diff --git a/.github/workflows/lint.yml b/.github/workflows/lint.yml new file mode 100644 index 0000000..bb9154f --- /dev/null +++ b/.github/workflows/lint.yml @@ -0,0 +1,26 @@ +name: Lint + +on: [push, pull_request] + +jobs: + lint: + runs-on: ubuntu-latest + + steps: + - uses: actions/checkout@v2 + + - name: Set up Python + uses: actions/setup-python@v4 + with: + python-version: '3.10' # or any version your project uses + + - name: Install dependencies + run: | + python -m pip install --upgrade pip + pip install black==25.1.0 ruff==0.12.2 + + - name: Run Black + run: black --check . + + - name: Run Ruff (no formatting) + run: ruff check . --no-fix diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..613c70b --- /dev/null +++ b/.gitignore @@ -0,0 +1,179 @@ +# Byte-compiled / optimized / DLL files +__pycache__/ +*.py[cod] +*$py.class + +# C extensions +*.so + +# Distribution / packaging +.Python +build/ +develop-eggs/ +dist/ +downloads/ +eggs/ +.eggs/ +lib/ +lib64/ +parts/ +sdist/ +var/ +wheels/ +share/python-wheels/ +*.egg-info/ +.installed.cfg +*.egg +MANIFEST + +# PyInstaller +# Usually these files are written by a python script from a template +# before PyInstaller builds the exe, so as to inject date/other infos into it. +*.manifest +*.spec + +# Installer logs +pip-log.txt +pip-delete-this-directory.txt + +# Unit test / coverage reports +htmlcov/ +.tox/ +.nox/ +.coverage +.coverage.* +.cache +nosetests.xml +coverage.xml +*.cover +*.py,cover +.hypothesis/ +.pytest_cache/ +cover/ + +# Translations +*.mo +*.pot + +# Django stuff: +*.log +local_settings.py +db.sqlite3 +db.sqlite3-journal + +# Flask stuff: +instance/ +.webassets-cache + +# Scrapy stuff: +.scrapy + +# Sphinx documentation +docs/_build/ +docs/build/ + +# PyBuilder +.pybuilder/ +target/ + +# Jupyter Notebook +.ipynb_checkpoints + +# IPython +profile_default/ +ipython_config.py + +# pyenv +# For a library or package, you might want to ignore these files since the code is +# intended to run in multiple environments; otherwise, check them in: +# .python-version + +# pipenv +# According to pypa/pipenv#598, it is recommended to include Pipfile.lock in version control. +# However, in case of collaboration, if having platform-specific dependencies or dependencies +# having no cross-platform support, pipenv may install dependencies that don't work, or not +# install all needed dependencies. +#Pipfile.lock + +# poetry +# Similar to Pipfile.lock, it is generally recommended to include poetry.lock in version control. +# This is especially recommended for binary packages to ensure reproducibility, and is more +# commonly ignored for libraries. +# https://python-poetry.org/docs/basic-usage/#commit-your-poetrylock-file-to-version-control +#poetry.lock + +# pdm +# Similar to Pipfile.lock, it is generally recommended to include pdm.lock in version control. +#pdm.lock +# pdm stores project-wide configurations in .pdm.toml, but it is recommended to not include it +# in version control. +# https://pdm.fming.dev/#use-with-ide +.pdm.toml + +# PEP 582; used by e.g. github.com/David-OConnor/pyflow and github.com/pdm-project/pdm +__pypackages__/ + +# Celery stuff +celerybeat-schedule +celerybeat.pid + +# SageMath parsed files +*.sage.py + +# Environments +.env +.venv +env/ +venv/ +ENV/ +env.bak/ +venv.bak/ + +# Spyder project settings +.spyderproject +.spyproject + +# Rope project settings +.ropeproject + +# mkdocs documentation +/site + +# mypy +.mypy_cache/ +.dmypy.json +dmypy.json + +# Pyre type checker +.pyre/ + +# pytype static type analyzer +.pytype/ + +# Cython debug symbols +cython_debug/ + +# PyCharm +# JetBrains specific template is maintained in a separate JetBrains.gitignore that can +# be found at https://github.com/github/gitignore/blob/main/Global/JetBrains.gitignore +# and can be added to the global gitignore or merged into this file. For a more nuclear +# option (not recommended) you can uncomment the following to ignore the entire idea folder. +#.idea/ + +# configs/ # commented as new configs can be added as a part of a feature + +/.idea +/data +/logs +/results_buffer +electra_pretrained.ckpt + +build +.virtual_documents +.jupyter +chebai.egg-info +lightning_logs +logs +.isort.cfg +/.vscode +/api/.cloned_repos diff --git a/.pre-commit-config.yaml b/.pre-commit-config.yaml new file mode 100644 index 0000000..cbb7284 --- /dev/null +++ b/.pre-commit-config.yaml @@ -0,0 +1,31 @@ +repos: +- repo: https://github.com/psf/black + rev: "25.1.0" + hooks: + - id: black + - id: black-jupyter # for formatting jupyter-notebook + +- repo: https://github.com/pycqa/isort + rev: 5.13.2 + hooks: + - id: isort + name: isort (python) + args: ["--profile=black"] + +- repo: https://github.com/asottile/seed-isort-config + rev: v2.2.0 + hooks: + - id: seed-isort-config + +- repo: https://github.com/pre-commit/pre-commit-hooks + rev: v4.6.0 + hooks: + - id: check-yaml + - id: end-of-file-fixer + - id: trailing-whitespace + +- repo: https://github.com/astral-sh/ruff-pre-commit + rev: v0.12.2 + hooks: + - id: ruff + args: [--fix] diff --git a/README.md b/README.md index 27110d4..42031b5 100644 --- a/README.md +++ b/README.md @@ -1,8 +1,17 @@ # python-chebifier -An AI ensemble model for predicting chemical classes in the ChEBI ontology. +An AI ensemble model for predicting chemical classes in the ChEBI ontology. It integrates deep learning models, +rule-based models and generative AI-based models. + +A web application for the ensemble is available at https://chebifier.hastingslab.org/. ## Installation +You can get the package from PyPI: +```bash +pip install chebifier +``` + +or get the latest development version from GitHub: ```bash # Clone the repository git clone https://github.com/yourusername/python-chebifier.git @@ -12,7 +21,7 @@ cd python-chebifier pip install -e . ``` -Some dependencies of `chebai-graph` cannot be installed automatically. If you want to use Graph Neural Networks, follow +`chebai-graph` and its dependencies cannot be installed automatically. If you want to use Graph Neural Networks, follow the instructions in the [chebai-graph repository](https://github.com/ChEB-AI/python-chebai-graph). ## Usage @@ -21,23 +30,25 @@ the instructions in the [chebai-graph repository](https://github.com/ChEB-AI/pyt The package provides a command-line interface (CLI) for making predictions using an ensemble model. -```bash -# Get help -python -m chebifier.cli --help +The ensemble configuration is given by a configuration file (by default, this is `chebifier/ensemble.yml`). If you +want to change which models are included in the ensemble or how they are weighted, you can create your own configuration file. -# Make predictions using a configuration file -python -m chebifier.cli predict configs/example_config.yml --smiles "CC(=O)OC1=CC=CC=C1C(=O)O" "C1=CC=C(C=C1)C(=O)O" +Model weights for deep learning models are downloaded automatically from [Hugging Face](https://huggingface.co/chebai). +However, you can also supply your own model checkpoints (see `configs/example_config.yml` for an example). -# Make predictions using SMILES from a file -python -m chebifier.cli predict configs/example_config.yml --smiles-file smiles.txt -``` +```bash +# Make predictions +python -m chebifier predict --smiles "CC(=O)OC1=CC=CC=C1C(=O)O" --smiles "C1=CC=C(C=C1)C(=O)O" -### Configuration File +# Make predictions using SMILES from a file +python -m chebifier predict --smiles-file smiles.txt -The CLI requires a YAML configuration file that defines the ensemble model. An example can be found in `configs/example_config.yml`. +# Make predictions using a configuration file +python -m chebifier predict --ensemble-config configs/my_config.yml --smiles-file smiles.txt -The models and other required files are trained / generated by our [chebai](https://github.com/ChEB-AI/python-chebai) package. -Examples for models can be found on [kaggle](https://www.kaggle.com/datasets/sfluegel/chebai). +# Get all available options +python -m chebifier predict --help +``` ### Python API @@ -67,7 +78,29 @@ for smiles, prediction in zip(smiles_list, predictions): print("No predictions") ``` +### The models +Currently, the following models are supported: + + +| Model | Description | #Classes | Publication | Repository | +|-------|-------------|----------|-----------------------------------------------------------------------|----------------------------------------------------------------------------------------| +| `electra` | A transformer-based deep learning model trained on ChEBI SMILES strings. | 1522 | [Glauer, Martin, et al., 2024: Chebifier: Automating semantic classification in ChEBI to accelerate data-driven discovery, Digital Discovery 3 (2024) 896-907](https://pubs.rsc.org/en/content/articlehtml/2024/dd/d3dd00238a) | [python-chebai](https://github.com/ChEB-AI/python-chebai) | +| `resgated` | A Residual Gated Graph Convolutional Network trained on ChEBI molecules. | 1522 | | [python-chebai-graph](https://github.com/ChEB-AI/python-chebai-graph) | +| `chemlog_peptides` | A rule-based model specialised on peptide classes. | 18 | [Flügel, Simon, et al., 2025: ChemLog: Making MSOL Viable for Ontological Classification and Learning, arXiv](https://arxiv.org/abs/2507.13987) | [chemlog-peptides](https://github.com/sfluegel05/chemlog-peptides) | +| `chemlog_element`, `chemlog_organox` | Extensions of ChemLog for classes that are defined either by the presence of a specific element or by the presence of an organic bond. | 118 + 37 | | [chemlog-extra](https://github.com/ChEB-AI/chemlog-extra) | +| `c3p` | A collection _Chemical Classifier Programs_, generated by LLMs based on the natural language definitions of ChEBI classes. | 338 | [Mungall, Christopher J., et al., 2025: Chemical classification program synthesis using generative artificial intelligence, arXiv](https://arxiv.org/abs/2505.18470) | [c3p](https://github.com/chemkg/c3p) | + +In addition, Chebifier also includes a ChEBI lookup that automatically retrieves the ChEBI superclasses for a class +matched by a SMILES string. This is not activated by default, but can be included by adding +```yaml +chebi_lookup: + type: chebi_lookup + model_weight: 10 # optional +``` +to your configuration file. + ### The ensemble +ensemble_architecture Given a sample (i.e., a SMILES string) and models $m_1, m_2, \ldots, m_n$, the ensemble works as follows: 1. Get predictions from each model $m_i$ for the sample. @@ -103,7 +136,7 @@ Trust is based on the model's performance on a validation set. After training, w on a validation set for each class. If the `ensemble_type` is set to `wmv-f1`, the trust is calculated as 1 + the F1 score. If the `ensemble_type` is set to `mv` (the default), the trust is set to 1 for all models. -### Inconsistency correction +### Inconsistency resolution After a decision has been made for each class independently, the consistency of the predictions with regard to the ChEBI hierarchy and disjointness axioms is checked. This is done in 3 steps: @@ -114,7 +147,7 @@ belongs to the direct and indirect superclasses (e.g., primary alcohol, aromatic - (2) Next, we check for disjointness. This is not specified directly in ChEBI, but in an additional ChEBI module ([chebi-disjoints.owl](https://ftp.ebi.ac.uk/pub/databases/chebi/ontology/)). We have extracted these disjointness axioms into a CSV file and added some more disjointness axioms ourselves (see `data>disjoint_chebi.csv` and `data>disjoint_additional.csv`). If two classes $A$ and $B$ are disjoint and we predict -both, we select one of them randomly (https://github.com/ChEB-AI/python-chebifier/issues/6) and set the other to 0. +both, we select one with the higher class score and set the other to 0. - (3) Since the second step might have introduced new inconsistencies into the hierarchy, we repeat the first step, but with a small change. For a pair of classes $A \subseteq B$ with predictions $1$ and $0$, instead of setting $B$ to $1$, we now set $A$ to $0$. This has the advantage that we cannot introduce new disjointness-inconsistencies and don't have diff --git a/chebifier/__main__.py b/chebifier/__main__.py new file mode 100644 index 0000000..22bf70c --- /dev/null +++ b/chebifier/__main__.py @@ -0,0 +1,4 @@ +from chebifier.cli import cli + +if __name__ == "__main__": + cli() diff --git a/chebifier/check_env.py b/chebifier/check_env.py new file mode 100644 index 0000000..b215fda --- /dev/null +++ b/chebifier/check_env.py @@ -0,0 +1,30 @@ +import subprocess +import sys + + +def get_current_environment() -> str: + """ + Return the path of the Python executable for the current environment. + """ + return sys.executable + + +def check_package_installed(package_name: str) -> None: + """ + Check if the given package is installed in the current Python environment. + """ + python_exec = get_current_environment() + try: + subprocess.check_output( + [python_exec, "-m", "pip", "show", package_name], stderr=subprocess.DEVNULL + ) + print(f"✅ Package '{package_name}' is already installed.") + except subprocess.CalledProcessError: + raise ( + f"❌ Please install '{package_name}' into your environment: {python_exec}" + ) + + +if __name__ == "__main__": + print(f"🔍 Using Python executable: {get_current_environment()}") + check_package_installed("numpy") # Replace with your desired package diff --git a/chebifier/cli.py b/chebifier/cli.py index 5870db1..c201187 100644 --- a/chebifier/cli.py +++ b/chebifier/cli.py @@ -1,10 +1,9 @@ - - +import importlib.resources import click import yaml -from chebifier.ensemble.base_ensemble import BaseEnsemble -from chebifier.ensemble.weighted_majority_ensemble import WMVwithPPVNPVEnsemble, WMVwithF1Ensemble + +from chebifier.model_registry import ENSEMBLES @click.group() @@ -12,50 +11,133 @@ def cli(): """Command line interface for Chebifier.""" pass -ENSEMBLES = { - "mv": BaseEnsemble, - "wmv-ppvnpv": WMVwithPPVNPVEnsemble, - "wmv-f1": WMVwithF1Ensemble -} @cli.command() -@click.argument('config_file', type=click.Path(exists=True)) -@click.option('--smiles', '-s', multiple=True, help='SMILES strings to predict') -@click.option('--smiles-file', '-f', type=click.Path(exists=True), help='File containing SMILES strings (one per line)') -@click.option('--output', '-o', type=click.Path(), help='Output file to save predictions (optional)') -@click.option('--ensemble-type', '-e', type=click.Choice(ENSEMBLES.keys()), default='mv', help='Type of ensemble to use (default: Majority Voting)') -@click.option("--chebi-version", "-v", type=int, default=241, help="ChEBI version to use for checking consistency (default: 241)") -@click.option("--use-confidence", "-c", is_flag=True, default=True, help="Weight predictions based on how 'confident' a model is in its prediction (default: True)") -def predict(config_file, smiles, smiles_file, output, ensemble_type, chebi_version): - """Predict ChEBI classes for SMILES strings using an ensemble model. - - CONFIG_FILE is the path to a YAML configuration file for the ensemble model. - """ +@click.option( + "--ensemble-config", + "-e", + type=click.Path(exists=True), + default=None, + help="Configuration file for ensemble models", +) +@click.option("--smiles", "-s", multiple=True, help="SMILES strings to predict") +@click.option( + "--smiles-file", + "-f", + type=click.Path(exists=True), + help="File containing SMILES strings (one per line)", +) +@click.option( + "--output", + "-o", + type=click.Path(), + help="Output file to save predictions (optional)", +) +@click.option( + "--ensemble-type", + "-t", + type=click.Choice(ENSEMBLES.keys()), + default="wmv-f1", + help="Type of ensemble to use (default: Weighted Majority Voting)", +) +@click.option( + "--chebi-version", + "-v", + type=int, + default=241, + help="ChEBI version to use for checking consistency (default: 241)", +) +@click.option( + "--use-confidence", + "-c", + is_flag=True, + default=True, + help="Weight predictions based on how 'confident' a model is in its prediction (default: True)", +) +@click.option( + "--resolve-inconsistencies", + "-r", + is_flag=True, + default=True, + help="Resolve inconsistencies in predictions automatically (default: True)", +) +def predict( + ensemble_config, + smiles, + smiles_file, + output, + ensemble_type, + chebi_version, + use_confidence, + resolve_inconsistencies=True, +): + """Predict ChEBI classes for SMILES strings using an ensemble model.""" # Load configuration from YAML file - with open(config_file, 'r') as f: - config = yaml.safe_load(f) - + if not ensemble_config: + print("Using default ensemble configuration") + with ( + importlib.resources.files("chebifier") + .joinpath("ensemble.yml") + .open("r") as f + ): + config = yaml.safe_load(f) + else: + print(f"Loading ensemble configuration from {ensemble_config}") + with open(ensemble_config, "r") as f: + config = yaml.safe_load(f) + + with ( + importlib.resources.files("chebifier") + .joinpath("model_registry.yml") + .open("r") as f + ): + model_registry = yaml.safe_load(f) + + new_config = {} + for model_name, entry in config.items(): + if "load_model" in entry: + if entry["load_model"] not in model_registry: + raise ValueError( + f"Model {entry['load_model']} not found in model registry. " + f"Available models are: {','.join(model_registry.keys())}." + ) + new_config[model_name] = {**model_registry[entry["load_model"]], **entry} + else: + new_config[model_name] = entry + config = new_config + # Instantiate ensemble model - ensemble = ENSEMBLES[ensemble_type](config, chebi_version=chebi_version) - + ensemble = ENSEMBLES[ensemble_type]( + config, + chebi_version=chebi_version, + resolve_inconsistencies=resolve_inconsistencies, + ) + # Collect SMILES strings from arguments and/or file smiles_list = list(smiles) if smiles_file: - with open(smiles_file, 'r') as f: + with open(smiles_file, "r") as f: smiles_list.extend([line.strip() for line in f if line.strip()]) - + if not smiles_list: click.echo("No SMILES strings provided. Use --smiles or --smiles-file options.") return # Make predictions - predictions = ensemble.predict_smiles_list(smiles_list) + predictions = ensemble.predict_smiles_list( + smiles_list, use_confidence=use_confidence + ) if output: # save as json import json - with open(output, 'w') as f: - json.dump({smiles: pred for smiles, pred in zip(smiles_list, predictions)}, f, indent=2) + + with open(output, "w") as f: + json.dump( + {smiles: pred for smiles, pred in zip(smiles_list, predictions)}, + f, + indent=2, + ) else: # Print results @@ -67,5 +149,5 @@ def predict(config_file, smiles, smiles_file, output, ensemble_type, chebi_versi click.echo(" No predictions") -if __name__ == '__main__': +if __name__ == "__main__": cli() diff --git a/chebifier/ensemble.yml b/chebifier/ensemble.yml new file mode 100644 index 0000000..1744bad --- /dev/null +++ b/chebifier/ensemble.yml @@ -0,0 +1,15 @@ +electra: + load_model: electra_chebi50_v241 +resgated: + load_model: resgated_chebi50_v241 +chemlog_peptides: + type: chemlog_peptides + model_weight: 100 +chemlog_element: + type: chemlog_element + model_weight: 100 +chemlog_organox: + type: chemlog_organox + model_weight: 100 +c3p: + load_model: c3p_with_weights diff --git a/chebifier/ensemble/base_ensemble.py b/chebifier/ensemble/base_ensemble.py index c4db998..989c691 100644 --- a/chebifier/ensemble/base_ensemble.py +++ b/chebifier/ensemble/base_ensemble.py @@ -1,37 +1,83 @@ import os -from abc import ABC +import time + import torch import tqdm from chebai.preprocessing.datasets.chebi import ChEBIOver50 -from chebai.result.analyse_sem import PredictionSmoother +from chebai.result.analyse_sem import PredictionSmoother, get_chebi_graph +from chebifier.check_env import check_package_installed from chebifier.prediction_models.base_predictor import BasePredictor -from chebifier.prediction_models.chemlog_predictor import ChemLogPredictor -from chebifier.prediction_models.electra_predictor import ElectraPredictor -from chebifier.prediction_models.gnn_predictor import ResGatedPredictor -MODEL_TYPES = { - "electra": ElectraPredictor, - "resgated": ResGatedPredictor, - "chemlog": ChemLogPredictor -} -class BaseEnsemble(ABC): +class BaseEnsemble: + + def __init__( + self, + model_configs: dict, + chebi_version: int = 241, + resolve_inconsistencies: bool = True, + ): + # Deferred Import: To avoid circular import error + from chebifier.model_registry import MODEL_TYPES + + self.chebi_dataset = ChEBIOver50(chebi_version=chebi_version) + self.chebi_dataset._download_required_data() # download chebi if not already downloaded + self.chebi_graph = get_chebi_graph(self.chebi_dataset, None) + local_disjoint_files = [ + os.path.join("data", "disjoint_chebi.csv"), + os.path.join("data", "disjoint_additional.csv"), + ] + self.disjoint_files = [] + for file in local_disjoint_files: + if os.path.isfile(file): + self.disjoint_files.append(file) + else: + print( + f"Disjoint axiom file {file} not found. Loading from huggingface instead..." + ) + from chebifier.hugging_face import download_model_files + + self.disjoint_files.append( + download_model_files( + { + "repo_id": "chebai/chebifier", + "repo_type": "dataset", + "files": {"disjoint_file": os.path.basename(file)}, + } + )["disjoint_file"] + ) - def __init__(self, model_configs: dict, chebi_version: int = 241): self.models = [] self.positive_prediction_threshold = 0.5 for model_name, model_config in model_configs.items(): model_cls = MODEL_TYPES[model_config["type"]] - model_instance = model_cls(model_name, **model_config) + if "hugging_face" in model_config: + from chebifier.hugging_face import download_model_files + + hugging_face_kwargs = download_model_files(model_config["hugging_face"]) + else: + hugging_face_kwargs = {} + if "package_name" in model_config: + check_package_installed(model_config["package_name"]) + + model_instance = model_cls( + model_name, + **model_config, + **hugging_face_kwargs, + chebi_graph=self.chebi_graph, + ) assert isinstance(model_instance, BasePredictor) self.models.append(model_instance) - self.smoother = PredictionSmoother(ChEBIOver50(chebi_version=chebi_version), disjoint_files=[ - os.path.join("data", "disjoint_chebi.csv"), - os.path.join("data", "disjoint_additional.csv") - ]) - + if resolve_inconsistencies: + self.smoother = PredictionSmoother( + self.chebi_dataset, + label_names=None, + disjoint_files=self.disjoint_files, + ) + else: + self.smoother = None def gather_predictions(self, smiles_list): # get predictions from all models for the SMILES list @@ -44,22 +90,30 @@ def gather_predictions(self, smiles_list): if logits_for_smiles is not None: for cls in logits_for_smiles: predicted_classes.add(cls) - print(f"Sorting predictions...") + print(f"Sorting predictions from {len(model_predictions)} models...") predicted_classes = sorted(list(predicted_classes)) predicted_classes_dict = {cls: i for i, cls in enumerate(predicted_classes)} - ordered_logits = torch.zeros(len(smiles_list), len(predicted_classes), len(self.models)) * torch.nan + ordered_logits = ( + torch.zeros(len(smiles_list), len(predicted_classes), len(self.models)) + * torch.nan + ) for i, model_prediction in enumerate(model_predictions): - for j, logits_for_smiles in tqdm.tqdm(enumerate(model_prediction), - total=len(model_prediction), - desc=f"Sorting predictions for {self.models[i].model_name}"): + for j, logits_for_smiles in tqdm.tqdm( + enumerate(model_prediction), + total=len(model_prediction), + desc=f"Sorting predictions for {self.models[i].model_name}", + ): if logits_for_smiles is not None: for cls in logits_for_smiles: - ordered_logits[j, predicted_classes_dict[cls], i] = logits_for_smiles[cls] + ordered_logits[j, predicted_classes_dict[cls], i] = ( + logits_for_smiles[cls] + ) return ordered_logits, predicted_classes - - def consolidate_predictions(self, predictions, classwise_weights, **kwargs): + def consolidate_predictions( + self, predictions, classwise_weights, predicted_classes, **kwargs + ): """ Aggregates predictions from multiple models using weighted majority voting. Optimized version using tensor operations instead of for loops. @@ -74,11 +128,17 @@ def consolidate_predictions(self, predictions, classwise_weights, **kwargs): has_valid_predictions = valid_counts > 0 # Calculate positive and negative predictions for all classes at once - positive_mask = (predictions > self.positive_prediction_threshold) & valid_predictions - negative_mask = (predictions < self.positive_prediction_threshold) & valid_predictions + positive_mask = ( + predictions > self.positive_prediction_threshold + ) & valid_predictions + negative_mask = ( + predictions < self.positive_prediction_threshold + ) & valid_predictions if "use_confidence" in kwargs and kwargs["use_confidence"]: - confidence = 2 * torch.abs(predictions.nan_to_num() - self.positive_prediction_threshold) + confidence = 2 * torch.abs( + predictions.nan_to_num() - self.positive_prediction_threshold + ) else: confidence = torch.ones_like(predictions) @@ -89,8 +149,12 @@ def consolidate_predictions(self, predictions, classwise_weights, **kwargs): # Calculate weighted predictions using broadcasting # predictions shape: (num_smiles, num_classes, num_models) # weights shape: (num_classes, num_models) - positive_weighted = positive_mask.float() * confidence * pos_weights.unsqueeze(0) - negative_weighted = negative_mask.float() * confidence * neg_weights.unsqueeze(0) + positive_weighted = ( + positive_mask.float() * confidence * pos_weights.unsqueeze(0) + ) + negative_weighted = ( + negative_mask.float() * confidence * neg_weights.unsqueeze(0) + ) # Sum over models dimension positive_sum = positive_weighted.sum(dim=2) # Shape: (num_smiles, num_classes) @@ -98,11 +162,25 @@ def consolidate_predictions(self, predictions, classwise_weights, **kwargs): # Determine which classes to include for each SMILES net_score = positive_sum - negative_sum # Shape: (num_smiles, num_classes) - class_decisions = (net_score > 0) & has_valid_predictions # Shape: (num_smiles, num_classes) - + # Smooth predictions + start_time = time.perf_counter() + class_names = list(predicted_classes.keys()) + if self.smoother is not None: + self.smoother.set_label_names(class_names) + smooth_net_score = self.smoother(net_score) + class_decisions = ( + smooth_net_score > 0.5 + ) & has_valid_predictions # Shape: (num_smiles, num_classes) + else: + class_decisions = ( + net_score > 0 + ) & has_valid_predictions # Shape: (num_smiles, num_classes) + end_time = time.perf_counter() + print(f"Prediction smoothing took {end_time - start_time:.2f} seconds") - return class_decisions + complete_failure = torch.all(~has_valid_predictions, dim=1) + return class_decisions, complete_failure def calculate_classwise_weights(self, predicted_classes): """No weights, simple majority voting""" @@ -111,11 +189,19 @@ def calculate_classwise_weights(self, predicted_classes): return positive_weights, negative_weights - def predict_smiles_list(self, smiles_list, load_preds_if_possible=True) -> list: + def predict_smiles_list( + self, smiles_list, load_preds_if_possible=False, **kwargs + ) -> list: preds_file = f"predictions_by_model_{'_'.join(model.model_name for model in self.models)}.pt" predicted_classes_file = f"predicted_classes_{'_'.join(model.model_name for model in self.models)}.txt" if not load_preds_if_possible or not os.path.isfile(preds_file): - ordered_predictions, predicted_classes = self.gather_predictions(smiles_list) + ordered_predictions, predicted_classes = self.gather_predictions( + smiles_list + ) + if len(predicted_classes) == 0: + print( + "Warning: No classes have been predicted for the given SMILES list." + ) # save predictions torch.save(ordered_predictions, preds_file) with open(predicted_classes_file, "w") as f: @@ -123,53 +209,72 @@ def predict_smiles_list(self, smiles_list, load_preds_if_possible=True) -> list: f.write(f"{cls}\n") predicted_classes = {cls: i for i, cls in enumerate(predicted_classes)} else: - print(f"Loading predictions from {preds_file} and label indexes from {predicted_classes_file}") + print( + f"Loading predictions from {preds_file} and label indexes from {predicted_classes_file}" + ) ordered_predictions = torch.load(preds_file) with open(predicted_classes_file, "r") as f: - predicted_classes = {line.strip(): i for i, line in enumerate(f.readlines())} + predicted_classes = { + line.strip(): i for i, line in enumerate(f.readlines()) + } classwise_weights = self.calculate_classwise_weights(predicted_classes) - class_decisions = self.consolidate_predictions(ordered_predictions, classwise_weights) - # Smooth predictions - class_names = list(predicted_classes.keys()) - self.smoother.label_names = class_names - class_decisions = self.smoother(class_decisions) + class_decisions, is_failure = self.consolidate_predictions( + ordered_predictions, classwise_weights, predicted_classes, **kwargs + ) class_names = list(predicted_classes.keys()) class_indices = {predicted_classes[cls]: cls for cls in class_names} result = [ - [class_indices[idx.item()] for idx in torch.nonzero(i, as_tuple=True)[0]] - for i in class_decisions + ( + [ + class_indices[idx.item()] + for idx in torch.nonzero(i, as_tuple=True)[0] + ] + if not failure + else None + ) + for i, failure in zip(class_decisions, is_failure) ] return result + if __name__ == "__main__": - ensemble = BaseEnsemble({"resgated_0ps1g189":{ - "type": "resgated", - "ckpt_path": "data/0ps1g189/epoch=122.ckpt", - "target_labels_path": "data/chebi_v241/ChEBI50/processed/classes.txt", - "molecular_properties": [ - "chebai_graph.preprocessing.properties.AtomType", - "chebai_graph.preprocessing.properties.NumAtomBonds", - "chebai_graph.preprocessing.properties.AtomCharge", - "chebai_graph.preprocessing.properties.AtomAromaticity", - "chebai_graph.preprocessing.properties.AtomHybridization", - "chebai_graph.preprocessing.properties.AtomNumHs", - "chebai_graph.preprocessing.properties.BondType", - "chebai_graph.preprocessing.properties.BondInRing", - "chebai_graph.preprocessing.properties.BondAromaticity", - "chebai_graph.preprocessing.properties.RDKit2DNormalized", - ], - #"classwise_weights_path" : "../python-chebai/metrics_0ps1g189_80-10-10.json" - }, - -"electra_14ko0zcf": { - "type": "electra", - "ckpt_path": "data/14ko0zcf/epoch=193.ckpt", - "target_labels_path": "data/chebi_v241/ChEBI50/processed/classes.txt", - #"classwise_weights_path": "../python-chebai/metrics_electra_14ko0zcf_80-10-10.json", -} - }) - r = ensemble.predict_smiles_list(["[NH3+]CCCC[C@H](NC(=O)[C@@H]([NH3+])CC([O-])=O)C([O-])=O"], load_preds_if_possible=False) - print(len(r), r[0]) \ No newline at end of file + ensemble = BaseEnsemble( + { + "resgated_0ps1g189": { + "type": "resgated", + "ckpt_path": "data/0ps1g189/epoch=122.ckpt", + "target_labels_path": "data/chebi_v241/ChEBI50/processed/classes.txt", + "molecular_properties": [ + "chebai_graph.preprocessing.properties.AtomType", + "chebai_graph.preprocessing.properties.NumAtomBonds", + "chebai_graph.preprocessing.properties.AtomCharge", + "chebai_graph.preprocessing.properties.AtomAromaticity", + "chebai_graph.preprocessing.properties.AtomHybridization", + "chebai_graph.preprocessing.properties.AtomNumHs", + "chebai_graph.preprocessing.properties.BondType", + "chebai_graph.preprocessing.properties.BondInRing", + "chebai_graph.preprocessing.properties.BondAromaticity", + "chebai_graph.preprocessing.properties.RDKit2DNormalized", + ], + # "classwise_weights_path" : "../python-chebai/metrics_0ps1g189_80-10-10.json" + }, + "electra_14ko0zcf": { + "type": "electra", + "ckpt_path": "data/14ko0zcf/epoch=193.ckpt", + "target_labels_path": "data/chebi_v241/ChEBI50/processed/classes.txt", + # "classwise_weights_path": "../python-chebai/metrics_electra_14ko0zcf_80-10-10.json", + }, + } + ) + r = ensemble.predict_smiles_list( + [ + "[NH3+]CCCC[C@H](NC(=O)[C@@H]([NH3+])CC([O-])=O)C([O-])=O", + "C[C@H](N)C(=O)NCC(O)=O#", + "", + ], + load_preds_if_possible=False, + ) + print(len(r), r[0]) diff --git a/chebifier/ensemble/weighted_majority_ensemble.py b/chebifier/ensemble/weighted_majority_ensemble.py index ac0a796..97338f5 100644 --- a/chebifier/ensemble/weighted_majority_ensemble.py +++ b/chebifier/ensemble/weighted_majority_ensemble.py @@ -3,9 +3,7 @@ from chebifier.ensemble.base_ensemble import BaseEnsemble - class WMVwithPPVNPVEnsemble(BaseEnsemble): - def calculate_classwise_weights(self, predicted_classes): """ Given the positions of predicted classes in the predictions tensor, assign weights to each class. The @@ -23,15 +21,18 @@ def calculate_classwise_weights(self, predicted_classes): positive_weights[predicted_classes[cls], j] *= weights["PPV"] negative_weights[predicted_classes[cls], j] *= weights["NPV"] - print(f"Calculated model weightings. The averages for positive / negative weights are:") + print( + "Calculated model weightings. The averages for positive / negative weights are:" + ) for i, model in enumerate(self.models): - print(f"{model.model_name}: {positive_weights[:, i].mean().item():.3f} / {negative_weights[:, i].mean().item():.3f}") + print( + f"{model.model_name}: {positive_weights[:, i].mean().item():.3f} / {negative_weights[:, i].mean().item():.3f}" + ) return positive_weights, negative_weights class WMVwithF1Ensemble(BaseEnsemble): - def calculate_classwise_weights(self, predicted_classes): """ Given the positions of predicted classes in the predictions tensor, assign weights to each class. The @@ -44,12 +45,17 @@ def calculate_classwise_weights(self, predicted_classes): if model.classwise_weights is None: continue for cls, weights in model.classwise_weights.items(): - if (2 * weights["TP"] + weights["FP"] + weights["FN"]) > 0: - f1 = 2 * weights["TP"] / (2 * weights["TP"] + weights["FP"] + weights["FN"]) - weights_by_cls[predicted_classes[cls], j] *= 1 + f1 - - print(f"Calculated model weightings. The average weights are:") + if cls in predicted_classes: + if (2 * weights["TP"] + weights["FP"] + weights["FN"]) > 0: + f1 = ( + 2 + * weights["TP"] + / (2 * weights["TP"] + weights["FP"] + weights["FN"]) + ) + weights_by_cls[predicted_classes[cls], j] *= 1 + f1 + + print("Calculated model weightings. The average weights are:") for i, model in enumerate(self.models): print(f"{model.model_name}: {weights_by_cls[:, i].mean().item():.3f}") - return weights_by_cls, weights_by_cls \ No newline at end of file + return weights_by_cls, weights_by_cls diff --git a/chebifier/hugging_face.py b/chebifier/hugging_face.py new file mode 100644 index 0000000..9b9e599 --- /dev/null +++ b/chebifier/hugging_face.py @@ -0,0 +1,50 @@ +""" +Hugging Face Api: + - For Windows Users check: https://huggingface.co/docs/huggingface_hub/en/guides/manage-cache#limitations + + Refer for Hugging Face Hub caching and versioning documentation: + https://huggingface.co/docs/huggingface_hub/en/guides/download + https://huggingface.co/docs/huggingface_hub/en/guides/manage-cache +""" + +from pathlib import Path + +from huggingface_hub import hf_hub_download + + +def download_model_files( + model_config: dict[str, str | dict[str, str]], +) -> dict[str, Path]: + """ + Downloads specified model files from a Hugging Face Hub repository using hf_hub_download. + + Hugging Face Hub provides internal caching and versioning, so file management or duplication + checks are not required. + + Args: + model_config (Dict[str, str | Dict[str, str]]): A dictionary containing: + - 'repo_id' (str): The Hugging Face repository ID (e.g., 'username/modelname'). + - 'subfolder' (str): The subfolder within the repo where the files are located. + - 'files' (Dict[str, str]): A mapping from file type (e.g., 'ckpt_path', 'target_labels_path') to + actual file names (e.g., 'electra.ckpt', 'classes.txt'). + + Returns: + Dict[str, Path]: A dictionary mapping each file type to the local Path of the downloaded file. + """ + repo_id = model_config["repo_id"] + subfolder = model_config.get("subfolder", None) + repo_type = model_config.get("repo_type", "model") + filenames = model_config["files"] + + local_paths: dict[str, Path] = {} + for file_type, filename in filenames.items(): + downloaded_file_path = hf_hub_download( + repo_id=repo_id, + filename=filename, + repo_type=repo_type, + subfolder=subfolder, + ) + local_paths[file_type] = Path(downloaded_file_path) + print(f"\t Using file `{filename}` from: {downloaded_file_path}") + + return local_paths diff --git a/chebifier/model_registry.py b/chebifier/model_registry.py new file mode 100644 index 0000000..76a3cde --- /dev/null +++ b/chebifier/model_registry.py @@ -0,0 +1,39 @@ +from chebifier.ensemble.base_ensemble import BaseEnsemble +from chebifier.ensemble.weighted_majority_ensemble import ( + WMVwithF1Ensemble, + WMVwithPPVNPVEnsemble, +) +from chebifier.prediction_models import ( + ChemlogPeptidesPredictor, + ElectraPredictor, + ResGatedPredictor, + ChEBILookupPredictor, +) +from chebifier.prediction_models.c3p_predictor import C3PPredictor +from chebifier.prediction_models.chemlog_predictor import ( + ChemlogXMolecularEntityPredictor, + ChemlogOrganoXCompoundPredictor, +) + +ENSEMBLES = { + "mv": BaseEnsemble, + "wmv-ppvnpv": WMVwithPPVNPVEnsemble, + "wmv-f1": WMVwithF1Ensemble, +} + + +MODEL_TYPES = { + "electra": ElectraPredictor, + "resgated": ResGatedPredictor, + "chemlog_peptides": ChemlogPeptidesPredictor, + "chebi_lookup": ChEBILookupPredictor, + "chemlog_element": ChemlogXMolecularEntityPredictor, + "chemlog_organox": ChemlogOrganoXCompoundPredictor, + "c3p": C3PPredictor, +} + + +common_keys = MODEL_TYPES.keys() & ENSEMBLES.keys() +assert ( + not common_keys +), f"Overlapping keys between MODEL_TYPES and ENSEMBLES: {common_keys}" diff --git a/chebifier/model_registry.yml b/chebifier/model_registry.yml new file mode 100644 index 0000000..0cef3af --- /dev/null +++ b/chebifier/model_registry.yml @@ -0,0 +1,34 @@ +electra_chebi50_v241: + type: electra + hugging_face: + repo_id: chebai/electra_chebi50_v241 + files: + ckpt_path: 14ko0zcf_epoch=193.ckpt + target_labels_path: classes.txt + classwise_weights_path: metrics_electra_14ko0zcf_80-10-10_short.json +resgated_chebi50_v241: + type: resgated + hugging_face: + repo_id: chebai/resgated_gcn_chebi50_v241 + files: + ckpt_path: 0ps1g189_epoch=122.ckpt + target_labels_path: classes.txt + classwise_weights_path: metrics_0ps1g189_80-10-10_short.json + molecular_properties: + - chebai_graph.preprocessing.properties.AtomType + - chebai_graph.preprocessing.properties.NumAtomBonds + - chebai_graph.preprocessing.properties.AtomCharge + - chebai_graph.preprocessing.properties.AtomAromaticity + - chebai_graph.preprocessing.properties.AtomHybridization + - chebai_graph.preprocessing.properties.AtomNumHs + - chebai_graph.preprocessing.properties.BondType + - chebai_graph.preprocessing.properties.BondInRing + - chebai_graph.preprocessing.properties.BondAromaticity + - chebai_graph.preprocessing.properties.RDKit2DNormalized +c3p_with_weights: + type: c3p + hugging_face: + repo_id: chebai/chebifier + repo_type: dataset + files: + classwise_weights_path: c3p_trust.json \ No newline at end of file diff --git a/chebifier/prediction_models/__init__.py b/chebifier/prediction_models/__init__.py index e69de29..51fa6d6 100644 --- a/chebifier/prediction_models/__init__.py +++ b/chebifier/prediction_models/__init__.py @@ -0,0 +1,14 @@ +from .base_predictor import BasePredictor +from .chemlog_predictor import ChemlogPeptidesPredictor, ChemlogExtraPredictor +from .electra_predictor import ElectraPredictor +from .gnn_predictor import ResGatedPredictor +from .chebi_lookup import ChEBILookupPredictor + +__all__ = [ + "BasePredictor", + "ChemlogPeptidesPredictor", + "ElectraPredictor", + "ResGatedPredictor", + "ChEBILookupPredictor", + "ChemlogExtraPredictor", +] diff --git a/chebifier/prediction_models/base_predictor.py b/chebifier/prediction_models/base_predictor.py index b5229c1..ba1412d 100644 --- a/chebifier/prediction_models/base_predictor.py +++ b/chebifier/prediction_models/base_predictor.py @@ -1,20 +1,39 @@ -from abc import ABC import json +from abc import ABC + +from functools import lru_cache -class BasePredictor(ABC): - def __init__(self, model_name: str, model_weight: int = 1, classwise_weights_path: str = None, **kwargs): +class BasePredictor(ABC): + def __init__( + self, + model_name: str, + model_weight: int = 1, + classwise_weights_path: str = None, + **kwargs, + ): self.model_name = model_name self.model_weight = model_weight if classwise_weights_path is not None: - self.classwise_weights = json.load(open(classwise_weights_path, encoding="utf-8")) + self.classwise_weights = json.load( + open(classwise_weights_path, encoding="utf-8") + ) else: self.classwise_weights = None self._description = kwargs.get("description", None) def predict_smiles_list(self, smiles_list: list[str]) -> dict: - raise NotImplementedError + # list is not hashable, so we convert it to a tuple (useful for caching) + return self.predict_smiles_tuple(tuple(smiles_list)) + + @lru_cache(maxsize=100) + def predict_smiles_tuple(self, smiles_tuple: tuple[str]) -> dict: + raise NotImplementedError() + + def predict_smiles(self, smiles: str) -> dict: + # by default, use list-based prediction + return self.predict_smiles_tuple((smiles,))[0] @property def info_text(self): diff --git a/chebifier/prediction_models/c3p_predictor.py b/chebifier/prediction_models/c3p_predictor.py new file mode 100644 index 0000000..a8e2e10 --- /dev/null +++ b/chebifier/prediction_models/c3p_predictor.py @@ -0,0 +1,72 @@ +from functools import lru_cache +from typing import Optional, List +from pathlib import Path + +from c3p import classifier as c3p_classifier + +from chebifier.prediction_models import BasePredictor + + +class C3PPredictor(BasePredictor): + """ + Wrapper for C3P (url). + """ + + def __init__( + self, + model_name: str, + program_directory: Optional[Path] = None, + chemical_classes: Optional[List[str]] = None, + **kwargs, + ): + super().__init__(model_name, **kwargs) + self.program_directory = program_directory + self.chemical_classes = chemical_classes + self.chebi_graph = kwargs.get("chebi_graph", None) + + @lru_cache(maxsize=100) + def predict_smiles_tuple(self, smiles_list: tuple[str]) -> list: + result_list = c3p_classifier.classify( + list(smiles_list), + self.program_directory, + self.chemical_classes, + strict=False, + ) + result_reformatted = [dict() for _ in range(len(smiles_list))] + for result in result_list: + chebi_id = result.class_id.split(":")[1] + result_reformatted[smiles_list.index(result.input_smiles)][ + chebi_id + ] = result.is_match + if result.is_match and self.chebi_graph is not None: + for parent in list(self.chebi_graph.predecessors(int(chebi_id))): + result_reformatted[smiles_list.index(result.input_smiles)][ + str(parent) + ] = 1 + return result_reformatted + + def explain_smiles(self, smiles): + """ + C3P provides natural language explanations for each prediction (positive or negative). Since there are more + than 300 classes, only take the positive ones. + """ + highlights = [] + result_list = c3p_classifier.classify( + [smiles], self.program_directory, self.chemical_classes, strict=False + ) + for result in result_list: + if result.is_match: + highlights.append( + ( + "text", + f"For class {result.class_name} ({result.class_id}), C3P gave the following explanation: {result.reason}", + ) + ) + highlights = [ + ( + "text", + f"C3P made positive predictions for {len(highlights)} classes. The explanations are as follows:", + ) + ] + highlights + + return {"highlights": highlights} diff --git a/chebifier/prediction_models/chebi_lookup.py b/chebifier/prediction_models/chebi_lookup.py new file mode 100644 index 0000000..f314bf5 --- /dev/null +++ b/chebifier/prediction_models/chebi_lookup.py @@ -0,0 +1,158 @@ +from functools import lru_cache +from typing import Optional + +from chebifier.prediction_models import BasePredictor +import os +import networkx as nx +from rdkit import Chem +import json + + +class ChEBILookupPredictor(BasePredictor): + + def __init__( + self, + model_name: str, + description: str = None, + chebi_version: int = 241, + **kwargs, + ): + super().__init__(model_name, **kwargs) + self._description = ( + description + or "ChEBI Lookup: If the SMILES is equivalent to a ChEBI entry, retrieve the classification of that entry." + ) + self.chebi_version = chebi_version + self.chebi_graph = kwargs.get("chebi_graph", None) + if self.chebi_graph is None: + from chebai.preprocessing.datasets.chebi import ChEBIOver50 + + self.chebi_dataset = ChEBIOver50(chebi_version=self.chebi_version) + self.chebi_dataset._download_required_data() + self.chebi_graph = self.chebi_dataset._extract_class_hierarchy( + os.path.join(self.chebi_dataset.raw_dir, "chebi.obo") + ) + self.lookup_table = self.get_smiles_lookup() + + def get_smiles_lookup(self): + path = os.path.join( + "data", f"chebi_v{self.chebi_version}", "smiles_lookup.json" + ) + if not os.path.exists(path): + smiles_lookup = self.build_smiles_lookup() + with open(path, "w", encoding="utf-8") as f: + json.dump(smiles_lookup, f, indent=4) + else: + print("Loading existing SMILES lookup...") + with open(path, "r", encoding="utf-8") as f: + smiles_lookup = json.load(f) + return smiles_lookup + + def build_smiles_lookup(self): + smiles_lookup = dict() + for chebi_id, smiles in nx.get_node_attributes( + self.chebi_graph, "smiles" + ).items(): + if smiles is not None: + try: + mol = Chem.MolFromSmiles(smiles) + if mol is None: + print( + f"Failed to parse SMILES {smiles} for ChEBI ID {chebi_id}" + ) + continue + canonical_smiles = Chem.MolToSmiles(mol) + if canonical_smiles not in smiles_lookup: + smiles_lookup[canonical_smiles] = [] + # if the canonical SMILES is already in the lookup, append "different interpretation of the SMILES" + smiles_lookup[canonical_smiles].append( + (chebi_id, list(self.chebi_graph.predecessors(chebi_id))) + ) + except Exception as e: + print( + f"Failed to parse SMILES {smiles} for ChEBI ID {chebi_id}: {e}" + ) + return smiles_lookup + + @lru_cache(maxsize=100) + def predict_smiles(self, smiles: str) -> Optional[dict]: + if not smiles: + return None + mol = Chem.MolFromSmiles(smiles) + if mol is None: + return None + canonical_smiles = Chem.MolToSmiles(mol) + if canonical_smiles in self.lookup_table: + parent_candidates = self.lookup_table[canonical_smiles] + preds_i = dict() + if len(parent_candidates) > 1: + print( + f"Multiple matches found in ChEBI for SMILES {smiles}: {', '.join(str(chebi_id) for chebi_id, _ in parent_candidates)}" + ) + for k in list(set(pp for _, p in parent_candidates for pp in p)): + preds_i[str(k)] = 1 + elif len(parent_candidates) == 1: + chebi_id, parents = parent_candidates[0] + for k in parents: + preds_i[str(k)] = 1 + else: + preds_i = None + return preds_i + else: + return None + + def predict_smiles_tuple(self, smiles_list: list[str]) -> list: + predictions = [] + for smiles in smiles_list: + predictions.append(self.predict_smiles(smiles)) + + return predictions + + @property + def info_text(self): + if self._description is None: + return "No description is available for this model." + return self._description + + def explain_smiles(self, smiles: str) -> dict: + mol = Chem.MolFromSmiles(smiles) + if mol is None: + return { + "highlights": [ + ( + "text", + "The input SMILES could not be parsed into a valid molecule.", + ) + ] + } + canonical_smiles = Chem.MolToSmiles(mol) + if canonical_smiles not in self.lookup_table: + return { + "highlights": [ + ("text", "The input SMILES does not match any ChEBI entry.") + ] + } + parent_candidates = self.lookup_table[canonical_smiles] + return { + "highlights": [ + ( + "text", + f"The ChEBI Lookup matches the canonical version of the input SMILES against ChEBI (v{self.chebi_version})." + f" It found {'1 match' if len(parent_candidates) == 1 else f'{len(parent_candidates)} matches'}:" + f" {', '.join(f'CHEBI:{chebi_id}' for chebi_id, _ in parent_candidates)}. The predicted classes are the" + f" parent classes of the matched ChEBI entries.", + ) + ] + } + + +if __name__ == "__main__": + predictor = ChEBILookupPredictor("ChEBI Lookup") + print(predictor.info_text) + # Example usage + smiles_list = [ + "CCO", + "C1=CC=CC=C1" "*C(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(*)=O", + ] # SMILES with 251 matches in ChEBI + predictions = predictor.predict_smiles_list(smiles_list) + print(predictions) diff --git a/chebifier/prediction_models/chemlog_predictor.py b/chebifier/prediction_models/chemlog_predictor.py index 854cffb..10729d2 100644 --- a/chebifier/prediction_models/chemlog_predictor.py +++ b/chebifier/prediction_models/chemlog_predictor.py @@ -1,61 +1,131 @@ -import tqdm +from typing import Optional -from chebifier.prediction_models.base_predictor import BasePredictor -from chemlog.alg_classification.charge_classifier import AlgChargeClassifier, get_charge_category -from chemlog.alg_classification.peptide_size_classifier import AlgPeptideSizeClassifier, get_n_amino_acid_residues -from chemlog.alg_classification.proteinogenics_classifier import AlgProteinogenicsClassifier, get_proteinogenic_amino_acids -from chemlog.alg_classification.substructure_classifier import AlgSubstructureClassifier, is_emericellamide, is_diketopiperazine -from chemlog.cli import strategy_call, _smiles_to_mol, CLASSIFIERS +import tqdm +from chemlog.alg_classification.charge_classifier import get_charge_category +from chemlog.alg_classification.peptide_size_classifier import get_n_amino_acid_residues +from chemlog.alg_classification.proteinogenics_classifier import ( + get_proteinogenic_amino_acids, +) +from chemlog.alg_classification.substructure_classifier import ( + is_diketopiperazine, + is_emericellamide, +) +from chemlog.cli import CLASSIFIERS, _smiles_to_mol, strategy_call +from chemlog_extra.alg_classification.by_element_classification import ( + XMolecularEntityClassifier, + OrganoXCompoundClassifier, +) +from functools import lru_cache +from .base_predictor import BasePredictor AA_DICT = { - "A": "L-alanine", - "C": "L-cysteine", - "D": "L-aspartic acid", - "E": "L-glutamic acid", - "F": "L-phenylalanine", - "G": "glycine", - "H": "L-histidine", - "I": "L-isoleucine", - "K": "L-lysine", - "L": "L-leucine", - "M": "L-methionine", - "fMet": "N-formylmethionine", - "N": "L-asparagine", - "O": "L-pyrrolysine", - "P": "L-proline", - "Q": "L-glutamine", - "R": "L-arginine", - "S": "L-serine", - "T": "L-threonine", - "U": "L-selenocysteine", - "V": "L-valine", - "W": "L-tryptophan", - "Y": "L-tyrosine", - } - - -class ChemLogPredictor(BasePredictor): + "A": "L-alanine", + "C": "L-cysteine", + "D": "L-aspartic acid", + "E": "L-glutamic acid", + "F": "L-phenylalanine", + "G": "glycine", + "H": "L-histidine", + "I": "L-isoleucine", + "K": "L-lysine", + "L": "L-leucine", + "M": "L-methionine", + "fMet": "N-formylmethionine", + "N": "L-asparagine", + "O": "L-pyrrolysine", + "P": "L-proline", + "Q": "L-glutamine", + "R": "L-arginine", + "S": "L-serine", + "T": "L-threonine", + "U": "L-selenocysteine", + "V": "L-valine", + "W": "L-tryptophan", + "Y": "L-tyrosine", +} + + +class ChemlogExtraPredictor(BasePredictor): + + CHEMLOG_CLASSIFIER = None + + def __init__(self, model_name: str, **kwargs): + super().__init__(model_name, **kwargs) + self.chebi_graph = kwargs.get("chebi_graph", None) + self.classifier = self.CHEMLOG_CLASSIFIER() + + def predict_smiles_tuple(self, smiles_list: tuple[str]) -> list: + mol_list = [_smiles_to_mol(smiles) for smiles in smiles_list] + res = self.classifier.classify(mol_list) + if self.chebi_graph is not None: + for sample in res: + sample_additions = dict() + for cls in sample: + if sample[cls] == 1: + successors = list(self.chebi_graph.predecessors(int(cls))) + if successors: + for succ in successors: + sample_additions[str(succ)] = 1 + sample.update(sample_additions) + return res + +class ChemlogXMolecularEntityPredictor(ChemlogExtraPredictor): + + CHEMLOG_CLASSIFIER = XMolecularEntityClassifier + + +class ChemlogOrganoXCompoundPredictor(ChemlogExtraPredictor): + + CHEMLOG_CLASSIFIER = OrganoXCompoundClassifier + + +class ChemlogPeptidesPredictor(BasePredictor): def __init__(self, model_name: str, **kwargs): super().__init__(model_name, **kwargs) self.strategy = "algo" + self.chebi_graph = kwargs.get("chebi_graph", None) self.classifier_instances = { k: v() for k, v in CLASSIFIERS[self.strategy].items() } - self.peptide_labels = ["15841", "16670", "24866", "25676", "25696", "25697", "27369", "46761", "47923", - "48030", "48545", "60194", "60334", "60466", "64372", "65061", "90799", "155837"] - + # fmt: off + self.peptide_labels = [ + "15841", "16670", "24866", "25676", "25696", "25697", "27369", "46761", "47923", + "48030", "48545", "60194", "60334", "60466", "64372", "65061", "90799", "155837" + ] + # fmt: on print(f"Initialised ChemLog model {self.model_name}") - def predict_smiles_list(self, smiles_list: list[str]) -> list: + @lru_cache(maxsize=100) + def predict_smiles(self, smiles: str) -> Optional[dict]: + mol = _smiles_to_mol(smiles) + if mol is None: + return None + pos_labels = [ + label + for label in self.peptide_labels + if label + in strategy_call(self.strategy, self.classifier_instances, mol)[ + "chebi_classes" + ] + ] + if self.chebi_graph: + indirect_pos_labels = [ + str(pr) + for label in pos_labels + for pr in self.chebi_graph.predecessors(int(label)) + ] + pos_labels = list(set(pos_labels + indirect_pos_labels)) + return { + label: (1 if label in pos_labels else 0) + for label in self.peptide_labels + pos_labels + } + + def predict_smiles_tuple(self, smiles_list: tuple[str]) -> list: results = [] for i, smiles in tqdm.tqdm(enumerate(smiles_list)): - mol = _smiles_to_mol(smiles) - if mol is None: - results.append(None) - else: - results.append({label: 1 if label in strategy_call(self.strategy, self.classifier_instances, mol)["chebi_classes"] else 0 for label in self.peptide_labels}) + results.append(self.predict_smiles(smiles)) for classifier in self.classifier_instances.values(): classifier.on_finish() @@ -72,16 +142,15 @@ def get_chemlog_result_info(self, smiles): n_amino_acid_residues, add_output = get_n_amino_acid_residues(mol) if n_amino_acid_residues > 1: proteinogenics, proteinogenics_locations, _ = get_proteinogenic_amino_acids( - mol, - add_output["amino_residue"], - add_output["carboxy_residue"]) + mol, add_output["amino_residue"], add_output["carboxy_residue"] + ) else: proteinogenics, proteinogenics_locations, _ = [], [], [] results = { - 'charge_category': charge_category.name, - 'n_amino_acid_residues': n_amino_acid_residues, - 'proteinogenics': proteinogenics, - 'proteinogenics_locations': proteinogenics_locations, + "charge_category": charge_category.name, + "n_amino_acid_residues": n_amino_acid_residues, + "proteinogenics": proteinogenics, + "proteinogenics_locations": proteinogenics_locations, } if n_amino_acid_residues == 5: @@ -97,97 +166,217 @@ def get_chemlog_result_info(self, smiles): return {**results, **add_output} - def build_explain_blocks_atom_allocations(self, atoms, cls_name): return [ ("heading", cls_name), - ("text", f"The peptide has been identified as an instance of '" - f"{cls_name}'. This was decided based on the presence of the following structure:"), - ("single", atoms) + ( + "text", + f"The peptide has been identified as an instance of '" + f"{cls_name}'. This was decided based on the presence of the following structure:", + ), + ("single", atoms), ] def build_explain_blocks_peptides(self, info): blocks = [] if "error" in info: - blocks.append(("text", f"An error occurred while processing the molecule: {info['error']}")) + blocks.append( + ( + "text", + f"An error occurred while processing the molecule: {info['error']}", + ) + ) return blocks blocks.append(("heading", "Functional groups")) if len(info["amide_bond"]) == 0: - blocks.append(("text", "The molecule does not contain any amide. Therefore, it cannot be a peptide, " - "peptide anion, peptide zwitterion or peptide cation.")) + blocks.append( + ( + "text", + "The molecule does not contain any amide. Therefore, it cannot be a peptide, " + "peptide anion, peptide zwitterion or peptide cation.", + ) + ) return blocks - blocks.append(("text", "The molecule contains the following functional groups:")) - blocks.append(("tabs", {"Amide": info["amide_bond"], - "Carboxylic acid derivative": info["carboxy_residue"], - "Amino group": [[a] for a in info["amino_residue"]]})) + blocks.append( + ("text", "The molecule contains the following functional groups:") + ) + blocks.append( + ( + "tabs", + { + "Amide": info["amide_bond"], + "Carboxylic acid derivative": info["carboxy_residue"], + "Amino group": [[a] for a in info["amino_residue"]], + }, + ) + ) blocks.append(("heading", "Identifying the peptide structure")) if len(info["chunks"]) == 0: - blocks.append(("text", "All atoms in the molecule are connected via a chain of carbon atoms. " - "Therefore, the molecule cannot be a peptide, peptide anion, peptide zwitterion " - "or peptide cation.")) + blocks.append( + ( + "text", + "All atoms in the molecule are connected via a chain of carbon atoms. " + "Therefore, the molecule cannot be a peptide, peptide anion, peptide zwitterion " + "or peptide cation.", + ) + ) return blocks - blocks.append(("text", "To divide up the molecule into potential amino acids, it has been split into the " - f"{len(info['chunks'])} 'building blocks' (based on heteroatoms).")) - blocks.append(("text", "For each, we have checked if it constitutes an amino acid residue.")) + blocks.append( + ( + "text", + "To divide up the molecule into potential amino acids, it has been split into the " + f"{len(info['chunks'])} 'building blocks' (based on heteroatoms).", + ) + ) + blocks.append( + ( + "text", + "For each, we have checked if it constitutes an amino acid residue.", + ) + ) if len(info["chunks"]) == len(info["longest_aa_chain"]): - blocks.append(("text", "All chunks have been identified as amino acid residues that are connected " - "via amide bonds:")) + blocks.append( + ( + "text", + "All chunks have been identified as amino acid residues that are connected " + "via amide bonds:", + ) + ) blocks.append(("tabs", {"Amino acid residue": info["longest_aa_chain"]})) elif len(info["longest_aa_chain"]) == 0: blocks.append(("tabs", {"Chunks": info["chunks"]})) blocks.append( - ("text", "In these chunks, no amino acids have been identified. " - "Therefore, the molecule cannot be a peptide, " - "peptide anion, peptide zwitterion or peptide cation.")) + ( + "text", + "In these chunks, no amino acids have been identified. " + "Therefore, the molecule cannot be a peptide, " + "peptide anion, peptide zwitterion or peptide cation.", + ) + ) return blocks else: - blocks.append(("text", f"{len(info['longest_aa_chain'])} of these chunks have been identified as amino acid " - f"residues and are connected via amide bonds:")) - blocks.append(("tabs", {"Chunks": info["chunks"], - "Amino acid residue": info["longest_aa_chain"]})) + blocks.append( + ( + "text", + f"{len(info['longest_aa_chain'])} of these chunks have been identified as amino acid " + f"residues and are connected via amide bonds:", + ) + ) + blocks.append( + ( + "tabs", + { + "Chunks": info["chunks"], + "Amino acid residue": info["longest_aa_chain"], + }, + ) + ) if len(info["longest_aa_chain"]) < 2: - blocks.append(("text", "Only one amino acid has been identified. Therefore, the molecule cannot be a " - "peptide, peptide anion, peptide zwitterion or peptide cation.")) + blocks.append( + ( + "text", + "Only one amino acid has been identified. Therefore, the molecule cannot be a " + "peptide, peptide anion, peptide zwitterion or peptide cation.", + ) + ) return blocks blocks.append(("heading", "Charge-based classification")) if info["charge_category"] == "SALT": - blocks.append(("text", "The molecule consists of disconnected anionic and cationic fragments. " - "Therefore, we classify it as a peptide salt. Since there is no class 'peptide salt'" - "in ChEBI, no prediction is made.")) + blocks.append( + ( + "text", + "The molecule consists of disconnected anionic and cationic fragments. " + "Therefore, we classify it as a peptide salt. Since there is no class 'peptide salt'" + "in ChEBI, no prediction is made.", + ) + ) return blocks elif info["charge_category"] == "CATION": - blocks.append(("text", "The molecule has a net positive charge, therefore it is a 'peptide cation'.")) + blocks.append( + ( + "text", + "The molecule has a net positive charge, therefore it is a 'peptide cation'.", + ) + ) return blocks elif info["charge_category"] == "ANION": - blocks.append(("text", "The molecule has a net negative charge, therefore it is a 'peptide anion'.")) + blocks.append( + ( + "text", + "The molecule has a net negative charge, therefore it is a 'peptide anion'.", + ) + ) return blocks elif info["charge_category"] == "ZWITTERION": - blocks.append(("text", "The molecule is overall neutral, but a zwitterion, i.e., it contains connected " - "(but non-adjacent) atoms with opposite charges.")) + blocks.append( + ( + "text", + "The molecule is overall neutral, but a zwitterion, i.e., it contains connected " + "(but non-adjacent) atoms with opposite charges.", + ) + ) if info["n_amino_acid_residues"] == 2: - blocks.append(("text", "Since we have identified 2 amino acid residues, the final classification is " - "'dipeptide zwitterion'.")) + blocks.append( + ( + "text", + "Since we have identified 2 amino acid residues, the final classification is " + "'dipeptide zwitterion'.", + ) + ) if info["n_amino_acid_residues"] == 3: - blocks.append(("text", "Since we have identified 3 amino acid residues, the final classification is " - "'tripeptide zwitterion'.")) + blocks.append( + ( + "text", + "Since we have identified 3 amino acid residues, the final classification is " + "'tripeptide zwitterion'.", + ) + ) return blocks - subclasses_dict = {2: "di", 3: "tri", 4: "tetra", 5: "penta", 6: "oligo", 7: "oligo", 8: "oligo", 9: "oligo", - 10: "poly"} - blocks.append(("text", "The molecule is overall neutral and not a zwitterion. Therefore, it is a peptide.")) - blocks.append(("text", f"More specifically, since we have identified " - f"{info["n_amino_acid_residues"]} amino acid residues," - f"the final classification is '{subclasses_dict[min(10, info["n_amino_acid_residues"])]}peptide'.")) + subclasses_dict = { + 2: "di", + 3: "tri", + 4: "tetra", + 5: "penta", + 6: "oligo", + 7: "oligo", + 8: "oligo", + 9: "oligo", + 10: "poly", + } + blocks.append( + ( + "text", + "The molecule is overall neutral and not a zwitterion. Therefore, it is a peptide.", + ) + ) + blocks.append( + ( + "text", + f"More specifically, since we have identified " + f"{info['n_amino_acid_residues']} amino acid residues," + f"the final classification is '{subclasses_dict[min(10, info['n_amino_acid_residues'])]}peptide'.", + ) + ) return blocks def build_explain_blocks_proteinogenics(self, proteinogenics, atoms): blocks = [("heading", "Proteinogenic amino acids")] if len(proteinogenics) == 0: - blocks.append(("text", "No proteinogenic amino acids have been identified.")) + blocks.append( + ("text", "No proteinogenic amino acids have been identified.") + ) return blocks - blocks.append(("text", "In addition to the classification, we have searched for the residues of 23 " - "proteinogenic amino acids in the molecule.")) - blocks.append(("text", "The following proteinogenic amino acids have been identified:")) + blocks.append( + ( + "text", + "In addition to the classification, we have searched for the residues of 23 " + "proteinogenic amino acids in the molecule.", + ) + ) + blocks.append( + ("text", "The following proteinogenic amino acids have been identified:") + ) proteinogenics_dict = {AA_DICT[aa]: [] for aa in proteinogenics} for aa, atoms_aa in zip(proteinogenics, atoms): proteinogenics_dict[AA_DICT[aa]].append(atoms_aa) @@ -196,13 +385,28 @@ def build_explain_blocks_proteinogenics(self, proteinogenics, atoms): def explain_smiles(self, smiles) -> dict: info = self.get_chemlog_result_info(smiles) - highlight_blocks = self.build_explain_blocks_peptides(info) + zero_blocks = [ + ( + "text", + "Results for peptides and peptide-related classes (e.g. peptide anion, depsipeptide) have been calculated" + " with a rule-based system. The following shows which parts of the molecule were identified as relevant" + " structures and have influenced the classification.", + ) + ] + highlight_blocks = zero_blocks + self.build_explain_blocks_peptides(info) - for chebi_id, internal_name in [(64372, "emericellamide"), (65061, "2,5-diketopiperazines")]: + for chebi_id, internal_name in [ + (64372, "emericellamide"), + (65061, "2,5-diketopiperazines"), + ]: if f"{internal_name}_atoms" in info: - highlight_blocks += self.build_explain_blocks_atom_allocations(info[f"{internal_name}_atoms"], internal_name) - highlight_blocks += self.build_explain_blocks_proteinogenics(info["proteinogenics"], info["proteinogenics_locations"]) + highlight_blocks += self.build_explain_blocks_atom_allocations( + info[f"{internal_name}_atoms"], internal_name + ) + highlight_blocks += self.build_explain_blocks_proteinogenics( + info["proteinogenics"], info["proteinogenics_locations"] + ) return { "smiles": smiles, "highlights": highlight_blocks, - } \ No newline at end of file + } diff --git a/chebifier/prediction_models/electra_predictor.py b/chebifier/prediction_models/electra_predictor.py index a1b7084..7d64418 100644 --- a/chebifier/prediction_models/electra_predictor.py +++ b/chebifier/prediction_models/electra_predictor.py @@ -1,8 +1,9 @@ import numpy as np - -from chebifier.prediction_models.nn_predictor import NNPredictor from chebai.models.electra import Electra -from chebai.preprocessing.reader import ChemDataReader, EMBEDDING_OFFSET +from chebai.preprocessing.reader import EMBEDDING_OFFSET, ChemDataReader + +from .nn_predictor import NNPredictor + def build_graph_from_attention(att, node_labels, token_labels, threshold=0.0): n_nodes = len(node_labels) @@ -35,7 +36,6 @@ def build_graph_from_attention(att, node_labels, token_labels, threshold=0.0): class ElectraPredictor(NNPredictor): - def __init__(self, model_name: str, ckpt_path: str, **kwargs): super().__init__(model_name, ckpt_path, reader_cls=ChemDataReader, **kwargs) print(f"Initialised Electra model {self.model_name} (device: {self.device})") @@ -44,8 +44,10 @@ def init_model(self, ckpt_path: str, **kwargs) -> Electra: model = Electra.load_from_checkpoint( ckpt_path, map_location=self.device, - criterion=None, strict=False, - metrics=dict(train=dict(), test=dict(), validation=dict()), pretrained_checkpoint=None + criterion=None, + strict=False, + metrics=dict(train=dict(), test=dict(), validation=dict()), + pretrained_checkpoint=None, ) model.eval() return model @@ -57,17 +59,16 @@ def explain_smiles(self, smiles) -> dict: result = self.calculate_results([token_dict]) token_labels = ( - ["[CLR]"] + [None for _ in range(EMBEDDING_OFFSET - 1)] + list(reader.cache.keys()) + ["[CLR]"] + + [None for _ in range(EMBEDDING_OFFSET - 1)] + + list(reader.cache.keys()) ) graphs = [ [ - build_graph_from_attention( - a[0, i], tokens, token_labels, threshold=0.1 - ) + build_graph_from_attention(a[0, i], tokens, token_labels, threshold=0.1) for i in range(a.shape[1]) ] for a in result["attentions"] ] return {"graphs": graphs} - diff --git a/chebifier/prediction_models/gnn_predictor.py b/chebifier/prediction_models/gnn_predictor.py index 9038846..3d6fc92 100644 --- a/chebifier/prediction_models/gnn_predictor.py +++ b/chebifier/prediction_models/gnn_predictor.py @@ -1,16 +1,18 @@ -from chebifier.prediction_models.nn_predictor import NNPredictor import chebai_graph.preprocessing.properties as p import torch from chebai_graph.models.graph import ResGatedGraphConvNetGraphPred -from chebai_graph.preprocessing.reader import GraphPropertyReader from chebai_graph.preprocessing.property_encoder import IndexEncoder, OneHotEncoder +from chebai_graph.preprocessing.reader import GraphPropertyReader from torch_geometric.data.data import Data as GeomData +from .nn_predictor import NNPredictor -class ResGatedPredictor(NNPredictor): +class ResGatedPredictor(NNPredictor): def __init__(self, model_name: str, ckpt_path: str, molecular_properties, **kwargs): - super().__init__(model_name, ckpt_path, reader_cls=GraphPropertyReader, **kwargs) + super().__init__( + model_name, ckpt_path, reader_cls=GraphPropertyReader, **kwargs + ) # molecular_properties is a list of class paths if molecular_properties is not None: properties = [self.load_class(prop)() for prop in molecular_properties] @@ -32,11 +34,13 @@ def load_class(self, class_path: str): def init_model(self, ckpt_path: str, **kwargs) -> ResGatedGraphConvNetGraphPred: model = ResGatedGraphConvNetGraphPred.load_from_checkpoint( - ckpt_path, map_location=torch.device(self.device), criterion=None, strict=False, input_dim=128, - metrics=dict(train=dict(), test=dict(), validation=dict()), pretrained_checkpoint=None, - config={"in_length": 256, "hidden_length": 512, "dropout_rate": 0.1, "n_conv_layers": 3, - "n_linear_layers": 3, "n_atom_properties": 158, "n_bond_properties": 7, - "n_molecule_properties": 200}) + ckpt_path, + map_location=torch.device(self.device), + criterion=None, + strict=False, + metrics=dict(train=dict(), test=dict(), validation=dict()), + pretrained_checkpoint=None, + ) model.eval() return model @@ -55,14 +59,19 @@ def read_smiles(self, smiles): # use default value if we meet an unseen value if isinstance(prop.encoder, IndexEncoder): if str(value) in prop.encoder.cache: - index = prop.encoder.cache.index(str(value)) + prop.encoder.offset + index = prop.encoder.cache[str(value)] + prop.encoder.offset else: index = 0 - print(f"Unknown property value {value} for property {prop} at smiles {smiles}") + print( + f"Unknown property value {value} for property {prop} at smiles {smiles}" + ) if isinstance(prop.encoder, OneHotEncoder): - encoded_values.append(torch.nn.functional.one_hot( - torch.tensor(index), num_classes=prop.encoder.get_encoding_length() - )) + encoded_values.append( + torch.nn.functional.one_hot( + torch.tensor(index), + num_classes=prop.encoder.get_encoding_length(), + ) + ) else: encoded_values.append(torch.tensor([index])) @@ -77,9 +86,7 @@ def read_smiles(self, smiles): if len(encoded_values.size()) == 1: encoded_values = encoded_values.unsqueeze(1) else: - encoded_values = torch.zeros( - (0, prop.encoder.get_encoding_length()) - ) + encoded_values = torch.zeros((0, prop.encoder.get_encoding_length())) if isinstance(prop, p.AtomProperty): x = torch.cat([x, encoded_values], dim=1) elif isinstance(prop, p.BondProperty): @@ -93,4 +100,4 @@ def read_smiles(self, smiles): edge_attr=edge_attr, molecule_attr=molecule_attr, ) - return d \ No newline at end of file + return d diff --git a/chebifier/prediction_models/nn_predictor.py b/chebifier/prediction_models/nn_predictor.py index 1ee5e46..e7d72c9 100644 --- a/chebifier/prediction_models/nn_predictor.py +++ b/chebifier/prediction_models/nn_predictor.py @@ -1,24 +1,36 @@ -import tqdm +from functools import lru_cache -from chebifier.prediction_models.base_predictor import BasePredictor -from rdkit import Chem import numpy as np import torch +import tqdm +from rdkit import Chem + +from .base_predictor import BasePredictor -class NNPredictor(BasePredictor): - def __init__(self, model_name: str, ckpt_path: str, reader_cls, target_labels_path: str, **kwargs): +class NNPredictor(BasePredictor): + def __init__( + self, + model_name: str, + ckpt_path: str, + reader_cls, + target_labels_path: str, + **kwargs, + ): super().__init__(model_name, **kwargs) self.reader_cls = reader_cls self.device = torch.device("cuda" if torch.cuda.is_available() else "cpu") self.model = self.init_model(ckpt_path=ckpt_path) - self.target_labels = [line.strip() for line in open(target_labels_path, encoding="utf-8")] + self.target_labels = [ + line.strip() for line in open(target_labels_path, encoding="utf-8") + ] self.batch_size = kwargs.get("batch_size", 1) - def init_model(self, ckpt_path: str, **kwargs): - raise NotImplementedError("Model initialization must be implemented in subclasses.") + raise NotImplementedError( + "Model initialization must be implemented in subclasses." + ) def calculate_results(self, batch): collator = self.reader_cls.COLLATOR() @@ -40,40 +52,61 @@ def read_smiles(self, smiles): d = reader.to_data(dict(features=smiles, labels=None)) return d - def predict_smiles_list(self, smiles_list) -> list: + @lru_cache(maxsize=100) + def predict_smiles_tuple(self, smiles_list: tuple[str]) -> list: """Returns a list with the length of smiles_list, each element is either None (=failure) or a dictionary Of classes and predicted values.""" token_dicts = [] could_not_parse = [] index_map = dict() for i, smiles in enumerate(smiles_list): + if not smiles: + print( + f"Model {self.model_name} received a missing SMILES string at position {i}." + ) + could_not_parse.append(i) + continue try: - # Try to parse the smiles string - if not smiles: - raise ValueError() d = self.read_smiles(smiles) # This is just for sanity checks rdmol = Chem.MolFromSmiles(smiles, sanitize=False) - except Exception as e: - # Note if it fails - could_not_parse.append(i) - print(f"Failing to parse {smiles} due to {e}") - else: if rdmol is None: + print( + f"Model {self.model_name} received a SMILES string RDKit can't read at position {i}: {smiles}" + ) could_not_parse.append(i) - else: - index_map[i] = len(token_dicts) - token_dicts.append(d) + continue + except Exception: + could_not_parse.append(i) + print( + f"Model {self.model_name} failed to parse a SMILES string at position {i}: {smiles}" + ) + continue + index_map[i] = len(token_dicts) + token_dicts.append(d) results = [] - if token_dicts: - for batch in tqdm.tqdm(self.batchify(token_dicts), desc=f"{self.model_name}", total=len(token_dicts)//self.batch_size): + if len(token_dicts) > 0: + for batch in tqdm.tqdm( + self.batchify(token_dicts), + desc=f"{self.model_name}", + total=len(token_dicts) // self.batch_size, + ): result = self.calculate_results(batch) if isinstance(result, dict) and "logits" in result: result = result["logits"] results += torch.sigmoid(result).cpu().detach().tolist() results = np.stack(results, axis=0) - preds = [{self.target_labels[j]: p for j, p in enumerate(results[index_map[i]])} - if i not in could_not_parse else None for i in range(len(smiles_list))] + preds = [ + ( + { + self.target_labels[j]: p + for j, p in enumerate(results[index_map[i]]) + } + if i not in could_not_parse + else None + ) + for i in range(len(smiles_list)) + ] return preds else: - return [None for _ in smiles_list] \ No newline at end of file + return [None for _ in smiles_list] diff --git a/configs/huggingface_config.yml b/configs/huggingface_config.yml new file mode 100644 index 0000000..c26950d --- /dev/null +++ b/configs/huggingface_config.yml @@ -0,0 +1,22 @@ + +chemlog_peptides: + type: chemlog + model_weight: 100 + +#resgated_huggingface: +# type: resgated +# hugging_face: +# repo_id: aditya0by0/python-chebifier +# subfolder: resgated +# files: +# ckpt: resgated.ckpt +# labels: classes.txt + +electra_huggingface: + type: electra + hugging_face: + repo_id: aditya0by0/python-chebifier + subfolder: electra + files: + ckpt: electra.ckpt + labels: classes.txt diff --git a/pyproject.toml b/pyproject.toml index 8a0223f..6c0f2fb 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -4,7 +4,7 @@ build-backend = "setuptools.build_meta" [project] name = "chebifier" -version = "1.0.0" +version = "1.1.0" description = "An AI ensemble model for predicting chemical classes" readme = "README.md" requires-python = ">=3.9" @@ -27,9 +27,9 @@ dependencies = [ "chemlog>=1.0.4" ] -[project.scripts] -chebifier = "chebifier.cli:cli" - [tool.setuptools] packages = ["chebifier", "chebifier.ensemble", "chebifier.prediction_models"] + +[project.optional-dependencies] +dev = ["black", "isort", "pre-commit"]