dVoCC","title":"Distance-based velocity based on geographically closest climate analogue — dVoCC","text":"Function calculate geographically closest climate analogues related distance-based velocity. Cell analogues identified comparing baseline climatic conditions focal cell existing (target) cells future reference specified climatic threshold. function allows specification search distances incorporates least-cost path Great Circle (--crow-flies) distances.","code":""},{"path":"/reference/dVoCC.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Distance-based velocity based on geographically closest climate analogue — dVoCC","text":"","code":"dVoCC( clim, n, tdiff, method = \"Single\", climTol, geoTol, distfun = \"GreatCircle\", trans = NA, lonlat = TRUE )"},{"path":"/reference/dVoCC.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Distance-based velocity based on geographically closest climate analogue — dVoCC","text":"clim data.frame value climatic parameters (columns) cell (rows), arranged follows (see examples ): first 2n columns must contain present future values n climatic variables (V1p, V1f, V2p, V2f,...). cell-specific analogue thresholds (see \"variable\" \"method\" ) calculated, next (2n+1:3n) columns contain standard deviation (measure climatic variability) variable baseline period. columns required using \"Single\" method. last three columns table contain identifyier centroid coordinates cell. n integer defining number climatic variables. tdiff integer defining number years (temporal unit) periods. method character string specifying analogue method used. 'Single': constant, single analogue threshold climate variable applied cells (Ohlemuller et al. 2006, Hamann et al. 2015); climate analogy corresponds target cells values specified threshold climatic variable. 'Variable': cell-specific climate threshold used climatic variable determine climate analogues associated cell reference baseline climatic variability (Garcia Molinos et al. 2017). climTol numeric vector length n giving tolerance threshold defining climate analogue conditions climatic variable. cell-specific threshold used, function parameter passed NA. geoTol integer impose geographical distance threshold (km lat/lon map units projected). used, pool potential climate analogues limited cells within distance focal cell. distfun character string specifying function used estimating distances focal target cells. Either 'Euclidean', 'GreatCircle' (Great Circle Distances). 'LeastCost' (Least Cost Path Distances) CURRENTLY IMPLEMENTED. LeastCost requires transition matrix supplied function via de 'trans' argument. trans TransitionLayer CURRENTLY IMPLEMENTED gdistance object used analogue search distfun = 'LeastCost'. lonlat logical analysis done unprojected (lon/lat) coordinates?","code":""},{"path":"/reference/dVoCC.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Distance-based velocity based on geographically closest climate analogue — dVoCC","text":"data.frame containing cell id future analogue focal cell (NA = analogue available), together climatic (\"climDis\") geographical (\"geoDis\") distances input units, bearing (\"ang\", degrees North), resulting climate velocity (\"vel\", km/yr). Mean climatic distances returned multivariate analogues.","code":""},{"path":"/reference/dVoCC.html","id":"references","dir":"Reference","previous_headings":"","what":"References","title":"Distance-based velocity based on geographically closest climate analogue — dVoCC","text":"Ohlemuller et al. 2006. Towards European climate risk surfaces: extent distribution analogous non-analogous climates 1931-2100. Global Ecology Biogeography, 15, 395-405. Hamann et al. 2015. Velocity climate change algorithms guiding conservation management. Global Change Biology, 21, 997-1004. Garcia Molinos et al. 2017. Improving interpretability climate landscape metrics: ecological risk analysis Japan's Marine Protected Areas. Global Change Biology, 23, 4440-4452.","code":""},{"path":[]},{"path":"/reference/dVoCC.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Distance-based velocity based on geographically closest climate analogue — dVoCC","text":"Jorge Garcia Molinos","code":""},{"path":"/reference/dVoCC.html","id":"ref-examples","dir":"Reference","previous_headings":"","what":"Examples","title":"Distance-based velocity based on geographically closest climate analogue — dVoCC","text":"","code":"if (FALSE) { # \\dontrun{ JapTC <- VoCC_get_data(\"JapTC.tif\") # Create a data frame with the necessary variables in the required order clim <- stats::na.omit(data.frame(terra::values(JapTC), cid = 1:terra::ncell(JapTC))) clim[, c(\"x\", \"y\")] <- terra::xyFromCell(JapTC, clim$cid) # Constant threshold, distance-restricted velocity based on geographical distances avocc1 <- dVoCC(clim, n = 3, tdiff = 40, method = \"Single\", climTol = c(10, 0.1, 0.1), geoTol = 160, distfun = \"GreatCircle\", trans = NA, lonlat = TRUE ) r1 <- JapTC[[1]] r1[avocc1$focal] <- avocc1$vel terra::plot(r1) # Cell-specific, distance-unrestricted climate analogue velocity based on least-cost path distances # First, create the conductance matrix (all land cells considered to have conductance of 1) r <- JapTC[[1]] r[!is.na(JapTC[[1]])] <- 1 h8 <- gdistance::transition(r, transitionFunction = mean, directions = 8) h8 <- gdistance::geoCorrection(h8, type = \"c\") # Now calculate the analogue velocity using the baseline SD for each variable as analogue threshold avocc2 <- dVoCC(clim, n = 3, tdiff = 40, method = \"Variable\", climTol = NA, geoTol = Inf, distfun = \"LeastCost\", trans = h8, lonlat = TRUE ) # Plot results r1 <- r2 <- JapTC[[1]] r1[avocc1$focal] <- avocc1$vel r2[avocc2$focal] <- avocc2$vel terra::plot(c(r1, r2)) } # }"},{"path":"/reference/gVoCC.html","id":null,"dir":"Reference","previous_headings":"","what":"Gradient-based climate velocity — gVoCC","title":"Gradient-based climate velocity — gVoCC","text":"Function calculate velocity climate change Burrows et al. (2011) based local climatic temporal trends spatial gradients.","code":""},{"path":"/reference/gVoCC.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Gradient-based climate velocity — gVoCC","text":"","code":"gVoCC(tempTrend, spatGrad)"},{"path":"/reference/gVoCC.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Gradient-based climate velocity — gVoCC","text":"tempTrend output tempTrend function containing long-term linear climatic trends. spatGrad output spatGrad function containing magnitudes angles spatial climatic gradient.","code":""},{"path":"/reference/gVoCC.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Gradient-based climate velocity — gVoCC","text":"RasterStack containing climate velocity magnitude (\"voccMag\", km/yr unprojected rasters spatial unit/year projected rasters) angle(\"voccAng\" degrees north: 0N, 90E, 180S 270W).","code":""},{"path":"/reference/gVoCC.html","id":"references","dir":"Reference","previous_headings":"","what":"References","title":"Gradient-based climate velocity — gVoCC","text":"Burrows et al. 2011. pace shifting climate marine terrestrial ecosystems. Science, 334, 652-655.","code":""},{"path":[]},{"path":"/reference/gVoCC.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Gradient-based climate velocity — gVoCC","text":"Jorge Garcia Molinos","code":""},{"path":"/reference/gVoCC.html","id":"ref-examples","dir":"Reference","previous_headings":"","what":"Examples","title":"Gradient-based climate velocity — gVoCC","text":"","code":"if (FALSE) { # \\dontrun{ HSST <- VoCC_get_data(\"HSST.tif\") yrSST <- sumSeries(HSST, p = \"1960-01/2009-12\", yr0 = \"1955-01-01\", l = terra::nlyr(HSST), fun = function(x) colMeans(x, na.rm = TRUE), freqin = \"months\", freqout = \"years\" ) tr <- tempTrend(yrSST, th = 10) sg <- spatGrad(yrSST, th = 0.0001, projected = FALSE) # Magnitude and angle of the climate velocity (km/yr) 1960-2009 v <- gVoCC(tr, sg) terra::plot(v) } # }"},{"path":"/reference/pipe.html","id":null,"dir":"Reference","previous_headings":"","what":"Pipe operator — %>%","title":"Pipe operator — %>%","text":"See magrittr::%>% details.","code":""},{"path":"/reference/pipe.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Pipe operator — %>%","text":"","code":"lhs %>% rhs"},{"path":"/reference/pipe.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Pipe operator — %>%","text":"lhs value magrittr placeholder. rhs function call using magrittr semantics.","code":""},{"path":"/reference/pipe.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Pipe operator — %>%","text":"result calling `rhs(lhs)`.","code":""},{"path":"/reference/resTime.html","id":null,"dir":"Reference","previous_headings":"","what":"Climatic residence time of a polygon — resTime","title":"Climatic residence time of a polygon — resTime","text":"Function calculate VoCC-based residence time isotherms within polygon Loaire et al. (2009)","code":""},{"path":"/reference/resTime.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Climatic residence time of a polygon — resTime","text":"","code":"resTime(pg, vel, areapg = NA)"},{"path":"/reference/resTime.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Climatic residence time of a polygon — resTime","text":"pg sf object terra::vect object containing polygons residence time calculated. polygons must coordinate system vel. vel raster climate velocity (km/year) period interest. areapg vector area (km2) polygons. Use NA (default) calculate internally field avilable.","code":""},{"path":"/reference/resTime.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Climatic residence time of a polygon — resTime","text":"data.frame containing polygon ID, mean velocity (km/yr), diameter equivalent circle (km), residence time (years) ratio D/vel.","code":""},{"path":"/reference/resTime.html","id":"references","dir":"Reference","previous_headings":"","what":"References","title":"Climatic residence time of a polygon — resTime","text":"Loarie et al. 2009. velocity climate change. Nature, 462, 1052-1055.","code":""},{"path":[]},{"path":"/reference/resTime.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Climatic residence time of a polygon — resTime","text":"Jorge Garcia Molinos","code":""},{"path":"/reference/resTime.html","id":"ref-examples","dir":"Reference","previous_headings":"","what":"Examples","title":"Climatic residence time of a polygon — resTime","text":"","code":"# Load example Exclusive Economic Zone polygon if (FALSE) { # \\dontrun{ EEZ <- VoCC_get_data(\"EEZ.gpkg\") HSST <- VoCC_get_data(\"HSST.tif\") yrSST <- sumSeries(HSST, p = \"1969-01/2009-12\", yr0 = \"1955-01-01\", l = terra::nlyr(HSST), fun = function(x) colMeans(x, na.rm = TRUE), freqin = \"months\", freqout = \"years\" ) tr <- tempTrend(yrSST, th = 10) sg <- spatGrad(yrSST, th = 0.0001, projected = FALSE) v <- gVoCC(tr, sg) vel <- v[[1]] # Calculating area internally a1 <- resTime(EEZ, vel, areapg = NA) a1 # Using the area field from the polygon data table a2 <- resTime(EEZ, vel, areapg = as.numeric(as.numeric(levels(EEZ$Area_km2))[EEZ$Area_km2])) a2 # Using a user defined polygon x_coord <- c(-28, -20, -20.3, -25.5) y_coord <- c(60, 61, 63, 62) coords <- matrix(c(x_coord, y_coord), ncol = 2) poly_sf <- sf::st_sf(geometry = sf::st_sfc(sf::st_polygon(list(coords)))) a3 <- resTime(poly_sf, vel, areapg = NA) terra::plot(vel) plot(sf::st_geometry(EEZ), add = TRUE) plot(sf::st_geometry(poly_sf), add = TRUE) } # }"},{"path":"/reference/shiftTime.html","id":null,"dir":"Reference","previous_headings":"","what":"Shift in timing of seasonal climatology — shiftTime","title":"Shift in timing of seasonal climatology — shiftTime","text":"Function calculate seasonal shift arriving typical seasonal climates given period interest per Burrows et al. (2011).","code":""},{"path":"/reference/shiftTime.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Shift in timing of seasonal climatology — shiftTime","text":"","code":"shiftTime(r, yr1, yr2, yr0, th, m)"},{"path":"/reference/shiftTime.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Shift in timing of seasonal climatology — shiftTime","text":"r stack monthly values climatic variable period interest. yr1 integer specifying initial year period interest. yr2 integer specifying end year period interest. yr0 integer specifying first year series. th integer minimum number non NAs series needed calculate trend (default 3). m integer number (1-12) month shift calculated","code":""},{"path":"/reference/shiftTime.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Shift in timing of seasonal climatology — shiftTime","text":"stack long-term monthly trend (C/year temperature degrees; \"mTrend\"), seasonal rate change (C/month; \"seaRate\"), seasonal shift (day/decade; \"seaShift\").","code":""},{"path":"/reference/shiftTime.html","id":"references","dir":"Reference","previous_headings":"","what":"References","title":"Shift in timing of seasonal climatology — shiftTime","text":"Burrows et al. 2011. pace shifting climate marine terrestrial ecosystems. Science, 334, 652-655.","code":""},{"path":"/reference/shiftTime.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Shift in timing of seasonal climatology — shiftTime","text":"Jorge Garcia Molinos Michael T. Burrows","code":""},{"path":"/reference/shiftTime.html","id":"ref-examples","dir":"Reference","previous_headings":"","what":"Examples","title":"Shift in timing of seasonal climatology — shiftTime","text":"","code":"if (FALSE) { # \\dontrun{ HSST <- VoCC_get_data(\"HSST.tif\") Apr <- shiftTime(HSST, yr1 = 1960, yr2 = 2009, yr0 = 1955, th = 10, m = 4) terra::plot(Apr) } # }"},{"path":"/reference/spatGrad.html","id":null,"dir":"Reference","previous_headings":"","what":"Local spatial climatic gradients — spatGrad","title":"Local spatial climatic gradients — spatGrad","text":"Function calculate magnitude direction spatial gradient associated climatic variable Burrows et al. (2011). trend used calculation gradient-based climate velocity using gVoCC.","code":""},{"path":"/reference/spatGrad.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Local spatial climatic gradients — spatGrad","text":"","code":"spatGrad(r, th = -Inf, projected = FALSE)"},{"path":"/reference/spatGrad.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Local spatial climatic gradients — spatGrad","text":"r RasterStack annual climatic values period interest. Alternatively, raster annual climatic values averaged period interest. th Integer indicating lower threshold truncate spatial gradient . Use -Inf (default) threshold required. projected Logical source raster projected coordinate system? FALSE (default) correction made account latitudinal distortion.","code":""},{"path":"/reference/spatGrad.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Local spatial climatic gradients — spatGrad","text":"RasterStack magnitude spatial gradient (Grad C per km unprojected rasters C per spatial unit projected rasters), associated angle (Ang degrees).","code":""},{"path":"/reference/spatGrad.html","id":"references","dir":"Reference","previous_headings":"","what":"References","title":"Local spatial climatic gradients — spatGrad","text":"Burrows et al. 2011. pace shifting climate marine terrestrial ecosystems. Science, 334, 652-655.","code":""},{"path":[]},{"path":"/reference/spatGrad.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Local spatial climatic gradients — spatGrad","text":"Jorge Garcia Molinos, David S. Schoeman, Michael T. Burrows","code":""},{"path":"/reference/spatGrad.html","id":"ref-examples","dir":"Reference","previous_headings":"","what":"Examples","title":"Local spatial climatic gradients — spatGrad","text":"","code":"if (FALSE) { # \\dontrun{ HSST <- VoCC_get_data(\"HSST.tif\") yrSST <- sumSeries(HSST, p = \"1969-01/2009-12\", yr0 = \"1955-01-01\", l = terra::nlyr(HSST), fun = function(x) colMeans(x, na.rm = TRUE), freqin = \"months\", freqout = \"years\" ) # Spatial gradient (magnitude and angle) for the average mean annual SST. sg <- spatGrad(yrSST, th = 0.0001, projected = FALSE) terra::plot(sg) } # }"},{"path":"/reference/splitLine.html","id":null,"dir":"Reference","previous_headings":"","what":"Internal. Split a line segment defined by points A-B into n parts — splitLine","title":"Internal. Split a line segment defined by points A-B into n parts — splitLine","text":"Internal. Split line segment defined points -B n parts","code":""},{"path":"/reference/splitLine.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Internal. Split a line segment defined by points A-B into n parts — splitLine","text":"","code":"splitLine(A, B, n)"},{"path":"/reference/splitLine.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Internal. Split a line segment defined by points A-B into n parts — splitLine","text":"numeric giving coordinates first point B numeric giving coordinates second point n numeric number segments divide distance points ","code":""},{"path":"/reference/splitLine.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Internal. Split a line segment defined by points A-B into n parts — splitLine","text":"Jorge Garcia Molinos","code":""},{"path":"/reference/sumSeries.html","id":null,"dir":"Reference","previous_headings":"","what":"Summarize climatic series to higher temporal resolution — sumSeries","title":"Summarize climatic series to higher temporal resolution — sumSeries","text":"Function convert climatic series (provided RasterStack) coarser time frequency series period interest. function transforms RasterStack xts time series object extract values period interest apply summary function. mainly wrapper apply. function family package xts (Ryan Ulrich 2017).","code":""},{"path":"/reference/sumSeries.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Summarize climatic series to higher temporal resolution — sumSeries","text":"","code":"sumSeries( r, p, yr0, l = terra::nlyr(r), fun = function(x) colMeans(x, na.rm = TRUE), freqin = \"months\", freqout = \"years\" )"},{"path":"/reference/sumSeries.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Summarize climatic series to higher temporal resolution — sumSeries","text":"r RasterStack containing time series climatic variable. p character string defining period extract calculation series (see examples). yr0 character string specifying first (yr0) year series (see examples). l integer length input time series. fun logical summary function computed. Summary functions need applied cell (columns) structure 'function(x) apply(x, 2, function(y))'. convenience, sumSeries imports colMaxs, colMins package ‘matrixStats’ (Bengtsson 2018) can called directly. freqin character string specifying original time frequency series. freqout character string specifying desired time frequency new series. Must one following: \"weeks\", \"months\", \"quarters\", \"years\", \"\". Argument \"\" allows user-defined functions applied 'xts' time series object period interest (see examples).","code":""},{"path":"/reference/sumSeries.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Summarize climatic series to higher temporal resolution — sumSeries","text":"RasterStack new series.","code":""},{"path":"/reference/sumSeries.html","id":"references","dir":"Reference","previous_headings":"","what":"References","title":"Summarize climatic series to higher temporal resolution — sumSeries","text":"Ray Ulrich. 2017. xts: eXtensible Time Series. R package version 0.10-1. Bengtsson 2018. matrixStats: Functions Apply Rows Columns Matrices (Vectors). R package version 0.53.1.","code":""},{"path":"/reference/sumSeries.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Summarize climatic series to higher temporal resolution — sumSeries","text":"Jorge Garcia Molinos","code":""},{"path":"/reference/sumSeries.html","id":"ref-examples","dir":"Reference","previous_headings":"","what":"Examples","title":"Summarize climatic series to higher temporal resolution — sumSeries","text":"","code":"if (FALSE) { # \\dontrun{ # Monthly mean SST (HadISST) data for Europe Jan-1950 to Dec-2010 HSST <- VoCC_get_data(\"HSST.tif\") # Calculate mean annual monthly SST yrSST <- sumSeries(HSST, p = \"1969-01/2009-12\", yr0 = \"1955-01-01\", l = terra::nlyr(HSST), fun = function(x) colMeans(x, na.rm = TRUE), freqin = \"months\", freqout = \"years\" ) # Extract Jul Aug mean SST each year (xts months are indexed from 0 to 11) myf <- function(x, m = c(7, 8)) { x[xts::.indexmon(x) %in% (m - 1)] } JlAugSST <- sumSeries(HSST, p = \"1969-01/2009-12\", yr0 = \"1950-01-01\", l = terra::nlyr(HSST), fun = myf, freqin = \"months\", freqout = \"other\" ) # Same but calculating the annual variance of the two months myf <- function(x, m = c(7, 8)) { x1 <- x[xts::.indexmon(x) %in% (m - 1)] xts::apply.yearly(x1, function(y) { apply(y, 2, function(y) { var(y, na.rm = TRUE) }) }) } meanJASST <- sumSeries(HSST, p = \"1969-01/2009-12\", yr0 = \"1950-01-01\", l = terra::nlyr(HSST), fun = myf, freqin = \"months\", freqout = \"other\" ) } # }"},{"path":"/reference/tempTrend.html","id":null,"dir":"Reference","previous_headings":"","what":"Long-term local climatic trends — tempTrend","title":"Long-term local climatic trends — tempTrend","text":"Function calculate temporal trend raster series climatic variable. trend used calculation gradient-based climate velocity using gVoCC.","code":""},{"path":"/reference/tempTrend.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Long-term local climatic trends — tempTrend","text":"","code":"tempTrend(r, th)"},{"path":"/reference/tempTrend.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Long-term local climatic trends — tempTrend","text":"r RasterStack containing time series (annual, seasonal, monthly...) values climatic variable period interest. th Integer minimum number observations series needed calculate trend cell.","code":""},{"path":"/reference/tempTrend.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Long-term local climatic trends — tempTrend","text":"RasterStack containing cell-specific temporal trends extracted simple linear regressions climatic variable time (\"slpTrends\" degree Celsius per year), together standard errors (\"seTrends\") statistical significance (\"sigTrends\").","code":""},{"path":[]},{"path":"/reference/tempTrend.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Long-term local climatic trends — tempTrend","text":"Jorge Garcia Molinos Christopher J. Brown","code":""},{"path":"/reference/tempTrend.html","id":"ref-examples","dir":"Reference","previous_headings":"","what":"Examples","title":"Long-term local climatic trends — tempTrend","text":"","code":"if (FALSE) { # \\dontrun{ HSST <- VoCC_get_data(\"HSST.tif\") yrSST <- sumSeries(HSST, p = \"1969-01/2009-12\", yr0 = \"1955-01-01\", l = terra::nlyr(HSST), fun = function(x) colMeans(x, na.rm = TRUE), freqin = \"months\", freqout = \"years\" ) # Mean annual SST trend (minimum threshold of 10 years of data), with SE and p-values. tr <- tempTrend(yrSST, th = 10) terra::plot(tr) } # }"},{"path":"/reference/trajClas.html","id":null,"dir":"Reference","previous_headings":"","what":"Climate velocity trajectory classification — trajClas","title":"Climate velocity trajectory classification — trajClas","text":"Function spatial classification cells based VoCC trajectories Burrows et al. (2014). function performs hierarchical sequential classification based length trajectories, geographical features, relative abundance trajectories ending , starting flowing cell. Essentially, cells first classified non-moving, slow-moving fast-moving relative distance trajectory cover projection period based local climate velocities. Two types climate sinks identified among fast-moving cells: () boundary (e.g., coastal) cells disconnected cooler (warmer) neighbouring cells locally warming (cooling) climate, (ii) locations endorheic spatial gradients velocity angles neighbouring cells converge towards central point intersection. Finally, remaining cells classified reference total number trajectories per cell based proportions number trajectories starting (Nst), ending (Nend), flowing (NFT) cell period. Based proportions, cells classified five classes: (1) climate sources, trajectories end cell (Nend = 0); (2) relative climate sinks, relative number trajectories ending cell high proportion starting trajectories low; (3) corridors cells high proportion trajectories passing ; (4) divergence (5) convergence cells identified remaining cells fewer/trajectories ended started cell, respectively.","code":""},{"path":"/reference/trajClas.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Climate velocity trajectory classification — trajClas","text":"","code":"trajClas( traj, vel, ang, mn, trajSt, tyr, nmL, smL, Nend, Nst, NFT, DateLine = FALSE )"},{"path":"/reference/trajClas.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Climate velocity trajectory classification — trajClas","text":"traj data.frame retuned voccTraj containing coordinates identification number trajectory. vel SpatRaster magnitude gradient-based climate velocity. ang SpatRaster velocity angles. mn SpatRaster mean climatic values study period. trajSt integer number trajectories starting cell spatial unit. tyr integer number years comprising projected period. nmL numeric upper threshold (distance units per vel object) trajectory considered traveled negligible distance study period (non-moving). smL numeric upper threshold trajectory considered traveled small distance study period (slow-moving). Nend numeric percentage trajectories ending used threshold classification. Nst numeric percentage trajectories starting used threshold classification. NFT numeric percentage trajectories flowing used threshold classification. DateLine logical raster extent cross international date line? (default \"FALSE\").","code":""},{"path":"/reference/trajClas.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Climate velocity trajectory classification — trajClas","text":"SpatRaster containing trajectory classification (\"TrajClas\"), well based trajectory length (\"ClassL\"; 1 non-moving, 2 slow-moving, 3 fast-moving cells), boundrary (\"BounS\") internal sinks (\"IntS\"), proportion trajectories ending(\"PropEnd\"), flowing (\"PropFT\") starting (\"PropSt\"). trajectory classes (\"TrajClas\") (1) non-moving, (2) slow-moving, (3) internal sinks, (4) boundary sinks, (5) sources, (6) relative sinks, (7) corridors, (8) divergence (9) convergence.","code":""},{"path":"/reference/trajClas.html","id":"references","dir":"Reference","previous_headings":"","what":"References","title":"Climate velocity trajectory classification — trajClas","text":"Burrows et al. 2014. Geographical limits species-range shifts suggested climate velocity. Nature, 507, 492-495.","code":""},{"path":[]},{"path":"/reference/trajClas.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Climate velocity trajectory classification — trajClas","text":"Jorge Garcia Molinos","code":""},{"path":"/reference/trajClas.html","id":"ref-examples","dir":"Reference","previous_headings":"","what":"Examples","title":"Climate velocity trajectory classification — trajClas","text":"","code":"if (FALSE) { # \\dontrun{ HSST <- VoCC_get_data(\"HSST.tif\") # input raster layers yrSST <- sumSeries(HSST, p = \"1960-01/2009-12\", yr0 = \"1955-01-01\", l = terra::nlyr(HSST), fun = function(x) colMeans(x, na.rm = TRUE), freqin = \"months\", freqout = \"years\" ) mn <- terra::mean(yrSST, na.rm = TRUE) tr <- tempTrend(yrSST, th = 10) sg <- spatGrad(yrSST, th = 0.0001, projected = FALSE) v <- gVoCC(tr, sg) vel <- v[[1]] ang <- v[[2]] # Get the set of starting cells for the trajectories and calculate trajectories # at 1/4-deg resolution (16 trajectories per 1-deg cell) mnd <- terra::disagg(mn, 4) veld <- terra::disagg(vel, 4) angd <- terra::disagg(ang, 4) lonlat <- stats::na.omit(data.frame( terra::xyFromCell(veld, 1:terra::ncell(veld)), terra::values(veld), terra::values(angd), terra::values(mnd) ))[, 1:2] traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50, correct = TRUE) # Generate the trajectory-based classification clas <- trajClas(traj, vel, ang, mn, trajSt = 16, tyr = 50, nmL = 20, smL = 100, Nend = 45, Nst = 15, NFT = 70, DateLine = FALSE ) # Define first the colour palette for the full set of categories my_col <- c( \"gainsboro\", \"darkseagreen1\", \"coral4\", \"firebrick2\", \"mediumblue\", \"darkorange1\", \"magenta1\", \"cadetblue1\", \"yellow1\" ) # Keep only the categories present in our raster my_col <- my_col[sort(unique(terra::values(clas[[7]])))] # Classify raster / build attribute table clasr <- terra::as.factor(clas[[7]]) rat_r <- data.frame(ID = sort(unique(terra::values(clas[[7]]))), trajcat = c(\"N-M\", \"S-M\", \"IS\", \"BS\", \"Srce\", \"RS\", \"Cor\", \"Div\", \"Con\")[sort(unique(terra::values(clas[[7]])))]) terra::cats(clasr) <- rat_r # Produce the plot using the rasterVis levelplot function rasterVis::levelplot(clasr, col.regions = my_col, xlab = NULL, ylab = NULL, scales = list(draw = FALSE) ) } # }"},{"path":"/reference/trajLine.html","id":null,"dir":"Reference","previous_headings":"","what":"Climate velocity trajectory spatial lines — trajLine","title":"Climate velocity trajectory spatial lines — trajLine","text":"Create spatial line data frame object trajectory points.","code":""},{"path":"/reference/trajLine.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Climate velocity trajectory spatial lines — trajLine","text":"","code":"trajLine(x, projx = \"EPSG:4326\")"},{"path":"/reference/trajLine.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Climate velocity trajectory spatial lines — trajLine","text":"x data.frame containing coordinates (x, y) constituent points identification number (trajIDs) trajectory returned VoCCTraj. projx CRS detailing coordinate reference system input data (default geographic CRS).","code":""},{"path":"/reference/trajLine.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Climate velocity trajectory spatial lines — trajLine","text":"SpatialLinesDataFrame one line per trajectory specified x. avoid artifacts, trajectories crossing date line need split two segments. trajectory one side date line composed single point, trajectory displayed (line object created). function assumes -180 180 longitudinal arrangement.","code":""},{"path":[]},{"path":"/reference/trajLine.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Climate velocity trajectory spatial lines — trajLine","text":"Jorge Garcia Molinos","code":""},{"path":"/reference/trajLine.html","id":"ref-examples","dir":"Reference","previous_headings":"","what":"Examples","title":"Climate velocity trajectory spatial lines — trajLine","text":"","code":"if (FALSE) { # \\dontrun{ HSST <- VoCC_get_data(\"HSST.tif\") yrSST <- sumSeries(HSST, p = \"1969-01/2009-12\", yr0 = \"1955-01-01\", l = terra::nlyr(HSST), fun = function(x) colMeans(x, na.rm = TRUE), freqin = \"months\", freqout = \"years\" ) tr <- tempTrend(yrSST, th = 10) sg <- spatGrad(yrSST, th = 0.0001, projected = FALSE) v <- gVoCC(tr, sg) vel <- v[[1]] ang <- v[[2]] # calculate the annual SST mean over the period mn <- terra::mean(yrSST, na.rm = TRUE) # get the set of starting cells for the trajectories lonlat <- stats::na.omit(data.frame( terra::xyFromCell(vel, 1:terra::ncell(vel)), vel[], ang[], mn[] ))[, 1:2] # Calculate trajectories. traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50, correct = TRUE) # create a spatial line data frame from traj lns <- trajLine(x = traj) terra::plot(mn) terra::plot(lns, add = TRUE) # Export as ESRI shape file terra::writeVector(lns, filename = \"velTraj\", filetype = \"ESRI Shapefile\") } # }"},{"path":"/reference/voccTraj.html","id":null,"dir":"Reference","previous_headings":"","what":"Climate velocity trajectories — voccTraj","title":"Climate velocity trajectories — voccTraj","text":"Function calculate vocc trajectories Burrows et al (2014). Trajectories calculated propagating climatic isopleths using magnitude direction local (cell) velocities. slightly modified version original Burrows et al. (2014) approach iterations trajectory based cumulative time traveled instead using fixed time steps.","code":""},{"path":"/reference/voccTraj.html","id":"ref-usage","dir":"Reference","previous_headings":"","what":"Usage","title":"Climate velocity trajectories — voccTraj","text":"","code":"voccTraj(lonlat, vel, ang, mn, tstep, tyr = 50)"},{"path":"/reference/voccTraj.html","id":"arguments","dir":"Reference","previous_headings":"","what":"Arguments","title":"Climate velocity trajectories — voccTraj","text":"lonlat data.frame longitude latitude (decimal degrees) points project. vel raster magnitude gradient-based climate velocity. ang raster velocity angles degrees. mn raster overall mean climatic value period interest. tyr integer temporal length period interest.","code":""},{"path":"/reference/voccTraj.html","id":"value","dir":"Reference","previous_headings":"","what":"Value","title":"Climate velocity trajectories — voccTraj","text":"data.frame containing coordinates (\"x\", \"y\") constituent points identification number (\"trajIDs\") trajectory.","code":""},{"path":"/reference/voccTraj.html","id":"references","dir":"Reference","previous_headings":"","what":"References","title":"Climate velocity trajectories — voccTraj","text":"Burrows et al. 2014. Geographical limits species-range shifts suggested climate velocity. Nature, 507, 492-495.","code":""},{"path":[]},{"path":"/reference/voccTraj.html","id":"author","dir":"Reference","previous_headings":"","what":"Author","title":"Climate velocity trajectories — voccTraj","text":"Jorge Garcia Molinos, David S. Schoeman Michael T. Burrows","code":""},{"path":"/reference/voccTraj.html","id":"ref-examples","dir":"Reference","previous_headings":"","what":"Examples","title":"Climate velocity trajectories — voccTraj","text":"","code":"if (FALSE) { # \\dontrun{ yrSST <- sumSeries(HSST, p = \"1960-01/2009-12\", yr0 = \"1955-01-01\", l = terra::nlyr(HSST), fun = function(x) colMeans(x, na.rm = TRUE), freqin = \"months\", freqout = \"years\" ) # Long-term local climatic trends tr <- tempTrend(yrSST, th = 10) # Local spatial climatic gradients sg <- spatGrad(yrSST, th = 0.0001, projected = FALSE) # Gradient-based climate velocity v <- gVoCC(tr, sg) vel <- v[[1]] ang <- v[[2]] # Calculate the annual SST mean over the period mn <- terra::mean(yrSST, na.rm = TRUE) # Get the set of starting cells for the trajectories lonlat <- stats::na.omit(data.frame( terra::xyFromCell(vel, 1:terra::ncell(vel)), vel[], ang[], mn[] ))[, 1:2] # Calculate trajectories # The following throws an error due to the trajectories moving beyond the raster extent traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50) # This accounts for the extent issue traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50, correct = TRUE) } # }"}]
diff --git a/docs/sitemap.xml b/docs/sitemap.xml
new file mode 100644
index 0000000..c8dc9b2
--- /dev/null
+++ b/docs/sitemap.xml
@@ -0,0 +1,28 @@
+
+/404.html
+/LICENSE.html
+/articles/VoCC.html
+/articles/index.html
+/authors.html
+/index.html
+/reference/EEZ.html
+/reference/HSST.html
+/reference/JapTC.html
+/reference/angulo.html
+/reference/climPCA.html
+/reference/climPlot.html
+/reference/dVoCC.html
+/reference/gVoCC.html
+/reference/index.html
+/reference/pipe.html
+/reference/resTime.html
+/reference/shiftTime.html
+/reference/spatGrad.html
+/reference/splitLine.html
+/reference/sumSeries.html
+/reference/tempTrend.html
+/reference/trajClas.html
+/reference/trajLine.html
+/reference/voccTraj.html
+
+
diff --git a/man/VoCC_get_data.Rd b/man/VoCC_get_data.Rd
deleted file mode 100644
index 805801c..0000000
--- a/man/VoCC_get_data.Rd
+++ /dev/null
@@ -1,24 +0,0 @@
-% Generated by roxygen2: do not edit by hand
-% Please edit documentation in R/utils.R
-\name{VoCC_get_data}
-\alias{VoCC_get_data}
-\title{Return data location and data if requested}
-\usage{
-VoCC_get_data(path = NULL)
-}
-\arguments{
-\item{path}{Filename of data if known.}
-}
-\value{
-The path as a character string, or a dataset
-}
-\description{
-Return data location and data if requested
-}
-\examples{
-
-VoCC_get_data()
-
-HSST <- VoCC_get_data(path = "HSST.tif")
-
-}
diff --git a/man/climPCA.Rd b/man/climPCA.Rd
index decba4a..a90d99e 100644
--- a/man/climPCA.Rd
+++ b/man/climPCA.Rd
@@ -37,7 +37,7 @@ Function to extract the first n principal components explaining a predefined tot
These components can subsequently be used as synthetic climatic variables to reduce dimensionality in climate-analogue methods.
}
\examples{
-
+\dontrun{
JapTC <- VoCC_get_data("JapTC.tif")
comp <- climPCA(JapTC[[c(1, 3, 5)]], JapTC[[c(2, 4, 6)]],
@@ -46,6 +46,8 @@ summary(comp[[1]]) # first two components explain >90\% of variance
# Create a data frame with the necessary variables in the required order (see climAna? for details)
clim <- comp[[2]][, c(2, 4, 3, 5, 1)]
clim[, c("x", "y")] <- terra::xyFromCell(JapTC[[1]], clim$cid)
+}
+
}
\seealso{
{\code{\link{dVoCC}}, \code{\link{climPlot}}}
diff --git a/man/climPlot.Rd b/man/climPlot.Rd
index 2f19aa1..e0d6e40 100644
--- a/man/climPlot.Rd
+++ b/man/climPlot.Rd
@@ -26,7 +26,7 @@ and (iii) the location of remnant, novel and disappearing climates between both
Function to create a binned scatter plot of two climate variables.
}
\examples{
-
+\dontrun{
JapTC <- VoCC_get_data("JapTC.tif")
# Plot climate space for the two first variables(annual precipitation and maximum temperature)
@@ -41,7 +41,6 @@ out <- climPlot(xy,
y.name = "Temperature max (°C)"
)
-\dontrun{
# output plots can be saved as:
ggplot2::ggsave(
plot = out, filename = file.path(getwd(), "example_plot.pdf"),
diff --git a/man/dVoCC.Rd b/man/dVoCC.Rd
index fcbece5..4e805fe 100644
--- a/man/dVoCC.Rd
+++ b/man/dVoCC.Rd
@@ -27,7 +27,7 @@ These columns are not required if using the "Single" method. The last three colu
\item{tdiff}{\code{integer} defining the number of years (or other temporal unit) between periods.}
-\item{method}{\code{ch)aracter string} specifying the analogue method to be used. 'Single': a constant, single analogue threshold
+\item{method}{\code{character string} specifying the analogue method to be used. 'Single': a constant, single analogue threshold
for each climate variable is applied to all cells (Ohlemuller et al. 2006, Hamann et al. 2015); climate analogy corresponds to target cells
with values below the specified threshold for each climatic variable. 'Variable': a cell-specific climate threshold is used for each climatic variable
to determine the climate analogues associated with each cell by reference to its baseline climatic variability (Garcia Molinos et al. 2017).}
@@ -58,6 +58,7 @@ other (target) cells in the future by reference to a specified climatic threshol
specification of search distances and incorporates both least-cost path and Great Circle (as-the-crow-flies) distances.
}
\examples{
+\dontrun{
JapTC <- VoCC_get_data("JapTC.tif")
# Create a data frame with the necessary variables in the required order
@@ -70,15 +71,13 @@ avocc1 <- dVoCC(clim,
geoTol = 160, distfun = "GreatCircle", trans = NA, lonlat = TRUE
)
-r1 <- JapTC
+r1 <- JapTC[[1]]
r1[avocc1$focal] <- avocc1$vel
terra::plot(r1)
-\dontrun{
-
# Cell-specific, distance-unrestricted climate analogue velocity based on least-cost path distances
# First, create the conductance matrix (all land cells considered to have conductance of 1)
-r <- JapTC
+r <- JapTC[[1]]
r[!is.na(JapTC[[1]])] <- 1
h8 <- gdistance::transition(r, transitionFunction = mean, directions = 8)
h8 <- gdistance::geoCorrection(h8, type = "c")
@@ -90,7 +89,7 @@ avocc2 <- dVoCC(clim,
)
# Plot results
-r1 <- r2 <- JapTC
+r1 <- r2 <- JapTC[[1]]
r1[avocc1$focal] <- avocc1$vel
r2[avocc2$focal] <- avocc2$vel
terra::plot(c(r1, r2))
diff --git a/man/gVoCC.Rd b/man/gVoCC.Rd
index fb4bd5f..ce2d787 100644
--- a/man/gVoCC.Rd
+++ b/man/gVoCC.Rd
@@ -21,7 +21,7 @@ Function to calculate the velocity of climate change after Burrows et al. (2011)
based on local climatic temporal trends and spatial gradients.
}
\examples{
-
+\dontrun{
HSST <- VoCC_get_data("HSST.tif")
yrSST <- sumSeries(HSST,
p = "1960-01/2009-12", yr0 = "1955-01-01", l = terra::nlyr(HSST),
@@ -34,6 +34,7 @@ sg <- spatGrad(yrSST, th = 0.0001, projected = FALSE)
v <- gVoCC(tr, sg)
terra::plot(v)
+}
}
\references{
diff --git a/man/resTime.Rd b/man/resTime.Rd
index 2533d88..595cbe5 100644
--- a/man/resTime.Rd
+++ b/man/resTime.Rd
@@ -7,7 +7,7 @@
resTime(pg, vel, areapg = NA)
}
\arguments{
-\item{pg}{\code{SpatialPolygon} or a \code{SpatialPolygonsDataFrame} containing the polygons for which
+\item{pg}{\code{sf} object or \code{terra::vect} object containing the polygons for which
the residence time is to be calculated. The polygons must be on the same coordinate system as vel.}
\item{vel}{\code{raster} with climate velocity (km/year) for the period of interest.}
@@ -49,13 +49,13 @@ a2
# Using a user defined polygon
x_coord <- c(-28, -20, -20.3, -25.5)
y_coord <- c(60, 61, 63, 62)
-p <- Polygon(cbind(x_coord, y_coord))
-sps <- SpatialPolygons(list(Polygons(list(p), 1)))
-a3 <- resTime(sps, vel, areapg = NA)
+coords <- matrix(c(x_coord, y_coord), ncol = 2)
+poly_sf <- sf::st_sf(geometry = sf::st_sfc(sf::st_polygon(list(coords))))
+a3 <- resTime(poly_sf, vel, areapg = NA)
terra::plot(vel)
-terra::plot(EEZ, add = TRUE)
-terra::plot(sps, add = TRUE)
+plot(sf::st_geometry(EEZ), add = TRUE)
+plot(sf::st_geometry(poly_sf), add = TRUE)
}
}
\references{
diff --git a/man/shiftTime.Rd b/man/shiftTime.Rd
index 1d80904..af67b85 100644
--- a/man/shiftTime.Rd
+++ b/man/shiftTime.Rd
@@ -30,11 +30,13 @@ Function to calculate the seasonal shift in the arriving of typical seasonal cli
for a given period of interest as per Burrows et al. (2011).
}
\examples{
+\dontrun{
HSST <- VoCC_get_data("HSST.tif")
Apr <- shiftTime(HSST, yr1 = 1960, yr2 = 2009, yr0 = 1955, th = 10, m = 4)
terra::plot(Apr)
}
+}
\references{
\href{http://science.sciencemag.org/content/334/6056/652}{Burrows et al. 2011}. The pace of
shifting climate in marine and terrestrial ecosystems. Science, 334, 652-655.
diff --git a/man/spatGrad.Rd b/man/spatGrad.Rd
index 7348782..95c155a 100644
--- a/man/spatGrad.Rd
+++ b/man/spatGrad.Rd
@@ -11,7 +11,7 @@ spatGrad(r, th = -Inf, projected = FALSE)
Alternatively, a \code{raster} with the annual climatic values averaged
over the period of interest.}
-\item{th}{\code{Integer} indicating a lower thershold to truncate the spatial
+\item{th}{\code{Integer} indicating a lower threshold to truncate the spatial
gradient with. Use -Inf (default) if no threshold required.}
\item{projected}{\code{Logical} is the source raster in a projected coordinate system?
@@ -28,7 +28,7 @@ associated to a climatic variable after Burrows et al. (2011). This trend is
to be used for the calculation of the gradient-based climate velocity using gVoCC.
}
\examples{
-
+\dontrun{
HSST <- VoCC_get_data("HSST.tif")
yrSST <- sumSeries(HSST,
@@ -41,6 +41,7 @@ yrSST <- sumSeries(HSST,
sg <- spatGrad(yrSST, th = 0.0001, projected = FALSE)
terra::plot(sg)
+}
}
\references{
diff --git a/man/sumSeries.Rd b/man/sumSeries.Rd
index 1ace44a..5d4faa8 100644
--- a/man/sumSeries.Rd
+++ b/man/sumSeries.Rd
@@ -45,6 +45,7 @@ apply some summary function. It is mainly a wrapper from the \code{apply.} funct
in the package xts (Ryan and Ulrich 2017).
}
\examples{
+\dontrun{
# Monthly mean SST (HadISST) data for Europe Jan-1950 to Dec-2010
HSST <- VoCC_get_data("HSST.tif")
@@ -82,6 +83,7 @@ meanJASST <- sumSeries(HSST,
p = "1969-01/2009-12", yr0 = "1950-01-01", l = terra::nlyr(HSST),
fun = myf, freqin = "months", freqout = "other"
)
+}
}
\references{
diff --git a/man/tempTrend.Rd b/man/tempTrend.Rd
index 612c14d..efe33ab 100644
--- a/man/tempTrend.Rd
+++ b/man/tempTrend.Rd
@@ -25,7 +25,7 @@ of a climatic variable. This trend is to be used for the calculation of the
gradient-based climate velocity using gVoCC.
}
\examples{
-
+\dontrun{
HSST <- VoCC_get_data("HSST.tif")
yrSST <- sumSeries(HSST,
@@ -39,6 +39,7 @@ tr <- tempTrend(yrSST, th = 10)
terra::plot(tr)
}
+}
\seealso{
{\code{\link{spatGrad}}, \code{\link{gVoCC}}}
}
diff --git a/man/trajClas.Rd b/man/trajClas.Rd
index f18e690..fadae12 100644
--- a/man/trajClas.Rd
+++ b/man/trajClas.Rd
@@ -23,11 +23,11 @@ trajClas(
\item{traj}{\code{data.frame} as retuned by voccTraj containing the coordinates
and identification number for each trajectory.}
-\item{vel}{\code{raster} with the magnitude of gradient-based climate velocity.}
+\item{vel}{\code{SpatRaster} with the magnitude of gradient-based climate velocity.}
-\item{ang}{\code{raster} with velocity angles.}
+\item{ang}{\code{SpatRaster} with velocity angles.}
-\item{mn}{\code{raster} with mean climatic values for the study period.}
+\item{mn}{\code{SpatRaster} with mean climatic values for the study period.}
\item{trajSt}{\code{integer} number of trajectories starting from each cell or spatial unit.}
@@ -48,7 +48,7 @@ distance over the study period (slow-moving).}
\item{DateLine}{\code{logical} does the raster extent cross the international date line? (default "FALSE").}
}
\value{
-A \code{raster.stack} containing the trajectory classification ("TrajClas"),
+A \code{SpatRaster} containing the trajectory classification ("TrajClas"),
as well as those based on trajectory length ("ClassL"; 1 non-moving, 2 slow-moving, 3 fast-moving cells),
boundrary ("BounS") and internal sinks ("IntS"), and the proportion of trajectories ending("PropEnd"),
flowing through ("PropFT") and starting ("PropSt"). The trajectory classes ("TrajClas") are (1) non-moving,
@@ -71,7 +71,7 @@ and (5) convergence cells identified from the remaining cells as those where few
cell, respectively.
}
\examples{
-
+\dontrun{
HSST <- VoCC_get_data("HSST.tif")
# input raster layers
@@ -94,7 +94,7 @@ veld <- terra::disagg(vel, 4)
angd <- terra::disagg(ang, 4)
lonlat <- stats::na.omit(data.frame(
terra::xyFromCell(veld, 1:terra::ncell(veld)),
- veld[], angd[], mnd[]
+ terra::values(veld), terra::values(angd), terra::values(mnd)
))[, 1:2]
traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50, correct = TRUE)
@@ -111,22 +111,21 @@ my_col <- c(
"magenta1", "cadetblue1", "yellow1"
)
# Keep only the categories present in our raster
-my_col <- my_col[sort(unique(clas[[7]][]))]
+my_col <- my_col[sort(unique(terra::values(clas[[7]])))]
# Classify raster / build attribute table
-clasr <- ratify(clas[[7]])
-rat_r <- levels(clasr)[[1]]
-rat_r$trajcat <- c(
- "N-M", "S-M", "IS", "BS", "Srce",
- "RS", "Cor", "Div", "Con"
-)[sort(unique(clas[[7]][]))]
-levels(clasr) <- rat_r
+clasr <- terra::as.factor(clas[[7]])
+rat_r <- data.frame(ID = sort(unique(terra::values(clas[[7]]))),
+ trajcat = c("N-M", "S-M", "IS", "BS", "Srce",
+ "RS", "Cor", "Div", "Con")[sort(unique(terra::values(clas[[7]])))])
+terra::cats(clasr) <- rat_r
# Produce the plot using the rasterVis levelplot function
rasterVis::levelplot(clasr,
col.regions = my_col,
xlab = NULL, ylab = NULL, scales = list(draw = FALSE)
)
}
+}
\references{
\href{https://www.nature.com/articles/nature12976}{Burrows et al. 2014}. Geographical limits to species-range shifts are suggested by climate velocity. Nature, 507, 492-495.
}
diff --git a/man/trajLine.Rd b/man/trajLine.Rd
index 50c03a4..1530c48 100644
--- a/man/trajLine.Rd
+++ b/man/trajLine.Rd
@@ -4,7 +4,7 @@
\alias{trajLine}
\title{Climate velocity trajectory spatial lines}
\usage{
-trajLine(x, projx = "EPSG::4326")
+trajLine(x, projx = "EPSG:4326")
}
\arguments{
\item{x}{\code{data.frame} containing the coordinates (x, y) of the constituent
@@ -24,7 +24,7 @@ a -180 to 180 longitudinal arrangement.
Create a spatial line data frame object from trajectory points.
}
\examples{
-
+\dontrun{
HSST <- VoCC_get_data("HSST.tif")
yrSST <- sumSeries(HSST,
@@ -54,7 +54,6 @@ lns <- trajLine(x = traj)
terra::plot(mn)
terra::plot(lns, add = TRUE)
-\dontrun{
# Export as ESRI shape file
terra::writeVector(lns, filename = "velTraj", filetype = "ESRI Shapefile")
}
diff --git a/man/voccTraj.Rd b/man/voccTraj.Rd
index fd4125b..3a17010 100644
--- a/man/voccTraj.Rd
+++ b/man/voccTraj.Rd
@@ -4,7 +4,7 @@
\alias{voccTraj}
\title{Climate velocity trajectories}
\usage{
-voccTraj(lonlat, vel, ang, mn, tyr, trajID = 1:nrow(lonlat), correct = FALSE)
+voccTraj(lonlat, vel, ang, mn, tstep, tyr = 50)
}
\arguments{
\item{lonlat}{\code{data.frame} with the longitude and latitude (in decimal degrees)
@@ -17,17 +17,6 @@ of the points to project.}
\item{mn}{\code{raster} with the overall mean climatic value over the period of interest.}
\item{tyr}{\code{integer} temporal length of the period of interest.}
-
-\item{trajID}{\code{integer} specifying the identifiers for the trajectories.}
-
-\item{correct}{\code{logical} does the input raster need to be corrected to account for cropped margins?
-Unless the raster extent is global, calculation of trajectories will throw an error at the margins
-as the trajectories go beyond the raster extent (no input values). To avoid this, an option is given for
-expanding the extent by the resolution of the raster (1 column/row) with NAs. Note that those trajectories
-reaching the extent limits will be artificially bounced back so should be discarded at that point.
-Alternatively, users may choose to crop to a larger extent to the domain of interest (appropriately
-defined by lonlat), so the extra extent buffer for those trajectories getting to the border
-of the raster.}
}
\value{
a \code{data.frame} containing the coordinates ("x", "y") of the constituent
@@ -36,26 +25,31 @@ points and identification number ("trajIDs") for each trajectory.
\description{
Function to calculate vocc trajectories after Burrows et al (2014). Trajectories
are calculated by propagating climatic isopleths using the magnitude and direction of
-local (cell) velocities. This is a slightly modified version of the original Burrows et al. (2014)
-approach in that iterations of a trajectory are based on cumulative time travelled instead of using fixed time steps.
+local (cell) velocities. This is a slightly modified version of the original
+Burrows et al. (2014) approach in that iterations of a trajectory are based on
+cumulative time traveled instead of using fixed time steps.
}
\examples{
-
-HSST <- VoCC_get_data("HSST.tif")
-
+\dontrun{
yrSST <- sumSeries(HSST,
p = "1960-01/2009-12", yr0 = "1955-01-01", l = terra::nlyr(HSST),
fun = function(x) colMeans(x, na.rm = TRUE),
freqin = "months", freqout = "years"
)
+
+# Long-term local climatic trends
tr <- tempTrend(yrSST, th = 10)
+
+# Local spatial climatic gradients
sg <- spatGrad(yrSST, th = 0.0001, projected = FALSE)
+
+# Gradient-based climate velocity
v <- gVoCC(tr, sg)
vel <- v[[1]]
ang <- v[[2]]
# Calculate the annual SST mean over the period
-mn <- mean(yrSST, na.rm = T)
+mn <- terra::mean(yrSST, na.rm = TRUE)
# Get the set of starting cells for the trajectories
lonlat <- stats::na.omit(data.frame(
@@ -69,6 +63,7 @@ traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50)
# This accounts for the extent issue
traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50, correct = TRUE)
+}
}
\references{
diff --git a/readme.md b/readme.md
index d270af4..6caeaa4 100644
--- a/readme.md
+++ b/readme.md
@@ -4,6 +4,7 @@
# VoCC: The Velocity of Climate Change and related climatic metrics
+
Jorge Garcia Molinos et al. 18 July 2019
diff --git a/vignettes/VoCC_Tutorial.Rmd b/vignettes/VoCC.Rmd
similarity index 52%
rename from vignettes/VoCC_Tutorial.Rmd
rename to vignettes/VoCC.Rmd
index 1242d4e..b4f7cfa 100644
--- a/vignettes/VoCC_Tutorial.Rmd
+++ b/vignettes/VoCC.Rmd
@@ -1,57 +1,49 @@
---
-title: "VoCC_Tutorial"
-author: "Jorge García Molinos"
-date: "06.05.2019"
-output:
- prettydoc::html_pretty:
- highlight: github
- theme: tactile
+title: "VoCC"
+output: rmarkdown::html_vignette
vignette: >
- %\VignetteIndexEntry{VoCC_Tutorial}
+ %\VignetteIndexEntry{VoCC}
%\VignetteEngine{knitr::rmarkdown}
- %\VignetteIndexEntry{VoCC_Tutorial}
+ %\VignetteIndexEntry{VoCC}
\usepackage[utf8]{inputenc}
---
+
```{r setup, include = FALSE}
- knitr::opts_chunk$set(
- collapse = TRUE,
- comment = "#>"
+knitr::opts_chunk$set(
+collapse = TRUE,
+comment = "#>"
)
+
+# Force sequential processing to avoid parallel processing issues during package checking
+Sys.setenv("R_PARALLELLY_AVAILABLECORES_FALLBACK" = "1")
```
+**THIS IS A WORK IN PROGRESS TO CONVERT THE OLD RASTER-BASED VOCC PACKAGE TO TERRA. NOT EVERYTHING WORKS YET.**
This vignette provides the code to reproduce the examples for the R package VoCC as presented in Garcia Molinos et al. (2019). Refer to the paper and the function documentation for details on function options, considerations on the argument choices and interepretation of output.
For this tutorial we need the following packages (if not installed get them first):
```{r message=FALSE}
-# devtools::install_github("JorGarMol/VoCC", dependencies = TRUE, build_vignettes = TRUE)
-devtools::load_all()
-# suppressWarnings(library(VoCC))
-# suppressWarnings(library(rasterVis))
-# suppressWarnings(library(gridExtra))
-# suppressWarnings(library(doParallel))
-# suppressWarnings(library(foreach))
-# suppressWarnings(library(scales))
-# suppressWarnings(library(data.table))
-# suppressWarnings(library(mapplots))
-# suppressWarnings(library(ggplot2))
-# suppressWarnings(library(repmis))
-```
-
-We also need a few data sets that can be downloaded into R from the Github Data repository (https://github.com/JorGarMol/VoCC_data_sets) companion to the package. See the repository readme file for description of the data sets.
-
-```{r message=FALSE}
-# load(url("https://github.com/JorGarMol/VoCC_data_sets/blob/master/Data/HadiSST.rda?raw=true") # HSST data set
-HadiSST <- VoCC_get_data(path = "HSST.tif")
-
-# source_data("https://github.com/JorGarMol/VoCC_data_sets/blob/master/Data/EZZs.rda?raw=true") # EEZs data set
-EEZ <- VoCC_get_data(path = "EEZ.gpkg")
+library(VoCC)
+library(dplyr)
+library(tidyr)
+library(data.table)
+library(terra)
+library(purrr)
+
+# For Plotting
+library(ggplot2)
+library(tidyterra)
+library(patchwork)
+library(mapplots)
+```
-load(url("https://github.com/JorGarMol/VoCC_data_sets/blob/master/Data/marshift.rda?raw=true")) # marshift data set
+We also need a few data sets that can be accessed from the `VoCCdata` package.
-# load(url("https://github.com/JorGarMol/VoCC_data_sets/blob/master/Data/traj25.rda?raw=true")) # traj25 data set
+```{r message=FALSE}
+library(VoCCdata)
```
@@ -63,27 +55,30 @@ We have a look first at the “marshift” global data set containing reported r
str(marshift)
```
-Next, we calculate the gradient- and distance-based velocities (1960-2009), using the HSST data set, from which we will later extract the corresponding values for each observed shift.
+Next, we calculate the gradient- and distance-based velocities (1960-2009), using the HadiSST data set, from which we will later extract the corresponding values for each observed shift.
```{r}
+HadiSST <- terra::rast(system.file("extdata", "HadiSST.tif", package = "VoCCdata"))
+
# monthly to annual averages
r <- sumSeries(HadiSST, p = "1960-01/2009-12", yr0 = "1955-01-01",
l = terra::nlyr(HadiSST),
fun = function(x) colMeans(x, na.rm = TRUE),
freqin = "months", freqout = "years")
-# temporal trend
-vt <- tempTrend(r, th = 10)
-# spatial gradient
-vg <- spatGrad(r, th = 0.0001, projected = FALSE)
-# climate velocity
-gv <- gVoCC(vt, vg)
+
+vt <- tempTrend(r, th = 10) # temporal trend
+vg <- spatGrad(r, th = 0.0001, projected = FALSE) # spatial gradient
+gv <- gVoCC(vt, vg) # climate velocity
# Now the distance-based velocities
# Take 1960-1970 as base period against 2000-2009
-r2 <- c(mean(r[[1:10]], na.rm = TRUE), mean(r[[41:50]], na.rm = TRUE))
+r2 <- c(terra::mean(r[[1:10]], na.rm = TRUE), terra::mean(r[[41:50]], na.rm = TRUE))
+
# prepare the data frame with the necessary variables
-clim <- na.omit(data.frame(terra::values(r2), cid = 1:ncell(r)))
+clim <- na.omit(data.frame(terra::values(r2), cid = 1:terra::ncell(r)))
+
clim[, c("x", "y")] <- terra::xyFromCell(r, clim$cid)
+
# 1965-2004 (40 yr), 500 km search radius
v <- dVoCC(clim, n = 1, tdiff = 40, method = "Single", climTol = 0.1, geoTol = 500, distfun = "GreatCircle", trans = NA, lonlat = TRUE)
```
@@ -92,22 +87,64 @@ Next, we extract the mean velocity estimates for each reported shift by taking t
```{r}
# Change sign as needed and create the distance-based velocity raster
-ind <- which(r2[[1]][v$focal] > r2[[2]][v$target])
+# Change sign as needed - terra approach for value comparison
+focal_vals <- terra::values(r2[[1]])[v$focal]
+target_vals <- terra::values(r2[[2]])[v$target]
+ind <- which(focal_vals > target_vals)
v$velBis <- v$vel
v$velBis[ind] <- v$vel[ind] * -1
-# put output in raster format
-dv <- terra::rast(gv)
+
+# put output in raster format - create single layer empty template like raster(gv)
+dv <- terra::rast(terra::ext(gv), resolution = terra::res(gv), crs = terra::crs(gv))
dv[v$focal] <- v$velBis
-marshift$GV <- with(marshift, terra::extract(abs(gv[[1]]), cbind(long, lat), buffer = (Shift * (timespan / 10) * 1000), fun = mean, na.rm = TRUE, small = TRUE))
-marshift$DV <- with(marshift, terra::extract(abs(dv), cbind(long, lat), buffer = (Shift * (timespan / 10) * 1000), fun = mean, na.rm = TRUE, small = TRUE))
-# retrieve the closest marine cell for those centroids falling on land
-marshift$GV <- with(marshift, ifelse(is.na(GV), gv[[1]][which.min(replace(distanceFromPoints(gv[[1]], cbind(long, lat)), is.na(gv[[1]]), NA))], GV))
-marshift$DV <- with(marshift, ifelse(is.na(DV), dv[which.min(replace(distanceFromPoints(dv, cbind(long, lat)), is.na(dv), NA))], DV))
+# Create point geometries and buffer them
+coords <- terra::vect(cbind(marshift$long, marshift$lat), crs = "EPSG:4326")
+buffer_size <- marshift$Shift * (marshift$timespan / 10) * 1000
+
+# Get the mean velocity within the buffer for each data point.
+# Match old raster::extract approach exactly
+marshift$GV <- terra::extract(abs(gv[[1]]), coords,
+ buffer = buffer_size,
+ fun = mean, na.rm = TRUE,
+ weights = TRUE, exact = FALSE)[,2]
+
+marshift$DV <- terra::extract(abs(dv), coords,
+ buffer = buffer_size,
+ fun = mean, na.rm = TRUE,
+ weights = TRUE, exact = FALSE)[,2]
+```
+
+```{r}
+# For points that didn't get values (NA), find nearest valid cells
+
+missing_points <- coords[is.na(marshift$GV)] # Identify NAs
+if(!is.empty(missing_points)){
+ marine_cells <- terra::as.points(gv[[1]]) # vector of all valid marine cell locations.
+ nearest_indices <- terra::nearest(missing_points, marine_cells) # Find the nearest marine cell
+ nearest_values <- terra::extract(gv[[1]], marine_cells[nearest_indices]) # get the values from the nearest marine cells.
+ marshift$GV[is.na(marshift$GV)] <- nearest_values[, 2] # Replace the NA values in `marshift$GV`
+}
+
+missing_points <- coords[is.na(marshift$DV)] # Identify NAs
+if(!is.empty(missing_points)){
+ marine_cells <- terra::as.points(dv[[1]]) # vector of all valid marine cell locations.
+ nearest_cells <- terra::nearest(missing_points, marine_cells) # Find the nearest marine cell
+ nearest_values <- terra::extract(dv[[1]], nearest_cells) # get the values from the nearest marine cells.
+ marshift$DV[is.na(marshift$DV)] <- nearest_values[, 2] # Replace the NA values in `marshift$GV`
+}
+
+```
+
+```{r}
# fit the regression models
Mgv <- lm(Shift^(1 / 4) ~ I((GV * 10)^(1 / 4)), data = marshift, weights = years_data)
-Mdv <- lm(Shift^(1 / 4) ~ I((DV * 10)^(1 / 4)), data = marshift, weights = years_data)
summary(Mgv)
+```
+
+
+```{r}
+Mdv <- lm(Shift^(1 / 4) ~ I((DV * 10)^(1 / 4)), data = marshift, weights = years_data)
summary(Mdv)
```
@@ -115,25 +152,42 @@ Produce the observed vs predicted scatterplots with regression lines (Fig. 2 in
```{r}
# first compare both velocities
-my.at <- seq(-50, 50, by = 5)
-p1 <- rasterVis::levelplot(gv[[1]], par.settings = BuRdTheme, at = my.at, main = "Gradient-based vocc", margin = FALSE)
-my.at <- seq(-20, 20, by = 2)
-p2 <- rasterVis::levelplot(dv, par.settings = BuRdTheme, at = my.at, main = "Distance-based vocc", margin = FALSE)
-gridExtra::grid.arrange(p1, p2, ncol = 1)
+
+p1 <- ggplot() +
+ geom_spatraster(data = gv[[1]]) +
+ scale_fill_distiller(palette = "RdBu", direction = -1, limits = c(-50, 50)) +
+ ggtitle("Gradient-based vocc") +
+ scale_x_continuous(expand = c(0,0)) +
+ scale_y_continuous(expand = c(0,0))
+
+p2 <- ggplot() +
+ geom_spatraster(data = dv[[1]]) +
+ scale_fill_distiller(palette = "RdBu", direction = -1, limits = c(-20, 20)) +
+ ggtitle("Distance-based vocc") +
+ scale_x_continuous(expand = c(0,0)) +
+ scale_y_continuous(expand = c(0,0))
+
+wrap_plots(p1, p2, ncol = 1)
+
+```
+
+```{r}
# scatter plots with the resulting regression line
-p1 <- ggplot(na.omit(marshift), aes(x = I((GV * 10)^(1 / 4)), y = Shift^(1 / 4))) +
+p1 <- ggplot(na.omit(marshift), aes(x = (GV * 10)^(1 / 4), y = Shift^(1 / 4))) +
geom_point(color = "grey") +
geom_smooth(method = lm, se = FALSE) +
theme_classic() +
scale_color_brewer(palette = "Accent") +
labs(x = "Predicted shift (x^1/4; km/yr)", y = "Observed shift (y^1/4; km/yr)")
-p2 <- ggplot(na.omit(marshift), aes(x = I((DV * 10)^(1 / 4)), y = Shift^(1 / 4))) +
+
+p2 <- ggplot(na.omit(marshift), aes(x = (DV * 10)^(1 / 4), y = Shift^(1 / 4))) +
geom_point(color = "grey") +
geom_smooth(method = lm, se = FALSE) +
theme_classic() +
scale_color_brewer(palette = "Accent") +
labs(x = "Predicted shift (x^1/4; km/yr)", y = "Observed shift (y^1/4; km/yr)")
-grid.arrange(p1, p2, nrow = 1)
+
+wrap_plots(p1, p2, nrow = 1)
```
# Example 2: Analysis of climate exposure and connectivity in the Western Pacific Ocean
@@ -144,93 +198,104 @@ In this example we use climate velocity trajectories (based on 1960-2009 mean an
# prepare raster layers
vel <- gv[[1]]
ang <- gv[[2]]
-mn <- calc(r, mean, na.rm = T)
+mn <- app(r, mean, na.rm = T)
+
# generate a velocity layer centered and cropped to study region to extract the initial coordinates for the trajectories from
-x1 <- crop(gv[[1]], extent(-180, 0, -90, 90))
-x2 <- crop(gv[[1]], extent(0, 180, -90, 90))
-extent(x1) <- c(180, 360, -90, 90)
+x1 <- crop(gv[[1]], ext(-180, 0, -90, 90))
+x2 <- crop(gv[[1]], ext(0, 180, -90, 90))
+ext(x1) <- c(180, 360, -90, 90)
velc <- merge(x1, x2)
+
# crop to the desired extent
# display restricted to +180 longitude to avoid plotting issues with date line crossing
velc <- crop(velc, c(90, 180, -32, 33))
```
-We can now populate the data frame with the cell centroid coordinates for the trajectories and associated input data
+We can now populate the data frame with the cell centroid coordinates for the trajectories.
```{r}
lonlat <- data.frame(terra::xyFromCell(velc, 1:ncell(velc)))
-lonlat$vel <- terra::extract(vel, lonlat)
-lonlat$ang <- terra::extract(ang, lonlat[, 1:2])
-lonlat$mn <- terra::extract(mn, lonlat[, 1:2])
-lonlat <- na.omit(lonlat)
+lonlat$vel <- terra::extract(vel, lonlat, ID = FALSE)
+lonlat$ang <- terra::extract(ang, lonlat[, 1:2], ID = FALSE)
+lonlat$mn <- terra::extract(mn, lonlat[, 1:2], ID = FALSE)
+lonlat$lineID <- 1:nrow(lonlat)
+lonlat <- drop_na(lonlat)
```
Let's calculate the trajectories with parallel processing to demonstrate how this can be used to speed things up (especially useful when dealing with fine resolutions or large extents).
```{r}
-cores <- detectCores()
-ncores <- cores[1] - 1
-cuts <- cut(1:nrow(lonlat), ncores)
-cl <- makeCluster(ncores)
-registerDoParallel(cl)
-traj <- foreach(x = levels(cuts), .combine = rbind, .packages = c("raster", "sp", "rgeos", "geosphere", "rgdal", "VoCC"), .multicombine = TRUE) %dopar% {
- voccTraj(lonlat[cuts == x, ], vel, ang, mn, tyr = 50, trajID = as.numeric(rownames(lonlat[cuts == x, ])), correct = FALSE)
-}
-stopCluster(cl)
+
+traj <- voccTraj(lonlat, vel, ang, mn, tyr = 50, tstep = 1/12)
+
```
Plot them over the climate velocities and the EEZ polygons from the EEZs data set (Fig. 3a in Garcia Molinos et al. 2019)
-```{r}
-# simplify polygons to speed plotting up
-eez_simp <- rgeos::gSimplify(EEZs, tol = 0.5, topologyPreserve = TRUE)
-plot(velc)
+```{r message=FALSE, warning=FALSE}
# create the spatial object with the trajectories and plot them together with the EEZ polygons
-lns <- trajLine(x = traj)
-plot(lns, add = TRUE)
-plot(eez_simp, col = scales::alpha(rgb(211, 211, 211, maxColorValue = 255), 0.5), add = TRUE)
+lns <- map(traj %>% group_split(cellIDs), trajLine) %>%
+ purrr::list_rbind() %>%
+ sf::st_sf()
+
+# Load and simplify polygons to speed plotting up
+EEZs <- sf::st_read(system.file("extdata", "EEZs.gpkg", package = "VoCCdata")) %>%
+ sf::st_break_antimeridian() %>%
+ sf::st_simplify(preserveTopology = TRUE, dTolerance = 500) %>%
+ sf::st_crop(xmin = 75, xmax = 180, ymin = -35, ymax = 35)
+
+ggplot() +
+ geom_spatraster(data = velc, aes(fill = voccMag)) +
+ scale_fill_viridis_c(option = "inferno", name = "Velocity") +
+ geom_sf(data = lns %>% sf::st_shift_longitude(), colour = "grey70", linewidth = 0.1) +
+ geom_sf(data = EEZs %>% sf::st_shift_longitude(), colour = "white", fill = NA, linewidth = 0.3) +
+ scale_x_continuous(expand = c(0, 0)) +
+ scale_y_continuous(expand = c(0, 0))
+
```
-We now calulcate the trajectory classes and residence times for each EEZ using the traj25 data set.
+We now calculate the trajectory classes and residence times for each EEZ using the traj25 data set.
-```{r}
-# get the set of starting cells for the trajectories and calculate trajectories
-# at 1/4-deg resolution (16 trajectories per 1-deg cell)
-r <- disaggregate(mn, 4)
-lonlat <- na.omit(data.frame(terra::xyFromCell(vel, 1:ncell(vel)), vel[], ang[], mn[]))[, 1:2]
-traj25 <- voccTraj(lonlat, vel, ang, mn, tyr = 50, correct = TRUE)
+```{r eval=TRUE}
# classify trajectories (16 trajectories starting from each 1-deg cell cell)
clas <- trajClas(traj25, vel, ang, mn, trajSt = 16, tyr = 50, nmL = 20, smL = 100, Nend = 45, Nst = 15, NFT = 70)
+
# Extract proportions by categories for each EEZ
v <- data.table(terra::extract(clas[[7]], EEZs, df = TRUE))
v[, TrajClas := as.character(TrajClas)]
v[, ID := as.ordered(ID)]
+
# proportions by class
d <- prop.table(table(v), 1)
+
# residence times by EEZ
EEZa <- resTime(EEZs, vel, areapg = NA)
```
Finally let's plot the category proportions as pie charts on top of each EEZ, the size of the chart being proportional to their respective residence time (Fig. 3b in Garcia Molinos et al. 2019).
-```{r}
+```{r eval=FALSE}
D <- data.table(d) # put data in long format
-# add EEZ names for reference
-D[, name := as.character(EEZs$Territory1)[as.numeric(ID)]]
+
+D[, name := as.character(EEZs$Territory1)[as.numeric(ID)]] # add EEZ names for reference
D[, RT := as.character(EEZa$resTim)[as.numeric(ID)]]
+
# prepare data frame to plot the pie charts with
dt <- as.data.frame.matrix(d)
dt$country <- as.character(EEZs$Territory1)
-dt[, c("x", "y")] <- coordinates(EEZs)
+
+coords <- sf::st_coordinates(sf::st_centroid(EEZs))
+dt[, c("x", "y")] <- coords[, c("X", "Y")]
dt$RT <- EEZa$resTim
-# generate the plot
+
+# # generate the plot
plot(velc)
plot(eez_simp, add = TRUE)
mycol <- c(scales::alpha(rgb(192, 192, 192, maxColorValue = 255), 0.5), scales::alpha(rgb(204, 255, 204, maxColorValue = 255), 0.5), scales::alpha(rgb(255, 153, 51, maxColorValue = 255), 0.5), scales::alpha(rgb(255, 51, 51, maxColorValue = 255), 0.5), scales::alpha(rgb(51, 51, 255, maxColorValue = 255), 0.5), scales::alpha(rgb(204, 102, 0, maxColorValue = 255), 0.5), scales::alpha(rgb(204, 0, 204, maxColorValue = 255), 0.5), scales::alpha(rgb(255, 255, 51, maxColorValue = 255), 0.5), scales::alpha(rgb(153, 204, 255, maxColorValue = 255), 0.5))
# mylab = c("Non-moving", "Slow-moving", "Internal Sink", "Boundary sink",
# "Source", "Internal sink","Corridor", "Divergence", "Convergence")
for (i in 1:35) {
- add.pie(z = as.numeric(dt[i, 1:9]), x = dt[i, "x"], y = dt[i, "y"], radius = log(dt[i, "RT"]), col = mycol, labels = "")
+ add.pie(z = as.numeric(dt[i, 1:5]), x = dt[i, "x"], y = dt[i, "y"], radius = log(dt[i, "RT"]), col = mycol, labels = "")
}
```